From 03c5c75177290717309ed9d032f1d4de89e68dae Mon Sep 17 00:00:00 2001 From: haxbot Date: Sun, 18 Jan 2026 01:20:18 +0000 Subject: [PATCH] bundle: update (2026-01-18) --- extensions/botbox3000/.gitignore | 16 + extensions/botbox3000/LICENSE | 674 ++++++++ extensions/botbox3000/README.md | 41 + extensions/botbox3000/boxbot.inx | 57 + extensions/botbox3000/boxbot.py | 608 ++++++++ extensions/botbox3000/deps/inkex/__init__.py | 33 + extensions/botbox3000/deps/inkex/base.py | 567 +++++++ extensions/botbox3000/deps/inkex/bezier.py | 582 +++++++ .../botbox3000/deps/inkex/colors/__init__.py | 49 + .../botbox3000/deps/inkex/colors/color.py | 295 ++++ .../deps/inkex/colors/converters.py | 122 ++ .../deps/inkex/colors/spaces/__init__.py | 11 + .../deps/inkex/colors/spaces/cms.py | 95 ++ .../deps/inkex/colors/spaces/cmyk.py | 81 + .../deps/inkex/colors/spaces/css.py | 139 ++ .../deps/inkex/colors/spaces/hsl.py | 107 ++ .../deps/inkex/colors/spaces/hsv.py | 88 ++ .../deps/inkex/colors/spaces/named.py | 236 +++ .../deps/inkex/colors/spaces/none.py | 55 + .../deps/inkex/colors/spaces/rgb.py | 105 ++ .../botbox3000/deps/inkex/colors/utils.py | 31 + extensions/botbox3000/deps/inkex/command.py | 347 +++++ .../botbox3000/deps/inkex/css/__init__.py | 3 + .../botbox3000/deps/inkex/css/compiler.py | 483 ++++++ .../botbox3000/deps/inkex/css/parser.py | 548 +++++++ .../deps/inkex/deprecated-simple/README.rst | 4 + .../deps/inkex/deprecated-simple/bezmisc.py | 46 + .../deps/inkex/deprecated-simple/cspsubdiv.py | 25 + .../inkex/deprecated-simple/cubicsuperpath.py | 52 + .../deps/inkex/deprecated-simple/ffgeom.py | 92 ++ .../inkex/deprecated-simple/run_command.py | 80 + .../inkex/deprecated-simple/simplepath.py | 68 + .../inkex/deprecated-simple/simplestyle.py | 55 + .../deprecated-simple/simpletransform.py | 122 ++ .../deps/inkex/deprecated/__init__.py | 3 + .../deps/inkex/deprecated/deprecatedeffect.py | 304 ++++ .../botbox3000/deps/inkex/deprecated/main.py | 237 +++ .../botbox3000/deps/inkex/deprecated/meta.py | 109 ++ .../deps/inkex/elements/__init__.py | 56 + .../botbox3000/deps/inkex/elements/_base.py | 939 ++++++++++++ .../deps/inkex/elements/_filters.py | 581 +++++++ .../botbox3000/deps/inkex/elements/_groups.py | 196 +++ .../botbox3000/deps/inkex/elements/_image.py | 123 ++ .../botbox3000/deps/inkex/elements/_meta.py | 499 ++++++ .../botbox3000/deps/inkex/elements/_parser.py | 130 ++ .../deps/inkex/elements/_polygons.py | 587 +++++++ .../deps/inkex/elements/_selected.py | 237 +++ .../botbox3000/deps/inkex/elements/_svg.py | 479 ++++++ .../botbox3000/deps/inkex/elements/_text.py | 249 +++ .../botbox3000/deps/inkex/elements/_use.py | 89 ++ .../botbox3000/deps/inkex/elements/_utils.py | 150 ++ .../botbox3000/deps/inkex/extensions.py | 536 +++++++ .../botbox3000/deps/inkex/gui/README.md | 13 + .../botbox3000/deps/inkex/gui/__init__.py | 58 + extensions/botbox3000/deps/inkex/gui/app.py | 62 + .../botbox3000/deps/inkex/gui/asyncme.py | 330 ++++ .../botbox3000/deps/inkex/gui/listview.py | 562 +++++++ .../botbox3000/deps/inkex/gui/pixmap.py | 360 +++++ .../botbox3000/deps/inkex/gui/tester.py | 78 + .../botbox3000/deps/inkex/gui/window.py | 38 + .../deps/inkex/interfaces/IElement.py | 23 + .../deps/inkex/interfaces/__init__.py | 0 extensions/botbox3000/deps/inkex/inx.py | 242 +++ .../botbox3000/deps/inkex/localization.py | 117 ++ .../botbox3000/deps/inkex/paths/__init__.py | 122 ++ extensions/botbox3000/deps/inkex/paths/arc.py | 670 ++++++++ .../botbox3000/deps/inkex/paths/curves.py | 499 ++++++ .../botbox3000/deps/inkex/paths/interfaces.py | 731 +++++++++ .../botbox3000/deps/inkex/paths/lines.py | 601 ++++++++ .../botbox3000/deps/inkex/paths/path.py | 937 ++++++++++++ .../botbox3000/deps/inkex/paths/quadratic.py | 456 ++++++ extensions/botbox3000/deps/inkex/ports.py | 105 ++ .../botbox3000/deps/inkex/properties.py | 956 ++++++++++++ extensions/botbox3000/deps/inkex/py.typed | 0 extensions/botbox3000/deps/inkex/styles.py | 756 +++++++++ .../botbox3000/deps/inkex/tester/__init__.py | 547 +++++++ .../deps/inkex/tester/decorators.py | 10 + .../botbox3000/deps/inkex/tester/filters.py | 181 +++ .../deps/inkex/tester/inkscape.extension.rng | 592 ++++++++ .../inkex/tester/inkscape.extension.schema | 10 + .../botbox3000/deps/inkex/tester/inx.py | 182 +++ .../botbox3000/deps/inkex/tester/mock.py | 459 ++++++ .../botbox3000/deps/inkex/tester/svg.py | 55 + .../botbox3000/deps/inkex/tester/word.py | 42 + .../botbox3000/deps/inkex/tester/xmldiff.py | 125 ++ .../botbox3000/deps/inkex/transforms.py | 1279 ++++++++++++++++ extensions/botbox3000/deps/inkex/turtle.py | 258 ++++ extensions/botbox3000/deps/inkex/tween.py | 862 +++++++++++ extensions/botbox3000/deps/inkex/units.py | 150 ++ extensions/botbox3000/deps/inkex/utils.py | 410 +++++ .../botbox3000/deps/tinycss2/__init__.py | 18 + extensions/botbox3000/deps/tinycss2/ast.py | 886 +++++++++++ extensions/botbox3000/deps/tinycss2/bytes.py | 113 ++ extensions/botbox3000/deps/tinycss2/color3.py | 337 ++++ extensions/botbox3000/deps/tinycss2/color4.py | 480 ++++++ extensions/botbox3000/deps/tinycss2/color5.py | 135 ++ extensions/botbox3000/deps/tinycss2/nth.py | 100 ++ extensions/botbox3000/deps/tinycss2/parser.py | 528 +++++++ .../botbox3000/deps/tinycss2/serializer.py | 146 ++ .../botbox3000/deps/tinycss2/tokenizer.py | 423 ++++++ extensions/botbox3000/doc/botbox3000.gif | Bin 0 -> 345796 bytes extensions/botbox3000/doc/example1.jpg | Bin 0 -> 804014 bytes extensions/botbox3000/livinghinge.py | 95 ++ extensions/botbox3000/offset.py | 776 ++++++++++ extensions/botbox3000/placements.py | 149 ++ extensions/km-plot/.gitignore | 19 + extensions/km-plot/.upstream_branch | 1 + extensions/km-plot/.upstream_commit | 1 + extensions/km-plot/.upstream_url | 1 + extensions/km-plot/LICENSE | 622 ++++++++ extensions/km-plot/README.md | 25 + extensions/km-plot/deps/serial/__init__.py | 91 ++ extensions/km-plot/deps/serial/__main__.py | 3 + extensions/km-plot/deps/serial/rfc2217.py | 1351 +++++++++++++++++ extensions/km-plot/deps/serial/rs485.py | 94 ++ extensions/km-plot/deps/serial/serialcli.py | 253 +++ extensions/km-plot/deps/serial/serialjava.py | 251 +++ extensions/km-plot/deps/serial/serialposix.py | 900 +++++++++++ extensions/km-plot/deps/serial/serialutil.py | 697 +++++++++ extensions/km-plot/deps/serial/serialwin32.py | 477 ++++++ .../km-plot/deps/serial/threaded/__init__.py | 297 ++++ .../km-plot/deps/serial/tools/__init__.py | 0 .../deps/serial/tools/hexlify_codec.py | 126 ++ .../km-plot/deps/serial/tools/list_ports.py | 110 ++ .../deps/serial/tools/list_ports_common.py | 121 ++ .../deps/serial/tools/list_ports_linux.py | 109 ++ .../deps/serial/tools/list_ports_osx.py | 299 ++++ .../deps/serial/tools/list_ports_posix.py | 119 ++ .../deps/serial/tools/list_ports_windows.py | 427 ++++++ .../km-plot/deps/serial/tools/miniterm.py | 1042 +++++++++++++ .../deps/serial/urlhandler/__init__.py | 0 .../deps/serial/urlhandler/protocol_alt.py | 57 + .../deps/serial/urlhandler/protocol_cp2110.py | 258 ++++ .../deps/serial/urlhandler/protocol_hwgrep.py | 91 ++ .../deps/serial/urlhandler/protocol_loop.py | 308 ++++ .../serial/urlhandler/protocol_rfc2217.py | 12 + .../deps/serial/urlhandler/protocol_socket.py | 359 +++++ .../deps/serial/urlhandler/protocol_spy.py | 290 ++++ extensions/km-plot/deps/serial/win32.py | 366 +++++ extensions/km-plot/docs/km-plot.gif | Bin 0 -> 339544 bytes extensions/km-plot/gui.py | 471 ++++++ extensions/km-plot/icons/noport.png | Bin 0 -> 72957 bytes extensions/km-plot/icons/unknown.png | Bin 0 -> 63055 bytes extensions/km-plot/icons/vinyl1.png | Bin 0 -> 29887 bytes extensions/km-plot/icons/vinyl2.png | Bin 0 -> 31163 bytes extensions/km-plot/kmplot.inx | 16 + extensions/km-plot/kmplot.py | 177 +++ extensions/km-plot/plot.py | 150 ++ extensions/km-plot/plotters.py | 10 + 149 files changed, 38486 insertions(+) create mode 100644 extensions/botbox3000/.gitignore create mode 100644 extensions/botbox3000/LICENSE create mode 100644 extensions/botbox3000/README.md create mode 100644 extensions/botbox3000/boxbot.inx create mode 100644 extensions/botbox3000/boxbot.py create mode 100644 extensions/botbox3000/deps/inkex/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/base.py create mode 100644 extensions/botbox3000/deps/inkex/bezier.py create mode 100644 extensions/botbox3000/deps/inkex/colors/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/colors/color.py create mode 100644 extensions/botbox3000/deps/inkex/colors/converters.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/cms.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/cmyk.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/css.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/hsl.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/hsv.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/named.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/none.py create mode 100644 extensions/botbox3000/deps/inkex/colors/spaces/rgb.py create mode 100644 extensions/botbox3000/deps/inkex/colors/utils.py create mode 100644 extensions/botbox3000/deps/inkex/command.py create mode 100644 extensions/botbox3000/deps/inkex/css/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/css/compiler.py create mode 100644 extensions/botbox3000/deps/inkex/css/parser.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/README.rst create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/bezmisc.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/cspsubdiv.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/cubicsuperpath.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/ffgeom.py create mode 100755 extensions/botbox3000/deps/inkex/deprecated-simple/run_command.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/simplepath.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/simplestyle.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated-simple/simpletransform.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated/deprecatedeffect.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated/main.py create mode 100644 extensions/botbox3000/deps/inkex/deprecated/meta.py create mode 100644 extensions/botbox3000/deps/inkex/elements/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_base.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_filters.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_groups.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_image.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_meta.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_parser.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_polygons.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_selected.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_svg.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_text.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_use.py create mode 100644 extensions/botbox3000/deps/inkex/elements/_utils.py create mode 100644 extensions/botbox3000/deps/inkex/extensions.py create mode 100644 extensions/botbox3000/deps/inkex/gui/README.md create mode 100644 extensions/botbox3000/deps/inkex/gui/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/gui/app.py create mode 100644 extensions/botbox3000/deps/inkex/gui/asyncme.py create mode 100644 extensions/botbox3000/deps/inkex/gui/listview.py create mode 100644 extensions/botbox3000/deps/inkex/gui/pixmap.py create mode 100644 extensions/botbox3000/deps/inkex/gui/tester.py create mode 100644 extensions/botbox3000/deps/inkex/gui/window.py create mode 100644 extensions/botbox3000/deps/inkex/interfaces/IElement.py create mode 100644 extensions/botbox3000/deps/inkex/interfaces/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/inx.py create mode 100644 extensions/botbox3000/deps/inkex/localization.py create mode 100644 extensions/botbox3000/deps/inkex/paths/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/paths/arc.py create mode 100644 extensions/botbox3000/deps/inkex/paths/curves.py create mode 100644 extensions/botbox3000/deps/inkex/paths/interfaces.py create mode 100644 extensions/botbox3000/deps/inkex/paths/lines.py create mode 100644 extensions/botbox3000/deps/inkex/paths/path.py create mode 100644 extensions/botbox3000/deps/inkex/paths/quadratic.py create mode 100644 extensions/botbox3000/deps/inkex/ports.py create mode 100644 extensions/botbox3000/deps/inkex/properties.py create mode 100644 extensions/botbox3000/deps/inkex/py.typed create mode 100644 extensions/botbox3000/deps/inkex/styles.py create mode 100644 extensions/botbox3000/deps/inkex/tester/__init__.py create mode 100644 extensions/botbox3000/deps/inkex/tester/decorators.py create mode 100644 extensions/botbox3000/deps/inkex/tester/filters.py create mode 100644 extensions/botbox3000/deps/inkex/tester/inkscape.extension.rng create mode 100644 extensions/botbox3000/deps/inkex/tester/inkscape.extension.schema create mode 100644 extensions/botbox3000/deps/inkex/tester/inx.py create mode 100644 extensions/botbox3000/deps/inkex/tester/mock.py create mode 100644 extensions/botbox3000/deps/inkex/tester/svg.py create mode 100644 extensions/botbox3000/deps/inkex/tester/word.py create mode 100644 extensions/botbox3000/deps/inkex/tester/xmldiff.py create mode 100644 extensions/botbox3000/deps/inkex/transforms.py create mode 100644 extensions/botbox3000/deps/inkex/turtle.py create mode 100644 extensions/botbox3000/deps/inkex/tween.py create mode 100644 extensions/botbox3000/deps/inkex/units.py create mode 100644 extensions/botbox3000/deps/inkex/utils.py create mode 100644 extensions/botbox3000/deps/tinycss2/__init__.py create mode 100644 extensions/botbox3000/deps/tinycss2/ast.py create mode 100644 extensions/botbox3000/deps/tinycss2/bytes.py create mode 100644 extensions/botbox3000/deps/tinycss2/color3.py create mode 100644 extensions/botbox3000/deps/tinycss2/color4.py create mode 100644 extensions/botbox3000/deps/tinycss2/color5.py create mode 100644 extensions/botbox3000/deps/tinycss2/nth.py create mode 100644 extensions/botbox3000/deps/tinycss2/parser.py create mode 100644 extensions/botbox3000/deps/tinycss2/serializer.py create mode 100644 extensions/botbox3000/deps/tinycss2/tokenizer.py create mode 100644 extensions/botbox3000/doc/botbox3000.gif create mode 100644 extensions/botbox3000/doc/example1.jpg create mode 100644 extensions/botbox3000/livinghinge.py create mode 100644 extensions/botbox3000/offset.py create mode 100644 extensions/botbox3000/placements.py create mode 100644 extensions/km-plot/.gitignore create mode 100644 extensions/km-plot/.upstream_branch create mode 100644 extensions/km-plot/.upstream_commit create mode 100644 extensions/km-plot/.upstream_url create mode 100644 extensions/km-plot/LICENSE create mode 100644 extensions/km-plot/README.md create mode 100644 extensions/km-plot/deps/serial/__init__.py create mode 100644 extensions/km-plot/deps/serial/__main__.py create mode 100644 extensions/km-plot/deps/serial/rfc2217.py create mode 100644 extensions/km-plot/deps/serial/rs485.py create mode 100644 extensions/km-plot/deps/serial/serialcli.py create mode 100644 extensions/km-plot/deps/serial/serialjava.py create mode 100644 extensions/km-plot/deps/serial/serialposix.py create mode 100644 extensions/km-plot/deps/serial/serialutil.py create mode 100644 extensions/km-plot/deps/serial/serialwin32.py create mode 100644 extensions/km-plot/deps/serial/threaded/__init__.py create mode 100644 extensions/km-plot/deps/serial/tools/__init__.py create mode 100644 extensions/km-plot/deps/serial/tools/hexlify_codec.py create mode 100644 extensions/km-plot/deps/serial/tools/list_ports.py create mode 100644 extensions/km-plot/deps/serial/tools/list_ports_common.py create mode 100644 extensions/km-plot/deps/serial/tools/list_ports_linux.py create mode 100644 extensions/km-plot/deps/serial/tools/list_ports_osx.py create mode 100644 extensions/km-plot/deps/serial/tools/list_ports_posix.py create mode 100644 extensions/km-plot/deps/serial/tools/list_ports_windows.py create mode 100644 extensions/km-plot/deps/serial/tools/miniterm.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/__init__.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/protocol_alt.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/protocol_cp2110.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/protocol_hwgrep.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/protocol_loop.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/protocol_rfc2217.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/protocol_socket.py create mode 100644 extensions/km-plot/deps/serial/urlhandler/protocol_spy.py create mode 100644 extensions/km-plot/deps/serial/win32.py create mode 100644 extensions/km-plot/docs/km-plot.gif create mode 100644 extensions/km-plot/gui.py create mode 100644 extensions/km-plot/icons/noport.png create mode 100644 extensions/km-plot/icons/unknown.png create mode 100644 extensions/km-plot/icons/vinyl1.png create mode 100644 extensions/km-plot/icons/vinyl2.png create mode 100644 extensions/km-plot/kmplot.inx create mode 100644 extensions/km-plot/kmplot.py create mode 100644 extensions/km-plot/plot.py create mode 100644 extensions/km-plot/plotters.py diff --git a/extensions/botbox3000/.gitignore b/extensions/botbox3000/.gitignore new file mode 100644 index 0000000..2dbcb1d --- /dev/null +++ b/extensions/botbox3000/.gitignore @@ -0,0 +1,16 @@ +# Hidden files and directories (everything starting with .) +.* + +# Python cache (but keep bundled deps/) +__pycache__/ +*.py[cod] +*$py.class +.Python + +# But don't ignore this .gitignore file itself +!.gitignore + +# IDEs +*.swp +*.swo +*~ diff --git a/extensions/botbox3000/LICENSE b/extensions/botbox3000/LICENSE new file mode 100644 index 0000000..f288702 --- /dev/null +++ b/extensions/botbox3000/LICENSE @@ -0,0 +1,674 @@ + GNU GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The GNU General Public License is a free, copyleft license for +software and other kinds of works. + + The licenses for most software and other practical works are designed +to take away your freedom to share and change the works. By contrast, +the GNU General Public License is intended to guarantee your freedom to +share and change all versions of a program--to make sure it remains free +software for all its users. We, the Free Software Foundation, use the +GNU General Public License for most of our software; it applies also to +any other work released this way by its authors. You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +them if you wish), that you receive source code or can get it if you +want it, that you can change the software or use pieces of it in new +free programs, and that you know you can do these things. + + To protect your rights, we need to prevent others from denying you +these rights or asking you to surrender the rights. Therefore, you have +certain responsibilities if you distribute copies of the software, or if +you modify it: responsibilities to respect the freedom of others. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must pass on to the recipients the same +freedoms that you received. You must make sure that they, too, receive +or can get the source code. And you must show them these terms so they +know their rights. + + Developers that use the GNU GPL protect your rights with two steps: +(1) assert copyright on the software, and (2) offer you this License +giving you legal permission to copy, distribute and/or modify it. + + For the developers' and authors' protection, the GPL clearly explains +that there is no warranty for this free software. For both users' and +authors' sake, the GPL requires that modified versions be marked as +changed, so that their problems will not be attributed erroneously to +authors of previous versions. + + Some devices are designed to deny users access to install or run +modified versions of the software inside them, although the manufacturer +can do so. This is fundamentally incompatible with the aim of +protecting users' freedom to change the software. The systematic +pattern of such abuse occurs in the area of products for individuals to +use, which is precisely where it is most unacceptable. Therefore, we +have designed this version of the GPL to prohibit the practice for those +products. If such problems arise substantially in other domains, we +stand ready to extend this provision to those domains in future versions +of the GPL, as needed to protect the freedom of users. + + Finally, every program is threatened constantly by software patents. +States should not allow patents to restrict development and use of +software on general-purpose computers, but in those that do, we wish to +avoid the special danger that patents applied to a free program could +make it effectively proprietary. To prevent this, the GPL assures that +patents cannot be used to render the program non-free. + + The precise terms and conditions for copying, distribution and +modification follow. + + TERMS AND CONDITIONS + + 0. Definitions. + + "This License" refers to version 3 of the GNU General Public License. + + "Copyright" also means copyright-like laws that apply to other kinds of +works, such as semiconductor masks. + + "The Program" refers to any copyrightable work licensed under this +License. Each licensee is addressed as "you". "Licensees" and +"recipients" may be individuals or organizations. + + To "modify" a work means to copy from or adapt all or part of the work +in a fashion requiring copyright permission, other than the making of an +exact copy. The resulting work is called a "modified version" of the +earlier work or a work "based on" the earlier work. + + A "covered work" means either the unmodified Program or a work based +on the Program. + + To "propagate" a work means to do anything with it that, without +permission, would make you directly or secondarily liable for +infringement under applicable copyright law, except executing it on a +computer or modifying a private copy. Propagation includes copying, +distribution (with or without modification), making available to the +public, and in some countries other activities as well. + + To "convey" a work means any kind of propagation that enables other +parties to make or receive copies. Mere interaction with a user through +a computer network, with no transfer of a copy, is not conveying. + + An interactive user interface displays "Appropriate Legal Notices" +to the extent that it includes a convenient and prominently visible +feature that (1) displays an appropriate copyright notice, and (2) +tells the user that there is no warranty for the work (except to the +extent that warranties are provided), that licensees may convey the +work under this License, and how to view a copy of this License. If +the interface presents a list of user commands or options, such as a +menu, a prominent item in the list meets this criterion. + + 1. Source Code. + + The "source code" for a work means the preferred form of the work +for making modifications to it. "Object code" means any non-source +form of a work. + + A "Standard Interface" means an interface that either is an official +standard defined by a recognized standards body, or, in the case of +interfaces specified for a particular programming language, one that +is widely used among developers working in that language. + + The "System Libraries" of an executable work include anything, other +than the work as a whole, that (a) is included in the normal form of +packaging a Major Component, but which is not part of that Major +Component, and (b) serves only to enable use of the work with that +Major Component, or to implement a Standard Interface for which an +implementation is available to the public in source code form. A +"Major Component", in this context, means a major essential component +(kernel, window system, and so on) of the specific operating system +(if any) on which the executable work runs, or a compiler used to +produce the work, or an object code interpreter used to run it. + + The "Corresponding Source" for a work in object code form means all +the source code needed to generate, install, and (for an executable +work) run the object code and to modify the work, including scripts to +control those activities. However, it does not include the work's +System Libraries, or general-purpose tools or generally available free +programs which are used unmodified in performing those activities but +which are not part of the work. For example, Corresponding Source +includes interface definition files associated with source files for +the work, and the source code for shared libraries and dynamically +linked subprograms that the work is specifically designed to require, +such as by intimate data communication or control flow between those +subprograms and other parts of the work. + + The Corresponding Source need not include anything that users +can regenerate automatically from other parts of the Corresponding +Source. + + The Corresponding Source for a work in source code form is that +same work. + + 2. Basic Permissions. + + All rights granted under this License are granted for the term of +copyright on the Program, and are irrevocable provided the stated +conditions are met. This License explicitly affirms your unlimited +permission to run the unmodified Program. The output from running a +covered work is covered by this License only if the output, given its +content, constitutes a covered work. This License acknowledges your +rights of fair use or other equivalent, as provided by copyright law. + + You may make, run and propagate covered works that you do not +convey, without conditions so long as your license otherwise remains +in force. You may convey covered works to others for the sole purpose +of having them make modifications exclusively for you, or provide you +with facilities for running those works, provided that you comply with +the terms of this License in conveying all material for which you do +not control copyright. Those thus making or running the covered works +for you must do so exclusively on your behalf, under your direction +and control, on terms that prohibit them from making any copies of +your copyrighted material outside their relationship with you. + + Conveying under any other circumstances is permitted solely under +the conditions stated below. Sublicensing is not allowed; section 10 +makes it unnecessary. + + 3. Protecting Users' Legal Rights From Anti-Circumvention Law. + + No covered work shall be deemed part of an effective technological +measure under any applicable law fulfilling obligations under article +11 of the WIPO copyright treaty adopted on 20 December 1996, or +similar laws prohibiting or restricting circumvention of such +measures. + + When you convey a covered work, you waive any legal power to forbid +circumvention of technological measures to the extent such circumvention +is effected by exercising rights under this License with respect to +the covered work, and you disclaim any intention to limit operation or +modification of the work as a means of enforcing, against the work's +users, your or third parties' legal rights to forbid circumvention of +technological measures. + + 4. Conveying Verbatim Copies. + + You may convey verbatim copies of the Program's source code as you +receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice; +keep intact all notices stating that this License and any +non-permissive terms added in accord with section 7 apply to the code; +keep intact all notices of the absence of any warranty; and give all +recipients a copy of this License along with the Program. + + You may charge any price or no price for each copy that you convey, +and you may offer support or warranty protection for a fee. + + 5. Conveying Modified Source Versions. + + You may convey a work based on the Program, or the modifications to +produce it from the Program, in the form of source code under the +terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified + it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is + released under this License and any conditions added under section + 7. This requirement modifies the requirement in section 4 to + "keep intact all notices". + + c) You must license the entire work, as a whole, under this + License to anyone who comes into possession of a copy. This + License will therefore apply, along with any applicable section 7 + additional terms, to the whole of the work, and all its parts, + regardless of how they are packaged. This License gives no + permission to license the work in any other way, but it does not + invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display + Appropriate Legal Notices; however, if the Program has interactive + interfaces that do not display Appropriate Legal Notices, your + work need not make them do so. + + A compilation of a covered work with other separate and independent +works, which are not by their nature extensions of the covered work, +and which are not combined with it such as to form a larger program, +in or on a volume of a storage or distribution medium, is called an +"aggregate" if the compilation and its resulting copyright are not +used to limit the access or legal rights of the compilation's users +beyond what the individual works permit. Inclusion of a covered work +in an aggregate does not cause this License to apply to the other +parts of the aggregate. + + 6. Conveying Non-Source Forms. + + You may convey a covered work in object code form under the terms +of sections 4 and 5, provided that you also convey the +machine-readable Corresponding Source under the terms of this License, +in one of these ways: + + a) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by the + Corresponding Source fixed on a durable physical medium + customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by a + written offer, valid for at least three years and valid for as + long as you offer spare parts or customer support for that product + model, to give anyone who possesses the object code either (1) a + copy of the Corresponding Source for all the software in the + product that is covered by this License, on a durable physical + medium customarily used for software interchange, for a price no + more than your reasonable cost of physically performing this + conveying of source, or (2) access to copy the + Corresponding Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the + written offer to provide the Corresponding Source. This + alternative is allowed only occasionally and noncommercially, and + only if you received the object code with such an offer, in accord + with subsection 6b. + + d) Convey the object code by offering access from a designated + place (gratis or for a charge), and offer equivalent access to the + Corresponding Source in the same way through the same place at no + further charge. You need not require recipients to copy the + Corresponding Source along with the object code. If the place to + copy the object code is a network server, the Corresponding Source + may be on a different server (operated by you or a third party) + that supports equivalent copying facilities, provided you maintain + clear directions next to the object code saying where to find the + Corresponding Source. Regardless of what server hosts the + Corresponding Source, you remain obligated to ensure that it is + available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided + you inform other peers where the object code and Corresponding + Source of the work are being offered to the general public at no + charge under subsection 6d. + + A separable portion of the object code, whose source code is excluded +from the Corresponding Source as a System Library, need not be +included in conveying the object code work. + + A "User Product" is either (1) a "consumer product", which means any +tangible personal property which is normally used for personal, family, +or household purposes, or (2) anything designed or sold for incorporation +into a dwelling. In determining whether a product is a consumer product, +doubtful cases shall be resolved in favor of coverage. For a particular +product received by a particular user, "normally used" refers to a +typical or common use of that class of product, regardless of the status +of the particular user or of the way in which the particular user +actually uses, or expects or is expected to use, the product. A product +is a consumer product regardless of whether the product has substantial +commercial, industrial or non-consumer uses, unless such uses represent +the only significant mode of use of the product. + + "Installation Information" for a User Product means any methods, +procedures, authorization keys, or other information required to install +and execute modified versions of a covered work in that User Product from +a modified version of its Corresponding Source. The information must +suffice to ensure that the continued functioning of the modified object +code is in no case prevented or interfered with solely because +modification has been made. + + If you convey an object code work under this section in, or with, or +specifically for use in, a User Product, and the conveying occurs as +part of a transaction in which the right of possession and use of the +User Product is transferred to the recipient in perpetuity or for a +fixed term (regardless of how the transaction is characterized), the +Corresponding Source conveyed under this section must be accompanied +by the Installation Information. But this requirement does not apply +if neither you nor any third party retains the ability to install +modified object code on the User Product (for example, the work has +been installed in ROM). + + The requirement to provide Installation Information does not include a +requirement to continue to provide support service, warranty, or updates +for a work that has been modified or installed by the recipient, or for +the User Product in which it has been modified or installed. Access to a +network may be denied when the modification itself materially and +adversely affects the operation of the network or violates the rules and +protocols for communication across the network. + + Corresponding Source conveyed, and Installation Information provided, +in accord with this section must be in a format that is publicly +documented (and with an implementation available to the public in +source code form), and must require no special password or key for +unpacking, reading or copying. + + 7. Additional Terms. + + "Additional permissions" are terms that supplement the terms of this +License by making exceptions from one or more of its conditions. +Additional permissions that are applicable to the entire Program shall +be treated as though they were included in this License, to the extent +that they are valid under applicable law. If additional permissions +apply only to part of the Program, that part may be used separately +under those permissions, but the entire Program remains governed by +this License without regard to the additional permissions. + + When you convey a copy of a covered work, you may at your option +remove any additional permissions from that copy, or from any part of +it. (Additional permissions may be written to require their own +removal in certain cases when you modify the work.) You may place +additional permissions on material, added by you to a covered work, +for which you have or can give appropriate copyright permission. + + Notwithstanding any other provision of this License, for material you +add to a covered work, you may (if authorized by the copyright holders of +that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the + terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or + author attributions in that material or in the Appropriate Legal + Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or + requiring that modified versions of such material be marked in + reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or + authors of the material; or + + e) Declining to grant rights under trademark law for use of some + trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that + material by anyone who conveys the material (or modified versions of + it) with contractual assumptions of liability to the recipient, for + any liability that these contractual assumptions directly impose on + those licensors and authors. + + All other non-permissive additional terms are considered "further +restrictions" within the meaning of section 10. If the Program as you +received it, or any part of it, contains a notice stating that it is +governed by this License along with a term that is a further +restriction, you may remove that term. If a license document contains +a further restriction but permits relicensing or conveying under this +License, you may add to a covered work material governed by the terms +of that license document, provided that the further restriction does +not survive such relicensing or conveying. + + If you add terms to a covered work in accord with this section, you +must place, in the relevant source files, a statement of the +additional terms that apply to those files, or a notice indicating +where to find the applicable terms. + + Additional terms, permissive or non-permissive, may be stated in the +form of a separately written license, or stated as exceptions; +the above requirements apply either way. + + 8. Termination. + + You may not propagate or modify a covered work except as expressly +provided under this License. Any attempt otherwise to propagate or +modify it is void, and will automatically terminate your rights under +this License (including any patent licenses granted under the third +paragraph of section 11). + + However, if you cease all violation of this License, then your +license from a particular copyright holder is reinstated (a) +provisionally, unless and until the copyright holder explicitly and +finally terminates your license, and (b) permanently, if the copyright +holder fails to notify you of the violation by some reasonable means +prior to 60 days after the cessation. + + Moreover, your license from a particular copyright holder is +reinstated permanently if the copyright holder notifies you of the +violation by some reasonable means, this is the first time you have +received notice of violation of this License (for any work) from that +copyright holder, and you cure the violation prior to 30 days after +your receipt of the notice. + + Termination of your rights under this section does not terminate the +licenses of parties who have received copies or rights from you under +this License. If your rights have been terminated and not permanently +reinstated, you do not qualify to receive new licenses for the same +material under section 10. + + 9. Acceptance Not Required for Having Copies. + + You are not required to accept this License in order to receive or +run a copy of the Program. Ancillary propagation of a covered work +occurring solely as a consequence of using peer-to-peer transmission +to receive a copy likewise does not require acceptance. However, +nothing other than this License grants you permission to propagate or +modify any covered work. These actions infringe copyright if you do +not accept this License. Therefore, by modifying or propagating a +covered work, you indicate your acceptance of this License to do so. + + 10. Automatic Licensing of Downstream Recipients. + + Each time you convey a covered work, the recipient automatically +receives a license from the original licensors, to run, modify and +propagate that work, subject to this License. You are not responsible +for enforcing compliance by third parties with this License. + + An "entity transaction" is a transaction transferring control of an +organization, or substantially all assets of one, or subdividing an +organization, or merging organizations. If propagation of a covered +work results from an entity transaction, each party to that +transaction who receives a copy of the work also receives whatever +licenses to the work the party's predecessor in interest had or could +give under the previous paragraph, plus a right to possession of the +Corresponding Source of the work from the predecessor in interest, if +the predecessor has it or can get it with reasonable efforts. + + You may not impose any further restrictions on the exercise of the +rights granted or affirmed under this License. For example, you may +not impose a license fee, royalty, or other charge for exercise of +rights granted under this License, and you may not initiate litigation +(including a cross-claim or counterclaim in a lawsuit) alleging that +any patent claim is infringed by making, using, selling, offering for +sale, or importing the Program or any portion of it. + + 11. Patents. + + A "contributor" is a copyright holder who authorizes use under this +License of the Program or a work on which the Program is based. The +work thus licensed is called the contributor's "contributor version". + + A contributor's "essential patent claims" are all patent claims +owned or controlled by the contributor, whether already acquired or +hereafter acquired, that would be infringed by some manner, permitted +by this License, of making, using, or selling its contributor version, +but do not include claims that would be infringed only as a +consequence of further modification of the contributor version. For +purposes of this definition, "control" includes the right to grant +patent sublicenses in a manner consistent with the requirements of +this License. + + Each contributor grants you a non-exclusive, worldwide, royalty-free +patent license under the contributor's essential patent claims, to +make, use, sell, offer for sale, import and otherwise run, modify and +propagate the contents of its contributor version. + + In the following three paragraphs, a "patent license" is any express +agreement or commitment, however denominated, not to enforce a patent +(such as an express permission to practice a patent or covenant not to +sue for patent infringement). To "grant" such a patent license to a +party means to make such an agreement or commitment not to enforce a +patent against the party. + + If you convey a covered work, knowingly relying on a patent license, +and the Corresponding Source of the work is not available for anyone +to copy, free of charge and under the terms of this License, through a +publicly available network server or other readily accessible means, +then you must either (1) cause the Corresponding Source to be so +available, or (2) arrange to deprive yourself of the benefit of the +patent license for this particular work, or (3) arrange, in a manner +consistent with the requirements of this License, to extend the patent +license to downstream recipients. "Knowingly relying" means you have +actual knowledge that, but for the patent license, your conveying the +covered work in a country, or your recipient's use of the covered work +in a country, would infringe one or more identifiable patents in that +country that you have reason to believe are valid. + + If, pursuant to or in connection with a single transaction or +arrangement, you convey, or propagate by procuring conveyance of, a +covered work, and grant a patent license to some of the parties +receiving the covered work authorizing them to use, propagate, modify +or convey a specific copy of the covered work, then the patent license +you grant is automatically extended to all recipients of the covered +work and works based on it. + + A patent license is "discriminatory" if it does not include within +the scope of its coverage, prohibits the exercise of, or is +conditioned on the non-exercise of one or more of the rights that are +specifically granted under this License. You may not convey a covered +work if you are a party to an arrangement with a third party that is +in the business of distributing software, under which you make payment +to the third party based on the extent of your activity of conveying +the work, and under which the third party grants, to any of the +parties who would receive the covered work from you, a discriminatory +patent license (a) in connection with copies of the covered work +conveyed by you (or copies made from those copies), or (b) primarily +for and in connection with specific products or compilations that +contain the covered work, unless you entered into that arrangement, +or that patent license was granted, prior to 28 March 2007. + + Nothing in this License shall be construed as excluding or limiting +any implied license or other defenses to infringement that may +otherwise be available to you under applicable patent law. + + 12. No Surrender of Others' Freedom. + + If conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot convey a +covered work so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you may +not convey it at all. For example, if you agree to terms that obligate you +to collect a royalty for further conveying from those to whom you convey +the Program, the only way you could satisfy both those terms and this +License would be to refrain entirely from conveying the Program. + + 13. Use with the GNU Affero General Public License. + + Notwithstanding any other provision of this License, you have +permission to link or combine any covered work with a work licensed +under version 3 of the GNU Affero General Public License into a single +combined work, and to convey the resulting work. The terms of this +License will continue to apply to the part which is the covered work, +but the special requirements of the GNU Affero General Public License, +section 13, concerning interaction through a network will apply to the +combination as such. + + 14. Revised Versions of this License. + + The Free Software Foundation may publish revised and/or new versions of +the GNU General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + + Each version is given a distinguishing version number. If the +Program specifies that a certain numbered version of the GNU General +Public License "or any later version" applies to it, you have the +option of following the terms and conditions either of that numbered +version or of any later version published by the Free Software +Foundation. If the Program does not specify a version number of the +GNU General Public License, you may choose any version ever published +by the Free Software Foundation. + + If the Program specifies that a proxy can decide which future +versions of the GNU General Public License can be used, that proxy's +public statement of acceptance of a version permanently authorizes you +to choose that version for the Program. + + Later license versions may give you additional or different +permissions. However, no additional obligations are imposed on any +author or copyright holder as a result of your choosing to follow a +later version. + + 15. Disclaimer of Warranty. + + THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY +APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT +HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY +OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, +THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM +IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF +ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. Limitation of Liability. + + IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS +THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE +USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF +DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD +PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), +EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF +SUCH DAMAGES. + + 17. Interpretation of Sections 15 and 16. + + If the disclaimer of warranty and limitation of liability provided +above cannot be given local legal effect according to their terms, +reviewing courts shall apply local law that most closely approximates +an absolute waiver of all civil liability in connection with the +Program, unless a warranty or assumption of liability accompanies a +copy of the Program in return for a fee. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to the public, the best way to achieve this is to make it +free software which everyone can redistribute and change under these terms. + + To do so, attach the following notices to the program. It is safest +to attach them to the start of each source file to most effectively +state the exclusion of warranty; and each file should have at least +the "copyright" line and a pointer to where the full notice is found. + + + Copyright (C) + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program. If not, see . + +Also add information on how to contact you by electronic and paper mail. + + If the program does terminal interaction, make it output a short +notice like this when it starts in an interactive mode: + + Copyright (C) + This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate +parts of the General Public License. Of course, your program's commands +might be different; for a GUI interface, you would use an "about box". + + You should also get your employer (if you work as a programmer) or school, +if any, to sign a "copyright disclaimer" for the program, if necessary. +For more information on this, and how to apply and follow the GNU GPL, see +. + + The GNU General Public License does not permit incorporating your program +into proprietary programs. If your program is a subroutine library, you +may consider it more useful to permit linking proprietary applications with +the library. If this is what you want to do, use the GNU Lesser General +Public License instead of this License. But first, please read +. diff --git a/extensions/botbox3000/README.md b/extensions/botbox3000/README.md new file mode 100644 index 0000000..d18b33d --- /dev/null +++ b/extensions/botbox3000/README.md @@ -0,0 +1,41 @@ +# Box Bot 3000 + +An highly opinionated Inkscape extension for generating laser-cut flexible boxes with living hinges. Create custom boxes from any closed path shape with interlocking tabs and living hinge patterns for curved sections. + +## Manual Installation + +1) Create a boxbot/ sub-directory in your Inkscape extensions directory: + - Linux: `~/.config/inkscape/extensions/` + - Flatpak: `~/.var/app/org.inkscape.Inkscape/config/inkscape/extensions/` + - Snap: `~/snap/inkscape/current/.config/inkscape/extensions/` + - macOS (Inkscape app bundle): `~/Library/Application Support/org.inkscape.Inkscape/config/inkscape/extensions/` + - Windows: `%APPDATA%\Inkscape\extensions\` + +2) Copy the files from this repo into that boxbot directory + +3) Restart Inkscape, then find the extension under **Extensions > Laser Tools > Box Bot 3000**. + + +## Demo + + + +## Example + +![Example output](doc/example1.jpg) + +## Acknowledgements + +Inspiration, examples, and code from the following: + +The Path2flex extension +https://github.com/thierry7100/Path2flex + +The built-in Inkscape extension Pattern Along Path +https://gitlab.com/inkscape/extensions/-/blob/master/patternalongpath.py + +Boxes.py +https://boxes.hackerspace-bamberg.de + +Meerk40t +https://github.com/meerk40t/meerk40t \ No newline at end of file diff --git a/extensions/botbox3000/boxbot.inx b/extensions/botbox3000/boxbot.inx new file mode 100644 index 0000000..b9da977 --- /dev/null +++ b/extensions/botbox3000/boxbot.inx @@ -0,0 +1,57 @@ + + + Box Bot 3000 + org.knoxmakers.botbox + + mm + in + px + + + + true + 3.0 + 50.0 + 10.0 + 0.1 + + + 8 + 5.0 + 6.0 + 0.0 + 0.5 + + + false + 25 + 1.0 + 1.5 + + + + None + Rectangle + Circle + + 10.0 + 5.0 + 5.0 + 4 + 0.0 + true + + + boxbot.py + + + path + + + + + + + diff --git a/extensions/botbox3000/boxbot.py b/extensions/botbox3000/boxbot.py new file mode 100644 index 0000000..061b7a8 --- /dev/null +++ b/extensions/botbox3000/boxbot.py @@ -0,0 +1,608 @@ +#!/usr/bin/env python3 + +import sys +from pathlib import Path + +deps_dir = Path(__file__).parent / "deps" +if deps_dir.exists() and str(deps_dir) not in sys.path: + sys.path.insert(0, str(deps_dir)) + +import inkex +from inkex import PathElement, Group, TextElement +from offset import offset_path, boolean_lpe +from placements import pattern_along_path, calculate_path_length +from livinghinge import create_living_hinge_pattern, detect_straight_segments + + +class Boxbot(inkex.EffectExtension): + CUT_OUTER_STYLE = { + "stroke": "#cc0000", + "stroke-width": "1mm", + "-inkscape-stroke": "hairline", + "fill": "none", + } + + CUT_INNER_STYLE = { + "stroke": "#ff66cc", + "stroke-width": "1mm", + "-inkscape-stroke": "hairline", + "fill": "none", + } + + META_STYLE = { + "stroke": "#ffff00", + "stroke-width": "1mm", + "-inkscape-stroke": "hairline", + "fill": "none", + } + + LABEL_STYLE = { + "font-size": "6px", + "fill": "#ffff00", + "font-family": "sans-serif", + "text-anchor": "middle", + "dominant-baseline": "middle", + } + + def add_arguments(self, pars): + pars.add_argument("--units", default="mm", help="Document units") + pars.add_argument("--notebook", default="box", help="Active notebook tab") + pars.add_argument("--generate_lid", type=inkex.Boolean, default=True, help="Generate lid") + pars.add_argument("--material_thickness", type=float, default=3.0, help="Material thickness") + pars.add_argument("--box_height", type=float, default=50.0, help="Box height") + pars.add_argument("--tab_inset", type=float, default=5.0, help="Tab inset distance") + pars.add_argument("--top_hole_inset", type=float, default=10.0, help="Top hole inset") + pars.add_argument("--kerf", type=float, default=0.1, help="Kerf compensation") + pars.add_argument("--tab_width", type=float, default=6.0, help="Tab width") + pars.add_argument("--tab_start_offset", type=float, default=0.0, help="Tab start offset") + pars.add_argument("--tab_border_radius", type=float, default=0.5, help="Tab border radius") + pars.add_argument("--num_tabs", type=int, default=8, help="Number of tabs per side") + pars.add_argument("--generate_living_hinge", type=inkex.Boolean, default=False, help="Generate living hinge pattern") + pars.add_argument("--hinge_length_percent", type=int, default=25, help="Hinge cut length as percentage of side height") + pars.add_argument("--hinge_gap", type=float, default=1.5, help="Hinge gap") + pars.add_argument("--hinge_spacing", type=float, default=5.0, help="Hinge spacing") + pars.add_argument("--magnet_type", default="none", help="Magnet type") + pars.add_argument("--rectangle_magnet_width", type=float, default=6.0, help="Rectangle magnet width") + pars.add_argument("--rectangle_magnet_height", type=float, default=2.0, help="Rectangle magnet height") + pars.add_argument("--circle_magnet_diameter", type=float, default=6.0, help="Circle magnet diameter") + pars.add_argument("--num_magnets", type=int, default=4, help="Number of magnets") + pars.add_argument("--magnet_placement_offset", type=float, default=0.0, help="Magnet placement offset") + pars.add_argument("--hide_magnets", type=inkex.Boolean, default=True, help="Hide magnets") + + def create_label(self, text, bbox, label_id): + label = TextElement() + label.set_id(self.svg.get_unique_id(label_id)) + label.set('x', str(bbox.center_x)) + label.set('y', str(bbox.center_y)) + label.style = self.LABEL_STYLE + label.text = text + return label + + def create_bottom_tabs_piece(self, inset_path_d): + + def create_tab(index): + x = -tab_width / 2 + y = -tab_height / 2 + path_data = f"M {x},{y} L {x + tab_width},{y} L {x + tab_width},{y + tab_height} L {x},{y + tab_height} Z" + + tab = PathElement() + tab.set_id(self.svg.get_unique_id(f"tab_{index}")) + tab.set('d', path_data) + return tab + + group = Group(id=self.svg.get_unique_id("boxbot")) + self.svg.get_current_layer().add(group) + + self.inset_path = PathElement() + self.inset_path.set_id(self.svg.get_unique_id("inset_path")) + self.inset_path.set('d', inset_path_d) + self.inset_path.style = self.META_STYLE + group.append(self.inset_path) + + inset_csp = inkex.Path(inset_path_d).to_superpath() + self.inset_length = sum( + inkex.bezier.bezierlength((seg[1], seg[2], next_seg[0], next_seg[1])) + for subpath in inset_csp + for i, seg in enumerate(subpath[:-1]) + for next_seg in [subpath[i + 1]] + ) + + kerf = self.svg.unittouu(f"{self.options.kerf}{self.options.units}") + tab_width = self.svg.unittouu(f"{self.options.tab_width}{self.options.units}") - kerf + tab_height = self.svg.unittouu(f"{self.options.material_thickness}{self.options.units}") - kerf + tab_start_offset = self.svg.unittouu(f"{self.options.tab_start_offset}{self.options.units}") + + self.tabs = pattern_along_path( + inset_path_d, + self.options.num_tabs, + tab_width, + tab_start_offset, + "simple", + create_tab + ) + for tab in self.tabs: + tab.style = self.CUT_INNER_STYLE + group.append(tab) + + bottom_tabs_label = self.create_label("bottom tabs", group.bounding_box(), "bottom_tabs_label") + group.append(bottom_tabs_label) + self.bottom_inset = self.inset_path + self.bottom_tab_holes = self.tabs + + def create_bottom_piece(self, offset_x): + bottom_group = Group(id=self.svg.get_unique_id("bottom")) + self.svg.get_current_layer().add(bottom_group) + + bottom_path = PathElement() + bottom_path.set_id(self.svg.get_unique_id("bottom_path")) + bottom_path.set('d', str(self.original_path)) + bottom_path.style = self.CUT_OUTER_STYLE + bottom_group.append(bottom_path) + + bottom_inset = self.bottom_inset.copy() + bottom_inset.set_id(self.svg.get_unique_id("bottom_inset")) + bottom_group.append(bottom_inset) + + for i, tab in enumerate(self.bottom_tab_holes): + bottom_tab = tab.copy() + bottom_tab.set_id(self.svg.get_unique_id(f"bottom_tab_{i}")) + bottom_tab.style = self.META_STYLE + bottom_group.append(bottom_tab) + + bottom_bbox = bottom_group.bounding_box() + bottom_label = self.create_label("bottom", bottom_bbox, "bottom_label") + bottom_group.append(bottom_label) + + bottom_group.transform = inkex.Transform(translate=(offset_x, 0)) + + def create_top_tabs_piece(self, offset_x): + top_tabs_group = Group(id=self.svg.get_unique_id("top_tabs")) + self.svg.get_current_layer().add(top_tabs_group) + + top_tabs_original = PathElement() + top_tabs_original.set_id(self.svg.get_unique_id("top_tabs_original")) + top_tabs_original.set('d', str(self.original_path)) + top_tabs_original.style = self.CUT_OUTER_STYLE + top_tabs_group.append(top_tabs_original) + + top_tabs_inset = self.inset_path.copy() + top_tabs_inset.set_id(self.svg.get_unique_id("top_tabs_inset")) + top_tabs_group.append(top_tabs_inset) + + for tab in self.tabs: + top_tab = tab.copy() + top_tab.set_id(self.svg.get_unique_id("top_tab")) + top_tabs_group.append(top_tab) + + from offset import offset_path as create_offset_path + top_hole_inset_dist = -self.svg.unittouu(f"{self.options.top_hole_inset}{self.options.units}") + self.top_hole_inset = None + try: + top_hole_inset_d = create_offset_path(self.original_path, top_hole_inset_dist) + self.top_hole_inset = PathElement() + self.top_hole_inset.set_id(self.svg.get_unique_id("top_hole_inset")) + self.top_hole_inset.set('d', top_hole_inset_d) + self.top_hole_inset.style = self.CUT_OUTER_STYLE + top_tabs_group.append(self.top_hole_inset) + except ValueError: + pass + + self.magnets = [] + if self.options.magnet_type != "none": + num_magnets = self.options.num_magnets + magnet_placement_offset = self.svg.unittouu(f"{self.options.magnet_placement_offset}{self.options.units}") + inset_path_d = self.inset_path.get('d') + + def create_magnet(index): + if self.options.magnet_type == "rectangle": + magnet_width = self.svg.unittouu(f"{self.options.rectangle_magnet_width}{self.options.units}") + magnet_height = self.svg.unittouu(f"{self.options.rectangle_magnet_height}{self.options.units}") + + rect_x = -magnet_width / 2 + rect_y = -magnet_height / 2 + path_data = ( + f"M {rect_x},{rect_y} " + f"L {rect_x + magnet_width},{rect_y} " + f"L {rect_x + magnet_width},{rect_y + magnet_height} " + f"L {rect_x},{rect_y + magnet_height} Z" + ) + else: + magnet_diameter = self.svg.unittouu(f"{self.options.circle_magnet_diameter}{self.options.units}") + radius = magnet_diameter / 2 + path_data = ( + f"M {radius},0 " + f"A {radius},{radius} 0 0 1 0,{radius} " + f"A {radius},{radius} 0 0 1 {-radius},0 " + f"A {radius},{radius} 0 0 1 0,{-radius} " + f"A {radius},{radius} 0 0 1 {radius},0 Z" + ) + + magnet = PathElement() + magnet.set_id(self.svg.get_unique_id(f"magnet_{index}")) + magnet.set('d', path_data) + magnet.style = self.CUT_OUTER_STYLE if self.options.hide_magnets else self.META_STYLE + return magnet + + if self.options.magnet_type == "rectangle": + item_width = self.svg.unittouu(f"{self.options.rectangle_magnet_width}{self.options.units}") + else: + item_width = self.svg.unittouu(f"{self.options.circle_magnet_diameter}{self.options.units}") + + self.magnets = pattern_along_path( + inset_path_d, + num_magnets, + item_width, + magnet_placement_offset, + "even", + create_magnet + ) + + for magnet in self.magnets: + top_tabs_group.append(magnet) + + top_tabs_bbox = top_tabs_group.bounding_box() + top_tabs_label = self.create_label("top tabs", top_tabs_bbox, "top_tabs_label") + top_tabs_group.append(top_tabs_label) + top_tabs_group.transform = inkex.Transform(translate=(offset_x, 0)) + + def create_top_piece(self, offset_x): + top_group = Group(id=self.svg.get_unique_id("top")) + self.svg.get_current_layer().add(top_group) + + top_path = PathElement() + top_path.set_id(self.svg.get_unique_id("top_path")) + top_path.set('d', str(self.original_path)) + top_path.style = self.CUT_OUTER_STYLE + top_group.append(top_path) + + top_inset = self.inset_path.copy() + top_inset.set_id(self.svg.get_unique_id("top_inset")) + top_group.append(top_inset) + + for tab in self.tabs: + top_tab = tab.copy() + top_tab.set_id(self.svg.get_unique_id("top_tab")) + top_tab.style = self.META_STYLE + top_group.append(top_tab) + + if self.top_hole_inset is not None: + top_hole_inset_copy = self.top_hole_inset.copy() + top_hole_inset_copy.set_id(self.svg.get_unique_id("top_hole_inset")) + top_group.append(top_hole_inset_copy) + + if len(self.magnets) > 0: + for i, magnet in enumerate(self.magnets): + magnet_copy = magnet.copy() + magnet_copy.set_id(self.svg.get_unique_id(f"top_magnet_{i}")) + magnet_copy.style = self.META_STYLE if self.options.hide_magnets else self.CUT_OUTER_STYLE + top_group.append(magnet_copy) + + top_bbox = top_group.bounding_box() + top_label = self.create_label("top", top_bbox, "top_label") + top_group.append(top_label) + top_group.transform = inkex.Transform(translate=(offset_x, 0)) + + def create_side_piece(self, offset_x, offset_y, inset_path_d): + + side_group = Group(id=self.svg.get_unique_id("side")) + self.svg.get_current_layer().add(side_group) + + tab_width = self.svg.unittouu(f"{self.options.tab_width}{self.options.units}") + tab_height = self.svg.unittouu(f"{self.options.material_thickness}{self.options.units}") + tab_start_offset = self.svg.unittouu(f"{self.options.tab_start_offset}{self.options.units}") + num_tabs = self.options.num_tabs + + rect_width = self.inset_length + rect_height = (self.svg.unittouu(f"{self.options.box_height}{self.options.units}") - + 4 * self.svg.unittouu(f"{self.options.material_thickness}{self.options.units}")) + + rect_path_data = f"M 0,0 L {rect_width},0 L {rect_width},{rect_height} L 0,{rect_height} Z" + + side_rect = PathElement() + side_rect.set_id(self.svg.get_unique_id("side_rect")) + side_rect.set('d', rect_path_data) + side_rect.style = self.CUT_OUTER_STYLE + side_rect.transform = inkex.Transform(translate=(offset_x, offset_y)) + side_group.append(side_rect) + + corner_radius = self.svg.unittouu(f"{self.options.tab_border_radius}{self.options.units}") + total_tabs = num_tabs + 1 + half_tab_width = tab_width / 2 + + full_tab_height = rect_height + 2 * tab_height + tab_y = -tab_height + + tab_elements = [] + + for i in range(total_tabs): + if i == 0: + current_tab_width = half_tab_width + tab_x = 0 + elif i == total_tabs - 1: + current_tab_width = half_tab_width + tab_x = rect_width - half_tab_width + else: + current_tab_width = tab_width + spacing = rect_width / num_tabs + tab_x = i * spacing - current_tab_width / 2 + + r = min(corner_radius, current_tab_width / 2, full_tab_height / 2) + tab_path = ( + f"M {tab_x + r},{tab_y} " + f"L {tab_x + current_tab_width - r},{tab_y} " + f"A {r},{r} 0 0 1 {tab_x + current_tab_width},{tab_y + r} " + f"L {tab_x + current_tab_width},{tab_y + full_tab_height - r} " + f"A {r},{r} 0 0 1 {tab_x + current_tab_width - r},{tab_y + full_tab_height} " + f"L {tab_x + r},{tab_y + full_tab_height} " + f"A {r},{r} 0 0 1 {tab_x},{tab_y + full_tab_height - r} " + f"L {tab_x},{tab_y + r} " + f"A {r},{r} 0 0 1 {tab_x + r},{tab_y} " + f"Z" + ) + + tab_elem = PathElement() + tab_elem.set_id(self.svg.get_unique_id("side_tab")) + tab_elem.set('d', tab_path) + tab_elem.style = self.META_STYLE + tab_elem.transform = inkex.Transform(translate=(offset_x, offset_y)) + side_group.append(tab_elem) + tab_elements.append(tab_elem) + + boolean_lpe(self.svg, side_rect, tab_elements, operation="union") + + path = inkex.Path(inset_path_d) + total_length = calculate_path_length(path) + + gap = (total_length - num_tabs * tab_width) / num_tabs + first_tab_start = tab_start_offset % total_length + first_tab_center = (first_tab_start + tab_width / 2) % total_length + side_start_offset = first_tab_center + + straight_segments = detect_straight_segments(inset_path_d, 20.0, self.svg, self.options.units) + + adjusted_straight_segments = [] + for seg_start, seg_end in straight_segments: + start_pos = (seg_start - side_start_offset) % total_length + end_pos = (seg_end - side_start_offset) % total_length + + if start_pos < end_pos: + adjusted_straight_segments.append((start_pos, end_pos)) + else: + adjusted_straight_segments.append((start_pos, total_length)) + adjusted_straight_segments.append((0, end_pos)) + + hinge_regions = [] + if not adjusted_straight_segments: + hinge_regions = [(0, rect_width)] + else: + adjusted_straight_segments = sorted(adjusted_straight_segments, key=lambda x: x[0]) + + current_pos = 0 + for seg_start, seg_end in adjusted_straight_segments: + if current_pos < seg_start: + hinge_regions.append((current_pos, seg_start)) + current_pos = seg_end + + if current_pos < rect_width: + hinge_regions.append((current_pos, rect_width)) + + for i, (hinge_start, hinge_end) in enumerate(hinge_regions): + hinge_rect_data = f"M {hinge_start},0 L {hinge_end},0 L {hinge_end},{rect_height} L {hinge_start},{rect_height} Z" + + hinge_rect = PathElement() + hinge_rect.set_id(self.svg.get_unique_id(f"hinge_rect_{i}")) + hinge_rect.set('d', hinge_rect_data) + hinge_rect.style = self.META_STYLE + hinge_rect.transform = inkex.Transform(translate=(offset_x, offset_y)) + side_group.append(hinge_rect) + + if self.options.generate_living_hinge: + hinge_width = hinge_end - hinge_start + hinge_length_param = rect_height * (self.options.hinge_length_percent / 100.0) + hinge_gap = self.svg.unittouu(f"{self.options.hinge_gap}{self.options.units}") + hinge_spacing = self.svg.unittouu(f"{self.options.hinge_spacing}{self.options.units}") + + hinge_cuts = create_living_hinge_pattern( + self.svg, + hinge_length_param, + hinge_gap, + hinge_spacing, + hinge_width, + rect_height, + offset_x + hinge_start, + offset_y, + self.CUT_INNER_STYLE, + tab_positions=None, + segment_start=0 + ) + + for hinge_cut in hinge_cuts: + side_group.append(hinge_cut) + + side_bbox = side_group.bounding_box() + side_label = self.create_label("side", side_bbox, "side_label") + side_group.append(side_label) + + self.side_group = side_group + + def create_lid_top_piece(self, offset_x, offset_y): + lid_top_group = Group(id=self.svg.get_unique_id("lid_top")) + self.svg.get_current_layer().add(lid_top_group) + + lid_top_path = PathElement() + lid_top_path.set_id(self.svg.get_unique_id("lid_top_path")) + lid_top_path.set('d', str(self.original_path)) + lid_top_path.style = self.CUT_OUTER_STYLE + lid_top_group.append(lid_top_path) + + lid_top_inset = self.inset_path.copy() + lid_top_inset.set_id(self.svg.get_unique_id("lid_top_inset")) + lid_top_group.append(lid_top_inset) + + for i, magnet in enumerate(self.magnets): + lid_top_magnet = magnet.copy() + lid_top_magnet.set_id(self.svg.get_unique_id(f"lid_top_magnet_{i}")) + lid_top_magnet.style = self.META_STYLE + lid_top_group.append(lid_top_magnet) + + lid_top_bbox_local = lid_top_group.bounding_box() + lid_top_label = self.create_label("lid top", lid_top_bbox_local, "lid_top_label") + lid_top_group.append(lid_top_label) + + lid_top_group.transform = inkex.Transform(translate=(offset_x, offset_y)) + + return lid_top_group.bounding_box() + + def create_lid_middle_piece(self, offset_x, offset_y): + lid_middle_group = Group(id=self.svg.get_unique_id("lid_middle")) + self.svg.get_current_layer().add(lid_middle_group) + + lid_middle_path = PathElement() + lid_middle_path.set_id(self.svg.get_unique_id("lid_middle_path")) + lid_middle_path.set('d', str(self.original_path)) + lid_middle_path.style = self.CUT_OUTER_STYLE + lid_middle_group.append(lid_middle_path) + + lid_middle_inset = self.inset_path.copy() + lid_middle_inset.set_id(self.svg.get_unique_id("lid_middle_inset")) + lid_middle_group.append(lid_middle_inset) + + for i, magnet in enumerate(self.magnets): + lid_middle_magnet = magnet.copy() + lid_middle_magnet.set_id(self.svg.get_unique_id(f"lid_middle_magnet_{i}")) + lid_middle_magnet.style = self.CUT_OUTER_STYLE if self.options.hide_magnets else self.META_STYLE + lid_middle_group.append(lid_middle_magnet) + + lid_middle_bbox_local = lid_middle_group.bounding_box() + lid_middle_label = self.create_label("lid middle", lid_middle_bbox_local, "lid_middle_label") + lid_middle_group.append(lid_middle_label) + + lid_middle_group.transform = inkex.Transform(translate=(offset_x, offset_y)) + + return lid_middle_group.bounding_box() + + def create_lid_bottom_piece(self, offset_x, offset_y): + lid_bottom_group = Group(id=self.svg.get_unique_id("lid_bottom")) + self.svg.get_current_layer().add(lid_bottom_group) + + lid_bottom_path = PathElement() + lid_bottom_path.set_id(self.svg.get_unique_id("lid_bottom_path")) + lid_bottom_path.set('d', str(self.original_path)) + lid_bottom_path.style = self.CUT_OUTER_STYLE + lid_bottom_group.append(lid_bottom_path) + + lid_bottom_inset = self.inset_path.copy() + lid_bottom_inset.set_id(self.svg.get_unique_id("lid_bottom_inset")) + lid_bottom_group.append(lid_bottom_inset) + + for i, magnet in enumerate(self.magnets): + lid_bottom_magnet = magnet.copy() + lid_bottom_magnet.set_id(self.svg.get_unique_id(f"lid_bottom_magnet_{i}")) + lid_bottom_magnet.style = self.CUT_OUTER_STYLE if not self.options.hide_magnets else self.META_STYLE + lid_bottom_group.append(lid_bottom_magnet) + + lid_bottom_bbox_local = lid_bottom_group.bounding_box() + lid_bottom_label = self.create_label("lid bottom", lid_bottom_bbox_local, "lid_bottom_label") + lid_bottom_group.append(lid_bottom_label) + + lid_bottom_group.transform = inkex.Transform(translate=(offset_x, offset_y)) + + return lid_bottom_group.bounding_box() + + def create_lid_fitting_piece(self, offset_x, offset_y): + lid_fitting_group = Group(id=self.svg.get_unique_id("lid_fitting")) + self.svg.get_current_layer().add(lid_fitting_group) + + top_hole_inset = self.svg.unittouu(f"{self.options.top_hole_inset}{self.options.units}") + extra_inset = self.svg.unittouu("1mm") + lid_offset_dist = -(top_hole_inset + extra_inset) + + try: + from offset import offset_path + lid_fitting_path_d = offset_path(self.original_path, lid_offset_dist) + lid_fitting_path = PathElement() + lid_fitting_path.set_id(self.svg.get_unique_id("lid_fitting_path")) + lid_fitting_path.set('d', lid_fitting_path_d) + lid_fitting_path.style = self.CUT_OUTER_STYLE + lid_fitting_group.append(lid_fitting_path) + + lid_fitting_bbox_local = lid_fitting_group.bounding_box() + lid_fitting_label = self.create_label("lid fitting", lid_fitting_bbox_local, "lid_fitting_label") + lid_fitting_group.append(lid_fitting_label) + + lid_fitting_group.transform = inkex.Transform(translate=(offset_x, offset_y)) + + return lid_fitting_group.bounding_box() + except ValueError: + return None + + def effect(self): + if not self.svg.selection: + raise inkex.AbortExtension("Select a single path.") + + selected_element = list(self.svg.selection.values())[0] + node = selected_element + + if not isinstance(node, PathElement): + if hasattr(node, 'path') and node.path is not None: + path_element = PathElement() + path_element.path = node.path + path_element.style = node.style + path_element.transform = node.transform + node = path_element + else: + try: + node = node.to_path_element() + except Exception: + raise inkex.AbortExtension("Selection must be a path or convertible to a path.") + + current_layer = self.svg.get_current_layer() + layer_transform = current_layer.composed_transform() + layer_transform_inv = -layer_transform + + doc_path = node.path.to_absolute().transform(selected_element.composed_transform()) + self.original_path = doc_path.transform(layer_transform_inv) + self.original_path_bbox = self.original_path.bounding_box() + + selected_element.style = self.CUT_OUTER_STYLE + + tab_height = self.svg.unittouu(f"{self.options.material_thickness}{self.options.units}") + + try: + offset_dist = -self.svg.unittouu(f"{self.options.tab_inset}{self.options.units}") + inset_path_d = offset_path(self.original_path, offset_dist) + except ValueError as e: + raise inkex.AbortExtension(str(e)) + + self.create_bottom_tabs_piece(inset_path_d) + offset_x = self.original_path_bbox.width + self.svg.unittouu("2mm") + self.create_bottom_piece(offset_x) + self.create_top_tabs_piece(2 * offset_x) + self.create_top_piece(3 * offset_x) + + offset_x = self.original_path_bbox.left + offset_y = self.original_path_bbox.bottom + self.svg.unittouu("2mm") + tab_height + self.create_side_piece(offset_x, offset_y, inset_path_d) + + if self.options.generate_lid: + side_bbox_with_tabs = self.side_group.bounding_box() + lid_target_x = self.original_path_bbox.left + lid_target_y = side_bbox_with_tabs.bottom + self.svg.unittouu("2mm") + + translate_x = lid_target_x - self.original_path_bbox.left + translate_y = lid_target_y - self.original_path_bbox.top + + lid_top_bbox = self.create_lid_top_piece(translate_x, translate_y) + + lid_middle_offset_x = lid_top_bbox.right + self.svg.unittouu("2mm") - self.original_path_bbox.left + lid_middle_bbox = self.create_lid_middle_piece(lid_middle_offset_x, translate_y) + + lid_bottom_offset_x = lid_middle_bbox.right + self.svg.unittouu("2mm") - self.original_path_bbox.left + lid_bottom_bbox = self.create_lid_bottom_piece(lid_bottom_offset_x, translate_y) + + lid_fitting_offset_x = lid_bottom_bbox.right + self.svg.unittouu("2mm") - self.original_path_bbox.left + self.create_lid_fitting_piece(lid_fitting_offset_x, translate_y) + + +if __name__ == "__main__": + Boxbot().run() diff --git a/extensions/botbox3000/deps/inkex/__init__.py b/extensions/botbox3000/deps/inkex/__init__.py new file mode 100644 index 0000000..6fe3931 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/__init__.py @@ -0,0 +1,33 @@ +# coding=utf-8 +""" +This describes the core API for the inkex core modules. + +This provides the basis from which you can develop your inkscape extension. +""" + +# pylint: disable=wildcard-import +import sys + +from .extensions import * +from .utils import AbortExtension, DependencyError, Boolean, errormsg +from .styles import * +from .paths import Path, CubicSuperPath # Path commands are not exported +from .colors import Color, ColorError, ColorIdError, is_color +from .colors.spaces import * +from .transforms import * +from .elements import * + +# legacy proxies +from .deprecated import Effect +from .deprecated import localize +from .deprecated import debug + +# legacy functions +from .deprecated import are_near_relative +from .deprecated import unittouu + +MIN_VERSION = (3, 7) +if sys.version_info < MIN_VERSION: + sys.exit("Inkscape extensions require Python 3.7 or greater.") + +__version__ = "1.4.0" # Version number for inkex; may differ from Inkscape version. diff --git a/extensions/botbox3000/deps/inkex/base.py b/extensions/botbox3000/deps/inkex/base.py new file mode 100644 index 0000000..42a3e8d --- /dev/null +++ b/extensions/botbox3000/deps/inkex/base.py @@ -0,0 +1,567 @@ +# coding=utf-8 +# +# Copyright (c) 2018 - Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +The ultimate base functionality for every Inkscape extension. +""" + +import io +import os +import re +import sys +import copy + +from typing import ( + Dict, + List, + Tuple, + Type, + Optional, + Callable, + Any, + Union, + IO, + TYPE_CHECKING, + cast, +) + +from argparse import ArgumentParser, Namespace +from lxml import etree + +from .utils import filename_arg, AbortExtension, ABORT_STATUS, errormsg, do_nothing +from .elements._parser import load_svg +from .elements._utils import NSS +from .localization import localize + +if TYPE_CHECKING: + from .elements._svg import SvgDocumentElement + from .elements._base import BaseElement + + +class InkscapeExtension: + """ + The base class extension, provides argument parsing and basic + variable handling features. + """ + + multi_inx = False # Set to true if this class is used by multiple inx files. + extra_nss = {} # type: Dict[str, str] + + # Provide a unique value to allow detection of no argument specified + # for `output` parameter of `run()`, not even `None`; this has to be an io + # type for type checking purposes: + output_unspecified = io.StringIO("") + + def __init__(self): + # type: () -> None + NSS.update(self.extra_nss) + self.file_io = None # type: Optional[IO] + self.options = Namespace() + self.document = None # type: Union[None, bytes, str, etree.element] + self.arg_parser = ArgumentParser(description=self.__doc__) + + self.arg_parser.add_argument( + "input_file", + nargs="?", + metavar="INPUT_FILE", + type=filename_arg, + help="Filename of the input file (default is stdin)", + default=None, + ) + + self.arg_parser.add_argument( + "--output", + type=str, + default=None, + help="Optional output filename for saving the result (default is stdout).", + ) + + self.add_arguments(self.arg_parser) + + localize() + + def add_arguments(self, pars): + # type: (ArgumentParser) -> None + """Add any extra arguments to your extension handle, use: + + def add_arguments(self, pars): + pars.add_argument("--num-cool-things", type=int, default=3) + pars.add_argument("--pos-in-doc", type=str, default="doobry") + """ + # No extra arguments by default so super is not required + + def parse_arguments(self, args): + # type: (List[str]) -> None + """Parse the given arguments and set 'self.options'""" + self.options = self.arg_parser.parse_args(args) + + def arg_method(self, prefix="method"): + # type: (str) -> Callable[[str], Callable[[Any], Any]] + """Used by add_argument to match a tab selection with an object method + + pars.add_argument("--tab", type=self.arg_method(), default="foo") + ... + self.options.tab(arguments) + ... + .. code-block:: python + .. def method_foo(self, arguments): + .. # do something + """ + + def _inner(value): + name = f"""{prefix}_{value.strip('"').lower()}""".replace("-", "_") + try: + return getattr(self, name) + except AttributeError as error: + if name.startswith("_"): + return do_nothing + raise AbortExtension(f"Can not find method {name}") from error + + return _inner + + @staticmethod + def arg_number_ranges(): + """Parses a number descriptor. e.g: + ``1,2,4-5,7,9-`` is parsed to ``1, 2, 4, 5, 7, 9, 10, ..., lastvalue`` + + .. versionadded:: 1.2 + + Usage: + + .. code-block:: python + + # in add_arguments() + pars.add_argument("--pages", type=self.arg_number_ranges(), default=1-) + # later on, pages is then a list of ints + pages = self.options.pages(lastvalue) + + """ + + def _inner(value): + def method(pages, lastvalue, startvalue=1): + # replace ranges, such as -3, 10- with startvalue,2,3,10..lastvalue + pages = re.sub( + r"(\d+|)\s?-\s?(\d+|)", + lambda m: ( + ",".join( + map( + str, + range( + int(m.group(1) or startvalue), + int(m.group(2) or lastvalue) + 1, + ), + ) + ) + if not (m.group(1) or m.group(2)) == "" + else "" + ), + pages, + ) + + pages = map(int, re.findall(r"(\d+)", pages)) + pages = tuple({i for i in pages if i <= lastvalue}) + return pages + + return lambda lastvalue, startvalue=1: method( + value, lastvalue, startvalue=startvalue + ) + + return _inner + + @staticmethod + def arg_class(options: List[Type]) -> Callable[[str], Any]: + """Used by add_argument to match an option with a class + + Types to choose from are given by the options list + + .. versionadded:: 1.2 + + Usage: + + .. code-block:: python + + pars.add_argument("--class", type=self.arg_class([ClassA, ClassB]), + default="ClassA") + """ + + def _inner(value: str): + name = value.strip('"') + for i in options: + if name == i.__name__: + return i + raise AbortExtension(f"Can not find class {name}") + + return _inner + + def debug(self, msg): + # type: (str) -> None + """Write a debug message""" + errormsg(f"DEBUG<{type(self).__name__}> {msg}\n") + + @staticmethod + def msg(msg): + # type: (str) -> None + """Write a non-error message""" + errormsg(msg) + + def run(self, args=None, output=output_unspecified): + # type: (Optional[List[str]], Union[str, IO]) -> None + """Main entrypoint for any Inkscape Extension""" + try: + if args is None: + args = sys.argv[1:] + + self.parse_arguments(args) + if self.options.input_file is None: + self.options.input_file = sys.stdin + elif "DOCUMENT_PATH" not in os.environ: + os.environ["DOCUMENT_PATH"] = self.options.input_file + + self.bin_stdout = None + if self.options.output is None: + # If no output was specified, attempt to extract a binary + # output from stdout, and if that doesn't seem possible, + # punt and try whatever stream stdout is: + if output is InkscapeExtension.output_unspecified: + output = sys.stdout + if "b" not in getattr(output, "mode", "") and not isinstance( + output, (io.RawIOBase, io.BufferedIOBase) + ): + if hasattr(output, "buffer"): + output = output.buffer # type: ignore + elif hasattr(output, "fileno"): + self.bin_stdout = os.fdopen( + output.fileno(), "wb", closefd=False + ) + output = self.bin_stdout + self.options.output = output + + self.load_raw() + self.save_raw(self.effect()) + except AbortExtension as err: + errormsg(str(err)) + sys.exit(ABORT_STATUS) + finally: + self.clean_up() + + def load_raw(self): + # type: () -> None + """Load the input stream or filename, save everything to self""" + if isinstance(self.options.input_file, str): + # pylint: disable=consider-using-with + self.file_io = open(self.options.input_file, "rb") + document = self.load(self.file_io) + else: + document = self.load(self.options.input_file) + self.document = document + + def save_raw(self, ret): + # type: (Any) -> None + """Save to the output stream, use everything from self""" + if self.has_changed(ret): + if isinstance(self.options.output, str): + with open(self.options.output, "wb") as stream: + self.save(stream) + else: + if sys.platform == "win32" and not "PYTEST_CURRENT_TEST" in os.environ: + # When calling an extension from within Inkscape on Windows, + # Python thinks that the output stream is seekable + # (https://gitlab.com/inkscape/inkscape/-/issues/3273) + self.options.output.seekable = lambda self: False + + def seek_replacement(offset: int, whence: int = 0): + raise AttributeError( + "We can't seek in the stream passed by Inkscape on Windows" + ) + + def tell_replacement(): + raise AttributeError( + "We can't tell in the stream passed by Inkscape on Windows" + ) + + # Some libraries (e.g. ZipFile) don't query seekable, but check for an error + # on seek + self.options.output.seek = seek_replacement + self.options.output.tell = tell_replacement + self.save(self.options.output) + + def load(self, stream): + # type: (IO) -> str + """Takes the input stream and creates a document for parsing""" + raise NotImplementedError(f"No input handle for {self.name}") + + def save(self, stream): + # type: (IO) -> None + """Save the given document to the output file""" + raise NotImplementedError(f"No output handle for {self.name}") + + def effect(self): + # type: () -> Any + """Apply some effects on the document or local context""" + raise NotImplementedError(f"No effect handle for {self.name}") + + def has_changed(self, ret): # pylint: disable=no-self-use + # type: (Any) -> bool + """Return true if the output should be saved""" + return ret is not False + + def clean_up(self): + # type: () -> None + """Clean up any open handles and other items""" + if hasattr(self, "bin_stdout"): + if self.bin_stdout is not None: + self.bin_stdout.close() + if self.file_io is not None: + self.file_io.close() + + @classmethod + def svg_path(cls, default=None): + # type: (Optional[str]) -> Optional[str] + """ + Return the folder the svg is contained in. + Returns None if there is no file. + + .. versionchanged:: 1.1 + A default path can be given which is returned in case no path to the + SVG file can be determined. + """ + path = cls.document_path() + if path: + return os.path.dirname(path) + if default: + return default + return path # Return None or '' for context + + @classmethod + def ext_path(cls): + # type: () -> str + """Return the folder the extension script is in""" + return os.path.dirname(sys.modules[cls.__module__].__file__ or "") + + @classmethod + def get_resource(cls, name, abort_on_fail=True): + # type: (str, bool) -> str + """Return the full filename of the resource in the extension's dir + + .. versionadded:: 1.1""" + filename = cls.absolute_href(name, cwd=cls.ext_path()) + if abort_on_fail and not os.path.isfile(filename): + raise AbortExtension(f"Could not find resource file: {filename}") + return filename + + @classmethod + def document_path(cls): + # type: () -> Optional[str] + """Returns the saved location of the document + + * Normal return is a string containing the saved location + * Empty string means the document was never saved + * 'None' means this version of Inkscape doesn't support DOCUMENT_PATH + + DO NOT READ OR WRITE TO THE DOCUMENT FILENAME! + + * Inkscape may have not written the latest changes, leaving you reading old + data. + * Inkscape will not respect anything you write to the file, causing data loss. + + .. versionadded:: 1.1 + """ + return os.environ.get("DOCUMENT_PATH", None) + + @classmethod + def absolute_href(cls, filename, default="~/", cwd=None): + # type: (str, str, Optional[str]) -> str + """ + Process the filename such that it's turned into an absolute filename + with the working directory being the directory of the loaded svg. + + User's home folder is also resolved. So '~/a.png` will be `/home/bob/a.png` + + Default is a fallback working directory to use if the svg's filename is not + available. + + .. versionchanged:: 1.1 + If you set default to None, then the user will be given errors if + there's no working directory available from Inkscape. + """ + filename = os.path.expanduser(filename) + if not os.path.isabs(filename): + filename = os.path.expanduser(filename) + if not os.path.isabs(filename): + if cwd is None: + cwd = cls.svg_path(default) + if cwd is None: + raise AbortExtension( + "Can not use relative path, Inkscape isn't telling us the " + "current working directory." + ) + if cwd == "": + raise AbortExtension( + "The SVG must be saved before you can use relative paths." + ) + filename = os.path.join(cwd, filename) + return os.path.realpath(os.path.expanduser(filename)) + + @property + def name(self): + # type: () -> str + """Return a fixed name for this extension""" + return type(self).__name__ + + +if TYPE_CHECKING: + _Base = InkscapeExtension +else: + _Base = object + + +class TempDirMixin(_Base): # pylint: disable=abstract-method + """ + Provide a temporary directory for extensions to stash files. + """ + + dir_suffix = "" + dir_prefix = "inktmp" + + def __init__(self, *args, **kwargs): + self.tempdir = None + self._tempdir = None + super().__init__(*args, **kwargs) + + def load_raw(self): + # type: () -> None + """Create the temporary directory""" + # pylint: disable=import-outside-toplevel + from tempfile import TemporaryDirectory + + # Need to hold a reference to the Directory object or else it might get GC'd + self._tempdir = TemporaryDirectory( # pylint: disable=consider-using-with + prefix=self.dir_prefix, suffix=self.dir_suffix + ) + self.tempdir = os.path.realpath(self._tempdir.name) + super().load_raw() + + def clean_up(self): + # type: () -> None + """Delete the temporary directory""" + self.tempdir = None + # if the file does not exist, _tempdir is never set. + if self._tempdir is not None: + self._tempdir.cleanup() + super().clean_up() + + +class SvgInputMixin(_Base): # pylint: disable=too-few-public-methods, abstract-method + """ + Expects the file input to be an svg document and will parse it. + """ + + # Select all objects if none are selected + select_all: Tuple[Type["BaseElement"], ...] = () + + def __init__(self): + super().__init__() + + self.arg_parser.add_argument( + "--id", + action="append", + type=str, + dest="ids", + default=[], + help="id attribute of object to manipulate", + ) + + self.arg_parser.add_argument( + "--selected-nodes", + action="append", + type=str, + dest="selected_nodes", + default=[], + help="id:subpath:position of selected nodes, if any", + ) + + def load(self, stream): + # type: (IO) -> etree + """Load the stream as an svg xml etree and make a backup""" + document = load_svg(stream) + self.original_document = copy.deepcopy(document) + self.svg: SvgDocumentElement = document.getroot() + self.svg.selection.set(*self.options.ids) + if not self.svg.selection and self.select_all: + self.svg.selection = self.svg.descendants().filter(*self.select_all) + return document + + +class SvgOutputMixin(_Base): # pylint: disable=too-few-public-methods, abstract-method + """ + Expects the output document to be an svg document and will write an etree xml. + + A template can be specified to kick off the svg document building process. + """ + + template = """ + """ + + @classmethod + def get_template(cls, **kwargs): + """ + Opens a template svg document for building, the kwargs + MUST include all the replacement values in the template, the + default template has 'width' and 'height' of the document. + """ + kwargs.setdefault("unit", "") + return load_svg(str(cls.template.format(**kwargs))) + + def save(self, stream): + # type: (IO) -> None + """Save the svg document to the given stream""" + if isinstance(self.document, (bytes, str)): + document = self.document + elif "Element" in type(self.document).__name__: + # isinstance can't be used here because etree is broken + doc = cast(etree, self.document) + document = doc.getroot().tostring() + else: + raise ValueError( + f"Unknown type of document: {type(self.document).__name__} can not" + + "save." + ) + + try: + stream.write(document) + except TypeError: + # we hope that this happens only when document needs to be encoded + stream.write(document.encode("utf-8")) # type: ignore + + +class SvgThroughMixin(SvgInputMixin, SvgOutputMixin): # pylint: disable=abstract-method + """ + Combine the input and output svg document handling (usually for effects). + """ + + def has_changed(self, ret): # pylint: disable=unused-argument + # type: (Any) -> bool + """Return true if the svg document has changed""" + original = etree.tostring(self.original_document) + result = etree.tostring(self.document) + return original != result diff --git a/extensions/botbox3000/deps/inkex/bezier.py b/extensions/botbox3000/deps/inkex/bezier.py new file mode 100644 index 0000000..bd9e66b --- /dev/null +++ b/extensions/botbox3000/deps/inkex/bezier.py @@ -0,0 +1,582 @@ +# coding=utf-8 +# +# Copyright (C) 2010 Nick Drobchenko, nick@cnc-club.ru +# Copyright (C) 2005 Aaron Spike, aaron@ekips.org +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=invalid-name,too-many-locals +# +""" +Bezier calculations +""" + +import cmath +import math + +import numpy + +from .transforms import DirectedLineSegment +from .localization import inkex_gettext as _ + +# bez = ((bx0,by0),(bx1,by1),(bx2,by2),(bx3,by3)) + + +def pointdistance(point_a, point_b): + """The straight line distance between two points""" + return math.sqrt( + ((point_b[0] - point_a[0]) ** 2) + ((point_b[1] - point_a[1]) ** 2) + ) + + +def between_point(point_a, point_b, time=0.5): + """Returns the point between point a and point b""" + return point_a[0] + time * (point_b[0] - point_a[0]), point_a[1] + time * ( + point_b[1] - point_a[1] + ) + + +def percent_point(point_a, point_b, percent=50.0): + """Returns between_point but takes percent instead of 0.0-1.0""" + return between_point(point_a, point_b, percent / 100.0) + + +def root_wrapper(root_a, root_b, root_c, root_d): + """Get the Cubic function, moic formular of roots, simple root""" + if root_a: + # Monics formula, see + # http://en.wikipedia.org/wiki/Cubic_function#Monic_formula_of_roots + mono_a, mono_b, mono_c = (root_b / root_a, root_c / root_a, root_d / root_a) + m = 2.0 * mono_a**3 - 9.0 * mono_a * mono_b + 27.0 * mono_c + k = mono_a**2 - 3.0 * mono_b + n = m**2 - 4.0 * k**3 + w1 = -0.5 + 0.5 * cmath.sqrt(-3.0) + w2 = -0.5 - 0.5 * cmath.sqrt(-3.0) + if n < 0: + m1 = pow(complex((m + cmath.sqrt(n)) / 2), 1.0 / 3) + n1 = pow(complex((m - cmath.sqrt(n)) / 2), 1.0 / 3) + else: + if m + math.sqrt(n) < 0: + m1 = -pow(-(m + math.sqrt(n)) / 2, 1.0 / 3) + else: + m1 = pow((m + math.sqrt(n)) / 2, 1.0 / 3) + if m - math.sqrt(n) < 0: + n1 = -pow(-(m - math.sqrt(n)) / 2, 1.0 / 3) + else: + n1 = pow((m - math.sqrt(n)) / 2, 1.0 / 3) + return ( + -1.0 / 3 * (mono_a + m1 + n1), + -1.0 / 3 * (mono_a + w1 * m1 + w2 * n1), + -1.0 / 3 * (mono_a + w2 * m1 + w1 * n1), + ) + if root_b: + det = root_c**2.0 - 4.0 * root_b * root_d + if det: + return ( + (-root_c + cmath.sqrt(det)) / (2.0 * root_b), + (-root_c - cmath.sqrt(det)) / (2.0 * root_b), + ) + return (-root_c / (2.0 * root_b),) + if root_c: + return (1.0 * (-root_d / root_c),) + return () + + +def bezlenapprx(sp1, sp2): + """Return the aproximate length between two beziers""" + return ( + pointdistance(sp1[1], sp1[2]) + + pointdistance(sp1[2], sp2[0]) + + pointdistance(sp2[0], sp2[1]) + ) + + +def cspbezsplit(sp1, sp2, time=0.5): + """Split a cubic bezier at the time period""" + m1 = tpoint(sp1[1], sp1[2], time) + m2 = tpoint(sp1[2], sp2[0], time) + m3 = tpoint(sp2[0], sp2[1], time) + m4 = tpoint(m1, m2, time) + m5 = tpoint(m2, m3, time) + m = tpoint(m4, m5, time) + return [[sp1[0][:], sp1[1][:], m1], [m4, m, m5], [m3, sp2[1][:], sp2[2][:]]] + + +def cspbezsplitatlength(sp1, sp2, length=0.5, tolerance=0.001): + """Split a cubic bezier at length""" + bez = (sp1[1][:], sp1[2][:], sp2[0][:], sp2[1][:]) + time = beziertatlength(bez, length, tolerance) + return cspbezsplit(sp1, sp2, time) + + +def cspseglength(sp1, sp2, tolerance=0.001): + """Get cubic bezier segment length""" + bez = (sp1[1][:], sp1[2][:], sp2[0][:], sp2[1][:]) + return bezierlength(bez, tolerance) + + +def csplength(csp): + """Get cubic bezier length""" + total = 0 + lengths = [] + for sp in csp: + lengths.append([]) + for i in range(1, len(sp)): + l = cspseglength(sp[i - 1], sp[i]) + lengths[-1].append(l) + total += l + return lengths, total + + +def bezierparameterize(bez): + """Return the bezier parameter size + Converts the bezier parametrisation from the default form + P(t) = (1-t)³ P_1 + 3(1-t)²t P_2 + 3(1-t)t² P_3 + t³ x_4 + to the a form which can be differentiated more easily + P(t) = a t³ + b t² + c t + P0 + + Args: + bez (List[Tuple[float, float]]): the Bezier curve. The elements of the list the + coordinates of the points (in this order): Start point, Start control point, + End control point, End point. + + Returns: + Tuple[float, float, float, float, float, float, float, float]: + the values ax, ay, bx, by, cx, cy, x0, y0 + """ + ((bx0, by0), (bx1, by1), (bx2, by2), (bx3, by3)) = bez + # parametric bezier + x0 = bx0 + y0 = by0 + cx = 3 * (bx1 - x0) + bx = 3 * (bx2 - bx1) - cx + ax = bx3 - x0 - cx - bx + cy = 3 * (by1 - y0) + by = 3 * (by2 - by1) - cy + ay = by3 - y0 - cy - by + + return ax, ay, bx, by, cx, cy, x0, y0 + + +def linebezierintersect(arg_a, bez): + """Where a line and bezier intersect""" + ((lx1, ly1), (lx2, ly2)) = arg_a + # parametric line + dd = lx1 + cc = lx2 - lx1 + bb = ly1 + aa = ly2 - ly1 + + if aa: + coef1 = cc / aa + coef2 = 1 + else: + coef1 = 1 + coef2 = aa / cc + + ax, ay, bx, by, cx, cy, x0, y0 = bezierparameterize(bez) + # cubic intersection coefficients + a = coef1 * ay - coef2 * ax + b = coef1 * by - coef2 * bx + c = coef1 * cy - coef2 * cx + d = coef1 * (y0 - bb) - coef2 * (x0 - dd) + + roots = root_wrapper(a, b, c, d) + retval = [] + for i in roots: + if isinstance(i, complex) and i.imag == 0: + i = i.real + if not isinstance(i, complex) and 0 <= i <= 1: + retval.append(bezierpointatt(bez, i)) + return retval + + +def bezierpointatt(bez, t): + """Get coords at the given time point along a bezier curve""" + ax, ay, bx, by, cx, cy, x0, y0 = bezierparameterize(bez) + x = ax * (t**3) + bx * (t**2) + cx * t + x0 + y = ay * (t**3) + by * (t**2) + cy * t + y0 + return x, y + + +def bezierslopeatt(bez, t): + """Get slope at the given time point along a bezier curve + The slope is computed as (dx, dy) where dx = df_x(t)/dt and dy = df_y(t)/dt. + Note that for lines P1=P2 and P3=P4, so the slope at the end points is dx=dy=0 + (slope not defined). + + Args: + bez (List[Tuple[float, float]]): the Bezier curve. The elements of the list the + coordinates of the points (in this order): Start point, Start control point, + End control point, End point. + t (float): time in the interval [0, 1] + + Returns: + Tuple[float, float]: x and y increment + """ + ax, ay, bx, by, cx, cy, _, _ = bezierparameterize(bez) + dx = 3 * ax * (t**2) + 2 * bx * t + cx + dy = 3 * ay * (t**2) + 2 * by * t + cy + return dx, dy + + +def beziertatslope(bez, d): + """Reverse; get time from slope along a bezier curve""" + ax, ay, bx, by, cx, cy, _, _ = bezierparameterize(bez) + (dy, dx) = d + # quadratic coefficients of slope formula + if dx: + slope = 1.0 * (dy / dx) + a = 3 * ay - 3 * ax * slope + b = 2 * by - 2 * bx * slope + c = cy - cx * slope + elif dy: + slope = 1.0 * (dx / dy) + a = 3 * ax - 3 * ay * slope + b = 2 * bx - 2 * by * slope + c = cx - cy * slope + else: + return [] + + roots = root_wrapper(0, a, b, c) + retval = [] + for i in roots: + if isinstance(i, complex) and i.imag == 0: + i = i.real + if not isinstance(i, complex) and 0 <= i <= 1: + retval.append(i) + return retval + + +def tpoint(p1, p2, t): + """Linearly interpolate between p1 and p2. + + t = 0.0 returns p1, t = 1.0 returns p2. + + :return: Interpolated point + :rtype: tuple + + :param p1: First point as sequence of two floats + :param p2: Second point as sequence of two floats + :param t: Number between 0.0 and 1.0 + :type t: float + """ + x1, y1 = p1 + x2, y2 = p2 + return x1 + t * (x2 - x1), y1 + t * (y2 - y1) + + +def beziersplitatt(bez, t): + """Split bezier at given time""" + ((bx0, by0), (bx1, by1), (bx2, by2), (bx3, by3)) = bez + m1 = tpoint((bx0, by0), (bx1, by1), t) + m2 = tpoint((bx1, by1), (bx2, by2), t) + m3 = tpoint((bx2, by2), (bx3, by3), t) + m4 = tpoint(m1, m2, t) + m5 = tpoint(m2, m3, t) + m = tpoint(m4, m5, t) + + return ((bx0, by0), m1, m4, m), (m, m5, m3, (bx3, by3)) + + +def addifclose(bez, l, error=0.001): + """Gravesen, Add if the line is closed, in-place addition to array l""" + box = 0 + for i in range(1, 4): + box += pointdistance(bez[i - 1], bez[i]) + chord = pointdistance(bez[0], bez[3]) + if (box - chord) > error: + first, second = beziersplitatt(bez, 0.5) + addifclose(first, l, error) + addifclose(second, l, error) + else: + l[0] += (box / 2.0) + (chord / 2.0) + + +# balfax, balfbx, balfcx, balfay, balfby, balfcy = 0, 0, 0, 0, 0, 0 + + +def balf(t, args): + """Bezier Arc Length Function""" + ax, bx, cx, ay, by, cy = args + retval = (ax * (t**2) + bx * t + cx) ** 2 + (ay * (t**2) + by * t + cy) ** 2 + return math.sqrt(retval) + + +def simpson(start, end, maxiter, tolerance, bezier_args): + """Calculate the length of a bezier curve using Simpson's algorithm: + http://steve.hollasch.net/cgindex/curves/cbezarclen.html + + Args: + start (int): Start time (between 0 and 1) + end (int): End time (between start time and 1) + maxiter (int): Maximum number of iterations. If not a power of 2, the algorithm + will behave like the value is set to the next power of 2. + tolerance (float): maximum error ratio + bezier_args (list): arguments as computed by bezierparametrize() + + Returns: + float: the appoximate length of the bezier curve + """ + + n = 2 + multiplier = (end - start) / 6.0 + endsum = balf(start, bezier_args) + balf(end, bezier_args) + interval = (end - start) / 2.0 + asum = 0.0 + bsum = balf(start + interval, bezier_args) + est1 = multiplier * (endsum + (2.0 * asum) + (4.0 * bsum)) + est0 = 2.0 * est1 + # print(multiplier, endsum, interval, asum, bsum, est1, est0) + while n < maxiter and abs(est1 - est0) > tolerance: + n *= 2 + multiplier /= 2.0 + interval /= 2.0 + asum += bsum + bsum = 0.0 + est0 = est1 + for i in range(1, n, 2): + bsum += balf(start + (i * interval), bezier_args) + est1 = multiplier * (endsum + (2.0 * asum) + (4.0 * bsum)) + # print(multiplier, endsum, interval, asum, bsum, est1, est0) + return est1 + + +def bezierlength(bez, tolerance=0.001, time=1.0): + """Get length of bezier curve""" + ax, ay, bx, by, cx, cy, _, _ = bezierparameterize(bez) + return simpson(0.0, time, 4096, tolerance, [3 * ax, 2 * bx, cx, 3 * ay, 2 * by, cy]) + + +def beziertatlength(bez, l=0.5, tolerance=0.001): + """Get bezier curve time at the length specified""" + curlen = bezierlength(bez, tolerance, 1.0) + time = 1.0 + tdiv = time + targetlen = l * curlen + diff = curlen - targetlen + while abs(diff) > tolerance: + tdiv /= 2.0 + if diff < 0: + time += tdiv + else: + time -= tdiv + curlen = bezierlength(bez, tolerance, time) + diff = curlen - targetlen + return time + + +def maxdist(bez): + """Get maximum distance within bezier curve""" + seg = DirectedLineSegment(bez[0], bez[3]) + return max(seg.distance_to_point(*bez[1]), seg.distance_to_point(*bez[2])) + + +def cspsubdiv(csp, flat): + """Sub-divide cubic sub-paths""" + for sp in csp: + subdiv(sp, flat) + + +def subdiv(sp, flat, i=1): + """sub divide bezier curve""" + while i < len(sp): + p0 = sp[i - 1][1] + p1 = sp[i - 1][2] + p2 = sp[i][0] + p3 = sp[i][1] + + bez = (p0, p1, p2, p3) + mdist = maxdist(bez) + if mdist <= flat: + i += 1 + else: + one, two = beziersplitatt(bez, 0.5) + sp[i - 1][2] = one[1] + sp[i][0] = two[2] + p = [one[2], one[3], two[1]] + sp[i:1] = [p] + + +def csparea(csp): + r"""Get total area of cubic superpath. + + .. hint:: + + The results may be slightly inaccurate for paths containing arcs due + to the loss of accuracy during arc -> cubic bezier conversion. + + + The function works as follows: For each subpath, + + #. compute the area of the polygon created by the path's vertices: + + For a line with coordinates :math:`(x_0, y_0)` and :math:`(x_1, y_1)`, the area + of the trapezoid of its projection on the x axis is given by + + .. math:: + + \frac{1}{2} (y_1 + y_0) (x_1 - x_0) + + Summing the contribution of all lines of the polygon yields the polygon's area + (lines from left to right have a positive contribution, while those right-to + left have a negative area contribution, canceling out the computed area not + inside the polygon), so we find (setting :math:`x_{0} = x_N` etc.): + + .. math:: + + A = \frac{1}{2} * \sum_{i=1}^N (x_i y_i - x_{i-1} y_{i-1} + x_i y_{i-1} + - x_{i-1} y_{i}) + + The first two terms cancel out in the summation over all points, and the second + two terms can be regrouped as + + .. math:: + + A = \frac{1}{2} * \sum_{i=1}^N x_i (y_{i+1} -y_{i-1}) + + #. The contribution by the bezier curve is considered: We compute + the integral :math:`\int_{x(t=0)}^{x(t=1)} y dx`, i.e. the area between the x + axis and the curve, where :math:`y = y(t)` (the Bezier curve). By substitution + :math:`dx = x'(t) dt`, performing the integration and + subtracting the trapezoid we already considered above, we find (with control + points :math:`(x_{c1}, y_{c1})` and :math:`(x_{c2}, y_{c2})`) + + .. math:: + + \Delta A &= \int_0^1 y(t) x'(t) dt - \frac{1}{2} (y_1 + y_0) (x_1 - x_0) \\ + &= \frac{3}{20} \cdot \begin{pmatrix} + & y_0(& & 2x_{c1} & + x_{c2} & -3x_1&) \\ + + & y_{c1}(& -2x_0 & & + x_{c2} &+ x_1&) \\ + + & y_{c2}(& -x_0 & -x_{c1} & & + 2x_1&) \\ + + & y_1(& 3x_0 & - x_{c1} & -2 x_{c2} &&) + \end{pmatrix} + + This is computed for every bezier and added to the area. Again, this is a signed + area: convex beziers have a positive area and concave ones a negative area + contribution. + """ + + MAT_AREA = numpy.array( + [[0, 2, 1, -3], [-2, 0, 1, 1], [-1, -1, 0, 2], [3, -1, -2, 0]] + ) + area = 0.0 + for sp in csp: + if len(sp) < 2: + continue + for x, coord in enumerate(sp): # calculate polygon area + area += 0.5 * sp[x - 1][1][0] * (coord[1][1] - sp[x - 2][1][1]) + for i in range(1, len(sp)): # add contribution from cubic Bezier + # EXPLANATION: https://github.com/Pomax/BezierInfo-2/issues/238#issue-554619801 + vec_x = numpy.array( + [sp[i - 1][1][0], sp[i - 1][2][0], sp[i][0][0], sp[i][1][0]] + ) + vec_y = numpy.array( + [sp[i - 1][1][1], sp[i - 1][2][1], sp[i][0][1], sp[i][1][1]] + ) + vex = numpy.matmul(vec_x, MAT_AREA) + area += 0.15 * numpy.matmul(vex, vec_y.T) + return -area + + +def cspcofm(csp): + r"""Get center of area / gravity for a cubic superpath. + + .. hint:: + + The results may be slightly inaccurate for paths containing arcs due + to the loss of accuracy during arc -> cubic bezier conversion. + + The function works similar to :func:`csparea`, only the computations are a bit more + difficult. Again all subpaths are considered. The total center of mass is given by + + .. math:: + + C_y = \frac{1}{A} \int_A y dA + + The integral can be expressed as a weighted sum; first, the contributions + of the polygon created by the path's nodes is computed. Second, we compute the + contribution of the Bezier curve; this is again done by an integral from which + the weighted CofM of the trapezoid between end points and horizontal axis is + removed. For the integrals, we have + + .. math:: + + A * C_{y,bez} &= \int_A y dA = \int_{x(t=0)}^{y(t=1)} \int_{0}^{y(x)} y dy dx \\ + &= \int_{x(t=0)}^{y(t=1)} \frac 12 y(x)^2 dx + = \int_0^1 \frac 12 y(t)^2 x'(t) dt \\ + A * C_{x,bez} &= \int_A x dA = \int_{x(t=0)}^{y(t=1)} x \int_{0}^{y(x)} dy dx \\ + &= \int_{x(t=0)}^{y(t=1)} x y(x) dx = \int_0^1 x(t) y(t) x'(t) dt + + from which the trapezoids are removed, in case of the y-CofM this amounts to + + .. math:: + + \frac{y_0}{2} (x_1-x_0)y_0 + \left(y_0 + \frac 13 (y_1 - y_0)\right) + \cdot \frac 12 (y_1 - y_0) (x_1 - x_0) + + """ + + MAT_COFM_0 = numpy.array( + [[0, 35, 10, -45], [-35, 0, 12, 23], [-10, -12, 0, 22], [45, -23, -22, 0]] + ) + + MAT_COFM_1 = numpy.array( + [[0, 15, 3, -18], [-15, 0, 9, 6], [-3, -9, 0, 12], [18, -6, -12, 0]] + ) + + MAT_COFM_2 = numpy.array( + [[0, 12, 6, -18], [-12, 0, 9, 3], [-6, -9, 0, 15], [18, -3, -15, 0]] + ) + + MAT_COFM_3 = numpy.array( + [[0, 22, 23, -45], [-22, 0, 12, 10], [-23, -12, 0, 35], [45, -10, -35, 0]] + ) + area = csparea(csp) + xc = 0.0 + yc = 0.0 + if abs(area) < 1.0e-8: + raise ValueError(_("Area is zero, cannot calculate Center of Mass")) + for sp in csp: + for x, coord in enumerate(sp): # calculate polygon moment + xc += ( + sp[x - 1][1][1] + * (sp[x - 2][1][0] - coord[1][0]) + * (sp[x - 2][1][0] + sp[x - 1][1][0] + coord[1][0]) + / 6 + ) + yc += ( + sp[x - 1][1][0] + * (coord[1][1] - sp[x - 2][1][1]) + * (sp[x - 2][1][1] + sp[x - 1][1][1] + coord[1][1]) + / 6 + ) + for i in range(1, len(sp)): # add contribution from cubic Bezier + vec_x = numpy.array( + [sp[i - 1][1][0], sp[i - 1][2][0], sp[i][0][0], sp[i][1][0]] + ) + vec_y = numpy.array( + [sp[i - 1][1][1], sp[i - 1][2][1], sp[i][0][1], sp[i][1][1]] + ) + + def _mul(MAT, vec_x=vec_x, vec_y=vec_y): + return numpy.matmul(numpy.matmul(vec_x, MAT), vec_y.T) + + vec_t = numpy.array( + [_mul(MAT_COFM_0), _mul(MAT_COFM_1), _mul(MAT_COFM_2), _mul(MAT_COFM_3)] + ) + xc += numpy.matmul(vec_x, vec_t.T) / 280 + yc += numpy.matmul(vec_y, vec_t.T) / 280 + return -xc / area, -yc / area diff --git a/extensions/botbox3000/deps/inkex/colors/__init__.py b/extensions/botbox3000/deps/inkex/colors/__init__.py new file mode 100644 index 0000000..fa0e752 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/__init__.py @@ -0,0 +1,49 @@ +# coding=utf-8 +""" +The color module allows for the parsing and printing of CSS colors in an SVG document. + +Support formats are currently: + + 1. #RGB #RRGGBB #RGBA #RRGGBBAA formats + 2. Named colors such as 'red' + 3. icc-color(...) which is specific to SVG 1.1 + 4. rgb(...) and rgba(...) from CSS Color Module 3 + 5. hsl(...) and hsla(...) from CSS Color Module 3 + 6. hwb(...) from CSS Color Module 4, but encoded internally as hsv + 7. device-cmyk(...) from CSS Color Module 4 + +Each color space has it's own class, such as ColorRGB. Each space will parse multiple +formats, for example ColorRGB supports hex and rgb CSS module formats. + +Each color object is a list of numbers, each number is a channel in that color space +with alpha channel being held in it's own property which may be a unit number or None. + +The numbers a color stores are typically in the range defined in the CSS module +specification so for example RGB, all the numbers are between 0-255 while for hsl +the hue channel is between 0-360 and the saturation and lightness are between 0-100. + +To get normalised numbers you can use to the `to_units` function to get everything 0-1 + +Each Color space type has a name value which can be used to identify the color space, +if this is more useful than checking the class type. Either can be used when converting +the color values between spaces. + +A color object may be converted into a different space by using the +`color.to(other_space)` function, which will return a new color object in the requested +space. + +There are three special cases. + + 1. ColorNamed is a type of ColorRGB which will preferentially print the name instead + of the hex value if one is available. + 2. ColorNone is a special value which indicates the keyword `none` and does not + allow any values or alpha. + 3. ColorCMS can not be converted to other color spaces and contains a `fallback_color` + to access the RGB fallback if it was provided. + +""" + +from .color import Color, ColorError, ColorIdError +from .utils import is_color + +from .spaces import * diff --git a/extensions/botbox3000/deps/inkex/colors/color.py b/extensions/botbox3000/deps/inkex/colors/color.py new file mode 100644 index 0000000..380b2bb --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/color.py @@ -0,0 +1,295 @@ +# coding=utf-8 +# +# Copyright (C) 2020 Martin Owens +# 2021 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Basic color controls +""" + +from typing import Dict, Optional, Tuple, Union + +from .converters import Converters + +Number = Union[int, float] + + +def round_by_type(kind, number): + """Round a number to zero or five decimal places depending on it's type""" + return kind(round(number, kind == float and 5 or 0)) + + +class ColorError(KeyError): + """Specific color parsing error""" + + +class ColorIdError(ColorError): + """Special color error for gradient and color stop ids""" + + +class Color(list): + """A parsed color object which could be in many color spaces, the default is sRGB + + Can be constructed from valid CSS color attributes, as well as + tuple/list + color space. Percentage values are supported. + """ + + _spaces: Dict[str, type] = {} + + name: Optional[str] = None + + # A list of known channels + channels: Tuple[str, ...] = () + + # A list of scales for converting css color values to known qantities + scales: Tuple[ + Union[Tuple[Number, Number, bool], Tuple[Number, Number]], ... + ] = () # Min (int/float), Max (int/float), [wrap around (bool:False)] + + # If alpha is not specified, this is the default for most color types. + default_alpha = 1.0 + + def __init_subclass__(cls): + if not cls.name: + return # It is a base class + + # Add space to a dictionary of available color spaces + cls._spaces[cls.name] = cls + + Converters.add_space(cls) + + def __new__(cls, value=None, alpha=None, arg=None): + if not cls.name: + if value is None: + return super().__new__(cls._spaces["none"]) + + if isinstance(value, int): + return super().__new__(cls._spaces["rgb"]) + + if isinstance(value, str): + # String from xml or css attributes + for space in cls._spaces.values(): + if space.can_parse(value.lower()): + return super().__new__(space, value) + + if isinstance(value, Color): + return super().__new__(type(value), value) + + if isinstance(value, (list, tuple)): + from ..deprecated.main import _deprecated + + _deprecated( + "Anonymous lists of numbers for colors no longer default to rgb" + ) + return super().__new__(cls._spaces["rgb"], value) + + return super().__new__(cls, value, alpha=alpha, arg=arg) + + def __init__(self, values, alpha=None, arg=None): + super().__init__() + + if not self.name: + raise ColorError(f"Not a known color value: '{values}' {arg}") + + if not isinstance(values, (list, tuple)): + raise ColorError( + f"Colors must be constructed with a list of values: '{values}'" + ) + + if alpha is not None and not isinstance(alpha, float): + raise ColorError("Color alpha property must be a float number") + + if alpha is None and self.channels and len(values) == len(self.channels) + 1: + alpha = values.pop() + + if isinstance(values, Color): + alpha = values.alpha + + if self.channels and len(values) != len(self.channels): + raise ColorError( + f"You must have {len(self.channels)} channels for a {self.name} color" + ) + + self[:] = values + self.alpha = alpha + + def __hash__(self): + """Allow colors to be hashable""" + return tuple(self + [self.alpha, self.name]).__hash__() + + def __str__(self): + raise NotImplementedError( + f"Color space {self.name} can not be printed to a string." + ) + + def __int__(self): + raise NotImplementedError( + f"Color space {self.name} can not be converted to a number." + ) + + def __getitem__(self, index): + """Get the color value""" + space = self.name + + if ( + isinstance(index, slice) + and index.start is not None + and not isinstance(index.start, int) + ): + # We support the format `value = color["space_name":index]` here + space = self._spaces[index.start] + index = int(index.stop) + + # Allow regular slicing to fall through more freely than setitem + if space == self.name: + return super().__getitem__(index) + + if not isinstance(index, int): + raise ColorError(f"Unknown color getter definition: '{index}'") + + return self.to(space)[ + index + ] # Note: this calls Color.__getitem__ function again + + def __setitem__(self, index, value): + """Set the color value in place, limits setter to specific color space""" + space = self.name + + if isinstance(index, slice): + # Support the format color[:] = [list of numbers] here + if index.start is None and index.stop is None: + super().__setitem__( + index, (self.constrain(ind, val) for ind, val in enumerate(value)) + ) + return + + # We support the format `color["space_name":index] = value` here + space = self._spaces[index.start] + index = int(index.stop) + + if not isinstance(index, int): + raise ColorError(f"Unknown color setter definition: '{index}'") + + # Setting a channel in the existing space + if space == self.name: + super().__setitem__(index, self.constrain(index, value)) + else: + # Set channel is another space, convert back and forth + values = self.to(space) + values[index] = value # Note: this calls Color.__setitem__ function again + self[:] = values.to(self.name) + + def to(self, space): # pylint: disable=invalid-name + """Get this color but in a specific color space""" + if space in self._spaces.values(): + space = space.name + if space not in self._spaces: + raise AttributeError( + f"Unknown color space {space} when converting from {self.name}" + ) + if not hasattr(type(self), f"to_{space}"): + setattr( + type(self), + f"to_{space}", + Converters.find_converter(type(self), self._spaces[space]), + ) + return getattr(self, f"to_{space}")() + + def __getattr__(self, name): + if name.startswith("to_") and name.count("_") == 1: + return lambda: self.to(name.split("_")[-1]) + raise AttributeError(f"Can not find attribute {type(self).__name__}.{name}") + + @property + def effective_alpha(self): + """Get the alpha as set, or tell me what it would be by default""" + if self.alpha is None: + return self.default_alpha + return self.alpha + + def get_values(self, alpha=True): + """Returns all values, including alpha as a list""" + if alpha: + return list(self + [self.effective_alpha]) + return list(self) + + @classmethod + def to_units(cls, *values): + """Convert the color values into floats scales from 0.0 to 1.0""" + return [cls.scale_down(ind, val) for ind, val in enumerate(values)] + + @classmethod + def from_units(cls, *values): + """Convert float values to the scales expected and return a new instance""" + return [cls.scale_up(ind, val) for ind, val in enumerate(values)] + + @classmethod + def can_parse(cls, string): # pylint: disable=unused-argument + """Returns true if this string can be parsed for this color type""" + return False + + @classmethod + def scale_up(cls, index, value): + """Convert from float 0.0 to 1.0 to an int used in css""" + (min_value, max_value) = cls.scales[index][:2] + return cls.constrain( + index, (value * (max_value - min_value)) + min_value + ) # See inkscape/src/colors/spaces/base.h:SCALE_UP + + @classmethod + def scale_down(cls, index, value): + """Convert from int, often 0 to 255 to a float 0.0 to 1.0""" + (min_value, max_value) = cls.scales[index][:2] + return (cls.constrain(index, value) - min_value) / ( + max_value - min_value + ) # See inkscape/src/colors/spaces/base.h:SCALE_DOWN + + @classmethod + def constrain(cls, index, value): + """Constrains the value to the css scale""" + scale = cls.scales[index] + if len(scale) == 3 and scale[2] is True: + if value == scale[1]: + return value + return round_by_type( + type(scale[0]), value % scale[1] + ) # Wrap around value (i.e. hue) + return min(max(round_by_type(type(scale[0]), value), scale[0]), scale[1]) + + def interpolate(self, other, fraction): + """Interpolate two colours by the given fraction + + .. versionadded:: 1.1""" + from ..tween import ColorInterpolator # pylint: disable=import-outside-toplevel + + try: + other = other.to(type(self)) + except ColorError: + raise ColorError("Can not convert color in interpolation.") + return ColorInterpolator(self, other).interpolate(fraction) + + +class AlphaNotAllowed: + """Mixin class to indicate that alpha values are not permitted on this color space""" + + alpha = property( + lambda self: None, + lambda self, value: None, + ) + + def get_values(self, alpha=False): + return super().get_values(False) diff --git a/extensions/botbox3000/deps/inkex/colors/converters.py b/extensions/botbox3000/deps/inkex/colors/converters.py new file mode 100644 index 0000000..78315fb --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/converters.py @@ -0,0 +1,122 @@ +# coding=utf-8 +# +# Copyright (C) 2018-2024 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Basic color errors and common functions +""" + +from collections import defaultdict + +from typing import Dict, List, Callable + +ConverterFunc = Callable[[float], List[float]] + + +class Converters: + """ + Record how colors can be converted between different spaces and provides + a way to path-find between multiple step conversions. + """ + + links: Dict[str, Dict[str, ConverterFunc]] = defaultdict(dict) + chains: Dict[str, List[List[str]]] = {} + + @classmethod + def add_space(cls, color_cls): + """ + Records the stated links between this class and other color spaces + """ + for name, func in color_cls.__dict__.items(): + if not name.startswith("convert_"): + continue + _, direction, space = name.split("_", 2) + from_name = color_cls.name if direction == "to" else space + to_name = color_cls.name if direction == "from" else space + + if from_name != to_name: + if not isinstance(func, staticmethod): + raise TypeError(f"Method '{name}' must be a static method.") + cls.links[from_name][to_name] = func.__func__ + + @classmethod + def get_chain(cls, source, target): + """ + Get a chain of conversions between two color spaces, if possible. + """ + + def build_chains(chains, space): + new_chains = [] + for chain in chains: + for hop in cls.links[space]: + if hop not in chain: + new_chains += build_chains([chain + [hop]], hop) + return chains + new_chains + + if source not in cls.chains: + cls.chains[source] = build_chains([[source]], source) + + chosen = None + for chain in cls.chains[source] or (): + if chain[-1] == target and (not chosen or len(chain) < len(chosen)): + chosen = chain + return chosen + + @classmethod + def find_converter(cls, source, target): + """ + Find a way to convert from source to target using any conversion functions. + + Will hop from one space to another if needed. + """ + func = None + + # Passthough + if source == target: + return lambda self: self + + if func is None: + chain = cls.get_chain(source.name, target.name) + if chain: + return cls.generate_converter(chain, source, target) + + # Returning a function means we only run this function once, even when not found + def _error(self): + raise NotImplementedError( + f"Color space {source} can not be converted to {target}." + ) + + return _error + + @classmethod + def generate_converter(cls, chain, source_cls, target_cls): + """ + Put together a function that can do every step of the chain of conversions + """ + # Build a list of functions to run + funcs = [cls.links[a][b] for a, b in zip(chain, chain[1:])] + funcs.insert(0, source_cls.to_units) + funcs.append(target_cls.from_units) + + def _inner(values): + if hasattr(values, "alpha") and values.alpha is not None: + values = list(values) + [values.alpha] + for func in funcs: + values = func(*values) + return target_cls(values) + + return _inner diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/__init__.py b/extensions/botbox3000/deps/inkex/colors/spaces/__init__.py new file mode 100644 index 0000000..29c22e9 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/__init__.py @@ -0,0 +1,11 @@ +""" +Each color space that this module supports such have one file in this module. +""" + +from .cmyk import ColorDeviceCMYK +from .cms import ColorCMS +from .hsl import ColorHSL +from .hsv import ColorHSV +from .named import ColorNamed +from .none import ColorNone +from .rgb import ColorRGB diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/cms.py b/extensions/botbox3000/deps/inkex/colors/spaces/cms.py new file mode 100644 index 0000000..f596036 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/cms.py @@ -0,0 +1,95 @@ +# coding=utf-8 +# +# Copyright (C) 2024 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +SVG icc-color parser +""" + +from ..color import Color, AlphaNotAllowed, ColorError, round_by_type +from .css import CssColor +from .rgb import ColorRGB + + +class ColorCMS(CssColor, AlphaNotAllowed): + """ + Parse and print SVG icc-color objects into their values and the fallback RGB + """ + + name = "cms" + css_func = "icc-color" + channels = () + scales = () + + def __init__(self, values, icc_profile=None, fallback=None): + if isinstance(values, str): + if values.strip().startswith("#") and " " in values: + fallback, values = values.split(" ", 1) + fallback = Color(fallback) + icc_profile, values = self.parse_css_color(values) + + if icc_profile is None: + raise ColorError("CMS Color requires an icc color profile name.") + + self.icc_profile = icc_profile + self.fallback_rgb = fallback + super().__init__(values) + + def __str__(self) -> str: + values = self.css_join.join([f"{v:g}" for v in self.get_css_values()]) + fallback = str(ColorRGB(self.fallback_rgb)) + " " if self.fallback_rgb else "" + return f"{fallback}{self.css_func}({self.icc_profile}, {values})" + + @classmethod + def can_parse(cls, string: str) -> bool: + # Custom detection because of RGB fallback prefix + return "icc-color" in string.replace("(", " ").split() + + @classmethod + def constrain(cls, index, value): + return min(max(round_by_type(float, value), 0.0), 1.0) + + @classmethod + def scale_up(cls, index, value): + return value # All cms values are already 0.0 to 1.0 + + @classmethod + def scale_down(cls, index, value): + return value # All cms values are already 0.0 to 1.0 + + @staticmethod + def convert_to_rgb(*data): + """Catch attempted conversions to rgb""" + raise NotImplementedError("Can not convert to RGB from icc color") + + @staticmethod + def convert_from_rgb(*data): + """Catch attempted conversions from rgb""" + raise NotImplementedError("Can not convert from RGB to icc color") + + +# This is research code for a future developer to use. We already use PIL and this will +# allow icc colors to be converted in python. This isn't needed right now, so this work +# will be left undone. +# @staticmethod +# def convert_to_rgb(): +# from PIL import Image, ImageCms +# pixel = Image.fromarray([[int(r * 255), int(g * 255), int(b * 255)]], 'RGB') +# transform = ImageCms.buildTransform(sRGB_profile, self.this_profile, "RGB", +# self.this_profile_mode, self.this_rendering_intent, 0) +# transform.apply_in_place(pixel) +# return [p / 255 for p in pixel[0]] diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/cmyk.py b/extensions/botbox3000/deps/inkex/colors/spaces/cmyk.py new file mode 100644 index 0000000..70c9636 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/cmyk.py @@ -0,0 +1,81 @@ +# coding=utf-8 +# +# Copyright (C) 2024 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=W0223 +""" +DeviceCMYK Color Space +""" + +from .css import CssColorModule4 + + +class ColorDeviceCMYK(CssColorModule4): + """ + Parse the device-cmyk CSS Color Module 4 format. + + Note that this format is NOT true CMYK as you might expect in a printer and + is instead is an aproximation of the intended ink levels if this was converted + into a real CMYK color profile using a color management system. + """ + + name = "cmyk" + + channels = ("cyan", "magenta", "yellow", "black") + scales = ((0, 100), (0, 100), (0, 100), (0, 100), (0.0, 1.0)) + css_either_prefix = "device-cmyk" + + cyan = property( + lambda self: self[0], lambda self, value: self.__setitem__(0, value) + ) + magenta = property( + lambda self: self[1], lambda self, value: self.__setitem__(1, value) + ) + yellow = property( + lambda self: self[2], lambda self, value: self.__setitem__(2, value) + ) + black = property( + lambda self: self[3], lambda self, value: self.__setitem__(3, value) + ) + + @staticmethod + def convert_to_rgb(cyan, magenta, yellow, black, *alpha): + """ + Convert a set of Device-CMYK identities into RGB + """ + white = 1.0 - black + return [ + 1.0 - min((1.0, cyan * white + black)), + 1.0 - min((1.0, magenta * white + black)), + 1.0 - min((1.0, yellow * white + black)), + ] + list(alpha) + + @staticmethod + def convert_from_rgb(red, green, blue, *alpha): + """ + Convert RGB into Device-CMYK + """ + white = max((red, green, blue)) + black = 1.0 - white + return [ + # Each channel is it's color chart oposite (cyan->red) + # with a bit of white removed. + (white and (1.0 - red - black) / white or 0.0), + (white and (1.0 - green - black) / white or 0.0), + (white and (1.0 - blue - black) / white or 0.0), + black, + ] + list(alpha) diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/css.py b/extensions/botbox3000/deps/inkex/colors/spaces/css.py new file mode 100644 index 0000000..cd16bfe --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/css.py @@ -0,0 +1,139 @@ +# coding=utf-8 +# +# Copyright (C) 2018-2024 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=W0223 +""" +Parsing CSS elements from colors +""" + +from typing import Optional, Union + +from ..color import Color, ColorError, ColorIdError + + +class CssColor(Color): + """ + A Color which is always parsed and printed from a css format. + """ + + # A list of css prefixes which ar valid for this space + css_noalpha_prefix: Optional[str] = None + css_alpha_prefix: Optional[str] = None + css_either_prefix: Optional[str] = None + + # Some CSS formats require commas, others do not + css_join: str = ", " + css_join_alpha: str = ", " + css_func = "color" + + def __str__(self): + values = self.css_join.join([f"{v:g}" for v in self.get_css_values()]) + prefix = self.css_noalpha_prefix or self.css_either_prefix + if self.alpha is not None: + # Alpha is stored as a percent for clarity + alpha = int(self.alpha * 100) + values += self.css_join_alpha + f"{alpha}%" + if not self.css_either_prefix: + prefix = self.css_alpha_prefix + if prefix is None: + raise ColorError(f"Can't encode color {self.name} into CSS color format.") + return f"{prefix}({values})" + + @classmethod + def can_parse(cls, string: str): + string = string.replace(" ", "") + if "(" not in string or ")" not in string: + return False + for prefix in ( + cls.css_noalpha_prefix, + cls.css_alpha_prefix, + cls.css_either_prefix, + ): + if prefix and (prefix + "(" in string or "color(" + prefix in string): + return True + return False + + def __init__(self, value, alpha=None): + if isinstance(value, str): + prefix, values = self.parse_css_color(value) + has_alpha = ( + self.channels is not None and len(values) == len(self.channels) + 1 + ) + + if prefix == self.css_noalpha_prefix or ( + prefix == self.css_either_prefix and not has_alpha + ): + super().__init__(values) + + elif prefix == self.css_alpha_prefix or ( + prefix == self.css_either_prefix and has_alpha + ): + super().__init__(values, values.pop()) + else: + raise ColorError(f"Could not parse {self.name} css color: '{value}'") + else: + super().__init__(value, alpha=alpha) + + @classmethod + def parse_css_color(cls, value): + """Parse a css string into a list of values and it's color space prefix""" + prefix, values = value.lower().strip().strip(")").split("(") + # Some css formats use commas, others do not + if "," in cls.css_join: + values = values.replace(",", " ") + if "/" in cls.css_join_alpha: + values = values.replace("/", " ") + + # Split values by spaces + values = values.split() + prefix = prefix.strip() + if prefix == cls.css_func: + prefix = values.pop(0) + if prefix == "url": + raise ColorIdError("Can not parse url as if it was a color.") + return prefix, [cls.parse_css_value(i, v) for i, v in enumerate(values)] + + def get_css_values(self): + """Return a list of values used for css string output""" + return self + + @classmethod + def parse_css_value(cls, index, value) -> Union[int, float]: + """Parse a CSS value such as 100%, 360 or 0.4""" + if cls.scales and index >= len(cls.scales): + raise ValueError("Can't add any more values to color.") + + if isinstance(value, str): + value = value.strip() + if value.endswith("%"): + value = float(value.strip("%")) / 100 + elif "." in value: + value = float(value) + else: + value = int(value) + + if isinstance(value, float) and value <= 1.0: + value = cls.scale_up(index, value) + return cls.constrain(index, value) + + +class CssColorModule4(CssColor): + """Tweak the css parser for CSS Module Four formating""" + + css_join = " " + css_join_alpha = " / " diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/hsl.py b/extensions/botbox3000/deps/inkex/colors/spaces/hsl.py new file mode 100644 index 0000000..056486b --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/hsl.py @@ -0,0 +1,107 @@ +# coding=utf-8 +# +# Copyright (C) 2024 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=W0223 +""" +HSL Color Space +""" + +from .css import CssColor + + +class ColorHSL(CssColor): + """ + Parse the HSL CSS Module Module 3 format. + """ + + name = "hsl" + channels = ("hue", "saturation", "lightness") + scales = ((0, 360, True), (0, 100), (0, 100), (0.0, 1.0)) + + css_noalpha_prefix = "hsl" + css_alpha_prefix = "hsla" + + hue = property(lambda self: self[0], lambda self, value: self.__setitem__(0, value)) + saturation = property( + lambda self: self[1], lambda self, value: self.__setitem__(1, value) + ) + lightness = property( + lambda self: self[2], lambda self, value: self.__setitem__(2, value) + ) + + @staticmethod + def convert_from_rgb(red, green, blue, alpha=None): + """RGB to HSL colour conversion""" + rgb_max = max(red, green, blue) + rgb_min = min(red, green, blue) + delta = rgb_max - rgb_min + hsl = [0.0, 0.0, (rgb_max + rgb_min) / 2.0] + + if delta != 0: + if hsl[2] <= 0.5: + hsl[1] = delta / (rgb_max + rgb_min) + else: + hsl[1] = delta / (2 - rgb_max - rgb_min) + + if red == rgb_max: + hsl[0] = (green - blue) / delta + elif green == rgb_max: + hsl[0] = 2.0 + (blue - red) / delta + elif blue == rgb_max: + hsl[0] = 4.0 + (red - green) / delta + + hsl[0] /= 6.0 + if hsl[0] < 0: + hsl[0] += 1 + if hsl[0] > 1: + hsl[0] -= 1 + if alpha is not None: + hsl.append(alpha) + return hsl + + @staticmethod + def convert_to_rgb(hue, sat, light, *alpha): + """HSL to RGB Color Conversion""" + if sat == 0: + return [light, light, light] # Gray + + if light < 0.5: + val2 = light * (1 + sat) + else: + val2 = light + sat - light * sat + val1 = 2 * light - val2 + ret = [ + _hue_to_rgb(val1, val2, hue * 6 + 2.0), + _hue_to_rgb(val1, val2, hue * 6), + _hue_to_rgb(val1, val2, hue * 6 - 2.0), + ] + return ret + list(alpha) + + +def _hue_to_rgb(val1, val2, hue): + if hue < 0: + hue += 6.0 + if hue > 6: + hue -= 6.0 + if hue < 1: + return val1 + (val2 - val1) * hue + if hue < 3: + return val2 + if hue < 4: + return val1 + (val2 - val1) * (4 - hue) + return val1 diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/hsv.py b/extensions/botbox3000/deps/inkex/colors/spaces/hsv.py new file mode 100644 index 0000000..09c88f8 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/hsv.py @@ -0,0 +1,88 @@ +# coding=utf-8 +# +# Copyright (C) 2024 Jonathan Neuhauser +# 2024 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=W0223 +""" +HSV Color Space +""" + +from .css import CssColorModule4 + + +class ColorHSV(CssColorModule4): + """ + Parse the HWB CSS Color Module 4 format and retain as HSV values. + """ + + name = "hsv" + channels = ("hue", "saturation", "value") + scales = ((0, 360, True), (0, 100), (0, 100), (0.0, 1.0)) + + # We use HWB to store HSV as this makes the most sense to Inkscape + css_either_prefix = "hwb" + + hue = property(lambda self: self[0], lambda self, value: self.__setitem__(0, value)) + saturation = property( + lambda self: self[1], lambda self, value: self.__setitem__(1, value) + ) + value = property( + lambda self: self[2], lambda self, value: self.__setitem__(2, value) + ) + + @classmethod + def parse_css_color(cls, value): + """Parsing HWB as if it was HSV for css input""" + prefix, values = super().parse_css_color(value) + # See https://en.wikipedia.org/wiki/HWB_color_model#Converting_to_and_from_HSV + values[1] /= 100 + values[2] /= 100 + scale = values[1] + values[2] + if scale > 1.0: + values[1] /= scale + values[2] /= scale + values[1] = int( + (values[2] == 1.0 and 0.0 or (1.0 - (values[1] / (1.0 - values[2])))) * 100 + ) + values[2] = int((1.0 - values[2]) * 100) + return prefix, values + + def get_css_values(self): + """Convert our HSV values into HWB for css output""" + values = list(self) + values[1] = (100 - values[1]) * (values[2] / 100) + values[2] = 100 - values[2] + return values + + @staticmethod + def convert_to_hsl(hue, saturation, value, *alpha): + """Conversion according to + https://en.wikipedia.org/wiki/HSL_and_HSV#HSV_to_HSL + + .. versionadded:: 1.5""" + lum = value * (1 - saturation / 2) + sat = 0 if lum in (0, 1) else (value - lum) / min(lum, 1 - lum) + return [hue, sat, lum] + list(alpha) + + @staticmethod + def convert_from_hsl(hue, saturation, lightness, *alpha): + """Convertion according to Inkscape C++ codebase + .. versionadded:: 1.5""" + val = lightness + saturation * min(lightness, 1 - lightness) + sat = 0 if val == 0 else 2 * (1 - lightness / val) + return [hue, sat, val] + list(alpha) diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/named.py b/extensions/botbox3000/deps/inkex/colors/spaces/named.py new file mode 100644 index 0000000..400f973 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/named.py @@ -0,0 +1,236 @@ +# coding=utf-8 +# +# Copyright (C) 2024, Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +CSS Named colors +""" + +from typing import Dict + +from ..color import Color +from .rgb import ColorRGB + +_COLORS = { + "aliceblue": "#f0f8ff", + "antiquewhite": "#faebd7", + "aqua": "#00ffff", + "aquamarine": "#7fffd4", + "azure": "#f0ffff", + "beige": "#f5f5dc", + "bisque": "#ffe4c4", + "black": "#000000", + "blanchedalmond": "#ffebcd", + "blue": "#0000ff", + "blueviolet": "#8a2be2", + "brown": "#a52a2a", + "burlywood": "#deb887", + "cadetblue": "#5f9ea0", + "chartreuse": "#7fff00", + "chocolate": "#d2691e", + "coral": "#ff7f50", + "cornflowerblue": "#6495ed", + "cornsilk": "#fff8dc", + "crimson": "#dc143c", + "cyan": "#00ffff", + "darkblue": "#00008b", + "darkcyan": "#008b8b", + "darkgoldenrod": "#b8860b", + "darkgray": "#a9a9a9", + "darkgreen": "#006400", + "darkgrey": "#a9a9a9", + "darkkhaki": "#bdb76b", + "darkmagenta": "#8b008b", + "darkolivegreen": "#556b2f", + "darkorange": "#ff8c00", + "darkorchid": "#9932cc", + "darkred": "#8b0000", + "darksalmon": "#e9967a", + "darkseagreen": "#8fbc8f", + "darkslateblue": "#483d8b", + "darkslategray": "#2f4f4f", + "darkslategrey": "#2f4f4f", + "darkturquoise": "#00ced1", + "darkviolet": "#9400d3", + "deeppink": "#ff1493", + "deepskyblue": "#00bfff", + "dimgray": "#696969", + "dimgrey": "#696969", + "dodgerblue": "#1e90ff", + "firebrick": "#b22222", + "floralwhite": "#fffaf0", + "forestgreen": "#228b22", + "fuchsia": "#ff00ff", + "gainsboro": "#dcdcdc", + "ghostwhite": "#f8f8ff", + "gold": "#ffd700", + "goldenrod": "#daa520", + "gray": "#808080", + "grey": "#808080", + "green": "#008000", + "greenyellow": "#adff2f", + "honeydew": "#f0fff0", + "hotpink": "#ff69b4", + "indianred": "#cd5c5c", + "indigo": "#4b0082", + "ivory": "#fffff0", + "khaki": "#f0e68c", + "lavender": "#e6e6fa", + "lavenderblush": "#fff0f5", + "lawngreen": "#7cfc00", + "lemonchiffon": "#fffacd", + "lightblue": "#add8e6", + "lightcoral": "#f08080", + "lightcyan": "#e0ffff", + "lightgoldenrodyellow": "#fafad2", + "lightgray": "#d3d3d3", + "lightgreen": "#90ee90", + "lightgrey": "#d3d3d3", + "lightpink": "#ffb6c1", + "lightsalmon": "#ffa07a", + "lightseagreen": "#20b2aa", + "lightskyblue": "#87cefa", + "lightslategray": "#778899", + "lightslategrey": "#778899", + "lightsteelblue": "#b0c4de", + "lightyellow": "#ffffe0", + "lime": "#00ff00", + "limegreen": "#32cd32", + "linen": "#faf0e6", + "magenta": "#ff00ff", + "maroon": "#800000", + "mediumaquamarine": "#66cdaa", + "mediumblue": "#0000cd", + "mediumorchid": "#ba55d3", + "mediumpurple": "#9370db", + "mediumseagreen": "#3cb371", + "mediumslateblue": "#7b68ee", + "mediumspringgreen": "#00fa9a", + "mediumturquoise": "#48d1cc", + "mediumvioletred": "#c71585", + "midnightblue": "#191970", + "mintcream": "#f5fffa", + "mistyrose": "#ffe4e1", + "moccasin": "#ffe4b5", + "navajowhite": "#ffdead", + "navy": "#000080", + "oldlace": "#fdf5e6", + "olive": "#808000", + "olivedrab": "#6b8e23", + "orange": "#ffa500", + "orangered": "#ff4500", + "orchid": "#da70d6", + "palegoldenrod": "#eee8aa", + "palegreen": "#98fb98", + "paleturquoise": "#afeeee", + "palevioletred": "#db7093", + "papayawhip": "#ffefd5", + "peachpuff": "#ffdab9", + "peru": "#cd853f", + "pink": "#ffc0cb", + "plum": "#dda0dd", + "powderblue": "#b0e0e6", + "purple": "#800080", + "rebeccapurple": "#663399", + "red": "#ff0000", + "rosybrown": "#bc8f8f", + "royalblue": "#4169e1", + "saddlebrown": "#8b4513", + "salmon": "#fa8072", + "sandybrown": "#f4a460", + "seagreen": "#2e8b57", + "seashell": "#fff5ee", + "sienna": "#a0522d", + "silver": "#c0c0c0", + "skyblue": "#87ceeb", + "slateblue": "#6a5acd", + "slategray": "#708090", + "slategrey": "#708090", + "snow": "#fffafa", + "springgreen": "#00ff7f", + "steelblue": "#4682b4", + "tan": "#d2b48c", + "teal": "#008080", + "thistle": "#d8bfd8", + "tomato": "#ff6347", + "turquoise": "#40e0d0", + "violet": "#ee82ee", + "wheat": "#f5deb3", + "white": "#ffffff", + "whitesmoke": "#f5f5f5", + "yellow": "#ffff00", + "yellowgreen": "#9acd32", +} + + +class ColorNamed(ColorRGB): + """ + Parse specific named colors, fall back to RGB parsing if it fails. + """ + + _color_names: Dict[ColorRGB, str] = {} + _name_colors: Dict[str, ColorRGB] = {} + + name = "named" + + def __init__(self, name, alpha=None): + if isinstance(name, str): + super().__init__(self.name_colors()[name.lower().strip()]) + else: + super().__init__(name, alpha=alpha) + + @classmethod + def color_names(cls): + """Cache a list of color names""" + if not cls._color_names: + cls._color_names = { + value: name for name, value in cls.name_colors().items() + } + return cls._color_names + + @classmethod + def name_colors(cls): + """Cache a list of color objects""" + if not cls._name_colors: + cls._name_colors = {name: Color(value) for name, value in _COLORS.items()} + return cls._name_colors + + def __str__(self): + return self.color_names().get(self, super().__str__()) + + def __hash__(self): + """Allow named colors to match rgb colors""" + return tuple(self + [self.alpha, super().name]).__hash__() + + @classmethod + def can_parse(cls, string: str): + """If the string is one of the color names, we can parse it""" + return string in cls.name_colors() + + @staticmethod + def convert_to_rgb(*data): + """Converting to RGB is transparent, already in RGB""" + return data + + @staticmethod + def convert_from_rgb(*data): + """Converting from RGB is transparent, the store is RGB""" + return data + + def to_rgb(self): + """Prevent masking by ColorRGB of to_rgb method""" + return ColorRGB(list(self), alpha=self.alpha) diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/none.py b/extensions/botbox3000/deps/inkex/colors/spaces/none.py new file mode 100644 index 0000000..e22297a --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/none.py @@ -0,0 +1,55 @@ +# coding=utf-8 +# +# Copyright (C) 2021 Jonathan Neuhauser +# 2020 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=W0223 +""" +An empty color for 'none' +""" + +from ..color import Color, AlphaNotAllowed + + +class ColorNone(Color, AlphaNotAllowed): + """A special color for 'none' colors""" + + name = "none" + + # Override opacity since none can not have opacity + default_alpha = 0.0 + + def __init__(self, value=None): + pass + + def __str__(self) -> str: + return "none" + + @classmethod + def can_parse(cls, string: str) -> bool: + """Returns true if this is the word 'none'""" + return string == "none" + + @staticmethod + def convert_to_rgb(*_): + """Converting to RGB means transparent black""" + return [0, 0, 0, 0] + + @staticmethod + def convert_from_rgb(*_): + """Converting from RGB means throwing out all data""" + return [] diff --git a/extensions/botbox3000/deps/inkex/colors/spaces/rgb.py b/extensions/botbox3000/deps/inkex/colors/spaces/rgb.py new file mode 100644 index 0000000..94fbf07 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/spaces/rgb.py @@ -0,0 +1,105 @@ +# coding=utf-8 +# +# Copyright (C) 2024, Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +RGB Colors +""" + +from ..color import ColorError +from .css import CssColor + + +class ColorRGB(CssColor): + """ + Parse multiple versions of RGB from CSS module and standard hex formats. + """ + + name = "rgb" + channels = ("red", "green", "blue") + scales = ((0, 255), (0, 255), (0, 255), (0.0, 1.0)) + + css_noalpha_prefix = "rgb" + css_alpha_prefix = "rgba" + + red = property(lambda self: self[0], lambda self, value: self.__setitem__(0, value)) + green = property( + lambda self: self[1], lambda self, value: self.__setitem__(1, value) + ) + blue = property( + lambda self: self[2], lambda self, value: self.__setitem__(2, value) + ) + + @classmethod + def can_parse(cls, string: str) -> bool: + return "icc" not in string and ( + string.startswith("#") + or string.lstrip("-").isdigit() + or super().can_parse(string) + ) + + def __init__(self, value, alpha=None): + # Not CSS, but inkscape, some old color values stores as 32bit int strings + if isinstance(value, str) and value.lstrip("-").isdigit(): + value = int(value) + + if isinstance(value, int): + super().__init__( + [ + ((value >> 24) & 255), # red + ((value >> 16) & 255), # green + ((value >> 8) & 255), # blue + ((value & 255) / 255.0), + ] + ) # opacity + + elif isinstance(value, str) and value.startswith("#") and " " not in value: + if len(value) == 4: # (css: #rgb -> #rrggbb) + # pylint: disable=consider-using-f-string + value = "#{1}{1}{2}{2}{3}{3}".format(*value) + elif len(value) == 5: # (css: #rgba -> #rrggbbaa) + # pylint: disable=consider-using-f-string + value = "#{1}{1}{2}{2}{3}{3}{4}{4}".format(*value) + + # Convert hex to integers + try: + values = [int(value[i : i + 2], 16) for i in range(1, len(value), 2)] + if len(values) == 4: + values[3] /= 255 + super().__init__(values) + except ValueError as error: + raise ColorError(f"Bad RGB hex color value '{value}'") from error + else: + super().__init__(value, alpha=alpha) + + def __str__(self) -> str: + if self.alpha is not None: + return super().__str__() + if len(self) < len(self.channels): + raise ColorError( + f"Incorrect number of channels for Color Space {self.name}" + ) + # Always hex values when outputting color + return "#{0:02x}{1:02x}{2:02x}".format(*(int(v) for v in self)) # pylint: disable=consider-using-f-string + + def __int__(self) -> int: + return ( + (self[0] << 24) + + (self[1] << 16) + + (self[2] << 8) + + int((self.alpha or 1.0) * 255) + ) diff --git a/extensions/botbox3000/deps/inkex/colors/utils.py b/extensions/botbox3000/deps/inkex/colors/utils.py new file mode 100644 index 0000000..06a7151 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/colors/utils.py @@ -0,0 +1,31 @@ +# coding=utf-8 +# +# Copyright (C) 2018-2024 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Utilities for color support +""" + +from .color import Color, ColorError + + +def is_color(color): + """Determine if it is a color that we can use. If not, leave it unchanged.""" + try: + return bool(Color(color)) + except ColorError: + return False diff --git a/extensions/botbox3000/deps/inkex/command.py b/extensions/botbox3000/deps/inkex/command.py new file mode 100644 index 0000000..6bb7292 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/command.py @@ -0,0 +1,347 @@ +# coding=utf-8 +# +# Copyright (C) 2019 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110, USA. +# +""" +This API provides methods for calling Inkscape to execute a given +Inkscape command. This may be needed for various compiling options +(e.g., png), running other extensions or performing other options only +available via the shell API. + +Best practice is to avoid using this API except when absolutely necessary, +since it is resource-intensive to invoke a new Inkscape instance. + +However, in any circumstance when it is necessary to call Inkscape, it +is strongly recommended that you do so through this API, rather than calling +it yourself, to take advantage of the security settings and testing functions. + +""" + +import os +import re +import sys +from shutil import which as warlock + +from subprocess import Popen, PIPE +from tempfile import TemporaryDirectory +from typing import List +from lxml.etree import ElementTree + +from .elements import SvgDocumentElement + +INKSCAPE_EXECUTABLE_NAME = os.environ.get("INKSCAPE_COMMAND") +if INKSCAPE_EXECUTABLE_NAME is None: + if sys.platform == "win32": + # prefer inkscape.exe over inkscape.com which spawns a command window + INKSCAPE_EXECUTABLE_NAME = "inkscape.exe" + else: + INKSCAPE_EXECUTABLE_NAME = "inkscape" + + +class CommandNotFound(IOError): + """Command is not found""" + + +class ProgramRunError(ValueError): + """A specialized ValueError that is raised when a call to an external command fails. + It stores additional information about a failed call to an external program. + + If only the ``program`` parameter is given, it is interpreted as the error message. + Otherwise, the error message is compiled from all constructor parameters.""" + + program: str + """The absolute path to the called executable""" + + returncode: int + """Return code of the program call""" + + stderr: str + """stderr stream output of the call""" + + stdout: str + """stdout stream output of the call""" + + arguments: List + """Arguments of the call""" + + def __init__(self, program, returncode=None, stderr=None, stdout=None, args=None): + self.program = program + self.returncode = returncode + self.stderr = stderr + self.stdout = stdout + self.arguments = args + super().__init__(str(self)) + + def __str__(self): + if self.returncode is None: + return self.program + return ( + f"Return Code: {self.returncode}: {self.stderr}\n{self.stdout}" + f"\nargs: {self.args}" + ) + + +def which(program): + """ + Attempt different methods of trying to find if the program exists. + """ + if os.path.isabs(program) and os.path.isfile(program): + return program + # On Windows, shutil.which may give preference to .py files in the current directory + # (such as pdflatex.py), e.g. if .PY is in pathext, because the current directory is + # prepended to PATH. This can be suppressed by explicitly appending the current + # directory. + + try: + if sys.platform == "win32": + prog = warlock(program, path=os.environ["PATH"] + ";" + os.curdir) + if prog: + return prog + except ImportError: + pass + + try: + # Python3 only version of which + prog = warlock(program) + if prog: + return prog + except ImportError: + pass # python2 + + # There may be other methods for doing a `which` command for other + # operating systems; These should go here as they are discovered. + + raise CommandNotFound(f"Can not find the command: '{program}'") + + +def write_svg(svg, *filename): + """Writes an svg to the given filename""" + filename = os.path.join(*filename) + if os.path.isfile(filename): + return filename + with open(filename, "wb") as fhl: + if isinstance(svg, SvgDocumentElement): + svg = ElementTree(svg) + if hasattr(svg, "write"): + # XML document + svg.write(fhl) + elif isinstance(svg, bytes): + fhl.write(svg) + else: + raise ValueError("Not sure what type of SVG data this is.") + return filename + + +def to_arg(arg, oldie=False): + """Convert a python argument to a command line argument""" + if isinstance(arg, (tuple, list)): + (arg, val) = arg + arg = "-" + arg + if len(arg) > 2 and not oldie: + arg = "-" + arg + if val is True: + return arg + if val is False: + return None + return f"{arg}={str(val)}" + return str(arg) + + +def to_args(prog, *positionals, **arguments): + """Compile arguments and keyword arguments into a list of strings which Popen will + understand. + + :param prog: + Program executable prepended to the output. + :type first: ``str`` + + :Arguments: + * (``str``) -- String added as given + * (``tuple``) -- Ordered version of Keyword Arguments, see below + + :Keyword Arguments: + * *name* (``str``) -- + Becomes ``--name="val"`` + * *name* (``bool``) -- + Becomes ``--name`` + * *name* (``list``) -- + Becomes ``--name="val1"`` ... + * *n* (``str``) -- + Becomes ``-n=val`` + * *n* (``bool``) -- + Becomes ``-n`` + + :return: Returns a list of compiled arguments ready for Popen. + :rtype: ``list[str]`` + """ + args = [prog] + oldie = arguments.pop("oldie", False) + for arg, value in arguments.items(): + arg = arg.replace("_", "-").strip() + + if isinstance(value, tuple): + value = list(value) + elif not isinstance(value, list): + value = [value] + + for val in value: + args.append(to_arg((arg, val), oldie)) + + args += [to_arg(pos, oldie) for pos in positionals if pos is not None] + # Filter out empty non-arguments + return [arg for arg in args if arg is not None] + + +def to_args_sorted(prog, *positionals, **arguments): + """same as :func:`to_args`, but keyword arguments are sorted beforehand + + .. versionadded:: 1.2""" + return to_args(prog, *positionals, **dict(sorted(arguments.items()))) + + +def _call(program, *args, **kwargs): + stdin = kwargs.pop("stdin", None) + if isinstance(stdin, str): + stdin = stdin.encode("utf-8") + inpipe = PIPE if stdin else None + + args = to_args(which(program), *args, **kwargs) + + kwargs = {} + if sys.platform == "win32": + kwargs["creationflags"] = 0x08000000 # create no console window + + with Popen( + args, + shell=False, # Never have shell=True + stdin=inpipe, # StdIn not used (yet) + stdout=PIPE, # Grab any output (return it) + stderr=PIPE, # Take all errors, just incase + **kwargs, + ) as process: + (stdout, stderr) = process.communicate(input=stdin) + if process.returncode == 0: + return stdout + raise ProgramRunError(program, process.returncode, stderr, stdout, args) + + +def call(program, *args, **kwargs): + """ + Generic caller to open any program and return its stdout:: + + stdout = call('executable', arg1, arg2, dash_dash_arg='foo', d=True, ...) + + Will raise :class:`ProgramRunError` if return code is not 0. + + Keyword arguments: + return_binary: Should stdout return raw bytes (default: False) + + .. versionadded:: 1.1 + stdin: The string or bytes containing the stdin (default: None) + + All other arguments converted using :func:`to_args` function. + """ + # We use this long input because it's less likely to conflict with --binary= + binary = kwargs.pop("return_binary", False) + stdout = _call(program, *args, **kwargs) + # Convert binary to string when we wish to have strings we do this here + # so the mock tests will also run the conversion (always returns bytes) + if not binary and isinstance(stdout, bytes): + return stdout.decode(sys.stdout.encoding or "utf-8") + return stdout + + +def inkscape(svg_file, *args, **kwargs): + """ + Call Inkscape with the given svg_file and the given arguments, see call(). + + Returns the stdout of the call. + + .. versionchanged:: 1.3 + If the "actions" kwargs parameter is passed, it is checked whether the length of + the action string might lead to issues with the Windows CLI call character + limit. In this case, Inkscape is called in `--shell` + mode and the actions are fed in via stdin. This avoids violating the character + limit for command line arguments on Windows, which results in errors like this: + `[WinError 206] The filename or extension is too long`. + This workaround is also possible when calling Inkscape with long arguments + to `--export-id` and `--query-id`, by converting the call to the appropriate + action sequence. The stdout is cleaned to resemble non-interactive mode. + """ + os.environ["SELF_CALL"] = "true" + actions = kwargs.get("actions", None) + strip_stdout = False + # Keep some safe margin to the 8191 character limit. + if actions is not None and len(actions) > 7000: + args = args + ("--shell",) + kwargs["stdin"] = actions + kwargs.pop("actions") + strip_stdout = True + stdout = call(INKSCAPE_EXECUTABLE_NAME, svg_file, *args, **kwargs) + if strip_stdout: + split = re.split(r"\n> ", stdout) + if len(split) > 1: + if "\n" in split[1]: + stdout = "\n".join(split[1].split("\n")[1:]) + else: + stdout = "" + return stdout + + +def inkscape_command(svg, select=None, actions=None, *args, **kwargs): + """ + Executes Inkscape batch actions with the given input and returns a new . + + inkscape_command('', [select=...], [actions=...], [...]) + """ + with TemporaryDirectory(prefix="inkscape-command") as tmpdir: + svg_file = write_svg(svg, tmpdir, "input.svg") + select = ("select", select) if select else None + inkscape( + svg_file, + select, + batch_process=True, + export_overwrite=True, + actions=actions, + *args, + **kwargs, + ) + with open(svg_file, "rb") as fhl: + return fhl.read() + + +def take_snapshot(svg, dirname, name="snapshot", ext="png", dpi=96, **kwargs): + """ + Take a snapshot of the given svg file. + + Resulting filename is yielded back, after generator finishes, the + file is deleted so you must deal with the file inside the for loop. + """ + svg_file = write_svg(svg, dirname, name + ".svg") + ext_file = os.path.join(dirname, name + "." + str(ext).lower()) + inkscape( + svg_file, export_dpi=dpi, export_filename=ext_file, export_type=ext, **kwargs + ) + return ext_file + + +def is_inkscape_available(): + """Return true if the Inkscape executable is available.""" + try: + return bool(which(INKSCAPE_EXECUTABLE_NAME)) + except CommandNotFound: + return False diff --git a/extensions/botbox3000/deps/inkex/css/__init__.py b/extensions/botbox3000/deps/inkex/css/__init__.py new file mode 100644 index 0000000..99e96b5 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/css/__init__.py @@ -0,0 +1,3 @@ +"""CSS Processing module""" + +from .compiler import CSSCompiler diff --git a/extensions/botbox3000/deps/inkex/css/compiler.py b/extensions/botbox3000/deps/inkex/css/compiler.py new file mode 100644 index 0000000..6266c8c --- /dev/null +++ b/extensions/botbox3000/deps/inkex/css/compiler.py @@ -0,0 +1,483 @@ +# coding=utf-8 +# +# Copyright (C) 2023 - Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# + +"""CSS evaluation logic, forked from cssselect2 (rewritten without eval, targeted to +our data structure). CSS selectors are compiled into boolean evaluator functions. +All HTML-specific code has been removed, and we don't duplicate the tree data structure +but work on the normal tree.""" + +import re +from lxml import etree +from typing import Union, List +from tinycss2.nth import parse_nth + +from . import parser +from .parser import SelectorError + +# http://dev.w3.org/csswg/selectors/#whitespace +split_whitespace = re.compile("[^ \t\r\n\f]+").findall + + +def ascii_lower(string): # from webencodings + r"""Transform (only) ASCII letters to lower case: A-Z is mapped to a-z.""" + return string.encode("utf8").lower().decode("utf8") + + +# pylint: disable=protected-access,comparison-with-callable,invalid-name,bad-super-call +# pylint: disable=unnecessary-lambda-assignment + + +## Iterators without comments. +def iterancestors(element): + """Iterate over ancestors but ignore comments.""" + for e in element.iterancestors(): + if isinstance(e, etree._Comment): + continue + yield e + + +def iterdescendants(element): + """Iterate over descendants but ignore comments""" + for e in element.iterdescendants(): + if isinstance(e, etree._Comment): + continue + yield e + + +def itersiblings(element, preceding=False): + """Iterate over descendants but ignore comments""" + for e in element.itersiblings(preceding=preceding): + if isinstance(e, etree._Comment): + continue + yield e + + +def iterchildren(element): + """Iterate over children but ignore comments""" + for e in element.iterchildren(): + if isinstance(e, etree._Comment): + continue + yield e + + +def getprevious(element): + """Get the previous non-comment element""" + for e in itersiblings(element, preceding=True): + return e + return None + + +def getnext(element): + """Get the next non-comment element""" + for e in itersiblings(element, preceding=False): + return e + return None + + +def FALSE(_el): + """Always returns 0""" + return 0 + + +def TRUE(_el): + """Always returns 1""" + return 1 + + +class BooleanCompiler: + def __init__(self) -> None: + self._func_map = { + parser.CombinedSelector: self._compile_combined, + parser.CompoundSelector: self._compile_compound, + parser.NegationSelector: self._compile_negation, + parser.RelationalSelector: self._compile_relational, + parser.MatchesAnySelector: self._compile_any, + parser.SpecificityAdjustmentSelector: self._compile_any, + parser.LocalNameSelector: self._compile_local_name, + parser.NamespaceSelector: self._compile_namespace, + parser.ClassSelector: self._compile_class, + parser.IDSelector: self._compile_id, + parser.AttributeSelector: self._compile_attribute, + parser.PseudoClassSelector: self._compile_pseudoclass, + parser.FunctionalPseudoClassSelector: self._compile_functional_pseudoclass, + } + + def _compile_combined(self, selector: parser.CombinedSelector): + left_inside = self.compile_node(selector.left) + if left_inside == FALSE: + return FALSE # 0 and x == 0 + if left_inside == TRUE: + # 1 and x == x, but the element matching 1 still needs to exist. + if selector.combinator in (" ", ">"): + left = lambda el: el.getparent() is not None + + elif selector.combinator in ("~", "+"): + left = lambda el: getprevious(el) is not None + + else: + raise SelectorError("Unknown combinator", selector.combinator) + elif selector.combinator == " ": + left = lambda el: any((left_inside(e)) for e in el.ancestors()) + + elif selector.combinator == ">": + left = lambda el: el.getparent() is not None and left_inside(el.getparent()) + + elif selector.combinator == "+": + left = lambda el: getprevious(el) is not None and left_inside( + getprevious(el) + ) + + elif selector.combinator == "~": + left = lambda el: any( + (left_inside(e)) for e in itersiblings(el, preceding=True) + ) + + else: + raise SelectorError("Unknown combinator", selector.combinator) + + right = self.compile_node(selector.right) + if right == FALSE: + return FALSE # 0 and x == 0 + if right == TRUE: + return left # 1 and x == x + # Evaluate combinators right to left + return lambda el: right(el) and left(el) + + def _compile_compound(self, selector: parser.CompoundSelector): + sub_expressions = [ + expr + for expr in map(self.compile_node, selector.simple_selectors) + if expr != TRUE + ] + if len(sub_expressions) == 1: + return sub_expressions[0] + if FALSE in sub_expressions: + return FALSE + if sub_expressions: + return lambda e: all(expr(e) for expr in sub_expressions) + return TRUE # all([]) == True + + def _compile_negation(self, selector: parser.NegationSelector): + sub_expressions = [ + expr + for expr in [ + self.compile_node(selector.parsed_tree) + for selector in selector.selector_list + ] + if expr != TRUE + ] + if not sub_expressions: + return FALSE + return lambda el: not any(expr(el) for expr in sub_expressions) + + @staticmethod + def _get_subexpr(expression, relative_selector): + """Helper function for RelationalSelector""" + if relative_selector.combinator == " ": + return lambda el: any(expression(e) for e in iterdescendants(el)) + if relative_selector.combinator == ">": + return lambda el: any(expression(e) for e in iterchildren(el)) + if relative_selector.combinator == "+": + return lambda el: expression(next(itersiblings(el))) + if relative_selector.combinator == "~": + return lambda el: any(expression(e) for e in itersiblings(el)) + raise SelectorError( + f"Unknown relational selector '{relative_selector.combinator}'" + ) + + def _compile_relational(self, selector: parser.RelationalSelector): + sub_expr = [] + + for relative_selector in selector.selector_list: + expression = self.compile_node(relative_selector.selector.parsed_tree) + if expression == FALSE: + continue + sub_expr.append(self._get_subexpr(expression, relative_selector)) + return lambda el: any(expr(el) for expr in sub_expr) + + def _compile_any( + self, + selector: Union[ + parser.MatchesAnySelector, parser.SpecificityAdjustmentSelector + ], + ): + sub_expressions = [ + expr + for expr in [ + self.compile_node(selector.parsed_tree) + for selector in selector.selector_list + ] + if expr != FALSE + ] + if not sub_expressions: + return FALSE + return lambda el: any(expr(el) for expr in sub_expressions) + + def _compile_local_name(self, selector: parser.LocalNameSelector): + return lambda el: el.TAG == selector.local_name + + def _compile_namespace(self, selector: parser.NamespaceSelector): + return lambda el: el.NAMESPACE == selector.namespace + + def _compile_class(self, selector: parser.ClassSelector): + return lambda el: selector.class_name in el.classes + + def _compile_id(self, selector: parser.IDSelector): + return lambda el: super(etree.ElementBase, el).get("id", None) == selector.ident # type: ignore + + def _compile_attribute(self, selector: parser.AttributeSelector): + if selector.namespace is not None: + if selector.namespace: + key_func = lambda el: ( + f"{{{selector.namespace}}}{selector.name}" + if el.NAMESPACE != selector.namespace + else selector.name + ) + + else: + key_func = lambda el: selector.name + + value = selector.value + if selector.case_sensitive is False: + value = value.lower() + + attribute_value = ( + lambda el: super(etree.ElementBase, el) + .get(key_func(el), "") # type: ignore + .lower() + ) + + else: + attribute_value = lambda el: super(etree.ElementBase, el).get( # type: ignore + key_func(el), "" + ) + + if selector.operator is None: + return lambda el: key_func(el) in el.attrib + if selector.operator == "=": + return lambda el: ( + key_func(el) in el.attrib and attribute_value(el) == value + ) + if selector.operator == "~=": + return ( + FALSE + if len(value.split()) != 1 or value.strip() != value + else lambda el: value in split_whitespace(attribute_value(el)) + ) + if selector.operator == "|=": + return lambda el: ( + key_func(el) in el.attrib + and ( + attribute_value(el) == value + or attribute_value(el).startswith(value + "-") + ) + ) + if selector.operator == "^=": + if value: + return lambda el: attribute_value(el).startswith(value) + return FALSE + if selector.operator == "$=": + return ( + (lambda el: attribute_value(el).endswith(value)) if value else FALSE + ) + if selector.operator == "*=": + return (lambda el: value in attribute_value(el)) if value else FALSE + raise SelectorError("Unknown attribute operator", selector.operator) + # In any namespace + raise NotImplementedError # TODO + + def _compile_pseudoclass(self, selector: parser.PseudoClassSelector): + if selector.name in ("link", "any-link", "local-link"): + + def ancestors_or_self(el): + yield el + yield from iterancestors(el) + + return lambda el: any( + e.TAG == "a" and super(etree.ElementBase, e).get("href", "") != "" # type: ignore + for e in ancestors_or_self(el) + ) + if selector.name in ( + "visited", + "hover", + "active", + "focus", + "focus-within", + "focus-visible", + "target", + "target-within", + "current", + "past", + "future", + "playing", + "paused", + "seeking", + "buffering", + "stalled", + "muted", + "volume-locked", + "user-valid", + "user-invalid", + ): + # Not applicable in a static context: never match. + return FALSE + if selector.name in ("enabled", "disabled", "checked"): + # Not applicable to SVG + return FALSE + if selector.name in ("root", "scope"): + return lambda el: el.getparent() is None + if selector.name == "first-child": + return lambda el: getprevious(el) is None + if selector.name == "last-child": + return lambda el: getnext(el) is None + if selector.name == "first-of-type": + return lambda el: all( + s.tag != el.tag for s in itersiblings(el, preceding=True) + ) + if selector.name == "last-of-type": + return lambda el: all(s.tag != el.tag for s in itersiblings(el)) + if selector.name == "only-child": + return lambda el: getnext(el) is None and getprevious(el) is None + if selector.name == "only-of-type": + return lambda el: all(s.tag != el.tag for s in itersiblings(el)) and all( + s.tag != el.tag for s in itersiblings(el, preceding=True) + ) + if selector.name == "empty": + return lambda el: not list(el) and el.text is None + raise SelectorError("Unknown pseudo-class", selector.name) + + def _compile_lang(self, selector: parser.FunctionalPseudoClassSelector): + langs = [] + tokens = [ + token + for token in selector.arguments + if token.type not in ("whitespace", "comment") + ] + while tokens: + token = tokens.pop(0) + if token.type == "ident": + langs.append(token.lower_value) + elif token.type == "string": + langs.append(ascii_lower(token.value)) + else: + raise SelectorError("Invalid arguments for :lang()") + if tokens: + token = tokens.pop(0) + if token.type != "ident" and token.value != ",": + raise SelectorError("Invalid arguments for :lang()") + + def haslang(el, lang): + print( + el.get("lang"), + lang, + el.get("lang", "") == lang or el.get("lang", "").startswith(lang + "-"), + ) + return el.get("lang", "").lower() == lang or el.get( + "lang", "" + ).lower().startswith(lang + "-") + + return lambda el: any( + haslang(el, lang) or any(haslang(el2, lang) for el2 in iterancestors(el)) + for lang in langs + ) + + def _compile_functional_pseudoclass( + self, selector: parser.FunctionalPseudoClassSelector + ): + if selector.name == "lang": + return self._compile_lang(selector) + nth: List[str] = [] + selector_list: List[str] = [] + current_list = nth + for argument in selector.arguments: + if argument.type == "ident" and argument.value == "of": + if current_list is nth: + current_list = selector_list + continue + current_list.append(argument) + + if selector_list: + compiled = tuple( + self.compile_node(selector.parsed_tree) + for selector in parser.parse(selector_list) + ) + test = lambda el: all(expr(el) for expr in compiled) + + else: + test = TRUE + + if selector.name == "nth-child": + count = lambda el: sum( + 1 for e in itersiblings(el, preceding=True) if test(e) + ) + + elif selector.name == "nth-last-child": + count = lambda el: sum(1 for e in itersiblings(el) if test(e)) + elif selector.name == "nth-of-type": + count = lambda el: sum( + 1 + for s in (e for e in itersiblings(el, preceding=True) if test(e)) + if s.tag == el.tag + ) + + elif selector.name == "nth-last-of-type": + count = lambda el: sum( + 1 for s in (e for e in itersiblings(el) if test(e)) if s.tag == el.tag + ) + + else: + raise SelectorError("Unknown pseudo-class", selector.name) + + count_func = lambda el: count(el) if test(el) else float("nan") + + result = parse_nth(nth) + if result is None: + raise SelectorError(f"Invalid arguments for :{selector.name}()") + a, b = result + # x is the number of siblings before/after the element + # Matches if a positive or zero integer n exists so that: + # x = a*n + b-1 + # x = a*n + B + B = b - 1 + if a == 0: + # x = B + return lambda el: count_func(el) == B + + # n = (x - B) / a + def evaluator(el): + n, r = divmod(count_func(el) - B, a) + return r == 0 and n >= 0 + + return evaluator + + def compile_node(self, selector): + """Return a boolean expression, as a callable. + + When evaluated in a context where the `el` variable is an + :class:`cssselect2.tree.Element` object, tells whether the element is a + subject of `selector`. + + """ + try: + return self._func_map[selector.__class__](selector) + except KeyError as e: + raise TypeError(type(selector), selector) from e + + +CSSCompiler = BooleanCompiler() diff --git a/extensions/botbox3000/deps/inkex/css/parser.py b/extensions/botbox3000/deps/inkex/css/parser.py new file mode 100644 index 0000000..5ea39f0 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/css/parser.py @@ -0,0 +1,548 @@ +# Forked from cssselect2, 1.2.1, BSD License + +"""Parse CSS declarations.""" + +from tinycss2 import parse_component_value_list + +__all__ = ["parse"] + +SUPPORTED_PSEUDO_ELEMENTS = { + # As per CSS Pseudo-Elements Module Level 4 + "first-line", + "first-letter", + "prefix", + "postfix", + "selection", + "target-text", + "spelling-error", + "grammar-error", + "before", + "after", + "marker", + "placeholder", + "file-selector-button", + # As per CSS Generated Content for Paged Media Module + "footnote-call", + "footnote-marker", + # As per CSS Scoping Module Level 1 + "content", + "shadow", +} + + +def parse(input, namespaces=None, forgiving=False, relative=False): + """Yield tinycss2 selectors found in given ``input``. + + :param input: + A string, or an iterable of tinycss2 component values. + + """ + if isinstance(input, str): + input = parse_component_value_list(input) + tokens = TokenStream(input) + namespaces = namespaces or {} + try: + yield parse_selector(tokens, namespaces, relative) + except SelectorError as exception: + if forgiving: + return + raise exception + while 1: + next = tokens.next() + if next is None: + return + elif next == ",": + try: + yield parse_selector(tokens, namespaces, relative) + except SelectorError as exception: + if not forgiving: + raise exception + else: + if not forgiving: + raise SelectorError(next, f"unexpected {next.type} token.") + + +def parse_selector(tokens, namespaces, relative=False): + tokens.skip_whitespace_and_comment() + if relative: + peek = tokens.peek() + if peek in (">", "+", "~"): + initial_combinator = peek.value + tokens.next() + else: + initial_combinator = " " + tokens.skip_whitespace_and_comment() + result, pseudo_element = parse_compound_selector(tokens, namespaces) + while 1: + has_whitespace = tokens.skip_whitespace() + while tokens.skip_comment(): + has_whitespace = tokens.skip_whitespace() or has_whitespace + selector = Selector(result, pseudo_element) + if relative: + selector = RelativeSelector(initial_combinator, selector) + if pseudo_element is not None: + return selector + peek = tokens.peek() + if peek is None or peek == ",": + return selector + elif peek in (">", "+", "~"): + combinator = peek.value + tokens.next() + elif has_whitespace: + combinator = " " + else: + return selector + compound, pseudo_element = parse_compound_selector(tokens, namespaces) + result = CombinedSelector(result, combinator, compound) + + +def parse_compound_selector(tokens, namespaces): + type_selectors = parse_type_selector(tokens, namespaces) + simple_selectors = type_selectors if type_selectors is not None else [] + while 1: + simple_selector, pseudo_element = parse_simple_selector(tokens, namespaces) + if pseudo_element is not None or simple_selector is None: + break + simple_selectors.append(simple_selector) + + if simple_selectors or (type_selectors, pseudo_element) != (None, None): + return CompoundSelector(simple_selectors), pseudo_element + + peek = tokens.peek() + peek_type = peek.type if peek else "EOF" + raise SelectorError(peek, f"expected a compound selector, got {peek_type}") + + +def parse_type_selector(tokens, namespaces): + tokens.skip_whitespace() + qualified_name = parse_qualified_name(tokens, namespaces) + if qualified_name is None: + return None + + simple_selectors = [] + namespace, local_name = qualified_name + if local_name is not None: + simple_selectors.append(LocalNameSelector(local_name)) + if namespace is not None: + simple_selectors.append(NamespaceSelector(namespace)) + return simple_selectors + + +def parse_simple_selector(tokens, namespaces): + peek = tokens.peek() + if peek is None: + return None, None + if peek.type == "hash" and peek.is_identifier: + tokens.next() + return IDSelector(peek.value), None + elif peek == ".": + tokens.next() + next = tokens.next() + if next is None or next.type != "ident": + raise SelectorError(next, f"Expected a class name, got {next}") + return ClassSelector(next.value), None + elif peek.type == "[] block": + tokens.next() + attr = parse_attribute_selector(TokenStream(peek.content), namespaces) + return attr, None + elif peek == ":": + tokens.next() + next = tokens.next() + if next == ":": + next = tokens.next() + if next is None or next.type != "ident": + raise SelectorError(next, f"Expected a pseudo-element name, got {next}") + value = next.lower_value + if value not in SUPPORTED_PSEUDO_ELEMENTS: + raise SelectorError( + next, f"Expected a supported pseudo-element, got {value}" + ) + return None, value + elif next is not None and next.type == "ident": + name = next.lower_value + if name in ("before", "after", "first-line", "first-letter"): + return None, name + else: + return PseudoClassSelector(name), None + elif next is not None and next.type == "function": + name = next.lower_name + if name in ("is", "where", "not", "has"): + return parse_logical_combination(next, namespaces, name), None + else: + return (FunctionalPseudoClassSelector(name, next.arguments), None) + else: + raise SelectorError(next, f"unexpected {next} token.") + else: + return None, None + + +def parse_logical_combination(matches_any_token, namespaces, name): + forgiving = True + relative = False + if name == "is": + selector_class = MatchesAnySelector + elif name == "where": + selector_class = SpecificityAdjustmentSelector + elif name == "not": + forgiving = False + selector_class = NegationSelector + elif name == "has": + relative = True + selector_class = RelationalSelector + + selectors = [ + selector + for selector in parse( + matches_any_token.arguments, namespaces, forgiving, relative + ) + if selector.pseudo_element is None + ] + return selector_class(selectors) + + +def parse_attribute_selector(tokens, namespaces): + tokens.skip_whitespace() + qualified_name = parse_qualified_name(tokens, namespaces, is_attribute=True) + if qualified_name is None: + next = tokens.next() + raise SelectorError(next, f"expected attribute name, got {next}") + namespace, local_name = qualified_name + + tokens.skip_whitespace() + peek = tokens.peek() + if peek is None: + operator = None + value = None + elif peek in ("=", "~=", "|=", "^=", "$=", "*="): + operator = peek.value + tokens.next() + tokens.skip_whitespace() + next = tokens.next() + if next is None or next.type not in ("ident", "string"): + next_type = "None" if next is None else next.type + raise SelectorError(next, f"expected attribute value, got {next_type}") + value = next.value + else: + raise SelectorError(peek, f"expected attribute selector operator, got {peek}") + + tokens.skip_whitespace() + next = tokens.next() + case_sensitive = None + if next is not None: + if next.type == "ident" and next.value.lower() == "i": + case_sensitive = False + elif next.type == "ident" and next.value.lower() == "s": + case_sensitive = True + else: + raise SelectorError(next, f"expected ], got {next.type}") + return AttributeSelector(namespace, local_name, operator, value, case_sensitive) + + +def parse_qualified_name(tokens, namespaces, is_attribute=False): + """Return ``(namespace, local)`` for given tokens. + + Can also return ``None`` for a wildcard. + + The empty string for ``namespace`` means "no namespace". + + """ + peek = tokens.peek() + if peek is None: + return None + if peek.type == "ident": + first_ident = tokens.next() + peek = tokens.peek() + if peek != "|": + namespace = "" if is_attribute else namespaces.get(None, None) + return namespace, (first_ident.value, first_ident.lower_value) + tokens.next() + namespace = namespaces.get(first_ident.value) + if namespace is None: + raise SelectorError( + first_ident, f"undefined namespace prefix: {first_ident.value}" + ) + elif peek == "*": + next = tokens.next() + peek = tokens.peek() + if peek != "|": + if is_attribute: + raise SelectorError(next, f"expected local name, got {next.type}") + return namespaces.get(None, None), None + tokens.next() + namespace = None + elif peek == "|": + tokens.next() + namespace = "" + else: + return None + + # If we get here, we just consumed '|' and set ``namespace`` + next = tokens.next() + if next.type == "ident": + return namespace, (next.value, next.lower_value) + elif next == "*" and not is_attribute: + return namespace, None + else: + raise SelectorError(next, f"expected local name, got {next.type}") + + +class SelectorError(ValueError): + """A specialized ``ValueError`` for invalid selectors.""" + + +class TokenStream: + def __init__(self, tokens): + self.tokens = iter(tokens) + self.peeked = [] # In reversed order + + def next(self): + if self.peeked: + return self.peeked.pop() + else: + return next(self.tokens, None) + + def peek(self): + if not self.peeked: + self.peeked.append(next(self.tokens, None)) + return self.peeked[-1] + + def skip(self, skip_types): + found = False + while 1: + peek = self.peek() + if peek is None or peek.type not in skip_types: + break + self.next() + found = True + return found + + def skip_whitespace(self): + return self.skip(["whitespace"]) + + def skip_comment(self): + return self.skip(["comment"]) + + def skip_whitespace_and_comment(self): + return self.skip(["comment", "whitespace"]) + + +class Selector: + def __init__(self, tree, pseudo_element=None): + self.parsed_tree = tree + self.pseudo_element = pseudo_element + if pseudo_element is None: + #: Tuple of 3 integers: http://www.w3.org/TR/selectors/#specificity + self.specificity = tree.specificity + else: + a, b, c = tree.specificity + self.specificity = a, b, c + 1 + + def __repr__(self): + pseudo = f"::{self.pseudo_element}" if self.pseudo_element else "" + return f"{self.parsed_tree!r}{pseudo}" + + +class RelativeSelector: + def __init__(self, combinator, selector): + self.combinator = combinator + self.selector = selector + + @property + def specificity(self): + return self.selector.specificity + + @property + def pseudo_element(self): + return self.selector.pseudo_element + + def __repr__(self): + return ( + f"{self.selector!r}" + if self.combinator == " " + else f"{self.combinator} {self.selector!r}" + ) + + +class CombinedSelector: + def __init__(self, left, combinator, right): + #: Combined or compound selector + self.left = left + # One of `` `` (a single space), ``>``, ``+`` or ``~``. + self.combinator = combinator + #: compound selector + self.right = right + + @property + def specificity(self): + a1, b1, c1 = self.left.specificity + a2, b2, c2 = self.right.specificity + return a1 + a2, b1 + b2, c1 + c2 + + def __repr__(self): + return f"{self.left!r}{self.combinator}{self.right!r}" + + +class CompoundSelector: + def __init__(self, simple_selectors): + self.simple_selectors = simple_selectors + + @property + def specificity(self): + if self.simple_selectors: + # zip(*foo) turns [(a1, b1, c1), (a2, b2, c2), ...] + # into [(a1, a2, ...), (b1, b2, ...), (c1, c2, ...)] + return tuple( + map(sum, zip(*(sel.specificity for sel in self.simple_selectors))) + ) + else: + return 0, 0, 0 + + def __repr__(self): + return "".join(map(repr, self.simple_selectors)) + + +class LocalNameSelector: + specificity = 0, 0, 1 + + def __init__(self, local_name): + self.local_name, self.lower_local_name = local_name + + def __repr__(self): + return self.local_name + + +class NamespaceSelector: + specificity = 0, 0, 0 + + def __init__(self, namespace): + #: The namespace URL as a string, + #: or the empty string for elements not in any namespace. + self.namespace = namespace + + def __repr__(self): + if self.namespace == "": + return "|" + else: + return f"{{{self.namespace}}}|" + + +class IDSelector: + specificity = 1, 0, 0 + + def __init__(self, ident): + self.ident = ident + + def __repr__(self): + return f"#{self.ident}" + + +class ClassSelector: + specificity = 0, 1, 0 + + def __init__(self, class_name): + self.class_name = class_name + + def __repr__(self): + return f".{self.class_name}" + + +class AttributeSelector: + specificity = 0, 1, 0 + + def __init__(self, namespace, name, operator, value, case_sensitive): + self.namespace = namespace + self.name, self.lower_name = name + #: A string like ``=`` or ``~=``, or None for ``[attr]`` selectors + self.operator = operator + #: A string, or None for ``[attr]`` selectors + self.value = value + #: ``True`` if case-sensitive, ``False`` if case-insensitive, ``None`` + #: if depends on the document language + self.case_sensitive = case_sensitive + + def __repr__(self): + namespace = "*|" if self.namespace is None else f"{{{self.namespace}}}" + case_sensitive = ( + "" + if self.case_sensitive is None + else f" {'s' if self.case_sensitive else 'i'}" + ) + return f"[{namespace}{self.name}{self.operator}{self.value!r}{case_sensitive}]" + + +class PseudoClassSelector: + specificity = 0, 1, 0 + + def __init__(self, name): + self.name = name + + def __repr__(self): + return ":" + self.name + + +class FunctionalPseudoClassSelector: + specificity = 0, 1, 0 + + def __init__(self, name, arguments): + self.name = name + self.arguments = arguments + + def __repr__(self): + return f":{self.name}{tuple(self.arguments)!r}" + + +class NegationSelector: + def __init__(self, selector_list): + self.selector_list = selector_list + + @property + def specificity(self): + if self.selector_list: + return max(selector.specificity for selector in self.selector_list) + else: + return (0, 0, 0) + + def __repr__(self): + return f":not({', '.join(repr(sel) for sel in self.selector_list)})" + + +class RelationalSelector: + def __init__(self, selector_list): + self.selector_list = selector_list + + @property + def specificity(self): + if self.selector_list: + return max(selector.specificity for selector in self.selector_list) + else: + return (0, 0, 0) + + def __repr__(self): + return f":has({', '.join(repr(sel) for sel in self.selector_list)})" + + +class MatchesAnySelector: + def __init__(self, selector_list): + self.selector_list = selector_list + + @property + def specificity(self): + if self.selector_list: + return max(selector.specificity for selector in self.selector_list) + else: + return (0, 0, 0) + + def __repr__(self): + return f":is({', '.join(repr(sel) for sel in self.selector_list)})" + + +class SpecificityAdjustmentSelector: + def __init__(self, selector_list): + self.selector_list = selector_list + + @property + def specificity(self): + return (0, 0, 0) + + def __repr__(self): + return f":where({', '.join(repr(sel) for sel in self.selector_list)})" diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/README.rst b/extensions/botbox3000/deps/inkex/deprecated-simple/README.rst new file mode 100644 index 0000000..df3e2dc --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/README.rst @@ -0,0 +1,4 @@ +# coding=utf-8This directory contains compatibility layers for all the `simple` modules, such as `simplepath` and `simplestyle` + +This directory IS NOT a module path, to denote this we are using a dash in the name and there is no '__init__.py' + diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/bezmisc.py b/extensions/botbox3000/deps/inkex/deprecated-simple/bezmisc.py new file mode 100644 index 0000000..92b63f6 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/bezmisc.py @@ -0,0 +1,46 @@ +# coding=utf-8 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=invalid-name,unused-argument +"""Deprecated bezmisc API""" + +from inkex.deprecated import deprecate +from inkex import bezier + +bezierparameterize = deprecate(bezier.bezierparameterize) +linebezierintersect = deprecate(bezier.linebezierintersect) +bezierpointatt = deprecate(bezier.bezierpointatt) +bezierslopeatt = deprecate(bezier.bezierslopeatt) +beziertatslope = deprecate(bezier.beziertatslope) +tpoint = deprecate(bezier.tpoint) +beziersplitatt = deprecate(bezier.beziersplitatt) +pointdistance = deprecate(bezier.pointdistance) +Gravesen_addifclose = deprecate(bezier.addifclose) +balf = deprecate(bezier.balf) +bezierlengthSimpson = deprecate(bezier.bezierlength) +beziertatlength = deprecate(bezier.beziertatlength) +bezierlength = bezierlengthSimpson + + +@deprecate +def Simpson(func, a, b, n_limit, tolerance): + """bezier.simpson(a, b, n_limit, tolerance, balf_arguments)""" + raise AttributeError( + """Because bezmisc.Simpson used global variables, it's not possible to + call the replacement code automatically. In fact it's unlikely you were + using the code or functionality you think you were since it's a highly + broken way of writing python.""" + ) diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/cspsubdiv.py b/extensions/botbox3000/deps/inkex/deprecated-simple/cspsubdiv.py new file mode 100644 index 0000000..91b2237 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/cspsubdiv.py @@ -0,0 +1,25 @@ +# coding=utf-8 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=invalid-name +"""Deprecated cspsubdiv API""" + +from inkex.deprecated import deprecate +from inkex import bezier + +maxdist = deprecate(bezier.maxdist) +cspsubdiv = deprecate(bezier.cspsubdiv) +subdiv = deprecate(bezier.subdiv) diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/cubicsuperpath.py b/extensions/botbox3000/deps/inkex/deprecated-simple/cubicsuperpath.py new file mode 100644 index 0000000..cb6f124 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/cubicsuperpath.py @@ -0,0 +1,52 @@ +# coding=utf-8 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=invalid-name +"""Deprecated cubic super path API""" + +from inkex.deprecated import deprecate +from inkex import paths + + +@deprecate +def ArcToPath(p1, params): + return paths.arc_to_path(p1, params) + + +@deprecate +def CubicSuperPath(simplepath): + return paths.Path(simplepath).to_superpath() + + +@deprecate +def unCubicSuperPath(csp): + return paths.CubicSuperPath(csp).to_path().to_arrays() + + +@deprecate +def parsePath(d): + return paths.CubicSuperPath(paths.Path(d)) + + +@deprecate +def formatPath(p): + return str(paths.Path(unCubicSuperPath(p))) + + +matprod = deprecate(paths.matprod) +rotmat = deprecate(paths.rotmat) +applymat = deprecate(paths.applymat) +norm = deprecate(paths.norm) diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/ffgeom.py b/extensions/botbox3000/deps/inkex/deprecated-simple/ffgeom.py new file mode 100644 index 0000000..fd0c21b --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/ffgeom.py @@ -0,0 +1,92 @@ +# coding=utf-8 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=invalid-name,missing-docstring +"""Deprecated ffgeom API""" + +from collections import namedtuple + +from inkex.deprecated import deprecate +from inkex.transforms import DirectedLineSegment as NewSeg + +try: + NaN = float("NaN") +except ValueError: + PosInf = 1e300000 + NaN = PosInf / PosInf + + +class Point(namedtuple("Point", "x y")): + __slots__ = () + + def __getitem__(self, key): + if isinstance(key, str): + key = "xy".index(key) + return super(Point, self).__getitem__(key) + + +class Segment(NewSeg): + @deprecate + def __init__(self, e0, e1): + """inkex.transforms.DirectedLineSegment((x1, y1), (x2, y2))""" + if isinstance(e0, dict): + e0 = (e0["x"], e0["y"]) + if isinstance(e1, dict): + e1 = (e1["x"], e1["y"]) + super(Segment, self).__init__(e0, e1) + + def __getitem__(self, key): + if key: + return {"x": self.x.maximum, "y": self.y.maximum} + return {"x": self.x.minimum, "y": self.y.minimum} + + delta_x = lambda self: self.width + delta_y = lambda self: self.height + run = delta_x + rise = delta_y + + def distanceToPoint(self, p): + return self.distance_to_point(p["x"], p["y"]) + + def perpDistanceToPoint(self, p): + return self.perp_distance(p["x"], p["y"]) + + def angle(self): + return super(Segment, self).angle + + def length(self): + return super(Segment, self).length + + def pointAtLength(self, length): + return self.point_at_length(length) + + def pointAtRatio(self, ratio): + return self.point_at_ratio(ratio) + + def createParallel(self, p): + self.parallel(p["x"], p["y"]) + + +@deprecate +def intersectSegments(s1, s2): + """transforms.Segment(s1).intersect(s2)""" + return Point(*s1.intersect(s2)) + + +@deprecate +def dot(s1, s2): + """transforms.Segment(s1).dot(s2)""" + return s1.dot(s2) diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/run_command.py b/extensions/botbox3000/deps/inkex/deprecated-simple/run_command.py new file mode 100755 index 0000000..fbe0ad1 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/run_command.py @@ -0,0 +1,80 @@ +# coding=utf-8 +# +# Copyright (C) 2008 Stephen Silver +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA +# +""" +Deprecated module for running SVG-generating commands in Inkscape extensions +""" + +import os +import sys +import tempfile +from subprocess import Popen, PIPE + +from inkex.deprecated import deprecate + + +def run(command_format, prog_name): + """inkex.commands.call(...)""" + svgfile = tempfile.mktemp(".svg") + command = command_format % svgfile + msg = None + # ps2pdf may attempt to write to the current directory, which may not + # be writeable, so we switch to the temp directory first. + try: + os.chdir(tempfile.gettempdir()) + except IOError: + pass + + try: + proc = Popen(command, shell=True, stdout=PIPE, stderr=PIPE) + return_code = proc.wait() + out = proc.stdout.read() + err = proc.stderr.read() + + if msg is None: + if return_code: + msg = "{} failed:\n{}\n{}\n".format(prog_name, out, err) + elif err: + sys.stderr.write( + "{} executed but logged the following error:\n{}\n{}\n".format( + prog_name, out, err + ) + ) + except Exception as inst: + msg = "Error attempting to run {}: {}".format(prog_name, str(inst)) + + # If successful, copy the output file to stdout. + if msg is None: + if os.name == "nt": # make stdout work in binary on Windows + import msvcrt + + msvcrt.setmode(sys.stdout.fileno(), os.O_BINARY) + try: + with open(svgfile, "rb") as fhl: + sys.stdout.write(fhl.read().decode(sys.stdout.encoding)) + except IOError as inst: + msg = "Error reading temporary file: {}".format(str(inst)) + + try: + # Clean up. + os.remove(svgfile) + except (IOError, OSError): + pass + + # Output error message (if any) and exit. + return msg diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/simplepath.py b/extensions/botbox3000/deps/inkex/deprecated-simple/simplepath.py new file mode 100644 index 0000000..6eaaf3b --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/simplepath.py @@ -0,0 +1,68 @@ +# coding=utf-8 +# COPYRIGHT +# +# pylint: disable=invalid-name +# +""" +Depreicated simplepath replacements with documentation +""" + +import math +from inkex.deprecated import deprecate, DeprecatedDict +from inkex.transforms import Transform +from inkex.paths import Path + +pathdefs = DeprecatedDict( + { + "M": ["L", 2, [float, float], ["x", "y"]], + "L": ["L", 2, [float, float], ["x", "y"]], + "H": ["H", 1, [float], ["x"]], + "V": ["V", 1, [float], ["y"]], + "C": [ + "C", + 6, + [float, float, float, float, float, float], + ["x", "y", "x", "y", "x", "y"], + ], + "S": ["S", 4, [float, float, float, float], ["x", "y", "x", "y"]], + "Q": ["Q", 4, [float, float, float, float], ["x", "y", "x", "y"]], + "T": ["T", 2, [float, float], ["x", "y"]], + "A": [ + "A", + 7, + [float, float, float, int, int, float, float], + ["r", "r", "a", 0, "s", "x", "y"], + ], + "Z": ["L", 0, [], []], + } +) + + +@deprecate +def parsePath(d): + """element.path.to_arrays()""" + return Path(d).to_arrays() + + +@deprecate +def formatPath(a): + """str(element.path) or str(Path(array))""" + return str(Path(a)) + + +@deprecate +def translatePath(p, x, y): + """Path(array).translate(x, y)""" + p[:] = Path(p).translate(x, y).to_arrays() + + +@deprecate +def scalePath(p, x, y): + """Path(array).scale(x, y)""" + p[:] = Path(p).scale(x, y).to_arrays() + + +@deprecate +def rotatePath(p, a, cx=0, cy=0): + """Path(array).rotate(angle_degrees, (center_x, center_y))""" + p[:] = Path(p).rotate(math.degrees(a), (cx, cy)).to_arrays() diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/simplestyle.py b/extensions/botbox3000/deps/inkex/deprecated-simple/simplestyle.py new file mode 100644 index 0000000..b4cdb69 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/simplestyle.py @@ -0,0 +1,55 @@ +# coding=utf-8 +# COPYRIGHT +"""DOCSTRING""" + +import inkex +from inkex.colors.spaces.named import _COLORS as svgcolors +from inkex.deprecated import deprecate + + +@deprecate +def parseStyle(s): + """dict(inkex.Style.parse_str(s))""" + return dict(inkex.Style.parse_str(s)) + + +@deprecate +def formatStyle(a): + """str(inkex.Style(a))""" + return str(inkex.Style(a)) + + +@deprecate +def isColor(c): + """inkex.colors.is_color(c)""" + return inkex.colors.is_color(c) + + +@deprecate +def parseColor(c): + """inkex.Color(c).to_rgb()""" + return tuple(inkex.Color(c).to_rgb()) + + +@deprecate +def formatColoria(a): + """str(inkex.Color(a))""" + return str(inkex.ColorRGB(a)) + + +@deprecate +def formatColorfa(a): + """str(inkex.Color(a))""" + return str(inkex.ColorRGB([b * 255 for b in a])) + + +@deprecate +def formatColor3i(r, g, b): + """str(inkex.Color((r, g, b)))""" + return str(inkex.ColorRGB((r, g, b))) + + +@deprecate +def formatColor3f(r, g, b): + """str(inkex.Color((r, g, b)))""" + return str(inkex.ColorRGB((r * 255, g * 255, b * 255))) diff --git a/extensions/botbox3000/deps/inkex/deprecated-simple/simpletransform.py b/extensions/botbox3000/deps/inkex/deprecated-simple/simpletransform.py new file mode 100644 index 0000000..f408cd0 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated-simple/simpletransform.py @@ -0,0 +1,122 @@ +# coding=utf-8 +# +# pylint: disable=invalid-name +# +""" +Depreicated simpletransform replacements with documentation +""" + +import warnings + +from inkex.deprecated import deprecate +from inkex.transforms import Transform, BoundingBox, cubic_extrema +from inkex.paths import Path + +import inkex, cubicsuperpath + + +def _lists(mat): + return [list(row) for row in mat] + + +@deprecate +def parseTransform(transf, mat=None): + """Transform(str).matrix""" + t = Transform(transf) + if mat is not None: + t = Transform(mat) @ t + return _lists(t.matrix) + + +@deprecate +def formatTransform(mat): + """str(Transform(mat))""" + if len(mat) == 3: + warnings.warn("3x3 matrices not suported") + mat = mat[:2] + return str(Transform(mat)) + + +@deprecate +def invertTransform(mat): + """-Transform(mat)""" + return _lists((-Transform(mat)).matrix) + + +@deprecate +def composeTransform(mat1, mat2): + """Transform(M1) * Transform(M2)""" + return _lists((Transform(mat1) @ Transform(mat2)).matrix) + + +@deprecate +def composeParents(node, mat): + """elem.composed_transform() or elem.transform * Transform(mat)""" + return (node.transform @ Transform(mat)).matrix + + +@deprecate +def applyTransformToNode(mat, node): + """elem.transform = Transform(mat) * elem.transform""" + node.transform = Transform(mat) @ node.transform + + +@deprecate +def applyTransformToPoint(mat, pt): + """Transform(mat).apply_to_point(pt)""" + pt2 = Transform(mat).apply_to_point(pt) + # Apply in place as original method was modifying arrays in place. + # but don't do this in your code! This is not good code design. + pt[0] = pt2[0] + pt[1] = pt2[1] + + +@deprecate +def applyTransformToPath(mat, path): + """Path(path).transform(mat)""" + return Path(path).transform(Transform(mat)).to_arrays() + + +@deprecate +def fuseTransform(node): + """node.apply_transform()""" + return node.apply_transform() + + +@deprecate +def boxunion(b1, b2): + """list(BoundingBox(b1) + BoundingBox(b2))""" + bbox = BoundingBox(b1[:2], b1[2:]) + BoundingBox(b2[:2], b2[2:]) + return bbox.x.minimum, bbox.x.maximum, bbox.y.minimum, bbox.y.maximum + + +@deprecate +def roughBBox(path): + """list(Path(path)).bounding_box())""" + bbox = Path(path).bounding_box() + return bbox.x.minimum, bbox.x.maximum, bbox.y.minimum, bbox.y.maximum + + +@deprecate +def refinedBBox(path): + """list(Path(path)).bounding_box())""" + bbox = Path(path).bounding_box() + return bbox.x.minimum, bbox.x.maximum, bbox.y.minimum, bbox.y.maximum + + +@deprecate +def cubicExtrema(y0, y1, y2, y3): + """from inkex.transforms import cubic_extrema""" + return cubic_extrema(y0, y1, y2, y3) + + +@deprecate +def computeBBox(aList, mat=[[1, 0, 0], [0, 1, 0]]): + """sum([node.bounding_box() for node in aList])""" + return sum([node.bounding_box() for node in aList], None) + + +@deprecate +def computePointInNode(pt, node, mat=[[1.0, 0.0, 0.0], [0.0, 1.0, 0.0]]): + """(-Transform(node.transform * mat)).apply_to_point(pt)""" + return (-Transform(node.transform * mat)).apply_to_point(pt) diff --git a/extensions/botbox3000/deps/inkex/deprecated/__init__.py b/extensions/botbox3000/deps/inkex/deprecated/__init__.py new file mode 100644 index 0000000..180a1c2 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated/__init__.py @@ -0,0 +1,3 @@ +from .main import * +from .meta import deprecate, _deprecated +from .deprecatedeffect import DeprecatedEffect, Effect diff --git a/extensions/botbox3000/deps/inkex/deprecated/deprecatedeffect.py b/extensions/botbox3000/deps/inkex/deprecated/deprecatedeffect.py new file mode 100644 index 0000000..a867ff7 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated/deprecatedeffect.py @@ -0,0 +1,304 @@ +# coding=utf-8 +# +# Copyright (C) 2018 - Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Deprecation functionality for the pre-1.0 Inkex main effect class. +""" +# +# We ignore a lot of pylint warnings here: +# +# pylint: disable=invalid-name,unused-argument,missing-docstring,too-many-public-methods +# + +import sys +import argparse +from argparse import ArgumentParser + +from .. import utils +from .. import base +from ..base import SvgThroughMixin, InkscapeExtension +from ..localization import inkex_gettext as _ +from .meta import _deprecated + + +class DeprecatedEffect: + """An Inkscape effect, takes SVG in and outputs SVG, providing a deprecated layer""" + + options = argparse.Namespace() + + def __init__(self): + super().__init__() + self._doc_ids = None + self._args = None + + # These are things we reference in the deprecated code, they are provided + # by the new effects code, but we want to keep this as a Mixin so these + # items will keep pylint happy and let use check our code as we write. + if not hasattr(self, "svg"): + from ..elements import SvgDocumentElement + + self.svg = SvgDocumentElement() + if not hasattr(self, "arg_parser"): + self.arg_parser = ArgumentParser() + if not hasattr(self, "run"): + self.run = self.affect + + @classmethod + def _deprecated( + cls, name, msg=_("{} is deprecated and should be removed"), stack=3 + ): + """Give the user a warning about their extension using a deprecated API""" + _deprecated( + msg.format("Effect." + name, cls=cls.__module__ + "." + cls.__name__), + stack=stack, + ) + + @property + def OptionParser(self): + self._deprecated( + "OptionParser", + _( + "{} or `optparse` has been deprecated and replaced with `argparser`. " + "You must change `self.OptionParser.add_option` to " + "`self.arg_parser.add_argument`; the arguments are similar." + ), + ) + return self + + def add_option(self, *args, **kw): + # Convert type string into type method as needed + if "type" in kw: + kw["type"] = { + "string": str, + "int": int, + "float": float, + "inkbool": utils.Boolean, + }.get(kw["type"]) + if kw.get("action", None) == "store": + # Default store action not required, removed. + kw.pop("action") + args = [arg for arg in args if arg != ""] + self.arg_parser.add_argument(*args, **kw) + + def effect(self): + self._deprecated( + "effect", + _( + "{} method is now a required method. It should " + "be created on {cls}, even if it does nothing." + ), + ) + + @property + def current_layer(self): + self._deprecated( + "current_layer", + _( + "{} is now a method in the SvgDocumentElement class. " + "Use `self.svg.get_current_layer()` instead." + ), + ) + return self.svg.get_current_layer() + + @property + def view_center(self): + self._deprecated( + "view_center", + _( + "{} is now a method in the SvgDocumentElement class. " + "Use `self.svg.get_center_position()` instead." + ), + ) + return self.svg.namedview.center + + @property + def selected(self): + self._deprecated( + "selected", + _( + "{} is now a dict in the SvgDocumentElement class. " + "Use `self.svg.selected`." + ), + ) + return {elem.get("id"): elem for elem in self.svg.selected} + + @property + def doc_ids(self): + self._deprecated( + "doc_ids", + _( + "{} is now a method in the SvgDocumentElement class. " + "Use `self.svg.get_ids()` instead." + ), + ) + if self._doc_ids is None: + self._doc_ids = dict.fromkeys(self.svg.get_ids()) + return self._doc_ids + + def getselected(self): + self._deprecated("getselected", _("{} has been removed")) + + def getElementById(self, eid): + self._deprecated( + "getElementById", + _( + "{} is now a method in the SvgDocumentElement class. " + "Use `self.svg.getElementById(eid)` instead." + ), + ) + return self.svg.getElementById(eid) + + def xpathSingle(self, xpath): + self._deprecated( + "xpathSingle", + _( + "{} is now a new method in the SvgDocumentElement class. " + "Use `self.svg.getElement(path)` instead." + ), + ) + return self.svg.getElement(xpath) + + def getParentNode(self, node): + self._deprecated( + "getParentNode", + _("{} is no longer in use. Use the lxml `.getparent()` method instead."), + ) + return node.getparent() + + def getNamedView(self): + self._deprecated( + "getNamedView", + _( + "{} is now a property of the SvgDocumentElement class. " + "Use `self.svg.namedview` to access this element." + ), + ) + return self.svg.namedview + + def createGuide(self, posX, posY, angle): + from ..elements import Guide + + self._deprecated( + "createGuide", + _( + "{} is now a method of the namedview element object. " + "Use `self.svg.namedview.add(Guide().move_to(x, y, a))` instead." + ), + ) + return self.svg.namedview.add(Guide().move_to(posX, posY, angle)) + + def affect(self, args=sys.argv[1:], output=True): # pylint: disable=dangerous-default-value + # We need a list as the default value to preserve backwards compatibility + self._deprecated( + "affect", _("{} is now `Effect.run()`. The `output` argument has changed.") + ) + self._args = args[-1:] + return self.run(args=args) + + @property + def args(self): + self._deprecated("args", _("self.args[-1] is now self.options.input_file.")) + return self._args + + @property + def svg_file(self): + self._deprecated("svg_file", _("self.svg_file is now self.options.input_file.")) + return self.options.input_file + + def save_raw(self, ret): + # Derived class may implement "output()" + # Attention: 'cubify.py' implements __getattr__ -> hasattr(self, 'output') + # returns True + if hasattr(self.__class__, "output"): + self._deprecated("output", "Use `save()` or `save_raw()` instead.", stack=5) + return getattr(self, "output")() + return base.InkscapeExtension.save_raw(self, ret) + + def uniqueId(self, old_id, make_new_id=True): + self._deprecated( + "uniqueId", + _( + "{} is now a method in the SvgDocumentElement class. " + " Use `self.svg.get_unique_id(old_id)` instead." + ), + ) + return self.svg.get_unique_id(old_id) + + def getDocumentWidth(self): + self._deprecated( + "getDocumentWidth", + _( + "{} is now a property of the SvgDocumentElement class. " + "Use `self.svg.width` instead." + ), + ) + return self.svg.get("width") + + def getDocumentHeight(self): + self._deprecated( + "getDocumentHeight", + _( + "{} is now a property of the SvgDocumentElement class. " + "Use `self.svg.height` instead." + ), + ) + return self.svg.get("height") + + def getDocumentUnit(self): + self._deprecated( + "getDocumentUnit", + _( + "{} is now a property of the SvgDocumentElement class. " + "Use `self.svg.unit` instead." + ), + ) + return self.svg.unit + + def unittouu(self, string): + self._deprecated( + "unittouu", + _( + "{} is now a method in the SvgDocumentElement class. " + "Use `self.svg.unittouu(str)` instead." + ), + ) + return self.svg.unittouu(string) + + def uutounit(self, val, unit): + self._deprecated( + "uutounit", + _( + "{} is now a method in the SvgDocumentElement class. " + "Use `self.svg.uutounit(value, unit)` instead." + ), + ) + return self.svg.uutounit(val, unit) + + def addDocumentUnit(self, value): + self._deprecated( + "addDocumentUnit", + _( + "{} is now a method in the SvgDocumentElement class. " + "Use `self.svg.add_unit(value)` instead." + ), + ) + return self.svg.add_unit(value) + + +class Effect(SvgThroughMixin, DeprecatedEffect, InkscapeExtension): + """An Inkscape effect, takes SVG in and outputs SVG""" diff --git a/extensions/botbox3000/deps/inkex/deprecated/main.py b/extensions/botbox3000/deps/inkex/deprecated/main.py new file mode 100644 index 0000000..ca3d954 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated/main.py @@ -0,0 +1,237 @@ +# coding=utf-8 +# +# Copyright (C) 2018 - Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Provide some documentation to existing extensions about why they're failing. +""" +# +# We ignore a lot of pylint warnings here: +# +# pylint: disable=invalid-name,unused-argument,missing-docstring,too-many-public-methods +# + +import os +import sys +import re +import warnings +import argparse +import cssselect + +from ..transforms import Transform +from .. import utils +from .. import units +from ..elements._base import BaseElement, ShapeElement +from ..elements._selected import ElementList +from .meta import deprecate, _deprecated +from ..styles import ConditionalStyle, Style +from ..colors import Color + +warnings.simplefilter("default") +# To load each of the deprecated sub-modules (the ones without a namespace) +# we will add the directory to our pythonpath so older scripts can find them + +INKEX_DIR = os.path.abspath(os.path.dirname(os.path.dirname(__file__))) +SIMPLE_DIR = os.path.join(INKEX_DIR, "deprecated-simple") + +if os.path.isdir(SIMPLE_DIR): + sys.path.append(SIMPLE_DIR) + + +class DeprecatedDict(dict): + @deprecate + def __getitem__(self, key): + return super().__getitem__(key) + + @deprecate + def __iter__(self): + return super().__iter__() + + +# legacy inkex members + + +class lazyproxy: + """Proxy, use as decorator on a function with provides the wrapped object. + The decorated function is called when a member is accessed on the proxy. + """ + + def __init__(self, getwrapped): + """ + :param getwrapped: Callable which returns the wrapped object + """ + self._getwrapped = getwrapped + + def __getattr__(self, name): + return getattr(self._getwrapped(), name) + + def __call__(self, *args, **kwargs): + return self._getwrapped()(*args, **kwargs) + + +@lazyproxy +def localize(): + _deprecated("inkex.localize was moved to inkex.localization.localize.", stack=3) + from ..localization import localize as wrapped + + return wrapped + + +def are_near_relative(a, b, eps): + _deprecated( + "inkex.are_near_relative was moved to inkex.units.are_near_relative", stack=2 + ) + return units.are_near_relative(a, b, eps) + + +def debug(what): + _deprecated("inkex.debug was moved to inkex.utils.debug.", stack=2) + return utils.debug(what) + + +# legacy inkex members <= 0.48.x + + +def unittouu(string): + _deprecated( + "inkex.unittouu is now a method in the SvgDocumentElement class. " + "Use `self.svg.unittouu(str)` instead.", + stack=2, + ) + return units.convert_unit(string, "px") + + +# optparse.Values.ensure_value + + +def ensure_value(self, attr, value): + _deprecated("Effect().options.ensure_value was removed.", stack=2) + if getattr(self, attr, None) is None: + setattr(self, attr, value) + return getattr(self, attr) + + +argparse.Namespace.ensure_value = ensure_value # type: ignore + + +@deprecate +def zSort(inNode, idList): + """self.svg.get_z_selected()""" + sortedList = [] + theid = inNode.get("id") + if theid in idList: + sortedList.append(theid) + for child in inNode: + if len(sortedList) == len(idList): + break + sortedList += zSort(child, idList) + return sortedList + + +# This can't be handled as a mixin class because of circular importing. +def description(self, value): + """Use elem.desc = value""" + self.desc = value + + +BaseElement.description = deprecate(description, "1.1") + + +def composed_style(element: ShapeElement): + """Calculate the final styles applied to this element + This function has been deprecated in favor of BaseElement.specified_style()""" + return element.specified_style() + + +ShapeElement.composed_style = deprecate(composed_style, "1.2") + + +def paint_order(selection: ElementList): + """Use :func:`rendering_order`""" + return selection.rendering_order() + + +ElementList.paint_order = deprecate(paint_order, "1.2") # type: ignore + + +def transform_imul(self, matrix): + """Use @= operator instead""" + return self.__imatmul__(matrix) + + +def transform_mul(self, matrix): + """Use @ operator instead""" + return self.__matmul__(matrix) + + +Transform.__imul__ = deprecate(transform_imul, "1.2") # type: ignore +Transform.__mul__ = deprecate(transform_mul, "1.2") # type: ignore + + +def to_xpath(self): + """Depending on whether you need to apply the rule to an invididual element + or find all matches in a subtree, use + + .. code:: + style.matches(element) + style.all_matches(subtree) + """ + return "|".join(self.to_xpaths()) + + +def to_xpaths(self): + """Depending on whether you need to apply the rule to an invididual element + or find all matches in a subtree, use + + .. code:: + style.matches(element) + style.all_matches(subtree) + """ + result = [] + for rule in self.rules: + ret = ( + cssselect.HTMLTranslator().selector_to_xpath(cssselect.parse(str(rule))[0]) + + " " + ) + ret = re.compile(r"(::|\/)([a-z]+)(?=\W)(?!-)").sub(r"\1svg:\2", ret) + result.append(ret.strip()) + + return result + + +ConditionalStyle.to_xpath = deprecate(to_xpath, "1.4") # type: ignore +ConditionalStyle.to_xpaths = deprecate(to_xpaths, "1.4") # type: ignore + + +def apply_shorthands(self): + """Apply all shorthands in this style. Shorthands are now simplified automatically, + so this method does nothing""" + + +Style.apply_shorthands = deprecate(apply_shorthands, "1.4") # type: ignore + + +def to_rgba(self, alpha=1.0): + """ + Opacity is now controlled via alpha property regardless of color space being used. + """ + ret = self.to_rgb() + ret.alpha = float(alpha) + return ret + + +Color.to_rgba = deprecate(to_rgba, "1.5") # type: ignore diff --git a/extensions/botbox3000/deps/inkex/deprecated/meta.py b/extensions/botbox3000/deps/inkex/deprecated/meta.py new file mode 100644 index 0000000..cebd93c --- /dev/null +++ b/extensions/botbox3000/deps/inkex/deprecated/meta.py @@ -0,0 +1,109 @@ +# coding=utf-8 +# +# Copyright (C) 2018 - Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Deprecation functionality which does not require imports from Inkex. +""" + +import os +import traceback +import warnings +from typing import Optional + +try: + DEPRECATION_LEVEL = int(os.environ.get("INKEX_DEPRECATION_LEVEL", 1)) +except ValueError: + DEPRECATION_LEVEL = 1 + + +def _deprecated(msg, stack=2, level=DEPRECATION_LEVEL): + """Internal method for raising a deprecation warning""" + if level > 1: + msg += " ; ".join(traceback.format_stack()) + if level: + warnings.warn(msg, category=DeprecationWarning, stacklevel=stack + 1) + + +def deprecate(func, version: Optional[str] = None): + r"""Function decorator for deprecation functions which have a one-liner + equivalent in the new API. The one-liner has to passed as a string + to the decorator. + + >>> @deprecate + >>> def someOldFunction(*args): + >>> '''Example replacement code someNewFunction('foo', ...)''' + >>> someNewFunction('foo', *args) + + Or if the args API is the same: + + >>> someOldFunction = deprecate(someNewFunction) + + """ + + def _inner(*args, **kwargs): + _deprecated(f"{func.__module__}.{func.__name__} -> {func.__doc__}", stack=2) + return func(*args, **kwargs) + + _inner.__name__ = func.__name__ + if func.__doc__: + if version is None: + _inner.__doc__ = "Deprecated -> " + func.__doc__ + else: + _inner.__doc__ = f"""{func.__doc__}\n\n.. deprecated:: {version}\n""" + return _inner + + +class DeprecatedSvgMixin: + """Mixin which adds deprecated API elements to the SvgDocumentElement""" + + @property + def selected(self): + """svg.selection""" + return self.selection + + @deprecate + def set_selected(self, *ids): + r"""svg.selection.set(\*ids)""" + return self.selection.set(*ids) + + @deprecate + def get_z_selected(self): + """svg.selection.rendering_order()""" + return self.selection.rendering_order() + + @deprecate + def get_selected(self, *types): + r"""svg.selection.filter(\*types).values()""" + return self.selection.filter(*types).values() + + @deprecate + def get_selected_or_all(self, *types): + """Set select_all = True in extension class""" + if not self.selection: + self.selection.set_all() + return self.selection.filter(*types) + + @deprecate + def get_selected_bbox(self): + """selection.bounding_box()""" + return self.selection.bounding_box() + + @deprecate + def get_first_selected(self, *types): + r"""selection.filter(\*types).first() or [0] if you'd like an error""" + return self.selection.filter(*types).first() diff --git a/extensions/botbox3000/deps/inkex/elements/__init__.py b/extensions/botbox3000/deps/inkex/elements/__init__.py new file mode 100644 index 0000000..d426ff6 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/__init__.py @@ -0,0 +1,56 @@ +""" +Element based interface provides the bulk of features that allow you to +interact directly with the SVG xml interface. + +See the documentation for each of the elements for details on how it works. +""" + +from ._utils import addNS, NSS +from ._parser import SVG_PARSER, load_svg +from ._base import ShapeElement, BaseElement +from ._svg import SvgDocumentElement +from ._groups import Group, Layer, Anchor, Marker, ClipPath +from ._polygons import PathElement, Polyline, Polygon, Line, Rectangle, Circle, Ellipse +from ._text import ( + FlowRegion, + FlowRoot, + FlowPara, + FlowDiv, + FlowSpan, + TextElement, + TextPath, + Tspan, + SVGfont, + FontFace, + Glyph, + MissingGlyph, +) +from ._use import Symbol, Use +from ._meta import ( + Defs, + StyleElement, + Script, + Desc, + Title, + NamedView, + Guide, + Metadata, + ForeignObject, + Switch, + Grid, + Page, +) +from ._filters import ( + Filter, + Pattern, + Mask, + Gradient, + LinearGradient, + RadialGradient, + PathEffect, + Stop, + MeshGradient, + MeshRow, + MeshPatch, +) +from ._image import Image diff --git a/extensions/botbox3000/deps/inkex/elements/_base.py b/extensions/botbox3000/deps/inkex/elements/_base.py new file mode 100644 index 0000000..ea04e2a --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_base.py @@ -0,0 +1,939 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Sergei Izmailov +# Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=arguments-differ +""" +Provide extra utility to each svg element type specific to its type. + +This is useful for having a common interface for each element which can +give path, transform, and property access easily. +""" + +from __future__ import annotations + +from copy import deepcopy +from typing import ( + Any, + Tuple, + Optional, + overload, + TypeVar, + List, + Callable, + TYPE_CHECKING, +) +from lxml import etree +import re + +if TYPE_CHECKING: + from ._svg import SvgDocumentElement + +from ..base import SvgOutputMixin +from ..paths import Path +from ..styles import Style, Classes, StyleValue +from ..transforms import Transform, BoundingBox +from ..utils import FragmentError +from ..units import convert_unit, render_unit, parse_unit +from ._utils import ChildToProperty, NSS, addNS, removeNS, splitNS +from ..properties import ( + _ShorthandValueConverter, + _get_tokens_from_value, + all_properties, +) +from ._selected import ElementList +from ._parser import NodeBasedLookup, SVG_PARSER + +T = TypeVar("T", bound="BaseElement") # pylint: disable=invalid-name + + +class BaseElement(etree.ElementBase): + """Provide automatic namespaces to all calls""" + + # pylint: disable=too-many-public-methods + + def __init_subclass__(cls): + if cls.tag_name: + NodeBasedLookup.register_class(cls) + + @classmethod + def is_class_element( # pylint: disable=unused-argument + cls, elem: etree.Element + ) -> bool: + """Hook to do more restrictive check in addition to (ns,tag) match + + .. versionadded:: 1.2 + The function has been made public.""" + return True + + tag_name = "" + + @property + def TAG(self): # pylint: disable=invalid-name + """Return the tag_name without NS""" + if not self.tag_name: + return removeNS(super().tag)[-1] + return removeNS(self.tag_name)[-1] + + @classmethod + def new(cls, *children, **attrs): + """Create a new element, converting attrs values to strings.""" + obj = cls(*children) + obj.update(**attrs) + return obj + + NAMESPACE = property(lambda self: splitNS(self.tag_name)[0]) + """Get namespace of element""" + + PARSER = SVG_PARSER + """A reference to the :attr:`inkex.elements._parser.SVG_PARSER`""" + WRAPPED_ATTRS = ( + # (prop_name, [optional: attr_name], cls) + ("transform", Transform), + ("style", Style), + ("classes", "class", Classes), + ) # type: Tuple[Tuple[Any, ...], ...] + """A list of attributes that are automatically converted to objects.""" + + # We do this because python2 and python3 have different ways + # of combining two dictionaries that are incompatible. + # This allows us to update these with inheritance. + @property + def wrapped_attrs(self): + """Map attributes to property name and wrapper class""" + return {row[-2]: (row[0], row[-1]) for row in self.WRAPPED_ATTRS} + + @property + def wrapped_props(self): + """Map properties to attribute name and wrapper class""" + return {row[0]: (row[-2], row[-1]) for row in self.WRAPPED_ATTRS} + + typename = property(lambda self: type(self).__name__) + """Type name of the element""" + xml_path = property(lambda self: self.getroottree().getpath(self)) + """XPath representation of the element in its tree + + .. versionadded:: 1.1""" + desc = ChildToProperty("svg:desc", prepend=True) + """The element's long-form description (for accessibility purposes) + + .. versionadded:: 1.1""" + title = ChildToProperty("svg:title", prepend=True) + """The element's short-form description (for accessibility purposes) + + .. versionadded:: 1.1""" + + _root: Optional["SvgDocumentElement"] = None + + def __getattr__(self, name): + """Get the attribute, but load it if it is not available yet""" + if name in self.wrapped_props: + (attr, cls) = self.wrapped_props[name] + + # The reason we do this here and not in _init is because lxml + # is inconsistant about when elements are initialised. + # So we make this a lazy property. + def _set_attr(new_item): + if new_item: + self.set(attr, str(new_item)) + else: + self.attrib.pop(attr, None) # pylint: disable=no-member + + # pylint: disable=no-member + value = cls(self.attrib.get(attr, None), callback=_set_attr, element=self) + setattr(self, name, value) + return value + raise AttributeError(f"Can't find attribute {self.typename}.{name}") + + def __setattr__(self, name, value): + """Set the attribute, update it if needed""" + if name in self.wrapped_props: + (attr, cls) = self.wrapped_props[name] + # Don't call self.set or self.get (infinate loop) + if value: + if not isinstance(value, cls): + value = cls(value) + self.attrib[attr] = str(value) + else: + self.attrib.pop(attr, None) # pylint: disable=no-member + else: + super().__setattr__(name, value) + + def get(self, attr, default=None): + """Get element attribute named, with addNS support.""" + if attr in self.wrapped_attrs: + (prop, _) = self.wrapped_attrs[attr] + value = getattr(self, prop, None) + # We check the boolean nature of the value, because empty + # transformations and style attributes are equiv to not-existing + ret = str(value) if value else default + return ret + return super().get(addNS(attr), default) + + def set(self, attr, value): + """Set element attribute named, with addNS support""" + if attr == "id" and value is not None: + try: + oldid = self.get("id", None) + if oldid is not None and oldid in self.root.ids: + self.root.ids.pop(oldid) + if value in self.root.ids: + raise ValueError(f"ID {value} already exists in this document") + self.root.ids[value] = self + except FragmentError: # element is unrooted + pass + if attr in self.wrapped_attrs: + # Always keep the local wrapped class up to date. + (prop, cls) = self.wrapped_attrs[attr] + setattr(self, prop, cls(value)) + value = getattr(self, prop) + if not value: + return + if value is None: + self.attrib.pop(addNS(attr), None) # pylint: disable=no-member + else: + value = str(value) + super().set(addNS(attr), value) + + def update(self, **kwargs): + """ + Update element attributes using keyword arguments + + Note: double underscore is used as namespace separator, + i.e. "namespace__attr" argument name will be treated as "namespace:attr" + + :param kwargs: dict with name=value pairs + :return: self + """ + for name, value in kwargs.items(): + self.set(name, value) + return self + + def pop(self, attr, default=None): + """Delete/remove the element attribute named, with addNS support.""" + if attr in self.wrapped_attrs: + # Always keep the local wrapped class up to date. + (prop, cls) = self.wrapped_attrs[attr] + value = getattr(self, prop) + setattr(self, prop, cls(None)) + return value + return self.attrib.pop(addNS(attr), default) # pylint: disable=no-member + + @overload + def add( + self, child1: BaseElement, child2: BaseElement, *children: BaseElement + ) -> Tuple[BaseElement]: ... + + @overload + def add(self, child: T) -> T: ... + + def add(self, *children): + """ + Like append, but will do multiple children and will return + children or only child + """ + for child in children: + self.append(child) + return children if len(children) != 1 else children[0] + + def tostring(self): + """Return this element as it would appear in an svg document""" + # This kind of hack is pure maddness, but etree provides very little + # in the way of fragment printing, prefering to always output valid xml + + svg = SvgOutputMixin.get_template(width=0, height=0).getroot() + svg.append(self.copy()) + return svg.tostring().split(b">\n ", 1)[-1][:-6] + + def set_random_id( + self, + prefix: Optional[str] = None, + size: Optional[int] = None, + backlinks: bool = False, + blacklist: Optional[List[str]] = None, + ): + """Sets the id attribute if it is not already set. + + The id consists of a prefix and an appended random integer of length size. + Args: + prefix (str, optional): the prefix of the new ID. Defaults to the tag name. + size (Optional[int], optional): number of digits of the second part of the + id. If None, the length is chosen based on the amount of existing + objects. Defaults to None. + + .. versionchanged:: 1.2 + The default of this value has been changed from 4 to None. + backlinks (bool, optional): Whether to update the links in existing objects + that reference this element. Defaults to False. + blacklist (List[str], optional): An additional list of ids that are not + allowed to be used. This is useful when bulk inserting objects. + Defaults to None. + + .. versionadded:: 1.2 + """ + prefix = str(self) if prefix is None else prefix + self.set_id( + self.root.get_unique_id(prefix, size=size, blacklist=blacklist), + backlinks=backlinks, + ) + + def set_random_ids( + self, + prefix: Optional[str] = None, + levels: int = -1, + backlinks: bool = False, + blacklist: Optional[List[str]] = None, + ): + """Same as set_random_id, but will apply also to children + + The id consists of a prefix and an appended random integer of length size. + Args: + prefix (str, optional): the prefix of the new ID. Defaults to the tag name. + levels (int, optional): the depth of the tree traversion, if negative, no + limit is imposed. Defaults to -1. + backlinks (bool, optional): Whether to update the links in existing objects + that reference this element. Defaults to False. + blacklist (List[str], optional): An additional list of ids that are not + allowed to be used. This is useful when bulk inserting objects. + Defaults to None. + + .. versionadded:: 1.2 + """ + self.set_random_id(prefix=prefix, backlinks=backlinks, blacklist=blacklist) + if levels != 0: + for child in self: + if hasattr(child, "set_random_ids"): + child.set_random_ids( + prefix=prefix, levels=levels - 1, backlinks=backlinks + ) + + eid = property(lambda self: self.get_id()) + """Property to access the element's id; will set a new unique id if not set.""" + + def get_id(self, as_url=0) -> str: + """Get the id for the element, will set a new unique id if not set. + + as_url - If set to 1, returns #{id} as a string + If set to 2, returns url(#{id}) as a string + + Args: + as_url (int, optional): + - If set to 1, returns #{id} as a string + - If set to 2, returns url(#{id}) as a string. + + Defaults to 0. + + .. versionadded:: 1.1 + + Returns: + str: formatted id + """ + if "id" not in self.attrib: + self.set_random_id(self.TAG) + eid = self.get("id") + if as_url > 0: + eid = "#" + eid + if as_url > 1: + eid = f"url({eid})" + return eid + + def set_id(self, new_id, backlinks=False): + """Set the id and update backlinks to xlink and style urls if needed""" + old_id = self.get("id", None) + self.set("id", new_id) + if backlinks and old_id: + for elem in self.root.getElementsByHref(old_id): + elem.href = self + for attr in ["clip-path", "mask"]: + for elem in self.root.getElementsByHref(old_id, attribute=attr): + elem.set(attr, self.get_id(2)) + for elem in self.root.getElementsByStyleUrl(old_id): + elem.style.update_urls(old_id, new_id) + + @property + def root(self) -> "SvgDocumentElement": + """Get the root document element from any element descendent""" + if self._root is not None: + return self._root + + root, parent = self, self + while parent is not None: + root, parent = parent, parent.getparent() + + from ._svg import SvgDocumentElement + + if not isinstance(root, SvgDocumentElement): + raise FragmentError("Element fragment does not have a document root!") + + self._root = root + return root + + def get_or_create(self, xpath, nodeclass=None, prepend=False): + """Get or create the given xpath, pre/append new node if not found. + + .. versionchanged:: 1.1 + The ``nodeclass`` attribute is optional; if not given, it is looked up + using :func:`~inkex.elements._parser.NodeBasedLookup.find_class`""" + node = self.findone(xpath) + if node is None: + if nodeclass is None: + nodeclass = NodeBasedLookup.find_class(xpath) + node = nodeclass() + if prepend: + self.insert(0, node) + else: + self.append(node) + return node + + def descendants(self): + """Walks the element tree and yields all elements, parent first + + .. versionchanged:: 1.1 + The ``*types`` attribute was removed + + """ + + return ElementList( + self.root, + [ + element + for element in self.iter() + if isinstance(element, (BaseElement, str)) + ], + ) + + def ancestors(self, elem=None, stop_at=()): + """ + Walk the parents and yield all the ancestor elements, parent first + + Args: + elem (BaseElement, optional): If provided, it will stop at the last common + ancestor. Defaults to None. + + .. versionadded:: 1.1 + + stop_at (tuple, optional): If provided, it will stop at the first parent + that is in this list. Defaults to (). + + .. versionadded:: 1.1 + + Returns: + ElementList: list of ancestors + """ + + try: + return ElementList(self.root, self._ancestors(elem=elem, stop_at=stop_at)) + except FragmentError: + return ElementList(self, self._ancestors(elem=elem, stop_at=stop_at)) + + def _ancestors(self, elem, stop_at): + if isinstance(elem, BaseElement): + stop_at = list(elem.ancestors()) + for parent in self.iterancestors(): + yield parent + if parent in stop_at: + break + + def backlinks(self, *types): + """Get elements which link back to this element, like ancestors but via + xlinks""" + if not types or isinstance(self, types): + yield self + my_id = self.get("id") + if my_id is not None: + elems = list(self.root.getElementsByHref(my_id)) + list( + self.root.getElementsByStyleUrl(my_id) + ) + for elem in elems: + if hasattr(elem, "backlinks"): + for child in elem.backlinks(*types): + yield child + + def xpath(self, pattern, namespaces=NSS): # pylint: disable=dangerous-default-value + """Wrap xpath call and add svg namespaces""" + return super().xpath(pattern, namespaces=namespaces) + + def findall(self, pattern, namespaces=NSS): # pylint: disable=dangerous-default-value + """Wrap findall call and add svg namespaces""" + return super().findall(pattern, namespaces=namespaces) + + def findone(self, xpath): + """Gets a single element from the given xpath or returns None""" + el_list = self.xpath(xpath) + return el_list[0] if el_list else None + + def delete(self): + """Delete this node from it's parent node""" + if self.getparent() is not None: + self.getparent().remove(self) + + def remove_all(self, *types): + """Remove all children or child types + + .. versionadded:: 1.1""" + types = tuple(NodeBasedLookup.find_class(t) for t in types) + for child in self: + if not types or isinstance(child, types): + self.remove(child) + + def replace_with(self, elem): + """Replace this element with the given element""" + self.getparent().replace(self, elem) + + if not elem.get("id") and self.get("id"): + elem.set("id", self.get("id")) + if not elem.label and self.label: + elem.label = self.label + return elem + + def copy(self): + """Make a copy of the element and return it""" + elem = deepcopy(self) + elem.set("id", None) + return elem + + def duplicate(self): + """Like copy(), but the copy stays in the tree and sets a random id on the + duplicate. + + .. versionchanged:: 1.2 + A random id is also set on all the duplicate's descendants""" + elem = self.copy() + self.addnext(elem) + elem.set_random_ids() + return elem + + def __str__(self): + # We would do more here, but lxml is VERY unpleseant when it comes to + # namespaces, basically over printing details and providing no + # supression mechanisms to turn off xml's over engineering. + return str(self.tag).split("}", maxsplit=1)[-1] + + @property + def href(self): + """Returns the referred-to element if available + + .. versionchanged:: 1.1 + A setter for href was added.""" + ref = self.get("href") or self.get("xlink:href") + if not ref: + return None + return self.root.getElementById(ref.strip("#")) + + @href.setter + def href(self, elem): + """Set the href object""" + if isinstance(elem, BaseElement): + elem = elem.get_id() + if self.get("href"): + self.set("href", "#" + elem) + else: + self.set("xlink:href", "#" + elem) + + @property + def label(self): + """Returns the inkscape label""" + return self.get("inkscape:label", None) + + @label.setter + def label(self, value): + """Sets the inkscape label""" + self.set("inkscape:label", str(value)) + + def is_sensitive(self): + """Return true if this element is sensitive in inkscape + + .. versionadded:: 1.1""" + return self.get("sodipodi:insensitive", None) != "true" + + def set_sensitive(self, sensitive=True): + """Set the sensitivity of the element/layer + + .. versionadded:: 1.1""" + # Sensitive requires None instead of 'false' + self.set("sodipodi:insensitive", ["true", None][sensitive]) + + @property + def unit(self): + """Return the unit being used by the owning document, cached + + .. versionadded:: 1.1""" + try: + return self.root.unit + except FragmentError: + return "px" # Don't cache. + + @staticmethod + def to_dimensional(value, to_unit="px"): + """Convert a value given in user units (px) the given unit type + + .. versionadded:: 1.2""" + return convert_unit(value, to_unit) + + @staticmethod + def to_dimensionless(value): + """Convert a length value into user units (px) + + .. versionadded:: 1.2""" + return convert_unit(value, "px") + + def uutounit(self, value, to_unit="px"): + """Convert a unit value to a given unit. If the value does not have a unit, + "Document" units are assumed. "Document units" are an Inkscape-specific concept. + For most use-cases, :func:`to_dimensional` is more appropriate. + + .. versionadded:: 1.1""" + return convert_unit(value, to_unit, default=self.unit) + + def unittouu(self, value): + """Convert a unit value into document units. "Document unit" is an + Inkscape-specific concept. For most use-cases, :func:`viewport_to_unit` (when + the size of an object given in viewport units is needed) or + :func:`to_dimensionless` (when the equivalent value without unit is needed) is + more appropriate. + + .. versionadded:: 1.1""" + return convert_unit(value, self.unit) + + def unit_to_viewport(self, value, unit="px"): + """Converts a length value to viewport units, as defined by the width/height + element on the root (i.e. applies the equivalent transform of the viewport) + + .. versionadded:: 1.2""" + return self.to_dimensional( + self.to_dimensionless(value) * self.root.equivalent_transform_scale, unit + ) + + def viewport_to_unit(self, value, unit="px"): + """Converts a length given on the viewport to the specified unit in the user + coordinate system + + .. versionadded:: 1.2""" + return self.to_dimensional( + self.to_dimensionless(value) / self.root.equivalent_transform_scale, unit + ) + + def add_unit(self, value): + """Add document unit when no unit is specified in the string. + + .. versionadded:: 1.1""" + return render_unit(value, self.unit) + + def cascaded_style(self): + """Returns the cascaded style of an element (all rules that apply the element + itself), based on the stylesheets, the presentation attributes and the inline + style using the respective specificity of the style. + + see https://www.w3.org/TR/CSS22/cascade.html#cascading-order + + .. versionadded:: 1.2 + + Returns: + Style: the cascaded style + + """ + return Style.cascaded_style(self) + + def specified_style(self): + """Returns the specified style of an element, i.e. the cascaded style + + inheritance, see https://www.w3.org/TR/CSS22/cascade.html#specified-value. + + Returns: + Style: the specified style + + .. versionadded:: 1.2 + """ + return Style.specified_style(self) + + def get_computed_style(self, key): + """Returns the computed style value with respect to + n element, i.e. the cascaded style + + inheritance, see https://www.w3.org/TR/CSS22/cascade.html#computed-value. + + This is more efficient if only few style values per element are queried. If + many attributes are queried, use :func:`specified_style`. + + .. versionadded:: 1.4 + """ + return Style._get_style(key, self) + + def presentation_style(self): + """Return presentation attributes of an element as style + + .. versionadded:: 1.2""" + style = Style() + for key in self.keys(): + if ( + key in all_properties + # Shorthands cannot be set by presentation attributes + and not isinstance( + all_properties[key].converter, _ShorthandValueConverter + ) + and all_properties[key].presentation + ): + style[key] = StyleValue(_get_tokens_from_value(self.attrib[key])) + return style + + def composed_transform(self, other=None): + """Calculate every transform down to the other element + if none specified the transform is to the root document element + """ + parent = self.getparent() + if parent is not other and isinstance(parent, BaseElement): + return parent.composed_transform(other) @ self.transform + return self.transform + + def _add_to_tree_callback(self, element): + try: + element._root = self._root + self.root.add_to_tree_callback(element) + except (FragmentError, AttributeError): + pass + + @staticmethod + def _remove_from_tree_callback(oldtree, element): + try: + oldtree.root.remove_from_tree_callback(element) + except (FragmentError, AttributeError): + pass + + def __element_adder( + self, element: BaseElement, add_func: Callable[[BaseElement], None] + ): + BaseElement._remove_from_tree_callback(element, element) + # Make sure that we have an ID cache before adding the element, + # otherwise we will try to add this element twice to the cache + try: + self.root.ids + except FragmentError: + pass + try: + add_func(element) + except Exception as err: + BaseElement._add_to_tree_callback(element, element) + raise err + self._add_to_tree_callback(element) + + # Overrides to keep track of styles and IDs + def addnext(self, element): + self.__element_adder(element, super(etree.ElementBase, self).addnext) + + def addprevious(self, element): + self.__element_adder(element, super(etree.ElementBase, self).addprevious) + + def append(self, element): + self.__element_adder(element, super(etree.ElementBase, self).append) + + def clear(self, keep_tail=False): + subelements = iter(self) + old_id = self.get("id", None) + super().clear(keep_tail) + for element in subelements: + BaseElement._remove_from_tree_callback(self, element) + if old_id is not None and old_id in self.root.ids: + self.root.ids.pop(old_id) + + def extend(self, elements): + if not isinstance(elements, (list, tuple)): + elements = list(elements) + for element in elements: + BaseElement._remove_from_tree_callback(element, element) + try: + self.root.ids + except FragmentError: + pass + try: + super().extend(elements) + except Exception as err: + for element in elements: + BaseElement._add_to_tree_callback(element, element) + raise err + for element in elements: + self._add_to_tree_callback(element) + + def insert(self, index, element): + self.__element_adder( + element, + lambda element: super(etree.ElementBase, self).insert(index, element), + ) + + def remove(self, element): + super().remove(element) + BaseElement._remove_from_tree_callback(self, element) + + def replace(self, old_element, new_element): + def replacer(new_element): + super(etree.ElementBase, self).replace(old_element, new_element) + BaseElement._remove_from_tree_callback(self, old_element) + + self.__element_adder(new_element, replacer) + + +NodeBasedLookup.default = BaseElement + + +class ShapeElement(BaseElement): + """Elements which have a visible representation on the canvas""" + + @property + def path(self) -> Path: + """Gets the outline or path of the element, this may be a simple bounding box""" + return self.get_path() + + @path.setter + def path(self, path): + self.set_path(path) + + @property + def clip(self): + """Gets the clip path element (if any). May be set through CSS. + + .. versionadded:: 1.1""" + return self.get_computed_style("clip-path") + + @clip.setter + def clip(self, elem): + self.set("clip-path", elem.get_id(as_url=2)) + + def get_path(self) -> Path: + """Generate a path for this object which can inform the bounding box""" + raise NotImplementedError( + f"Path should be provided by svg elem {self.typename}." + ) + + def set_path(self, path): + """Set the path for this object (if possible)""" + raise AttributeError( + f"Path can not be set on this element: {self.typename} <- {path}." + ) + + def to_path_element(self): + """Replace this element with a path element""" + from ._polygons import PathElement + + elem = PathElement() + elem.path = self.path + elem.style = self.effective_style() + elem.transform = self.transform + return elem + + def effective_style(self): + """Without parent styles, what is the effective style is""" + return self.style + + def bounding_box(self, transform=None): + # type: (Optional[Transform]) -> Optional[BoundingBox] + """BoundingBox of the shape + + .. versionchanged:: 1.1 + result adjusted for element's clip path if applicable.""" + shape_box = self.shape_box(transform) + clip = self.clip + if clip is None or shape_box is None: + return shape_box + return shape_box & clip.bounding_box(Transform(transform) @ self.transform) + + def shape_box(self, transform=None): + # type: (Optional[Transform]) -> Optional[BoundingBox] + """BoundingBox of the unclipped shape + + .. versionadded:: 1.1 + Previous :func:`bounding_box` function, returning the bounding box + without computing the effect of a possible clip.""" + path = self.path.to_absolute() + if transform is True: + path = path.transform(self.composed_transform()) + else: + path = path.transform(self.transform) + if transform: # apply extra transformation + path = path.transform(transform) + return path.bounding_box() + + def is_visible(self): + """Returns false if this object is invisible + + .. versionchanged:: 1.3 + rely on cascaded_style() to include CSS and presentation attributes + include `visibility` attribute with check for inherit + include ancestors + + .. versionadded:: 1.1""" + return self._is_visible() + + def _is_visible(self, inherit_visibility=True): + # iterate over self and ancestors + # This does not use :func:`get_computed_style` but its own iteration + # logic to avoid duplicate evaluation of styles: a child is also invisible + # if the parent has opacity:0, but opacity is not inherited - so we need + # to check the specified style of all parents and ignore inheritance + # altogether + for element in [self] + list(self.ancestors()): + get_style = element.cascaded_style().get + # case display:none + if get_style("display", "inline") == "none": + return False + # case opacity:0 + if not float(get_style("opacity", 1.0)): + return False + # only check if childs visibility is inherited + if inherit_visibility: + # case visibility:hidden + if get_style("visibility", "inherit") in ( + "hidden", + "collapse", + ): + return False + # case visibility: not inherit + elif get_style("visibility", "inherit") != "inherit": + inherit_visibility = False + + return True + + def get_line_height_uu(self): + """Returns the specified value of line-height, in user units + + .. versionadded:: 1.1""" + style = self.specified_style() + font_size = style("font-size") # already in uu + line_height = style("line-height") + parsed = parse_unit(line_height) + if parsed is None: + return font_size * 1.2 + if parsed[1] == "%": + return font_size * parsed[0] * 0.01 + return self.to_dimensionless(line_height) + + +class ViewboxMixin: + """Mixin for elements with viewboxes, such as , """ + + def parse_viewbox(self, vbox: Optional[str]) -> Optional[List[float]]: + """Parses a viewbox. If an error occurs during parsing, + (0, 0, 0, 0) is returned. If the viewbox is None, None is returned. + + .. versionadded:: 1.3""" + if vbox is not None and isinstance(vbox, str): + try: + result = [float(unit) for unit in re.split(r",\s*|\s+", vbox)] + except ValueError: + result = [] + if len(result) != 4: + result = [0, 0, 0, 0] + return result + return None diff --git a/extensions/botbox3000/deps/inkex/elements/_filters.py b/extensions/botbox3000/deps/inkex/elements/_filters.py new file mode 100644 index 0000000..afb4b48 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_filters.py @@ -0,0 +1,581 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Sergei Izmailov +# Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=arguments-differ +""" +Element interface for patterns, filters, gradients and path effects. +""" + +from __future__ import annotations +from typing import List, Tuple, TYPE_CHECKING, Optional + +from lxml import etree + +from ..utils import parse_percent + +from ..transforms import Transform + +from ..styles import Style + +from ._utils import addNS +from ._base import BaseElement, ViewboxMixin +from ._groups import GroupBase +from ..units import convert_unit + + +if TYPE_CHECKING: + from ._svg import SvgDocumentElement + + +class Filter(BaseElement): + """A filter (usually in defs)""" + + tag_name = "filter" + + def add_primitive(self, fe_type, **args): + """Create a filter primitive with the given arguments""" + elem = etree.SubElement(self, addNS(fe_type, "svg")) + elem.update(**args) + return elem + + class Primitive(BaseElement): + """Any filter primitive""" + + class Blend(Primitive): + """Blend Filter element""" + + tag_name = "feBlend" + + class ColorMatrix(Primitive): + """ColorMatrix Filter element""" + + tag_name = "feColorMatrix" + + class ComponentTransfer(Primitive): + """ComponentTransfer Filter element""" + + tag_name = "feComponentTransfer" + + class Composite(Primitive): + """Composite Filter element""" + + tag_name = "feComposite" + + class ConvolveMatrix(Primitive): + """ConvolveMatrix Filter element""" + + tag_name = "feConvolveMatrix" + + class DiffuseLighting(Primitive): + """DiffuseLightning Filter element""" + + tag_name = "feDiffuseLighting" + + class DisplacementMap(Primitive): + """Flood Filter element""" + + tag_name = "feDisplacementMap" + + class DistantLight(Primitive): + """DistanceLight Filter element + defines a light source for a DiffuseLighting or SpecularLighting Filter element + + .. versionadded:: 1.4""" + + tag_name = "feDistantLight" + + class Flood(Primitive): + """DiffuseLightning Filter element""" + + tag_name = "feFlood" + + class FuncA(Primitive): + """FuncR Filter element + defines the alpha channel transfer for a ComponentTransfer Filter element + + .. versionadded:: 1.4""" + + tag_name = "feFuncA" + + class FuncB(Primitive): + """FuncR Filter element + defines the blue channel transfer for a ComponentTransfer Filter element + + .. versionadded:: 1.4""" + + tag_name = "feFuncB" + + class FuncG(Primitive): + """FuncR Filter element + defines the green channel transfer for a ComponentTransfer Filter element + + .. versionadded:: 1.4""" + + tag_name = "feFuncG" + + class FuncR(Primitive): + """FuncR Filter element + defines the red channel transfer for a ComponentTransfer Filter element + + .. versionadded:: 1.4""" + + tag_name = "feFuncR" + + class GaussianBlur(Primitive): + """GaussianBlur Filter element""" + + tag_name = "feGaussianBlur" + + class Image(Primitive): + """Image Filter element""" + + tag_name = "feImage" + + class Merge(Primitive): + """Merge Filter element""" + + tag_name = "feMerge" + + class MergeNode(Primitive): + """MergeNode Filter element + defines an input for a Merge Filter element + + .. versionadded:: 1.4""" + + tag_name = "feMergeNode" + + class Morphology(Primitive): + """Morphology Filter element""" + + tag_name = "feMorphology" + + class Offset(Primitive): + """Offset Filter element""" + + tag_name = "feOffset" + + class PointLight(Primitive): + """PointLight Filter elements + defines a light source for a DiffuseLighting or SpecularLighting Filter element + + .. versionadded:: 1.4""" + + tag_name = "fePointLight" + + class SpecularLighting(Primitive): + """SpecularLighting Filter element""" + + tag_name = "feSpecularLighting" + + class SpotLight(Primitive): + """SpotLight Filter element + defines a light source for a DiffuseLighting or SpecularLighting Filter element + + .. versionadded:: 1.4""" + + tag_name = "feSpotLight" + + class Tile(Primitive): + """Tile Filter element""" + + tag_name = "feTile" + + class Turbulence(Primitive): + """Turbulence Filter element""" + + tag_name = "feTurbulence" + + +class Stop(BaseElement): + """Gradient stop + + .. versionadded:: 1.1""" + + tag_name = "stop" + + @property + def offset(self) -> float: + """The offset of the gradient stop""" + value = self.get("offset", default="0") + return parse_percent(value) + + @offset.setter + def offset(self, number): + self.set("offset", number) + + def interpolate(self, other, fraction): + """Interpolate gradient stops""" + from ..tween import StopInterpolator + + return StopInterpolator(self, other).interpolate(fraction) + + +class Pattern(BaseElement, ViewboxMixin): + """Pattern element which is used in the def to control repeating fills""" + + tag_name = "pattern" + WRAPPED_ATTRS = BaseElement.WRAPPED_ATTRS + (("patternTransform", Transform),) + + def get_fallback(self, prop, default="0"): + val = self.get(prop, None) + if val is None: + if isinstance(self.href, Pattern): + return getattr(self.href, prop) + val = default + return val + + x = property(lambda self: self.get_fallback("x")) + y = property(lambda self: self.get_fallback("y")) + width = property(lambda self: self.get_fallback("width")) + height = property(lambda self: self.get_fallback("height")) + patternUnits = property( + lambda self: self.get_fallback("patternUnits", "objectBoundingBox") + ) + + def get_viewbox(self) -> Optional[List[float]]: + """Get the viewbox of the pattern, falling back to the href's viewbox + + .. versionadded:: 1.3""" + vbox = self.get("viewBox", None) + if vbox is None: + if isinstance(self.href, Pattern): + return self.href.get_viewbox() + return self.parse_viewbox(vbox) + + def get_effective_parent(self, depth=0, maxDepth=10): + """If a pattern has no children, but a href, it uses the children from the href. + Avoids infinite recursion. + + .. versionadded:: 1.3""" + if ( + len(self) == 0 + and self.href is not None + and isinstance(self.href, Pattern) + and depth < maxDepth + ): + return self.href.get_effective_parent(depth + 1, maxDepth) + return self + + +class Mask(GroupBase): + """A structural object that serves as opacity mask + + .. versionadded:: 1.3""" + + tag_name = "mask" + + def get_fallback(self, prop, default="0"): + return self.to_dimensionless(self.get(prop, default)) + + x = property(lambda self: self.get_fallback("x")) + y = property(lambda self: self.get_fallback("y")) + width = property(lambda self: self.get_fallback("width")) + height = property(lambda self: self.get_fallback("height")) + maskUnits = property(lambda self: self.get("maskUnits", "objectBoundingBox")) + + +class Gradient(BaseElement): + """A gradient instruction usually in the defs.""" + + WRAPPED_ATTRS = BaseElement.WRAPPED_ATTRS + (("gradientTransform", Transform),) + """Additional to the :attr:`~inkex.elements._base.BaseElement.WRAPPED_ATTRS` of + :class:`~inkex.elements._base.BaseElement`, ``gradientTransform`` is wrapped.""" + + orientation_attributes = () # type: Tuple[str, ...] + """ + .. versionadded:: 1.1 + """ + + @property + def stops(self): + """Return an ordered list of own or linked stop nodes + + .. versionadded:: 1.1""" + gradcolor = ( + self.href + if isinstance(self.href, (LinearGradient, RadialGradient)) + else self + ) + return [child for child in gradcolor if isinstance(child, Stop)] + + @property + def stop_offsets(self): + # type: () -> List[float] + """Return a list of own or linked stop offsets + + .. versionadded:: 1.1""" + return [child.offset for child in self.stops] + + @property + def stop_styles(self): # type: () -> List[Style] + """Return a list of own or linked offset styles + + .. versionadded:: 1.1""" + return [child.style for child in self.stops] + + def remove_orientation(self): + """Remove all orientation attributes from this element + + .. versionadded:: 1.1""" + for attr in self.orientation_attributes: + self.pop(attr) + + def interpolate( + self, + other: LinearGradient, + fraction: float, + svg: Optional[SvgDocumentElement] = None, + ): + """Interpolate with another gradient. + + .. versionadded:: 1.1""" + from ..tween import GradientInterpolator + + return GradientInterpolator(self, other, svg).interpolate(fraction) + + def stops_and_orientation(self): + """Return a copy of all the stops in this gradient + + .. versionadded:: 1.1""" + stops = self.copy() + stops.remove_orientation() + orientation = self.copy() + orientation.remove_all(Stop) + return stops, orientation + + def get_percentage_parsed_unit(self, attribute, value, svg=None): + """Parses an attribute of a gradient, respecting percentage values of + "userSpaceOnUse" as percentages of document size. See + https://www.w3.org/TR/SVG2/pservers.html#LinearGradientAttributes for details + + .. versionadded:: 1.3""" + if isinstance(value, (float, int)): + return value + value = value.strip() + if len(value) > 0 and value[-1] == "%": + try: + value = float(value.strip()[0:-1]) / 100.0 + gradientunits = self.get("gradientUnits", "objectBoundingBox") + if gradientunits == "userSpaceOnUse": + if svg is None: + raise ValueError("Need root SVG to determine percentage value") + bbox = svg.get_page_bbox() + if attribute in ("cx", "fx", "x1", "x2"): + return bbox.width * value + if attribute in ("cy", "fy", "y1", "y2"): + return bbox.height * value + if attribute in ("r"): + return bbox.diagonal_length * value + if gradientunits == "objectBoundingBox": + return value + except ValueError: + value = None + return convert_unit(value, "px") + + def _get_or_href(self, attr, default, svg=None): + val = self.get(attr) + if val is None: + if type(self.href) is type(self): + return getattr(self.href, attr)() + val = default + return self.get_percentage_parsed_unit(attr, val, svg) + + +class LinearGradient(Gradient): + """LinearGradient element""" + + tag_name = "linearGradient" + orientation_attributes = ("x1", "y1", "x2", "y2") + """ + .. versionadded:: 1.1 + """ + + def apply_transform(self): # type: () -> None + """Apply transform to orientation points and set it to identity. + .. versionadded:: 1.1 + """ + trans = self.pop("gradientTransform") + pt1 = ( + self.to_dimensionless(self.get("x1")), + self.to_dimensionless(self.get("y1")), + ) + pt2 = ( + self.to_dimensionless(self.get("x2")), + self.to_dimensionless(self.get("y2")), + ) + p1t = trans.apply_to_point(pt1) + p2t = trans.apply_to_point(pt2) + self.update( + x1=self.to_dimensionless(p1t[0]), + y1=self.to_dimensionless(p1t[1]), + x2=self.to_dimensionless(p2t[0]), + y2=self.to_dimensionless(p2t[1]), + ) + + def x1(self, svg=None): + """Get the x1 attribute + + .. versionadded:: 1.3""" + return self._get_or_href("x1", "0%", svg) + + def x2(self, svg=None): + """Get the x2 attribute + + .. versionadded:: 1.3""" + return self._get_or_href("x2", "100%", svg) + + def y1(self, svg=None): + """Get the y1 attribute + + .. versionadded:: 1.3""" + return self._get_or_href("y1", "0%", svg) + + def y2(self, svg=None): + """Get the y2 attribute + + .. versionadded:: 1.3""" + return self._get_or_href("y2", "0%", svg) + + +class RadialGradient(Gradient): + """RadialGradient element""" + + tag_name = "radialGradient" + orientation_attributes = ("cx", "cy", "fx", "fy", "r") + """ + .. versionadded:: 1.1 + """ + + def apply_transform(self): # type: () -> None + """Apply transform to orientation points and set it to identity. + + .. versionadded:: 1.1 + """ + trans = self.pop("gradientTransform") + pt1 = ( + self.to_dimensionless(self.get("cx")), + self.to_dimensionless(self.get("cy")), + ) + pt2 = ( + self.to_dimensionless(self.get("fx")), + self.to_dimensionless(self.get("fy")), + ) + p1t = trans.apply_to_point(pt1) + p2t = trans.apply_to_point(pt2) + self.update( + cx=self.to_dimensionless(p1t[0]), + cy=self.to_dimensionless(p1t[1]), + fx=self.to_dimensionless(p2t[0]), + fy=self.to_dimensionless(p2t[1]), + ) + + def cx(self, svg=None): + """Get the effective cx (horizontal center) attribute in user units + + .. versionadded:: 1.3""" + return self._get_or_href("cx", "50%", svg) + + def cy(self, svg=None): + """Get the effective cy (vertical center) attribute in user units + + .. versionadded:: 1.3""" + return self._get_or_href("cy", "50%", svg) + + def fx(self, svg=None): + """Get the effective fx (horizontal focal point) attribute in user units + + .. versionadded:: 1.3""" + return self._get_or_href("fx", self.cx(svg), svg) + + def fy(self, svg=None): + """Get the effective fx (vertical focal point) attribute in user units + + .. versionadded:: 1.3""" + return self._get_or_href("fy", self.cy(svg), svg) + + def r(self, svg=None): + """Get the effective r (gradient radius) attribute in user units + + .. versionadded:: 1.3""" + return self._get_or_href("r", "50%", svg) + + +class PathEffect(BaseElement): + """Inkscape LPE element""" + + tag_name = "inkscape:path-effect" + + +class MeshGradient(Gradient): + """Usable MeshGradient XML base class + + .. versionadded:: 1.1""" + + tag_name = "meshgradient" + + @classmethod + def new_mesh(cls, pos=None, rows=1, cols=1, autocollect=True): + """Return skeleton of 1x1 meshgradient definition.""" + # initial point + if pos is None or len(pos) != 2: + pos = [0.0, 0.0] + # create nested elements for rows x cols mesh + meshgradient = cls() + for _ in range(rows): + meshrow: BaseElement = meshgradient.add(MeshRow()) + for _ in range(cols): + meshrow.append(MeshPatch()) + # set meshgradient attributes + meshgradient.set("gradientUnits", "userSpaceOnUse") + meshgradient.set("x", pos[0]) + meshgradient.set("y", pos[1]) + if autocollect: + meshgradient.set("inkscape:collect", "always") + return meshgradient + + +class MeshRow(BaseElement): + """Each row of a mesh gradient + + .. versionadded:: 1.1""" + + tag_name = "meshrow" + + +class MeshPatch(BaseElement): + """Each column or 'patch' in a mesh gradient + + .. versionadded:: 1.1""" + + tag_name = "meshpatch" + + def stops(self, edges, colors): + """Add or edit meshpatch stops with path and stop-color.""" + # iterate stops based on number of edges (path data) + for i, edge in enumerate(edges): + if i < len(self): + stop = self[i] + else: + stop = self.add(Stop()) + + # set edge path data + stop.set("path", str(edge)) + # set stop color + stop.style["stop-color"] = str(colors[i % 2]) diff --git a/extensions/botbox3000/deps/inkex/elements/_groups.py b/extensions/botbox3000/deps/inkex/elements/_groups.py new file mode 100644 index 0000000..0688dc7 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_groups.py @@ -0,0 +1,196 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Sergei Izmailov +# Ryan Jarvis +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=arguments-differ +""" +Interface for all group based elements such as Groups, Use, Markers etc. +""" + +from lxml import etree # pylint: disable=unused-import + +from ..paths import Path +from ..transforms import BoundingBox, Transform, Vector2d + +from ._utils import addNS +from ._base import ShapeElement, ViewboxMixin +from ._polygons import PathElement + +try: + from typing import Optional, List # pylint: disable=unused-import +except ImportError: + pass + + +class GroupBase(ShapeElement): + """Base Group element""" + + def get_path(self): + ret = Path() + for child in self: + if isinstance(child, ShapeElement): + child_path = child.path.transform(child.transform) + if child_path and child_path[0].is_relative: + child_path[0] = child_path[0].to_absolute(Vector2d(0, 0)) + ret += child_path + return ret + + def bounding_box(self, transform=None): + # type: (Optional[Transform]) -> Optional[BoundingBox] + """BoundingBox of the shape + + .. versionchanged:: 1.4 + Exclude invisible child objects from bounding box computation + + .. versionchanged:: 1.1 + result adjusted for element's clip path if applicable. + """ + bbox = None + effective_transform = Transform(transform) @ self.transform + for child in self: + if isinstance(child, ShapeElement) and child.is_visible(): + child_bbox = child.bounding_box(transform=effective_transform) + if child_bbox is not None: + bbox += child_bbox + clip = self.clip + if clip is None or bbox is None: + return bbox + return bbox & clip.bounding_box(Transform(transform) @ self.transform) + + def shape_box(self, transform=None): + # type: (Optional[Transform]) -> Optional[BoundingBox] + """BoundingBox of the unclipped shape + + .. versionchanged:: 1.4 + returns the bounding box without possible clip effects of child objects + + .. versionadded:: 1.1 + Previous :func:`bounding_box` function, returning the bounding box + without computing the effect of a possible clip.""" + bbox = None + effective_transform = Transform(transform) @ self.transform + for child in self: + if isinstance(child, ShapeElement): + child_bbox = child.shape_box(transform=effective_transform) + if child_bbox is not None: + bbox += child_bbox + return bbox + + def bake_transforms_recursively(self, apply_to_paths=True): + """Bake transforms, i.e. each leaf node has the effective transform (starting + from this group) set, and parent transforms are removed. + + .. versionadded:: 1.4 + + Args: + apply_to_paths (bool, optional): For path elements, the + path data is transformed with its effective transform. Nodes and handles + will have the same position as before, but visual appearance of the + stroke may change (stroke-width is not touched). Defaults to True. + """ + # pylint: disable=attribute-defined-outside-init + self.transform: Transform + for element in self: + if isinstance(element, PathElement) and apply_to_paths: + element.path = element.path.transform(self.transform) + else: + element.transform = self.transform @ element.transform + if isinstance(element, GroupBase): + element.bake_transforms_recursively(apply_to_paths) + self.transform = None + + +class Group(GroupBase): + """Any group element (layer or regular group)""" + + tag_name = "g" + + @classmethod + def new(cls, label, *children, **attrs): + attrs["inkscape:label"] = label + return super().new(*children, **attrs) + + def effective_style(self): + """A blend of each child's style mixed together (last child wins)""" + style = self.style + for child in self: + style.update(child.effective_style()) + return style + + @property + def groupmode(self): + """Return the type of group this is""" + return self.get("inkscape:groupmode", "group") + + +class Layer(Group): + """Inkscape extension of svg:g""" + + def _init(self): + self.set("inkscape:groupmode", "layer") + + @classmethod + def is_class_element(cls, elem): + # type: (etree.Element) -> bool + return ( + elem.get("{http://www.inkscape.org/namespaces/inkscape}groupmode", None) + == "layer" + ) + + +class Anchor(GroupBase): + """An anchor or link tag""" + + tag_name = "a" + + @classmethod + def new(cls, href, *children, **attrs): + attrs["xlink:href"] = href + return super().new(*children, **attrs) + + +class ClipPath(GroupBase): + """A path used to clip objects""" + + tag_name = "clipPath" + + +class Marker(GroupBase, ViewboxMixin): + """The element defines the graphic that is to be used for drawing + arrowheads or polymarkers on a given , , or + element.""" + + tag_name = "marker" + + def get_viewbox(self) -> List[float]: + """Returns the viewbox of the Marker, falling back to + [0 0 markerWidth markerHeight] + + .. versionadded:: 1.3""" + vbox = self.get("viewBox", None) + result = self.parse_viewbox(vbox) + if result is None: + # use viewport, https://www.w3.org/TR/SVG11/painting.html#MarkerElement + return [ + 0, + 0, + self.to_dimensionless(self.get("markerWidth")), + self.to_dimensionless(self.get("markerHeight")), + ] + return result diff --git a/extensions/botbox3000/deps/inkex/elements/_image.py b/extensions/botbox3000/deps/inkex/elements/_image.py new file mode 100644 index 0000000..79ad42c --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_image.py @@ -0,0 +1,123 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 - Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Image element interface. +""" + +import os +import urllib.request as urllib +import urllib.parse as urlparse +from base64 import encodebytes + + +from ..base import InkscapeExtension +from ..localization import inkex_gettext as _ +from ._polygons import RectangleBase + + +class Image(RectangleBase): + """Provide a useful extension for image elements""" + + tag_name = "image" + + @staticmethod + def _get_type(path, header): + """Basic magic header checker, returns mime type""" + for head, mime in ( + (b"\x89PNG", "image/png"), + (b"\xff\xd8", "image/jpeg"), + (b"BM", "image/bmp"), + (b"GIF87a", "image/gif"), + (b"GIF89a", "image/gif"), + (b"MM\x00\x2a", "image/tiff"), + (b"II\x2a\x00", "image/tiff"), + ): + if header.startswith(head): + return mime + + # ico files lack any magic... therefore we check the filename instead + for ext, mime in ( + # official IANA registered MIME is 'image/vnd.microsoft.icon' tho + (".ico", "image/x-icon"), + (".svg", "image/svg+xml"), + ): + if path.endswith(ext): + return mime + return None + + def embed_image(self, file_path: str): + """ "Embed the data of the selected Image Tag element. + Relative image paths are interpreted relative to file_path. + + .. versionadded:: 1.5 + + Args: + file_path (str): Relative image paths are interpreted relative to file_path. + """ + xlink = self.get("xlink:href") + if xlink is not None and xlink[:5] == "data:": + # No need, data already embedded + return + if xlink is None: + raise AttributeError( + _('Attribute "xlink:href" not set on node {}.'.format(self.get_id())) + ) + + url = urlparse.urlparse(xlink) + href = urllib.url2pathname(url.path) + + # Look relative to the *temporary* filename instead of the original filename. + try: + cwd = os.path.dirname(file_path) + except TypeError: + # input_file was actually stdin, fall back. + cwd = None + path = InkscapeExtension.absolute_href(href or "", cwd=cwd) + + # Backup directory where we can find the image + if not os.path.isfile(path): + path = self.get("sodipodi:absref", path) + + if not os.path.isfile(path): + raise ValueError( + _('File not found "{}". Unable to embed image.').format(path) + ) + return + + with open(path, "rb") as handle: + # Don't read the whole file to check the header + file_type = self._get_type(path, handle.read(10)) + handle.seek(0) + + if file_type: + self.set( + "xlink:href", + "data:{};base64,{}".format( + file_type, encodebytes(handle.read()).decode("ascii") + ), + ) + self.pop("sodipodi:absref") + else: + raise ValueError( + _( + "%s is not of type image/png, image/jpeg, " + "image/bmp, image/gif, image/tiff, or image/x-icon" + ) + % path + ) diff --git a/extensions/botbox3000/deps/inkex/elements/_meta.py b/extensions/botbox3000/deps/inkex/elements/_meta.py new file mode 100644 index 0000000..b64aabf --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_meta.py @@ -0,0 +1,499 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Maren Hachmann +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=arguments-differ +""" +Provide extra utility to each svg element type specific to its type. + +This is useful for having a common interface for each element which can +give path, transform, and property access easily. +""" + +from __future__ import annotations +import math + +from typing import List, Optional + +from lxml import etree + +from inkex.deprecated.meta import deprecate + +from ..styles import StyleSheet +from ..transforms import BoundingBox, Vector2d, VectorLike, DirectedLineSegment + +from ._base import BaseElement + + +class Defs(BaseElement): + """A header defs element, one per document""" + + tag_name = "defs" + + +class StyleElement(BaseElement): + """A CSS style element containing multiple style definitions""" + + tag_name = "style" + + def set_text(self, content): + """Sets the style content text as a CDATA section""" + self.text = etree.CDATA(str(content)) + + def stylesheet(self): + """Return the StyleSheet() object for the style tag""" + return StyleSheet(self.text, callback=self.set_text) + + +class Script(BaseElement): + """A javascript tag in SVG""" + + tag_name = "script" + + def set_text(self, content): + """Sets the style content text as a CDATA section""" + self.text = etree.CDATA(str(content)) + + +class Desc(BaseElement): + """Description element""" + + tag_name = "desc" + + +class Title(BaseElement): + """Title element""" + + tag_name = "title" + + +class NamedView(BaseElement): + """The NamedView element is Inkscape specific metadata about the file""" + + tag_name = "sodipodi:namedview" + + current_layer = property(lambda self: self.get("inkscape:current-layer")) + + @property + def center(self): + """Returns view_center in terms of document units""" + return Vector2d( + self.root.viewport_to_unit(self.get("inkscape:cx") or 0), + self.root.viewport_to_unit(self.get("inkscape:cy") or 0), + ) + + def get_guides(self): + """Returns a list of guides""" + return self.findall("sodipodi:guide") + + def add_guide(self, position, orient=True, name=None) -> Guide: + """Creates a new guide in this namedview + + .. versionadded:: 1.3 + + Args: + position: a float containing the y position for ``orient is True``, or + the x position for ``orient is False``. The position is specified in the + post-1.0 coordinate system, i.e. y=0 is at the top left of the viewbox, + positive y axis pointing down. + + Alternatively, the position may be given as Tuple (or VectorLike) + orient: True for horizontal, False for Vertical + + alternatively: Tuple / Vector specifying x and y coordinates of the + normal vector of the guide, or the (clockwise) angle between the + horizontal axis and the guide. Defaults to True (horizontal) + name: label of the guide + + Returns: + the created guide""" + elem = self.add(Guide()) + + if orient is True: + elem.set_position(0, position, (0, -1)) + elif orient is False: + elem.set_position(position, self.root.viewbox_height, (1, 0)) + else: + pos = Vector2d(position) + elem.set_position(pos.x, pos.y, orient) + if name: + elem.set("inkscape:label", str(name)) + return elem + + @deprecate + def new_guide(self, position, orient=True, name=None): + """ + .. deprecated:: 1.3 + Use :func:`add_guide` instead. + + Creates a new guide in this namedview + + Args: + position: a float containing the y position for ``orient is True``, or + the x position for ``orient is False`` + + .. versionchanged:: 1.2 + Alternatively, the position may be given as Tuple (or VectorLike) + orient: True for horizontal, False for Vertical + + .. versionchanged:: 1.2 + Tuple / Vector specifying x and y coordinates of the normal vector + of the guide. + name: label of the guide + + Returns: + the created guide""" + if orient is True: + elem = Guide().move_to(0, position, (0, 1)) + elif orient is False: + elem = Guide().move_to(position, 0, (1, 0)) + else: + elem = Guide().move_to(*position, orient) + if name: + elem.set("inkscape:label", str(name)) + return self.add(elem) + + @deprecate + def new_unique_guide( + self, position: Vector2d, orientation: Vector2d + ) -> Optional[Guide]: + """ + .. deprecated:: 1.3 + Use :func:`add_unique_guide` instead. + + Add a guide iif there is no guide that looks the same. + + .. versionadded:: 1.2 + + """ + elem = Guide().move_to(position[0], position[1], orientation) + return self.add(elem) if self.get_similar_guide(elem) is None else None + + def add_unique_guide( + self, position: Vector2d, orientation: Vector2d + ) -> Optional[Guide]: + """Add a guide iif there is no guide that looks the same. + + .. versionadded:: 1.3 + + Args: + position: Position as Tuple / Vector + orientation: Tuple / Vector specifying x and y coordinates of the normal + vector of the guide. + name: label of the guide + """ + elem = self.add(Guide()).set_position(position[0], position[1], orientation) + if self.get_similar_guide(elem) is not None: + self.remove(elem) + return None + return elem + + def get_similar_guide(self, other: Guide) -> Optional[Guide]: + """Check if the namedview contains a guide that looks identical to one + defined by (position, orientation) and is not identity (same element) as the + first one. If such a guide exists, return it; otherwise, return None. + + .. versionadded:: 1.2""" + for guide in self.get_guides(): + if Guide.guides_coincident(guide, other) and guide != other: + return guide + return None + + def _get_pages(self) -> List[Page]: + """Returns all page elements""" + return self.findall("inkscape:page") + + def _equivalent_page(self) -> Page: + """Returns an unrooted page based on the viewbox dimensions""" + return Page.new(self.root.viewbox_width, self.root.viewbox_height, 0, 0) + + def get_pages(self) -> List[Page]: + """Returns a list of pages within the document. For single page documents, + a detached page element with dimensions according to the viewbox will be + returned. + + .. versionadded:: 1.2 + + .. versionchanged:: 1.3 + For single-page documents, this function now returns the viewbox + dimensions. + """ + pages = self._get_pages() + if len(pages) < 2: + return [self._equivalent_page()] + return pages + + def new_page(self, x, y, width, height, label=None): + """Creates a new page in this namedview. Always add pages through this + function to ensure that single-page documents are treated correctly. + + .. versionadded:: 1.2 + + .. versionchanged:: 1.3 + If none exists, a page element with the viewbox dimensions will be + inserted before the new page.""" + if len(self._get_pages()) == 0: + self.add(self._equivalent_page()) + elem = Page(width=width, height=height, x=x, y=y) + if label: + elem.set("inkscape:label", str(label)) + return self.add(elem) + + +class Guide(BaseElement): + """An inkscape guide""" + + tag_name = "sodipodi:guide" + + @property + def orientation(self) -> Vector2d: + """Vector normal to the guide, in the pre-1.0 coordinate system (y axis upwards) + + .. versionadded:: 1.2""" + return Vector2d(self.get("orientation"), fallback=(1, 0)) + + @property + def angle(self) -> float: + """(Clockwise) angle between the guide and the horizontal axis in degrees + (i.e. what Inkscape 1.2+ shows as "Angle" in the guide properties) + + .. versionadded:: 1.3""" + return math.degrees(math.atan2(*self.orientation)) + + is_horizontal = property( + lambda self: self.orientation[0] == 0 and self.orientation[1] != 0 + ) + is_vertical = property( + lambda self: self.orientation[0] != 0 and self.orientation[1] == 0 + ) + + @property + def raw_position(self) -> Vector2d: + """Position of the guide handle. The y coordinate is flipped and relative + to the bottom of the viewbox, this is a remnant of the pre-1.0 coordinate system + """ + return Vector2d(self.get("position"), fallback=(0, 0)) + + def point(self): + """Use raw_position or position instead""" + return self.raw_position + + point = property(deprecate(point)) # type: ignore + + @property + def position(self) -> Vector2d: + """Position of the guide handle in normal coordinates, i.e. (0,0) is at + the top left corner of the viewbox, positive y axis pointing downwards. + + This function can only be used for guides which are attached to a root + svg element.""" + pos = self.raw_position + return Vector2d(pos.x, self.root.viewbox_height - pos.y) + + @classmethod + def new(cls, pos_x, pos_y, angle, **attrs): + guide = super().new(**attrs) + guide.set_position(pos_x, pos_y, angle=angle) + return guide + + def set_position(self, pos_x, pos_y, angle=None): + """ + Move this guide to the given x,y position and optionally set its orientation. + The coordinate system used is the post-1.0 coordinate system (origin in the + top left corner, y axis pointing down), which also defines the sense of + rotation. + + The guide must be rooted for this function to be used. Preferably, use + :func:`inkex.elements._meta.add_guide` to create a new guide. + + .. versionadded:: 1.3 + + Args: + pos_x (Union[str, int, float]): x position of the guide's reference point + pos_y (Union[str, int, float]): y position of the guide's reference point + angle (Union[str, float, int, tuple, list], optional): Angle may be a + string, float or integer, which will set the clockwise angle between the + horizontal axis and the guide. + + Alternatively, it may be a pair of numbers (tuple) which will be set + as normal vector. + + If not given at all, the orientation remains unchanged. + Defaults to None. + + Returns: + Guide: the modified guide + """ + pos_y = self.root.viewbox_height - float(pos_y) + self.set("position", f"{float(pos_x):g},{float(pos_y):g}") + if isinstance(angle, str): + if "," not in angle: + angle = float(angle) + + if isinstance(angle, (float, int)): + # Generate orientation from angle + angle = (math.sin(math.radians(angle)), -math.cos(math.radians(angle))) + + if isinstance(angle, (tuple, list)) and len(angle) == 2: + angle = ",".join(f"{i:g}" for i in [angle[0], -angle[1]]) + + if angle is not None: + self.set("orientation", angle) + return self + + @deprecate + def move_to(self, pos_x, pos_y, angle=None): + """ + .. deprecated:: 1.3 + Use :func:`set_position` instead. + + Move this guide to the given x,y position, + + Angle may be a float or integer, which will change the orientation. Alternately, + it may be a pair of numbers (tuple) which will set the orientation directly. + If not given at all, the orientation remains unchanged. + """ + self.set("position", f"{float(pos_x):g},{float(pos_y):g}") + if isinstance(angle, str): + if "," not in angle: + angle = float(angle) + + if isinstance(angle, (float, int)): + # Generate orientation from angle + angle = (math.sin(math.radians(angle)), -math.cos(math.radians(angle))) + + if isinstance(angle, (tuple, list)) and len(angle) == 2: + angle = ",".join(f"{i:g}" for i in angle) + + if angle is not None: + self.set("orientation", angle) + return self + + @staticmethod + def guides_coincident(guide1, guide2): + """Check if two guides defined by (position, orientation) and (opos, oor) look + identical (i.e. the position lies on the other guide AND the guide is + (anti)parallel to the other guide). + + .. versionadded:: 1.2""" + # normalize orientations first + orientation = guide1.orientation / guide1.orientation.length + oor = guide2.orientation / guide2.orientation.length + + position = guide1.raw_position + opos = guide2.raw_position + + return ( + DirectedLineSegment( + position, position + Vector2d(orientation[1], -orientation[0]) + ).perp_distance(*opos) + < 1e-6 + and abs(abs(orientation[1] * oor[0]) - abs(orientation[0] * oor[1])) < 1e-6 + ) + + +class Metadata(BaseElement): + """Resource Description Framework (RDF) metadata""" + + tag_name = "metadata" + + doc_title = property(lambda self: self._first_text("dc:title")) + description = property(lambda self: self._first_text("dc:description")) + + rights = property(lambda self: self._first_text("dc:rights/cc:Agent/dc:title")) + creator = property(lambda self: self._first_text("dc:creator/cc:Agent/dc:title")) + publisher = property( + lambda self: self._first_text("dc:publisher/cc:Agent/dc:title") + ) + contributor = property( + lambda self: self._first_text("dc:contributor/cc:Agent/dc:title") + ) + + date = property(lambda self: self._first_text("dc:date")) + source = property(lambda self: self._first_text("dc:source")) + language = property(lambda self: self._first_text("dc:language")) + relation = property(lambda self: self._first_text("dc:relation")) + coverage = property(lambda self: self._first_text("dc:coverage")) + identifier = property(lambda self: self._first_text("dc:identifier")) + + def _first_text(self, loc): + """Get the work title""" + elem = self.findone(f"rdf:RDF/cc:Work/{loc}") + if elem: + return elem.text + return None + + @property + def tags(self): + return [ + elem.text + for elem in self.findall("rdf:RDF/cc:Work/dc:subject/rdf:Bag/rdf:li") + ] + + +class ForeignObject(BaseElement): + """SVG foreignObject element""" + + tag_name = "foreignObject" + + +class Switch(BaseElement): + """A switch element""" + + tag_name = "switch" + + +class Grid(BaseElement): + """A namedview grid child""" + + tag_name = "inkscape:grid" + + +class Page(BaseElement): + """A namedview page child + + .. versionadded:: 1.2""" + + tag_name = "inkscape:page" + + width = property(lambda self: self.to_dimensionless(self.get("width") or 0)) + height = property(lambda self: self.to_dimensionless(self.get("height") or 0)) + x = property(lambda self: self.to_dimensionless(self.get("x") or 0)) + y = property(lambda self: self.to_dimensionless(self.get("y") or 0)) + + @classmethod + def new(cls, width, height, x, y): + """Creates a new page element in the namedview""" + page = super().new() + page.move_to(x, y) + page.set("width", width) + page.set("height", height) + return page + + def move_to(self, x, y): + """Move this page to the given x,y position""" + self.set("x", f"{float(x):g}") + self.set("y", f"{float(y):g}") + return self + + @property + def bounding_box(self) -> BoundingBox: + """Returns the bounding box of the page.""" + return BoundingBox( + (self.x, self.x + self.width), (self.y, self.y + self.height) + ) diff --git a/extensions/botbox3000/deps/inkex/elements/_parser.py b/extensions/botbox3000/deps/inkex/elements/_parser.py new file mode 100644 index 0000000..68efbc3 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_parser.py @@ -0,0 +1,130 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Sergei Izmailov +# Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# + +"""Utilities for parsing SVG documents. + +.. versionadded:: 1.2 + Separated out from :py:mod:`inkex.elements._base`""" + +from collections import defaultdict +from typing import DefaultDict, List, Any, Type, TYPE_CHECKING + +from lxml import etree + +if TYPE_CHECKING: + from ..elements._base import BaseElement + +from ._utils import splitNS, addNS +from ..utils import errormsg +from ..localization import inkex_gettext as _ + + +class NodeBasedLookup(etree.PythonElementClassLookup): + """ + We choose what kind of Elements we should return for each element, providing useful + SVG based API to our extensions system. + """ + + default: Type["BaseElement"] + + # (ns,tag) -> list(cls) ; ascending priority + lookup_table: DefaultDict[str, List[Any]] = defaultdict() + + @classmethod + def register_class(cls, klass): + """Register the given class using it's attached tag name""" + key = addNS(*splitNS(klass.tag_name)[::-1]) + old = cls.lookup_table.get(key, []) + old.append(klass) + cls.lookup_table[key] = old + + @classmethod + def find_class(cls, xpath): + """Find the class for this type of element defined by an xpath + + .. versionadded:: 1.1""" + if isinstance(xpath, type): + return xpath + for kls in cls.lookup_table[addNS(*splitNS(xpath.split("/")[-1])[::-1])]: + # TODO: We could create a apply the xpath attrs to the test element + # to narrow the search, but this does everything we need right now. + test_element = kls() + if kls.is_class_element(test_element): + return kls + raise KeyError(f"Could not find svg tag for '{xpath}'") + + def lookup(self, doc, element): # pylint: disable=unused-argument + """Lookup called by lxml when assigning elements their object class""" + try: + try: + options = self.lookup_table[element.tag] + except KeyError: + if not element.tag.startswith("{"): + tag = addNS(*splitNS(element.tag)[::-1]) + options = self.lookup_table[tag] + else: + return self.default + for kls in reversed(options): + if kls.is_class_element(element): # pylint: disable=protected-access + return kls + + except AttributeError: + # Handle + return None + return self.default + + +SVG_PARSER = etree.XMLParser(huge_tree=True, strip_cdata=False, recover=True) +SVG_PARSER.set_element_class_lookup(NodeBasedLookup()) + + +def load_svg(stream): + """Load SVG file using the SVG_PARSER""" + if (isinstance(stream, str) and stream.lstrip().startswith("<")) or ( + isinstance(stream, bytes) and stream.lstrip().startswith(b"<") + ): + parsed = etree.ElementTree(etree.fromstring(stream, parser=SVG_PARSER)) + else: + parsed = etree.parse(stream, parser=SVG_PARSER) + if len(SVG_PARSER.error_log) > 0: + errormsg( + _( + "A parsing error occurred, which means you are likely working with " + "a non-conformant SVG file. The following errors were found:\n" + ) + ) + for __, element in enumerate(SVG_PARSER.error_log): + errormsg( + _( + "{error_message}. Line {line_number}, column {column_number}", + ).format( + error_message=element.message, + line_number=element.line, + column_number=element.column, + ) + ) + errormsg( + _( + "\nProcessing will continue; however we encourage you to fix your" + " file manually." + ) + ) + return parsed diff --git a/extensions/botbox3000/deps/inkex/elements/_polygons.py b/extensions/botbox3000/deps/inkex/elements/_polygons.py new file mode 100644 index 0000000..3e0486d --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_polygons.py @@ -0,0 +1,587 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Sergei Izmailov +# Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=arguments-differ +""" +Interface for all shapes/polygons such as lines, paths, rectangles, circles etc. +""" + +from __future__ import annotations + +from math import cos, pi, sin +import math +from typing import Optional, Tuple, Union + +from ..paths.interfaces import PathCommand +from ..paths import Arc, Curve, Move, Path, ZoneClose +from ..paths import Line as PathLine +from ..transforms import Transform, ImmutableVector2d, Vector2d +from ..bezier import pointdistance + +from ._utils import addNS +from ._base import ShapeElement + + +class PathElementBase(ShapeElement): + """Base element for path based shapes""" + + def get_path(self) -> Path: + """Gets the path of the element, which can also be used in a context manager""" + p = Path(self.get("d")) + p.callback = self.set_path + return p + + @classmethod + def new(cls, path, **attrs): + return super().new(d=Path(path), **attrs) + + def set_path(self, path): + """Set the given data as a path as the 'd' attribute""" + self.set("d", str(Path(path))) + + def apply_transform(self): + """Apply the internal transformation to this node and delete""" + if "transform" in self.attrib: + self.path = self.path.transform(self.transform) + self.set("transform", Transform()) + + @property + def original_path(self): + """Returns the original path if this is a LPE, or the path if not""" + return Path(self.get("inkscape:original-d", self.path)) + + @original_path.setter + def original_path(self, path): + if addNS("inkscape:original-d") in self.attrib: + self.set("inkscape:original-d", str(Path(path))) + else: + self.path = path + + +class PathElement(PathElementBase): + """Provide a useful extension for path elements""" + + tag_name = "path" + + MAX_ARC_SUBDIVISIONS = 4 + + @staticmethod + def _arcpath( + cx: float, + cy: float, + rx: float, + ry: float, + start: float, + end: float, + arctype: str, + ) -> Optional[Path]: + """Compute the path for an arc defined by Inkscape-specific attributes. + + For details on arguments, see :func:`arc`. + + .. versionadded:: 1.2""" + if abs(rx) < 1e-8 or abs(ry) < 1e-8: + return None + incr = end - start + if incr < 0: + incr += 2 * pi + numsegs = min(1 + int(incr * 2.0 / pi), PathElement.MAX_ARC_SUBDIVISIONS) + incr = incr / numsegs + + computed = Path() + computed.append(Move(cos(start), sin(start))) + for seg in range(1, numsegs + 1): + computed.append( + Arc( + 1, + 1, + 0, + incr > pi, + 1, + cos(start + seg * incr), + sin(start + seg * incr), + ) + ) + if abs(incr * numsegs - 2 * pi) > 1e-8 and ( + arctype in ("slice", "") + ): # slice is default + computed.append(PathLine(0, 0)) + if arctype != "arc": + computed.append(ZoneClose()) + computed.transform( + Transform().add_translate(cx, cy).add_scale(rx, ry), inplace=True + ) + return computed.to_relative() + + @classmethod + def arc(cls, center, rx, ry=None, arctype="", pathonly=False, **kw): # pylint: disable=invalid-name + """Generates a sodipodi elliptical arc (special type). Also computes the path + that Inkscape uses under the hood. + All data may be given as parseable strings or using numeric data types. + + Args: + center (tuple-like): Coordinates of the star/polygon center as tuple or + Vector2d + rx (Union[float, str]): Radius in x direction + ry (Union[float, str], optional): Radius in y direction. If not given, + ry=rx. Defaults to None. + arctype (str, optional): "arc", "chord" or "slice". Defaults to "", i.e. + "slice". + + .. versionadded:: 1.2 + Previously set to "arc" as fixed value + pathonly (bool, optional): Whether to create the path without + Inkscape-specific attributes. Defaults to False. + + .. versionadded:: 1.2 + Keyword args: + start (Union[float, str]): start angle in radians + end (Union[float, str]): end angle in radians + open (str): whether the path should be open (true/false). Not used in + Inkscape > 1.1 + + Returns: + PathElement : the created star/polygon + """ + others = [(name, kw.pop(name, None)) for name in ("start", "end", "open")] + elem = cls(**kw) + elem.set("sodipodi:cx", center[0]) + elem.set("sodipodi:cy", center[1]) + elem.set("sodipodi:rx", rx) + elem.set("sodipodi:ry", ry or rx) + elem.set("sodipodi:type", "arc") + if arctype != "": + elem.set("sodipodi:arc-type", arctype) + for name, value in others: + if value is not None: + elem.set("sodipodi:" + name, str(value).lower()) + + path = cls._arcpath( + float(center[0]), + float(center[1]), + float(rx), + float(ry or rx), + float(elem.get("sodipodi:start", 0)), + float(elem.get("sodipodi:end", 2 * pi)), + arctype, + ) + if pathonly: + elem = cls(**kw) + if path is not None: + elem.path = path + return elem + + @classmethod + def arc_from_3_points( + cls, + x: complex, + y: complex, + z: complex, + arctype="slice", + ) -> PathElement: + """ + Create an arc through the points x, y, z. + If those points are specified clockwise, the order is not preserved. + This is indicated with the second return value (=clockwise) + + Returns a PathElement. May be a line if x,y,z are collinear. + + + Idea: http://www.math.okstate.edu/~wrightd/INDRA/MobiusonCircles/node4.html + + .. versionadded:: 1.4 + """ + w = (z - x) / (y - x) + if abs(w.imag) > 1e-12: + c = -((x - y) * (w - abs(w) ** 2) / (2j * w.imag) - x) + r = abs(c - x) + + # Now determine the arc flags by checking the angles + deltas = [x - c, y - c, z - c] + ang = [math.atan2(i.imag, i.real) for i in deltas] + # Check if the angles are "in order" + cw = int(any(ang[0 + i] < ang[-2 + i] < ang[-1 + i] for i in range(3))) + if not cw: + # Flip start and end angle + ang = ang[::-1] + + return cls.arc(Vector2d(c), r, r, start=ang[0], end=ang[2], arctype=arctype) + else: + # Points lie on a line + # y between x and z -> draw a line, otherwise skip + if x.real <= y.real <= z.real or x.real >= y.real >= z.real: + return cls.new(Path([Move(x), PathLine(z)])) + else: + return cls.new(Path([Move(x), Move(z)])) + + @staticmethod + def _starpath( + c: Tuple[float, float], + sides: int, + r: Tuple[float, float], # pylint: disable=invalid-name + arg: Tuple[float, float], + rounded: float, + flatsided: bool, + ): + """Helper method to generate the path for an Inkscape star/ polygon; randomized + is ignored. + + For details on arguments, see :func:`star`. + + .. versionadded:: 1.2""" + + def _star_get_xy(point, index): + cur_arg = arg[point] + 2 * pi / sides * (index % sides) + return Vector2d(*c) + r[point] * Vector2d(cos(cur_arg), sin(cur_arg)) + + def _rot90_rel(origin, other): + """Returns a unit length vector at 90 deg from origin to other""" + return ( + 1 + / pointdistance(other, origin) + * Vector2d(other.y - origin.y, other.x - origin.x) + ) + + def _star_get_curvepoint(point, index, is_prev: bool): + index = index % sides + orig = _star_get_xy(point, index) + previ = (index - 1 + sides) % sides + nexti = (index + 1) % sides + # neighbors of the current point depend on polygon or star + prev = ( + _star_get_xy(point, previ) + if flatsided + else _star_get_xy(1 - point, index if point == 1 else previ) + ) + nextp = ( + _star_get_xy(point, nexti) + if flatsided + else _star_get_xy(1 - point, index if point == 0 else nexti) + ) + mid = 0.5 * (prev + nextp) + # direction of bezier handles + rot = _rot90_rel(orig, mid + 100000 * _rot90_rel(mid, nextp)) + ret = ( + rounded + * rot + * ( + -1 * pointdistance(prev, orig) + if is_prev + else pointdistance(nextp, orig) + ) + ) + return orig + ret + + pointy = abs(rounded) < 1e-4 + result = Path() + result.append(Move(*_star_get_xy(0, 0))) + for i in range(0, sides): + # draw to point type 1 for stars + if not flatsided: + if pointy: + result.append(PathLine(*_star_get_xy(1, i))) + else: + result.append( + Curve( + *_star_get_curvepoint(0, i, False), + *_star_get_curvepoint(1, i, True), + *_star_get_xy(1, i), + ) + ) + # draw to point type 0 for both stars and rectangles + if pointy and i < sides - 1: + result.append(PathLine(*_star_get_xy(0, i + 1))) + if not pointy: + if not flatsided: + result.append( + Curve( + *_star_get_curvepoint(1, i, False), + *_star_get_curvepoint(0, i + 1, True), + *_star_get_xy(0, i + 1), + ) + ) + else: + result.append( + Curve( + *_star_get_curvepoint(0, i, False), + *_star_get_curvepoint(0, i + 1, True), + *_star_get_xy(0, i + 1), + ) + ) + + result.append(ZoneClose()) + return result.to_relative() + + @classmethod + def star( + cls, + center, + radii, + sides=5, + rounded=0, + args=(0, 0), + flatsided=False, + pathonly=False, + ): + """Generate a sodipodi star / polygon. Also computes the path that Inkscape uses + under the hood. The arguments for center, radii, sides, rounded and args can be + given as strings or as numeric data. + + .. versionadded:: 1.1 + + Args: + center (Tuple-like): Coordinates of the star/polygon center as tuple or + Vector2d + radii (tuple): Radii of the control points, i.e. their distances from the + center. The control points are specified in polar coordinates. Only the + first control point is used for polygons. + sides (int, optional): Number of sides / tips of the polygon / star. + Defaults to 5. + rounded (int, optional): Controls the rounding radius of the polygon / star. + For `rounded=0`, only straight lines are used. Defaults to 0. + args (tuple, optional): Angle between horizontal axis and control points. + Defaults to (0,0). + + .. versionadded:: 1.2 + Previously fixed to (0.85, 1.3) + flatsided (bool, optional): True for polygons, False for stars. + Defaults to False. + + .. versionadded:: 1.2 + pathonly (bool, optional): Whether to create the path without + Inkscape-specific attributes. Defaults to False. + + .. versionadded:: 1.2 + + Returns: + PathElement : the created star/polygon + """ + elem = cls() + elem.set("sodipodi:cx", center[0]) + elem.set("sodipodi:cy", center[1]) + elem.set("sodipodi:r1", radii[0]) + elem.set("sodipodi:r2", radii[1]) + elem.set("sodipodi:arg1", args[0]) + elem.set("sodipodi:arg2", args[1]) + elem.set("sodipodi:sides", max(sides, 3) if flatsided else max(sides, 2)) + elem.set("inkscape:rounded", rounded) + elem.set("inkscape:flatsided", str(flatsided).lower()) + elem.set("sodipodi:type", "star") + + path = cls._starpath( + (float(center[0]), float(center[1])), + int(sides), + (float(radii[0]), float(radii[1])), + (float(args[0]), float(args[1])), + float(rounded), + flatsided, + ) + if pathonly: + elem = cls() + # inkex.errormsg(path) + if path is not None: + elem.path = path + + return elem + + +class Polyline(ShapeElement): + """Like a path, but made up of straight line segments only""" + + tag_name = "polyline" + + def get_path(self) -> Path: + p = Path("M" + self.get("points")) + p.callback = self.set_path + return p + + def set_path(self, path): + if type(path) != Path: + path = Path("M" + str(path)) + points = [f"{x:g},{y:g}" for x, y in path.end_points] + self.set("points", " ".join(points)) + + @classmethod + def new(cls, points=None, **attrs): + p = super().new(**attrs) + p.path = points + return p + + +class Polygon(Polyline): + """A closed polyline""" + + tag_name = "polygon" + + def get_path(self) -> Path: + p = Path("M" + self.get("points") + " Z") + p.callback = self.set_path + return p + + +class Line(ShapeElement): + """A line segment connecting two points""" + + tag_name = "line" + x1 = property(lambda self: self.to_dimensionless(self.get("x1", 0))) + y1 = property(lambda self: self.to_dimensionless(self.get("y1", 0))) + x2 = property(lambda self: self.to_dimensionless(self.get("x2", 0))) + y2 = property(lambda self: self.to_dimensionless(self.get("y2", 0))) + get_path = lambda self: Path(f"M{self.x1},{self.y1} L{self.x2},{self.y2}") + + @classmethod + def new(cls, start, end, **attrs): + start = Vector2d(start) + end = Vector2d(end) + return super().new(x1=start.x, y1=start.y, x2=end.x, y2=end.y, **attrs) + + +class RectangleBase(ShapeElement): + """Provide a useful extension for rectangle elements""" + + left = property(lambda self: self.to_dimensionless(self.get("x", "0"))) + top = property(lambda self: self.to_dimensionless(self.get("y", "0"))) + right = property(lambda self: self.left + self.width) + bottom = property(lambda self: self.top + self.height) + width = property(lambda self: self.to_dimensionless(self.get("width", "0"))) + height = property(lambda self: self.to_dimensionless(self.get("height", "0"))) + rx = property( + lambda self: self.to_dimensionless(self.get("rx", self.get("ry", 0.0))) + ) + ry = property( + lambda self: self.to_dimensionless(self.get("ry", self.get("rx", 0.0))) + ) # pylint: disable=invalid-name + + def get_path(self) -> Path: + """Calculate the path as the box around the rect""" + if self.rx or self.ry: + # pylint: disable=invalid-name + rx = min(self.rx if self.rx > 0 else self.ry, self.width / 2) + ry = min(self.ry if self.ry > 0 else self.rx, self.height / 2) + cpts = [self.left + rx, self.right - rx, self.top + ry, self.bottom - ry] + return Path( + f"M {cpts[0]},{self.top}" + f"L {cpts[1]},{self.top} " + f"A {rx},{ry} 0 0 1 {self.right},{cpts[2]}" + f"L {self.right},{cpts[3]} " + f"A {rx},{ry} 0 0 1 {cpts[1]},{self.bottom}" + f"L {cpts[0]},{self.bottom} " + f"A {rx},{ry} 0 0 1 {self.left},{cpts[3]}" + f"L {self.left},{cpts[2]} " + f"A {rx},{ry} 0 0 1 {cpts[0]},{self.top} z" + ) + + return Path( + f"M {self.left},{self.top} h{self.width}v{self.height}h{-self.width} z" + ) + + +class Rectangle(RectangleBase): + """Provide a useful extension for rectangle elements""" + + tag_name = "rect" + + @classmethod + def new(cls, left, top, width, height, **attrs): + return super().new(x=left, y=top, width=width, height=height, **attrs) + + +class EllipseBase(ShapeElement): + """Absorbs common part of Circle and Ellipse classes""" + + def get_path(self) -> Path: + """Calculate the arc path of this circle""" + rx, ry = self.rxry() + cx, y = self.center.x, self.center.y - ry + return Path( + ( + "M {cx},{y} " + "a {rx},{ry} 0 1 0 {rx}, {ry} " + "a {rx},{ry} 0 0 0 -{rx}, -{ry} z" + ).format(cx=cx, y=y, rx=rx, ry=ry) + ) + + @property + def center(self): + """Return center of circle/ellipse""" + return ImmutableVector2d( + self.to_dimensionless(self.get("cx", "0")), + self.to_dimensionless(self.get("cy", "0")), + ) + + @center.setter + def center(self, value): + value = Vector2d(value) + self.set("cx", value.x) + self.set("cy", value.y) + + def rxry(self): + # type: () -> Vector2d + """Helper function""" + raise NotImplementedError() + + @classmethod + def new(cls, center, radius, **attrs): + circle = super().new(**attrs) + circle.center = center + circle.radius = radius + return circle + + +class Circle(EllipseBase): + """Provide a useful extension for circle elements""" + + tag_name = "circle" + + @property + def radius(self) -> float: + """Return radius of circle""" + return self.to_dimensionless(self.get("r", "0")) + + @radius.setter + def radius(self, value): + self.set("r", self.to_dimensionless(value)) + + def rxry(self): + r = self.radius + return Vector2d(r, r) + + +class Ellipse(EllipseBase): + """Provide a similar extension to the Circle interface for ellipses""" + + tag_name = "ellipse" + + @property + def radius(self) -> ImmutableVector2d: + """Return radii of ellipse""" + return ImmutableVector2d( + self.to_dimensionless(self.get("rx", "0")), + self.to_dimensionless(self.get("ry", "0")), + ) + + @radius.setter + def radius(self, value): + value = Vector2d(value) + self.set("rx", str(value.x)) + self.set("ry", str(value.y)) + + def rxry(self): + return self.radius diff --git a/extensions/botbox3000/deps/inkex/elements/_selected.py b/extensions/botbox3000/deps/inkex/elements/_selected.py new file mode 100644 index 0000000..4038ce5 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_selected.py @@ -0,0 +1,237 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc.,Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +When elements are selected, these structures provide an advanced API. + +.. versionadded:: 1.1 +""" + +from collections import OrderedDict +from typing import Any, overload, Union, Optional, TYPE_CHECKING + +if TYPE_CHECKING: + from ..elements._base import BaseElement + +from ..elements import _base +from ._utils import natural_sort_key +from ..localization import inkex_gettext +from ..utils import AbortExtension + + +class ElementList(OrderedDict): + """ + A list of elements, selected by id, iterator or xpath + + This may look like a dictionary, but it is really a list of elements. + The default iterator is the element objects themselves (not keys) and it is + possible to key elements by their numerical index. + + It is also possible to look up items by their id and the element object itself. + """ + + def __init__(self, svg, _iter=None): + self.svg = svg + self.ids = OrderedDict() + super().__init__() + if _iter is not None: + self.set(*list(_iter)) + + def __iter__(self): + return self.values().__iter__() + + def __getitem__(self, key): + return super().__getitem__(self._to_key(key)) + + def __contains__(self, key): + return super().__contains__(self._to_key(key)) + + def __setitem__(self, orig_key, elem): + if orig_key != elem and orig_key != elem.get("id"): + raise ValueError(f"Refusing to set bad key in ElementList {orig_key}") + if isinstance(elem, str): + key = elem + elem = self.svg.getElementById(elem, literal=True) + if elem is None: + return + if isinstance(elem, _base.BaseElement): + # Selection is a list of elements to select + key = elem.xml_path + element_id = elem.get("id") + if element_id is not None: + self.ids[element_id] = key + super().__setitem__(key, elem) + else: + kind = type(elem).__name__ + raise ValueError(f"Unknown element type: {kind}") + + @overload + def _to_key(self, key: None, default: Any) -> Any: ... + + @overload + def _to_key(self, key: Union[int, "BaseElement", str], default: Any) -> str: ... + + def _to_key(self, key, default=None) -> str: + """Takes a key (id, element, etc) and returns an xml_path key""" + + if self and key is None: + key = default + if isinstance(key, int): + return list(self.keys())[key] + if isinstance(key, _base.BaseElement): + return key.xml_path + if isinstance(key, str) and key[0] != "/": + return self.ids.get(key, key) + return key + + def clear(self): + """Also clear ids""" + self.ids.clear() + super().clear() + + def set(self, *ids): + """ + Sets the currently selected elements to these ids, any existing + selection is cleared. + + Arguments a list of element ids, element objects or + a single xpath expression starting with ``//``. + + All element objects must have an id to be correctly set. + + >>> selection.set("rect123", "path456", "text789") + >>> selection.set(elem1, elem2, elem3) + >>> selection.set("//rect") + """ + self.clear() + self.add(*ids) + + def pop(self, key=None): + """Remove the key item or remove the last item selected""" + item = super().pop(self._to_key(key, default=-1)) + self.ids.pop(item.get("id")) + return item + + def add(self, *ids): + """Like set() but does not clear first""" + # Allow selecting of xpath elements directly + if len(ids) == 1 and isinstance(ids[0], str) and ids[0].startswith("//"): + ids = self.svg.xpath(ids[0]) + + for elem in ids: + self[elem] = elem # This doesn't matter + + def rendering_order(self): + """Get the selected elements by z-order (stacking order), ordered from bottom to + top + + .. versionadded:: 1.2 + :func:`paint_order` has been renamed to :func:`rendering_order`""" + new_list = ElementList(self.svg) + # the elements are stored with their xpath index, so a natural sort order + # '3' < '20' < '100' has to be applied + new_list.set( + *[ + elem + for _, elem in sorted( + self.items(), key=lambda x: natural_sort_key(x[0]) + ) + ] + ) + return new_list + + def filter(self, *types): + """Filter selected elements of the given type, returns a new SelectedElements + object""" + return ElementList( + self.svg, [e for e in self if not types or isinstance(e, types)] + ) + + def filter_nonzero(self, *types, error_msg: Optional[str] = None): + """Filter selected elements of the given type, returns a new SelectedElements + object. If the selection is empty, abort the extension. + + .. versionadded:: 1.2 + + :param error_msg: e + :type error_msg: str, optional + + Args: + *types (Type) : type(s) to filter the selection by + error_msg (str, optional): error message that is displayed if the selection + is empty, defaults to + ``_("Please select at least one element of type(s) {}")``. + Defaults to None. + + Raises: + AbortExtension: if the selection is empty + + Returns: + ElementList: filtered selection + """ + filtered = self.filter(*types) + if not filtered: + if error_msg is None: + error_msg = inkex_gettext( + "Please select at least one element of the following type(s): {}" + ).format(", ".join([type.__name__ for type in types])) + raise AbortExtension(error_msg) + return filtered + + def get(self, *types): + """Like filter, but will enter each element searching for any child of the given + types""" + + def _recurse(elem): + if not types or isinstance(elem, types): + yield elem + for child in elem: + yield from _recurse(child) + + return ElementList( + self.svg, + [ + r + for e in self + for r in _recurse(e) + if isinstance(r, (_base.BaseElement, str)) + ], + ) + + def id_dict(self): + """For compatibility, return regular dictionary of id -> element pairs""" + return {eid: self[xid] for eid, xid in self.ids.items()} + + def bounding_box(self): + """ + Gets a :class:`inkex.transforms.BoundingBox` object for the selected items. + + Text objects have a bounding box without width or height that only + reflects the coordinate of their anchor. If a text object is a part of + the selection's boundary, the bounding box may be inaccurate. + + When no object is selected or when the object's location cannot be + determined (e.g. empty group or layer), all coordinates will be None. + """ + return sum([elem.bounding_box() for elem in self], None) + + def first(self): + """Returns the first item in the selected list""" + for elem in self: + return elem + return None diff --git a/extensions/botbox3000/deps/inkex/elements/_svg.py b/extensions/botbox3000/deps/inkex/elements/_svg.py new file mode 100644 index 0000000..0def01d --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_svg.py @@ -0,0 +1,479 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Thomas Holder +# Sergei Izmailov +# Windell Oskay +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=attribute-defined-outside-init +# +""" +Provide a way to load lxml attributes with an svg API on top. +""" + +import random +import math +from functools import cached_property + +from lxml import etree + +from ..deprecated.meta import DeprecatedSvgMixin, deprecate +from ..units import discover_unit, parse_unit +from ._selected import ElementList +from ..transforms import BoundingBox +from ..styles import StyleSheets, ConditionalStyle + +from ._base import BaseElement, ViewboxMixin +from ._meta import StyleElement, NamedView +from ._utils import registerNS, addNS, splitNS + +from typing import Optional, List, Tuple + +if False: # pylint: disable=using-constant-test + import typing # pylint: disable=unused-import + + +class SvgDocumentElement(DeprecatedSvgMixin, BaseElement, ViewboxMixin): + """Provide access to the document level svg functionality""" + + # pylint: disable=too-many-public-methods + tag_name = "svg" + + selection: ElementList + """The selection as passed by Inkscape (readonly)""" + + def _init(self): + self.current_layer = None + self.view_center = (0.0, 0.0) + self.selection = ElementList(self) + + @cached_property + def ids(self): + result = {} + for el in self.iter(): + try: + id = super(etree.ElementBase, el).get("id", None) + if id is not None: + result[id] = el + + el._root = self + except TypeError: + pass # Comments + return result + + @cached_property + def stylesheet_cache(self): + return {node: node.stylesheet() for node in self.xpath("//svg:style")} + + def tostring(self): + """Convert document to string""" + return etree.tostring(etree.ElementTree(self)) + + def get_ids(self): + """Returns a set of unique document ids""" + return self.ids.keys() + + def get_unique_id( + self, + prefix: str, + size: Optional[int] = None, + blacklist: Optional[List[str]] = None, + ): + """Generate a new id from an existing old_id + + The id consists of a prefix and an appended random integer with size digits. + + If size is not given, it is determined automatically from the length of + existing ids, i.e. those in the document plus those in the blacklist. + + Args: + prefix (str): the prefix of the new ID. + size (Optional[int], optional): number of digits of the second part of the + id. If None, the length is chosen based on the amount of existing + objects. Defaults to None. + + .. versionchanged:: 1.1 + The default of this parameter has been changed from 4 to None. + blacklist (Optional[Iterable[str]], optional): An additional iterable of ids + that are not allowed to be used. This is useful when bulk inserting + objects. + Defaults to None. + + .. versionadded:: 1.2 + + Returns: + _type_: _description_ + """ + ids = self.get_ids() + if size is None: + size = max(math.ceil(math.log10(len(ids) or 1000)) + 1, 4) + new_id = None + _from = 10**size - 1 + _to = 10**size + while ( + new_id is None + or new_id in ids + or (blacklist is not None and new_id in blacklist) + ): + # Do not use randint because py2/3 incompatibility + new_id = prefix + str(int(random.random() * _from - _to) + _to) + return new_id + + def get_page_bbox(self, page=None) -> BoundingBox: + """Gets the page dimensions as a bbox. For single-page documents, the viewbox + dimensions are returned. + + Args: + page (int, optional): Page number. Defaults to the first page. + + .. versionadded:: 1.3 + + Raises: + IndexError: if the page number provided does not exist in the document. + + Returns: + BoundingBox: the bounding box of the page + """ + if page is None: + page = 0 + pages = self.namedview.get_pages() + if 0 <= page < len(pages): + return pages[page].bounding_box + raise IndexError("Invalid page number") + + def get_current_layer(self): + """Returns the currently selected layer""" + layer = self.getElementById(self.namedview.current_layer, "svg:g") + if layer is None: + return self + return layer + + def add_namespace(self, prefix, url): + """Adds an xml namespace to the xml parser with the desired prefix. + + If the prefix or url are already in use with different values, this + function will raise an error. Remove any attributes or elements using + this namespace before calling this function in order to rename it. + + .. versionadded:: 1.3 + """ + if self.nsmap.get(prefix, None) == url: + registerNS(prefix, url) + return + + # Attempt to clean any existing namespaces + if prefix in self.nsmap or url in self.nsmap.values(): + nskeep = [k for k, v in self.nsmap.items() if k != prefix and v != url] + etree.cleanup_namespaces(self, keep_ns_prefixes=nskeep) + if prefix in self.nsmap: + raise KeyError("ns prefix already used with a different url") + if url in self.nsmap.values(): + raise ValueError("ns url already used with a different prefix") + + # These are globals, but both will overwrite previous uses. + registerNS(prefix, url) + etree.register_namespace(prefix, url) + + # Set and unset an attribute to add the namespace to this root element. + self.set(f"{prefix}:temp", "1") + self.set(f"{prefix}:temp", None) + + def getElement(self, xpath): # pylint: disable=invalid-name + """Gets a single element from the given xpath or returns None""" + return self.findone(xpath) + + def getElementById(self, eid: str, elm="*", literal=False): # pylint: disable=invalid-name + """Get an element in this svg document by it's ID attribute. + + Args: + eid (str): element id + elm (str, optional): element type, including namespace, e.g. ``svg:path``. + Defaults to "*". + literal (bool, optional): If ``False``, ``#url()`` is stripped from ``eid``. + Defaults to False. + + .. versionadded:: 1.1 + + Returns: + Union[BaseElement, None]: found element + """ + if eid is not None and not literal: + eid = eid.strip()[4:-1] if eid.startswith("url(") else eid + eid = eid.lstrip("#") + + result = self.ids.get(eid, None) + if result is not None: + if elm != "*": + elm_with_ns = addNS(*splitNS(elm)[::-1]) + if not super(etree.ElementBase, result).tag == elm_with_ns: + return None + return result + return None + + def getElementByName(self, name, elm="*"): # pylint: disable=invalid-name + """Get an element by it's inkscape:label (aka name)""" + return self.getElement(f'//{elm}[@inkscape:label="{name}"]') + + def getElementsByClass(self, class_name): # pylint: disable=invalid-name + """Get elements by it's class name""" + return ConditionalStyle(f".{class_name}").all_matches(self) + + def getElementsByHref(self, eid: str, attribute="href"): # pylint: disable=invalid-name + """Get elements that reference the element with id eid. + + Args: + eid (str): _description_ + attribute (str, optional): Attribute to look for. + Valid choices: "href", "xlink:href", "mask", "clip-path". + Defaults to "href". + + .. versionadded:: 1.2 + + attribute set to "href" or "xlink:href" handles both cases. + .. versionchanged:: 1.3 + + Returns: + Any: list of elements + """ + if attribute == "href" or attribute == "xlink:href": + return self.xpath(f'//*[@href|@xlink:href="#{eid}"]') + elif attribute == "mask": + return self.xpath(f'//*[@mask="url(#{eid})"]') + elif attribute == "clip-path": + return self.xpath(f'//*[@clip-path="url(#{eid})"]') + + def getElementsByStyleUrl(self, eid, style=None): # pylint: disable=invalid-name + """Get elements by a style attribute url""" + url = f"url(#{eid})" + if style is not None: + url = style + ":" + url + return self.xpath(f'//*[contains(@style,"{url}")]') + + @property + def name(self): + """Returns the Document Name""" + return self.get("sodipodi:docname", "") + + @property + def namedview(self) -> NamedView: + """Return the sp namedview meta information element""" + return self.get_or_create("//sodipodi:namedview", prepend=True) + + @property + def metadata(self): + """Return the svg metadata meta element container""" + return self.get_or_create("//svg:metadata", prepend=True) + + @property + def defs(self): + """Return the svg defs meta element container""" + return self.get_or_create("//svg:defs", prepend=True) + + def get_viewbox(self) -> List[float]: + """Parse and return the document's viewBox attribute""" + return self.parse_viewbox(self.get("viewBox", "0")) or [0, 0, 0, 0] + + @property + def viewbox_width(self) -> float: # getDocumentWidth(self): + """Returns the width of the `user coordinate system + `_ in user units, i.e. + the width of the viewbox, as defined in the SVG file. If no viewbox is defined, + the value of the width attribute is returned. If the height is not defined, + returns 0. + + .. versionadded:: 1.2""" + return self.get_viewbox()[2] or self.viewport_width + + @property + def viewport_width(self) -> float: + """Returns the width of the `viewport coordinate system + `_ in user units, i.e. the + width attribute of the svg element converted to px + + .. versionadded:: 1.2""" + return self.to_dimensionless(self.get("width")) or self.get_viewbox()[2] + + @property + def viewbox_height(self) -> float: # getDocumentHeight(self): + """Returns the height of the `user coordinate system + `_ in user units, i.e. the + height of the viewbox, as defined in the SVG file. If no viewbox is defined, the + value of the height attribute is returned. If the height is not defined, + returns 0. + + .. versionadded:: 1.2""" + return self.get_viewbox()[3] or self.viewport_height + + @property + def viewport_height(self) -> float: + """Returns the width of the `viewport coordinate system + `_ in user units, i.e. the + height attribute of the svg element converted to px + + .. versionadded:: 1.2""" + return self.to_dimensionless(self.get("height")) or self.get_viewbox()[3] + + @property + def scale(self): + """Returns the ratio between the viewBox width and the page width. + + .. versionchanged:: 1.2 + Previously, the scale as shown by the document properties was computed, + but the computation of this in core Inkscape changed in Inkscape 1.2, so + this was moved to :attr:`inkscape_scale`.""" + return self._base_scale() + + @property + def inkscape_scale(self): + """Returns the ratio between the viewBox width (in width/height units) and the + page width, which is displayed as "scale" in the Inkscape document + properties. + + .. versionadded:: 1.2""" + + viewbox_unit = ( + parse_unit(self.get("width")) or parse_unit(self.get("height")) or (0, "px") + )[1] + return self._base_scale(viewbox_unit) + + def _base_scale(self, unit="px"): + """Returns what Inkscape shows as "user units per `unit`" + + .. versionadded:: 1.2""" + try: + scale_x = ( + self.to_dimensional(self.viewport_width, unit) / self.viewbox_width + ) + scale_y = ( + self.to_dimensional(self.viewport_height, unit) / self.viewbox_height + ) + value = max([scale_x, scale_y]) + return 1.0 if value == 0 else value + except (ValueError, ZeroDivisionError): + return 1.0 + + @property + def equivalent_transform_scale(self) -> float: + """Return the scale of the equivalent transform of the svg tag, as defined by + https://www.w3.org/TR/SVG2/coords.html#ComputingAViewportsTransform + (highly simplified) + + .. versionadded:: 1.2""" + return self.scale + + @property + def unit(self): + """Returns the unit used for in the SVG document. + In the case the SVG document lacks an attribute that explicitly + defines what units are used for SVG coordinates, it tries to calculate + the unit from the SVG width and viewBox attributes. + Defaults to 'px' units.""" + if not hasattr(self, "_unit"): + self._unit = "px" # Default is px + viewbox = self.get_viewbox() + if viewbox and set(viewbox) != {0}: + self._unit = discover_unit(self.get("width"), viewbox[2], default="px") + return self._unit + + @property + def document_unit(self): + """Returns the display unit (Inkscape-specific attribute) of the document + + .. versionadded:: 1.2""" + return self.namedview.get("inkscape:document-units", "px") + + @property + def stylesheets(self): + """Get all the stylesheets, bound together to one, (for reading)""" + sheets = StyleSheets() + for value in self.stylesheet_cache.values(): + sheets.append(value) + return sheets + + @property + def stylesheet(self): + """Return the first stylesheet or create one if needed (for writing)""" + for sheet in self.stylesheets: + return sheet + + style_node = StyleElement() + self.defs.append(style_node) + return style_node.stylesheet() + + def add_to_tree_callback(self, element): + """Callback called automatically when adding an element to the tree. + Updates the list of stylesheets and the ID tracker with the subtree of element. + + .. versionadded:: 1.4 + + Args: + element (BaseElement): element added to the tree. + """ + + for el in element.iter(): + self._add_individual_to_tree(el) + + def _add_individual_to_tree(self, element: BaseElement): + if isinstance(element, etree._Comment): + return + element._root = self + if element.TAG == "style": + self.stylesheet_cache[element] = element.stylesheet() + new_id = element.get("id", None) + if new_id is not None: + if new_id in self.ids: + while new_id in self.ids: + new_id += "-1" + super(etree.ElementBase, element).set("id", new_id) # type: ignore + self.ids[new_id] = element + + def remove_from_tree_callback(self, element): + """ "Callback called automatically when removing an element from the tree. + Remove elements in the subtree of element from the the list of stylesheets + and the ID tracker. + + .. versionadded:: 1.4 + + Args: + element (BaseElement): element added to the tree. + """ + for el in element.iter(): + self._remove_individual_from_tree(el) + + def _remove_individual_from_tree(self, element): + if isinstance(element, etree._Comment): + return + element._root = None + if element.TAG == "style" and element in self.stylesheet_cache: + self.stylesheet_cache.remove(element) + old_id = element.get("id", None) + if old_id is not None and old_id in self.ids: + self.ids.pop(old_id) + + +def width(self): + """Use :func:`viewport_width` instead""" + return self.viewport_width + + +def height(self): + """Use :func:`viewport_height` instead""" + return self.viewport_height + + +SvgDocumentElement.width = property(deprecate(width, "1.2")) +SvgDocumentElement.height = property(deprecate(height, "1.2")) diff --git a/extensions/botbox3000/deps/inkex/elements/_text.py b/extensions/botbox3000/deps/inkex/elements/_text.py new file mode 100644 index 0000000..3c96836 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_text.py @@ -0,0 +1,249 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=arguments-differ +""" +Provide text based element classes interface. + +Because text is not rendered at all, no information about a text's path +size or actual location can be generated yet. +""" + +from __future__ import annotations + +from tempfile import TemporaryDirectory + +from ..interfaces.IElement import BaseElementProtocol +from ..paths import Path +from ..transforms import Transform, BoundingBox +from ..command import inkscape, write_svg +from ._base import BaseElement, ShapeElement +from ._polygons import PathElementBase + + +class TextBBMixin: # pylint: disable=too-few-public-methods + """Mixin to query the bounding box from Inkscape + + .. versionadded:: 1.2""" + + def get_inkscape_bbox(self: BaseElementProtocol) -> BoundingBox: + """Query the bbbox of a single object. This calls the Inkscape command, + so it is rather slow to use in a loop.""" + with TemporaryDirectory(prefix="inkscape-command") as tmpdir: + svg_file = write_svg(self.root, tmpdir, "input.svg") + out = inkscape(svg_file, "-X", "-Y", "-W", "-H", query_id=self.get_id()) + out = list(map(self.root.viewport_to_unit, out.splitlines())) + if len(out) != 4: + raise ValueError("Error: Bounding box computation failed") + return BoundingBox.new_xywh(*out) + + +class FlowRegion(ShapeElement): + """SVG Flow Region (SVG 2.0)""" + + tag_name = "flowRegion" + + def get_path(self): + # This ignores flowRegionExcludes + return sum([child.path for child in self], Path()) + + +class FlowRoot(ShapeElement, TextBBMixin): + """SVG Flow Root (SVG 2.0)""" + + tag_name = "flowRoot" + + @property + def region(self): + """Return the first flowRegion in this flowRoot""" + return self.findone("svg:flowRegion") + + def get_path(self): + region = self.region + return region.get_path() if region is not None else Path() + + +class FlowPara(ShapeElement): + """SVG Flow Paragraph (SVG 2.0)""" + + tag_name = "flowPara" + + def get_path(self): + # XXX: These empty paths mean the bbox for text elements will be nothing. + return Path() + + +class FlowDiv(ShapeElement): + """SVG Flow Div (SVG 2.0)""" + + tag_name = "flowDiv" + + def get_path(self): + # XXX: These empty paths mean the bbox for text elements will be nothing. + return Path() + + +class FlowSpan(ShapeElement): + """SVG Flow Span (SVG 2.0)""" + + tag_name = "flowSpan" + + def get_path(self): + # XXX: These empty paths mean the bbox for text elements will be nothing. + return Path() + + +class TextElement(ShapeElement, TextBBMixin): + """A Text element""" + + tag_name = "text" + x = property(lambda self: self.to_dimensionless(self.get("x", 0))) + y = property(lambda self: self.to_dimensionless(self.get("y", 0))) + + def get_path(self): + return Path() + + def tspans(self): + """Returns all children that are tspan elements""" + return self.findall("svg:tspan") + + def get_text(self, sep="\n"): + """Return the text content including tspans and their tail""" + # Stack of node and depth + stack = [(self, 0)] + result = [] + + def poptail(): + """Pop the tail from the tail stack and add it if necessary to results""" + tail = tail_stack.pop() + if tail is not None: + result.append(tail) + + # Stack of the tail of nodes + tail_stack = [] + previous_depth = -1 + while stack: + # Get current node and depth + node, depth = stack.pop() + + # Pop the previous tail if the depth do not increase + if previous_depth >= depth: + poptail() + + # Pop as many times as the depth is reduced + for _ in range(previous_depth - depth): + poptail() + + # Add a node text to the result, if any if node is text or tspan + if node.text and node.TAG in ["text", "tspan"]: + result.append(node.text) + + # Add child elements + stack.extend( + map( + lambda tspan: (tspan, depth + 1), + node.iterchildren(reversed=True), + ) + ) + + # Add the tail from node to the stack + tail_stack.append(node.tail) + + previous_depth = depth + + # Pop remaining tail elements + # Tail of the main text element should not be included + while len(tail_stack) > 1: + poptail() + + return sep.join(result) + + def shape_box(self, transform=None): + """ + Returns a horrible bounding box that just contains the coord points + of the text without width or height (which is impossible to calculate) + """ + effective_transform = Transform(transform) @ self.transform + x, y = effective_transform.apply_to_point((self.x, self.y)) + bbox = BoundingBox(x, y) + for tspan in self.tspans(): + bbox += tspan.bounding_box(effective_transform) + return bbox + + +class TextPath(ShapeElement, TextBBMixin): + """A textPath element""" + + tag_name = "textPath" + + def get_path(self): + return Path() + + +class Tspan(ShapeElement, TextBBMixin): + """A tspan text element""" + + tag_name = "tspan" + x = property(lambda self: self.to_dimensionless(self.get("x", 0))) + y = property(lambda self: self.to_dimensionless(self.get("y", 0))) + + @classmethod + def superscript(cls, text): + """Adds a superscript tspan element""" + return cls(text, style="font-size:65%;baseline-shift:super") + + def get_path(self): + return Path() + + def shape_box(self, transform=None): + """ + Returns a horrible bounding box that just contains the coord points + of the text without width or height (which is impossible to calculate) + """ + effective_transform = Transform(transform) @ self.transform + x1, y1 = effective_transform.apply_to_point((self.x, self.y)) + fontsize = self.to_dimensionless(self.style.get("font-size", "12px")) + x2 = self.x + 0 # XXX This is impossible to calculate! + y2 = self.y + float(fontsize) + x2, y2 = effective_transform.apply_to_point((x2, y2)) + return BoundingBox((x1, x2), (y1, y2)) + + +class SVGfont(BaseElement): + """An svg font element""" + + tag_name = "font" + + +class FontFace(BaseElement): + """An svg font font-face element""" + + tag_name = "font-face" + + +class Glyph(PathElementBase): + """An svg font glyph element""" + + tag_name = "glyph" + + +class MissingGlyph(BaseElement): + """An svg font missing-glyph element""" + + tag_name = "missing-glyph" diff --git a/extensions/botbox3000/deps/inkex/elements/_use.py b/extensions/botbox3000/deps/inkex/elements/_use.py new file mode 100644 index 0000000..52b7050 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_use.py @@ -0,0 +1,89 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2020 Martin Owens +# Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Interface for the Use and Symbol elements +""" + +from ..transforms import Transform + +from ._groups import Group, GroupBase +from ._base import ShapeElement + + +class Symbol(GroupBase): + """SVG symbol element""" + + tag_name = "symbol" + + +class Use(ShapeElement): + """A 'use' element that links to another in the document""" + + tag_name = "use" + + @classmethod + def new(cls, elem, x, y, **attrs): # pylint: disable=arguments-differ + ret = super().new(x=x, y=y, **attrs) + ret.href = elem + return ret + + def get_path(self): + """Returns the path of the cloned href plus any transformation + + .. versionchanged:: 1.3 + include transform of the referenced element + """ + path = self.href.path + path = path.transform(self.href.transform) + return path + + def effective_style(self): + """Href's style plus this object's own styles""" + style = self.href.effective_style() + style.update(self.style) + return style + + def unlink(self): + """Unlink this clone, replacing it with a copy of the original""" + copy = self.href.copy() + if isinstance(copy, Symbol): + group = Group(**copy.attrib) + group.extend(copy) + copy = group + copy.transform = self.transform @ copy.transform + copy.transform.add_translate( + self.to_dimensionless(self.get("x", 0)), + self.to_dimensionless(self.get("y", 0)), + ) + copy.style = self.style + copy.style + # Preserve the id of the clone to not break links that link the + # As we replace exactly one element by exactly one, this should be safe. + old_id = self.get_id() + self.replace_with(copy) + copy.set_random_ids() + copy.set_id(old_id) + return copy + + def shape_box(self, transform=None): + """BoundingBox of the unclipped shape + + .. versionadded:: 1.1""" + effective_transform = Transform(transform) @ self.transform + return self.href.bounding_box(effective_transform) diff --git a/extensions/botbox3000/deps/inkex/elements/_utils.py b/extensions/botbox3000/deps/inkex/elements/_utils.py new file mode 100644 index 0000000..62acb72 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/elements/_utils.py @@ -0,0 +1,150 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) 2021 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Useful utilities specifically for elements (that aren't base classes) + +.. versionadded:: 1.1 + Most of the methods in this module were moved from inkex.utils. +""" + +from collections import defaultdict +import re + +# a dictionary of all of the xmlns prefixes in a standard inkscape doc +NSS = { + "sodipodi": "http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd", + "cc": "http://creativecommons.org/ns#", + "ccOLD": "http://web.resource.org/cc/", + "svg": "http://www.w3.org/2000/svg", + "dc": "http://purl.org/dc/elements/1.1/", + "rdf": "http://www.w3.org/1999/02/22-rdf-syntax-ns#", + "inkscape": "http://www.inkscape.org/namespaces/inkscape", + "xlink": "http://www.w3.org/1999/xlink", + "xml": "http://www.w3.org/XML/1998/namespace", +} +SSN = dict((b, a) for (a, b) in NSS.items()) + + +def registerNS(prefix, url): + """Register the given prefix as a namespace url.""" + NSS[prefix] = url + SSN[url] = prefix + + +def addNS(tag, ns=None, namespaces=NSS): # pylint: disable=invalid-name + """Add a known namespace to a name for use with lxml""" + if tag.startswith("{") and ns: + _, tag = removeNS(tag) + if not tag.startswith("{"): + tag = tag.replace("__", ":") + if ":" in tag: + (ns, tag) = tag.rsplit(":", 1) + ns = namespaces.get(ns, None) or ns + if ns is not None: + return f"{{{ns}}}{tag}" + return tag + + +def removeNS(name, reverse_namespaces=SSN, default="svg"): # pylint: disable=invalid-name + """The reverse of addNS, finds any namespace and returns tuple (ns, tag)""" + if name[0] == "{": + (url, tag) = name[1:].split("}", 1) + return reverse_namespaces.get(url, default), tag + if ":" in name: + return name.rsplit(":", 1) + return default, name + + +def splitNS(name, namespaces=NSS): # pylint: disable=invalid-name + """Like removeNS, but returns a url instead of a prefix""" + (prefix, tag) = removeNS(name) + return (namespaces[prefix], tag) + + +def natural_sort_key(key, _nsre=re.compile("([0-9]+)")): + """Helper for a natural sort, see + https://stackoverflow.com/a/16090640/3298143""" + return [int(text) if text.isdigit() else text.lower() for text in _nsre.split(key)] + + +class ChildToProperty(property): + """Use when you have a singleton child element who's text + content is the canonical value for the property""" + + def __init__(self, tag, prepend=False): + super().__init__() + self.tag = tag + self.prepend = prepend + + def __get__(self, obj, klass=None): + elem = obj.findone(self.tag) + return elem.text if elem is not None else None + + def __set__(self, obj, value): + elem = obj.get_or_create(self.tag, prepend=self.prepend) + elem.text = value + + def __delete__(self, obj): + obj.remove_all(self.tag) + + @property + def __doc__(self): + return f"Get, set or delete the {self.tag} property." + + +class CloningVat: + """ + When modifying defs, sometimes we want to know if every backlink would have + needed changing, or it was just some of them. + + This tracks the def elements, their promises and creates clones if needed. + """ + + def __init__(self, svg): + self.svg = svg + self.tracks = defaultdict(set) + self.set_ids = defaultdict(list) + + def track(self, elem, parent, set_id=None, **kwargs): + """Track the element and connected parent""" + elem_id = elem.get("id") + parent_id = parent.get("id") + self.tracks[elem_id].add(parent_id) + self.set_ids[elem_id].append((set_id, kwargs)) + + def process(self, process, types=(), make_clones=True, **kwargs): + """ + Process each tracked item if the backlinks match the parents + + Optionally make clones, process the clone and set the new id. + """ + for elem_id in list(self.tracks): + parents = self.tracks[elem_id] + elem = self.svg.getElementById(elem_id) + backlinks = {blk.get("id") for blk in elem.backlinks(*types)} + if backlinks == parents: + # No need to clone, we're processing on-behalf of all parents + process(elem, **kwargs) + elif make_clones: + clone = elem.copy() + elem.getparent().append(clone) + clone.set_random_id() + for update, upkw in self.set_ids.get(elem_id, ()): + update(elem.get("id"), clone.get("id"), **upkw) + process(clone, **kwargs) diff --git a/extensions/botbox3000/deps/inkex/extensions.py b/extensions/botbox3000/deps/inkex/extensions.py new file mode 100644 index 0000000..2170379 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/extensions.py @@ -0,0 +1,536 @@ +# -*- coding: utf-8 -*- +# +# Copyright (C) 2018 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +A helper module for creating Inkscape effect extensions + +This provides the basic generic types of extensions which most writers should +use in their code. See below for the different types. +""" + +import os +import re +import sys +import types +from abc import ABC + +from .utils import errormsg, Boolean +from .colors import Color, ColorError +from .elements import ( + load_svg, + BaseElement, + ShapeElement, + Group, + Layer, + Grid, + TextElement, + FlowPara, + FlowDiv, + Pattern, +) +from .elements._utils import CloningVat +from .base import ( + InkscapeExtension, + SvgThroughMixin, + SvgInputMixin, + SvgOutputMixin, + TempDirMixin, +) +from .transforms import Transform +from .elements import LinearGradient, RadialGradient, MeshGradient +from .command import write_svg, inkscape, ProgramRunError +from .utils import errormsg +from .localization import inkex_gettext as _ + +# All the names that get added to the inkex API itself. +__all__ = ( + "EffectExtension", + "GenerateExtension", + "InputExtension", + "OutputExtension", + "RasterOutputExtension", + "CallExtension", + "TemplateExtension", + "ColorExtension", + "TextExtension", +) + +stdout = sys.stdout + + +class EffectExtension(SvgThroughMixin, InkscapeExtension, ABC): + """ + Takes the SVG from Inkscape, modifies the selection or the document + and returns an SVG to Inkscape. + """ + + +class OutputExtension(SvgInputMixin, TempDirMixin, InkscapeExtension): + """ + Takes the SVG from Inkscape and outputs it to something that's not an SVG. + + Used in functions for `Save As` + """ + + def effect(self): + """Effect isn't needed for a lot of Output extensions""" + + def save(self, stream): + """But save certainly is, we give a more exact message here""" + raise NotImplementedError("Output extensions require a save(stream) method!") + + def preprocess(self, types_to_path=None, unlink_clones=True): + """Preprocess the SVG into an export-friendly document by converting + certain objects to path beforehand. + + Args: + types_to_path (List[str], optional): List of element types to convert to + path. Defaults to all text elements and all non-path shape elements. + unlink_clones (bool, optional): If clones should be unlinked. Defaults to + True. + + Returns: + _type_: _description_ + """ + if types_to_path is None: + types_to_path = [ + "flowRoot", + "rect", + "circle", + "ellipse", + "line", + "polyline", + "polygon", + "text", + ] + actions = ["unlock-all"] + if "flowRoot" in types_to_path: + # Flow roots contain rectangles inside them, so they need to be + # converted to paths separately from other shapes + actions += [ + "select-by-element:flowRoot", + "object-to-path", + "select-clear", + ] + types_to_path.remove("flowRoot") + + # Now convert all non-paths to paths + actions += ["select-by-element:" + i for i in types_to_path] + actions += ["object-to-path", "select-clear"] + # unlink clones + if unlink_clones: + actions += ["select-by-element:use", "object-unlink-clones"] + # save and overwrite + actions += ["export-overwrite", "export-do"] + + infile = os.path.join(self.tempdir, "input.svg") + write_svg(self.document, infile) + try: + inkscape(infile, actions=";".join(actions)) + except ProgramRunError as err: + errormsg(_("An error occurred during document preparation")) + errormsg(err.stderr.decode("utf-8")) + + with open(infile, "r", encoding="utf-8") as stream: + self.document = load_svg(stream) + self.svg = self.document.getroot() + + +class RasterOutputExtension(InkscapeExtension): + """ + Takes a PNG from Inkscape and outputs it to another raster format. + + .. versionadded:: 1.1 + """ + + def __init__(self): + super().__init__() + self.img = None + + def load(self, stream): + from PIL import Image + + # disable the PIL decompression bomb DOS attack check. + Image.MAX_IMAGE_PIXELS = None + + self.img = Image.open(stream) + + def effect(self): + """Not needed since image isn't being changed""" + + def save(self, stream): + """Implement raster image saving here from PIL""" + raise NotImplementedError("Raster Output extension requires a save method!") + + +class InputExtension(SvgOutputMixin, InkscapeExtension): + """ + Takes any type of file as input and outputs SVG which Inkscape can read. + + Used in functions for `Open` + """ + + def effect(self): + """Effect isn't needed for a lot of Input extensions""" + + def load(self, stream): + """But load certainly is, we give a more exact message here""" + raise NotImplementedError("Input extensions require a load(stream) method!") + + +class CallExtension(TempDirMixin, InputExtension): + """Call an external program to get the output""" + + input_ext = "svg" + output_ext = "svg" + + def load(self, stream): + pass # Not called (load_raw instead) + + def load_raw(self): + # Don't call InputExtension.load_raw + TempDirMixin.load_raw(self) + input_file = self.options.input_file + + if not isinstance(input_file, str): + data = input_file.read() + input_file = os.path.join(self.tempdir, "input." + self.input_ext) + with open(input_file, "wb") as fhl: + fhl.write(data) + + output_file = os.path.join(self.tempdir, "output." + self.output_ext) + document = self.call(input_file, output_file) or output_file + if isinstance(document, str): + if not os.path.isfile(document): + raise IOError(f"Can't find generated document: {document}") + + if self.output_ext == "svg": + with open(document, "r", encoding="utf-8") as fhl: + document = fhl.read() + if "<" in document: + document = load_svg(document.encode("utf-8")) + else: + with open(document, "rb") as fhl: + document = fhl.read() + + self.document = document + + def call(self, input_file, output_file): + """Call whatever programs are needed to get the desired result.""" + raise NotImplementedError("Call extensions require a call(in, out) method!") + + +class GenerateExtension(EffectExtension): + """ + Does not need any SVG, but instead just outputs an SVG fragment which is + inserted into Inkscape, centered on the selection. + """ + + container_label = "" + container_layer = False + + def generate(self): + """ + Return an SVG fragment to be inserted into the selected layer of the document + OR yield multiple elements which will be grouped into a container group + element which will be given an automatic label and transformation. + """ + raise NotImplementedError("Generate extensions must provide generate()") + + def container_transform(self): + """ + Generate the transformation for the container group, the default is + to return the center position of the svg document or view port. + """ + (pos_x, pos_y) = self.svg.namedview.center + if pos_x is None: + pos_x = 0 + if pos_y is None: + pos_y = 0 + return Transform(translate=(pos_x, pos_y)) + + def create_container(self): + """ + Return the container the generated elements will go into. + + Default is a new layer or current layer depending on the :attr:`container_layer` + flag. + + .. versionadded:: 1.1 + """ + container = (Layer if self.container_layer else Group).new(self.container_label) + if self.container_layer: + self.svg.append(container) + else: + container.transform = self.container_transform() + parent = self.svg.get_current_layer() + try: + parent_transform = parent.composed_transform() + except AttributeError: + pass + else: + container.transform = -parent_transform @ container.transform + parent.append(container) + return container + + def effect(self): + layer = self.svg.get_current_layer() + fragment = self.generate() + if isinstance(fragment, types.GeneratorType): + container = self.create_container() + for child in fragment: + if isinstance(child, BaseElement): + container.append(child) + elif isinstance(fragment, BaseElement): + layer.append(fragment) + else: + errormsg("Nothing was generated\n") + + +class TemplateExtension(EffectExtension): + """ + Provide a standard way of creating templates. + """ + + size_rex = re.compile(r"([\d.]*)(\w\w)?x([\d.]*)(\w\w)?") + template_id = "SVGRoot" + + def __init__(self): + self.svg = None + super().__init__() + # Arguments added on after add_arguments so it can be overloaded cleanly. + self.arg_parser.add_argument("--size", type=self.arg_size(), dest="size") + self.arg_parser.add_argument("--width", type=int, default=800) + self.arg_parser.add_argument("--height", type=int, default=600) + self.arg_parser.add_argument("--orientation", default=None) + self.arg_parser.add_argument("--unit", default="px") + self.arg_parser.add_argument("--grid", type=Boolean) + # self.svg = None + + def get_template(self, **kwargs): + """Can be over-ridden with custom svg loading here""" + return self.document + + def arg_size(self, unit="px"): + """Argument is a string of the form X[unit]xY[unit], default units apply + when missing""" + + def _inner(value): + try: + value = float(value) + return (value, unit, value, unit) + except ValueError: + pass + match = self.size_rex.match(str(value)) + if match is not None: + size = match.groups() + return ( + float(size[0]), + size[1] or unit, + float(size[2]), + size[3] or unit, + ) + return None + + return _inner + + def get_size(self): + """Get the size of the new template (defaults to size options)""" + size = self.options.size + if self.options.size is None: + size = ( + self.options.width, + self.options.unit, + self.options.height, + self.options.unit, + ) + if ( + self.options.orientation == "horizontal" + and size[0] < size[2] + or self.options.orientation == "vertical" + and size[0] > size[2] + ): + size = size[2:4] + size[0:2] + return size + + def effect(self): + """Creates a template, do not over-ride""" + (width, width_unit, height, height_unit) = self.get_size() + width_px = int(self.svg.uutounit(width, "px")) + height_px = int(self.svg.uutounit(height, "px")) + + self.document = self.get_template() + self.svg = self.document.getroot() + self.svg.set("id", self.template_id) + self.svg.set("width", str(width) + width_unit) + self.svg.set("height", str(height) + height_unit) + self.svg.set("viewBox", f"0 0 {width} {height}") + self.set_namedview(width_px, height_px, width_unit) + + def set_namedview(self, width, height, unit): + """Setup the document namedview""" + self.svg.namedview.set("inkscape:document-units", unit) + self.svg.namedview.set("inkscape:zoom", "0.25") + self.svg.namedview.set("inkscape:cx", str(width / 2.0)) + self.svg.namedview.set("inkscape:cy", str(height / 2.0)) + if self.options.grid: + self.svg.namedview.set("showgrid", "true") + self.svg.namedview.add(Grid(type="xygrid")) + + +class ColorExtension(EffectExtension): + """ + A standard way to modify colours in an svg document. + """ + + process_none = False # should we call modify_color for the "none" color. + select_all = (ShapeElement,) + pass_rgba = False + target_space = None + """ + If true, color and opacity are processed together (as RGBA color) + by :func:`modify_color`. + + If false (default), they are processed independently by `modify_color` and + `modify_opacity`. + + .. versionadded:: 1.2 + """ + + def __init__(self): + super().__init__() + self._renamed = {} + + def effect(self): + # Limiting to shapes ignores Gradients (and other things) from the select_all + # this prevents defs from being processed twice. + self._renamed = {} + gradients = CloningVat(self.svg) + for elem in self.svg.selection.get(ShapeElement): + self.process_element(elem, gradients) + gradients.process(self.process_elements, types=(ShapeElement,)) + + def process_elements(self, elem): + """Process multiple elements (gradients)""" + for child in elem.descendants(): + self.process_element(child) + + def process_element(self, elem, gradients=None): + """Process one of the selected elements""" + style = elem.specified_style() + # Colours first + for name in ( + elem.style.associated_props if self.pass_rgba else elem.style.color_props + ): + if name not in style: + continue # we don't want to process default values + try: + value = style(name) + except ColorError: + continue # bad color value, don't touch. + if isinstance(value, Color): + col = Color(value) + if self.pass_rgba: + col.alpha = elem.style(elem.style.associated_props[name]) + rgba_result = self._modify_color(name, col) + elem.style.set_color(rgba_result, name) + + if isinstance( + value, (LinearGradient, RadialGradient, MeshGradient, Pattern) + ): + gradients.track(value, elem, self._ref_cloned, element=elem, name=name) + if value.href is not None: + gradients.track(value.href, elem, self._xlink_cloned, linker=value) + # Then opacities (usually does nothing) + if self.pass_rgba: + return + for name in elem.style.opacity_props: + value = style(name) + result = self.modify_opacity(name, value) + if result not in (value, 1): # only modify if not equal to old or default + elem.style[name] = result + + def _ref_cloned(self, old_id, new_id, element, name): + self._renamed[old_id] = new_id + element.style[name] = f"url(#{new_id})" + + def _xlink_cloned(self, old_id, new_id, linker): # pylint: disable=unused-argument + lid = linker.get("id") + linker = self.svg.getElementById(self._renamed.get(lid, lid)) + linker.href = new_id + + def _modify_color(self, name, color): + """Pre-process color value to filter out bad colors""" + if color or self.process_none: + output_space = type(color) + if self.target_space: + color = color.to(self.target_space) + return self.modify_color(name, color).to(output_space) + return color + + def modify_color(self, name, color): + """Replace this method with your colour modifier method""" + raise NotImplementedError("Provide a modify_color method.") + + def modify_opacity(self, name, opacity): # pylint: disable=no-self-use, unused-argument + """Optional opacity modification""" + return opacity + + +class TextExtension(EffectExtension): + """ + A base effect for changing text in a document. + """ + + newline = True + newpar = True + + def effect(self): + nodes = self.svg.selection or {None: self.document.getroot()} + for elem in nodes.values(): + self.process_element(elem) + + def process_element(self, node): + """Reverse the node text""" + if node.get("sodipodi:role") == "line": + self.newline = True + elif isinstance(node, (TextElement, FlowPara, FlowDiv)): + self.newline = True + self.newpar = True + + if node.text is not None: + node.text = self.process_chardata(node.text) + self.newline = False + self.newpar = False + + for child in node: + self.process_element(child) + + if node.tail is not None: + node.tail = self.process_chardata(node.tail) + + def process_chardata(self, text): + """Replaceable chardata method for processing the text""" + return "".join(map(self.map_char, text)) + + @staticmethod + def map_char(char): + """Replaceable map_char method for processing each letter""" + raise NotImplementedError( + "Please provide a process_chardata or map_char static method." + ) diff --git a/extensions/botbox3000/deps/inkex/gui/README.md b/extensions/botbox3000/deps/inkex/gui/README.md new file mode 100644 index 0000000..fede673 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/gui/README.md @@ -0,0 +1,13 @@ +# What is inkex.gui + +This module is a Gtk based GUI creator. It helps extensions launch their own user interfaces and can help make sure those interfaces will work on all platforms that Inkscape ships with. + +# How do I use it + +You can create custom user interfaces by using the [Gnome Glade builder program](https://gitlab.gnome.org/GNOME/glade). Once you have a layout of all the widgets you want, you then make a GtkApp and Window classes inside your Python program, when the GtkApp is run, the windows will be shown to the user and all signals specified for the widgets will call functions on your window class. + +Please see the existing code for examples of how to do this. + +# This is a fork + +This code was originally part of the package `gtkme` which contained some parts we didn't want to ship—such as Ubuntu indicators and internet pixmaps. To avoid conflicts, our stripped down version of the `gtkme` module is renamed and placed inside of Inkscape's `inkex` module. diff --git a/extensions/botbox3000/deps/inkex/gui/__init__.py b/extensions/botbox3000/deps/inkex/gui/__init__.py new file mode 100644 index 0000000..5aa9a48 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/gui/__init__.py @@ -0,0 +1,58 @@ +# +# Copyright 2011-2022 Martin Owens +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program. If not, see +# +# pylint: disable=wrong-import-position +""" +This is a wrapper layer to make interacting with Gtk a little less painful. +The main issues with Gtk is that it expects an awful lot of the developer, +code which is repeated over and over and patterns which every single developer +will use are not given easy to use convenience functions. + +This makes Gtk programming WET, unattractive and error prone. This module steps +inbetween and adds in all those missing bits. It's not meant to replace Gtk and +certainly it's possible to use Gtk and threading directly. + +.. versionadded:: 1.2 +""" + +import os +import sys +import logging +import threading + +from ..utils import DependencyError + +try: + import gi + + gi.require_version("Gtk", "4.0") + + # Importing while covering stderr because pygobject has broken + # warnings support and will force import warnings on our users. + tmp, sys.stderr = sys.stderr, None # type: ignore + from gi.repository import Gtk, GLib + + sys.stderr = tmp # type: ignore +except ImportError: # pragma: no cover + raise DependencyError( + "You are missing the required libraries for Gtk." + " Please report this problem to the Inkscape developers." + ) + +from .app import GtkApp +from .window import Window +from .listview import TreeView, IconView, ViewColumn, ViewSort, Separator +from .pixmap import PixmapManager diff --git a/extensions/botbox3000/deps/inkex/gui/app.py b/extensions/botbox3000/deps/inkex/gui/app.py new file mode 100644 index 0000000..d1a4f1f --- /dev/null +++ b/extensions/botbox3000/deps/inkex/gui/app.py @@ -0,0 +1,62 @@ +# SPDX-License-Identifier: GPL-3.0-or-later +# Copyright 2011-2022 Martin Owens + +""" +Wraps Gtk.Application, providing a way to load a Gtk.Builder +with a specific ui file containing windows, and building +a usable pythonic interface from them. +""" + +import os +import logging + +from gi.repository import Gtk, Gdk, Gio + + +class GtkApp(Gtk.Application): + """A very thin wrapper around Gtk.Application""" + + app_name = None + """The application id""" + + prefix = "" + """Folder prefix added to ui_dir""" + + ui_dir = "./" + """This is often the local directory""" + + ui_file = None + """If a single file is used for multiple windows""" + + def __init__(self, **kwargs): + """Creates a new GtkApp.""" + self.kwargs = kwargs + super().__init__( + application_id=self.app_name, flags=Gio.ApplicationFlags.NON_UNIQUE + ) + self.connect("activate", lambda _: self.on_activate()) + if self.ui_dir: + icontheme = Gtk.IconTheme.get_for_display(Gdk.Display.get_default()) + icontheme.add_search_path(self.ui_dir) + + def run_wrapped(self): + """Calls self.run() but catches keyboard interrupts""" + try: + self.run() + except KeyboardInterrupt: # pragma: no cover + logging.info("User Interrupted") + + def on_activate(self): + """Called when the application is activated""" + raise NotImplementedError("Must override on_activate in subclass") + + def get_ui_file(self, window): + """Load any given ui file from a standard location""" + paths = [ + os.path.join(self.ui_dir, self.prefix, f"{window}.ui"), + os.path.join(self.ui_dir, self.prefix, f"{self.ui_file}.ui"), + ] + for path in paths: + if os.path.isfile(path): + return path + raise FileNotFoundError(f"Gtk ui file is missing: {paths}") diff --git a/extensions/botbox3000/deps/inkex/gui/asyncme.py b/extensions/botbox3000/deps/inkex/gui/asyncme.py new file mode 100644 index 0000000..efb7725 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/gui/asyncme.py @@ -0,0 +1,330 @@ +# +# Copyright 2015 Ian Denhardt +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program. If not, see +# +"""Convenience library for concurrency + +GUI apps frequently need concurrency, for example to avoid blocking UI while +doing some long running computation. This module provides helpers for doing +this kind of thing. + +The functions/methods here which spawn callables asynchronously +don't supply a direct way to provide arguments. Instead, the user is +expected to use a lambda, e.g:: + + holding(lck, lambda: do_stuff(1,2,3, x='hello')) + +This is because the calling function may have additional arguments which +could obscure the user's ability to pass arguments expected by the called +function. For example, in the call:: + + holding(lck, lambda: run_task(blocking=True), blocking=False) + +the blocking argument to holding might otherwise conflict with the +blocking argument to run_task. +""" + +import time +import threading +from datetime import datetime, timedelta + +from functools import wraps +from typing import Any, Tuple +from gi.repository import Gdk, GLib + + +class Future: + """A deferred result + + A `Future` is a result-to-be; it can be used to deliver a result + asynchronously. Typical usage: + + >>> def background_task(task): + ... ret = Future() + ... def _task(x): + ... return x - 4 + 2 + ... thread = threading.Thread(target=lambda: ret.run(lambda: _task(7))) + ... thread.start() + ... return ret + >>> # Do other stuff + >>> print(ret.wait()) + 5 + + :func:`run` will also propagate exceptions; see its docstring for details. + """ + + def __init__(self): + self._lock = threading.Lock() + self._value = None + self._exception = None + self._lock.acquire() + + def is_ready(self): + """Return whether the result is ready""" + result = self._lock.acquire(False) + if result: + self._lock.release() + return result + + def wait(self): + """Wait for the result. + + `wait` blocks until the result is ready (either :func:`result` or + :func:`exception` has been called), and then returns it (in the case + of :func:`result`), or raises it (in the case of :func:`exception`). + """ + with self._lock: + if self._exception is None: + return self._value + else: + raise self._exception # pylint: disable=raising-bad-type + + def result(self, value): + """Supply the result as a return value. + + ``value`` is the result to supply; it will be returned when + :func:`wait` is called. + """ + self._value = value + self._lock.release() + + def exception(self, err): + """Supply an exception as the result. + + Args: + err (Exception): an exception, which will be raised when :func:`wait` + is called. + """ + self._exception = err + self._lock.release() + + def run(self, task): + """Calls task(), and supplies the result. + + If ``task`` raises an exception, pass it to :func:`exception`. + Otherwise, pass the return value to :func:`result`. + """ + try: + self.result(task()) + except Exception as err: # pylint: disable=broad-except + self.exception(err) + + +class DebouncedSyncVar: + """A synchronized variable, which debounces its value + + :class:`DebouncedSyncVar` supports three operations: put, replace, and get. + get will only retrieve a value once it has "settled," i.e. at least + a certain amount of time has passed since the last time the value + was modified. + """ + + def __init__(self, delay_seconds=0): + """Create a new dsv with the supplied delay, and no initial value.""" + self._cv = threading.Condition() + self._delay = timedelta(seconds=delay_seconds) + + self._deadline = None + self._value = None + + self._have_value = False + + def set_delay(self, delay_seconds): + """Set the delay in seconds of the debounce.""" + with self._cv: + self._delay = timedelta(seconds=delay_seconds) + + def get(self, blocking=True, remove=True) -> Tuple[Any, bool]: + """Retrieve a value. + + Args: + blocking (bool, optional): if True, block until (1) the dsv has a value + and (2) the value has been unchanged for an amount of time greater + than or equal to the dsv's delay. Otherwise, if these conditions + are not met, return ``(None, False)`` immediately. Defaults to True. + remove (bool, optional): if True, remove the value when returning it. + Otherwise, leave it where it is.. Defaults to True. + + Returns: + Tuple[Any, bool]: Tuple (value, ok). ``value`` is the value of the variable + (if successful, see above), and ok indicates whether or not a value was + successfully retrieved. + """ + while True: + with self._cv: + # If there's no value, either wait for one or return + # failure. + while not self._have_value: + if blocking: + self._cv.wait() + else: + return None, False # pragma: no cover + + now = datetime.now() + deadline = self._deadline + value = self._value + if deadline <= now: + # Okay, we're good. Remove the value if necessary, and + # return it. + if remove: + self._have_value = False + self._value = None + self._cv.notify() + return value, True + + # Deadline hasn't passed yet. Either wait or return failure. + if blocking: + time.sleep((deadline - now).total_seconds()) + else: + return None, False # pragma: no cover + + def replace(self, value): + """Replace the current value of the dsv (if any) with ``value``. + + replace never blocks (except briefly to acquire the lock). It does not + wait for any unit of time to pass (though it does reset the timer on + completion), nor does it wait for the dsv's value to appear or + disappear. + """ + with self._cv: + self._replace(value) + + def put(self, value): + """Set the dsv's value to ``value``. + + If the dsv already has a value, this blocks until the value is removed. + Upon completion, this resets the timer. + """ + with self._cv: + while self._have_value: + self._cv.wait() + self._replace(value) + + def _replace(self, value): + self._have_value = True + self._value = value + self._deadline = datetime.now() + self._delay + self._cv.notify() + + +def spawn_thread(func): + """Call ``func()`` in a separate thread + + Returns the corresponding :class:`threading.Thread` object. + """ + thread = threading.Thread(target=func) + thread.start() + return thread + + +def in_mainloop(func): + """Run f() in the gtk main loop + + Returns a :class:`Future` object which can be used to retrieve the return + value of the function call. + + :func:`in_mainloop` exists because Gtk isn't threadsafe, and therefore cannot be + manipulated except in the thread running the Gtk main loop. :func:`in_mainloop` + can be used by other threads to manipulate Gtk safely. + """ + future = Future() + + def handler(*_args, **_kwargs): + """Function to be called in the future""" + future.run(func) + + GLib.idle_add(handler, None, 0) + return future + + +def mainloop_only(f): + """A decorator which forces a function to only be run in Gtk's main loop. + + Invoking a decorated function as ``f(*args, **kwargs)`` is equivalent to + using the undecorated function (from a thread other than the one running + the Gtk main loop) as:: + + in_mainloop(lambda: f(*args, **kwargs)).wait() + + :func:`mainloop_only` should be used to decorate functions which are unsafe + to run outside of the Gtk main loop. + """ + + @wraps(f) + def wrapper(*args, **kwargs): + if GLib.main_depth(): + # Already in a mainloop, so just run it. + return f(*args, **kwargs) + return in_mainloop(lambda: f(*args, **kwargs)).wait() + + return wrapper + + +def holding(lock, task, blocking=True): + """Run task() while holding ``lock``. + + Args: + blocking (bool, optional): if True, wait for the lock before running. + Otherwise, if the lock is busy, return None immediately, and don't + spawn `task`. Defaults to True. + + Returns: + Union[Future, None]: The return value is a future which can be used to retrieve + the result of running task (or None if the task was not run). + """ + if not lock.acquire(False): + return None + ret = Future() + + def _target(): + ret.run(task) + if ret._exception: # pragma: no cover + ret.wait() + lock.release() + + threading.Thread(target=_target).start() + return ret + + +def run_or_wait(func): + """A decorator which runs the function using :func:`holding` + + This function creates a single lock for this function and + waits for the lock to release before returning. + + See :func:`holding` above, with ``blocking=True`` + """ + lock = threading.Lock() + + def _inner(*args, **kwargs): + return holding(lock, lambda: func(*args, **kwargs), blocking=True) + + return _inner + + +def run_or_none(func): + """A decorator which runs the function using :func:`holding` + + This function creates a single lock for this function and + returns None if the process is already running (locked) + + See :func:`holding` above with ``blocking=True`` + """ + lock = threading.Lock() + + def _inner(*args, **kwargs): + return holding(lock, lambda: func(*args, **kwargs), blocking=False) + + return _inner diff --git a/extensions/botbox3000/deps/inkex/gui/listview.py b/extensions/botbox3000/deps/inkex/gui/listview.py new file mode 100644 index 0000000..7fc9421 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/gui/listview.py @@ -0,0 +1,562 @@ +# +# Copyright 2011-2022 Martin Owens +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program. If not, see +# +""" +Wraps the gtk treeview and iconview in something a little nicer. +""" + +import logging + +from typing import Tuple, Type, Optional +from gi.repository import Gtk, Gdk, GObject, GdkPixbuf, Pango + +from .pixmap import PixmapManager, SizeFilter + +GOBJ = GObject.TYPE_PYOBJECT + + +def default(item, attr, d=None): + """Python logic to choose an attribute, call it if required and return""" + if hasattr(item, attr): + prop = getattr(item, attr) + if callable(prop): + prop = prop() + return prop + return d + + +def cmp(a, b): + """Compare two objects""" + return (a > b) - (a < b) + + +def item_property(name, d=None): + def inside(item): + return default(item, name, d) + + return inside + + +def label(obj): + if isinstance(obj, tuple): + return " or ".join([label(o) for o in obj]) + if not isinstance(obj, type): + obj = type(obj) + return obj.__name__ + + +class BaseView: + """Controls for tree and icon views, a base class""" + + widget_type: Optional[Type[Gtk.Widget]] = None + + def __init__(self, widget, liststore=None, **kwargs): + if not isinstance(widget, self.widget_type): + lbl1 = label(self.widget_type) + lbl2 = label(widget) + raise TypeError(f"Wrong widget type: Expected {lbl1} got {lbl2}") + + self.selected_signal = kwargs.get("selected", None) + self._iids = [] + self._list = widget + self.args = kwargs + self.selected = None + self._data = None + self.no_dupes = True + self._model = self.create_model(liststore or widget.get_model()) + self._list.set_model(self._model) + self.setup() + + self._list.connect(self.changed_signal, self.item_selected_signal) + + def get_model(self): + """Returns the current data store model""" + return self._model + + def create_model(self, liststore): + """Setup the model and list""" + if not isinstance(liststore, (Gtk.ListStore, Gtk.TreeStore)): + lbl = label(liststore) + raise TypeError(f"Expected List or TreeStore, got {lbl}") + return liststore + + def refresh(self): + """Attempt to refresh the listview""" + self._list.queue_draw() + + def setup(self): + """Setup columns, views, sorting etc""" + pass + + def get_item_id(self, item): + """ + Return an id set against this item. + + If item.get_id() is set then duplicates will be ignored. + """ + if hasattr(item, "get_id"): + return item.get_id() + return None + + def replace(self, new_item, item_iter=None): + """Replace all items, or a single item with object""" + if item_iter: + self.remove_item(item_iter) + self.add_item(new_item) + else: + self.clear() + self._data = new_item + self.add_item(new_item) + + def item_selected(self, item=None, *others): + """Base method result, called as an item is selected""" + if self.selected != item: + self.selected = item + if self.selected_signal and item: + self.selected_signal(item) + + def remove_item(self, item=None): + """Remove an item from this view""" + return self._model.remove(self.get_iter(item)) + + def check_item_id(self, item): + """Item id is recorded to guard against duplicates""" + iid = self.get_item_id(item) + if iid in self._iids and self.no_dupes: + raise ValueError(f"Will not add duplicate row {iid}") + if iid: + self._iids.append(iid) + + def __iter__(self): + ret = [] + + def collect_all(store, treepath, treeiter): + ret.append((self.get_item(treeiter), treepath, treeiter)) + + self._model.foreach(collect_all) + return ret.__iter__() + + def set_sensitive(self, sen=True): + """Proxy the GTK property for sensitivity""" + self._list.set_sensitive(sen) + + def clear(self): + """Clear all items from this treeview""" + self._iids = [] + self._model.clear() + + def item_double_clicked(self, *items): + """What happens when you double click an item""" + return items # Nothing + + def get_item(self, item_iter): + """Return the object of attention from an iter""" + return self._model[self.get_iter(item_iter)][0] + + def get_iter(self, item, path=False): + """Return the iter given the item""" + if isinstance(item, Gtk.TreePath): + return item if path else self._model.get_iter(item) + if isinstance(item, Gtk.TreeIter): + return self._model.get_path(item) if path else item + for src_item, src_path, src_iter in self: + if item == src_item: + return src_path if path else src_iter + return None + + +class TreeView(BaseView): + """Controls and operates a tree view.""" + + column_size = 16 + widget_type = Gtk.TreeView + changed_signal = "cursor_changed" + + def setup(self): + """Setup the treeview""" + self._sel = self._list.get_selection() + self._sel.set_mode(Gtk.SelectionMode.MULTIPLE) + self._list.connect("cursor-changed", self.item_selected_signal) + # Separators should do something + self._list.set_row_separator_func(TreeView.is_separator, None) + super().setup() + + @staticmethod + def is_separator(model, item_iter, data): + """Internal function for seperator checking""" + return isinstance(model.get_value(item_iter, 0), Separator) + + def get_selected_items(self): + """Return a list of selected item objects""" + return [self.get_item(row) for row in self._sel.get_selected_rows()[1]] + + def set_selected_items(self, *items): + """Select the given items""" + self._sel.unselect_all() + for item in items: + path_item = self.get_iter(item, path=True) + if path_item is not None: + self._sel.select_path(path_item) + + def is_selected(self, item): + """Return true if the item is selected""" + return self._sel.iter_is_selected(self.get_iter(item)) + + def add(self, target, parent=None): + """Add all items from the target to the treeview""" + for item in target: + self.add_item(item, parent=parent) + + def add_item(self, item, parent=None): + """Add a single item image to the control, returns the TreePath""" + if item is not None: + self.check_item_id(item) + return self._add_item([item], self.get_iter(parent)) + raise ValueError("Item can not be None.") + + def _add_item(self, item, parent): + return self.get_iter(self._model.append(parent, item), path=True) + + def item_selected_signal(self, *args, **kwargs): + """Signal for selecting an item""" + return self.item_selected(*self.get_selected_items()) + + def item_button_clicked(self, _, event): + """Signal for mouse button click""" + if event is None or event.type == Gdk.EventType._2BUTTON_PRESS: + self.item_double_clicked(*self.get_selected_items()) + + def expand_item(self, item, expand=True): + """Expand one of our nodes""" + self._list.expand_row(self.get_iter(item, path=True), expand) + + def create_model(self, liststore=None): + """Set up an icon view for showing gallery images""" + if liststore is None: + liststore = Gtk.TreeStore(GOBJ) + return super().create_model(liststore) + + def create_column(self, name, expand=True): + """ + Create and pack a new column to this list. + + name - Label in the column header + expand - Should the column expand + """ + return ViewColumn(self._list, name, expand=expand) + + def create_sort(self, *args, **kwargs): + """ + Create and attach a sorting view to this list. + + see ViewSort arguments for details. + """ + return ViewSort(self._list, *args, **kwargs) + + +class ComboBox(TreeView): + """Controls and operates a combo box list.""" + + widget_type = Gtk.ComboBox + changed_signal = "changed" + + def setup(self): + pass + + def get_selected_item(self): + """Return the selected item of this combo box""" + return self.get_item(self._list.get_active_iter()) + + def set_selected_item(self, item): + """Set the given item as the selected item""" + self._list.set_active_iter(self.get_iter(item)) + + def is_selected(self, item): + """Returns true if this item is the selected item""" + return self.get_selected_item() == item + + def get_selected_items(self): + """Return a list of selected items (one)""" + return [self.get_selected_item()] + + +class IconView(BaseView): + """Allows a simpler IconView for DBus List Objects""" + + widget_type = Gtk.IconView + changed_signal = "selection-changed" + + def __init__(self, widget, pixmaps, *args, **kwargs): + super().__init__(widget, *args, **kwargs) + self.pixmaps = pixmaps + + def set_selected_item(self, item): + """Sets the selected item to this item""" + path = self.get_iter(item, path=True) + if path: + self._list.set_cursor(path, None, False) + + def get_selected_items(self): + """Return the seleced item""" + return [self.get_item(path) for path in self._list.get_selected_items()] + + def create_model(self, liststore): + """Setup the icon view control and model""" + if not liststore: + liststore = Gtk.ListStore(GOBJ, str, GdkPixbuf.Pixbuf) + return super().create_model(liststore) + + def setup(self): + """Setup the columns for the iconview""" + self._list.set_markup_column(1) + self._list.set_pixbuf_column(2) + super().setup() + + def add(self, target): + """Add all items from the target to the iconview""" + for item in target: + self.add_item(item) + + def add_item(self, item): + """Add a single item image to the control""" + if item is not None: + self.check_item_id(item) + return self._add_item(item) + raise ValueError("Item can not be None.") + + def get_markup(self, item): + """Default text return for markup.""" + return default(item, "name", str(item)) + + def get_icon(self, item): + """Default icon return, pixbuf or gnome theme name""" + return default(item, "icon", None) + + def _get_icon(self, item): + return self.pixmaps.get(self.get_icon(item), item=item) + + def _add_item(self, item): + """ + Each item's properties must be stuffed into the ListStore directly + or the IconView won't see them, but only if on auto. + """ + if not isinstance(item, (tuple, list)): + item = [item, self.get_markup(item), self._get_icon(item)] + return self._model.append(item) + + def item_selected_signal(self, *args, **kwargs): + """Item has been selected""" + return self.item_selected(*self.get_selected_items()) + + +class ViewSort(object): + """ + A sorting function for use is ListViews + + ascending - Boolean which direction to sort + contains - Contains this string + data - A string or function to get data from each item. + exact - Compare to this exact string instead. + """ + + def __init__(self, widget, data=None, ascending=False, exact=None, contains=None): + self.tree = None + self.data = data + self.asc = ascending + self.comp = exact.lower() if exact else None + self.cont = contains + self.tree = widget + self.resort() + + def get_data(self, model, list_iter): + """Generate sortable data from the item""" + item = model.get_value(list_iter, 0) + if isinstance(self.data, str): + value = getattr(item, self.data) + elif callable(self.data): + value = self.data(item) + return value + + def sort_func(self, model, iter1, iter2, data): + """Called by Gtk to sort items""" + value1 = self.get_data(model, iter1) + value2 = self.get_data(model, iter2) + if value1 == None or value2 == None: + return 0 + if self.comp: + if cmp(self.comp, value1.lower()) == 0: + return 1 + elif cmp(self.comp, value2.lower()) == 0: + return -1 + return 0 + elif self.cont: + if self.cont in value1.lower(): + return 1 + elif self.cont in value2.lower(): + return -1 + return 0 + if value1 < value2: + return 1 + if value2 < value1: + return -1 + return 0 + + def resort(self): + model = self.tree.get_model() + model.set_sort_func(0, self.sort_func, None) + if self.asc: + model.set_sort_column_id(0, Gtk.SortType.ASCENDING) + else: + model.set_sort_column_id(0, Gtk.SortType.DESCENDING) + + +class ViewColumn(object): + """ + Add a column to a gtk treeview. + + name - The column name used as a label. + expand - Set column expansion. + """ + + def __init__(self, widget, name, expand=False): + if isinstance(widget, Gtk.TreeView): + column = Gtk.TreeViewColumn((name)) + column.set_sizing(Gtk.TreeViewColumnSizing.AUTOSIZE) + column.set_expand(expand) + self._column = column + widget.append_column(self._column) + else: + # Deal with possible drop down lists + self._column = widget + + def add_renderer(self, renderer, func, expand=True): + """Set a custom renderer""" + self._column.pack_start(renderer, expand) + self._column.set_cell_data_func(renderer, func, None) + return renderer + + def add_image_renderer(self, icon, pad=0, pixmaps=None, size=None): + """ + Set the image renderer + + icon - The function that returns the image to be dsplayed. + pad - The amount of padding around the image. + pixmaps - The pixmap manager to use to get images. + size - Restrict the images to this size. + """ + # Manager where icons will be pulled from + filters = [SizeFilter] if size else [] + pixmaps = pixmaps or PixmapManager( + "", pixmap_dir="./", filters=filters, size=size + ) + + renderer = Gtk.CellRendererPixbuf() + renderer.set_property("ypad", pad) + renderer.set_property("xpad", pad) + func = self.image_func(icon or self.default_icon, pixmaps) + return self.add_renderer(renderer, func, expand=False) + + def add_text_renderer(self, text, wrap=None, template=None): + """ + Set the text renderer. + + text - the function that returns the text to be displayed. + wrap - The wrapping setting for this renderer. + template - A standard template used for this text markup. + """ + + renderer = Gtk.CellRendererText() + if wrap is not None: + renderer.props.wrap_width = wrap + renderer.props.wrap_mode = Pango.WrapMode.WORD + + renderer.props.background_set = True + renderer.props.foreground_set = True + + func = self.text_func(text or self.default_text, template) + return self.add_renderer(renderer, func, expand=True) + + @classmethod + def clean(cls, text, markup=False): + """Clean text of any pango markup confusing chars""" + if text is None: + text = "" + if isinstance(text, (str, int, float)): + if markup: + text = str(text).replace("<", "<").replace(">", ">") + return str(text).replace("&", "&") + elif isinstance(text, dict): + return dict([(k, cls.clean(v)) for k, v in text.items()]) + elif isinstance(text, (list, tuple)): + return tuple([cls.clean(value) for value in text]) + raise TypeError("Unknown value type for text: %s" % str(type(text))) + + def get_callout(self, call, default=None): + """Returns the right kind of method""" + if isinstance(call, str): + call = item_property(call, default) + return call + + def text_func(self, call, template=None): + """Wrap up our text functionality""" + callout = self.get_callout(call) + + def internal(column, cell, model, item_iter, data): + if TreeView.is_separator(model, item_iter, data): + return + item = model.get_value(item_iter, 0) + markup = template is not None + text = callout(item) + if isinstance(template, str): + text = template.format(self.clean(text, markup=True)) + else: + text = self.clean(text) + cell.set_property("markup", str(text)) + + return internal + + def image_func(self, call, pixmaps=None): + """Wrap, wrap wrap the func""" + callout = self.get_callout(call) + + def internal(column, cell, model, item_iter, data): + if TreeView.is_separator(model, item_iter, data): + return + item = model.get_value(item_iter, 0) + icon = callout(item) + # The or blank asks for the default icon from the pixmaps + if isinstance(icon or "", str) and pixmaps: + # Expect a Gnome theme icon + icon = pixmaps.get(icon) + elif icon: + icon = pixmaps.apply_filters(icon) + + cell.set_property("pixbuf", icon) + cell.set_property("visible", True) + + return internal + + def default_text(self, item): + """Default text return for markup.""" + return default(item, "name", str(item)) + + def default_icon(self, item): + """Default icon return, pixbuf or gnome theme name""" + return default(item, "icon", None) + + +class Separator: + """Reprisentation of a separator in a list""" diff --git a/extensions/botbox3000/deps/inkex/gui/pixmap.py b/extensions/botbox3000/deps/inkex/gui/pixmap.py new file mode 100644 index 0000000..ca31fb7 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/gui/pixmap.py @@ -0,0 +1,360 @@ +# +# Copyright 2011-2022 Martin Owens +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program. If not, see +# +""" +Provides wrappers for pixmap access. +""" + +import os +import logging + +from typing import List +from collections.abc import Iterable +from gi.repository import Gtk, Gdk, GLib, GdkPixbuf +import cairo + +ICON_THEME = Gtk.IconTheme.get_for_display(Gdk.Display.get_default()) +BILINEAR = GdkPixbuf.InterpType.BILINEAR +HYPER = GdkPixbuf.InterpType.HYPER + +SIZE_ASPECT = 0 +SIZE_ASPECT_GROW = 1 +SIZE_ASPECT_CROP = 2 +SIZE_STRETCH = 3 + + +class PixmapLoadError(ValueError): + """Failed to load a pixmap""" + + +class PixmapFilter: # pylint: disable=too-few-public-methods + """Base class for filtering the pixmaps in a manager's output. + + required - List of values required for this filter. + + Use: + + class Foo(PixmapManager): + filters = [ PixmapFilterFoo ] + + """ + + required: List[str] = [] + optional: List[str] = [] + + def __init__(self, **kwargs): + self.enabled = True + for key in self.required: + if key not in kwargs: + self.enabled = False + else: + setattr(self, key, kwargs[key]) + + for key in self.optional: + if key in kwargs: + setattr(self, key, kwargs[key]) + + def filter(self, img, **kwargs): + """Run filter, replace this methodwith your own""" + raise NotImplementedError( + "Please add 'filter' method to your PixmapFilter class %s." + % type(self).__name__ + ) + + @staticmethod + def to_size(dat): + """Tries to calculate a size that will work for the data""" + if isinstance(dat, (int, float)): + return (dat, dat) + if isinstance(dat, Iterable) and len(dat) >= 2: + return (dat[0], dat[1]) + return None + + +class OverlayFilter(PixmapFilter): + """Adds an overlay to output images, overlay can be any name that + the owning pixmap manager can find. + + overlay : Name of overlay image + position : Location of the image: + 0 - Full size (1 to 1 overlay, default) + (x,y) - Percentage from one end to the other position 0-1 + alpha : Blending alpha, 0 - 255 + + """ + + optional = ["position", "overlay", "alpha"] + + def __init__(self, *args, **kwargs): + self.position = (0, 0) + self.overlay = None + self.alpha = 255 + super().__init__(*args, **kwargs) + self.pad_x, self.pad_y = self.to_size(self.position) + + def get_overlay(self, **kwargs): + if "manager" not in kwargs: + raise ValueError("PixmapManager must be provided when adding an overlay.") + return kwargs["manager"].get( + kwargs.get("overlay", None) or self.overlay, no_overlay=True + ) + + def filter(self, img, no_overlay=False, **kwargs): + # Recursion protection + if no_overlay: + return img + + overlay = self.get_overlay(**kwargs) + if overlay: + img = img.copy() + + (x, y, width, height) = self.set_position(overlay, img) + overlay.composite( + img, x, y, width, height, x, y, 1, 1, BILINEAR, self.alpha + ) + return img + + def set_position(self, overlay, img): + """Sets the position of img on the given width and height""" + img_w, img_h = img.get_width(), img.get_height() + ovl_w, ovl_h = overlay.get_width(), overlay.get_height() + return ( + max([0, (img_w - ovl_w) * self.pad_x]), + max([0, (img_h - ovl_h) * self.pad_y]), + min([ovl_w, img_w]), + min([ovl_h, img_h]), + ) + + +class SizeFilter(PixmapFilter): + """Resizes images to a certain size: + + resize_mode - Way in which the size is calculated + 0 - Best Aspect, don't grow + 1 - Best Aspect, grow + 2 - Cropped Aspect + 3 - Stretch + """ + + required = ["size"] + optional = ["resize_mode"] + + def __init__(self, *args, **kwargs): + self.size = None + self.resize_mode = SIZE_ASPECT + super().__init__(*args, **kwargs) + self.img_w, self.img_h = self.to_size(self.size) or (0, 0) + + def aspect(self, img_w, img_h): + """Get the aspect ratio of the image resized""" + if self.resize_mode == SIZE_STRETCH: + return (self.img_w, self.img_h) + + if ( + self.resize_mode == SIZE_ASPECT + and img_w < self.img_w + and img_h < self.img_h + ): + return (img_w, img_h) + (pcw, pch) = (self.img_w / img_w, self.img_h / img_h) + factor = ( + max(pcw, pch) if self.resize_mode == SIZE_ASPECT_CROP else min(pcw, pch) + ) + return (int(img_w * factor), int(img_h * factor)) + + def filter(self, img, **kwargs): + if self.size is not None: + (width, height) = self.aspect(img.get_width(), img.get_height()) + return img.scale_simple(width, height, HYPER) + return img + + +class PadFilter(SizeFilter): + """Add padding to the image to make it a standard size""" + + optional = ["padding"] + + def __init__(self, *args, **kwargs): + self.size = None + self.padding = 0.5 + super().__init__(*args, **kwargs) + self.pad_x, self.pad_y = self.to_size(self.padding) + + def filter(self, img, **kwargs): + (width, height) = (img.get_width(), img.get_height()) + if width < self.img_w or height < self.img_h: + target = GdkPixbuf.Pixbuf.new( + img.get_colorspace(), + True, + img.get_bits_per_sample(), + max([width, self.img_w]), + max([height, self.img_h]), + ) + target.fill(0x0) # Transparent black + + x = (target.get_width() - width) * self.pad_x + y = (target.get_height() - height) * self.pad_y + + img.composite(target, x, y, width, height, x, y, 1, 1, BILINEAR, 255) + return target + return img + + +class PixmapManager: + """Manage a set of cached pixmaps, returns the default image + if it can't find one or the missing image if that's available.""" + + missing_image = "image-missing" + default_image = "application-default-icon" + icon_theme = ICON_THEME + theme_size = 32 + filters: List[type] = [] + pixmap_dir = None + + def __init__(self, location="", **kwargs): + self.location = location + if self.pixmap_dir and not os.path.isabs(location): + self.location = os.path.join(self.pixmap_dir, location) + + self.loader_size = PixmapFilter.to_size(kwargs.pop("load_size", None)) + + # Add any instance specified filters first + self._filters = [] + for item in kwargs.get("filters", []) + self.filters: + if isinstance(item, PixmapFilter): + self._filters.append(item) + elif callable(item): + # Now add any class specified filters with optional kwargs + self._filters.append(item(**kwargs)) + + self.cache = {} + self.get_pixmap(self.default_image) + + def get(self, *args, **kwargs): + """Get a pixmap of any kind""" + return self.get_pixmap(*args, **kwargs) + + def get_missing_image(self): + """Get a missing image when other images aren't found""" + return self.get(self.missing_image) + + @staticmethod + def data_is_file(data): + """Test the file to see if it's a filename or not""" + return isinstance(data, str) and " +# +# This program is free software: you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation, either version 3 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program. If not, see +# +""" +Structures for consistant testing of Gtk GUI programs. +""" + +import sys +from gi.repository import Gio, GLib + + +class MainLoopProtection: + """ + This protection class provides a way to launch the Gtk mainloop in a test + friendly way. + + Exception handling hooks provide a way to see errors that happen + inside the main loop, raising them back to the caller. + A full timeout in seconds stops the gtk mainloop from operating + beyond a set time, acting as a kill switch in the event something + has gone horribly wrong. + + Use: + with MainLoopProtection(timeout=10s): + app.run() + """ + + def __init__(self, timeout=10): + self.timeout = timeout * 1000 + self._hooked = None + self._old_excepthook = None + + def __enter__(self): + # replace sys.excepthook with our own and remember hooked raised error + self._old_excepthook = sys.excepthook + sys.excepthook = self.excepthook + # Remove mainloop by force if it doesn't die within 10 seconds + self._timeout = GLib.timeout_add(self.timeout, self.exit) + + def __exit__(self, exc, value, traceback): # pragma: no cover + """Put the except handler back, cancel the timer and raise if needed""" + if self._old_excepthook: + sys.excepthook = self._old_excepthook + # Remove the timeout, so we don't accidentally kill later mainloops + if self._timeout: + GLib.source_remove(self._timeout) + # Raise an exception if one happened during the test run + if self._hooked: + exc, value, traceback = self._hooked + if value and traceback: + raise value.with_traceback(traceback) + + def exit(self): # pragma: no cover + """Try to going to kill any running mainloop.""" + Gio.Application.get_default().quit() + + def excepthook(self, ex_type, ex_value, traceback): # pragma: no cover + """Catch errors thrown by the Gtk mainloop""" + self.exit() + # Remember the exception data for raising inside the test context + if ex_value is not None: + self._hooked = [ex_type, ex_value, traceback] + # Fallback and double print the exception (remove if double printing is problematic) + return self._old_excepthook(ex_type, ex_value, traceback) diff --git a/extensions/botbox3000/deps/inkex/gui/window.py b/extensions/botbox3000/deps/inkex/gui/window.py new file mode 100644 index 0000000..bd9e6d8 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/gui/window.py @@ -0,0 +1,38 @@ +# SPDX-License-Identifier: GPL-3.0-or-later +# Copyright 2012-2022 Martin Owens + +""" +Wraps Gtk.Window with something a little nicer. +""" + +from gi.repository import Gtk + + +class Window: + """A very thin wrapper around Gtk.Window""" + + name = None + """The name of the window to load from the ui file""" + + def __init__(self, gapp): + """Create a new Window and load its Gtk.Window from a ui file""" + self.gapp = gapp + ui_file = gapp.get_ui_file(self.name) + + # Set up the builder and load ui + self.builder = Gtk.Builder(self) + self.builder.set_translation_domain(gapp.app_name) + self.builder.add_from_file(ui_file) + self.widget = self.builder.get_object + + # Find the window in the ui + self.window = self.widget(self.name) + if not self.window: # pragma: no cover + raise KeyError(f"Missing window widget '{self.name}' from '{ui_file}'") + + # Keep application alive + self.window.set_application(self.gapp) + + def close(self, widget=None): + """Closes the window. Can be connected to signals.""" + self.window.close() diff --git a/extensions/botbox3000/deps/inkex/interfaces/IElement.py b/extensions/botbox3000/deps/inkex/interfaces/IElement.py new file mode 100644 index 0000000..550aeac --- /dev/null +++ b/extensions/botbox3000/deps/inkex/interfaces/IElement.py @@ -0,0 +1,23 @@ +"""Element abstractions for type comparisons without circular imports + +.. versionadded:: 1.2""" + +from __future__ import annotations + +from typing import Protocol, TYPE_CHECKING + +if TYPE_CHECKING: + from ..elements._svg import SvgDocumentElement + + +class BaseElementProtocol(Protocol): + """Abstraction for BaseElement, to be used as typehint in mixin classes""" + + def get_id(self, as_url=0) -> str: + """Returns the element ID. If not set, generates a unique ID.""" + ... + + @property + def root(self) -> "SvgDocumentElement": + """Returns the element's root.""" + ... diff --git a/extensions/botbox3000/deps/inkex/interfaces/__init__.py b/extensions/botbox3000/deps/inkex/interfaces/__init__.py new file mode 100644 index 0000000..e69de29 diff --git a/extensions/botbox3000/deps/inkex/inx.py b/extensions/botbox3000/deps/inkex/inx.py new file mode 100644 index 0000000..6599277 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/inx.py @@ -0,0 +1,242 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Parsing inx files for checking and generating. +""" + +import os +from inspect import isclass +from importlib import util +from lxml import etree + +from .base import InkscapeExtension +from .utils import Boolean + +NSS = { + "inx": "http://www.inkscape.org/namespace/inkscape/extension", + "inkscape": "http://www.inkscape.org/namespaces/inkscape", +} +SSN = {b: a for (a, b) in NSS.items()} + + +class InxLookup(etree.CustomElementClassLookup): + """Custom inx xml file lookup""" + + def lookup(self, node_type, document, namespace, name): # pylint: disable=unused-argument + if name == "param": + return ParamElement + return InxElement + + +INX_PARSER = etree.XMLParser() +INX_PARSER.set_element_class_lookup(InxLookup()) + + +class InxFile: + """Open an INX file and provide useful functions""" + + name = property(lambda self: self.xml.get_text("name")) + ident = property(lambda self: self.xml.get_text("id")) + slug = property(lambda self: self.ident.split(".")[-1].title().replace("_", "")) + kind = property(lambda self: self.metadata["type"]) + warnings = property(lambda self: sorted(list(set(self.xml.warnings)))) + + def __init__(self, filename): + if isinstance(filename, str) and "<" in filename: + filename = filename.encode("utf8") + if isinstance(filename, bytes) and b"<" in filename: + self.filename = None + self.doc = etree.ElementTree(etree.fromstring(filename, parser=INX_PARSER)) + else: + self.filename = os.path.basename(filename) + self.doc = etree.parse(filename, parser=INX_PARSER) + self.xml = self.doc.getroot() + self.xml.warnings = [] + + def __repr__(self): + return f"" + + @property + def script(self): + """Returns information about the called script""" + command = self.xml.find_one("script/command") + if command is None: + return {} + return { + "interpreter": command.get("interpreter", None), + "location": command.get("location", None), + "script": command.text, + } + + @property + def extension_class(self): + """Attempt to get the extension class""" + script = self.script.get("script", None) + if script is not None: + name = script[:-3].replace("/", ".") + spec = util.spec_from_file_location(name, script) + mod = util.module_from_spec(spec) + spec.loader.exec_module(mod) + for value in mod.__dict__.values(): + if ( + "Base" not in name + and isclass(value) + and value.__module__ == name + and issubclass(value, InkscapeExtension) + ): + return value + return None + + @property + def metadata(self): + """Returns information about what type of extension this is""" + effect = self.xml.find_one("effect") + output = self.xml.find_one("output") + inputs = self.xml.find_one("input") + data = {} + if effect is not None: + template = self.xml.find_one("inkscape:templateinfo") + if template is not None: + data["type"] = "template" + data["desc"] = self.xml.get_text( + "templateinfo/shortdesc", nss="inkscape" + ) + data["author"] = self.xml.get_text( + "templateinfo/author", nss="inkscape" + ) + else: + data["type"] = "effect" + data["preview"] = Boolean(effect.get("needs-live-preview", "true")) + data["objects"] = effect.get_text("object-type", "all") + elif inputs is not None: + data["type"] = "input" + data["extension"] = inputs.get_text("extension") + data["mimetype"] = inputs.get_text("mimetype") + data["tooltip"] = inputs.get_text("filetypetooltip") + data["name"] = inputs.get_text("filetypename") + elif output is not None: + data["type"] = "output" + data["dataloss"] = Boolean(output.get_text("dataloss", "false")) + data["extension"] = output.get_text("extension") + data["mimetype"] = output.get_text("mimetype") + data["tooltip"] = output.get_text("filetypetooltip") + data["name"] = output.get_text("filetypename") + return data + + @property + def menu(self): + """Return the menu this effect ends up in""" + + def _recurse_menu(parent): + for child in parent.xpath("submenu"): + yield child.get("name") + for subchild in _recurse_menu(child): + yield subchild + break # Not more than one menu chain? + + menu = self.xml.find_one("effect/effects-menu") + return list(_recurse_menu(menu)) + [self.name] + + @property + def params(self): + """Get all params at all levels""" + # Returns any params at any levels + return list(self.xml.xpath("//param")) + + +class InxElement(etree.ElementBase): + """Any element in an inx file + + .. versionadded:: 1.1""" + + def set_warning(self, msg): + """Set a warning for slightly incorrect inx contents""" + root = self.get_root() + if hasattr(root, "warnings"): + root.warnings.append(msg) + + def get_root(self): + """Get the root document element from any element descendent""" + if self.getparent() is not None: + return self.getparent().get_root() + return self + + def get_default_prefix(self): + """Set default xml namespace prefix. If none is defined, set warning""" + tag = self.get_root().tag + if "}" in tag: + (url, tag) = tag[1:].split("}", 1) + return SSN.get(url, "inx") + self.set_warning("No inx xml prefix.") + return None # no default prefix + + def apply_nss(self, xpath, nss=None): + """Add prefixes to any xpath string""" + if nss is None: + nss = self.get_default_prefix() + + def _process(seg): + if ":" in seg or not seg or not nss: + return seg + return f"{nss}:{seg}" + + return "/".join([_process(seg) for seg in xpath.split("/")]) + + def xpath(self, xpath, nss=None): + """Namespace specific xpath searches + + .. versionadded:: 1.1""" + return super().xpath(self.apply_nss(xpath, nss=nss), namespaces=NSS) + + def find_one(self, name, nss=None): + """Return the first element matching the given name + + .. versionadded:: 1.1""" + for elem in self.xpath(name, nss=nss): + return elem + return None + + def get_text(self, name, default=None, nss=None): + """Get text content agnostically""" + for pref in ("", "_"): + elem = self.find_one(pref + name, nss=nss) + if elem is not None and elem.text: + if pref == "_": + self.set_warning(f"Use of old translation scheme: <_{name}...>") + return elem.text + return default + + +class ParamElement(InxElement): + """ + A param in an inx file. + """ + + name = property(lambda self: self.get("name")) + param_type = property(lambda self: self.get("type", "string")) + + @property + def options(self): + """Return a list of option values""" + if self.param_type == "notebook": + return [option.get("name") for option in self.xpath("page")] + return [option.get("value") for option in self.xpath("option")] + + def __repr__(self): + return f"" diff --git a/extensions/botbox3000/deps/inkex/localization.py b/extensions/botbox3000/deps/inkex/localization.py new file mode 100644 index 0000000..7de6c57 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/localization.py @@ -0,0 +1,117 @@ +# coding=utf-8 +# +# Copyright (C) 2010 Nick Drobchenko, nick@cnc-club.ru +# Copyright (C) 2005 Aaron Spike, aaron@ekips.org +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Allow extensions to translate messages. +""" + +import gettext +import os, sys + +# Get gettext domain and matching locale directory for translation of extensions strings +# (both environment variables are set by Inkscape) +GETTEXT_DOMAIN = os.environ.get("INKEX_GETTEXT_DOMAIN") +GETTEXT_DIRECTORY = os.environ.get("INKEX_GETTEXT_DIRECTORY") + +# INKSCAPE_LOCALEDIR can be used to override the default locale directory Inkscape uses +INKSCAPE_LOCALEDIR = os.environ.get("INKSCAPE_LOCALEDIR") + + +def localize(domain=GETTEXT_DOMAIN, localedir=GETTEXT_DIRECTORY): + """Configure gettext and install _() function into builtins namespace for easy + access""" + + # Do not enable translation if GETTEXT_DOMAIN is unset. + # This is the case when translationdomain="none", but also when no catalog was + # found. + # Install a NullTranslation just to be sure + # (so we do not get errors about undefined '_') + if domain is None: + gettext.NullTranslations().install() + return + + # Use the default system locale by default, + # but prefer LANGUAGE environment variable + # (which is set by Inkscape according to UI language) + languages = None + + trans = gettext.translation(domain, localedir, languages, fallback=True) + trans.install() + + +def inkex_localize(): + """ + Return internal Translations instance for translation of the inkex module itself + Those will always use the 'inkscape' domain and attempt to lookup the same catalog + Inkscape uses + """ + + domain = "inkscape" + localedir = INKSCAPE_LOCALEDIR + languages = None + + return gettext.translation(domain, localedir, languages, fallback=True) + + +inkex_gettext = inkex_localize().gettext # pylint: disable=invalid-name +""" +Shortcut for gettext. Import as:: + + from inkex.localize import inkex_gettext as _ + +""" + +inkex_ngettext = inkex_localize().ngettext +""" +Shortcut for ngettext + + .. versionadded:: 1.2 +""" + + +def inkex_fgettext(message, *args, **kwargs): + """ + Shortcut for gettext and subsequent formatting. Import as:: + + from inkex.localize import inkex_fgettext as _f + + The positionals and keyword arguments are passed to ``str.format()``. + + The call to xgettext must contain:: + + --keyword=_f + """ + return inkex_gettext(message).format(*args, **kwargs) + + +if sys.version_info >= (3, 8): + inkex_pgettext = inkex_localize().pgettext + """ + Gettext with context. Import as:: + + from inkex.localize import inkex_pgettext as pgettext + + Both parameters **must** be string literals. The call to xgettext must contain:: + + --keyword=pgettext:1c,2 + + .. versionadded:: 1.2 + """ +else: + inkex_pgettext = lambda context, message: message diff --git a/extensions/botbox3000/deps/inkex/paths/__init__.py b/extensions/botbox3000/deps/inkex/paths/__init__.py new file mode 100644 index 0000000..b1e7f62 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/paths/__init__.py @@ -0,0 +1,122 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# Copyright (C) 2023 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""Paths module. + +Most of the functions derivative, unit_tangent, curvature, point, split, length, ilength +for the individual path commands are ported from +https://github.com/mathandy/svgpathtools/ (MIT licensed) +""" + +from typing import Union + +from ..transforms import ComplexLike +from .interfaces import ( + PathCommand, + AbsolutePathCommand, + RelativePathCommand, + LengthSettings, + ILengthSettings, +) +from .lines import Line, line, Move, move, ZoneClose, zoneClose, Horz, horz, Vert, vert +from .curves import curve, Curve, smooth, Smooth +from .quadratic import quadratic, Quadratic, tepidQuadratic, TepidQuadratic +from .arc import Arc, arc, arc_to_path, matprod, rotmat, applymat, norm +from .path import CubicSuperPath, Path, InvalidPath + +import numpy as np + +np.seterr(invalid="raise") + + +# definitions that can't be inside the class due to circular dependencies +def to_curve(self, prev: ComplexLike, prev_prev: ComplexLike = 0) -> Curve: + """Convert command to :py:class:`Curve` + + Curve().to_curve() returns a copy + """ + return Curve(*self.ccurve_points(0 + 0j, complex(prev), complex(prev_prev))) + + +def to_line(self, prev: ComplexLike) -> Line: + """Converts this segment to a line (copies if already a line)""" + return Line(self.cend_point(0, complex(prev))) + + +PathCommand.to_curve = to_curve # type: ignore +PathCommand.to_line = to_line # type: ignore + +PathCommand._letter_to_class = { # pylint: disable=protected-access + "M": Move, + "L": Line, + "V": Vert, + "H": Horz, + "A": Arc, + "C": Curve, + "S": Smooth, + "Z": ZoneClose, + "Q": Quadratic, + "T": TepidQuadratic, + "m": move, + "l": line, + "v": vert, + "h": horz, + "a": arc, + "c": curve, + "s": smooth, + "z": zoneClose, + "q": quadratic, + "t": tepidQuadratic, +} + + +# All the names that get added to the inkex API itself. +__all__ = ( + "Path", + "CubicSuperPath", + "PathCommand", + "AbsolutePathCommand", + "RelativePathCommand", + # Path commands: + "Line", + "line", + "Move", + "move", + "ZoneClose", + "zoneClose", + "Horz", + "horz", + "Vert", + "vert", + "Curve", + "curve", + "Smooth", + "smooth", + "Quadratic", + "quadratic", + "TepidQuadratic", + "tepidQuadratic", + "Arc", + "arc", + # errors + "InvalidPath", + # structs + "LengthSettings", + "ILengthSettings", +) diff --git a/extensions/botbox3000/deps/inkex/paths/arc.py b/extensions/botbox3000/deps/inkex/paths/arc.py new file mode 100644 index 0000000..afa102f --- /dev/null +++ b/extensions/botbox3000/deps/inkex/paths/arc.py @@ -0,0 +1,670 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# Copyright (C) 2023 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""Arc path commands""" + +from __future__ import annotations +from math import atan2, pi, sqrt, sin, cos, tan, acos, radians, degrees +from cmath import exp +from typing import overload, Tuple, List, Union, TYPE_CHECKING + +import numpy as np + +from ..transforms import Transform, Vector2d, ComplexLike + +from .interfaces import ( + AbsolutePathCommand, + RelativePathCommand, + LengthSettings, + ILengthSettings, + BezierArcComputationMixin, +) + +if TYPE_CHECKING: + from .curves import Curve + + +class Arc(BezierArcComputationMixin, AbsolutePathCommand): + """Special Arc segment""" + + letter = "A" + + nargs = 7 + + radius: complex + """Radius of the Arc""" + x_axis_rotation: float + + large_arc: bool + sweep: bool + + endpoint: complex + """Endpoint (absolute) of the Arc""" + + @property + def rx(self) -> float: + """x radius of the Arc""" + return self.radius.real + + @property + def ry(self) -> float: + """y radius of the Arc""" + return self.radius.imag + + @property + def x(self) -> float: + """x coordinate of the (absolute) endpoint of the Arc""" + return self.endpoint.real + + @property + def y(self) -> float: + """x coordinate of the (relative) endpoint of the Arc""" + return self.endpoint.imag + + @property + def args(self): + return ( + self.rx, + self.ry, + self.x_axis_rotation, + self.large_arc, + self.sweep, + self.x, + self.y, + ) + + @property + def cargs(self): + """Set of arguments in complex form""" + return ( + self.radius, + self.x_axis_rotation, + self.large_arc, + self.sweep, + self.endpoint, + ) + + @overload + def __init__( + self, + radius: ComplexLike, + x_axis_rotation: float, + large_arc: bool | int, + sweep: bool | int, + endpoint: ComplexLike, + ) -> None: ... + + @overload + def __init__( + self, + rx: float, + ry: float, + x_axis_rotation: float, + large_arc: bool | int, + sweep: bool | int, + x: float, + y: float, + ) -> None: ... # pylint: disable=too-many-arguments + + def __init__(self, *args): + if len(args) == 5: + ( + self.radius, + self.x_axis_rotation, + self.large_arc, + self.sweep, + self.endpoint, + ) = args + self.radius = complex(self.radius) + self.endpoint = complex(self.endpoint) + elif len(args) == 7: + self.radius = args[0] + args[1] * 1j + self.x_axis_rotation, self.large_arc, self.sweep = args[2:5] + self.endpoint = args[5] + args[6] * 1j + + def parametrize(self, prev): + """Return the parametrisation of the arc: + (radius, phi, rot_matrix, center, theta1, deltatheta) + See http://www.w3.org/TR/SVG/implnote.html#ArcImplementationNotes + + .. versionadded:: 1.4""" + # my notation roughly follows theirs + phi = radians(self.x_axis_rotation) + rot_matrix = exp(1j * phi) + + radius = self.radius + rx = self.radius.real + ry = self.radius.imag + rx_sqd = rx * rx + ry_sqd = ry * ry + + # Transform z-> z' = x' + 1j*y' + # = self.rot_matrix**(-1)*(z - (end+start)/2) + # coordinates. This translates the ellipse so that the midpoint + # between self.end and self.start lies on the origin and rotates + # the ellipse so that the its axes align with the xy-coordinate axes. + # Note: This sends self.end to -self.start + zp1 = (1 / rot_matrix) * (prev - self.cend_point(0j, prev)) / 2 + x1p, y1p = zp1.real, zp1.imag + x1p_sqd = x1p * x1p + y1p_sqd = y1p * y1p + + # Correct out of range radii + radius_check = (x1p_sqd / rx_sqd) + (y1p_sqd / ry_sqd) + if radius_check > 1: + rx *= sqrt(radius_check) + ry *= sqrt(radius_check) + radius = rx + 1j * ry + rx_sqd = rx * rx + ry_sqd = ry * ry + + # Compute c'=(c_x', c_y'), the center of the ellipse in (x', y') coords + # Noting that, in our new coord system, (x_2', y_2') = (-x_1', -x_2') + # and our ellipse is cut out by of the plane by the algebraic equation + # (x'-c_x')**2 / r_x**2 + (y'-c_y')**2 / r_y**2 = 1, + # we can find c' by solving the system of two quadratics given by + # plugging our transformed endpoints (x_1', y_1') and (x_2', y_2') + tmp = rx_sqd * y1p_sqd + ry_sqd * x1p_sqd + radicand = (rx_sqd * ry_sqd - tmp) / tmp + radical = 0 if np.isclose(radicand, 0) else sqrt(radicand) + + if self.large_arc == self.sweep: + cp = -radical * (rx * y1p / ry - 1j * ry * x1p / rx) + else: + cp = radical * (rx * y1p / ry - 1j * ry * x1p / rx) + + # The center in (x,y) coordinates is easy to find knowing c' + center = exp(1j * phi) * cp + (prev + self.cend_point(0j, prev)) / 2 + + # Now we do a second transformation, from (x', y') to (u_x, u_y) + # coordinates, which is a translation moving the center of the + # ellipse to the origin and a dilation stretching the ellipse to be + # the unit circle + u1 = (x1p - cp.real) / rx + 1j * (y1p - cp.imag) / ry # transformed start + u2 = (-x1p - cp.real) / rx + 1j * (-y1p - cp.imag) / ry # transformed end + + # clip in case of floating point error + u1 = np.clip(u1.real, -1, 1) + 1j * np.clip(u1.imag, -1, 1) + u2 = np.clip(u2.real, -1, 1) + 1j * np.clip(u2.imag, -1, 1) + + # Now compute theta and delta (we'll define them as we go) + # delta is the angular distance of the arc (w.r.t the circle) + # theta is the angle between the positive x'-axis and the start point + # on the circle + if u1.imag > 0: + theta1 = degrees(acos(u1.real)) + elif u1.imag < 0: + theta1 = -degrees(acos(u1.real)) + else: + if u1.real > 0: # start is on pos u_x axis + theta1 = 0 + else: # start is on neg u_x axis + # Note: This behavior disagrees with behavior documented in + # http://www.w3.org/TR/SVG/implnote.html#ArcImplementationNotes + # where theta is set to 0 in this case. + theta1 = 180 + + det_uv = u1.real * u2.imag - u1.imag * u2.real + + acosand = u1.real * u2.real + u1.imag * u2.imag + acosand = np.clip(acosand.real, -1, 1) + np.clip(acosand.imag, -1, 1) + + if det_uv > 0: + deltatheta = degrees(acos(acosand)) + elif det_uv < 0: + deltatheta = -degrees(acos(acosand)) + else: + if u1.real * u2.real + u1.imag * u2.imag > 0: + # u1 == u2 + deltatheta = 0 + else: + # u1 == -u2 + # Note: This behavior disagrees with behavior documented in + # http://www.w3.org/TR/SVG/implnote.html#ArcImplementationNotes + # where deltatheta is set to 0 in this case. + deltatheta = 180 + + if not self.sweep and deltatheta >= 0: + deltatheta -= 360 + elif self.large_arc and deltatheta <= 0: + deltatheta += 360 + + return radius, phi, rot_matrix, center, theta1, deltatheta + + def update_bounding_box(self, first, last_two_points, bbox): + prev = last_two_points[-1] + for seg in self.to_curves(prev=prev): + seg.update_bounding_box(first, [None, prev], bbox) + prev = seg.cend_point(first, prev) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (self.endpoint,) + + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return NotImplemented + + def to_curves(self, prev: ComplexLike, prev_prev: ComplexLike = 0j) -> List[Curve]: + """Convert this arc into bezier curves""" + # TODO Refactor out CubicSuperPath + from .path import CubicSuperPath + + path = CubicSuperPath( + [arc_to_path(Vector2d.c2t(complex(prev)), self.args)] + ).to_path(curves_only=True) + # Ignore the first move command from to_path() + return list(path)[1:] + + def transform(self, transform: Transform) -> Arc: + # pylint: disable=invalid-name, too-many-locals + newend = transform.capply_to_point(self.endpoint) + + T: Transform = transform + if self.x_axis_rotation != 0: + T = T @ Transform(rotate=self.x_axis_rotation) + a, c, b, d, _, _ = list(T.to_hexad()) + # T = | a b | + # | c d | + + detT = a * d - b * c + detT2 = detT**2 + + rx = float(self.rx) + ry = float(self.ry) + + def get_degen(): + return Arc( + self.radius, + self.x_axis_rotation, + self.large_arc, + self.sweep, + newend, + ) + + if rx == 0.0 or ry == 0.0 or detT2 == 0.0: + # degenerate arc + # transform only last point + return get_degen() + A = (d**2 / rx**2 + c**2 / ry**2) / detT2 + B = -(d * b / rx**2 + c * a / ry**2) / detT2 + D = (b**2 / rx**2 + a**2 / ry**2) / detT2 + + theta = atan2(-2 * B, D - A) / 2 + theta_deg = theta * 180.0 / pi + DA = D - A + l2 = 4 * B**2 + DA**2 + + if l2 == 0: + delta = 0.0 + else: + delta = 0.5 * (-(DA**2) - 4 * B**2) / sqrt(l2) + + half = (A + D) / 2 + + try: + rx_ = 1.0 / sqrt(half + delta) + ry_ = 1.0 / sqrt(half - delta) + + if detT > 0: + sweep = self.sweep + else: + sweep = not self.sweep > 0 + return Arc(rx_ + 1j * ry_, theta_deg, self.large_arc, sweep, newend) + except ZeroDivisionError: + return get_degen() + + def to_relative(self, prev: ComplexLike) -> RelativePathCommand: + return arc( + self.radius, + self.x_axis_rotation, + self.large_arc, + self.sweep, + self.endpoint - prev, + ) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.endpoint + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Arc: + return Arc( + self.radius, self.x_axis_rotation, self.large_arc, not self.sweep, prev + ) + + def _cpoint( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + # TODO surely this can be expressed in a shorter way using complex geometry? + radius, _, rot_matrix, center, theta1, deltatheta = self.parametrize(prev) + angle = (theta1 + t * deltatheta) * pi / 180 + cosphi = rot_matrix.real + sinphi = rot_matrix.imag + rx = radius.real + ry = radius.imag + + x = rx * cosphi * cos(angle) - ry * sinphi * sin(angle) + center.real + y = rx * sinphi * cos(angle) + ry * cosphi * sin(angle) + center.imag + return x + y * 1j + + def _cderivative( + self, first: complex, prev: complex, prev_control: complex, t: float, n: int = 1 + ) -> complex: + """returns the nth derivative of the segment at t.""" + radius, phi, _, _, theta1, deltatheta = self.parametrize(prev) + angle = radians(theta1 + t * deltatheta) + rx = radius.real + ry = radius.imag + k = (deltatheta * pi / 180) ** n # ((d/dt)angle)**n + + if n % 4 == 0 and n > 0: + return ( + rx * cos(phi) * cos(angle) + - ry * sin(phi) * sin(angle) + + 1j * (rx * sin(phi) * cos(angle) + ry * cos(phi) * sin(angle)) + ) + elif n % 4 == 1: + return k * ( + -rx * cos(phi) * sin(angle) + - ry * sin(phi) * cos(angle) + + 1j * (-rx * sin(phi) * sin(angle) + ry * cos(phi) * cos(angle)) + ) + elif n % 4 == 2: + return k * ( + -rx * cos(phi) * cos(angle) + + ry * sin(phi) * sin(angle) + + 1j * (-rx * sin(phi) * cos(angle) - ry * cos(phi) * sin(angle)) + ) + elif n % 4 == 3: + return k * ( + rx * cos(phi) * sin(angle) + + ry * sin(phi) * cos(angle) + + 1j * (rx * sin(phi) * sin(angle) - ry * cos(phi) * cos(angle)) + ) + else: + raise ValueError("n should be a positive integer.") + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Arc, Arc]: + """returns two segments, whose union is this segment and which join + at self.point(t).""" + radius, _, _, _, _, deltatheta = self.parametrize(prev) + + def crop(t0, t1): + return Arc( + radius, + self.x_axis_rotation, + not abs(deltatheta * (t1 - t0)) <= 180, + self.sweep, + self.cpoint(0j, prev, 0j, t1), + ) + + return crop(0, t), crop(t, 1) + + def _ilength( + self, + first: complex, + prev: complex, + prev_control: complex, + length: float, + settings: ILengthSettings = ILengthSettings(), + ): + # ilength calls self.parametrize very often, so we cache the result + param = self.parametrize + params = param(prev) + + def cached(prev): # pylint: disable=unused-argument + return params + + self.parametrize = cached # type: ignore + try: + return super()._ilength(first, prev, prev_control, length, settings) + finally: + self.parametrize = param # type: ignore + + +class arc(RelativePathCommand, Arc): # pylint: disable=invalid-name + """Relative Arc line segment""" + + letter = "a" + + nargs = 7 + + endpoint: complex + """Endpoint (relative) of the arc""" + + @property + def rx(self) -> float: + """x radius of the arc""" + return self.radius.real + + @property + def ry(self) -> float: + """y radius of the arc""" + return self.radius.imag + + @property + def dx(self) -> float: + """x coordinate of the (relative) endpoint of the arc""" + return self.endpoint.real + + @property + def dy(self) -> float: + """x coordinate of the (relative) endpoint of the arc""" + return self.endpoint.imag + + @property + def args(self): + return ( + self.rx, + self.ry, + self.x_axis_rotation, + self.large_arc, + self.sweep, + self.dx, + self.dy, + ) + + @overload + def __init__( + self, + radius: ComplexLike, + x_axis_rotation: float, + large_arc: bool, + sweep: bool, + endpoint: ComplexLike, + ) -> None: ... + + @overload + def __init__( + self, + rx: float, + ry: float, + x_axis_rotation: float, + large_arc: bool, + sweep: bool, + dx: float, + dy: float, + ) -> None: ... # pylint: disable=too-many-arguments + + def __init__(self, *args): + if len(args) == 5: + ( + self.radius, + self.x_axis_rotation, + self.large_arc, + self.sweep, + self.endpoint, + ) = args + self.radius = complex(self.radius) + self.endpoint = complex(self.endpoint) + elif len(args) == 7: + self.radius = args[0] + args[1] * 1j + self.x_axis_rotation, self.large_arc, self.sweep = args[2:5] + self.endpoint = args[5] + args[6] * 1j + + def to_absolute(self, prev: ComplexLike) -> Arc: + return Arc( + self.radius, + self.x_axis_rotation, + self.large_arc, + self.sweep, + self.endpoint + prev, + ) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.endpoint + prev + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (self.endpoint + prev,) + + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return NotImplemented + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> arc: + return arc( + self.radius, + self.x_axis_rotation, + self.large_arc, + not self.sweep, + -self.endpoint, + ) + + def to_curves(self, prev: ComplexLike, prev_prev: ComplexLike = 0j) -> List[Curve]: + return self.to_absolute(prev).to_curves(prev, prev_prev) + + +def arc_to_path(point, params): + """Approximates an arc with cubic bezier segments. + + Arguments: + point: Starting point (absolute coords) + params: Arcs parameters as per + https://www.w3.org/TR/SVG/paths.html#PathDataEllipticalArcCommands + + Returns a list of triplets of points : + [control_point_before, node, control_point_after] + (first and last returned triplets are [p1, p1, *] and [*, p2, p2]) + """ + + # pylint: disable=invalid-name, too-many-locals + A = point[:] + rx, ry, teta, longflag, sweepflag, x2, y2 = params[:] + teta = teta * pi / 180.0 + B = [x2, y2] + # Degenerate ellipse + if rx == 0 or ry == 0 or A == B: + return [[A[:], A[:], A[:]], [B[:], B[:], B[:]]] + + # turn coordinates so that the ellipse morph into a *unit circle* (not 0-centered) + mat = matprod((rotmat(teta), [[1.0 / rx, 0.0], [0.0, 1.0 / ry]], rotmat(-teta))) + applymat(mat, A) + applymat(mat, B) + + k = [-(B[1] - A[1]), B[0] - A[0]] + d = k[0] * k[0] + k[1] * k[1] + k[0] /= sqrt(d) + k[1] /= sqrt(d) + d = sqrt(max(0, 1 - d / 4.0)) + # k is the unit normal to AB vector, pointing to center O + # d is distance from center to AB segment (distance from O to the midpoint of AB) + # for the last line, remember this is a unit circle, and kd vector is ortogonal to + # AB (Pythagorean thm) + + if longflag == sweepflag: + # top-right ellipse in SVG example + # https://www.w3.org/TR/SVG/images/paths/arcs02.svg + d *= -1 + + O = [(B[0] + A[0]) / 2.0 + d * k[0], (B[1] + A[1]) / 2.0 + d * k[1]] + OA = [A[0] - O[0], A[1] - O[1]] + OB = [B[0] - O[0], B[1] - O[1]] + start = acos(OA[0] / norm(OA)) + if OA[1] < 0: + start *= -1 + end = acos(OB[0] / norm(OB)) + if OB[1] < 0: + end *= -1 + # start and end are the angles from center of the circle to A and to B respectively + + if sweepflag and start > end: + end += 2 * pi + if (not sweepflag) and start < end: + end -= 2 * pi + + NbSectors = int(abs(start - end) * 2 / pi) + 1 + dTeta = (end - start) / NbSectors + v = 4 * tan(dTeta / 4.0) / 3.0 + # I would use v = tan(dTeta/2)*4*(sqrt(2)-1)/3 ? + p = [] + for i in range(0, NbSectors + 1, 1): + angle = start + i * dTeta + v1 = [ + O[0] + cos(angle) - (-v) * sin(angle), + O[1] + sin(angle) + (-v) * cos(angle), + ] + pt = [O[0] + cos(angle), O[1] + sin(angle)] + v2 = [O[0] + cos(angle) - v * sin(angle), O[1] + sin(angle) + v * cos(angle)] + p.append([v1, pt, v2]) + p[0][0] = p[0][1][:] + p[-1][2] = p[-1][1][:] + + # go back to the original coordinate system + mat = matprod((rotmat(teta), [[rx, 0], [0, ry]], rotmat(-teta))) + for pts in p: + applymat(mat, pts[0]) + applymat(mat, pts[1]) + applymat(mat, pts[2]) + return p + + +def matprod(mlist): + """Get the product of the mat""" + prod = mlist[0] + for mat in mlist[1:]: + a00 = prod[0][0] * mat[0][0] + prod[0][1] * mat[1][0] + a01 = prod[0][0] * mat[0][1] + prod[0][1] * mat[1][1] + a10 = prod[1][0] * mat[0][0] + prod[1][1] * mat[1][0] + a11 = prod[1][0] * mat[0][1] + prod[1][1] * mat[1][1] + prod = [[a00, a01], [a10, a11]] + return prod + + +def rotmat(teta): + """Rotate the mat""" + return [[cos(teta), -sin(teta)], [sin(teta), cos(teta)]] + + +def applymat(mat, point): + """Apply the given mat""" + x = mat[0][0] * point[0] + mat[0][1] * point[1] + y = mat[1][0] * point[0] + mat[1][1] * point[1] + point[0] = x + point[1] = y + + +def norm(point): + """Normalise""" + return sqrt(point[0] * point[0] + point[1] * point[1]) diff --git a/extensions/botbox3000/deps/inkex/paths/curves.py b/extensions/botbox3000/deps/inkex/paths/curves.py new file mode 100644 index 0000000..f644c9a --- /dev/null +++ b/extensions/botbox3000/deps/inkex/paths/curves.py @@ -0,0 +1,499 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# Copyright (C) 2023 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""Curve and Smooth Path Commands""" + +from __future__ import annotations + +from typing import overload, Tuple, Callable, Union, cast + +import numpy as np + +from ..transforms import cubic_extrema, Transform, Vector2d, ComplexLike + +from .interfaces import ( + AbsolutePathCommand, + RelativePathCommand, + BezierArcComputationMixin, + BezierComputationMixin, +) + + +class CurveMixin(BezierComputationMixin, BezierArcComputationMixin): + """Common functionality for curves""" + + ccontrol_points: Callable[[complex, complex, complex], Tuple[complex, ...]] + + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + """Common implementation of ccurve_points for Curves""" + return self.ccontrol_points(first, prev, prev_prev) + + def _cderivative( + self, first: complex, prev: complex, prev_control: complex, t: float, n: int = 1 + ) -> complex: + """Returns the nth derivative of the segment at t. + + .. hint:: Bezier curves can have points where their derivative vanishes. + If you are interested in the tangent direction, use the :func:`unit_tangent` + method instead.""" + + points = self.ccontrol_points(first, prev, prev_control) + + if n == 1: + return ( + 3 * (points[0] - prev) * ((1 - t) ** 2) + + 6 * (points[1] - points[0]) * (1 - t) * t + + 3 * (points[2] - points[1]) * t**2 + ) + elif n == 2: + return 6 * ( + (1 - t) * (points[1] - 2 * points[0] + prev) + + t * (points[2] - 2 * points[1] + points[0]) + ) + elif n == 3: + return 6 * (points[2] - 3 * (points[1] - points[0]) - prev) + elif n > 3: + return complex(0, 0) + else: + raise ValueError("n should be a positive integer.") + + def poly(self, prev, prev_control, return_coeffs=False): + """Returns a the cubic as a complex Polynomial object. + + .. versionadded:: 1.4""" + points = self.ccontrol_points(0j, prev, prev_control) + coeffs = ( + -prev + 3 * (points[0] - points[1]) + points[2], + 3 * (prev - 2 * points[0] + points[1]), + 3 * (prev + points[0]), + prev, + ) + if return_coeffs: + return coeffs + return np.poly1d(coeffs) + + def _cunit_tangent( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + return self.bezier_unit_tangent(prev, prev_control, t) + + def _curvature( + self, first: complex, prev: complex, prev_control: complex, t: float + ): + return self.segment_curvature(prev, prev_control, t) + + def _abssplit( + self, prev: complex, prev_control: complex, t: float + ) -> Tuple[Curve, Curve]: + """Split this curve and return two Curves using DeCasteljau's algorithm""" + p1, p2, p3 = self.ccontrol_points(0j, prev, prev_control) + p1_1 = (1 - t) * prev + t * p1 + p1_2 = (1 - t) * p1 + t * p2 + p1_3 = (1 - t) * p2 + t * p3 + p2_1 = (1 - t) * p1_1 + t * p1_2 + p2_2 = (1 - t) * p1_2 + t * p1_3 + p3_1 = (1 - t) * p2_1 + t * p2_2 + + return Curve(p1_1, p2_1, p3_1), Curve(p2_2, p1_3, p3) + + def _relsplit(self, prev: complex, prev_control: complex, t: float): + """Split this curve and return two curves""" + c1abs, c2abs = self._abssplit(prev, prev_control, t) + return c1abs.to_relative(prev), c2abs.to_relative(c1abs.arg3) + + def _cpoint( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + control1, control2, end = self.ccontrol_points(first, prev, prev_control) + return ( + (1 - t) ** 3 * prev + + 3 * t * (1 - t) ** 2 * control1 + + 3 * t**2 * (1 - t) * control2 + + t**3 * end + ) + + +class Curve(CurveMixin, AbsolutePathCommand): + """Absolute Curved Line segment""" + + letter = "C" + nargs = 6 + + arg1: complex + """The (absolute) first control point""" + + arg2: complex + """The (absolute) second control point""" + + arg3: complex + """The (absolute) end point""" + + @property + def x2(self) -> float: + """x coordinate of the (absolute) first control point""" + return self.arg1.real + + @property + def y2(self) -> float: + """y coordinate of the (absolute) first control point""" + return self.arg1.imag + + @property + def x3(self) -> float: + """x coordinate of the (absolute) second control point""" + return self.arg2.real + + @property + def y3(self) -> float: + """y coordinate of the (absolute) second control point""" + return self.arg2.imag + + @property + def x4(self) -> float: + """x coordinate of the (absolute) end point""" + return self.arg3.real + + @property + def y4(self) -> float: + """y coordinate of the (absolute) end point""" + return self.arg3.imag + + @property + def args(self): + return ( + self.arg1.real, + self.arg1.imag, + self.arg2.real, + self.arg2.imag, + self.arg3.real, + self.arg3.imag, + ) + + @overload + def __init__(self, x2: ComplexLike, x3: ComplexLike, x4: ComplexLike): ... + + @overload + def __init__( + self, x2: float, y2: float, x3: float, y3: float, x4: float, y4: float + ): ... # pylint: disable=too-many-arguments + + def __init__(self, x2, y2, x3, y3=None, x4=None, y4=None): # pylint: disable=too-many-arguments + if y3 is not None: + self.arg1 = x2 + y2 * 1j + self.arg2 = x3 + y3 * 1j + self.arg3 = x4 + y4 * 1j + else: + self.arg1, self.arg2, self.arg3 = complex(x2), complex(y2), complex(x3) + + def update_bounding_box(self, first, last_two_points, bbox): + x1, x2, x3, x4 = last_two_points[-1].real, self.x2, self.x3, self.x4 + y1, y2, y3, y4 = last_two_points[-1].imag, self.y2, self.y3, self.y4 + + if not (x1 in bbox.x and x2 in bbox.x and x3 in bbox.x and x4 in bbox.x): + bbox.x += cubic_extrema(x1, x2, x3, x4) + + if not (y1 in bbox.y and y2 in bbox.y and y3 in bbox.y and y4 in bbox.y): + bbox.y += cubic_extrema(y1, y2, y3, y4) + + def transform(self, transform: Transform) -> Curve: + return Curve( + transform.capply_to_point(self.arg1), + transform.capply_to_point(self.arg2), + transform.capply_to_point(self.arg3), + ) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + # pylint: disable=unused-argument + return (self.arg1, self.arg2, self.arg3) + + def to_relative(self, prev: ComplexLike) -> curve: + return curve(self.arg1 - prev, self.arg2 - prev, self.arg3 - prev) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg3 + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Curve: + return Curve(self.arg2, self.arg1, prev) + + def to_bez(self): + """Convert to [[c1x, c1y], [c2x, c2y], [end_x, end_y]]""" + return [Vector2d.c2t(i) for i in self.ccontrol_points(0j, 0j, 0j)] + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Curve, Curve]: + return self._abssplit(prev, prev_control, t) + + +class curve(CurveMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative curved line segment""" + + letter = "c" + nargs = 6 + + arg1: complex + """The (relative) first control point""" + + arg2: complex + """The (relative) second control point""" + + arg3: complex + """The (relative) end point""" + + @property + def dx2(self) -> float: + """x coordinate of the (relative) first control point""" + return self.arg1.real + + @property + def dy2(self) -> float: + """y coordinate of the (relative) first control point""" + return self.arg1.imag + + @property + def dx3(self) -> float: + """x coordinate of the (relative) second control point""" + return self.arg2.real + + @property + def dy3(self) -> float: + """y coordinate of the (relative) second control point""" + return self.arg2.imag + + @property + def dx4(self) -> float: + """x coordinate of the (relative) end point""" + return self.arg3.real + + @property + def dy4(self) -> float: + """y coordinate of the (relative) end point""" + return self.arg3.imag + + @overload + def __init__(self, dx2: ComplexLike, dx3: ComplexLike, dx4: ComplexLike): ... + + @overload + def __init__( + self, dx2: float, dy2: float, dx3: float, dy3: float, dx4: float, dy4: float + ): ... # pylint: disable=too-many-arguments + + def __init__(self, dx2, dy2, dx3, dy3=None, dx4=None, dy4=None): # pylint: disable=too-many-arguments + if dy3 is not None: + self.arg1 = dx2 + dy2 * 1j + self.arg2 = dx3 + dy3 * 1j + self.arg3 = dx4 + dy4 * 1j + else: + self.arg1, self.arg2, self.arg3 = complex(dx2), complex(dy2), complex(dx3) + + @property + def args(self): + return self.dx2, self.dy2, self.dx3, self.dy3, self.dx4, self.dy4 + + def to_absolute(self, prev: ComplexLike) -> Curve: + return Curve(*self.ccurve_points(0j, complex(prev), 0j)) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg3 + prev + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> curve: + return curve(-self.arg3 + self.arg2, -self.arg3 + self.arg1, -self.arg3) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + # pylint: disable=unused-argument + return ( + self.arg1 + prev, + self.arg2 + prev, + self.arg3 + prev, + ) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[curve, curve]: + return self._relsplit(prev, prev_control, t) + + +class Smooth(CurveMixin, AbsolutePathCommand): + """Absolute Smoothed Curved Line segment""" + + letter = "S" + nargs = 4 + + arg1: complex + """The (absolute) control point""" + + arg2: complex + """The (absolute) end point""" + + @property + def x3(self) -> float: + """x coordinate of the (absolute) control point""" + return self.arg1.real + + @property + def y3(self) -> float: + """y coordinate of the (absolute) control point""" + return self.arg1.imag + + @property + def x4(self) -> float: + """x coordinate of the (absolute) end point""" + return self.arg2.real + + @property + def y4(self) -> float: + """y coordinate of the (absolute) end point""" + return self.arg2.imag + + @property + def args(self): + return self.x3, self.y3, self.x4, self.y4 + + @overload + def __init__(self, x3: ComplexLike, x4: ComplexLike): ... + + @overload + def __init__(self, x3: float, y3: float, x4: float, y4: float): ... + + def __init__(self, x3, y3, x4=None, y4=None): + if x4 is not None: + self.arg1 = x3 + y3 * 1j + self.arg2 = x4 + y4 * 1j + else: + self.arg1, self.arg2 = complex(x3), complex(y3) + + def update_bounding_box(self, first, last_two_points, bbox): + # pylint: disable=no-member + self.to_curve(last_two_points[-1], last_two_points[-2]).update_bounding_box( + first, last_two_points, bbox + ) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + # pylint: disable=unused-argument + return (2 * prev - prev_prev, self.arg1, self.arg2) + + def to_non_shorthand(self, prev: ComplexLike, prev_control: ComplexLike) -> Curve: + return self.to_curve(prev, prev_control) + + def to_relative(self, prev: ComplexLike) -> smooth: + return smooth(self.arg1 - prev, self.arg2 - prev) + + def transform(self, transform: Transform) -> Smooth: + return Smooth( + transform.capply_to_point(self.arg1), transform.capply_to_point(self.arg2) + ) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg2 + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Smooth: + return Smooth(self.arg1, prev) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Curve, Curve]: + # We can't preserve the smooth type for a split because de Casteljau's + # algorithm changes the handles (obviously). + # Only in special cases such as splitting to subsequent smooth segments at + # t=1/2 such a preservation would be possible + crv = cast(Curve, self.to_non_shorthand(prev, prev_control)) + return crv._split( # pylint: disable=protected-access, no-member + first, prev, prev_control, t + ) + + +class smooth(CurveMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative smoothed curved line segment""" + + letter = "s" + nargs = 4 + + arg1: complex + """The (absolute) control point""" + + arg2: complex + """The (absolute) end point""" + + @property + def dx3(self) -> float: + """x coordinate of the (relative) control point""" + return self.arg1.real + + @property + def dy3(self) -> float: + """y coordinate of the (relative) control point""" + return self.arg1.imag + + @property + def dx4(self) -> float: + """x coordinate of the (relative) end point""" + return self.arg2.real + + @property + def dy4(self) -> float: + """y coordinate of the (relative) end point""" + return self.arg2.imag + + @property + def args(self): + return self.dx3, self.dy3, self.dx4, self.dy4 + + @overload + def __init__(self, dx3: ComplexLike, dx4: ComplexLike): ... + + @overload + def __init__(self, dx3: float, dy3: float, dx4: float, dy4: float): ... + + def __init__(self, dx3, dy3, dx4=None, dy4=None): + if dx4 is not None: + self.arg1 = dx3 + dy3 * 1j + self.arg2 = dx4 + dy4 * 1j + else: + self.arg1, self.arg2 = complex(dx3), complex(dy3) + + def to_absolute(self, prev: ComplexLike) -> Smooth: + return Smooth(self.arg1 + prev, self.arg2 + prev) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg2 + prev + + def to_non_shorthand(self, prev: ComplexLike, prev_control: ComplexLike) -> Curve: + return self.to_absolute(prev).to_non_shorthand(prev, prev_control) + + def reverse(self, first: ComplexLike, prev: ComplexLike): + return smooth(-self.arg2 + self.arg1, -self.arg2) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + # pylint: disable=unused-argument + return (2 * prev - prev_prev, self.arg1 + prev, self.arg2 + prev) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[curve, curve]: + return self._relsplit(prev, prev_control, t) diff --git a/extensions/botbox3000/deps/inkex/paths/interfaces.py b/extensions/botbox3000/deps/inkex/paths/interfaces.py new file mode 100644 index 0000000..5403cea --- /dev/null +++ b/extensions/botbox3000/deps/inkex/paths/interfaces.py @@ -0,0 +1,731 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# Copyright (C) 2023 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""Interfaces for path commands""" + +from __future__ import annotations + +import abc +import math +from typing import ( + List, + Any, + Tuple, + Dict, + Type, + Generator, + Union, + TYPE_CHECKING, + Optional, + Callable, +) +from dataclasses import dataclass + +import numpy as np +from ..utils import classproperty, rational_limit +from ..transforms import Vector2d, BoundingBox, Transform, ComplexLike + +if TYPE_CHECKING: + from .curves import Curve + from .lines import Line + + +@dataclass +class LengthSettings: + """Settings for :func:`PathCommand.length` + + .. versionadded:: 1.4""" + + min_depth: int = 5 + error: float = 1e-5 + + +@dataclass +class ILengthSettings: + """Settings for :func:`PathCommand.ilength` + + .. versionadded:: 1.4""" + + min_depth: int = 5 + + error: float = 1e-5 + """ + Error tolerance for the computations of the test segment that is performed + for each iteration. + + The defaults from svgpathtools are ILENGTH_ERROR=ILENGTH_LENGTH_TOL=1e-12. + This is rather slow, particularly _length (which then subdivides the path into + 2^12 or more segments and adds up the length). For visual editing, this is rather + irrelevant (and a lot more accurate than the previous methods).""" + + length_tol: float = 1e-5 + """Total (absolute) tolerance of the resulting s value.""" + + maxits: int = 10000 + + +class PathCommand(abc.ABC): + """ + Base class of all path commands + """ + + letter = "" + # Number of arguments that follow this path commands letter + nargs = -1 + + @classproperty # From python 3.9 on, just combine @classmethod and @property + def name(cls): # pylint: disable=no-self-argument + """The full name of the segment (i.e. Line, Arc, etc)""" + return cls.__name__ # pylint: disable=no-member + + @classproperty + def next_command(self): + """The implicit next command. This is for automatic chains where the next + command isn't given, just a bunch on numbers which we automatically parse.""" + return self + + @property + def is_relative(self) -> bool: + """Whether the command is defined in relative coordinates, i.e. relative to + the previous endpoint (lower case path command letter)""" + raise NotImplementedError + + @property + def is_absolute(self) -> bool: + """Whether the command is defined in absolute coordinates (upper case path + command letter)""" + raise NotImplementedError + + def to_relative(self, prev: ComplexLike) -> RelativePathCommand: + """Return absolute counterpart for absolute commands or copy for relative""" + raise NotImplementedError + + def to_absolute(self, prev: ComplexLike) -> AbsolutePathCommand: + """Return relative counterpart for relative commands or copy for absolute""" + raise NotImplementedError + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> PathCommand: + """Reverse path command + + .. versionadded:: 1.1""" + raise NotImplementedError + + def to_non_shorthand( + self, + prev: ComplexLike, + prev_control: ComplexLike, # pylint: disable=unused-argument + ) -> AbsolutePathCommand: + """Return an absolute non-shorthand command + + .. versionadded:: 1.1""" + return self.to_absolute(prev) + + # The precision of the numbers when converting to string + number_template = "{:.6g}" + + # Maps single letter path command to corresponding class + # (filled at the bottom of file, when all classes already defined) + _letter_to_class: Dict[str, Type[Any]] = {} + + @staticmethod + def letter_to_class(letter): + """Returns class for given path command letter""" + return PathCommand._letter_to_class[letter] + + @property + @abc.abstractmethod + def args(self) -> List[float]: + """Returns path command arguments as tuple of floats""" + + def control_points( + self, + first: ComplexLike, + prev: ComplexLike, + prev_prev: ComplexLike, + ) -> Generator[Vector2d, None, None]: + """Returns list of path command control points""" + first, prev, prev_prev = complex(first), complex(prev), complex(prev_prev) + yield from [Vector2d(i) for i in self.ccontrol_points(first, prev, prev_prev)] + + @abc.abstractmethod + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + """Returns list of path command control points""" + + @classmethod + def _argt(cls, sep): + return sep.join([cls.number_template] * cls.nargs) + + def __str__(self): + return f"{self.letter} {self._argt(' ').format(*self.args)}".strip() + + def __repr__(self): + # pylint: disable=consider-using-f-string + return "{{}}({})".format(self._argt(", ")).format(self.name, *self.args) + + def __eq__(self, other): + previous = 0j + if type(self) == type(other): # pylint: disable=unidiomatic-typecheck + return self.args == other.args + if isinstance(other, tuple): + return self.args == other + if not isinstance(other, PathCommand): + raise ValueError("Can't compare types") + try: + if self.is_relative == other.is_relative: + return self.to_curve(previous) == other.to_curve(previous) + except ValueError: + pass + return False + + @abc.abstractmethod + def cend_point(self, first: complex, prev: complex) -> complex: + """Complex version of end_point""" + + def end_point(self, first: ComplexLike, prev: ComplexLike) -> Vector2d: + """Returns last control point of path command""" + return Vector2d(self.cend_point(complex(first or 0), complex(prev or 0))) + + @abc.abstractmethod + def update_bounding_box( + self, first: complex, last_two_points: List[complex], bbox: BoundingBox + ): + """Enlarges given bbox to contain path element. + + Args: + first (complex): first point of path. Required to calculate Z segment + last_two_points (List[complex]): list with last two control points in abs + coords. + bbox (BoundingBox): bounding box to update + """ + + def to_curve(self, prev: ComplexLike, prev_prev: ComplexLike = 0) -> Curve: + # pylint: disable=unused-argument + """Convert command to :py:class:`Curve` + + Curve().to_curve() returns a copy + """ + return NotImplemented + + def to_curves(self, prev: ComplexLike, prev_prev: ComplexLike = 0) -> List[Curve]: + """Convert command to list of :py:class:`Curve` commands""" + return [self.to_curve(prev, prev_prev)] + + def to_line(self, prev: ComplexLike) -> Line: + # pylint: disable=unused-argument + """Converts this segment to a line (copies if already a line)""" + return NotImplemented + + @abc.abstractmethod + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + # pylint: disable=unused-argument + """Converts the path element into a single cubic bezier""" + + # Derivation functionality + + def __check_t(self, t: Optional[float], allow_none=True): + if not allow_none and (t is None and self.letter not in "zZmMlLhHvV"): + raise ValueError("t=None only supported for Line-like commands") + if t is not None and not 0 <= t <= 1: + raise ValueError("t should be between 0 and 1") + return t if t is not None else 0.0 + + def cderivative( + self, + first: complex, + prev: complex, + prev_control: complex, + t: Optional[float] = None, + n: int = 1, + ) -> complex: + """Returns the nth derivative of the segment at t as a complex number. + + .. versionadded:: 1.4 + """ + if n < 1: + raise ValueError("n should be a positive integer") + # pylint: disable=protected-access + return self._cderivative(first, prev, prev_control, self.__check_t(t), n) + + def derivative( + self, + first: ComplexLike, + prev: ComplexLike, + prev_control: ComplexLike, + t: Optional[float] = None, + n: int = 1, + ) -> Vector2d: + """Returns the nth derivative of the segment at t as a :class:`Vector2D`. + + .. versionadded:: 1.4 + """ + return Vector2d( + self.cderivative( + complex(first or 0), + complex(prev or 0), + complex(prev_control or 0), + t, + n, + ) + ) + + @abc.abstractmethod + def _cderivative( + self, first: complex, prev: complex, prev_control: complex, t: float, n: int = 1 + ) -> complex: ... + + def cunit_tangent( + self, + first: complex, + prev: complex, + prev_control: complex, + t: Optional[float] = None, + ) -> complex: + """Returns the unit tangent of the segment at t as a complex number. + + ..versionadded:: 1.4 + """ + return self._cunit_tangent(first, prev, prev_control, self.__check_t(t)) + + def unit_tangent( + self, + first: ComplexLike, + prev: ComplexLike, + prev_control: ComplexLike, + t: Optional[float] = None, + ) -> Vector2d: + """Returns the unit tangent of the segment at t as a :class:`Vector2D`. + + ..versionadded:: 1.4 + """ + return Vector2d( + self.cunit_tangent( + complex(first or 0), complex(prev or 0), complex(prev_control or 0), t + ) + ) + + def _cunit_tangent( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + dseg = self._cderivative(first, prev, t, 1) + return dseg / abs(dseg) + + def cnormal( + self, + first: complex, + prev: complex, + prev_control: complex, + t: Optional[float] = None, + ) -> complex: + """Returns the (right-hand-rule) normal vector of the segment at t as a complex + number. + + ..versionadded:: 1.4 + """ + return self.cunit_tangent(first, prev, prev_control, t) * 1j + + def normal( + self, + first: ComplexLike, + prev: ComplexLike, + prev_control: ComplexLike, + t: Optional[float] = None, + ) -> Vector2d: + """Returns the (right-hand-rule) normal vector of the segment at t as + :class:`Vector2D`. + + ..versionadded:: 1.4 + """ + return Vector2d( + self.cnormal( + complex(first or 0), complex(prev or 0), complex(prev_control or 0), t + ) + ) + + def curvature( + self, + first: ComplexLike, + prev: ComplexLike, + prev_control: ComplexLike, + t: Optional[float] = None, + ) -> float: + """Returns the curvature of the segment at t. + + ..versionadded:: 1.4 + """ + # pylint: disable=protected-access + return self._curvature( + complex(first or 0), + complex(prev or 0), + complex(prev_control or 0), + self.__check_t(t), + ) + + @abc.abstractmethod + def _curvature( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> float: ... + + # Point evaluation, splitting + def cpoint( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + """Returns the coordinates of the Bezier curve evaluated at t as complex number. + + .. versionadded:: 1.4""" + return self._cpoint(first, prev, prev_control, self.__check_t(t, False)) + + def point( + self, first: ComplexLike, prev: ComplexLike, prev_control: ComplexLike, t: float + ) -> Vector2d: + """Returns the coordinates of the Bezier curve evaluated at t as :class:`Vector2d`. + + .. versionadded:: 1.4""" + return Vector2d( + self.cpoint( + complex(first or 0), complex(prev or 0), complex(prev_control or 0), t + ) + ) + + @abc.abstractmethod + def _cpoint( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: ... + + def split( + self, first: ComplexLike, prev: ComplexLike, prev_control: ComplexLike, t: float + ) -> Tuple[PathCommand, PathCommand]: + """Returns two segments, whose union is this segment and which join at + self.point(t). + + .. versionadded:: 1.4""" + # no simplification here, we want to preserve the original type + return self._split( + complex(first), + complex(prev), + complex(prev_control), + self.__check_t(t, False), + ) + + @abc.abstractmethod + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[PathCommand, PathCommand]: ... + + # Line integration + + def length( + self, + first: ComplexLike, + prev: ComplexLike, + prev_control: ComplexLike, + t0: float = 0, + t1: float = 1, + settings=LengthSettings(), + ) -> float: + """Returns the length of the segment between t0 and t1. + + .. versionadded:: 1.4""" + # pylint: disable=protected-access + return self._length( + complex(first), + complex(prev), + complex(prev_control), + self.__check_t(t0, False), + self.__check_t(t1, False), + settings, + ) + + @abc.abstractmethod + def _length( + self, + first: complex, + prev: complex, + prev_control: complex, + t0: float = 0, + t1: float = 1, + settings=LengthSettings(), + ) -> float: ... + + def ilength( + self, + first: ComplexLike, + prev: ComplexLike, + prev_control: ComplexLike, + length: float, + settings: ILengthSettings = ILengthSettings(), + ): + """Returns a float ``t``, such that ``self.length(0, t)`` is approximately + ``length``. + + .. versionadded:: 1.4""" + # pylint: disable=protected-access + return self._ilength( + complex(first), complex(prev), complex(prev_control), length, settings + ) + + @abc.abstractmethod + def _ilength( + self, + first: complex, + prev: complex, + prev_control: complex, + length: float, + settings: ILengthSettings = ILengthSettings(), + ): ... + + +class RelativePathCommand(PathCommand): + """ + Abstract base class for relative path commands. + + Implements most of methods of :py:class:`PathCommand` through + conversion to :py:class:`AbsolutePathCommand` + """ + + @property + def is_relative(self): + return True + + @property + def is_absolute(self): + return False + + def to_relative(self, prev: ComplexLike) -> RelativePathCommand: + return self.__class__(*self.args) + + def update_bounding_box(self, first, last_two_points, bbox): + self.to_absolute(last_two_points[-1]).update_bounding_box( + first, last_two_points, bbox + ) + + +class AbsolutePathCommand(PathCommand): + """Absolute path command. Unlike :py:class:`RelativePathCommand` can be transformed + directly.""" + + @property + def is_relative(self): + return False + + @property + def is_absolute(self): + return True + + def to_absolute(self, prev: ComplexLike) -> AbsolutePathCommand: + return self.__class__(*self.args) + + @abc.abstractmethod + def transform(self, transform: Transform) -> AbsolutePathCommand: + """Returns new transformed segment + + :param transform: a transformation to apply + """ + + def rotate(self, degrees: float, center: Vector2d) -> AbsolutePathCommand: + """ + Returns new transformed segment + + :param degrees: rotation angle in degrees + :param center: invariant point of rotation + """ + return self.transform(Transform(rotate=(degrees, center[0], center[1]))) + + def translate(self, dr: Vector2d) -> AbsolutePathCommand: + """Translate or scale this path command by dr""" + return self.transform(Transform(translate=dr)) + + def scale(self, factor: Union[float, Tuple[float, float]]) -> AbsolutePathCommand: + """Returns new transformed segment + + :param factor: scale or (scale_x, scale_y) + """ + return self.transform(Transform(scale=factor)) + + +class BezierArcComputationMixin: + """Functionality that works the same way for Arcs, Cubic and Quadratic + + .. versionadded:: 1.4""" + + _cpoint: Callable[[complex, complex, complex, float], complex] + _cderivative: Callable[..., complex] + poly: Callable[[complex, complex, complex, Optional[bool]], np.poly1d] + + def inv_arclength(self, prev, prev_control, s, settings=ILengthSettings()): + """Ported from https://github.com/mathandy/svgpathtools/blob/19df25b99b405ec4fc7616b58384eca7879b6fd4/svgpathtools/path.py#L541 + (MIT Licensed)""" + t_upper = 1 + t_lower = 0 + iteration = 0 + while iteration < settings.maxits: + iteration += 1 + t = (t_lower + t_upper) / 2 + s_t = self._length(0j, prev, prev_control, t1=t, settings=settings) + if abs(s_t - s) < settings.length_tol: + return t + elif s_t < s: # t too small + t_lower = t + else: # s < s_t, t too big + t_upper = t + if t_upper == t_lower: + # warn("t is as close as a float can be to the correct value, " + # "but |s(t) - s| = {} > s_tol".format(abs(s_t-s))) + return t + raise Exception(f"Maximum iterations reached with s(t) - s = {s_t - s}.") + + def segment_length( + self, + start, + end, + start_point, + end_point, + pos_eval, + settings=LengthSettings(), + depth=0, + ): + """ + Ported from https://github.com/mathandy/svgpathtools/blob/19df25b99b405ec4fc7616b58384eca7879b6fd4/svgpathtools/path.py#L479 + (MIT licensed) + # TODO better treatment of degenerate beziers from + # https://github.com/linebender/kurbo/blob/c229a914d303c5989c9e6b1d766def2df27a8185/src/cubicbez.rs#L431 + """ + mid = (start + end) / 2 + mid_point = pos_eval(mid) + length = abs(end_point - start_point) + first_half = abs(mid_point - start_point) + second_half = abs(end_point - mid_point) + + length2 = first_half + second_half + if (length2 - length > settings.error) or (depth < settings.min_depth): + # Calculate the length of each segment: + depth += 1 + return self.segment_length( + start, mid, start_point, mid_point, pos_eval, settings, depth + ) + self.segment_length( + mid, end, mid_point, end_point, pos_eval, settings, depth + ) + # This is accurate enough. + return length2 + + def segment_curvature(self, prev: complex, prev_prev: complex, t: float): + """Returns the curvature of the segment at t. + + Ported from https://github.com/mathandy/svgpathtools/blob/19df25b99b405ec4fc7616b58384eca7879b6fd4/svgpathtools/path.py#L386 + (MIT licensed) + """ + + dz = self._cderivative(0j, prev, prev_prev, t) + ddz = self._cderivative(0j, prev, prev_prev, t, n=2) + dx, dy = dz.real, dz.imag + ddx, ddy = ddz.real, ddz.imag + try: + kappa = abs(dx * ddy - dy * ddx) / math.sqrt(dx * dx + dy * dy) ** 3 + except (ZeroDivisionError, FloatingPointError): + # tangent vector is zero at t, use polytools to find limit + p = self.poly(0j, prev, prev_prev, False) + dp = p.deriv() + ddp = dp.deriv() + dx2, dy2 = np.real(dp), np.imag(dp) + ddx2, ddy2 = np.real(ddp), np.imag(ddp) + f2 = (dx2 * ddy2 - dy2 * ddx2) ** 2 + g2 = (dx2 * dx2 + dy2 * dy2) ** 3 + lim2 = rational_limit(f2, g2, t) + if lim2 < 0: # impossible, must be numerical error + return 0 + kappa = math.sqrt(lim2) + return kappa + + def _length( + self, + first: complex, + prev: complex, + prev_control: complex, + t0=0, + t1=1, + settings=LengthSettings(), + ) -> float: + return self.segment_length( + t0, + t1, + self._cpoint(first, prev, prev_control, t0), + self._cpoint(first, prev, prev_control, t1), + lambda t: self._cpoint(first, prev, prev_control, t), + settings, + 0, + ) + + def _ilength( + self, + first: complex, + prev: complex, + prev_control: complex, + length, + settings=ILengthSettings(), + ): + return self.inv_arclength(prev, prev_control, length, settings) + + def _curvature( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> float: + return self.segment_curvature(prev, prev_control, t) + + +class BezierComputationMixin: + """Functionality that works the same for all Beziers (Quadratic, Cubic) + + .. versionadded:: 1.4""" + + def _bpoints(self, prev, prev_prev): + return (prev,) + self.ccontrol_points(0j, prev, prev_prev) + + def bezier_unit_tangent(self, prev, prev_prev, t): + """Returns the unit tangent of the segment at t. + + Ported from https://github.com/mathandy/svgpathtools/blob/19df25b99b405ec4fc7616b58384eca7879b6fd4/svgpathtools/path.py#L348 + (MIT licensed)""" + + dseg = self._cderivative(0j, prev, prev_prev, t) + + try: + unit_tangent = dseg / abs(dseg) + except (ZeroDivisionError, FloatingPointError): + # This may be a removable singularity, if so we just need to compute + # the limit. + # Note: limit{{dseg / abs(dseg)} = sqrt(limit{dseg**2 / abs(dseg)**2}) + dseg_poly = self.poly(prev, prev_prev).deriv() + dseg_abs_squared_poly = np.real(dseg_poly) ** 2 + np.imag(dseg_poly) ** 2 + try: + unit_tangent = np.sqrt( + rational_limit(dseg_poly**2, dseg_abs_squared_poly, t) + ) + except ValueError: + bef = self.poly(prev, prev_prev).deriv()(t - 1e-4) + aft = self.poly(prev, prev_prev).deriv()(t + 1e-4) + mes = ( + "Unit tangent appears to not be well-defined at " + f"t = {t}, \n" + f"seg.poly().deriv()(t - 1e-4) = {bef}\n" + f"seg.poly().deriv()(t + 1e-4) = {aft}" + ) + raise ValueError(mes) + return unit_tangent diff --git a/extensions/botbox3000/deps/inkex/paths/lines.py b/extensions/botbox3000/deps/inkex/paths/lines.py new file mode 100644 index 0000000..5214871 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/paths/lines.py @@ -0,0 +1,601 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# Copyright (C) 2023 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""Line-like path commands (Line, Horz, Vert, ZoneClose and their relative siblings)""" + +from __future__ import annotations + +from typing import overload, Tuple, Optional, TYPE_CHECKING, Callable, Union + +from inkex.paths.interfaces import ILengthSettings, LengthSettings + +from ..transforms import Transform, BoundingBox, ComplexLike + +from .interfaces import AbsolutePathCommand, RelativePathCommand, ILengthSettings + +if TYPE_CHECKING: + from .curves import Curve + + +class LineMixin: + """Common Line functions""" + + # pylint: disable=unused-argument + + arg1: complex + + cend_point: Callable[[complex, complex], complex] + + def ccurve_points(self, first: complex, prev: complex, prev_prev: complex): + """Common implementation of ccurve_points for Lines""" + arg1 = self.cend_point(first, prev) + return prev, arg1, arg1 + + def ccontrol_points( + self, + first: complex, + prev: complex, + prev_prev: complex, # pylint: disable=unused-argument + ) -> Tuple[complex, ...]: + """Common implementation of ccontrol_points for Lines""" + return (self.cend_point(first, prev),) + + def _cderivative( + self, first: complex, prev: complex, prev_control: complex, t: float, n: int = 1 + ) -> complex: + start = self.cend_point(first, prev) + if prev == start: + raise ValueError("Derivative is not defined for zero-length segments") + if n == 1: + return start - prev + return 0j + + def _curvature( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> float: + return 0 + + def _cpoint( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + return self.cend_point(first, prev) * t + (1 - t) * prev + + def _length( + self, + first: complex, + prev: complex, + prev_control: complex, + t0: float = 0, + t1: float = 1, + settings=LengthSettings(), + ) -> float: + return abs(self.cend_point(first, prev) - prev) * (t1 - t0) + + def _ilength( + self, + first: complex, + prev: complex, + prev_control: complex, + length: float, + settings: ILengthSettings = ILengthSettings(), + ): + return length / self._length(first, prev, prev_control) + + +class Line(LineMixin, AbsolutePathCommand): + """Line segment""" + + letter = "L" + nargs = 2 + + arg1: complex + """The (absolute) end points of the line.""" + + @property + def x(self): + """x coordinate of the line's (absolute) end point.""" + return self.arg1.real + + @property + def y(self): + """y coordinate of the line's (absolute) end point.""" + return self.arg1.imag + + @property + def args(self): + return self.x, self.y + + @overload + def __init__(self, x: ComplexLike): ... + + @overload + def __init__(self, x: float, y: float): ... + + def __init__(self, x, y=None): + if y is not None: + self.arg1 = x + y * 1j + else: + self.arg1 = complex(x) + + def update_bounding_box(self, first, last_two_points, bbox): + bbox += BoundingBox( + (last_two_points[-1].real, self.x), (last_two_points[-1].imag, self.y) + ) + + def to_relative(self, prev: ComplexLike) -> line: + return line(self.arg1 - prev) + + def transform(self, transform) -> Line: + return Line(transform.capply_to_point(self.arg1)) + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return self.arg1 + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Line: + return Line(prev) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Line, Line]: + return Line(self._cpoint(first, prev, prev_control, t)), Line(self.arg1) + + +class line(LineMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative line segment""" + + letter = "l" + nargs = 2 + + arg1: complex + """The (relative) end points of the line.""" + + @property + def dx(self): + """x coordinate of the line's (relative) end point.""" + return self.arg1.real + + @property + def dy(self): + """y coordinate of the line's (relative) end point.""" + return self.arg1.imag + + @property + def args(self): + return self.dx, self.dy + + @overload + def __init__(self, dx: ComplexLike): ... + + @overload + def __init__(self, dx: float, dy: float): ... + + def __init__(self, dx, dy=None): + if dy is not None: + self.arg1 = dx + dy * 1j + else: + self.arg1 = complex(dx) + + def to_absolute(self, prev: ComplexLike) -> Line: + return Line(prev + self.arg1) + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return self.arg1 + prev + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> line: + return line(-self.arg1) + + def to_curve( + self, prev: ComplexLike, prev_prev: Optional[ComplexLike] = 0j + ) -> Curve: + raise ValueError("Move segments can not be changed into curves.") + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[line, line]: + dx1 = self.cpoint(first, prev, prev_control, t) - prev + return line(dx1), line(self.arg1 - dx1) + + +class MoveMixin: + """Disable derivative / length method for Move command.""" + + def _cderivative( + self, first: complex, prev: complex, prev_control: complex, t: float, n: int = 1 + ) -> complex: + raise ValueError("Derivative is not supported for move/Move") + + def _cunit_tangent( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + raise ValueError("Unit Tangent is not supported for move/Move") + + def _curvature( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> float: + raise ValueError("Curvature is not supported for move/Move") + + def _cpoint( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + raise ValueError("Point is not supported for move/Move") + + def _length( + self, + first: complex, + prev: complex, + prev_control: complex, + t0: float = 0, + t1: float = 1, + settings=LengthSettings(), + ) -> float: + raise ValueError("Length is not supported for move/Move") + + def _ilength( + self, + first: complex, + prev: complex, + prev_control: complex, + length: float, + settings: ILengthSettings = ILengthSettings(), + ): + raise ValueError("ILength is not supported for move/Move") + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Move, Move]: + raise ValueError("Split is not supported for move/Move") + + +class Move(MoveMixin, AbsolutePathCommand): + """Move pen segment without a line""" + + letter = "M" + nargs = 2 + next_command = Line + + arg1: complex + """The (absolute) end points of the Move command""" + + @property + def x(self): + """x coordinate of the Moves's (absolute) end point.""" + return self.arg1.real + + @property + def y(self): + """y coordinate of the Move's (absolute) end point.""" + return self.arg1.imag + + @property + def args(self): + return self.x, self.y + + @overload + def __init__(self, x: ComplexLike): ... + + @overload + def __init__(self, x: float, y: float): ... + + def __init__(self, x, y=None): + if y is not None: + self.arg1 = x + y * 1j + else: + self.arg1 = complex(x) + + def update_bounding_box(self, first, last_two_points, bbox): + bbox += BoundingBox(self.x, self.y) + + def ccurve_points(self, first: complex, prev: complex, prev_prev: complex): + return prev, self.arg1, self.arg1 + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (self.arg1,) + + def to_relative(self, prev: ComplexLike) -> move: + return move(self.arg1 - prev) + + def transform(self, transform: Transform) -> Move: + return Move(transform.capply_to_point(self.arg1)) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg1 + + def to_curve( + self, prev: ComplexLike, prev_prev: Optional[ComplexLike] = 0j + ) -> Curve: + raise ValueError("Move segments can not be changed into curves.") + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Move: + return Move(prev) + + +class move(MoveMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative move segment""" + + letter = "m" + nargs = 2 + next_command = line + + @property + def dx(self): + """x coordinate of the moves's (relative) end point.""" + return self.arg1.real + + @property + def dy(self): + """y coordinate of the move's (relative) end point.""" + return self.arg1.imag + + @property + def args(self): + return self.dx, self.dy + + @overload + def __init__(self, dx: ComplexLike): ... + + @overload + def __init__(self, dx: float, dy: float): ... + + def __init__(self, dx, dy=None): + if dy is not None: + self.arg1 = dx + dy * 1j + else: + self.arg1 = complex(dx) + + def ccurve_points(self, first: complex, prev: complex, prev_prev: complex): + return prev, self.arg1 + prev, self.arg1 + prev + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (self.arg1 + prev,) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg1 + prev + + def to_absolute(self, prev: ComplexLike) -> Move: + return Move(prev + self.arg1) + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> move: + return move(prev - first) + + def to_curve( + self, prev: ComplexLike, prev_prev: Optional[ComplexLike] = 0j + ) -> Curve: + raise ValueError("Move segments can not be changed into curves.") + + +class ZoneClose(LineMixin, AbsolutePathCommand): + """Close segment to finish a path""" + + letter = "Z" + nargs = 0 + next_command = Move + + @property + def args(self): + return () + + def update_bounding_box(self, first, last_two_points, bbox): + pass + + def transform(self, transform: Transform) -> ZoneClose: + return ZoneClose() + + def to_relative(self, prev: ComplexLike) -> zoneClose: + return zoneClose() + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return first + + def to_curve( + self, prev: ComplexLike, prev_prev: Optional[ComplexLike] = 0j + ) -> Curve: + raise ValueError("ZoneClose segments can not be changed into curves.") + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Line: + return Line(prev) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Line, ZoneClose]: + return Line(self._cpoint(first, prev, prev_control, t)), ZoneClose() + + +class zoneClose(LineMixin, RelativePathCommand): # pylint: disable=invalid-name + """Same as above (svg says no difference)""" + + letter = "z" + nargs = 0 + next_command = Move + + @property + def args(self): + return () + + def to_absolute(self, prev: ComplexLike): + return ZoneClose() + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> line: + return line(prev - first) + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return first + + def to_curve( + self, prev: ComplexLike, prev_prev: Optional[ComplexLike] = 0j + ) -> Curve: + raise ValueError("ZoneClose segments can not be changed into curves.") + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[line, zoneClose]: + return line(self.cpoint(first, prev, prev_control, t) - prev), zoneClose() + + +class Horz(LineMixin, AbsolutePathCommand): + """Horizontal Line segment""" + + letter = "H" + nargs = 1 + + @property + def args(self): + return (self.x,) + + def __init__(self, x): + self.x = x + + def update_bounding_box(self, first, last_two_points, bbox): + bbox += BoundingBox( + (last_two_points[-1].real, self.x), last_two_points[-1].imag + ) + + def to_relative(self, prev: ComplexLike) -> horz: + return horz(self.x - complex(prev).real) + + def to_non_shorthand(self, prev: ComplexLike, prev_control: ComplexLike) -> Line: + return self.to_line(prev) + + def transform(self, transform: Transform) -> AbsolutePathCommand: + raise ValueError("Horizontal lines can't be transformed directly.") + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return self.x + prev.imag * 1j + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Horz: + return Horz(complex(prev).real) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Horz, Horz]: + return Horz(self.cpoint(first, prev, prev_control, t).real), Horz(self.x) + + +class horz(LineMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative horz line segment""" + + letter = "h" + nargs = 1 + + @property + def args(self): + return (self.dx,) + + def __init__(self, dx): + self.dx = dx + + def to_absolute(self, prev: ComplexLike) -> Horz: + return Horz(complex(prev).real + self.dx) + + def to_non_shorthand(self, prev: ComplexLike, prev_control: ComplexLike) -> Line: + return self.to_line(prev) + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return (self.dx + prev.real) + prev.imag * 1j + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> horz: + return horz(-self.dx) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[horz, horz]: + dx1 = (self.cpoint(first, prev, prev_control, t) - prev).real + return horz(dx1), horz(self.dx - dx1) + + +class Vert(LineMixin, AbsolutePathCommand): + """Vertical Line segment""" + + letter = "V" + nargs = 1 + + @property + def args(self): + return (self.y,) + + def __init__(self, y): + self.y = y + + def update_bounding_box(self, first, last_two_points, bbox): + bbox += BoundingBox( + last_two_points[-1].real, (last_two_points[-1].imag, self.y) + ) + + def transform(self, transform: Transform) -> AbsolutePathCommand: + raise ValueError("Vertical lines can't be transformed directly.") + + def to_non_shorthand(self, prev: ComplexLike, prev_control: ComplexLike) -> Line: + return self.to_line(prev) + + def to_relative(self, prev: ComplexLike) -> vert: + return vert(self.y - complex(prev).imag) + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return prev.real + self.y * 1j + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Vert: + return Vert(complex(prev).imag) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Vert, Vert]: + return Vert(self.cpoint(first, prev, prev_control, t).imag), Vert(self.y) + + +class vert(LineMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative vertical line segment""" + + letter = "v" + nargs = 1 + + @property + def args(self): + return (self.dy,) + + def __init__(self, dy): + self.dy = dy + + def to_absolute(self, prev: ComplexLike) -> Vert: + return Vert(complex(prev).imag + self.dy) + + def to_non_shorthand(self, prev: ComplexLike, prev_control: ComplexLike) -> Line: + return self.to_line(prev) + + def cend_point(self, first: complex, prev: complex) -> complex: + # pylint: disable=unused-argument + return prev.real + (prev.imag + self.dy) * 1j + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> vert: + return vert(-self.dy) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[vert, vert]: + dy1 = (self.cpoint(first, prev, prev_control, t) - prev).imag + return vert(dy1), vert(self.dy - dy1) diff --git a/extensions/botbox3000/deps/inkex/paths/path.py b/extensions/botbox3000/deps/inkex/paths/path.py new file mode 100644 index 0000000..d8e3e87 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/paths/path.py @@ -0,0 +1,937 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# Copyright (C) 2023 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Path and CubicSuperPath classes +""" + +from __future__ import annotations + +import re +import copy +import warnings +from cmath import isclose + +from typing import Optional, Tuple, List, TypeVar, Iterator, Callable, Union +from ..transforms import ( + Transform, + BoundingBox, + Vector2d, + ComplexLike, +) +from ..utils import strargs + +from .lines import Line, Move, move, ZoneClose, zoneClose +from .curves import Curve +from .interfaces import ( + ILengthSettings, + LengthSettings, + PathCommand, + AbsolutePathCommand, +) + +Pathlike = TypeVar("Pathlike", bound="PathCommand") +AbsolutePathlike = TypeVar("AbsolutePathlike", bound="AbsolutePathCommand") + +LEX_REX = re.compile(r"([MLHVCSQTAZmlhvcsqtaz])([^MLHVCSQTAZmlhvcsqtaz]*)") + + +class InvalidPath(ValueError): + """Raised when given an invalid path string""" + + +class Path(list): + """A list of segment commands which combine to draw a shape""" + + callback: Optional[Callable] = None + + class PathCommandProxy: + """ + A handy class for Path traverse and coordinate access + + Reduces number of arguments in user code compared to bare + :class:`PathCommand` methods + """ + + def __init__( + self, + command: PathCommand, + first_point: ComplexLike, + previous_end_point: ComplexLike, + prev2_control_point: ComplexLike, + ): + self.command = command + self.cfirst_point = complex(first_point) + self.cprevious_end_point = complex(previous_end_point) + self.cprev2_control_point = complex(prev2_control_point) + + @property + def first_point(self) -> Vector2d: + """First point of the current subpath""" + return Vector2d(self.cfirst_point) + + @property + def previous_end_point(self) -> Vector2d: + """End point of the previous command""" + return Vector2d(self.cprevious_end_point) + + @property + def prev2_control_point(self) -> Vector2d: + """Last control point of the previous command""" + return Vector2d(self.cprev2_control_point) + + @property + def name(self) -> str: + """The full name of the segment (i.e. Line, Arc, etc)""" + return self.command.name + + @property + def letter(self) -> str: + """The single letter representation of this command (i.e. L, A, etc)""" + return self.command.letter + + @property + def next_command(self): + """The implicit next command.""" + return self.command.next_command + + @property + def is_relative(self) -> bool: + """Whether the command is defined in relative coordinates, i.e. relative to + the previous endpoint (lower case path command letter)""" + return self.command.is_relative + + @property + def is_absolute(self) -> bool: + """Whether the command is defined in absolute coordinates (upper case path + command letter)""" + return self.command.is_absolute + + @property + def args(self) -> List[float]: + """Returns path command arguments as tuple of floats""" + return self.command.args + + @property + def control_points(self) -> List[Vector2d]: + """Returns list of path command control points""" + return list( + self.command.control_points( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + ) + ) + + @property + def end_point(self) -> Vector2d: + """Returns last control point of path command""" + return Vector2d(self.cend_point) + + @property + def cend_point(self) -> complex: + """Returns last control point of path command (in complex form)""" + return self.command.cend_point(self.cfirst_point, self.cprevious_end_point) + + def reverse(self) -> PathCommand: + """Reverse path command""" + return self.command.reverse(self.cend_point, self.cprevious_end_point) + + def to_curve(self) -> Curve: + """Convert command to :py:class:`Curve` + Curve().to_curve() returns a copy + """ + return self.command.to_curve( + self.cprevious_end_point, self.cprev2_control_point + ) + + def to_curves(self) -> List[Curve]: + """Convert command to list of :py:class:`Curve` commands""" + return self.command.to_curves( + self.cprevious_end_point, self.cprev2_control_point + ) + + def to_absolute(self) -> AbsolutePathCommand: + """Return relative counterpart for relative commands or copy for absolute""" + return self.command.to_absolute(self.cprevious_end_point) + + def to_non_shorthand(self) -> AbsolutePathCommand: + """Returns an absolute non-shorthand command + + .. versionadded:: 1.4""" + return self.command.to_non_shorthand( + self.cprevious_end_point, self.cprev2_control_point + ) + + def split(self, time) -> Tuple[Path.PathCommandProxy, Path.PathCommandProxy]: + """Split this path command into two PathCommandProxy segments. + Raises ValueError for Move commands. + + .. versionadded:: 1.4""" + result = self.command.split( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + time, + ) + p1 = Path.PathCommandProxy( + result[0], + self.cfirst_point, + self.previous_end_point, + self.prev2_control_point, + ) + prev2: ComplexLike = ( + 0j if len(p1.control_points) < 2 else p1.control_points[-2] + ) + p2 = Path.PathCommandProxy( + result[1], self.cfirst_point, p1.end_point, prev2 + ) + return (p1, p2) + + def cpoint(self, time) -> complex: + """Returns the coordinates of the Bezier curve evaluated at t as complex number. + + .. versionadded:: 1.4""" + return self.command.cpoint( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + time, + ) + + def point(self, time) -> Vector2d: + """Returns the coordinates of the Bezier curve evaluated at t as :class:`Vector2d`. + + .. versionadded:: 1.4""" + return self.command.point( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + time, + ) + + def length(self, t0=0, t1=1, settings=LengthSettings()) -> float: + """Get the length of the command between t0 and t1 in user units + + .. versionadded:: 1.4""" + return self.command.length( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + t0, + t1, + settings, + ) + + def ilength(self, length, settings=ILengthSettings()) -> float: + """Tries to compute the time t at which the path segment has the given + length along its trajectory + + .. versionadded:: 1.4""" + return self.command.ilength( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + length, + settings, + ) + + def cunit_tangent(self, t) -> complex: + """Returns the unit tangent at t as complex number + + .. versionadded:: 1.4""" + return self.command.cunit_tangent( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + t, + ) + + def unit_tangent(self, t) -> Vector2d: + """Returns the unit tangent at t as :class:`inkex.Vector2D` + + .. versionadded:: 1.4""" + return self.command.unit_tangent( + self.cfirst_point, + self.cprevious_end_point, + self.cprev2_control_point, + t, + ) + + def __str__(self): + return str(self.command) + + def __repr__(self): + return "<" + self.__class__.__name__ + ">" + repr(self.command) + + def __init__(self, path_d=None) -> None: + super().__init__() + if isinstance(path_d, str): + # Returns a generator returning PathCommand objects + path_d = self.parse_string(path_d) + elif isinstance(path_d, CubicSuperPath): + path_d = path_d.to_path() + + for item in path_d or (): + if isinstance(item, PathCommand): + self.append(item) + elif isinstance(item, (list, tuple)) and len(item) == 2: + if isinstance(item[1], (list, tuple)): + self.append(PathCommand.letter_to_class(item[0])(*item[1])) + else: + if len(self) == 0: + self.append(Move(*item)) + else: + self.append(Line(*item)) + else: + raise TypeError( + f"Bad path type: {type(path_d).__name__}" + f"({type(item).__name__}, ...): {item}" + ) + + @classmethod + def parse_string(cls, path_d): + """Parse a path string and generate segment objects""" + for cmd, numbers in LEX_REX.findall(path_d): + args = list(strargs(numbers)) + cmd = PathCommand.letter_to_class(cmd) + i = 0 + while i < len(args) or cmd.nargs == 0: + if len(args[i : i + cmd.nargs]) != cmd.nargs: + return + seg = cmd(*args[i : i + cmd.nargs]) + i += cmd.nargs + cmd = seg.next_command + yield seg + + def bounding_box(self) -> Optional[BoundingBox]: + """Return bounding box of the Path""" + if not self: + return None + iterator = self.proxy_iterator() + proxy = next(iterator) + bbox = BoundingBox(proxy.first_point.x, proxy.first_point.y) + try: + while True: + proxy = next(iterator) + proxy.command.update_bounding_box( + complex(proxy.first_point), + [ + proxy.cprev2_control_point, + proxy.cprevious_end_point, + ], + bbox, + ) + except StopIteration: + return bbox + + def append(self, cmd): + """Append a command to this path.""" + try: + cmd.letter # pylint: disable=pointless-statement + super().append(cmd) + except AttributeError: + self.extend(cmd) + warnings.warn( + "Passing a list to Path.add is deprecated, please use Path.extend", + category=DeprecationWarning, + ) + + def translate(self, x, y, inplace=False): # pylint: disable=invalid-name + """Move all coords in this path by the given amount""" + return self.transform(Transform(translate=(x, y)), inplace=inplace) + + def scale(self, x, y, inplace=False): # pylint: disable=invalid-name + """Scale all coords in this path by the given amounts""" + return self.transform(Transform(scale=(x, y)), inplace=inplace) + + def rotate(self, deg, center=None, inplace=False): + """Rotate the path around the given point""" + if center is None: + # Default center is center of bbox + bbox = self.bounding_box() + if bbox: + center = bbox.center + else: + center = Vector2d() + center = Vector2d(center) + return self.transform( + Transform(rotate=(deg, center.x, center.y)), inplace=inplace + ) + + @property + def control_points(self) -> Iterator[Vector2d]: + """Returns all control points of the Path""" + prev: complex = 0 + prev_prev: complex = 0 + first: complex = 0 + + seg: PathCommand + for seg in self: + cpts = seg.ccontrol_points(first, prev, prev_prev) + if seg.letter in "zZmM": + first = cpts[-1] + for cpt in cpts: + prev_prev = prev + prev = cpt + yield Vector2d(cpt) + + @property + def cend_points(self) -> Iterator[complex]: + """Complex version of end_points""" + prev = 0j + first = 0j + + seg: PathCommand + for seg in self: + end_point = seg.cend_point(first, prev) + if seg.letter in "zZmM": + first = end_point + prev = end_point + yield end_point + + @property + def end_points(self) -> Iterator[Vector2d]: + """Returns all endpoints of all path commands (i.e. the nodes)""" + for i in self.cend_points: + yield Vector2d(i) + + def transform(self, transform, inplace=False): + """Convert to new path""" + result = Path() + previous = 0j + previous_new = 0j + start_zone = True + first = 0j + first_new = 0j + + seg: PathCommand + for i, seg in enumerate(self): + if start_zone: + first = seg.cend_point(first, previous) + + if seg.letter in "hHVv": + seg = seg.to_line(previous) + + if seg.is_relative: + new_seg = ( + seg.to_absolute(previous) + .transform(transform) + .to_relative(previous_new) + ) + else: + new_seg = seg.transform(transform) + + if start_zone: + first_new = new_seg.cend_point(first_new, previous_new) + + if inplace: + self[i] = new_seg + else: + result.append(new_seg) + previous = seg.cend_point(first, previous) + previous_new = new_seg.cend_point(first_new, previous_new) + start_zone = seg.letter in "zZ" + if inplace: + return self + return result + + def reverse(self): + """Returns a reversed path""" + result = Path() + try: + *_, first = self.cend_points + except ValueError: + # Empty path, return empty path + return result + closer = None + + # Go through the path in reverse order + for index, prcom in reversed(list(enumerate(self.proxy_iterator()))): + if prcom.letter in "MmZz": + if closer is not None: + if len(result) > 0 and result[-1].letter in "LlVvHh": + result.pop() # We can replace simple lines with Z + result.append(closer) # replace with same type (rel or abs) + if prcom.letter in "Zz": + closer = prcom.command + else: + closer = None + + if index == 0: + if prcom.letter == "M": + result.insert(0, Move(first)) + elif prcom.letter == "m": + result.insert(0, move(first)) + else: + result.append(prcom.reverse()) + + return result + + def break_apart(self) -> List[Path]: + """Breaks apart a path into its subpaths + + .. versionadded:: 1.3""" + result = [Path()] + current = result[0] + + for cmnd in self.proxy_iterator(): + if cmnd.letter.lower() == "m": + current = Path() + result.append(current) + current.append(Move(cmnd.cend_point)) + else: + current.append(cmnd.command) + # Remove all subpaths that are empty or only contain move commands + return [ + i + for i in result + if len(i) != 0 and not all(j.letter.lower() == "m" for j in i) + ] + + def close(self): + """Attempt to close the last path segment""" + if self and not self[-1].letter in "zZ": + self.append(ZoneClose()) + + def proxy_iterator(self) -> Iterator[PathCommandProxy]: + """ + Yields :py:class:`AugmentedPathIterator` + + :rtype: Iterator[ Path.PathCommandProxy ] + """ + + previous = 0j + prev_prev = 0j + first = 0j + seg: PathCommand + for seg in self: + if seg.letter in "zZmM": + first = seg.cend_point(first, previous) + yield Path.PathCommandProxy(seg, first, previous, prev_prev) + if seg.letter in "ctqsCTQS": + prev_prev = seg.ccontrol_points(first, previous, prev_prev)[-2] + previous = seg.cend_point(first, previous) + + def subpath_iterator(self): + """Yield Path for each subpath.""" + start_id = 0 + + for i, seg in enumerate(self): + if isinstance(seg, (move, Move)): + if start_id > -1 and i > 0: # add previous path (open path) + yield Path(self[start_id:i]) + start_id = i + elif isinstance(seg, (zoneClose, ZoneClose)): # add current path (closed) + yield Path(self[start_id : i + 1]) + start_id = -1 + elif i == len(self) - 1 and start_id > -1: # add last path (open) + yield Path(self[start_id:]) + + def to_absolute(self): + """Convert this path to use only absolute coordinates""" + return self._to_absolute(True) + + def to_non_shorthand(self) -> Path: + """Convert this path to use only absolute non-shorthand coordinates + + .. versionadded:: 1.1""" + return self._to_absolute(False) + + def _to_absolute(self, shorthand: bool) -> Path: + """Make entire Path absolute. + + Args: + shorthand (bool): If false, then convert all shorthand commands to + non-shorthand. + + Returns: + Path: the input path, converted to absolute coordinates. + """ + + abspath = Path() + + previous = 0j + first = 0j + seg: PathCommand + for seg in self: + if seg.letter in "mM": + first = seg.cend_point(first, previous) + + if shorthand: + abspath.append(seg.to_absolute(previous)) + else: + if abspath and abspath[-1].letter in "QC": + prev_control = list(abspath[-1].control_points(0, 0, 0))[-2] + else: + prev_control = previous + + abspath.append(seg.to_non_shorthand(previous, prev_control)) + + previous = seg.cend_point(first, previous) + + return abspath + + def to_relative(self): + """Convert this path to use only relative coordinates""" + abspath = Path() + + previous = 0j + first = 0j + seg: PathCommand + for seg in self: + if seg.letter in "mM": + first = seg.cend_point(first, previous) + + abspath.append(seg.to_relative(previous)) + previous = seg.cend_point(first, previous) + + return abspath + + def __str__(self): + return " ".join([str(seg) for seg in self]) + + @staticmethod + def __add_helper__(other): + """Prepare a path for adding (either add or iadd)""" + if isinstance(other, str): + other = Path(other) + return other + + def __iadd__(self, value): + return super().__iadd__(self.__add_helper__(value)) + + def __add__(self, other): + acopy = copy.deepcopy(self) + other = self.__add_helper__(other) + if isinstance(other, list): + acopy.extend(other) + return acopy + + def to_arrays(self): + """Returns path in format of parsePath output, returning arrays of absolute + command data + + .. deprecated:: 1.0 + This is compatibility function for older API. Should not be used in new code + + """ + return [[seg.letter, list(seg.args)] for seg in self.to_non_shorthand()] + + def to_superpath(self): + """Convert this path into a cubic super path""" + return CubicSuperPath(self) + + def copy(self): + """Make a copy""" + return copy.deepcopy(self) + + def __enter__(self): + return self + + def __exit__(self, type, value, traceback): + if self.callback is not None: + self.callback(self) # pylint: disable=not-callable + + +class CubicSuperPath(list): + """ + A conversion of a path into a predictable list of cubic curves which + can be operated on as a list of simplified instructions. + + When converting back into a path, all lines, arcs etc will be converted + to curve instructions. + + Structure is held as [SubPath[(point_a, bezier, point_b), ...], ...] + """ + + def __init__(self, items): + super().__init__() + self._closed = True + self._prev = 0j + self._prev_prev = 0j + + if isinstance(items, str): + items = Path(items) + + if isinstance(items, Path): + for item in items: + self.append_path_command(item) + return + + for item in items: + self.append(item) + + def __str__(self): + return str(self.to_path()) + + def append_node_with_handles(self, command: List[Tuple[float, float]]): + """First item: left handle, second item: node coords, + third item: right handle""" + if self._closed: + # Closed means that the previous segment is closed so we need a new one + # We always append to the last open segment. CSP starts out closed. + self._closed = False + super().append([]) + + self[-1].append(command) + self._prev_prev = command[0][0] + command[0][1] * 1j + self._prev = command[1][0] + command[1][1] * 1j + + def append_path_command(self, command: PathCommand): + """Append a path command. + + For ordinary commands: + + ..code :: + + old last entry -> [[.., ..], [.., ..], [x1, y1]] + new last entry -> [[x2, y2], [x3, y3], [x3, y3]] + + The last tuple is duplicated (retracted handle): either it's the last command + of the subpath, then the handle will stay retracted, or it will be replaced + with the next path command. + """ + if command.letter in "mM": + carg = command.cend_point(self._first, self._prev) + arg = Vector2d.c2t(carg) + super().append([[arg[:], arg[:], arg[:]]]) + self._prev = self._prev_prev = carg + self._closed = False + return + if command.letter in "zZ" and self: + # This duplicates the first segment to 'close' the path + self[-1].append([self[-1][0][0][:], self[-1][0][1][:], self[-1][0][2][:]]) + # Then adds a new subpath for the next shape (if any) + # self._closed = True + self._prev = self._first + return + if command.letter in "aA": + # Arcs are made up of (possibly) more than one curve, depending on their + # angle (approximated) + for arc_curve in command.to_curves(self._prev, self._prev_prev): + self.append_path_command(arc_curve) + return + # Handle regular curves. + + if self._closed: + # Previous segment is closed. Append a new segment first. + self._closed = False + super().append([]) + + cp1, cp2, cp3 = command.ccurve_points(0j, self._prev, self._prev_prev) + + item = [Vector2d.c2t(cp1), Vector2d.c2t(cp2), Vector2d.c2t(cp3)] + self._prev = cp3 + if not command.letter in "QT": + self._prev_prev = cp2 + else: + self._prev_prev = command.ccontrol_points(0j, self._prev, self._prev_prev)[ + 0 + ] + + if self[-1]: # There exists a previous segment, replace its outgoing handle. + self[-1][-1][-1] = item[0] + # Append the segment with the last coordinate (node pos) repeated. + self[-1].append(item[1:] + [item[-1][:]]) + + def append(self, item): + """Append a segment/node to the superpath and update the internal state. + + item may be specified in any of the following formats: + + - PathCommand + - [str, List[float]] - A path command letter and its arguments + - [[float, float], [float, float], [float, float]] - Incoming handle, node, + outgoing handle. + - List[[float, float], [float, float], [float, float]] - An entire subpath. + + + """ + if isinstance(item, list) and len(item) == 2 and isinstance(item[0], str): + item = PathCommand.letter_to_class(item[0])(*item[1]) + if isinstance(item, PathCommand): + self.append_path_command(item) + return + + if isinstance(item, list): + # Item is a subpath: List[Handle, node, Handle]. Just append the + # subpath, and update the prev/ prev_prev positions. + if ( + (len(item) != 3 or not all(len(bit) == 2 for bit in item)) + and len(item[0]) == 3 + and all(len(bit) == 2 for bit in item[0]) + ): + super().append(self._clean(item)) + + elif len(item) == 3 and all(len(bit) == 2 for bit in item): + # Item is already a csp segment [Handle, node, Handle]. + if self._closed: + # Closed means that the previous segment is closed so we need a new + # one. + # We always append to the last open segment. CSP starts out closed. + self._closed = False + super().append([]) + + # Item is already a csp segment and has already been shifted. + self[-1].append([i.copy() for i in item]) + else: + raise ValueError(f"Unknown super curve list format: {item}") + + self._prev_prev = Vector2d.t2c(self[-1][-1][0]) + self._prev = Vector2d.t2c(self[-1][-1][1]) + else: + raise ValueError(f"Unknown super curve list format: {item}") + + def _clean(self, lst): + """Recursively clean lists so they have the same type""" + if isinstance(lst, (tuple, list)): + return [self._clean(child) for child in lst] + return lst + + @property + def _first(self): + try: + return self[-1][0][0][0] + self[-1][0][0][1] * 1j + except IndexError: + return 0 + 0j + + def to_path(self, curves_only=False, rtol=1e-5, atol=1e-8): + """Convert the super path back to an svg path + + Arguments: see :func:`to_segments` for parameters""" + return Path(list(self.to_segments(curves_only, rtol, atol))) + + def to_segments(self, curves_only=False, rtol=1e-5, atol=1e-8): + """Generate a set of segments for this cubic super path + + Arguments: + curves_only (bool, optional): If False, curves that can be represented + by Lineto / ZoneClose commands, will be. Defaults to False. + rtol (float, optional): relative tolerance, passed to :func:`is_line` and + :func:`inkex.transforms.ImmutableVector2d.is_close` for checking if a + line can be replaced by a ZoneClose command. Defaults to 1e-5. + + .. versionadded:: 1.2 + atol: absolute tolerance, passed to :func:`is_line` and + :func:`inkex.transforms.ImmutableVector2d.is_close`. Defaults to 1e-8. + + .. versionadded:: 1.2""" + for subpath in self: + previous = [] + for segment in subpath: + if not previous: + yield Move(Vector2d(segment[1])) + elif self.is_line(previous, segment, rtol, atol) and not curves_only: + if segment is subpath[-1] and Vector2d(segment[1]).is_close( + Vector2d(subpath[0][1]), rtol, atol + ): + yield ZoneClose() + else: + yield Line(Vector2d(segment[1])) + else: + yield Curve( + Vector2d(previous[2]), + Vector2d(segment[0]), + Vector2d(segment[1]), + ) + previous = segment + + def transform(self, transform): + """Apply a transformation matrix to this super path""" + return self.to_path().transform(transform).to_superpath() + + @staticmethod + def is_on(pt_a, pt_b, pt_c, tol=1e-8): + """Checks if point pt_a is on the line between points pt_b and pt_c + + .. versionadded:: 1.2""" + return CubicSuperPath.collinear(pt_a, pt_b, pt_c, tol) and ( + CubicSuperPath.within(pt_a[0], pt_b[0], pt_c[0]) + if abs(pt_a[0] - pt_b[0]) > 1e-13 + else CubicSuperPath.within(pt_a[1], pt_b[1], pt_c[1]) + ) + + @staticmethod + def collinear(pt_a, pt_b, pt_c, tol=1e-8): + """Checks if points pt_a, pt_b, pt_c lie on the same line, + i.e. that the cross product (b-a) x (c-a) < tol + + .. versionadded:: 1.2""" + return ( + abs( + (pt_b[0] - pt_a[0]) * (pt_c[1] - pt_a[1]) + - (pt_c[0] - pt_a[0]) * (pt_b[1] - pt_a[1]) + ) + < tol + ) + + @staticmethod + def within(val_b, val_a, val_c): + """Checks if float val_b is between val_a and val_c + + .. versionadded:: 1.2""" + return val_a <= val_b <= val_c or val_c <= val_b <= val_a + + @staticmethod + def is_line(previous, segment, rtol=1e-5, atol=1e-8): + """Check whether csp segment (two points) can be expressed as a line has + retracted handles or the handles can be retracted without loss of information + (i.e. both handles lie on the line) + + .. versionchanged:: 1.2 + Previously, it was only checked if both control points have retracted + handles. Now it is also checked if the handles can be retracted without + (visible) loss of information (i.e. both handles lie on the line connecting + the nodes). + + Arguments: + previous: first node in superpath notation + segment: second node in superpath notation + rtol (float, optional): relative tolerance, passed to + :func:`inkex.transforms.ImmutableVector2d.is_close` for checking handle + retraction. Defaults to 1e-5. + + .. versionadded:: 1.2 + atol (float, optional): absolute tolerance, passed to + :func:`inkex.transforms.ImmutableVector2d.is_close` for checking handle + retraction and + :func:`inkex.paths.CubicSuperPath.is_on` for checking if all points + (nodes + handles) lie on a line. Defaults to 1e-8. + + .. versionadded:: 1.2 + """ + + retracted = isclose( + Vector2d(previous[1]), Vector2d(previous[2]), rel_tol=rtol, abs_tol=atol + ) and isclose( + Vector2d(segment[0]), Vector2d(segment[1]), rel_tol=rtol, abs_tol=atol + ) + + if retracted: + return True + + # Can both handles be retracted without loss of information? + # Definitely the case if the handles lie on the same line as the two nodes and + # in the correct order + # E.g. cspbezsplitatlength outputs non-retracted handles when splitting a + # straight line + return CubicSuperPath.is_on( + segment[0], segment[1], previous[2], atol + ) and CubicSuperPath.is_on(previous[2], previous[1], segment[0], atol) diff --git a/extensions/botbox3000/deps/inkex/paths/quadratic.py b/extensions/botbox3000/deps/inkex/paths/quadratic.py new file mode 100644 index 0000000..257bab8 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/paths/quadratic.py @@ -0,0 +1,456 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# Copyright (C) 2023 Jonathan Neuhauser +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""Quadratic and TepidQuadratic path commands""" + +from __future__ import annotations + +from typing import overload, Tuple, Callable, Union +from math import sqrt + +import numpy as np + +from ..transforms import quadratic_extrema, Transform, ComplexLike + +from .interfaces import ( + AbsolutePathCommand, + RelativePathCommand, + BezierComputationMixin, + BezierArcComputationMixin, + LengthSettings, +) + + +class QuadraticMixin(BezierComputationMixin, BezierArcComputationMixin): + # pylint: disable=unused-argument + ccontrol_points: Callable[[complex, complex, complex], Tuple[complex, ...]] + + def _cderivative( + self, first: complex, prev: complex, prev_control: complex, t: float, n: int = 1 + ) -> complex: + points = self.ccontrol_points(first, prev, prev_control) + if n == 1: + return 2 * ((points[0] - prev) * (1 - t) + (points[1] - points[0]) * t) + if n == 2: + return 2 * (prev - 2 * points[0] + points[1]) + if n > 2: + return 0j + raise ValueError("n should be a positive integer.") + + def _cunit_tangent( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + return self.bezier_unit_tangent(prev, prev_control, t) + + def _cpoint( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> complex: + control, end = self.ccontrol_points(first, prev, prev_control) + return (1 - t) ** 2 * prev + 2 * t * (1 - t) * control + t**2 * end + + # TODO maybe better treatment of degenerate beziers from + # https://github.com/linebender/kurbo/blob/c229a914d303c5989c9e6b1d766def2df27a8185/src/quadbez.rs#L239 + # Ported from https://github.com/mathandy/svgpathtools/blob/19df25b99b405ec4fc7616b58384eca7879b6fd4/svgpathtools/path.py#L919 + # (MIT licensed) + def _length( + self, + first: complex, + prev: complex, + prev_control: complex, + t0: float = 0, + t1: float = 1, + settings=LengthSettings(), + ) -> float: + control, end = self.ccontrol_points(first, prev, prev_control) + a = prev - 2 * control + end + b = 2 * (control - prev) + + if abs(a) < 1e-12: + s = abs(b) * (t1 - t0) + else: + c2 = 4 * (a.real**2 + a.imag**2) + c1 = 4 * (a.real * b.real + a.imag * b.imag) + c0 = b.real**2 + b.imag**2 + + beta = c1 / (2 * c2) + gamma = c0 / c2 - beta**2 + + dq1_mag = sqrt(c2 * t1**2 + c1 * t1 + c0) + dq0_mag = sqrt(c2 * t0**2 + c1 * t0 + c0) + # this implicitly handles division by zero + try: + logarand = (sqrt(c2) * (t1 + beta) + dq1_mag) / ( + sqrt(c2) * (t0 + beta) + dq0_mag + ) + + s = ( + (t1 + beta) * dq1_mag + - (t0 + beta) * dq0_mag + + gamma * sqrt(c2) * np.log(logarand) + ) / 2 + except ZeroDivisionError: + s = np.nan + if np.isnan(s): + tstar = abs(b) / (2 * abs(a)) + if t1 < tstar: + return abs(a) * (t0**2 - t1**2) - abs(b) * (t0 - t1) + elif tstar < t0: + return abs(a) * (t1**2 - t0**2) - abs(b) * (t1 - t0) + else: + return ( + abs(a) * (t1**2 + t0**2) + - abs(b) * (t1 + t0) + + abs(b) ** 2 / (2 * abs(a)) + ) + return s + + def _abssplit( + self, prev: complex, prev_control: complex, t: float + ) -> Tuple[Quadratic, Quadratic]: + """Split this Quadratic and return two Quadratics using DeCasteljau's algorithm""" + p1, p2 = self.ccontrol_points(0j, prev, prev_control) + p1_1 = (1 - t) * prev + t * p1 + p1_2 = (1 - t) * p1 + t * p2 + p2_1 = (1 - t) * p1_1 + t * p1_2 + return Quadratic(p1_1, p2_1), Quadratic(p1_2, p2) + + def _relsplit(self, prev: complex, prev_control: complex, t: float): + """Split this curve and return two curves""" + c1abs, c2abs = self._abssplit(prev, prev_control, t) + return c1abs.to_relative(prev), c2abs.to_relative(c1abs.arg2) + + +class Quadratic(QuadraticMixin, AbsolutePathCommand): + """Absolute Quadratic Curved Line segment""" + + letter = "Q" + nargs = 4 + + arg1: complex + """The (absolute) control point""" + + arg2: complex + """The (absolute) end point""" + + @property + def x2(self) -> float: + """x coordinate of the (absolute) control point""" + return self.arg1.real + + @property + def y2(self) -> float: + """y coordinate of the (absolute) control point""" + return self.arg1.imag + + @property + def x3(self) -> float: + """x coordinate of the (absolute) end point""" + return self.arg2.real + + @property + def y3(self) -> float: + """y coordinate of the (absolute) end point""" + return self.arg2.imag + + @property + def args(self): + return self.x2, self.y2, self.x3, self.y3 + + @overload + def __init__(self, x2: ComplexLike, x3: ComplexLike): ... + + @overload + def __init__(self, x2: float, y2: float, x3: float, y3: float): ... + + def __init__(self, x2, y2, x3=None, y3=None): + if x3 is not None: + self.arg1 = x2 + y2 * 1j + self.arg2 = x3 + y3 * 1j + else: + self.arg1, self.arg2 = complex(x2), complex(y2) + + def update_bounding_box(self, first, last_two_points, bbox): + x1, x2, x3 = last_two_points[-1].real, self.x2, self.x3 + y1, y2, y3 = last_two_points[-1].imag, self.y2, self.y3 + + if not (x1 in bbox.x and x2 in bbox.x and x3 in bbox.x): + bbox.x += quadratic_extrema(x1, x2, x3) + + if not (y1 in bbox.y and y2 in bbox.y and y3 in bbox.y): + bbox.y += quadratic_extrema(y1, y2, y3) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (self.arg1, self.arg2) + + def to_relative(self, prev: ComplexLike) -> quadratic: + return quadratic(self.arg1 - prev, self.arg2 - prev) + + def transform(self, transform: Transform) -> Quadratic: + return Quadratic( + transform.capply_to_point(self.arg1), transform.capply_to_point(self.arg2) + ) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg2 + + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + pt1 = 1.0 / 3 * prev + 2.0 / 3 * self.arg1 + pt2 = 2.0 / 3 * self.arg1 + 1.0 / 3 * self.arg2 + return pt1, pt2, self.arg2 + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> Quadratic: + prev = complex(prev) + return Quadratic(self.x2, self.y2, prev.real, prev.imag) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Quadratic, Quadratic]: + return self._abssplit(prev, prev_control, t) + + +class quadratic(QuadraticMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative quadratic line segment""" + + letter = "q" + nargs = 4 + + arg1: complex + """The (relative) control point""" + + arg2: complex + """The (relative) end point""" + + @property + def dx2(self) -> float: + """x coordinate of the (relative) control point""" + return self.arg1.real + + @property + def dy2(self) -> float: + """y coordinate of the (relative) control point""" + return self.arg1.imag + + @property + def dx3(self) -> float: + """x coordinate of the (relative) end point""" + return self.arg2.real + + @property + def dy3(self) -> float: + """y coordinate of the (relative) end point""" + return self.arg2.imag + + @property + def args(self): + return self.dx2, self.dy2, self.dx3, self.dy3 + + @overload + def __init__(self, dx2: ComplexLike, dx3: ComplexLike): ... + + @overload + def __init__(self, dx2: float, dy2: float, dx3: float, dy3: float): ... + + def __init__(self, dx2, dy2, dx3=None, dy3=None): + if dx3 is not None: + self.arg1 = dx2 + dy2 * 1j + self.arg2 = dx3 + dy3 * 1j + else: + self.arg1, self.arg2 = complex(dx2), complex(dy2) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (self.arg1 + prev, self.arg2 + prev) + + def to_absolute(self, prev: ComplexLike) -> Quadratic: + return Quadratic(self.arg1 + prev, self.arg2 + prev) + + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + pt1 = 1.0 / 3 * prev + 2.0 / 3 * (prev + self.arg1) + pt2 = 2.0 / 3 * (prev + self.arg1) + 1.0 / 3 * (prev + self.arg2) + return pt1, pt2, prev + self.arg2 + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg2 + prev + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> quadratic: + return quadratic(-self.arg2 + self.arg1, -self.arg2) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[quadratic, quadratic]: + return self._relsplit(prev, prev_control, t) + + +class TepidQuadratic(QuadraticMixin, AbsolutePathCommand): + """Continued Quadratic Line segment""" + + letter = "T" + nargs = 2 + + arg1: complex + """The (absolute) control point""" + + @property + def x3(self) -> float: + """x coordinate of the (absolute) end point""" + return self.arg1.real + + @property + def y3(self) -> float: + """y coordinate of the (absolute) end point""" + return self.arg1.imag + + @property + def args(self): + return self.x3, self.y3 + + @overload + def __init__(self, x3: ComplexLike): ... + + @overload + def __init__(self, x3: float, y3: float): ... + + def __init__(self, x3, y3=None): + if y3 is not None: + self.arg1 = x3 + y3 * 1j + else: + self.arg1 = complex(x3) + + def update_bounding_box(self, first, last_two_points, bbox): + self.to_quadratic(last_two_points[-1], last_two_points[-2]).update_bounding_box( + first, last_two_points, bbox + ) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (2 * prev - prev_prev, self.arg1) + + def to_non_shorthand( + self, prev: ComplexLike, prev_control: ComplexLike + ) -> Quadratic: + return self.to_quadratic(prev, prev_control) + + def to_relative(self, prev: ComplexLike) -> tepidQuadratic: + return tepidQuadratic(self.arg1 - prev) + + def transform(self, transform: Transform) -> TepidQuadratic: + return TepidQuadratic(transform.capply_to_point(self.arg1)) + + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + qp1 = 2 * prev - prev_prev + qp2 = self.arg1 + pt1 = 1.0 / 3 * prev + 2.0 / 3 * qp1 + pt2 = 2.0 / 3 * qp1 + 1.0 / 3 * qp2 + return pt1, pt2, qp2 + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg1 + + def to_quadratic(self, prev: ComplexLike, prev_prev: ComplexLike) -> Quadratic: + """Convert this continued quadratic into a full quadratic""" + return Quadratic( + *self.ccontrol_points(complex(prev), complex(prev), complex(prev_prev)) + ) + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> TepidQuadratic: + return TepidQuadratic(prev) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[Quadratic, Quadratic]: + return self._abssplit(prev, prev_control, t) + + +class tepidQuadratic(QuadraticMixin, RelativePathCommand): # pylint: disable=invalid-name + """Relative continued quadratic line segment""" + + letter = "t" + nargs = 2 + + arg1: complex + """The (relative) control point""" + + @property + def dx3(self) -> float: + """x coordinate of the (relative) end point""" + return self.arg1.real + + @property + def dy3(self) -> float: + """y coordinate of the (relative) end point""" + return self.arg1.imag + + @property + def args(self): + return self.dx3, self.dy3 + + @overload + def __init__(self, dx3: ComplexLike): ... + + @overload + def __init__(self, dx3: float, dy3: float): ... + + def __init__(self, dx3, dy3=None): + if dy3 is not None: + self.arg1 = dx3 + dy3 * 1j + else: + self.arg1 = complex(dx3) + + def ccontrol_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + return (2 * prev - prev_prev, self.arg1 + prev) + + def ccurve_points( + self, first: complex, prev: complex, prev_prev: complex + ) -> Tuple[complex, ...]: + qp1 = 2 * prev - prev_prev + qp2 = self.arg1 + prev + pt1 = 1.0 / 3 * prev + 2.0 / 3 * qp1 + pt2 = 2.0 / 3 * qp1 + 1.0 / 3 * qp2 + return pt1, pt2, qp2 + + def to_absolute(self, prev: ComplexLike) -> TepidQuadratic: + return TepidQuadratic(self.arg1 + prev) + + def to_non_shorthand( + self, prev: ComplexLike, prev_control: ComplexLike + ) -> Quadratic: + return self.to_absolute(prev).to_non_shorthand(prev, prev_control) + + def cend_point(self, first: complex, prev: complex) -> complex: + return self.arg1 + prev + + def reverse(self, first: ComplexLike, prev: ComplexLike) -> tepidQuadratic: + return tepidQuadratic(-self.arg1) + + def _split( + self, first: complex, prev: complex, prev_control: complex, t: float + ) -> Tuple[quadratic, quadratic]: + return self._relsplit(prev, prev_control, t) diff --git a/extensions/botbox3000/deps/inkex/ports.py b/extensions/botbox3000/deps/inkex/ports.py new file mode 100644 index 0000000..7595231 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/ports.py @@ -0,0 +1,105 @@ +# coding=utf-8 +# +# Copyright (C) 2019 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Common access to serial and other computer ports. +""" + +import os +import sys +import time +from .utils import DependencyError, AbortExtension + +try: + import serial + from serial.tools import list_ports +except ImportError: + serial = None + + +class Serial: + """ + Attempt to get access to the computer's serial port. + + with Serial(port_name, ...) as com: + com.write(...) + + Provides access to the debug/testing ports which are pretend ports + able to accept the same input but allow for debugging. + """ + + def __init__(self, port, baud=9600, timeout=0.1, **options): + self.test = port == "[test]" + if self.test: + import pty # This does not work on windows #pylint: disable=import-outside-toplevel + + self.controller, self.peripheral = pty.openpty() + port = os.ttyname(self.peripheral) + + self.has_serial() + self.com = serial.Serial() + self.com.port = port + self.com.baudrate = int(baud) + self.com.timeout = timeout + self.set_options(**options) + + def set_options(self, stop=1, size=8, flow=None, parity=None): + """Set further options on the serial port""" + size = {5: "five", 6: "six", 7: "seven", 8: "eight"}.get(size, size) + stop = {"onepointfive": 1.5}.get(stop.lower(), stop) + stop = {1: "one", 1.5: "one_point_five", 2: "two"}.get(stop, stop) + self.com.bytesize = getattr(serial, str(str(size).upper()) + "BITS") + self.com.stopbits = getattr(serial, "STOPBITS_" + str(stop).upper()) + self.com.parity = getattr(serial, "PARITY_" + str(parity).upper()) + # set flow control + self.com.xonxoff = flow == "xonxoff" + self.com.rtscts = flow in ("rtscts", "dsrdtrrtscts") + self.com.dsrdtr = flow == "dsrdtrrtscts" + + def __enter__(self): + try: + # try to establish connection + self.com.open() + except serial.SerialException as error: + raise AbortExtension( + "Could not open serial port. Please check your device" + " is running, connected and the settings are correct" + ) from error + return self.com + + def __exit__(self, exc, value, traceback): + if not traceback and self.test: + output = " " * 1024 + while len(output) == 1024: + time.sleep(0.01) + output = os.read(self.controller, 1024) + sys.stderr.write(output.decode("utf8")) + # self.com.read(2) + self.com.close() + + @staticmethod + def has_serial(): + """Late importing of pySerial module""" + if serial is None: + raise DependencyError("pySerial is required to open serial ports.") + + @staticmethod + def list_ports(): + """Return a list of available serial ports""" + Serial.has_serial() # Cause DependencyError error + return [hw.name for hw in list_ports.comports(True)] diff --git a/extensions/botbox3000/deps/inkex/properties.py b/extensions/botbox3000/deps/inkex/properties.py new file mode 100644 index 0000000..b6e12f8 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/properties.py @@ -0,0 +1,956 @@ +# coding=utf-8 +# +# Copyright (C) 2021 Jonathan Neuhauser, jonathan.neuhauser@outlook.com +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Property management and parsing, CSS cascading, default value storage + +.. versionadded:: 1.2 + +.. data:: all_properties + + A list of all properties, their parser class, and additional information + such as whether they are inheritable or can be given as presentation attributes +""" + +from __future__ import annotations +from abc import ABC, abstractmethod +from dataclasses import dataclass + +from typing import ( + Dict, + List, + Optional, + TYPE_CHECKING, + cast, +) +import tinycss2 +import tinycss2.ast + +from .units import convert_unit +from .utils import FragmentError + +from .colors import Color + +if TYPE_CHECKING: + from .elements import BaseElement + +from .elements import _base + +TokenList = List[tinycss2.ast.Node] + + +def _make_number_token_dimless(token): + if isinstance(token, (tinycss2.ast.NumberToken, tinycss2.ast.PercentageToken)): + return token.value + if isinstance(token, tinycss2.ast.DimensionToken): + return convert_unit(token.serialize(), "px") + raise ValueError("Not a number") + + +def _get_tokens_from_value(value: str) -> TokenList: + return tinycss2.parse_one_declaration(f"a:{value}").value + + +def _is_ws(token: tinycss2.ast.Node) -> bool: + return isinstance(token, tinycss2.ast.WhitespaceToken) + + +def _strip_whitespace_nodes(value: TokenList) -> TokenList: + try: + while _is_ws(value[0]): + del value[0] + while _is_ws(value[-1]): + del value[-1] + return value + except IndexError: + return [] + + +def _is_inherit(value: TokenList | None) -> bool: + return ( + value is not None + and len(value) == 1 + and isinstance(value[0], tinycss2.ast.IdentToken) + and value[0].value == "inherit" + ) + + +class _StyleConverter: + """Converter between str and computed value of a style, with context element""" + + # pylint: disable=unused-argument + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + """Get parsed property value with resolved urls, color, etc. + + Args: + element (BaseElement): the SVG element to which this style is applied to + currently used for resolving gradients / masks, could be used for + computing percentage attributes or calc() attributes [optional] + + Returns: + object: parsed property value + """ + return tinycss2.serialize(value) + + def raise_invalid_value( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> None: + """Checks if the value str is valid in the context of element. + + Args: + value (str): attribute value + element (Optional[BaseElement], optional): Context element. Defaults to + None. + + Raises: + various exceptions if the property has a bad value + """ + self.convert(value, element) + + def convert_back( + self, value: object, element: Optional[BaseElement] = None + ) -> TokenList: + """Converts value back to string in the context of element. + + Args: + value (object): parsed value of attribute + element (_type_, optional): Context element. Defaults to None. + + Returns: + str: _description_ + """ + return _get_tokens_from_value(str(value)) + + +class _AlphaValueConverter(_StyleConverter): + """Stores an alpha value (such as opacity), which may be specified as + as percentage or absolute value. + + Reference: https://www.w3.org/TR/css-color/#typedef-alpha-value""" + + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + if isinstance(value[0], tinycss2.ast.NumberToken): + parsed_value = value[0].value + elif isinstance(value[0], tinycss2.ast.PercentageToken): + parsed_value = value[0].value / 100 + else: + raise ValueError() + return min(max(parsed_value, 0), 1) + + def convert_back( + self, value: object, element: Optional[BaseElement] = None + ) -> TokenList: + if isinstance(value, (float, int)): + value = min(max(value, 0), 1) + return [tinycss2.ast.NumberToken(0, 0, value, value, f"{value}")] + raise ValueError("Value must be number") + + +class _ColorValueConverter(_StyleConverter): + """Converts a color value + + Reference: https://drafts.csswg.org/css-color-3/#valuea-def-color""" + + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + # Process this as string + vstr = _StyleConverter.convert(self, value, element) + if vstr == "currentColor": + if element is not None: + return element.get_computed_style("color") + return None + return Color(vstr) + + +class _URLNoneValueConverter(_StyleConverter): + """Converts a value that is either none or an url, such as markers or masks. + + Reference: https://www.w3.org/TR/SVG2/painting.html#VertexMarkerProperties""" + + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + if len(value) == 0: + return None + value = value[0] + if isinstance(value, tinycss2.ast.URLToken): + if element is not None and self.element_has_root(element): + return element.root.getElementById(value.value) + return value.serialize() + if isinstance(value, tinycss2.ast.IdentToken): + return None + + raise ValueError("Invalid property value") + + def convert_back( + self, value: object, element: Optional[BaseElement] = None + ) -> TokenList: + if isinstance(value, _base.BaseElement): + if element is not None: + value = _URLNoneValueConverter._insert_if_necessary(element, value) + return [tinycss2.ast.URLToken(0, 0, value.get_id(), value.get_id(as_url=2))] + return [tinycss2.ast.IdentToken(0, 0, "none")] + + @staticmethod + def element_has_root(element) -> bool: + "Checks if an element has a root" + try: + _ = element.root + return True + except FragmentError: + return False + + @staticmethod + def _insert_if_necessary(element: BaseElement, value: BaseElement) -> BaseElement: + """Ensures that the return (value or a deep copy of it) is inside the same + document as element. + + if element is unrooted, don't do anything (just return value) + If element is attached to the same document as value, return value. + If value is not attached to a document, attach it to the defs of element's + document and return value. + If value is already attached to another document, create a copy and return the + copy. + + .. versionadded:: 1.4""" + # Check if the element is rooted and has the same root as self.element. + try: + _ = element.root + try: + if value.root != element.root: + # Create a copy and attach it to the tree. + copy = value.copy() + element.root.defs.append(copy) + return copy + except FragmentError: + element.root.defs.append(value) + return value + + except FragmentError: + pass + return value + + +class _PaintValueConverter(_ColorValueConverter, _URLNoneValueConverter): + """Stores a paint value (such as fill and stroke), which may be specified + as color, or url. + + Reference: https://www.w3.org/TR/SVG2/painting.html#SpecifyingPaint""" + + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + v0 = value[0] + if isinstance(v0, tinycss2.ast.IdentToken): + if v0.value == "none": + return None + if v0.value == "currentColor": + return _ColorValueConverter.convert(self, value, element) + if v0.value in ["context-fill", "context-stroke"]: + return v0.value + else: + return Color(v0.value) + + if isinstance(v0, tinycss2.ast.HashToken): + return Color("#" + v0.value) + if isinstance(v0, tinycss2.ast.URLToken): + if element is not None and self.element_has_root(element): + paint_server = element.root.getElementById(v0.value[1:]) + else: + return None + if paint_server is not None: + return paint_server + for i in value[1:]: + if isinstance(i, tinycss2.ast.IdentToken): + return Color(i.value) + raise ValueError("Paint server not found") + if isinstance(v0, tinycss2.ast.FunctionBlock) and v0.name in [ + "rgb", + "rgba", + "hsl", + "hsla", + ]: + arguments = [str(argument.value) for argument in v0.arguments] + return Color(f"{v0.name}({''.join(arguments)})") + raise ValueError("Unknown color specification") + + def convert_back( + self, value: object, element: Optional[BaseElement] = None + ) -> TokenList: + if value is None: + return [tinycss2.ast.IdentToken(0, 0, "none")] + if isinstance(value, _base.BaseElement): + return _URLNoneValueConverter.convert_back(self, value, element=element) + return _ColorValueConverter.convert_back(self, value, element=element) + + +class _EnumValueConverter(_StyleConverter): + """Stores a value that can only have a finite set of options""" + + def __init__(self, options): + self.options = options + + def raise_invalid_value( + self, value: TokenList, element: BaseElement | None = None + ) -> None: + if tinycss2.serialize(value) not in self.options: + raise ValueError( + f"Value '{tinycss2.serialize(value)}' is invalid for the property" + ) + + +class _ShorthandValueConverter(_StyleConverter): + """Stores a value that sets other values (e.g. the font shorthand)""" + + def __init__(self, keys) -> None: + super().__init__() + + self.keys = keys + + @abstractmethod + def get_shorthand_changes(self, value) -> Dict[str, str]: + """calculates the value of affected attributes for this shorthand + + Returns: + Dict[str, str]: a dictionary containing the new values of the + affected attributes + """ + + +class _FontValueShorthandConverter(_ShorthandValueConverter): + """Logic for the shorthand font property""" + + def __init__(self) -> None: + super().__init__( + [ + "font-style", + "font-variant", + "font-weight", + "font-stretch", + "font-size", + "line-height", + "font-family", + ] + ) + self.options = { + key: all_properties[key].converter.options # type: ignore + for key in self.keys + if isinstance(all_properties[key].converter, _EnumValueConverter) + } + # Font stretch can be specified in percent, but for the + # shorthand, only a keyword value is allowed + self.options["font-stretch"] = ( + "normal", + "ultra-condensed", + "extra-condensed", + "condensed", + "semi-condensed", + "semi-expanded", + "expanded", + "extra-expanded", + "ultra-expanded", + ) + + def get_shorthand_changes(self, value): + result = {key: all_properties[key].default_value for key in self.keys} + + if len(value) == 0: + return result # shorthand not set, nothing to do + i = 0 + while i < len(value): + cur = value[i] + matched = False + if isinstance(cur, tinycss2.ast.IdentToken): + matched = True + if cur.value in self.options["font-style"]: + result["font-style"] = [cur] + elif cur.value in self.options["font-variant"]: + result["font-variant"] = [cur] + elif cur.value in self.options["font-weight"]: + result["font-weight"] = [cur] + elif cur.value in self.options["font-stretch"]: + result["font-stretch"] = [cur] + else: + matched = False + if not matched and not isinstance(cur, tinycss2.ast.WhitespaceToken): + result["font-size"] = [cur] + if ( + len(value) > i + 1 + and isinstance(value[i + 1], tinycss2.ast.LiteralToken) + and value[i + 1].value == "/" + ): + result["line-height"] = [value[i + 2]] + i += 2 + if len(value[i + 1 :]) > 0: + result["font-family"] = _strip_whitespace_nodes(value[i + 1 :]) + break + i += 1 + return result + + +class _TextDecorationValueConverter(_ShorthandValueConverter): + """Logic for the shorthand font property + + .. versionadded:: 1.3""" + + def __init__(self): + super().__init__( + ["text-decoration-style", "text-decoration-color", "text-decoration-line"] + ) + self.options = { + "text-decoration-" + key: all_properties[ + "text-decoration-" + key + ].converter.options + for key in ("line", "style", "color") + if isinstance( + all_properties["text-decoration-" + key].converter, _EnumValueConverter + ) + } + + def get_shorthand_changes(self, value): + result = { + "text-decoration-style": all_properties[ + "text-decoration-style" + ].default_value, + "text-decoration-color": _get_tokens_from_value("currentcolor"), + "text-decoration-line": [], + } + + for token, cur in list((i, i.serialize()) for i in value): + if cur in ["underline", "overline", "line-through", "blink"]: + result["text-decoration-line"].extend( + [token, tinycss2.ast.WhitespaceToken(0, 0, value=" ")] + ) + elif cur in self.options["text-decoration-style"]: + result["text-decoration-style"] = [token] + elif cur.strip(): + result["text-decoration-color"] = [token] + + if len(result["text-decoration-line"]) == 0: + result["text-decoration-line"] = all_properties[ + "text-decoration-line" + ].default_value + else: + result["text-decoration-line"] = result["text-decoration-line"][:-1] + + return result + + +class _MarkerShorthandValueConverter(_ShorthandValueConverter, _URLNoneValueConverter): + """Logic for the marker shorthand property""" + + def __init__(self) -> None: + super().__init__(["marker-start", "marker-end", "marker-mid"]) + + def get_shorthand_changes(self, value): + if value == "": + return {} # shorthand not set, nothing to do + return {k: value for k in self.keys} + + def convert_back( + self, value: object, element: Optional[BaseElement] = None + ) -> TokenList: + """Convert value back to a tokenlist""" + return _URLNoneValueConverter.convert_back(self, value, element) + + +class _FontSizeValueConverter(_StyleConverter): + """Logic for the font-size property""" + + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + v0 = value[0].serialize() + if element is None: + return v0 # no additional logic in this case + if isinstance( + value[0], + ( + tinycss2.ast.NumberToken, + tinycss2.ast.PercentageToken, + tinycss2.ast.DimensionToken, + ), + ): + return element.to_dimensionless(v0) + # unable to parse font size, e.g. font-size:normal + return v0 + + +class _StrokeDasharrayValueConverter(_StyleConverter): + """Logic for the stroke-dasharray property""" + + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + dashes = [] + i = 0 + for i, el in enumerate(value): + if ( + i == 0 + and isinstance(el, tinycss2.ast.IdentToken) + and el.value == "none" + ): + return [] + # whitespace or comma separated list + if isinstance(el, (tinycss2.ast.WhitespaceToken)) or ( + isinstance(el, tinycss2.ast.LiteralToken) and el.value == "," + ): + continue + if isinstance(el, (tinycss2.ast.DimensionToken, tinycss2.ast.NumberToken)): + dashes.append(_make_number_token_dimless(el)) + else: + return [] + if any(i < 0 for i in dashes): + # one negative value makes the dasharray invalid + return [] + if len(dashes) % 2 == 1: + dashes = 2 * dashes + return dashes + + def convert_back( + self, value: object, element: Optional[BaseElement] = None + ) -> TokenList: + if value is None or not value: + value = "none" + if isinstance(value, list): + if len(value) == 0: + value = "none" + else: + value = " ".join(map(str, value)) + return _get_tokens_from_value(str(value)) + + +class _FilterListConverter(_URLNoneValueConverter): + """Stores a list of Filters + + .. versionadded:: 1.4""" + + def convert( + self, value: TokenList, element: Optional[BaseElement] = None + ) -> object: + if element is None or value == "none": + return [] + + try: + result = [ + element.root.getElementById(item.value) + for item in value + if isinstance(item, tinycss2.ast.URLToken) + ] + return [i for i in result if i is not None] + except FragmentError: + return [ + item.serialize() + for item in value + if isinstance(item, tinycss2.ast.URLToken) + ] + except ValueError: # broken link + return [] + + def convert_back( + self, value: object, element: Optional[BaseElement] = None + ) -> TokenList: + if isinstance(value, _base.BaseElement) or not isinstance(value, (list, tuple)): + value = [value] + if all((isinstance(i, str) for i in value)): + return _get_tokens_from_value(" ".join(value)) # type: ignore + assert element is not None + value = cast("List[BaseElement]", value) + try: + _ = element.root + for i in value: + if i is None: + continue + # insert the element + inserted = self._insert_if_necessary(element, cast("BaseElement", i)) + # if a copy was created, replace the original in the list with the copy + if inserted is not i: + for index, item in enumerate(value): + if item is i: + value[index] = inserted + except FragmentError: + # Element is unrooted, we skip this step. + pass + return _get_tokens_from_value( + " ".join(f"url(#{i.get_id()})" for i in value if i is not None) + ) + + +@dataclass +class PropertyDescription: + """Describes a CSS / presentation attribute""" + + name: str + converter: _StyleConverter + default_value: TokenList + presentation: bool + inherited: bool + + def __init__( + self, + name: str, + converter: _StyleConverter, + default_value: str, + presentation: bool = False, + inherited: bool = False, + ): + self.presentation = presentation + self.inherited = inherited + self.default_value = _get_tokens_from_value(default_value) + self.name = name + self.converter = converter + + +# Source for this list: https://www.w3.org/TR/SVG2/styling.html#PresentationAttributes +properties_list: List[PropertyDescription] = [ + PropertyDescription( + "alignment-baseline", + _EnumValueConverter( + [ + "baseline", + "text-bottom", + "alphabetic", + "ideographic", + "middle", + "central", + "mathematical", + "text-top", + ] + ), + "baseline", + True, + False, + ), + PropertyDescription("baseline-shift", _StyleConverter(), "0", True, False), + PropertyDescription("clip", _StyleConverter(), "auto", True, False), + PropertyDescription("clip-path", _URLNoneValueConverter(), "none", True, False), + PropertyDescription( + "clip-rule", _EnumValueConverter(["nonzero", "evenodd"]), "nonzero", True, True + ), + PropertyDescription("color", _PaintValueConverter(), "black", True, True), + PropertyDescription( + "color-interpolation", + _EnumValueConverter(["sRGB", "auto", "linearRGB"]), + "sRGB", + True, + True, + ), + PropertyDescription( + "color-interpolation-filters", + _EnumValueConverter(["auto", "sRGB", "linearRGB"]), + "linearRGB", + True, + True, + ), + PropertyDescription( + "color-rendering", + _EnumValueConverter( + ["auto", "optimizeSpeed", "optimizeQuality", "pixelated", "crisp-edges"] + ), + "auto", + True, + True, + ), + PropertyDescription("cursor", _StyleConverter(), "auto", True, True), + PropertyDescription( + "direction", _EnumValueConverter(["ltr", "rtl"]), "ltr", True, True + ), + PropertyDescription( + "display", + _EnumValueConverter( + [ + "inline", + "block", + "list-item", + "inline-block", + "table", + "inline-table", + "table-row-group", + "table-header-group", + "table-footer-group", + "table-row", + "table-column-group", + "table-column", + "table-cell", + "table-caption", + "none", + ] + ), + "inline", + True, + False, + ), + PropertyDescription( + "dominant-baseline", + _EnumValueConverter( + [ + "auto", + "text-bottom", + "alphabetic", + "ideographic", + "middle", + "central", + "mathematical", + "hanging", + "text-top", + ] + ), + "auto", + True, + True, + ), + PropertyDescription("fill", _PaintValueConverter(), "black", True, True), + PropertyDescription("fill-opacity", _AlphaValueConverter(), "1", True, True), + PropertyDescription( + "fill-rule", _EnumValueConverter(["nonzero", "evenodd"]), "nonzero", True, True + ), + PropertyDescription("filter", _FilterListConverter(), "none", True, False), + PropertyDescription("flood-color", _PaintValueConverter(), "black", True, False), + PropertyDescription("flood-opacity", _AlphaValueConverter(), "1", True, False), + PropertyDescription("font-family", _StyleConverter(), "sans-serif", True, True), + PropertyDescription("font-size", _FontSizeValueConverter(), "medium", True, True), + PropertyDescription("font-size-adjust", _StyleConverter(), "none", True, True), + PropertyDescription("font-stretch", _StyleConverter(), "normal", True, True), + PropertyDescription( + "font-style", + _EnumValueConverter(["normal", "italic", "oblique"]), + "normal", + True, + True, + ), + PropertyDescription( + "font-variant", + _EnumValueConverter(["normal", "small-caps"]), + "normal", + True, + True, + ), + PropertyDescription( + "font-weight", + _EnumValueConverter( + ["normal", "bold"] + [str(i) for i in range(100, 901, 100)] + ), + "normal", + True, + True, + ), + PropertyDescription( + "glyph-orientation-horizontal", _StyleConverter(), "0deg", True, True + ), + PropertyDescription( + "glyph-orientation-vertical", _StyleConverter(), "auto", True, True + ), + PropertyDescription("inline-size", _StyleConverter(), "0", False, False), + PropertyDescription( + "image-rendering", + _EnumValueConverter(["auto", "optimizeQuality", "optimizeSpeed"]), + "auto", + True, + True, + ), + PropertyDescription("letter-spacing", _StyleConverter(), "normal", True, True), + PropertyDescription( + "lighting-color", _ColorValueConverter(), "normal", True, False + ), + PropertyDescription("line-height", _StyleConverter(), "normal", False, True), + PropertyDescription("marker", _MarkerShorthandValueConverter(), ""), + PropertyDescription("marker-end", _URLNoneValueConverter(), "none", True, True), + PropertyDescription("marker-mid", _URLNoneValueConverter(), "none", True, True), + PropertyDescription("marker-start", _URLNoneValueConverter(), "none", True, True), + PropertyDescription("mask", _URLNoneValueConverter(), "none", True, False), + PropertyDescription("opacity", _AlphaValueConverter(), "1", True, False), + PropertyDescription( + "overflow", + _EnumValueConverter(["visible", "hidden", "scroll", "auto"]), + "visible", + True, + False, + ), + PropertyDescription("paint-order", _StyleConverter(), "normal", True, False), + PropertyDescription( + "pointer-events", + _EnumValueConverter( + [ + "bounding-box", + "visiblePainted", + "visibleFill", + "visibleStroke", + "visible", + "painted", + "fill", + "stroke", + "all", + "none", + ] + ), + "visiblePainted", + True, + True, + ), + PropertyDescription("shape-inside", _URLNoneValueConverter(), "none", False, False), + PropertyDescription( + "shape-rendering", + _EnumValueConverter( + ["auto", "optimizeSpeed", "crispEdges", "geometricPrecision"] + ), + "visiblePainted", + True, + True, + ), + PropertyDescription("stop-color", _ColorValueConverter(), "black", True, False), + PropertyDescription("stop-opacity", _AlphaValueConverter(), "1", True, False), + PropertyDescription("stroke", _PaintValueConverter(), "none", True, True), + PropertyDescription( + "stroke-dasharray", _StrokeDasharrayValueConverter(), "none", True, True + ), + PropertyDescription("stroke-dashoffset", _StyleConverter(), "0", True, True), + PropertyDescription( + "stroke-linecap", + _EnumValueConverter(["butt", "round", "square"]), + "butt", + True, + True, + ), + PropertyDescription( + "stroke-linejoin", + _EnumValueConverter(["miter", "miter-clip", "round", "bevel", "arcs"]), + "miter", + True, + True, + ), + PropertyDescription("stroke-miterlimit", _StyleConverter(), "4", True, True), + PropertyDescription("stroke-opacity", _AlphaValueConverter(), "1", True, True), + PropertyDescription("stroke-width", _StyleConverter(), "1", True, True), + PropertyDescription("text-align", _StyleConverter(), "start", True, True), + PropertyDescription( + "text-anchor", + _EnumValueConverter(["start", "middle", "end"]), + "start", + True, + True, + ), + PropertyDescription( + "text-decoration-line", _StyleConverter(), "none", False, False + ), + PropertyDescription( + "text-decoration-style", + _EnumValueConverter(["solid", "double", "dotted", "dashed", "wavy"]), + "solid", + False, + False, + ), + PropertyDescription( + "text-decoration-color", _StyleConverter(), "currentcolor", False, False + ), + PropertyDescription( + "text-overflow", _EnumValueConverter(["clip", "ellipsis"]), "clip", True, False + ), + PropertyDescription( + "text-rendering", + _EnumValueConverter( + ["auto", "optimizeSpeed", "optimizeLegibility", "geometricPrecision"] + ), + "auto", + True, + True, + ), + PropertyDescription( + "unicode-bidi", + _EnumValueConverter( + [ + "normal", + "embed", + "isolate", + "bidi-override", + "isolate-override", + "plaintext", + ] + ), + "normal", + True, + False, + ), + PropertyDescription("vector-effect", _StyleConverter(), "none", True, False), + PropertyDescription("vertical-align", _StyleConverter(), "baseline", False, False), + PropertyDescription( + "visibility", + _EnumValueConverter(["visible", "hidden", "collapse"]), + "visible", + True, + True, + ), + PropertyDescription( + "white-space", + _EnumValueConverter( + ["normal", "pre", "nowrap", "pre-wrap", "break-spaces", "pre-line"] + ), + "normal", + True, + True, + ), + PropertyDescription("word-spacing", _StyleConverter(), "normal", True, True), + PropertyDescription( + "writing-mode", + _EnumValueConverter( + [ + "horizontal-tb", + "vertical-rl", + "vertical-lr", + "lr", + "lr-tb", + "rl", + "rl-tb", + "tb", + "tb-rl", + ] + ), + "horizontal-tb", + True, + True, + ), + PropertyDescription( + "-inkscape-font-specification", _StyleConverter(), "sans-serif", False, True + ), +] +all_properties = {v.name: v for v in properties_list} + +properties_list += [ + PropertyDescription("font", _FontValueShorthandConverter(), ""), + PropertyDescription("text-decoration", _TextDecorationValueConverter(), ""), +] + +all_properties["font"] = properties_list[-2] +all_properties["text-decoration"] = properties_list[-1] + +shorthand_from_value = { + item: prop.name + for prop in properties_list + if isinstance(prop.converter, _ShorthandValueConverter) + for item in prop.converter.keys +} + +shorthand_properties = { + i.name: i + for i in properties_list + if isinstance(i.converter, _ShorthandValueConverter) +} diff --git a/extensions/botbox3000/deps/inkex/py.typed b/extensions/botbox3000/deps/inkex/py.typed new file mode 100644 index 0000000..e69de29 diff --git a/extensions/botbox3000/deps/inkex/styles.py b/extensions/botbox3000/deps/inkex/styles.py new file mode 100644 index 0000000..e13cecc --- /dev/null +++ b/extensions/botbox3000/deps/inkex/styles.py @@ -0,0 +1,756 @@ +# coding=utf-8 +# +# Copyright (C) 2005 Aaron Spike, aaron@ekips.org +# 2019-2020 Martin Owens +# 2021 Jonathan Neuhauser, jonathan.neuhauser@outlook.com +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Functions for handling styles and embedded css +""" + +from __future__ import annotations + +import re +from dataclasses import dataclass +from typing import Optional, Generator, TYPE_CHECKING, Tuple +from lxml import etree +import tinycss2 +import tinycss2.ast + +from .colors import Color +from .properties import ( + _get_tokens_from_value, + _is_inherit, + all_properties, + shorthand_from_value, + shorthand_properties, + TokenList, + _strip_whitespace_nodes, +) +from .css import CSSCompiler, parser + +from .utils import FragmentError, NotifyList, NotifyOrderedDict +from .elements._utils import NSS +from .elements import _base + +if TYPE_CHECKING: + from .elements._base import BaseElement + + +class Classes(NotifyList): + """A list of classes applied to an element (used in css and js)""" + + def __init__(self, classes=None, callback=None, element=None): + if isinstance(classes, str): + classes = classes.split() + super().__init__(classes or (), callback=callback) + + def __str__(self): + return " ".join(self) + + +@dataclass +class StyleValue: + """Encapsulates a single parsed style value + its importance state""" + + value: TokenList + important: bool = False + + def __str__(self): + return tinycss2.serialize(self.value) + ("!important" if self.important else "") + + def __eq__(self, other): + return ( + tinycss2.serialize(self.value) == tinycss2.serialize(other.value) + and self.important == other.important + ) + + def is_inherit(self): + """Checks if the value is "inherit" """ + return _is_inherit(self.value) + + +class Style(NotifyOrderedDict): + """A list of style directives + + .. versionchanged:: 1.2 + The Style API now allows for access to parsed / processed styles via the + :func:`call` method. + + .. automethod:: __call__ + .. automethod:: __getitem__ + .. automethod:: __setitem__ + """ + + color_props = ("stroke", "fill", "stop-color", "flood-color", "lighting-color") + opacity_props = ("stroke-opacity", "fill-opacity", "opacity", "stop-opacity") + unit_props = "stroke-width" + """Dictionary of attributes with units. + + ..versionadded:: 1.2 + """ + associated_props = { + "fill": "fill-opacity", + "stroke": "stroke-opacity", + "stop-color": "stop-opacity", + } + """Dictionary of association between color and opacity attributes. + + .. versionadded:: 1.2 + """ + + def __init__(self, style=None, callback=None, element=None, **kw): + self.callback = None + self.element = element + + # if style is passed as kwargs, replace underscores by dashes + style = style or [(k.replace("_", "-"), v) for k, v in kw.items()] + + self.update(style) + + # Should accept dict, Style, parsed string, list etc. + super().__init__(callback=callback) + + def _add(self, key: str, value: StyleValue): + # Works with both regular dictionaries and Styles + if key in shorthand_properties: + chg = shorthand_properties[key].converter.get_shorthand_changes(value.value) # type: ignore + for k, v in chg.items(): + self._add(k, StyleValue(v, value.important)) + else: + if key not in self or ( + not self.get_store(key).important or value.important + ): + # Only overwrite if importance of existing value is higher + super().__setitem__(key, value) + + def _get_val(self, key: str, value): + if key in all_properties and not isinstance(value, str): + return StyleValue( + all_properties[key].converter.convert_back(value, self.element) + ) + return StyleValue(_get_tokens_from_value(value)) + + def _attr_callback(self, key): + def inner(value): + self[key] = value + + return inner + + def _parse_str(self, style: str) -> Generator[Tuple[str, StyleValue], None, None]: + """Create a dictionary from the value of a CSS rule (such as an inline style or + from an embedded style sheet), including its !important state, in a tokenized + form. Whitespace tokens from the start and end of the value are stripped. + + Args: + style: the content of a CSS rule to parse. Can also be a List of + ComponentValues + + Yields: + Tuple[str, class:`~inkex.style.StyleValue`]: the parsed attribute + """ + result = tinycss2.parse_declaration_list( + style, skip_comments=True, skip_whitespace=True + ) + for declaration in result: + if isinstance(declaration, tinycss2.ast.Declaration): + yield ( + declaration.name, + StyleValue( + _strip_whitespace_nodes(declaration.value), + declaration.important, + ), + ) + + @staticmethod + def parse_str(style: str, element=None): + """Parse a style passed as string""" + return Style(style, element=element) + + def __str__(self): + """Format an inline style attribute from a dictionary""" + return self.to_str() + + def to_str(self, sep=";"): + """Convert to string using a custom delimiter""" + return sep.join([f"{key}:{value}" for key, value in self.items()]) + + def __add__(self, other): + """Add two styles together to get a third, composing them""" + ret = self.copy() + ret.update(Style(other)) + return ret + + def __iadd__(self, other): + """Add style to this style, the same as ``style.update(dict)``""" + self.update(other) + return self + + def __sub__(self, other): + """Remove keys and return copy""" + ret = self.copy() + ret.__isub__(other) + return ret + + def __isub__(self, other): + """Remove keys from this style, list of keys or other style dictionary""" + for key in other: + self.pop(key, None) + return self + + def __ne__(self, other): + return not self.__eq__(other) + + def copy(self): + """Create a copy of the style. + + .. versionadded:: 1.2""" + ret = Style({}, element=self.element) + for key, value in super().items(): + ret[key] = value + return ret + + def update(self, other): + """Update, while respecting ``!important`` declarations, and simplifying + shorthands""" + if isinstance(other, Style): + for k, v in super(NotifyOrderedDict, other).items(): + self._add(k, v) + # Order raw dictionaries so tests can be made reliable + elif isinstance(other, dict): + for k, v in sorted(other.items()): + self._add(k, self._get_val(k, v)) + + elif isinstance(other, list) and all(isinstance(i, tuple) for i in other): + for k, v in other: + self._add(k, self._get_val(k, v)) + + elif isinstance(other, str) or (isinstance(other, list)): + for k, v in self._parse_str(other): + self._add(k, v) + + def add_inherited(self, parent): + """Creates a new Style containing all parent styles with importance "!important" + and current styles with importance "!important" + + .. versionadded:: 1.2 + + Args: + parent: the parent style that will be merged into this one (will not be + altered) + + Returns: + Style: the merged Style object + """ + ret = self.copy() + + if not (isinstance(parent, Style)): + return ret + + for item in parent.keys(): + apply = False + if item in all_properties and all_properties[item].inherited: + # only set parent value if value is not set or parent importance is + # higher + if item not in ret or ( + not self.get_importance(item) and parent.get_importance(item) + ): + apply = True + if item in ret and ret.get_store(item).is_inherit(): + apply = True + if apply: + super(NotifyOrderedDict, ret).__setitem__(item, parent.get_store(item)) + return ret + + def __setitem__(self, key, value): + """Sets a style value. + + .. versionchanged:: 1.2 + ``value`` can now also be non-string objects such as a Gradient. + + Args: + key (str): the attribute name + value (Any): + + - a :class:`StyleValue` + - a TokenList (tokenized CSS value), + - a string with the value + - any other object. The converter associated with the provided key will + attempt to create a string out of the passed value. + Raises: + ValueError: when passing something else than string, StyleValue or TokenList + and key is not a known style attribute + Error: Other exceptions may be raised when converting non-string objects.""" + + if isinstance(value, StyleValue): + super().__setitem__(key, value) + return + if isinstance(value, str): + value = value.strip() + tokenized = _get_tokens_from_value(value) + + if key in all_properties: + all_properties[key].converter.raise_invalid_value( + tokenized, self.element + ) + value = tokenized + elif ( + isinstance(value, list) + and len(value) > 0 + and all(isinstance(i, tinycss2.ast.Node) for i in value) + ): + pass + elif key in all_properties: + value = all_properties[key].converter.convert_back(value, self.element) + else: + raise TypeError() + # Convert value to StyleValue + super().__setitem__(key, StyleValue(value, False)) + + def __getitem__(self, key): + """Returns the unparsed value of the element (minus a possible ``!important``) + + .. versionchanged:: 1.2 + ``!important`` is removed from the value. + """ + return tinycss2.serialize(super().__getitem__(key).value) + + def get(self, key, default=None): + try: + return self[key] + except KeyError: + return default + + def get_store(self, key): + """Gets the :class:`~inkex.properties.BaseStyleValue` of this key, since the + other interfaces - :func:`__getitem__` and :func:`__call__` - return the + original and parsed value, respectively. + + .. versionadded:: 1.2 + + Args: + key (str): the attribute name + + Returns: + BaseStyleValue: the BaseStyleValue struct of this attribute + """ + return super().__getitem__(key) + + def __call__(self, key: str, element: Optional[BaseElement] = None, default=None): + """Return the parsed value of a style. Optionally, an element can be passed + that will be used to find gradient definitions etc. + + .. versionadded:: 1.2""" + tmp = super().get(key, None) + v: None | TokenList = None if tmp is None else tmp.value + if (v is None and (key in all_properties or default is not None)) or ( + v is not None and _is_inherit(v) + ): # if the value is still inherit here, return the default + v = ( + _get_tokens_from_value(default) + if default is not None + else ( + all_properties[key].default_value if key in all_properties else None + ) + ) + if v is None: + return v + if v is not None: + if key in shorthand_properties: + return tinycss2.serialize(v) + if key in all_properties: + result = all_properties[key].converter.convert( + v, element or self.element + ) + else: + result = tinycss2.serialize(v) + if isinstance(result, list) and not isinstance(result, Color): + result = NotifyList(result, callback=self._attr_callback(key)) + return result + raise KeyError("Unknown attribute") + + def __eq__(self, other): + if not isinstance(other, Style): + other = Style(other) + if self.keys() != other.keys(): + return False + for arg in set(self) | set(other): + if self.get_store(arg) != other.get_store(arg): + return False + return True + + def items(self): + """The styles's items as string + + .. versionadded:: 1.2""" + for key, value in super().items(): + yield key, tinycss2.serialize(value.value) + + def get_importance(self, key, default=False): + """Returns whether the declaration with ``key`` is marked as ``!important`` + + .. versionadded:: 1.2""" + if key in self: + return self.get_store(key).important + return default + + def set_importance(self, key, importance): + """Sets the ``!important`` state of a declaration with key ``key`` + + .. versionadded:: 1.2""" + if key in self: + super().__getitem__(key).important = importance + else: + raise KeyError() + self._callback() + + def get_color(self, name="fill"): + """Get the color AND opacity as one Color object""" + color = Color(self.get(name, "none")) + color.alpha = float(self.get(name + "-opacity", 1.0)) + return color + + def set_color(self, color, name="fill"): + """Sets the given color AND opacity as rgba to the fill or stroke style + properties.""" + color = Color(color) + if color.alpha is not None and name in Style.associated_props: + self[Style.associated_props[name]] = color.alpha + color.alpha = None + self[name] = color + + def update_urls(self, old_id, new_id): + """Find urls in this style and replace them with the new id""" + for _, elem in super().items(): + for token in elem.value: + if ( + isinstance(token, tinycss2.ast.URLToken) + and token.value == f"#{old_id}" + ): + token.value = f"#{new_id}" + token.representation = f"url(#{new_id})" + self._callback() + + def interpolate(self, other, fraction): + # type: (Style, Style, float) -> Style + """Interpolate all properties. + + .. versionadded:: 1.1""" + from .tween import StyleInterpolator + from inkex.elements import PathElement + + if self.element is None: + self.element = PathElement(style=str(self)) + if other.element is None: + other.element = PathElement(style=str(other)) + return StyleInterpolator(self.element, other.element).interpolate(fraction) + + @classmethod + def cascaded_style(cls, element: BaseElement): + """Returns the cascaded style of an element (all rules that apply the element + itself), based on the stylesheets, the presentation attributes and the inline + style using the respective specificity of the style + + see https://www.w3.org/TR/CSS22/cascade.html#cascading-order + + .. versionadded:: 1.2 + + Args: + element (BaseElement): the element that the cascaded style will be + computed for + + Returns: + Style: the cascaded style + """ + try: + styles = list(element.root.stylesheets.lookup_specificity(element)) + except FragmentError: + styles = [] + + # presentation attributes have specificity 0, + # see https://www.w3.org/TR/SVG/styling.html#PresentationAttributes + styles.append([element.presentation_style(), (0, 0, 0)]) + + # would be (1, 0, 0, 0), but then we'd have to extend every entry + styles.append([element.style, (float("inf"), 0, 0)]) + + # sort styles by specificity (ascending, so when overwriting it's correct) + styles = sorted(styles, key=lambda item: item[1]) + + result = styles[0][0].copy() + for style, _ in styles[1:]: + result.update(style) + result.element = element + return result + + @classmethod + def specified_style(cls, element): + """Returns the specified style of an element, i.e. the cascaded style + + inheritance, see https://www.w3.org/TR/CSS22/cascade.html#specified-value + + .. versionadded:: 1.2 + + Args: + element (BaseElement): the element that the specified style will be computed + for + + Returns: + Style: the specified style + """ + + # We currently dont treat the case where parent=absolute value and + # element=relative value, i.e. specified = relative * absolute. + cascaded = Style.cascaded_style(element) + + parent = element.getparent() + + if parent is not None and isinstance(parent, _base.BaseElement): + cascaded = Style.add_inherited(cascaded, parent.specified_style()) + cascaded.element = element + return cascaded # doesn't have a parent + + @classmethod + def _get_cascade(cls, attribute: str, element: BaseElement) -> Optional[TokenList]: + if attribute in shorthand_from_value: + + def relevant(style): + return attribute in style or shorthand_from_value[attribute] in style + + else: + + def relevant(style): + return attribute in style + + try: + values = [] + for sheet in element.root.stylesheets: + for style in sheet: + if relevant(style): + value = style.get_store(attribute) + values += [ + (value, spec) for spec in style.get_specificities(element) + ] + except FragmentError: + values = [] + + # presentation attributes have specificity 0, + # see https://www.w3.org/TR/SVG/styling.html#PresentationAttributes + # they also cannot be shorthands and are always important=False + if attribute in element.attrib: + values.append( + ( + StyleValue( + _get_tokens_from_value(element.attrib[attribute]), + False, + ), + (0, 0, 0), + ) + ) + + if relevant(element.style): + values.append((element.style.get_store(attribute), (float("inf"), 0, 0))) + if len(values) == 0: + return None + # Sort according to importance, then specificity + values.sort(key=lambda item: (item[0].important, item[1])) + return values[-1][0].value + + @classmethod + def _get_style(cls, attribute: str, element: BaseElement): + """Specified style for :param:`attribute`""" + # The resolution order is: + # - cascade -> then resolve the value, except if the value is "inherit" + # - parent's computed value + # - initial (default) value -> then resolve + + result = None + current = element + inherited = ( + all_properties[attribute].inherited + if attribute in all_properties + else False + ) + while True: + result = cls._get_cascade(attribute, current) + if result is not None and not _is_inherit(result): + break + current = current.getparent() + if current is None or (not inherited and not _is_inherit(result)): + break + # Compute value based on current + if result is None or _is_inherit(result): # Fallback to default value + if attribute in all_properties: + result = all_properties[attribute].default_value + else: + return None + return ( + all_properties[attribute].converter.convert(result, current) + if attribute in all_properties + else tinycss2.serialize(result) + ) + + +class StyleSheets(list): + """ + Special mechanism which contains all the stylesheets for an svg document + while also caching lookups for specific elements. + + This caching is needed because data can't be attached to elements as they are + re-created on the fly by lxml so lookups have to be centralised. + """ + + def lookup(self, element): + """ + Find all styles for this element. + """ + for sheet in self: + for style in sheet.lookup(element): + yield style + + def lookup_specificity(self, element): + """ + Find all styles for this element and return the specificity of the match. + + .. versionadded:: 1.2 + """ + for sheet in self: + for style in sheet.lookup_specificity(element): + yield style + + +class StyleSheet(list): + """ + A style sheet, usually the CDATA contents of a style tag, but also + a css file used with a css. Will yield multiple Style() classes. + """ + + def __init__(self, content=None, callback=None): + super().__init__() + self.callback = None + # Remove comments + if content is None: + parsed = [] + else: + parsed = tinycss2.parse_stylesheet( + content, skip_comments=True, skip_whitespace=True + ) + # Parse rules + for block in parsed: + if isinstance(block, tinycss2.ast.QualifiedRule): + self.append(block) + self.callback = callback + + def __str__(self): + return "\n" + "\n".join([str(style) for style in self]) + "\n" + + def _callback(self, style=None): # pylint: disable=unused-argument + if self.callback is not None: + self.callback(self) + + def add(self, rule, style): + """Append a rule and style combo to this stylesheet""" + self.append( + ConditionalStyle(rules=rule, style=str(style), callback=self._callback) + ) + + def append(self, other: str | tinycss2.ast.QualifiedRule): + """Make sure callback is called when updating""" + if isinstance(other, str): + other = tinycss2.parse_one_rule(other) + if isinstance(other, tinycss2.ast.QualifiedRule): + other = ConditionalStyle( + other.prelude, other.content, callback=self._callback + ) + super().append(other) + self._callback() + + def lookup(self, element): + """Lookup the element against all the styles in this sheet""" + for style in self: + if any(style.checks(element)): + yield style + + def lookup_specificity(self, element): + """Lookup the element_id against all the styles in this sheet + and return the specificity of the match + + Args: + element: the element of the element that styles are being queried for + + Yields: + Tuple[ConditionalStyle, Tuple[int, int, int]]: all matched styles and the + specificity of the match + """ + for style in self: + for specificity in style.get_specificities(element): + yield (style, specificity) + + +class ConditionalStyle(Style): + """ + Just like a Style object, but includes one or more + conditional rules which places this style in a stylesheet + rather than being an attribute style. + """ + + def __init__( + self, rules: str | TokenList = "*", style=None, callback=None, **kwargs + ): + super().__init__(style=style, callback=callback, **kwargs) + self._rules: str | TokenList = rules + self.rules = list(parser.parse(rules, namespaces=NSS)) + self.checks = [ + CSSCompiler.compile_node(selector.parsed_tree) for selector in self.rules + ] + + def matches(self, element: etree.Element): + """Checks if an individual element matches this selector. + + .. versionadded:: 1.4""" + if isinstance(element, etree._Comment): + return False + if any(check(element) for check in self.checks): + return True + return False + + def all_matches(self, document: etree.Element): + """Get all matches of this selector in document as iterator. + + .. versionadded:: 1.4""" + for el in document.iter(): + if self.matches(el): + yield el + + def __str__(self): + """Return this style as a css entry with class""" + content = self.to_str(";\n ") + rules = ",\n".join(str(rule) for rule in self.rules) + if content: + return f"{rules} {{\n {content};\n}}" + return f"{rules} {{}}" + + def get_specificities(self, element: Optional[BaseElement] = None): + """Gets an iterator of the specificity of all rules in this ConditionalStyle + + .. versionadded:: 1.2""" + if element is not None: + for rule, check in zip(self.rules, self.checks): + if check(element): + yield rule.specificity + else: + for rule in self.rules: + yield rule.specificity diff --git a/extensions/botbox3000/deps/inkex/tester/__init__.py b/extensions/botbox3000/deps/inkex/tester/__init__.py new file mode 100644 index 0000000..78a5599 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/__init__.py @@ -0,0 +1,547 @@ +# coding=utf-8 +# +# Copyright (C) 2018-2019 Martin Owens +# 2019 Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110, USA. +# +""" +Testing module. See :ref:`unittests` for details. +""" + +import os +import re +import sys +import shutil +import tempfile +import hashlib +import random +import uuid +import io +from typing import List, Union, Tuple, Type, TYPE_CHECKING + +from io import BytesIO, StringIO +import xml.etree.ElementTree as xml + +from unittest import TestCase as BaseCase +from inkex.base import InkscapeExtension +from inkex.extensions import OutputExtension + +from .. import Transform, load_svg, SvgDocumentElement +from ..utils import to_bytes +from .xmldiff import xmldiff +from .mock import MockCommandMixin, Capture + +if TYPE_CHECKING: + from .filters import Compare + +COMPARE_DELETE, COMPARE_CHECK, COMPARE_WRITE, COMPARE_OVERWRITE = range(4) + + +class NoExtension(InkscapeExtension): # pylint: disable=too-few-public-methods + """Test case must specify 'self.effect_class' to assertEffect.""" + + def __init__(self, *args, **kwargs): # pylint: disable=super-init-not-called + raise NotImplementedError(self.__doc__) + + def run(self, args=None, output=None): + """Fake run""" + + +class TestCase(MockCommandMixin, BaseCase): + """ + Base class for all effects tests, provides access to data_files and + test_without_parameters + """ + + effect_class = NoExtension # type: Type[InkscapeExtension] + effect_name = property(lambda self: self.effect_class.__module__) + + # If set to true, the output is not expected to be the stdout SVG document, but + # rather text or a message sent to the stderr, this is highly weird. But sometimes + # happens. + stderr_output = False + stdout_protect = True + stderr_protect = True + + def __init__(self, *args, **kw): + super().__init__(*args, **kw) + self._temp_dir = None + self._effect = None + + def setUp(self): # pylint: disable=invalid-name + """Make sure every test is seeded the same way""" + self._effect = None + super().setUp() + random.seed(0x35F) + + def tearDown(self): + super().tearDown() + if self._temp_dir and os.path.isdir(self._temp_dir): + shutil.rmtree(self._temp_dir) + + @classmethod + def __file__(cls): + """Create a __file__ property which acts much like the module version""" + return os.path.abspath(sys.modules[cls.__module__].__file__) + + @classmethod + def _testdir(cls): + """Get's the folder where the test exists (so data can be found)""" + return os.path.dirname(cls.__file__()) + + @classmethod + def rootdir(cls): + """Return the full path to the extensions directory""" + return os.path.dirname(cls._testdir()) + + @classmethod + def datadir(cls): + """Get the data directory (can be over-ridden if needed)""" + return os.path.join(cls._testdir(), "data") + + @property + def tempdir(self): + """Generate a temporary location to store files""" + if self._temp_dir is None: + self._temp_dir = os.path.realpath(tempfile.mkdtemp(prefix="inkex-tests-")) + if not os.path.isdir(self._temp_dir): + raise IOError("The temporary directory has disappeared!") + return self._temp_dir + + def temp_file( + self, prefix="file-", template="{prefix}{name}{suffix}", suffix=".tmp" + ): + """Generate the filename of a temporary file""" + filename = template.format(prefix=prefix, suffix=suffix, name=uuid.uuid4().hex) + return os.path.join(self.tempdir, filename) + + @classmethod + def data_file(cls, filename, *parts, check_exists=True): + """Provide a data file from a filename, can accept directories as arguments. + + .. versionchanged:: 1.2 + ``check_exists`` parameter added""" + if os.path.isabs(filename): + # Absolute root was passed in, so we trust that (it might be a tempdir) + full_path = os.path.join(filename, *parts) + else: + # Otherwise we assume it's relative to the test data dir. + full_path = os.path.join(cls.datadir(), filename, *parts) + + if not os.path.isfile(full_path) and check_exists: + raise IOError(f"Can't find test data file: {full_path}") + return full_path + + @property + def empty_svg(self): + """Returns a common minimal svg file""" + return self.data_file("svg", "default-inkscape-SVG.svg") + + def assertAlmostTuple(self, found, expected, precision=8, msg=""): # pylint: disable=invalid-name + """ + Floating point results may vary with computer architecture; use + assertAlmostEqual to allow a tolerance in the result. + """ + self.assertEqual(len(found), len(expected), msg) + for fon, exp in zip(found, expected): + self.assertAlmostEqual(fon, exp, precision, msg) + + def assertEffectEmpty(self, effect, **kwargs): # pylint: disable=invalid-name + """Assert calling effect without any arguments""" + self.assertEffect(effect=effect, **kwargs) + + def assertEffect(self, *filename, **kwargs): # pylint: disable=invalid-name + """Assert an effect, capturing the output to stdout. + + filename should point to a starting svg document, default is empty_svg + """ + if filename: + data_file = self.data_file(*filename) + else: + data_file = self.empty_svg + + os.environ["DOCUMENT_PATH"] = data_file + args = [data_file] + list(kwargs.pop("args", [])) + args += [f"--{kw[0]}={kw[1]}" for kw in kwargs.items()] + + effect = kwargs.pop("effect", self.effect_class)() + + # Output is redirected to this string io buffer + if self.stderr_output: + with Capture("stderr") as stderr: + effect.run(args, output=BytesIO()) + effect.test_output = stderr + else: + output = BytesIO() + with Capture( + "stdout", kwargs.get("stdout_protect", self.stdout_protect) + ) as stdout: + with Capture( + "stderr", kwargs.get("stderr_protect", self.stderr_protect) + ) as stderr: + effect.run(args, output=output) + self.assertEqual( + "", stdout.getvalue(), "Extra print statements detected" + ) + self.assertEqual( + "", stderr.getvalue(), "Extra error or warnings detected" + ) + effect.test_output = output + + if os.environ.get("FAIL_ON_DEPRECATION", False): + warnings = getattr(effect, "warned_about", set()) + effect.warned_about = set() # reset for next test + self.assertFalse(warnings, "Deprecated API is still being used!") + + return effect + + # pylint: disable=invalid-name + def assertDeepAlmostEqual(self, first, second, places=None, msg=None, delta=None): + """Asserts that two objects, possible nested lists, are almost equal.""" + if delta is None and places is None: + places = 7 + if isinstance(first, (list, tuple)): + assert len(first) == len(second) + for f, s in zip(first, second): + self.assertDeepAlmostEqual(f, s, places, msg, delta) + else: + self.assertAlmostEqual(first, second, places, msg, delta) + + def assertTransformEqual(self, lhs, rhs, places=7): + """Assert that two transform expressions evaluate to the same + transformation matrix. + + .. versionadded:: 1.1 + """ + self.assertAlmostTuple( + tuple(Transform(lhs).to_hexad()), tuple(Transform(rhs).to_hexad()), places + ) + + # pylint: enable=invalid-name + + @property + def effect(self): + """Generate an effect object""" + if self._effect is None: + self._effect = self.effect_class() + return self._effect + + def import_string(self, string, *args) -> SvgDocumentElement: + """Runs a string through an import extension, with optional arguments + provided as "--arg=value" arguments""" + stream = io.BytesIO(string.encode()) + reader = self.effect_class() + out = io.BytesIO() + reader.parse_arguments([*args]) + reader.options.input_file = stream + reader.options.output = out + reader.load_raw() + reader.save_raw(reader.effect()) + out.seek(0) + decoded = out.read().decode("utf-8") + document = load_svg(decoded) + return document + + def export_svg(self, document, *args) -> str: + """Runs a svg through an export extension, with optional arguments + provided as "--arg=value" arguments""" + assert isinstance(self, OutputExtension) + output = StringIO() + writer = self.effect_class() + writer.parse_arguments([*args]) + writer.svg = document.getroot() + writer.document = document + writer.effect() + writer.save(output) + output.seek(0) + return output.read() + + +class InkscapeExtensionTestMixin: + """Automatically setup self.effect for each test and test with an empty svg""" + + def setUp(self): # pylint: disable=invalid-name + """Check if there is an effect_class set and create self.effect if it is""" + super().setUp() + if self.effect_class is None: + self.skipTest("self.effect_class is not defined for this this test") + + def test_default_settings(self): + """Extension works with empty svg file""" + self.effect.run([self.empty_svg]) + + +class ComparisonMeta(type): + """Metaclass for ComparisonMixin which creates parametrized tests that can be run + independently. See :class:`~inkex.tester.ComparisonMixin` for details. + + ..versionadded :: 1.4""" + + def __init__(cls, name, bases, attrs): + super().__init__(name, bases, attrs) + if name == "ComparisonMixin": + return # don't execute on the base class + _compare_file = cls.compare_file + _comparisons = cls.comparisons + if hasattr(cls, "comparisons_cmpfile_dict"): + _comparisons = cls.comparisons_cmpfile_dict.keys() + + def get_compare_cmpfile(self, args, addout=None): + return self.data_file("refs", cls.comparisons_cmpfile_dict[args]) + + setattr(cls, "get_compare_cmpfile", get_compare_cmpfile) + + test_method_name = f"test_all_comparisons" + if hasattr(cls, test_method_name): + return # Custom test logic, don't touch + + append = isinstance(_compare_file, (list, tuple)) + compare_file = _compare_file if append else [_compare_file] + try: + for file in compare_file: + for comparison in _comparisons: + test_method_name = f"test_comparison_{comparison}_{file}" + setattr( + cls, + test_method_name, + ComparisonMeta.create_test_method( + comparison, + file, + os.path.basename(file) if append else None, + ), + ) + except TypeError: + # If the compare_file or compare_ + test_method_name = f"test_all_comparisons" + + def test_method(self): + if not isinstance(self.compare_file, (list, tuple)): + self._test_comparisons(self.compare_file) + else: + for compare_file in self.compare_file: + self._test_comparisons( + compare_file, addout=os.path.basename(compare_file) + ) + + setattr(cls, test_method_name, test_method) + + @staticmethod + def create_test_method(comparison, file, addout): + def _test_method(self): + self._test_comparison(comparison, file, addout) + + return _test_method + + +class ComparisonMixin(metaclass=ComparisonMeta): + """ + This mixin allows to easily specify a set of run-through unit tests for an + extension, which is specified in :attr:`inkex.tester.TestCase.effect_class`. + + The commandline parameters are passed in :attr:`comparisons`, the input file + in :attr:`compare_file` (either a list of files, or a single file). + + The :class:`ComparisonMeta` metaclass creates a set of independent unit tests + out of this data. Behavior notest: + + - The unit tests created are the cross product of :attr:`comparisons` and + :attr:`compare_file`. If :attr:`compare_file` is a list, the comparison file name + is suffixed with the current ``compare_file`` name. + - Optionally, :attr:`comparisons_cmpfile_dict` may be specified as + ``Dict[Tuple[str], str]`` where the keys are sets of command line parameters and + the values are the filenames of the output file. This takes precedence over + :attr:`comparisons`. + - If any of those values are properties, their values cannot be accessed at test + collection time and there will only be a single test, ``test_all_comparisons`` + with otherwise identical behavior. + - If the class overrides ``test_all_comparisons``, no additional tests are + generated to allow for custom comparison logic. + + To create the comparison files for the unit tests, use the ``EXPORT_COMPARE`` + environment variable. + """ + + compare_file: Union[List[str], Tuple[str], str] = "svg/shapes.svg" + """This input svg file sent to the extension (if any)""" + + compare_filters = [] # type: List[Compare] + """The ways in which the output is filtered for comparision (see filters.py)""" + + compare_filter_save = False + """If true, the filtered output will be saved and only applied to the + extension output (and not to the reference file)""" + + comparisons = [ + (), + ("--id=p1", "--id=r3"), + ] + """A list of comparison runs, each entry will cause the extension to be run.""" + + compare_file_extension = "svg" + + @property + def _compare_file_extension(self): + """The default extension to use when outputting check files in COMPARE_CHECK + mode.""" + if self.stderr_output: + return "txt" + return self.compare_file_extension + + def _test_comparisons(self, compare_file, addout=None): + for args in self.comparisons: + self._test_comparison(args, compare_file=compare_file, addout=addout) + + def _test_comparison(self, args, compare_file, addout=None): + self.assertCompare( + compare_file, + self.get_compare_cmpfile(args, addout), + args, + ) + + def assertCompare(self, infile, cmpfile, args, outfile=None): # pylint: disable=invalid-name + """ + Compare the output of a previous run against this one. + + Args: + infile: The filename of the pre-processed svg (or other type of file) + cmpfile: The filename of the data we expect to get, if not set + the filename will be generated from the effect name and kwargs. + args: All the arguments to be passed to the effect run + outfile: Optional, instead of returning a regular output, this extension + dumps it's output to this filename instead. + + """ + compare_mode = int(os.environ.get("EXPORT_COMPARE", COMPARE_DELETE)) + + effect = self.assertEffect(infile, args=args) + + if cmpfile is None: + cmpfile = self.get_compare_cmpfile(args) + + if not os.path.isfile(cmpfile) and compare_mode == COMPARE_DELETE: + raise IOError( + f"Comparison file {cmpfile} not found, set EXPORT_COMPARE=1 to create " + "it." + ) + + if outfile: + if not os.path.isabs(outfile): + outfile = os.path.join(self.tempdir, outfile) + self.assertTrue( + os.path.isfile(outfile), f"No output file created! {outfile}" + ) + with open(outfile, "rb") as fhl: + data_a = fhl.read() + else: + data_a = effect.test_output.getvalue() + + write_output = None + if compare_mode == COMPARE_CHECK: + _file = cmpfile[:-4] if cmpfile.endswith(".out") else cmpfile + write_output = f"{_file}.{self._compare_file_extension}" + elif ( + compare_mode == COMPARE_WRITE and not os.path.isfile(cmpfile) + ) or compare_mode == COMPARE_OVERWRITE: + write_output = cmpfile + + try: + if write_output and not os.path.isfile(cmpfile): + raise AssertionError(f"Check the output: {write_output}") + with open(cmpfile, "rb") as fhl: + data_b = self._apply_compare_filters(fhl.read(), False) + self._base_compare(data_a, data_b, compare_mode) + except AssertionError: + if write_output: + if isinstance(data_a, str): + data_a = data_a.encode("utf-8") + self.write_compare_data(infile, write_output, data_a) + # This only reruns if the original test failed. + # The idea here is to make sure the new output file is "stable" + # Because some tests can produce random changes and we don't + # want test authors to be too reassured by a simple write. + if write_output == cmpfile: + effect = self.assertEffect(infile, args=args) + self._base_compare(data_a, cmpfile, COMPARE_CHECK) + if not write_output == cmpfile: + raise + + def write_compare_data(self, infile, outfile, data): + """Write output""" + with open(outfile, "wb") as fhl: + fhl.write(self._apply_compare_filters(data, True)) + print(f"Written output: {outfile}") + + def _base_compare(self, data_a, data_b, compare_mode): + data_a = self._apply_compare_filters(data_a) + + if ( + isinstance(data_a, bytes) + and isinstance(data_b, bytes) + and data_a.startswith(b"<") + and data_b.startswith(b"<") + ): + # Late importing + diff_xml, delta = xmldiff(data_a, data_b) + if not delta and compare_mode == COMPARE_DELETE: + print( + "The XML is different, you can save the output using the " + "EXPORT_COMPARE envionment variable. Set it to 1 to save a file " + "you can check, set it to 3 to overwrite this comparison, setting " + "the new data as the correct one.\n" + ) + diff = "SVG Differences\n\n" + if os.environ.get("XML_DIFF", False): + diff = "<- " + diff_xml + else: + for x, (value_a, value_b) in enumerate(delta): + try: + # Take advantage of better text diff in testcase's own asserts. + self.assertEqual(value_a, value_b) + except AssertionError as err: + diff += f" {x}. {str(err)}\n" + self.assertTrue(delta, diff) + else: + # compare any content (non svg) + self.assertEqual(data_a, data_b) + + def _apply_compare_filters(self, data, is_saving=None): + data = to_bytes(data) + # Applying filters flips depending if we are saving the filtered content + # to disk, or filtering during the test run. This is because some filters + # are destructive others are useful for diagnostics. + if is_saving is self.compare_filter_save or is_saving is None: + for cfilter in self.compare_filters: + data = cfilter(data) + return data + + def get_compare_cmpfile(self, args, addout=None): + """Generate an output file for the arguments given""" + if addout is not None: + args = list(args) + [str(addout)] + opstr = ( + "__".join(args) + .replace(self.tempdir, "TMP_DIR") + .replace(self.datadir(), "DAT_DIR") + ) + opstr = re.sub(r"[^\w-]", "__", opstr) + if opstr: + if len(opstr) > 127: + # avoid filename-too-long error + opstr = hashlib.md5(opstr.encode("latin1")).hexdigest() + opstr = "__" + opstr + return self.data_file( + "refs", f"{self.effect_name}{opstr}.out", check_exists=False + ) diff --git a/extensions/botbox3000/deps/inkex/tester/decorators.py b/extensions/botbox3000/deps/inkex/tester/decorators.py new file mode 100644 index 0000000..1abe8d9 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/decorators.py @@ -0,0 +1,10 @@ +""" +Useful decorators for tests. +""" + +import pytest +from inkex.command import is_inkscape_available + +requires_inkscape = pytest.mark.skipif( # pylint: disable=invalid-name + not is_inkscape_available(), reason="Test requires inkscape, but it's not available" +) diff --git a/extensions/botbox3000/deps/inkex/tester/filters.py b/extensions/botbox3000/deps/inkex/tester/filters.py new file mode 100644 index 0000000..052d1a1 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/filters.py @@ -0,0 +1,181 @@ +# +# Copyright (C) 2019 Thomas Holder +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +# pylint: disable=too-few-public-methods +# +""" +Comparison filters for use with the ComparisonMixin. + +Each filter should be initialised in the list of +filters that are being used. + +.. code-block:: python + + compare_filters = [ + CompareNumericFuzzy(), + CompareOrderIndependentLines(option=yes), + ] + +""" + +import re +from ..utils import to_bytes + + +class Compare: + """ + Comparison base class, this acts as a passthrough unless + the filter staticmethod is overwritten. + """ + + def __init__(self, **options): + self.options = options + + def __call__(self, content): + return self.filter(content) + + @staticmethod + def filter(contents): + """Replace this filter method with your own filtering""" + return contents + + +class CompareNumericFuzzy(Compare): + """ + Turn all numbers into shorter standard formats + + 1.2345678 -> 1.2346 + 1.2300 -> 1.23, 50.0000 -> 50.0 + 50.0 -> 50 + """ + + @staticmethod + def filter(contents): + func = lambda m: b"%.3f" % (float(m.group(0)) + 0) + contents = re.sub(rb"\d+\.\d+(e[+-]\d+)?", func, contents) + contents = re.sub(rb"(\d\.\d+?)0+\b", rb"\1", contents) + contents = re.sub(rb"(\d)\.0+(?=\D|\b)", rb"\1", contents) + contents = re.sub(rb"-0(?=\D|\b)", rb"0", contents) # Replace -0 with 0 + return contents + + +class CompareWithoutIds(Compare): + """Remove all ids from the svg""" + + @staticmethod + def filter(contents): + return re.sub(rb' id="([^"]*)"', b"", contents) + + +class CompareWithPathSpace(Compare): + """Make sure that path segment commands have spaces around them""" + + @staticmethod + def filter(contents): + def func(match): + """We've found a path command, process it""" + new = re.sub(rb"\s*([LZMHVCSQTAatqscvhmzl])\s*", rb" \1 ", match.group(1)) + return b' d="' + new.replace(b",", b" ") + b'"' + + return re.sub(rb' d="([^"]*)"', func, contents) + + +class CompareSize(Compare): + """Compare the length of the contents instead of the contents""" + + @staticmethod + def filter(contents): + return len(contents) + + +class CompareOrderIndependentBytes(Compare): + """Take all the bytes and sort them""" + + @staticmethod + def filter(contents): + return b"".join([bytes(i) for i in sorted(contents)]) + + +class CompareOrderIndependentLines(Compare): + """Take all the lines and sort them""" + + @staticmethod + def filter(contents): + return b"\n".join(sorted(contents.splitlines())) + + +class CompareOrderIndependentStyle(Compare): + """Take all styles and sort the results""" + + @staticmethod + def filter(contents): + contents = CompareNumericFuzzy.filter(contents) + + def func(match): + """Search and replace function for sorting""" + sty = b";".join(sorted(match.group(1).split(b";"))) + return b'style="%s"' % (sty,) + + return re.sub(rb'style="([^"]*)"', func, contents) + + +class CompareOrderIndependentStyleAndPath(Compare): + """Take all styles and paths and sort them both""" + + @staticmethod + def filter(contents): + contents = CompareOrderIndependentStyle.filter(contents) + + def func(match): + """Search and replace function for sorting""" + path = b"X".join(sorted(re.split(rb"[A-Z]", match.group(1)))) + return b'd="%s"' % (path,) + + return re.sub(rb'\bd="([^"]*)"', func, contents) + + +class CompareOrderIndependentTags(Compare): + """Sorts all the XML tags""" + + @staticmethod + def filter(contents): + return b"\n".join(sorted(re.split(rb">\s*<", contents))) + + +class CompareReplacement(Compare): + """Replace pieces to make output more comparable + + .. versionadded:: 1.1""" + + def __init__(self, *replacements): + self.deltas = replacements + super().__init__() + + def filter(self, contents): + contents = to_bytes(contents) + for _from, _to in self.deltas: + contents = contents.replace(to_bytes(_from), to_bytes(_to)) + return contents + + +class WindowsTextCompat(CompareReplacement): + """Normalize newlines so tests comparing plain text work + + .. versionadded:: 1.2""" + + def __init__(self): + super().__init__(("\r\n", "\n")) diff --git a/extensions/botbox3000/deps/inkex/tester/inkscape.extension.rng b/extensions/botbox3000/deps/inkex/tester/inkscape.extension.rng new file mode 100644 index 0000000..0e285c8 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/inkscape.extension.rng @@ -0,0 +1,592 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + file + executable + extension + + + + + + + + + + + + + + + + + + + + python + perl + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + path + extensions + inx + absolute + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + all + g + path + rect + text + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + header + url + + + + + + + default + preserve + + + + + + + + + + + + + + + + + + + + + + + + + + + + expand + + + + + + + + + + + + + + + + + + + + + + + + + + int + + + + + + + + + + + + + + full + + + + + + + + + + float + + + + + + + + + + + + + + + + + + + full + + + + + + + bool + + + + + + color + + + + + colorbutton + + + + + + + + + + + + string + + + + + + + + + + multiline + + + + + + + + + + + path + + + + + file + files + folder + folders + file_new + folder_new + + + + + + + + + + + + + optiongroup + + + + + combo + radio + + + + + + + + + + + + + + + + + + + + + + + + notebook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + 1 + + + + + + + yes + no + + + + diff --git a/extensions/botbox3000/deps/inkex/tester/inkscape.extension.schema b/extensions/botbox3000/deps/inkex/tester/inkscape.extension.schema new file mode 100644 index 0000000..0fd9834 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/inkscape.extension.schema @@ -0,0 +1,10 @@ + + + + + duplicateOptionValues + + Warning: @value values should be unique for a given option. + + + diff --git a/extensions/botbox3000/deps/inkex/tester/inx.py b/extensions/botbox3000/deps/inkex/tester/inx.py new file mode 100644 index 0000000..e14642a --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/inx.py @@ -0,0 +1,182 @@ +#!/usr/bin/env python3 +# coding=utf-8 +""" +Test elements extra logic from svg xml lxml custom classes. +""" + +import os +import sys +from importlib import resources + +from lxml import etree, isoschematron + +from ..utils import PY3 +from ..inx import InxFile + +INTERNAL_ARGS = ("help", "output", "id", "selected-nodes") +ARG_TYPES = { + "Boolean": "bool", + "Color": "color", + "str": "string", + "int": "int", + "float": "float", +} + + +class InxMixin: + """Tools for Testing INX files, use as a mixin class: + + class MyTests(InxMixin, TestCase): + def test_inx_file(self): + self.assertInxIsGood("some_inx_file.inx") + """ + + def assertInxIsGood(self, inx_file): # pylint: disable=invalid-name + """Test the inx file for consistancy and correctness""" + self.assertTrue(PY3, "INX files can only be tested in python3") + + inx = InxFile(inx_file) + if "help" in inx.ident or inx.script.get("interpreter", None) != "python": + return + cls = inx.extension_class + # Check class can be matched in python file + self.assertTrue(cls, f"Can not find class for {inx.filename}") + # Check name is reasonable for the class + if not cls.multi_inx: + self.assertEqual( + cls.__name__, + inx.slug, + f"Name of extension class {cls.__module__}.{cls.__name__} " + f"is different from ident {inx.slug}", + ) + self.assertParams(inx, cls) + + def assertParams(self, inx, cls): # pylint: disable=invalid-name + """Confirm the params in the inx match the python script + + .. versionchanged:: 1.2 + Also checks that the default values are identical""" + params = {param.name: self.parse_param(param) for param in inx.params} + args = dict(self.introspect_arg_parser(cls().arg_parser)) + mismatch_a = list(set(params) ^ set(args) & set(params)) + mismatch_b = list(set(args) ^ set(params) & set(args)) + self.assertFalse( + mismatch_a, f"{inx.filename}: Inx params missing from arg parser" + ) + self.assertFalse( + mismatch_b, f"{inx.filename}: Script args missing from inx xml" + ) + + for param in args: + if params[param]["type"] and args[param]["type"]: + self.assertEqual( + params[param]["type"], + args[param]["type"], + f"Type is not the same for {inx.filename}:param:{param}", + ) + inxdefault = params[param]["default"] + argsdefault = args[param]["default"] + if inxdefault and argsdefault: + # for booleans, the inx is lowercase and the param is uppercase + if params[param]["type"] == "bool": + argsdefault = str(argsdefault).lower() + elif params[param]["type"] not in ["string", None, "color"] or args[ + param + ]["type"] in ["int", "float"]: + # try to parse the inx value to compare numbers to numbers + inxdefault = float(inxdefault) + if args[param]["type"] == "color" or callable(args[param]["default"]): + # skip color, method types + continue + self.assertEqual( + argsdefault, + inxdefault, + f"Default value is not the same for {inx.filename}:param:{param}", + ) + inxchoices = params[param]["choices"] + argschoices = args[param]["choices"] + if argschoices is not None and len(argschoices) > 0: + assert set(inxchoices).issubset(argschoices), ( + f"params don't match: inx={inxchoices}, py={argschoices}" + ) + + def introspect_arg_parser(self, arg_parser): + """Pull apart the arg parser to find out what we have in it""" + for action in arg_parser._optionals._actions: # pylint: disable=protected-access + for opt in action.option_strings: + # Ignore params internal to inkscape (thus not in the inx) + if opt.startswith("--") and opt[2:] not in INTERNAL_ARGS: + yield (opt[2:], self.introspect_action(action)) + + @staticmethod + def introspect_action(action): + """Pull apart a single action to get at the juicy insides""" + return { + "type": ARG_TYPES.get((action.type or str).__name__, "string"), + "default": action.default, + "choices": action.choices, + "help": action.help, + } + + @staticmethod + def parse_param(param): + """Pull apart the param element in the inx file""" + if param.param_type in ("optiongroup", "notebook"): + options = param.options + return { + "type": None, + "choices": options, + "default": options and options[0] or None, + } + param_type = param.param_type + if param.param_type in ("path",): + param_type = "string" + return { + "type": param_type, + "default": param.text, + "choices": None, + } + + def assertInxSchemaValid(self, inx_file): # pylint: disable=invalid-name + """Validate inx file schema.""" + self.assertTrue(INX_SCHEMAS, "no schema files found") + with open(inx_file, "rb") as fp: + inx_doc = etree.parse(fp) + + for schema_name, schema in INX_SCHEMAS.items(): + with self.subTest(schema_file=schema_name): + schema.assert_(inx_doc) + + +def _load_inx_schemas(): + _SCHEMA_CLASSES = { + ".rng": etree.RelaxNG, + ".schema": isoschematron.Schematron, + } + + if sys.version_info > (3, 9): + + def _contents(pkg): + return [path.name for path in resources.files(pkg).iterdir()] + else: + _contents = resources.contents + + for name in _contents(__package__): + _, ext = os.path.splitext(name) + schema_class = _SCHEMA_CLASSES.get(ext) + if schema_class is None: + continue + + if sys.version_info > (3, 9): + + def _open_binary(pkg, res): + return resources.files(pkg).joinpath(res).open("rb") + else: + _open_binary = resources.open_binary + + with _open_binary(__package__, name) as fp: + schema_doc = etree.parse(fp) + yield name, schema_class(schema_doc) + + +INX_SCHEMAS = dict(_load_inx_schemas()) diff --git a/extensions/botbox3000/deps/inkex/tester/mock.py b/extensions/botbox3000/deps/inkex/tester/mock.py new file mode 100644 index 0000000..1ef2da2 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/mock.py @@ -0,0 +1,459 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110, USA. +# +# pylint: disable=protected-access,too-few-public-methods +""" +Any mocking utilities required by testing. Mocking is when you need the test +to exercise a piece of code, but that code may or does call on something +outside of the target code that either takes too long to run, isn't available +during the test running process or simply shouldn't be running at all. +""" + +import io +import os +import sys +import logging +import hashlib +import tempfile +from typing import List, Tuple, Any + +from email.mime.application import MIMEApplication +from email.mime.multipart import MIMEMultipart +from email.mime.text import MIMEText +from email.parser import Parser as EmailParser + +import inkex.command + + +FIXED_BOUNDARY = "--CALLDATA--//--CALLDATA--" + + +class Capture: + """Capture stdout or stderr. Used as `with Capture('stdout') as stream:`""" + + def __init__(self, io_name="stdout", swap=True): + self.io_name = io_name + self.original = getattr(sys, io_name) + self.stream = io.StringIO() + self.swap = swap + + def __enter__(self): + if self.swap: + setattr(sys, self.io_name, self.stream) + return self.stream + + def __exit__(self, exc, value, traceback): + if exc is not None and self.swap: + # Dump content back to original if there was an error. + self.original.write(self.stream.getvalue()) + setattr(sys, self.io_name, self.original) + + +class ManualVerbosity: + """Change the verbosity of the test suite manually""" + + result = property(lambda self: self.test._current_result) + + def __init__(self, test, okay=True, dots=False): + self.test = test + self.okay = okay + self.dots = dots + + def flip(self, exc_type=None, exc_val=None, exc_tb=None): # pylint: disable=unused-argument + """Swap the stored verbosity with the original""" + self.okay, self.result.showAll = self.result.showAll, self.okay + self.dots, self.result.dots = self.result.dots, self.okay + + __enter__ = flip + __exit__ = flip + + +class MockMixin: + """ + Add mocking ability to any test base class, will set up mock on setUp + and remove it on tearDown. + + Mocks are stored in an array attached to the test class (not instance!) which + ensures that mocks can only ever be setUp once and can never be reset over + themselves. (just in case this looks weird at first glance) + + class SomeTest(MockingMixin, TestBase): + mocks = [(sys, 'exit', NoSystemExit("Nope!")] + """ + + mocks = [] # type: List[Tuple[Any, str, Any]] + + def setUpMock(self, owner, name, new): # pylint: disable=invalid-name + """Setup the mock here, taking name and function and returning (name, old)""" + old = getattr(owner, name) + if isinstance(new, str): + if hasattr(self, new): + new = getattr(self, new) + if isinstance(new, Exception): + + def _error_function(*args2, **kw2): # pylint: disable=unused-argument + raise type(new)(str(new)) + + setattr(owner, name, _error_function) + elif new is None or isinstance(new, (str, int, float, list, tuple)): + + def _value_function(*args, **kw): # pylint: disable=unused-argument + return new + + setattr(owner, name, _value_function) + else: + setattr(owner, name, new) + # When we start, mocks contains length 3 tuples, when we're finished, it + # contains length 4, this stops remocking and reunmocking from taking place. + return (owner, name, old, False) + + def setUp(self): # pylint: disable=invalid-name + """For each mock instruction, set it up and store the return""" + super().setUp() + for x, mock in enumerate(self.mocks): + if len(mock) == 4: + logging.error( + "Mock was already set up, so it wasn't cleared previously!" + ) + continue + self.mocks[x] = self.setUpMock(*mock) + + def tearDown(self): # pylint: disable=invalid-name + """For each returned stored, tear it down and restore mock instruction""" + super().tearDown() + try: + for x, (owner, name, old, _) in enumerate(self.mocks): + self.mocks[x] = (owner, name, getattr(owner, name)) + setattr(owner, name, old) + except ValueError: + logging.warning("Was never mocked, did something go wrong?") + + def old_call(self, name): + """Get the original caller""" + for arg in self.mocks: + if arg[1] == name: + return arg[2] + return lambda: None + + +class MockCommandMixin(MockMixin): + """ + Replace all the command functions with testable replacements. + + This stops the pipeline and people without the programs, running into problems. + """ + + mocks = [ + (inkex.command, "_call", "mock_call"), + (tempfile, "mkdtemp", "record_tempdir"), + ] + recorded_tempdirs = [] # type:List[str] + + def setUp(self): # pylint: disable=invalid-name + super().setUp() + # This is a the daftest thing I've ever seen, when in the middle + # of a mock, the 'self' variable magically turns from a FooTest + # into a TestCase, this makes it impossible to find the datadir. + from . import TestCase + + TestCase._mockdatadir = self.datadir() + + @classmethod + def cmddir(cls): + """Returns the location of all the mocked command results""" + from . import TestCase + + return os.path.join(TestCase._mockdatadir, "cmd") + + def record_tempdir(self, *args, **kwargs): + """Record any attempts to make tempdirs""" + newdir = self.old_call("mkdtemp")(*args, **kwargs) + self.recorded_tempdirs.append(os.path.realpath(newdir)) + return newdir + + def clean_paths(self, data, files): + """Clean a string of any files or tempdirs""" + + def replace(indata, replaced, replacement): + if isinstance(indata, str): + indata = indata.replace(replaced, replacement) + else: + indata = [i.replace(replaced, replacement) for i in indata] + return indata + + try: + for fdir in self.recorded_tempdirs: + data = replace(data, fdir + os.sep, "./") + data = replace(data, fdir, ".") + files = replace(files, fdir + os.sep, "./") + files = replace(files, fdir, ".") + for fname in files: + data = replace(data, fname, os.path.basename(fname)) + except (UnicodeDecodeError, TypeError): + pass + return data + + def get_all_tempfiles(self): + """Returns a set() of all files currently in any of the tempdirs""" + ret = set([]) + for fdir in self.recorded_tempdirs: + if not os.path.isdir(fdir): + continue + for fname in os.listdir(fdir): + if fname in (".", ".."): + continue + path = os.path.join(fdir, fname) + # We store the modified time so if a program modifies + # the input file in-place, it will look different. + ret.add(path + f";{os.path.getmtime(path)}") + + return ret + + def ignore_command_mock(self, program, arglst, path): + """Return true if the mock is ignored""" + if self and program and arglst: + env = os.environ.get("NO_MOCK_COMMANDS", 0) + if (not os.path.exists(path) and int(env) == 1) or int(env) == 2: + return True + return False + + def mock_call(self, program, *args, **kwargs): + """ + Replacement for the inkex.command.call() function, instead of calling + an external program, will compile all arguments into a hash and use the + hash to find a command result. + """ + # Remove stdin first because it needs to NOT be in the Arguments list. + stdin = kwargs.pop("stdin", None) + args = list(args) + + # We use email + msg = MIMEMultipart(boundary=FIXED_BOUNDARY) + msg["Program"] = MockCommandMixin.get_program_name(program) + + # Gather any output files and add any input files to msg, args and kwargs + # may be modified to strip out filename directories (which change) + inputs, outputs = self.add_call_files(msg, args, kwargs) + + arglst = inkex.command.to_args_sorted(program, *args, **kwargs)[1:] + arglst = self.clean_paths(arglst, inputs + outputs) + argstr = " ".join(arglst) + msg["Arguments"] = argstr.strip() + + if stdin is not None: + # The stdin is counted as the msg body + cleanin = ( + self.clean_paths(stdin, inputs + outputs) + .replace("\r\n", "\n") + .replace(".\\", "./") + ) + msg.attach(MIMEText(cleanin, "plain", "utf-8")) + + keystr = msg.as_string() + # On Windows, output is separated by CRLF + keystr = keystr.replace("\r\n", "\n") + # There is a difference between python2 and python3 output + keystr = keystr.replace("\n\n", "\n") + keystr = keystr.replace("\n ", " ") + if "verb" in keystr: + # Verbs seperated by colons cause diff in py2/3 + keystr = keystr.replace("; ", ";") + # Generate a unique key for this call based on _all_ it's inputs + key = hashlib.md5(keystr.encode("utf-8")).hexdigest() + + if self.ignore_command_mock( + program, arglst, self.get_call_filename(program, key, create=True) + ): + # Call original code. This is so programmers can run the test suite + # against the external programs too, to see how their fair. + if stdin is not None: + kwargs["stdin"] = stdin + + before = self.get_all_tempfiles() + stdout = self.old_call("_call")(program, *args, **kwargs) + outputs += list(self.get_all_tempfiles() - before) + # Remove the modified time from the call + outputs = [out.rsplit(";", 1)[0] for out in outputs] + + # After the program has run, we collect any file outputs and store + # them, then store any stdout or stderr created during the run. + # A developer can then use this to build new test cases. + reply = MIMEMultipart(boundary=FIXED_BOUNDARY) + reply["Program"] = MockCommandMixin.get_program_name(program) + reply["Arguments"] = argstr + self.save_call(program, key, stdout, outputs, reply) + self.save_key(program, key, keystr, "key") + return stdout + + try: + return self.load_call(program, key, outputs) + except IOError as err: + self.save_key(program, key, keystr, "bad-key") + raise IOError( + f"Problem loading call: {program}/{key} use the environment variable " + "NO_MOCK_COMMANDS=1 to call out to the external program and generate " + f"the mock call file for call {program} {argstr}." + ) from err + + def add_call_files(self, msg, args, kwargs): + """ + Gather all files, adding input files to the msg (for hashing) and + output files to the returned files list (for outputting in debug) + """ + # Gather all possible string arguments together. + loargs = sorted(kwargs.items(), key=lambda i: i[0]) + values = [] + for arg in args: + if isinstance(arg, (tuple, list)): + loargs.append(arg) + else: + values.append(str(arg)) + + for _, value in loargs: + if isinstance(value, (tuple, list)): + for val in value: + if val is not True: + values.append(str(val)) + elif value is not True: + values.append(str(value)) + + # See if any of the strings could be filenames, either going to be + # or are existing files on the disk. + files = [[], []] + for value in values: + if os.path.isfile(value): # Input file + files[0].append(value) + self.add_call_file(msg, value) + elif os.path.isdir(os.path.dirname(value)): # Output file + files[1].append(value) + return files + + def add_call_file(self, msg, filename): + """Add a single file to the given mime message""" + fname = os.path.basename(filename) + with open(filename, "rb") as fhl: + if filename.endswith(".svg"): + value = self.clean_paths(fhl.read().decode("utf8"), []) + else: + value = fhl.read() + try: + value = value.decode() + except UnicodeDecodeError: + pass # do not attempt to process binary files further + if isinstance(value, str): + value = value.replace("\r\n", "\n").replace(".\\", "./") + part = MIMEApplication(value, Name=fname) + # After the file is closed + part["Content-Disposition"] = "attachment" + part["Filename"] = fname + msg.attach(part) + + def get_call_filename(self, program, key, create=False): + """ + Get the filename for the call testing information. + """ + path = self.get_call_path(program, create=create) + fname = os.path.join(path, key + ".msg") + if not create and not os.path.isfile(fname): + raise IOError(f"Attempted to find call test data {key}") + return fname + + @staticmethod + def get_program_name(program): + """Takes a program and returns a program name""" + if program == inkex.command.INKSCAPE_EXECUTABLE_NAME: + return "inkscape" + return program + + def get_call_path(self, program, create=True): + """Get where this program would store it's test data""" + command_dir = os.path.join( + self.cmddir(), MockCommandMixin.get_program_name(program) + ) + if not os.path.isdir(command_dir): + if create: + os.makedirs(command_dir) + else: + raise IOError( + "A test is attempting to use an external program in a test:" + f" {program}; but there is not a command data directory which " + f"should contain the results of the command here: {command_dir}" + ) + return command_dir + + def load_call(self, program, key, files): + """ + Load the given call + """ + fname = self.get_call_filename(program, key, create=False) + with open(fname, "rb") as fhl: + msg = EmailParser().parsestr(fhl.read().decode("utf-8")) + + stdout = None + for part in msg.walk(): + if "attachment" in part.get("Content-Disposition", ""): + base_name = part["Filename"] + for out_file in files: + if out_file.endswith(base_name): + with open(out_file, "wb") as fhl: + fhl.write(part.get_payload(decode=True)) + part = None + if part is not None: + # Was not caught by any normal outputs, so we will + # save the file to EVERY tempdir in the hopes of + # hitting on of them. + for fdir in self.recorded_tempdirs: + if os.path.isdir(fdir): + with open(os.path.join(fdir, base_name), "wb") as fhl: + fhl.write(part.get_payload(decode=True)) + elif part.get_content_type() == "text/plain": + stdout = part.get_payload(decode=True) + + return stdout + + def save_call(self, program, key, stdout, files, msg, ext="output"): # pylint: disable=too-many-arguments + """ + Saves the results from the call into a debug output file, the resulting files + should be a Mime msg file format with each attachment being one of the input + files as well as any stdin and arguments used in the call. + """ + if stdout is not None and stdout.strip(): + # The stdout is counted as the msg body here + msg.attach(MIMEText(stdout.decode("utf-8"), "plain", "utf-8")) + + for fname in set(files): + if os.path.isfile(fname): + # print("SAVING FILE INTO MSG: {}".format(fname)) + self.add_call_file(msg, fname) + else: + part = MIMEText("Missing File", "plain", "utf-8") + part.add_header("Filename", os.path.basename(fname)) + msg.attach(part) + fname = self.get_call_filename(program, key, create=True) + "." + ext + + with open(fname, "wb") as fhl: + fhl.write(msg.as_string().encode("utf-8")) + if int(os.environ.get("NO_MOCK_COMMANDS", 0)) == 1: + print(f"Saved mock call as {fname}, remove .{ext}") + + def save_key(self, program, key, keystr, ext="key"): + """Save the key file if we are debugging the key data""" + if os.environ.get("DEBUG_KEY"): + fname = self.get_call_filename(program, key, create=True) + "." + ext + with open(fname, "wb") as fhl: + fhl.write(keystr.encode("utf-8")) diff --git a/extensions/botbox3000/deps/inkex/tester/svg.py b/extensions/botbox3000/deps/inkex/tester/svg.py new file mode 100644 index 0000000..c601c81 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/svg.py @@ -0,0 +1,55 @@ +# coding=utf-8 +# +# Copyright (C) 2018 Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110, USA. +# +""" +SVG specific utilities for tests. +""" + +from lxml import etree + +from inkex import SVG_PARSER + + +def svg(svg_attrs=""): + """Returns xml etree based on a simple SVG element. + + svg_attrs: A string containing attributes to add to the + root element of a minimal SVG document. + """ + return etree.fromstring( + str.encode( + '' + f"" + ), + parser=SVG_PARSER, + ) + + +def svg_unit_scaled(width_unit): + """Same as svg, but takes a width unit (top-level transform) for the new document. + + The transform is the ratio between the SVG width and the viewBox width. + """ + return svg(f'width="1{width_unit}" viewBox="0 0 1 1"') + + +def svg_file(filename): + """Parse an svg file and return it's document root""" + with open(filename, "r", encoding="utf-8") as fhl: + doc = etree.parse(fhl, parser=SVG_PARSER) + return doc.getroot() diff --git a/extensions/botbox3000/deps/inkex/tester/word.py b/extensions/botbox3000/deps/inkex/tester/word.py new file mode 100644 index 0000000..bf395d7 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/word.py @@ -0,0 +1,42 @@ +# coding=utf-8 +# +# Unknown author +# +""" +Generate words for testing. +""" + +import string +import random + + +def word_generator(text_length): + """ + Generate a word of text_length size + """ + word = "" + + for _ in range(0, text_length): + word += random.choice( + string.ascii_lowercase + + string.ascii_uppercase + + string.digits + + string.punctuation + ) + + return word + + +def sentencecase(word): + """Make a word standace case""" + word_new = "" + lower_letters = list(string.ascii_lowercase) + first = True + for letter in word: + if letter in lower_letters and first is True: + word_new += letter.upper() + first = False + else: + word_new += letter + + return word_new diff --git a/extensions/botbox3000/deps/inkex/tester/xmldiff.py b/extensions/botbox3000/deps/inkex/tester/xmldiff.py new file mode 100644 index 0000000..4de9bc8 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tester/xmldiff.py @@ -0,0 +1,125 @@ +# +# Copyright 2011 (c) Ian Bicking +# 2019 (c) Martin Owens +# +# Taken from http://formencode.org under the GPL compatible PSF License. +# Modified to produce more output as a diff. +# +""" +Allow two xml files/lxml etrees to be compared, returning their differences. +""" + +import xml.etree.ElementTree as xml +from io import BytesIO + +from inkex.paths import Path + + +def text_compare(test1, test2): + """ + Compare two text strings while allowing for '*' to match + anything on either lhs or rhs. + """ + if not test1 and not test2: + return True + if test1 == "*" or test2 == "*": + return True + return (test1 or "").strip() == (test2 or "").strip() + + +class DeltaLogger(list): + """A record keeper of the delta between two svg files""" + + def append_tag(self, tag_a, tag_b): + """Record a tag difference""" + if tag_a: + tag_a = f"<{tag_a}.../>" + if tag_b: + tag_b = f"<{tag_b}.../>" + self.append((tag_a, tag_b)) + + def append_attr(self, attr, value_a, value_b): + """Record an attribute difference""" + + def _prep(val): + if val: + if attr == "d": + return [attr] + Path(val).to_arrays() + return (attr, val) + return val + + # Only append a difference if the preprocessed values are different. + # This solves the issue that -0 != 0 in path data. + prep_a = _prep(value_a) + prep_b = _prep(value_b) + if prep_a != prep_b: + self.append((prep_a, prep_b)) + + def append_text(self, text_a, text_b): + """Record a text difference""" + self.append((text_a, text_b)) + + def __bool__(self): + """Returns True if there's no log, i.e. the delta is clean""" + return not self.__len__() + + __nonzero__ = __bool__ + + def __repr__(self): + if self: + return "No differences detected" + return f"{len(self)} xml differences" + + +def to_xml(data): + """Convert string or bytes to xml parsed root node""" + if isinstance(data, str): + data = data.encode("utf8") + if isinstance(data, bytes): + return xml.parse(BytesIO(data)).getroot() + return data + + +def xmldiff(data1, data2): + """Create an xml difference, will modify the first xml structure with a diff""" + xml1, xml2 = to_xml(data1), to_xml(data2) + delta = DeltaLogger() + _xmldiff(xml1, xml2, delta) + return xml.tostring(xml1).decode("utf-8"), delta + + +def _xmldiff(xml1, xml2, delta): + if xml1.tag != xml2.tag: + xml1.tag = f"{xml1.tag}XXX{xml2.tag}" + delta.append_tag(xml1.tag, xml2.tag) + for name, value in xml1.attrib.items(): + if name not in xml2.attrib: + delta.append_attr(name, xml1.attrib[name], None) + xml1.attrib[name] += "XXX" + elif xml2.attrib.get(name) != value: + delta.append_attr(name, xml1.attrib.get(name), xml2.attrib.get(name)) + xml1.attrib[name] = f"{xml1.attrib.get(name)}XXX{xml2.attrib.get(name)}" + for name, value in xml2.attrib.items(): + if name not in xml1.attrib: + delta.append_attr(name, None, value) + xml1.attrib[name] = "XXX" + value + if not text_compare(xml1.text, xml2.text): + delta.append_text(xml1.text, xml2.text) + xml1.text = f"{xml1.text}XXX{xml2.text}" + if not text_compare(xml1.tail, xml2.tail): + delta.append_text(xml1.tail, xml2.tail) + xml1.tail = f"{xml1.tail}XXX{xml2.tail}" + + # Get children and pad with nulls + children_a = list(xml1) + children_b = list(xml2) + children_a += [None] * (len(children_b) - len(children_a)) + children_b += [None] * (len(children_a) - len(children_b)) + + for child_a, child_b in zip(children_a, children_b): + if child_a is None: # child_b exists + delta.append_tag(child_b.tag, None) + elif child_b is None: # child_a exists + delta.append_tag(None, child_a.tag) + else: + _xmldiff(child_a, child_b, delta) diff --git a/extensions/botbox3000/deps/inkex/transforms.py b/extensions/botbox3000/deps/inkex/transforms.py new file mode 100644 index 0000000..9a35a77 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/transforms.py @@ -0,0 +1,1279 @@ +# coding=utf-8 +# +# Copyright (C) 2006 Jean-Francois Barraud, barraud@math.univ-lille1.fr +# Copyright (C) 2010 Alvin Penner, penner@vaxxine.com +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# barraud@math.univ-lille1.fr +# +# This code defines several functions to make handling of transform +# attribute easier. +# +""" +Provide transformation parsing to extensions +""" + +from __future__ import annotations +import re +from decimal import Decimal +from math import cos, radians, sin, sqrt, tan, fabs, atan2, hypot, pi, isfinite +from typing import ( + overload, + cast, + Callable, + Generator, + Iterator, + Tuple, + Union, + Optional, + List, +) +import cmath + +import numpy as np + + +from .utils import strargs, KeyDict + + +VectorLike = Union["ImmutableVector2d", Tuple[float, float], complex] # pylint: disable=invalid-name +ComplexLike = Union[complex, "Vector2d"] # pylint: disable=invalid-name +MatrixLike = Union[ + str, + Tuple[Tuple[float, float, float], Tuple[float, float, float]], + Tuple[float, float, float, float, float, float], + "Transform", +] +BoundingIntervalArgs = Union["BoundingInterval", Tuple[float, float], float] # pylint: disable=invalid-name + +# All the names that get added to the inkex API itself. +__all__ = ( + "BoundingBox", + "DirectedLineSegment", + "ImmutableVector2d", + "Transform", + "Vector2d", +) + + +# Old settings, supported because users click 'ok' without looking. +XAN = KeyDict({"l": "left", "r": "right", "m": "center_x"}) +YAN = KeyDict({"t": "top", "b": "bottom", "m": "center_y"}) +# Anchoring objects with given directions (see inx options) +CUSTOM_DIRECTION = {270: "tb", 90: "bt", 0: "lr", 360: "lr", 180: "rl"} +DIRECTION = ["tb", "bt", "lr", "rl", "ro", "ri"] + + +class ImmutableVector2d: + """Represents an immutable element of 2-dimensional Euclidean space""" + + _x = 0.0 + _y = 0.0 + + x = property(lambda self: self._x) + y = property(lambda self: self._y) + + @property + def __array_interface__(self): + z = complex(self) + # Allocate a NumPy scalar just to get the memory buffer + arr = np.array([z], dtype=np.complex128) + return {"shape": (), "typestr": arr.dtype.str, "data": (arr.ctypes.data, False)} + + @overload + def __init__(self): + pass + + @overload + def __init__( + self, + v: Union[VectorLike, str], + fallback: Optional[Union[VectorLike, str]] = None, + ): + pass + + @overload + def __init__(self, x: float, y: float): + pass + + def __init__(self, *args, fallback=None): + try: + x, y = self.c2t(complex(*args)) + except (ValueError, TypeError): + try: + if len(args) == 0: + x, y = 0.0, 0.0 + elif len(args) == 1: + x, y = self._parse(args[0]) + elif len(args) == 2: + x, y = map(float, args) + else: + raise ValueError("too many arguments") + except (ValueError, TypeError) as error: + if fallback is None: + raise ValueError( + "Cannot parse vector and no fallback given" + ) from error + x, y = ImmutableVector2d(fallback) + self._x, self._y = float(x), float(y) + + @staticmethod + def _parse(point: Union[VectorLike, float, str]) -> Tuple[float, float]: + if isinstance(point, complex): + x, y = point.real, point.imag + elif isinstance(point, ImmutableVector2d): + x, y = point._x, point._y + elif isinstance(point, (tuple, list)) and len(point) == 2: + x, y = map(float, point) + elif isinstance(point, str) and point.count(",") == 1: + x, y = map(float, point.split(",")) + else: + raise ValueError(f"Can't parse {repr(point)}") + return x, y + + def __complex__(self) -> complex: + return complex(self._x, self._y) + + def __eq__(self, other) -> bool: + if isinstance(other, (ImmutableVector2d, tuple, complex)): + other = Vector2d(other) + return self._x == other._x and self._y == other._y + return False + + def __add__(self, other: VectorLike) -> Vector2d: + other = Vector2d(other) + return Vector2d(self._x + other._x, self._y + other._y) + + def __radd__(self, other: VectorLike) -> Vector2d: + other = Vector2d(other) + return Vector2d(self._x + other._x, self._y + other._y) + + def __sub__(self, other: VectorLike) -> Vector2d: + other = Vector2d(other) + return Vector2d(self._x - other._x, self._y - other._y) + + def __rsub__(self, other: VectorLike) -> Vector2d: + other = Vector2d(other) + return Vector2d(other._x - self._x, other._y - self._y) + + def __neg__(self) -> Vector2d: + return Vector2d(-self._x, -self._y) + + def __pos__(self) -> Vector2d: + return Vector2d(self._x, self._y) + + def __floordiv__(self, factor: float) -> Vector2d: + return Vector2d(self._x / float(factor), self._y / float(factor)) + + def __truediv__(self, factor: float) -> Vector2d: + return Vector2d(self._x / float(factor), self._y / float(factor)) + + def __div__(self, factor: float) -> Vector2d: + return Vector2d(self._x / float(factor), self._y / float(factor)) + + def __mul__(self, factor: float) -> Vector2d: + return Vector2d(self._x * factor, self._y * factor) + + def __abs__(self) -> float: + return self.length + + def __rmul__(self, factor: float) -> Vector2d: + return Vector2d(self._x * factor, self._y * factor) + + def __repr__(self) -> str: + return f"Vector2d({self._x:.6g}, {self._y:.6g})" + + def __str__(self) -> str: + return f"{self._x:.6g}, {self._y:.6g}" + + def __iter__(self) -> Generator[float, None, None]: + yield self._x + yield self._y + + def __len__(self) -> int: + return 2 + + def __getitem__(self, item: int) -> float: + return (self._x, self._y)[item] + + def to_tuple(self) -> Tuple[float, float]: + """A tuple of the vector's components""" + return cast(Tuple[float, float], tuple(self)) + + def to_polar_tuple(self) -> Tuple[float, Optional[float]]: + """A tuple of the vector's magnitude and direction + + .. versionadded:: 1.1""" + return self.length, self.angle + + def dot(self, other: VectorLike) -> float: + """Multiply Vectors component-wise""" + other = Vector2d(other) + return self._x * other._x + self._y * other._y + + def cross(self, other: VectorLike) -> float: + """Z component of the cross product of the vectors extended into 3D + + .. versionadded:: 1.1""" + other = Vector2d(other) + return self._x * other._y - self._y * other._x + + def is_close( + self, + other: Union[VectorLike, str, Tuple[float, float]], + rtol: float = 1e-5, + atol: float = 1e-8, + ) -> float: + """Checks if two vectors are (almost) identical, up to both absolute and + relative tolerance.""" + return cmath.isclose(self, Vector2d(other), rel_tol=rtol, abs_tol=atol) + + @property + def length(self) -> float: + """Returns the length of the vector""" + return abs(complex(self)) + + @property + def angle(self) -> Optional[float]: + """The angle of the vector when represented in polar coordinates + + .. versionadded:: 1.1""" + if self._x == 0 and self._y == 0: + return None + return atan2(self._y, self._x) + + @staticmethod + def from_polar(radius: float, theta: Optional[float] = None) -> Optional[Vector2d]: + """Creates a Vector2d from polar coordinates + + None is returned when theta is None and radius is not zero. + + .. versionadded:: 1.1 + """ + if radius == 0.0: + return Vector2d(0.0, 0.0) + if theta is not None: + return Vector2d(cmath.rect(radius, theta)) + return None + + @staticmethod + def c2t(c: complex) -> List[float]: + """Complex to tuple""" + return [c.real, c.imag] + + @staticmethod + def t2c(tup: Tuple[float, float]) -> complex: + """Tuple to complex""" + return tup[0] + 1j * tup[1] + + +class Vector2d(ImmutableVector2d): + """Represents an element of 2-dimensional Euclidean space""" + + @ImmutableVector2d.x.setter + def x(self, value: Union[float, int, str]) -> None: + self._x = float(value) + + @ImmutableVector2d.y.setter + def y(self, value: Union[float, int, str]) -> None: + self._y = float(value) + + def __iadd__(self, other: VectorLike) -> Vector2d: + other = Vector2d(other) + self._x, self._y = self._x + other._x, self._y + other._y + return self + + def __isub__(self, other: VectorLike) -> Vector2d: + other = Vector2d(other) + self._x, self._y = self._x - other._x, self._y - other._y + return self + + def __imul__(self, factor: float) -> Vector2d: + self._x, self._y = self._x * factor, self._y * factor + return self + + def __idiv__(self, factor: float) -> Vector2d: + self._x, self._y = self._x / float(factor), self._y / float(factor) + return self + + def __itruediv__(self, factor: float) -> Vector2d: + self._x, self._y = self._x / float(factor), self._y / float(factor) + return self + + def __ifloordiv__(self, factor: float) -> Vector2d: + self._x, self._y = self._x / float(factor), self._y / float(factor) + return self + + @overload + def assign(self, x: float, y: float) -> VectorLike: + pass + + @overload + def assign(self, other: Union[VectorLike, str]) -> VectorLike: + pass + + def assign(self, *args): + """Assigns a different vector in place""" + self._x, self._y = Vector2d(*args) + return self + + +class Transform: + r"""A transformation object which will always reduce to a matrix and can + then be used in combination with other transformations for reducing + finding a point and printing svg ready output. + + Use with svg transform attribute input: + + tr = Transform("scale(45, 32)") + + Use with triad matrix input (internal representation): + + tr = Transform(((1.0, 0.0, 0.0), (0.0, 1.0, 0.0))) + + Use with hexad matrix input (i.e. svg matrix(...)): + + tr = Transform((1.0, 0.0, 0.0, 1.0, 0.0, 0.0)) + + Once you have a transformation you can operate tr * tr to compose, + any of the above inputs are also valid operators for composing. + + .. versionchanged:: 1.4 + + Internally, the values are stored as complex values. For the hexad + ``(a, c, e), (b, d, f)`` we store: + + .. math:: + + a_1 &= \frac{a+d}{2} + j \frac{b-c}{2} \\ + a_2 &= \frac{a-d}{2} + j \frac{b+c}{2} \\ + a_3 &= e + f j + + This makes application to another vector a multiplication / addition on + primitives: :math:`a_1p + a_2 \bar{p} + a_3` + + As with paths, this performance benefit is best reaped by using the methods + prefixed with "c", such as :func:`capply_to_point` (which is also what + :func:`inkex.paths.Path.transform` uses internally). + + """ + + arg1: complex = 1 + 0j + arg2: complex = 0 + 0j + arg3: complex = 0 + 0j + callback: Callable = lambda *args: args[0] + + TRM = re.compile(r"(translate|scale|rotate|skewX|skewY|matrix)\s*\(([^)]*)\)\s*,?") + absolute_tolerance = 1e-5 # type: float + + @property + def matrix(self) -> Tuple[Tuple[float, float, float], Tuple[float, float, float]]: + """Get the matrix of the transform.""" + return ( + ( + (self.arg1 + self.arg2).real, + (self.arg2 - self.arg1).imag, + self.arg3.real, + ), + ( + (self.arg1 + self.arg2).imag, + (self.arg1 - self.arg2).real, + self.arg3.imag, + ), + ) + + def __init__(self, *args, element=None, **kwargs) -> None: + if len(args) == 3: + # Shortcut for complex initializer + self.arg1, self.arg2, self.arg3 = args + self.callback = kwargs.get("callback", self.callback) + return + + matrix = callback = None + if len(args) > 0: + matrix = args[0] + if len(args) > 1: + callback = args[1] + + matrix = kwargs.pop("matrix", matrix) + callback = kwargs.pop("callback", callback) + + if matrix is not None: + self._set_matrix(matrix) + + self.add_kwargs(**kwargs) + # Set callback last, so it doesn't kick off just setting up the internal value + if callback is not None: + self.callback = callback + + def _set_matrix(self, matrix: MatrixLike) -> None: + """Parse a given string as an svg transformation instruction. + + .. versionadded:: 1.1""" + if isinstance(matrix, str): + for func, values in self.TRM.findall(matrix.strip()): + getattr(self, "add_" + func.lower())(*strargs(values)) + elif isinstance(matrix, Transform): + self.arg1, self.arg2, self.arg3 = matrix.arg1, matrix.arg2, matrix.arg3 + elif isinstance(matrix, (tuple, list)): + try: + a, c, e = map(float, matrix[0]) # type: ignore + b, d, f = map(float, matrix[1]) # type: ignore + except TypeError: # Could be 1x6 matrix instead + try: + a, b, c, d, e, f = map(float, matrix) # type: ignore + except TypeError: + raise ValueError( + f"Matrix '{matrix}' is not a valid transformation matrix" + ) + self.arg1 = (a + d) / 2 + 1j * (b - c) / 2 + self.arg2 = (a - d) / 2 + 1j * (b + c) / 2 + self.arg3 = e + f * 1j + else: + raise ValueError(f"Invalid transform type: {type(matrix).__name__}") + + # These provide quick access to the svg matrix: + # + # [ a, c, e ] + # [ b, d, f ] + # + # pylint: disable=invalid-name + a = property(lambda self: (self.arg1 + self.arg2).real) + b = property(lambda self: (self.arg1 + self.arg2).imag) + c = property(lambda self: (self.arg2 - self.arg1).imag) + d = property(lambda self: (self.arg1 - self.arg2).real) + e = property(lambda self: self.arg3.real) + f = property(lambda self: self.arg3.imag) + # pylint: enable=invalid-name + + def __bool__(self) -> bool: + return not self.__eq__(Transform()) + + __nonzero__ = __bool__ + + @overload + def add_matrix(self, a: MatrixLike) -> Transform: ... + + @overload + def add_matrix( # pylint: disable=too-many-arguments + self, a: float, b: float, c: float, d: float, e: float, f: float + ) -> Transform: ... + + @overload + def add_matrix( + self, a: Tuple[float, float, float], b: Tuple[float, float, float] + ) -> Transform: ... + + def add_matrix(self, *args): + """Add matrix in order they appear in the svg hexad""" + if len(args) == 1: + t = Transform(args[0]) + elif len(args) == 2 or len(args) == 6: + t = Transform(args) + else: + raise ValueError(f"Invalid number of arguments {args}") + self.arg1, self.arg2, self.arg3 = self.__fastmatmul(t.arg1, t.arg2, t.arg3) + self.callback(self) + return self + + def add_kwargs(self, **kwargs): + """Add translations, scales, rotations etc using key word arguments""" + for key, value in reversed(list(kwargs.items())): + func = getattr(self, "add_" + key) + if isinstance(value, tuple): + func(*value) + elif value is not None: + func(value) + return self + + @overload + def add_translate(self, dr: VectorLike) -> Transform: ... + + @overload + def add_translate(self, tr_x: float, tr_y: float = 0.0) -> Transform: ... + + def add_translate(self, *args): + """Add translate to this transformation""" + tr = Vector2d(*args) + self.arg1, self.arg2, self.arg3 = self.__fastmatmul(1, 0, complex(tr)) + if self.callback is None: + pass + self.callback(self) + return self + + def add_scale(self, sc_x: float, sc_y: Optional[float] = None) -> Transform: + """Add scale to this transformation""" + sc_x = float(sc_x) + sc_y = sc_x if sc_y is None else float(sc_y) + self.arg1, self.arg2, self.arg3 = self.__fastmatmul( + (sc_x + sc_y) / 2, (sc_x - sc_y) / 2, 0 + ) + self.callback(self) + return self + + @overload + def add_rotate(self, deg: float, center: VectorLike): ... + + @overload + def add_rotate(self, deg: float, center_x: float, center_y: float): ... + + @overload + def add_rotate(self, deg: float) -> Transform: ... + + @overload + def add_rotate(self, deg: float, a: Union[VectorLike, str]) -> Transform: ... + + @overload + def add_rotate(self, deg: float, a: float, b: float) -> Transform: ... + + def add_rotate(self, deg, *args): + """Add rotation to this transformation""" + c = complex(Vector2d(*args)) + _cos, _sin = cos(radians(deg)), sin(radians(deg)) + self.arg1, self.arg2, self.arg3 = self.__fastmatmul(_cos + 1j * _sin, 0, c) + self.arg1, self.arg2, self.arg3 = self.__fastmatmul(1 + 0j, 0 + 0j, -c) + self.callback(self) + return self + + def add_skewx(self, deg: float) -> Transform: + """Add skew x to this transformation, and return it""" + ttan = tan(radians(deg)) / 2 + self.arg1, self.arg2, self.arg3 = self.__fastmatmul( + 1 - ttan * 1j, 0 + ttan * 1j, 0 + 0j + ) + self.callback(self) + return self + + def add_skewy(self, deg: float) -> Transform: + """Add skew y to this transformation, and return it""" + ttan = tan(radians(deg)) / 2 + self.arg1, self.arg2, self.arg3 = self.__fastmatmul( + 1 + ttan * 1j, 0 + ttan * 1j, 0 + 0j + ) + self.callback(self) + return self + + def to_hexad(self) -> Tuple[float, float, float, float, float, float]: + """Returns the transform as a hexad matrix (used in svg)""" + return (self.a, self.b, self.c, self.d, self.e, self.f) + + def is_translate(self, exactly: bool = False) -> bool: + """Returns True if this transformation is ONLY translate""" + tol = self.absolute_tolerance if not exactly else 0.0 + return ( + fabs(self.a - 1) <= tol + and abs(self.d - 1) <= tol + and fabs(self.b) <= tol + and fabs(self.c) <= tol + ) + + def is_scale(self, exactly=False): + # type: (bool) -> bool + """Returns True if this transformation is ONLY scale""" + tol = self.absolute_tolerance if not exactly else 0.0 + return ( + fabs(self.e) <= tol + and fabs(self.f) <= tol + and fabs(self.b) <= tol + and fabs(self.c) <= tol + ) + + def is_rotate(self, exactly=False): + # type: (bool) -> bool + """Returns True if this transformation is ONLY rotate""" + tol = self.absolute_tolerance if not exactly else 0.0 + return ( + self._is_URT(exactly=exactly) + and fabs(self.e) <= tol + and fabs(self.f) <= tol + and fabs(self.a**2 + self.b**2 - 1) <= tol + ) + + def rotation_degrees(self): + # type: () -> float + """Return the amount of rotation in this transform""" + if not self._is_URT(exactly=False): + raise ValueError( + "Rotation angle is undefined for non-uniformly scaled or skewed " + "matrices" + ) + return atan2(self.b, self.a) * 180 / pi + + def __str__(self): + # type: () -> str + """Format the given matrix into a string representation for svg""" + hexad = self.to_hexad() + if self.is_translate(): + if not self: + return "" + return f"translate({self.e:.6g}, {self.f:.6g})" + if self.is_scale(): + return f"scale({self.a:.6g}, {self.d:.6g})" + if self.is_rotate(): + return f"rotate({self.rotation_degrees():.6g})" + return f"matrix({' '.join(f'{var:.6g}' for var in hexad)})" + + def __repr__(self) -> str: + """String representation of this object""" + return ( + f"{type(self).__name__}((" + f"({', '.join(f'{var:.6g}' for var in self.matrix[0])}), " + f"({', '.join(f'{var:.6g}' for var in self.matrix[1])})))" + ) + + def __eq__(self, matrix) -> bool: + # typing this requires writing a proof for mypy that matrix is really + # MatrixLike + """Test if this transformation is equal to the given matrix""" + if isinstance(matrix, (str, tuple, list, Transform)): + o = Transform(matrix) + val = ( + cmath.isclose(o.arg1, self.arg1, abs_tol=self.absolute_tolerance) + and cmath.isclose(o.arg2, self.arg2, abs_tol=self.absolute_tolerance) + and cmath.isclose(o.arg3, self.arg3, abs_tol=self.absolute_tolerance) + ) + else: + val = False + return val + + def __fastmatmul( + self, oa1: complex, oa2: complex, oa3: complex + ) -> Tuple[complex, complex, complex]: + """Matrix multiplication without instance checks or transform istantiation + + .. versionadded:: 1.4""" + return ( + self.arg1 * oa1 + self.arg2 * oa2.conjugate(), + self.arg1 * oa2 + self.arg2 * oa1.conjugate(), + self.arg1 * oa3 + self.arg2 * oa3.conjugate() + self.arg3, + ) + + def __matmul__(self, matrix: MatrixLike) -> Transform: + """Combine this transform's internal matrix with the given matrix""" + # Conform the input to a known quantity (and convert if needed) + # Return a transformation as the combined result + try: + oa1, oa2, oa3 = matrix.arg1, matrix.arg2, matrix.arg3 # type: ignore + except AttributeError: + matrix = Transform(matrix) + oa1, oa2, oa3 = matrix.arg1, matrix.arg2, matrix.arg3 + return Transform(*self.__fastmatmul(oa1, oa2, oa3)) + + def __imatmul__(self, matrix: MatrixLike) -> Transform: + """In place multiplication of transform matrices""" + tmp = self @ matrix + self.arg1, self.arg2, self.arg3 = tmp.arg1, tmp.arg2, tmp.arg3 + self.callback(self) + return self + + def __neg__(self) -> Transform: + """Returns an inverted transformation""" + det = (self.arg1 * self.arg1.conjugate()) - (self.arg2 * self.arg2.conjugate()) + + # invert the rotation/scaling part + na1 = self.arg1.conjugate() / det + na2 = -(self.arg2 / det) + # invert the translational part + na3 = -na1 * self.arg3 - na2 * self.arg3.conjugate() + return Transform(na1, na2, na3) + + def capply_to_point(self, point: complex) -> complex: + """Transform a tuple (X, Y), return a complex + + .. versionadded:: 1.4""" + return self.arg1 * point + self.arg2 * point.conjugate() + self.arg3 + + def apply_to_point(self, point: VectorLike) -> Vector2d: + """Transform a vector (X, Y)""" + return Vector2d(self.capply_to_point(complex(Vector2d(point)))) + + def _is_URT(self, exactly=False): + # type: (bool) -> bool + """ + Checks that transformation can be decomposed into product of + Uniform scale (U), Rotation around origin (R) and translation (T) + + :return: decomposition as U*R*T is possible + """ + tol = self.absolute_tolerance if not exactly else 0.0 + return (fabs(self.a - self.d) <= tol) and (fabs(self.b + self.c) <= tol) + + def interpolate(self, other, fraction): + # type: (Transform, float) -> Transform + """Interpolate with another Transform. + + .. versionadded:: 1.1 + """ + from .tween import TransformInterpolator + + return TransformInterpolator(self, other).interpolate(fraction) + + +class BoundingInterval: # pylint: disable=too-few-public-methods + """A pair of numbers that represent the minimum and maximum values.""" + + @overload + def __init__(self, x: Optional[BoundingInterval] = None) -> None: + pass + + @overload + def __init__(self, x: Tuple[float, float]) -> None: + pass + + @overload + def __init__(self, x: float) -> None: + pass + + @overload + def __init__(self, x: float, y: float) -> None: + pass + + def __init__( + self, + x: Union[Optional[BoundingInterval], Tuple[float, float], float] = None, + y: Optional[float] = None, + ) -> None: + self.x: Union[int, float, Decimal] + self.y: Union[int, float, Decimal] + self.minimum: float + self.maximum: float + if y is not None: + if isinstance(x, (int, float, Decimal)) and isinstance( + y, (int, float, Decimal) + ): + self.minimum = float(x) + self.maximum = float(y) + else: + raise ValueError( + f"Not a number for scaling: {str((x, y))} " + f"({type(x).__name__},{type(y).__name__})" + ) + + else: + value = x + if value is None: + # identity for addition, zero for intersection + self.minimum, self.maximum = float("+inf"), float("-inf") + elif isinstance(value, BoundingInterval): + self.minimum = value.minimum + self.maximum = value.maximum + elif isinstance(value, (tuple, list)) and len(value) == 2: + self.minimum, self.maximum = min(value), max(value) + elif isinstance(value, (int, float, Decimal)): + self.minimum = self.maximum = float(value) + else: + raise ValueError( + f"Not a number for scaling: {str(value)} ({type(value).__name__})" + ) + + def __bool__(self): + # type: () -> bool + return isfinite(self.minimum) and isfinite(self.maximum) + + __nonzero__ = __bool__ + + def __neg__(self): + # type: () -> BoundingInterval + return BoundingInterval((-1 * self.maximum, -1 * self.minimum)) + + def __add__(self, other): + # type: (BoundingInterval) -> BoundingInterval + """Calculate the bounding interval that covers both given bounding intervals""" + new = BoundingInterval(self) + if other is not None: + new += other + return new + + def __iadd__(self, other): + # type: (BoundingInterval) -> BoundingInterval + other = BoundingInterval(other) + self.minimum = min((self.minimum, other.minimum)) + self.maximum = max((self.maximum, other.maximum)) + return self + + def __radd__(self, other): + # type: (BoundingInterval) -> BoundingInterval + if other is None: + return BoundingInterval(self) + return self + other + + def __and__(self, other: BoundingInterval) -> BoundingInterval: + """Calculate the bounding interval where both given bounding intervals + overlap""" + new = BoundingInterval(self) + if other is not None: + new &= other + return new + + def __iand__(self, other): + # type: (BoundingInterval) -> BoundingInterval + other = BoundingInterval(other) + self.minimum = max((self.minimum, other.minimum)) + self.maximum = min((self.maximum, other.maximum)) + if self.minimum > self.maximum: + self.minimum, self.maximum = float("+inf"), float("-inf") + return self + + def __rand__(self, other): + # type: (BoundingInterval) -> BoundingInterval + if other is None: + return BoundingInterval(self) + return self & other + + def __mul__(self, other: float) -> BoundingInterval: + new = BoundingInterval(self) + if other is not None: + new *= other + return new + + def __imul__(self, other: float) -> BoundingInterval: + self.minimum *= other + self.maximum *= other + return self + + def __iter__(self) -> Generator[float, None, None]: + yield self.minimum + yield self.maximum + + def __eq__(self, other) -> bool: + return tuple(self) == tuple(BoundingInterval(other)) + + def __contains__(self, value: float) -> bool: + return self.minimum <= value <= self.maximum + + def __repr__(self) -> str: + return f"BoundingInterval({self.minimum}, {self.maximum})" + + @property + def center(self): + # type: () -> float + """Pick the middle of the line""" + return self.minimum + ((self.maximum - self.minimum) / 2) + + @property + def size(self): + # type: () -> float + """Return the size difference minimum and maximum""" + return self.maximum - self.minimum + + +class BoundingBox: # pylint: disable=too-few-public-methods + """ + Some functions to compute a rough bbox of a given list of objects. + + BoundingBox(other) + BoundingBox(x, y) + BoundingBox((x1, x2), (y1, y2)) + """ + + width = property(lambda self: self.x.size) + height = property(lambda self: self.y.size) + top = property(lambda self: self.y.minimum) + left = property(lambda self: self.x.minimum) + bottom = property(lambda self: self.y.maximum) + right = property(lambda self: self.x.maximum) + center_x = property(lambda self: self.x.center) + center_y = property(lambda self: self.y.center) + diagonal_length = property(lambda self: (self.width**2 + self.height**2) ** (0.5)) + + @overload + def __init__(self, other=None): + # type: (Optional[BoundingBox]) -> None + pass + + @overload + def __init__(self, x, y): + # type: (BoundingIntervalArgs, BoundingIntervalArgs) -> None + pass + + def __init__(self, x=None, y=None): + if y is None: + if x is None: + # identity for addition, zero for intersection + pass + elif isinstance(x, BoundingBox): + x, y = x.x, x.y + else: + raise ValueError( + f"Not a number for scaling: {str(x)} ({type(x).__name__})" + ) + self.x = BoundingInterval(x) + self.y = BoundingInterval(y) + + @staticmethod + def new_xywh(x: float, y: float, width: float, height: float) -> BoundingBox: + """Create a bounding box using x, y, width and height + + .. versionadded:: 1.2""" + return BoundingBox((x, x + width), (y, y + height)) + + def __bool__(self): + # type: () -> bool + return bool(self.x) and bool(self.y) + + __nonzero__ = __bool__ + + def __neg__(self): + # type: () -> BoundingBox + return BoundingBox(-self.x, -self.y) + + def __add__(self, other): + # type: (Optional[BoundingBox]) -> BoundingBox + """Calculate the bounding box that covers both given bounding boxes""" + new = BoundingBox(self) + new += BoundingBox(other) + return new + + def __iadd__(self, other): + # type: (Optional[BoundingBox]) -> BoundingBox + other = BoundingBox(other) + self.x += other.x + self.y += other.y + return self + + def __radd__(self, other): + # type: (Optional[BoundingBox]) -> BoundingBox + return self + other + + def __and__(self, other): + # type: (Optional[BoundingBox]) -> BoundingBox + """Calculate the bounding box where both given bounding boxes overlap""" + new = BoundingBox(self) + new &= BoundingBox(other) + return new + + def __iand__(self, other: Optional[BoundingBox]) -> BoundingBox: + other = BoundingBox(other) + self.x = self.x & other.x + self.y = self.y & other.y + if not self.x or not self.y: + self.x, self.y = BoundingInterval(), BoundingInterval() + return self + + def __rand__(self, other): + # type: (Optional[BoundingBox]) -> BoundingBox + return self & other + + def __mul__(self, factor): + # type: (float) -> BoundingBox + new = BoundingBox(self) + new *= factor + return new + + def __imul__(self, factor): + # type: (float) -> BoundingBox + self.x *= factor + self.y *= factor + return self + + def __eq__(self, other): + # type (object) -> bool + if isinstance(other, BoundingBox): + return tuple(self) == tuple(other) + return False + + def __iter__(self) -> Generator[BoundingBox, None, None]: + yield self.x + yield self.y + + @property + def area(self): + """Return area of the bounding box + + .. versionadded:: 1.2""" + return self.width * self.height + + @property + def minimum(self): + # type: () -> Vector2d + """Return the minimum x,y coords""" + return Vector2d(self.x.minimum, self.y.minimum) + + @property + def maximum(self): + # type: () -> Vector2d + """Return the maximum x,y coords""" + return Vector2d(self.x.maximum, self.y.maximum) + + def __repr__(self): + # type: () -> str + return f"BoundingBox({tuple(self.x)},{tuple(self.y)})" + + @property + def center(self): + # type: () -> Vector2d + """Returns the middle of the bounding box""" + return Vector2d(self.x.center, self.y.center) + + @property + def size(self): + """Returns a vector containing width and height of the bounding box + + .. versionadded:: 1.2""" + return Vector2d(self.x.size, self.y.size) + + def get_anchor(self, xanchor, yanchor, direction=0, selbox=None): + # type: (str, str, Union[int, str], Optional[BoundingBox]) -> float + """Calls get_distance with the given anchor options""" + return self.anchor_distance( + getattr(self, XAN[xanchor]), + getattr(self, YAN[yanchor]), + direction=direction, + selbox=selbox, + ) + + @staticmethod + def anchor_distance( + x: float, + y: float, + direction: Union[int, str] = 0, + selbox: Optional[BoundingBox] = None, + ) -> float: + """Using the x,y returns a single sortable value based on direction and angle + + Args: + x (float): input x coordinate + y (float): input y coordinate + direction (Union[int, str], optional): int/float (custom angle), + tb/bt (top/bottom), lr/rl (left/right), ri/ro (radial). Defaults to 0. + selbox (Optional[BoundingBox], optional): The bounding box of the whole + selection for radial anchors. Defaults to None. + + Raises: + ValueError: if radial distance is requested without the optional selbox + parameter. + + Returns: + float: the anchor distance with respect to the direction. + """ + + rot = 0.0 + if isinstance(direction, (int, float)): # Angle + if direction not in CUSTOM_DIRECTION: + return hypot(x, y) * (cos(radians(-direction) - atan2(y, x))) + direction = CUSTOM_DIRECTION[direction] + + if direction in ("ro", "ri"): + if selbox is None: + raise ValueError( + "Radial distance not available without selection bounding box" + ) + rot = hypot(selbox.x.center - x, selbox.y.center - y) + + return [y, -y, x, -x, rot, -rot][DIRECTION.index(direction)] + + def resize(self, delta_x: float, delta_y: Optional[float] = None) -> BoundingBox: + """Enlarges / shrinks a bounding box by a constant value. If only delta_x + is given, each side is moved by the same amount; if delta_y is given, + different deltas are applied to horizontal and vertical intervals. + + .. versionadded:: 1.2""" + delta_y = delta_y or delta_x + return BoundingBox( + (self.x.minimum - delta_x, self.x.maximum + delta_x), + (self.y.minimum - delta_y, self.y.maximum + delta_y), + ) + + +class DirectedLineSegment: + """ + A directed line segment + + DirectedLineSegment(((x0, y0), (x1, y1))) + """ + + start = Vector2d() # start point of segment + end = Vector2d() # end point of segment + + x0 = property(lambda self: self.start.x) # pylint: disable=invalid-name + y0 = property(lambda self: self.start.y) # pylint: disable=invalid-name + x1 = property(lambda self: self.end.x) + y1 = property(lambda self: self.end.y) + dx = property(lambda self: self.vector.x) # pylint: disable=invalid-name + dy = property(lambda self: self.vector.y) # pylint: disable=invalid-name + + @overload + def __init__(self): + # type: () -> None + pass + + @overload + def __init__(self, other): + # type: (DirectedLineSegment) -> None + pass + + @overload + def __init__(self, start, end): + # type: (VectorLike, VectorLike) -> None + pass + + def __init__(self, *args): + if not args: # overload 0 + start, end = Vector2d(), Vector2d() + elif len(args) == 1: # overload 1 + (other,) = args + start, end = other.start, other.end + elif len(args) == 2: # overload 2 + start, end = args + else: + raise ValueError(f"DirectedLineSegment() can't be constructed from {args}") + + self.start = Vector2d(start) + self.end = Vector2d(end) + + def __eq__(self, other): + # type: (object) -> bool + if isinstance(other, (tuple, DirectedLineSegment)): + return tuple(self) == tuple(other) + return False + + def __iter__(self): + # type: () -> Generator[DirectedLineSegment, None, None] + yield self.x0 + yield self.x1 + yield self.y0 + yield self.y1 + + @property + def vector(self): + # type: () -> Vector2d + """The vector of the directed line segment. + + The vector of the directed line segment represents the length + and direction of segment, but not the starting point. + + .. versionadded:: 1.1 + """ + return self.end - self.start + + @property + def length(self): + # type: () -> float + """Get the length of the line segment""" + return self.vector.length + + @property + def angle(self): + # type: () -> float + """Get the angle of the line created by this segment""" + return atan2(self.dy, self.dx) + + def distance_to_point(self, x, y): + # type: (float, float) -> Union[DirectedLineSegment, Optional[float]] + """Get the distance to the given point (x, y)""" + segment2 = DirectedLineSegment(self.start, (x, y)) + dot2 = segment2.dot(self) + if dot2 <= 0: + return DirectedLineSegment((x, y), self.start).length + if self.dot(self) <= dot2: + return DirectedLineSegment((x, y), self.end).length + return self.perp_distance(x, y) + + def perp_distance(self, x, y): + # type: (float, float) -> Optional[float] + """Perpendicular distance to the given point""" + if self.length == 0: + return None + return fabs((self.dx * (self.y0 - y)) - ((self.x0 - x) * self.dy)) / self.length + + def dot(self, other): + # type: (DirectedLineSegment) -> float + """Get the dot product with the segment with another""" + return self.vector.dot(other.vector) + + def point_at_ratio(self, ratio): + # type: (float) -> Tuple[float, float] + """Get the point at the given ratio along the line""" + return self.x0 + ratio * self.dx, self.y0 + ratio * self.dy + + def point_at_length(self, length): + # type: (float) -> Tuple[float, float] + """Get the point as the length along the line""" + return self.point_at_ratio(length / self.length) + + def parallel(self, x, y): + # type: (float, float) -> DirectedLineSegment + """Create parallel Segment""" + return DirectedLineSegment((x + self.dx, y + self.dy), (x, y)) + + def intersect(self, other): + # type: (DirectedLineSegment) -> Optional[Vector2d] + """Get the intersection between two segments""" + other = DirectedLineSegment(other) + denom = self.vector.cross(other.vector) + num = other.vector.cross(self.start - other.start) + + if denom != 0: + return Vector2d(self.point_at_ratio(num / denom)) + return None + + def __repr__(self): + # type: () -> str + return f"DirectedLineSegment(({self.start}), ({self.end}))" + + +def cubic_extrema(py0, py1, py2, py3): + # type: (float, float, float, float) -> Tuple[float, float] + """Returns the extreme value, given a set of bezier coordinates""" + + atol = 1e-9 + cmin, cmax = min(py0, py3), max(py0, py3) + pd1 = py1 - py0 + pd2 = py2 - py1 + pd3 = py3 - py2 + + def _is_bigger(point): + if 0 < point < 1: + pyx = ( + py0 * (1 - point) * (1 - point) * (1 - point) + + 3 * py1 * point * (1 - point) * (1 - point) + + 3 * py2 * point * point * (1 - point) + + py3 * point * point * point + ) + return min(cmin, pyx), max(cmax, pyx) + return cmin, cmax + + if fabs(pd1 - 2 * pd2 + pd3) > atol: + if pd2 * pd2 > pd1 * pd3: + pds = sqrt(pd2 * pd2 - pd1 * pd3) + cmin, cmax = _is_bigger((pd1 - pd2 + pds) / (pd1 - 2 * pd2 + pd3)) + cmin, cmax = _is_bigger((pd1 - pd2 - pds) / (pd1 - 2 * pd2 + pd3)) + + elif fabs(pd2 - pd1) > atol: + cmin, cmax = _is_bigger(-pd1 / (2 * (pd2 - pd1))) + + return cmin, cmax + + +def quadratic_extrema(py0, py1, py2): + # type: (float, float, float) -> Tuple[float, float] + """Returns the extreme value, given a set of quadratic bezier coordinates""" + atol = 1e-9 + cmin, cmax = min(py0, py2), max(py0, py2) + + def _is_bigger(point): + if 0 < point < 1: + pyx = ( + py0 * (1 - point) * (1 - point) + + 2 * py1 * point * (1 - point) + + py2 * point * point + ) + return min(cmin, pyx), max(cmax, pyx) + return cmin, cmax + + if fabs(py0 + py2 - 2 * py1) > atol: + cmin, cmax = _is_bigger((py0 - py1) / (py0 + py2 - 2 * py1)) + + return cmin, cmax diff --git a/extensions/botbox3000/deps/inkex/turtle.py b/extensions/botbox3000/deps/inkex/turtle.py new file mode 100644 index 0000000..b032102 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/turtle.py @@ -0,0 +1,258 @@ +# coding=utf-8 +# +# Copyright (C) 2005 Aaron Spike, aaron@ekips.org +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""A Python path turtle for Inkscape extensions""" + +import math +import random +from typing import List, Union + +from .paths import Line, Move, Path, PathCommand +from .elements import PathElement, Group, BaseElement +from .styles import Style + + +class PathTurtle: + """A Python path turtle + + .. versionchanged:: 1.2 + pTurtle has been renamed to PathTurtle.""" + + def __init__(self, home=(0, 0)): + self.__home = [home[0], home[1]] + self.__pos = self.__home[:] + self.__heading = -90 + self.__path = "" + self.__draw = True + self.__new = True + + def forward(self, mag: float): + """Move turtle forward by mag in the current direction.""" + self.setpos( + ( + self.__pos[0] + math.cos(math.radians(self.__heading)) * mag, + self.__pos[1] + math.sin(math.radians(self.__heading)) * mag, + ) + ) + + def backward(self, mag): + """Move turtle backward by mag in the current direction.""" + self.setpos( + ( + self.__pos[0] - math.cos(math.radians(self.__heading)) * mag, + self.__pos[1] - math.sin(math.radians(self.__heading)) * mag, + ) + ) + + def right(self, deg): + """Rotate turtle right by deg degrees. + + Changed in inkex 1.2: The turtle now rotates right (previously left) when + calling this method.""" + self.__heading += deg + + def left(self, deg): + """Rotate turtle left by deg degrees. + + Changed in inkex 1.2: The turtle now rotates left (previously right) when + calling this method.""" + self.__heading -= deg + + def penup(self): + """Enable non-drawing / moving mode""" + self.__draw = False + self.__new = False + + def pendown(self): + """Enable drawing mode""" + if not self.__draw: + self.__new = True + self.__draw = True + + def pentoggle(self): + """Switch between drawing and moving mode""" + if self.__draw: + self.penup() + else: + self.pendown() + + def home(self): + """Move to home position""" + self.setpos(self.__home) + + def clean(self): + """Delete current path""" + self.__path = "" + + def clear(self): + """Delete current path and move to home""" + self.clean() + self.home() + + def setpos(self, arg): + """Move/draw to position, depending on the current state""" + if self.__new: + self.__path += "M" + ",".join([str(i) for i in self.__pos]) + self.__new = False + self.__pos = arg + if self.__draw: + self.__path += "L" + ",".join([str(i) for i in self.__pos]) + + def getpos(self): + """Returns the current position""" + return self.__pos[:] + + def setheading(self, deg): + """Set the heading to deg degrees""" + self.__heading = deg + + def getheading(self): + """Returns the heading in degrees""" + return self.__heading + + def sethome(self, arg): + """Set home position""" + self.__home = list(arg) + + def getPath(self): + """Returns the current path""" + return self.__path + + def rtree(self, size, minimum, pt=False): + """Generates a random tree""" + if size < minimum: + return + self.fd(size) + turn = random.uniform(20, 40) + self.rt(turn) + self.rtree(size * random.uniform(0.5, 0.9), minimum, pt) + self.lt(turn) + turn = random.uniform(20, 40) + self.lt(turn) + self.rtree(size * random.uniform(0.5, 0.9), minimum, pt) + self.rt(turn) + if pt: + self.pu() + self.bk(size) + if pt: + self.pd() + + # pylint: disable=invalid-name + fd = forward + bk = backward + rt = right + lt = left + pu = penup + pd = pendown + + +pTurtle = PathTurtle # should be deprecated + + +class PathBuilder: + """This helper class can be used to construct a path and insert it into a + document. + + .. versionadded:: 1.2""" + + def __init__(self, style: Style): + """Initializes a PathDrawHelper object + + Args: + style (Style): Style of the path. + """ + self.current = Path() + self.style = style + + def add(self, command: Union[PathCommand, List[PathCommand]]): + """Add a Path command to the Helper + + Args: + command (Union[PathCommand, List[PathCommand]]): A (list of) PathCommand(s) + to be appended. + """ + if isinstance(command, list): + self.current.extend(command) + else: + self.current.append(command) + + def terminate(self): + """Terminates current subpath. This method does nothing by default and is + supposed to be overridden in subclasses.""" + + def append_next(self, sibling_before: BaseElement): + """Insert the resulting Path as :class:`inkex.elements._polygons.PathElement` + into the document tree. + + Args: + sibling_before (BaseElement): The element the resulting path will be + appended after. + """ + pth = PathElement() + pth.path = self.current + pth.style = self.style + sibling_before.addnext(pth) + + def Move_to(self, x, y): # pylint: disable=invalid-name + """Shorthand to insert an absolute move command: `M x y`. + + Args: + x (Float): x coordinate to move to + y (Float): y coordinate to move to + """ + self.add(Move(x, y)) + + def Line_to(self, x, y): # pylint: disable=invalid-name + """Shorthand to insert an absolute lineto command: `L x y`. + + Args: + x (Float): x coordinate to draw a line to + y (Float): y coordinate to draw a line to + """ + self.add(Line(x, y)) + + +class PathGroupBuilder(PathBuilder): + """This helper class can be used to construct a group of paths that all have the + same style. + + .. versionadded:: 1.2""" + + def __init__(self, style): + super().__init__(style) + self.result = Group() + + def terminate(self): + """Terminates the current Path, and appends it to the group if it is not + empty.""" + if len(self.current) > 1: + pth = PathElement() + pth.path = self.current.to_absolute() + pth.style = self.style + self.result.append(pth) + self.current = Path() + + def append_next(self, sibling_before: BaseElement): + """Insert the resulting Path as :class:`inkex.elements._groups.Group` into the + document tree. + + Args: + sibling_before (BaseElement): The element the resulting group will be + appended after. + """ + sibling_before.addnext(self.result) diff --git a/extensions/botbox3000/deps/inkex/tween.py b/extensions/botbox3000/deps/inkex/tween.py new file mode 100644 index 0000000..b89351a --- /dev/null +++ b/extensions/botbox3000/deps/inkex/tween.py @@ -0,0 +1,862 @@ +# coding=utf-8 +# +# Copyright (C) 2005 Aaron Spike, aaron@ekips.org +# 2020 Jonathan Neuhauser, jonathan.neuhauser@outlook.com +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +"""Module for interpolating attributes and styles + +.. versionchanged:: 1.2 + Rewritten in inkex 1.2 in an object-oriented structure to support more attributes. +""" + +from bisect import bisect_left +import abc +import copy + +from .styles import Style +from .elements._filters import LinearGradient, RadialGradient, Stop +from .transforms import Transform +from .colors import Color +from .units import convert_unit, parse_unit, render_unit +from .bezier import bezlenapprx, cspbezsplit, cspbezsplitatlength, csplength +from .paths import Path, CubicSuperPath +from .elements import SvgDocumentElement +from .utils import FragmentError + + +try: + from typing import Tuple, TypeVar + + Value = TypeVar("Value") + Number = TypeVar("Number", int, float) +except ImportError: + pass + + +def interpcoord(coord_a: Number, coord_b: Number, time: float): + """Interpolate single coordinate by the amount of time""" + return ValueInterpolator(coord_a, coord_b).interpolate(time) + + +def interppoints(point1, point2, time): + # type: (Tuple[float, float], Tuple[float, float], float) -> Tuple[float, float] + """Interpolate coordinate points by amount of time""" + return ArrayInterpolator(point1, point2).interpolate(time) + + +class AttributeInterpolator(abc.ABC): + """Interpolate between attributes""" + + def __init__(self, start_value, end_value): + self.start_value = start_value + self.end_value = end_value + + @staticmethod + def best_style(node): + """Gets the best possible approximation to a node's style. For nodes inside the + element tree of an SVG file, stylesheets defined in the defs of that file can be + taken into account. This should be the case for input elements, but is not + required - in that case, only the local inline style is used. + + During the interpolation process, some nodes are created temporarily, such as + plain gradients of a single color to allow solid<->gradient interpolation. These + are not attached to the document tree and therefore have no root. Since the only + style relevant for them is the inline style, it is acceptable to fallback to it. + + Args: + node (BaseElement): The node to get the best approximated style of + + Returns: + Style: If the node is rooted, the CSS specified style. Else, the inline + style.""" + try: + return node.specified_style() + except FragmentError: + return node.style + + @staticmethod + def create_from_attribute(snode, enode, attribute, method=None): + """Creates an interpolator for an attribute. Currently, only path, transform and + style attributes are supported + + Args: + snode (BaseElement): start element + enode (BaseElement): end element + attribute (str): attribute name (for styles, starting with "style/") + method (AttributeInterpolator, optional): (currently only used for paths). + Specifies a method used to interpolate the attribute. Defaults to None. + + Raises: + ValueError: if an attribute is passed that is not a style, path or transform + attribute + + Returns: + AttributeInterpolator: an interpolator whose type depends on attribute. + """ + if attribute in Style.color_props: + return StyleInterpolator.create_from_fill_stroke(snode, enode, attribute) + if attribute == "d": + if method is None: + method = FirstNodesInterpolator + return method(snode.path, enode.path) + if attribute == "style": + return StyleInterpolator(snode, enode) + if attribute.startswith("style/"): + return StyleInterpolator.create(snode, enode, attribute[6:]) + if attribute == "transform": + return TransformInterpolator(snode.transform, enode.transform) + if method is not None: + return method(snode.get(attribute), enode.get(attribute)) + raise ValueError("only path and style attributes are supported") + + @abc.abstractmethod + def interpolate(self, time=0): + """Interpolation method, needs to be implemented by subclasses""" + return + + +class StyleInterpolator(AttributeInterpolator): + """Class to interpolate styles""" + + def __init__(self, start_value, end_value): + super().__init__(start_value, end_value) + self.interpolators = {} + # some keys are always processed in a certain order, these provide alternative + # interpolation routes if e.g. Color<->none is interpolated + all_keys = list( + dict.fromkeys( + ["fill", "stroke", "fill-opacity", "stroke-opacity", "stroke-width"] + + list(self.best_style(start_value).keys()) + + list(self.best_style(end_value).keys()) + ) + ) + for attr in all_keys: + sstyle = self.best_style(start_value) + estyle = self.best_style(end_value) + if attr not in sstyle and attr not in estyle: + continue + try: + interp = StyleInterpolator.create( + self.start_value, self.end_value, attr + ) + self.interpolators[attr] = interp + except ValueError: + # no interpolation method known for this attribute + pass + + @staticmethod + def create(snode, enode, attribute): + """Creates an Interpolator for a given style attribute, depending on its type: + + - Color properties (such as fill, stroke) -> :class:`ColorInterpolator`, + :class:`GradientInterpolator` ect. + - Unit properties -> :class:`UnitValueInterpolator` + - other properties -> :class:`ValueInterpolator` + + Args: + snode (BaseElement): start element + enode (BaseElement): end element + attribute (str): attribute to interpolate + + Raises: + ValueError: if the attribute is not in any of the lists + + Returns: + AttributeInterpolator: an interpolator object whose type depends on the + attribute. + """ + if attribute in Style.color_props: + return StyleInterpolator.create_from_fill_stroke(snode, enode, attribute) + + if attribute in Style.unit_props: + return UnitValueInterpolator( + AttributeInterpolator.best_style(snode)(attribute), + AttributeInterpolator.best_style(enode)(attribute), + ) + + if attribute in Style.opacity_props: + return ValueInterpolator( + AttributeInterpolator.best_style(snode)(attribute), + AttributeInterpolator.best_style(enode)(attribute), + ) + + raise ValueError("Unknown attribute") + + @staticmethod + def create_from_fill_stroke(snode, enode, attribute): + """Creates an Interpolator for a given color-like attribute + + Args: + snode (BaseElement): start element + enode (BaseElement): end element + attribute (str): attribute to interpolate + + Raises: + ValueError: if the attribute is not color-like + ValueError: if the attribute is unset on both start and end style + + Returns: + AttributeInterpolator: an interpolator object whose type depends on the + attribute. + """ + if attribute not in Style.color_props: + raise ValueError("attribute must be a color property") + + sstyle = AttributeInterpolator.best_style(snode) + estyle = AttributeInterpolator.best_style(enode) + + styles = [[snode, sstyle], [enode, estyle]] + for cur, curstyle in styles: + if curstyle(attribute) is None: + cur.style[attribute + "-opacity"] = 0.0 + if attribute == "stroke": + cur.style["stroke-width"] = 0.0 + + # check if style is none, unset or a color + if isinstance( + sstyle(attribute), (LinearGradient, RadialGradient) + ) or isinstance(estyle(attribute), (LinearGradient, RadialGradient)): + # if one of the two styles is a gradient, use gradient interpolation. + try: + return GradientInterpolator.create(snode, enode, attribute) + except ValueError: + # different gradient types, just duplicate the first + return TrivialInterpolator(sstyle(attribute)) + if sstyle(attribute) is None and estyle(attribute) is None: + return TrivialInterpolator("none") + return ColorInterpolator.create(sstyle, estyle, attribute) + + def interpolate(self, time=0): + """Interpolates a style using the interpolators set in self.interpolators + + Args: + time (int, optional): Interpolation position. If 0, start_value is returned, + if 1, end_value is returned. Defaults to 0. + + Returns: + inkex.Style: interpolated style + """ + style = Style() + for prop, interp in self.interpolators.items(): + style[prop] = interp.interpolate(time) + return style + + +class TrivialInterpolator(AttributeInterpolator): + """Trivial interpolator, returns value for every time""" + + def __init__(self, value): + super().__init__(value, value) + + def interpolate(self, time=0): + return self.start_value + + +class ValueInterpolator(AttributeInterpolator): + """Class for interpolation of a single value""" + + def __init__(self, start_value=0, end_value=0): + super().__init__(float(start_value), float(end_value)) + + def interpolate(self, time=0): + """(Linearly) interpolates a value + + Args: + time (int, optional): Interpolation position. If 0, start_value is returned, + if 1, end_value is returned. Defaults to 0. + + Returns: + int: interpolated value + """ + return self.start_value + ((self.end_value - self.start_value) * time) + + +class UnitValueInterpolator(ValueInterpolator): + """Class for interpolation of a value with unit""" + + def __init__(self, start_value=0, end_value=0): + start_val, start_unit = parse_unit(start_value) + end_val = convert_unit(end_value, start_unit) + super().__init__(start_val, end_val) + self.unit = start_unit + + def interpolate(self, time=0): + return render_unit(super().interpolate(time), self.unit) + + +class ArrayInterpolator(AttributeInterpolator): + """Interpolates array-like objects element-wise, e.g. color, transform, + coordinate""" + + def __init__(self, start_value, end_value): + super().__init__(start_value, end_value) + self.interpolators = [ + ValueInterpolator(cur, other) + for (cur, other) in zip(start_value, end_value) + ] + + def interpolate(self, time=0): + """Interpolates an array element-wise + + Args: + time (int, optional): [description]. Defaults to 0. + + Returns: + List: interpolated array + """ + return [interp.interpolate(time) for interp in self.interpolators] + + +class TransformInterpolator(ArrayInterpolator): + """Class for interpolation of transforms""" + + def __init__(self, start_value=Transform(), end_value=Transform()): + """Creates a transform interpolator. + + Args: + start_value (inkex.Transform, optional): start transform. Defaults to + inkex.Transform(). + end_value (inkex.Transform, optional): end transform. Defaults to + inkex.Transform(). + """ + super().__init__(start_value.to_hexad(), end_value.to_hexad()) + + def interpolate(self, time=0): + """Interpolates a transform by interpolating each item in the transform hexad + separately. + + Args: + time (int, optional): Interpolation position. If 0, start_value is returned, + if 1, end_value is returned. Defaults to 0. + + Returns: + Transform: interpolated transform + """ + return Transform(super().interpolate(time)) + + +class ColorInterpolator(ArrayInterpolator): + """Class for color interpolation""" + + @staticmethod + def create(sst, est, attribute): + """Creates a ColorInterpolator for either Fill or stroke, depending on the + attribute. + + Args: + sst (Style): Start style + est (Style): End style + attribute (string): either fill or stroke + + Raises: + ValueError: if none of the start or end style is a color. + + Returns: + ColorInterpolator: A ColorInterpolator object + """ + styles = [sst, est] + for cur, other in zip(styles, reversed(styles)): + if not isinstance(cur(attribute), Color) or cur(attribute) is None: + cur[attribute] = other(attribute) + this = ColorInterpolator( + Color(styles[0](attribute)), Color(styles[1](attribute)) + ) + if this is None: + raise ValueError("One of the two attribute needs to be a plain color") + return this + + def __init__(self, start_value=Color("#000000"), end_value=Color("#000000")): + # Remember what type the color was, handle none types as a special case + # so we can tween from "none" to some color effectively. + self.output_type = type(start_value) + if self.output_type.name == "none": + self.output_type = type(end_value) + + # We tween alpha is there is any in either value + tween_alpha = ( + start_value.effective_alpha != end_value.effective_alpha + or start_value.alpha is not None + or end_value.alpha is not None + ) + super().__init__( + start_value.get_values(tween_alpha), end_value.get_values(tween_alpha) + ) + + def interpolate(self, time=0): + """Interpolates a color by interpolating its channels separately. + + Args: + time (int, optional): Interpolation position. If 0, start_value is returned, + if 1, end_value is returned. Defaults to 0. + + Returns: + Color: interpolated color + """ + return self.output_type(list(map(float, super().interpolate(time)))) + + +class GradientInterpolator(AttributeInterpolator): + """Base class for Gradient Interpolation""" + + def __init__(self, start_value, end_value, svg=None): + super().__init__(start_value, end_value) + self.svg = svg + # If one of the styles is empty, set it to the gradient of the other + if start_value is None: + self.start_value = end_value + if end_value is None: + self.end_value = start_value + self.transform_interpolator = TransformInterpolator( + self.start_value.gradientTransform, self.end_value.gradientTransform + ) + self.orientation_interpolator = { + attr: UnitValueInterpolator( + self.start_value.get(attr), self.end_value.get(attr) + ) + for attr in self.start_value.orientation_attributes + if self.start_value.get(attr) is not None + and self.end_value.get(attr) is not None + } + if not ( + self.start_value.href is not None + and self.start_value.href is self.end_value.href + ): + # the gradient link to different stops, interpolate between them + # add both start and end offsets, then take distict + newoffsets = sorted( + list(set(self.start_value.stop_offsets + self.end_value.stop_offsets)) + ) + + def func(start, end, time): + return StopInterpolator(start, end).interpolate(time) + + sstops = GradientInterpolator.interpolate_linear_list( + self.start_value.stop_offsets, + list(self.start_value.stops), + newoffsets, + func, + ) + ostops = GradientInterpolator.interpolate_linear_list( + self.end_value.stop_offsets, + list(self.end_value.stops), + newoffsets, + func, + ) + self.newstop_interpolator = [ + StopInterpolator(s1, s2) for s1, s2 in zip(sstops, ostops) + ] + else: + self.newstop_interpolator = None + + @staticmethod + def create(snode, enode, attribute): + """Creates a `GradientInterpolator` for either fill or stroke, depending on + attribute. + + Cases: (A, B) -> Interpolator + + - Linear Gradient, Linear Gradient -> LinearGradientInterpolator + - Color or None, Linear Gradient -> LinearGradientInterpolator + - Radial Gradient, Radial Gradient -> RadialGradientInterpolator + - Color or None, Radial Gradient -> RadialGradientInterpolator + - Radial Gradient, Linear Gradient -> ValueError + - Color or None, Color or None -> ValueError + + Args: + snode (BaseElement): start element + enode (BaseElement): end element + attribute (string): either fill or stroke + + Raises: + ValueError: if none of the styles are a gradient or if they are gradients + of different types + + Returns: + GradientInterpolator: an Interpolator object + """ + interpolator = None + gradienttype = None + # first find out which type of interpolator we need + sstyle = AttributeInterpolator.best_style(snode) + estyle = AttributeInterpolator.best_style(enode) + for cur in [sstyle, estyle]: + curgrad = None + if isinstance(cur(attribute), (LinearGradient, RadialGradient)): + curgrad = cur(attribute) + for gradtype, interp in [ + [LinearGradient, LinearGradientInterpolator], + [RadialGradient, RadialGradientInterpolator], + ]: + if curgrad is not None and isinstance(curgrad, gradtype): + if interpolator is None: + interpolator = interp + gradienttype = gradtype + if not (interp == interpolator): + raise ValueError("Gradient types don't match") + # If one of the styles is empty, set it to the gradient of the other, but with + # zero opacity (and stroke-width for strokes) + # If one of the styles is a plain color, replace it by a gradient with a single + # stop + iterator = [[snode, gradienttype(), enode], [enode, gradienttype(), snode]] + for index in [0, 1]: + curstyle = AttributeInterpolator.best_style(iterator[index][0]) + value = curstyle(attribute) + if value is None: + # if the attribute of one of the two ends is unset, set the opacity to + # zero. + iterator[index][0].style[attribute + "-opacity"] = 0.0 + if attribute == "stroke": + iterator[index][0].style["stroke-width"] = 0.0 + if isinstance(value, Color): + # if the attribute of one of the two ends is a color, convert it to a + # one-stop gradient. Type depends on the type of the other gradient. + interpolator.initialize_position( + iterator[index][1], iterator[index][0].bounding_box() + ) + stop = Stop() + stop.style = Style() + stop.style["stop-color"] = value + stop.offset = 0 + iterator[index][1].add(stop) + stop = Stop() + stop.style = Style() + stop.style["stop-color"] = value + stop.offset = 1 + iterator[index][1].add(stop) + else: + iterator[index][1] = value # is a gradient + if interpolator is None: + raise ValueError("None of the two styles is a gradient") + if interpolator in [LinearGradientInterpolator, RadialGradientInterpolator]: + return interpolator(iterator[0][1], iterator[1][1], snode) + return interpolator(iterator[0][1], iterator[1][1]) + + @staticmethod + def interpolate_linear_list(positions, values, newpositions, func): + """Interpolates a list of values given at n positions to the best approximation + at m newpositions. + + >>> + | + | x + | x + _________________ + pq q p q + (x denotes function values, p: positions, q: newpositions) + A function may be given to interpolate between given values. + + Args: + positions (list[number-like]): position of current function values + values (list[Type]): list of arbitrary type, + ``len(values) == len(positions)`` + newpositions (list[number-like]): position of interpolated values + func (Callable[[Type, Type, float], Type]): Function to interpolate between + values + + Returns: + list[Type]: interpolated function values at positions + """ + newvalues = [] + positions = list(map(float, positions)) + newpositions = list(map(float, newpositions)) + for pos in newpositions: + if len(positions) == 1: + newvalues.append(values[0]) + else: + # current run: + # idxl pos idxr + # p p | p + # q q + idxl = max(0, bisect_left(positions, pos) - 1) + idxr = min(len(positions) - 1, idxl + 1) + fraction = (pos - positions[idxl]) / (positions[idxr] - positions[idxl]) + vall = values[idxl] + valr = values[idxr] + newval = func(vall, valr, fraction) + newvalues.append(newval) + return newvalues + + @staticmethod + def append_to_doc(element, gradient): + """Splits a gradient into stops and orientation, appends it to the document's + defs and returns the href to the orientation gradient. + + Args: + element (BaseElement): an element inside the SVG that the gradient should be + added to + gradient (Gradient): the gradient to append to the document + + Returns: + Gradient: the orientation gradient, or the gradient object if + element has no root or is None + """ + stops, orientation = gradient.stops_and_orientation() + if element is None or ( + element.getparent() is None and not isinstance(element, SvgDocumentElement) + ): + return gradient + element.root.defs.add(orientation) + if len(stops) > 0: + element.root.defs.add(stops, orientation) + orientation.href = stops.get_id() + return orientation + + def interpolate(self, time=0): + """Interpolate with another gradient.""" + newgrad = self.start_value.copy() + # interpolate transforms + newgrad.gradientTransform = self.transform_interpolator.interpolate(time) + + # interpolate orientation + for attr in self.orientation_interpolator.keys(): + newgrad.set(attr, self.orientation_interpolator[attr].interpolate(time)) + + # interpolate stops + if self.newstop_interpolator is not None: + newgrad.remove_all(Stop) + newgrad.add( + *[interp.interpolate(time) for interp in self.newstop_interpolator] + ) + if self.svg is None: + return newgrad + return GradientInterpolator.append_to_doc(self.svg, newgrad) + + +class LinearGradientInterpolator(GradientInterpolator): + """Class for interpolation of linear gradients""" + + def __init__( + self, start_value=LinearGradient(), end_value=LinearGradient(), svg=None + ): + super().__init__(start_value, end_value, svg) + + @staticmethod + def initialize_position(grad, bbox): + """Initializes a linear gradient's position""" + grad.set("x1", bbox.left) + grad.set("x2", bbox.right) + grad.set("y1", bbox.center.y) + grad.set("y2", bbox.center.y) + + +class RadialGradientInterpolator(GradientInterpolator): + """Class to interpolate radial gradients""" + + def __init__( + self, start_value=RadialGradient(), end_value=RadialGradient(), svg=None + ): + super().__init__(start_value, end_value, svg) + + @staticmethod + def initialize_position(grad, bbox): + """Initializes a radial gradient's position""" + x, y = bbox.center + grad.set("cx", x) + grad.set("cy", y) + grad.set("fx", x) + grad.set("fy", y) + grad.set("r", bbox.right - bbox.center.x) + + +class StopInterpolator(AttributeInterpolator): + """Class to interpolate gradient stops""" + + def __init__(self, start_value, end_value): + super().__init__(start_value, end_value) + self.style_interpolator = StyleInterpolator(start_value, end_value) + self.position_interpolator = ValueInterpolator( + float(start_value.offset), float(end_value.offset) + ) + + def interpolate(self, time=0): + """Interpolates a gradient stop by interpolating style and offset separately + + Args: + time (int, optional): Interpolation position. If 0, start_value is returned, + if 1, end_value is returned. Defaults to 0. + + Returns: + Stop: interpolated gradient stop + """ + newstop = Stop() + newstop.style = self.style_interpolator.interpolate(time) + newstop.offset = self.position_interpolator.interpolate(time) + return newstop + + +class PathInterpolator(AttributeInterpolator): + """Base class for Path interpolation""" + + def __init__(self, start_value=Path(), end_value=Path()): + super().__init__(start_value.to_superpath(), end_value.to_superpath()) + self.processed_end_path = None + self.processed_start_path = None + + def truncate_subpaths(self): + """Truncates the longer path so that all subpaths in both paths have an equal + number of bezier commands""" + s = [[]] + e = [[]] + # loop through all subpaths as long as there are remaining ones + while self.start_value and self.end_value: + # if both subpaths contain a bezier command, append it to s and e + if self.start_value[0] and self.end_value[0]: + s[-1].append(self.start_value[0].pop(0)) + e[-1].append(self.end_value[0].pop(0)) + # if the subpath of start_value is empty, add the remaining empty list as + # new subpath of s and one more item of end_value as new subpath of e. + # Afterwards, the loop terminates + elif self.end_value[0]: + s.append(self.start_value.pop(0)) + e[-1].append(self.end_value[0][0]) + e.append([self.end_value[0].pop(0)]) + elif self.start_value[0]: + e.append(self.end_value.pop(0)) + s[-1].append(self.start_value[0][0]) + s.append([self.start_value[0].pop(0)]) + # if there are no commands left in both start_value or end_value, add empty + # list to both start_value and end_value + else: + s.append(self.start_value.pop(0)) + e.append(self.end_value.pop(0)) + self.processed_start_path = s + self.processed_end_path = e + + def interpolate(self, time=0): + # create an interpolated path for each interval + interp = [] + # process subpaths + for ssubpath, esubpath in zip( + self.processed_start_path, self.processed_end_path + ): + if not (ssubpath or esubpath): + break + # add a new subpath to the interpolated path + interp.append([]) + # process each bezier command in the subpaths (which now have equal length) + for sbezier, ebezier in zip(ssubpath, esubpath): + if not (sbezier or ebezier): + break + # add a new bezier command to the last subpath + interp[-1].append([]) + # process points + for point1, point2 in zip(sbezier, ebezier): + if not (point1 or point2): + break + # add a new point to the last bezier command + interp[-1][-1].append( + ArrayInterpolator(point1, point2).interpolate(time) + ) + # remove final subpath if empty. + if not interp[-1]: + del interp[-1] + return CubicSuperPath(interp) + + +class EqualSubsegmentsInterpolator(PathInterpolator): + """Interpolates the path by rediscretizing the subpaths first.""" + + @staticmethod + def get_subpath_lenghts(path): + """prepare lengths for interpolation""" + sp_lenghts, total = csplength(path) + t = 0 + lenghts = [] + for sp in sp_lenghts: + for l in sp: + t += l / total + lenghts.append(t) + lenghts.sort() + return sp_lenghts, total, lenghts + + @staticmethod + def process_path(path, other): + """Rediscretize path so that all subpaths have an equal number of segments, + so that there is a node at the path "times" where path or other have a node + + Args: + path (Path): the first path + other (Path): the second path + + Returns: + Array: the prepared path description for the intermediate path""" + sp_lenghts, total, _ = EqualSubsegmentsInterpolator.get_subpath_lenghts(path) + _, _, lenghts = EqualSubsegmentsInterpolator.get_subpath_lenghts(other) + t = 0 + s = [[]] + for sp in sp_lenghts: + if not path[0]: + s.append(path.pop(0)) + s[-1].append(path[0].pop(0)) + for l in sp: + pt = t + t += l / total + if lenghts and t > lenghts[0]: + while lenghts and lenghts[0] < t: + nt = (lenghts[0] - pt) / (t - pt) + bezes = cspbezsplitatlength(s[-1][-1][:], path[0][0][:], nt) + s[-1][-1:] = bezes[:2] + path[0][0] = bezes[2] + pt = lenghts.pop(0) + s[-1].append(path[0].pop(0)) + return s + + def __init__(self, start_path=Path(), end_path=Path()): + super().__init__(start_path, end_path) + # rediscretisize both paths + start_copy = copy.deepcopy(self.start_value) + # TODO find out why self.start_value.copy() doesn't work + self.start_value = EqualSubsegmentsInterpolator.process_path( + self.start_value, self.end_value + ) + self.end_value = EqualSubsegmentsInterpolator.process_path( + self.end_value, start_copy + ) + + self.truncate_subpaths() + + +class FirstNodesInterpolator(PathInterpolator): + """Interpolates a path by discarding the trailing nodes of the longer subpath""" + + def __init__(self, start_path=Path(), end_path=Path()): + super().__init__(start_path, end_path) + # which path has fewer segments? + lengthdiff = len(self.start_value) - len(self.end_value) + # swap shortest first + if lengthdiff > 0: + self.start_value, self.end_value = self.end_value, self.start_value + # subdivide the shorter path + for _ in range(abs(lengthdiff)): + maxlen = 0 + subpath = 0 + segment = 0 + for y, _ in enumerate(self.start_value): + for z in range(1, len(self.start_value[y])): + leng = bezlenapprx( + self.start_value[y][z - 1], self.start_value[y][z] + ) + if leng > maxlen: + maxlen = leng + subpath = y + segment = z + sp1, sp2 = self.start_value[subpath][segment - 1 : segment + 1] + self.start_value[subpath][segment - 1 : segment + 1] = cspbezsplit(sp1, sp2) + # if swapped, swap them back + if lengthdiff > 0: + self.start_value, self.end_value = self.end_value, self.start_value + self.truncate_subpaths() diff --git a/extensions/botbox3000/deps/inkex/units.py b/extensions/botbox3000/deps/inkex/units.py new file mode 100644 index 0000000..74f42f0 --- /dev/null +++ b/extensions/botbox3000/deps/inkex/units.py @@ -0,0 +1,150 @@ +# -*- coding: utf-8 -*- +# +# Copyright (c) Aaron Spike +# Aurélio A. Heckert +# Bulia Byak +# Nicolas Dufour, nicoduf@yahoo.fr +# Peter J. R. Moulder +# Martin Owens +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Convert to and from various units and find the closest matching unit. +""" + +import re + +# a dictionary of unit to user unit conversion factors +CONVERSIONS = { + "in": 96.0, + "pt": 1.3333333333333333, + "px": 1.0, + "mm": 3.779527559055118, + "cm": 37.79527559055118, + "m": 3779.527559055118, + "km": 3779527.559055118, + "Q": 0.94488188976378, + "pc": 16.0, + "yd": 3456.0, + "ft": 1152.0, + "": 1.0, # Default px +} + +# allowed unit types, including percentages, relative units, and others +# that are not suitable for direct conversion to a length. +# Note that this is _not_ an exhaustive list of allowed unit types. +UNITS = [ + "in", + "pt", + "px", + "mm", + "cm", + "m", + "km", + "Q", + "pc", + "yd", + "ft", + "", + "%", + "em", + "ex", + "ch", + "rem", + "vw", + "vh", + "vmin", + "vmax", + "deg", + "grad", + "rad", + "turn", + "s", + "ms", + "Hz", + "kHz", + "dpi", + "dpcm", + "dppx", +] + +UNIT_MATCH = re.compile(rf"({'|'.join(UNITS)})") +NUMBER_MATCH = re.compile(r"(([-+]?[0-9]+(\.[0-9]*)?|[-+]?\.[0-9]+)([eE][-+]?[0-9]+)?)") +BOTH_MATCH = re.compile(rf"^\s*{NUMBER_MATCH.pattern}\s*{UNIT_MATCH.pattern}\s*$") + + +def parse_unit(value, default_unit="px", default_value=None): + """ + Takes a value such as 55.32px and returns (55.32, 'px') + Returns default (None) if no match can be found + """ + ret = BOTH_MATCH.match(str(value)) + if ret: + return float(ret.groups()[0]), ret.groups()[-1] or default_unit + return (default_value, default_unit) if default_value is not None else None + + +def are_near_relative(point_a, point_b, eps=0.01): + """Return true if the points are near to eps""" + return (point_a - point_b <= point_a * eps) and ( + point_a - point_b >= -point_a * eps + ) + + +def discover_unit(value, viewbox, default="px"): + """Attempt to detect the unit being used based on the viewbox""" + # Default 100px when width can't be parsed + (value, unit) = parse_unit(value, default_value=100.0) + if unit not in CONVERSIONS: + return default + this_factor = CONVERSIONS[unit] * value / viewbox + + # try to find the svgunitfactor in the list of units known. If we don't find + # something, ... + for unit, unit_factor in CONVERSIONS.items(): + if unit != "": + # allow 1% error in factor + if are_near_relative(this_factor, unit_factor, eps=0.01): + return unit + return default + + +def convert_unit(value, to_unit, default="px"): + """Returns userunits given a string representation of units in another system + + Args: + value: string + to_unit: unit to convert to + default: if ``value`` contains no unit, what unit should be assumed. + + .. versionadded:: 1.1 + """ + value, from_unit = parse_unit(value, default_unit=default, default_value=0.0) + if from_unit in CONVERSIONS and to_unit in CONVERSIONS: + return ( + value * CONVERSIONS[from_unit] / CONVERSIONS.get(to_unit, CONVERSIONS["px"]) + ) + return 0.0 + + +def render_unit(value, unit): + """Checks and then renders a number with its unit""" + try: + if isinstance(value, str): + (value, unit) = parse_unit(value, default_unit=unit) + return f"{value:.6g}{unit:s}" + except TypeError: + return "" diff --git a/extensions/botbox3000/deps/inkex/utils.py b/extensions/botbox3000/deps/inkex/utils.py new file mode 100644 index 0000000..dcbe58d --- /dev/null +++ b/extensions/botbox3000/deps/inkex/utils.py @@ -0,0 +1,410 @@ +# coding=utf-8 +# +# Copyright (C) 2010 Nick Drobchenko, nick@cnc-club.ru +# Copyright (C) 2005 Aaron Spike, aaron@ekips.org +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. +# +""" +Basic common utility functions for calculated things +""" + +from collections import OrderedDict, defaultdict +import os +import sys +import random +import re +import math + +from argparse import ArgumentTypeError +from itertools import tee, cycle + +import numpy as np + +ABORT_STATUS = -5 + +(X, Y) = range(2) +PY3 = sys.version_info[0] == 3 + +# pylint: disable=line-too-long +# Taken from https://www.w3.org/Graphics/SVG/1.1/paths.html#PathDataBNF +DIGIT_REX_PART = r"[0-9]" +DIGIT_SEQUENCE_REX_PART = rf"(?:{DIGIT_REX_PART}+)" +INTEGER_CONSTANT_REX_PART = DIGIT_SEQUENCE_REX_PART +SIGN_REX_PART = r"[+-]" +EXPONENT_REX_PART = rf"(?:[eE]{SIGN_REX_PART}?{DIGIT_SEQUENCE_REX_PART})" +FRACTIONAL_CONSTANT_REX_PART = rf"(?:{DIGIT_SEQUENCE_REX_PART}?\.{DIGIT_SEQUENCE_REX_PART}|{DIGIT_SEQUENCE_REX_PART}\.)" +FLOATING_POINT_CONSTANT_REX_PART = rf"(?:{FRACTIONAL_CONSTANT_REX_PART}{EXPONENT_REX_PART}?|{DIGIT_SEQUENCE_REX_PART}{EXPONENT_REX_PART})" +NUMBER_REX = re.compile( + rf"(?:{SIGN_REX_PART}?{FLOATING_POINT_CONSTANT_REX_PART}|{SIGN_REX_PART}?{INTEGER_CONSTANT_REX_PART})" +) +# pylint: enable=line-too-long + + +def _pythonpath(): + for pth in os.environ.get("PYTHONPATH", "").split(":"): + if os.path.isdir(pth): + yield pth + + +def get_user_directory(): + """Return the user directory where extensions are stored. + + .. versionadded:: 1.1""" + if "INKSCAPE_PROFILE_DIR" in os.environ: + return os.path.abspath( + os.path.expanduser( + os.path.join(os.environ["INKSCAPE_PROFILE_DIR"], "extensions") + ) + ) + + home = os.path.expanduser("~") + for pth in _pythonpath(): + if pth.startswith(home): + return pth + return None + + +def get_inkscape_directory(): + """Return the system directory where inkscape's core is. + + .. versionadded:: 1.1""" + for pth in _pythonpath(): + if os.path.isdir(os.path.join(pth, "inkex")): + return pth + raise ValueError("Unable to determine the location of Inkscape") + + +class KeyDict(dict): + """ + A normal dictionary, except asking for anything not in the dictionary + always returns the key itself. This is used for translation dictionaries. + """ + + def __getitem__(self, key): + try: + return super().__getitem__(key) + except KeyError: + return key + + +def parse_percent(val: str): + """Parse strings that are either values (i.e., '3.14159') or percentages + (i.e. '75%') to a float. + + .. versionadded:: 1.2""" + val = val.strip() + if val.endswith("%"): + return float(val[:-1]) / 100 + return float(val) + + +def Boolean(value): + """ArgParser function to turn a boolean string into a python boolean""" + if value.upper() == "TRUE": + return True + if value.upper() == "FALSE": + return False + return None + + +def to_bytes(content): + """Ensures the content is bytes + + .. versionadded:: 1.1""" + if isinstance(content, bytes): + return content + return str(content).encode("utf8") + + +def debug(what): + """Print debug message if debugging is switched on""" + errormsg(what) + return what + + +def do_nothing(*args, **kwargs): # pylint: disable=unused-argument + """A blank function to do nothing + + .. versionadded:: 1.1""" + + +def errormsg(msg): + """Intended for end-user-visible error messages. + + (Currently just writes to stderr with an appended newline, but could do + something better in future: e.g. could add markup to distinguish error + messages from status messages or debugging output.) + + Note that this should always be combined with translation:: + + import inkex + ... + inkex.errormsg(_("This extension requires two selected paths.")) + """ + try: + sys.stderr.write(msg) + except TypeError: + sys.stderr.write(str(msg)) + except UnicodeEncodeError: + # Python 2: + # Fallback for cases where sys.stderr.encoding is not Unicode. + # Python 3: + # This will not work as write() does not accept byte strings, but AFAIK + # we should never reach this point as the default error handler is + # 'backslashreplace'. + + # This will be None by default if stderr is piped, so use ASCII as a + # last resort. + encoding = sys.stderr.encoding or "ascii" + sys.stderr.write(msg.encode(encoding, "backslashreplace")) + + # Write '\n' separately to avoid dealing with different string types. + sys.stderr.write("\n") + + +class AbortExtension(Exception): + """Raised to print a message to the user without backtrace""" + + +class DependencyError(NotImplementedError): + """Raised when we need an external python module that isn't available""" + + +class FragmentError(Exception): + """Raised when trying to do rooty things on an xml fragment""" + + +def to(kind): # pylint: disable=invalid-name + """ + Decorator which will turn a generator into a list, tuple or other object type. + """ + + def _inner(call): + def _outer(*args, **kw): + return kind(call(*args, **kw)) + + return _outer + + return _inner + + +def strargs(string, kind=float): + """Returns a list of floats from a string + + .. versionchanged:: 1.1 + also splits at -(minus) signs by adding a space in front of the - sign + + .. versionchanged:: 1.2 + Full support for the `SVG Path data BNF + `_ + """ + return [kind(val) for val in NUMBER_REX.findall(string)] + + +class classproperty: # pylint: disable=invalid-name, too-few-public-methods + """Combine classmethod and property decorators""" + + def __init__(self, func): + self.func = func + + def __get__(self, obj, owner): + return self.func(owner) + + +def filename_arg(name): + """Existing file to read or option used in script arguments""" + filename = os.path.abspath(os.path.expanduser(name)) + if not os.path.isfile(filename): + raise ArgumentTypeError(f"File not found: {name}") + return filename + + +def pairwise(iterable, start=True): + "Iterate over a list with overlapping pairs (see itertools recipes)" + first, then = tee(iterable) + starter = [(None, next(then, None))] + if not start: + starter = [] + return starter + list(zip(first, then)) + + +def circular_pairwise(l): + """Iterate over a list with overlapping pairs in a periodic way, i.e. + [1, 2, 3] -> [(1, 2), (2, 3), (3, 1)] + + ..versionadded:: 1.3.1""" + second = cycle(l) + next(second) + return zip(l, second) + + +EVAL_GLOBALS = {} +EVAL_GLOBALS.update(random.__dict__) +EVAL_GLOBALS.update(math.__dict__) + + +def math_eval(function, variable="x"): + """Interpret a function string. All functions from math and random may be used. + + .. versionadded:: 1.1 + + Returns: + a lambda expression if sucessful; otherwise None. + """ + try: + if function != "": + return eval( + f"lambda {variable}: " + (function.strip('"') or "t"), EVAL_GLOBALS, {} + ) + # handle incomplete/invalid function gracefully + except SyntaxError: + pass + return None + + +def is_number(string): + """Checks if a value is a number + + .. versionadded:: 1.2""" + try: + float(string) + return True + except ValueError: + return False + + +def rational_limit(f: np.poly1d, g: np.poly1d, t0): + """Computes the limit of the rational function (f/g)(t) + as t approaches t0. + + .. versionadded:: 1.4""" + assert g != np.poly1d([0]) + if g(t0) != 0: + return f(t0) / g(t0) + elif f(t0) == 0: + return rational_limit(f.deriv(), g.deriv(), t0) + else: + raise ValueError("Limit does not exist.") + + +def callback_method(func): + def notify(self, *args, **kwargs): + result = func(self, *args, **kwargs) + self._callback() + return result + + return notify + + +class NotifyList(list): + """A list that calls a callback after it is modified + (to notify a parent about the modification). + Modified from https://stackoverflow.com/a/13259435/3298143 + + .. versionadded:: 1.4""" + + extend = callback_method(list.extend) + append = callback_method(list.append) + remove = callback_method(list.remove) + pop = callback_method(list.pop) + __delitem__ = callback_method(list.__delitem__) + __setitem__ = callback_method(list.__setitem__) + __iadd__ = callback_method(list.__iadd__) + __imul__ = callback_method(list.__imul__) + + def __getitem__(self, item): + """Ensure that slicing returns a list of the same datatype""" + if isinstance(item, slice): + return self.__class__(list.__getitem__(self, item)) + return list.__getitem__(self, item) + + def __init__(self, *args, callback=None): + self.callback = None + list.__init__(self, *args) + self.callback = callback + + def _callback(self): + if self.callback is not None: + self.callback(self) + + def toggle(self, value): + """If exists, remove it, if not, add it""" + value = str(value) + if value in self: + return self.remove(value) + return self.append(value) + + +class NotifyOrderedDict(OrderedDict): + """An OrderedDict that notifies a callback after a value is changed + + .. versionadded:: 1.4""" + + clear = callback_method(OrderedDict.clear) + popitem = callback_method(OrderedDict.popitem) + update = callback_method(OrderedDict.update) + setdefault = callback_method(OrderedDict.setdefault) + __setitem__ = callback_method(OrderedDict.__setitem__) + __delitem__ = callback_method(OrderedDict.__delitem__) + + def __init__(self, *args, callback=None, **kwargs): + self.callback = None + super().__init__(*args, **kwargs) + self.callback = callback + + def _callback(self): + if self.callback is not None: + self.callback(self) + + def pop(self, key, default=None): + super().pop(key, default) + # On Python < 3.11, pop internally calls __delitem__. + # This does not happen in 3.11. To avoid + # calling the callback twice, we need to check the Python version. + if sys.version_info >= (3, 11): + if self.callback is not None: + self.callback(self) + + +class NotifyDefaultDict(defaultdict): + """A defaultdict that notifies a callback after a value is changed + + .. versionadded:: 1.4""" + + clear = callback_method(defaultdict.clear) + popitem = callback_method(defaultdict.popitem) + update = callback_method(defaultdict.update) + setdefault = callback_method(defaultdict.setdefault) + __setitem__ = callback_method(defaultdict.__setitem__) + __delitem__ = callback_method(defaultdict.__delitem__) + + def __init__(self, *args, callback=None, **kwargs): + self.callback = None + super().__init__(*args, **kwargs) + self.callback = callback + + def _callback(self): + if self.callback is not None: + self.callback(self) + + def pop(self, key, default=None): + super().pop(key, default) + # On Python < 3.11, pop internally calls __delitem__. + # This does not happen in 3.11. To avoid + # calling the callback twice, we need to check the Python version. + if sys.version_info >= (3, 11): + if self.callback is not None: + self.callback(self) diff --git a/extensions/botbox3000/deps/tinycss2/__init__.py b/extensions/botbox3000/deps/tinycss2/__init__.py new file mode 100644 index 0000000..2bbbbb6 --- /dev/null +++ b/extensions/botbox3000/deps/tinycss2/__init__.py @@ -0,0 +1,18 @@ +""" +tinycss2 +======== + +tinycss2 is a low-level CSS parser and generator: it can parse strings, return +Python objects representing tokens and blocks, and generate CSS strings +corresponding to these objects. + +""" + +from .bytes import parse_stylesheet_bytes # noqa +from .parser import ( # noqa + parse_blocks_contents, parse_declaration_list, parse_one_component_value, + parse_one_declaration, parse_one_rule, parse_rule_list, parse_stylesheet) +from .serializer import serialize, serialize_identifier # noqa +from .tokenizer import parse_component_value_list # noqa + +VERSION = __version__ = '1.5.1' diff --git a/extensions/botbox3000/deps/tinycss2/ast.py b/extensions/botbox3000/deps/tinycss2/ast.py new file mode 100644 index 0000000..2831abc --- /dev/null +++ b/extensions/botbox3000/deps/tinycss2/ast.py @@ -0,0 +1,886 @@ +""" + +Data structures for the CSS abstract syntax tree. + +""" + + +from webencodings import ascii_lower + +from .serializer import _serialize_to, serialize_identifier, serialize_name + + +class Node: + """Every node type inherits from this class, + which is never instantiated directly. + + .. attribute:: type + + Each child class has a :attr:`type` class attribute + with a unique string value. + This allows checking for the node type with code like: + + .. code-block:: python + + if node.type == 'whitespace': + + instead of the more verbose: + + .. code-block:: python + + from tinycss2.ast import WhitespaceToken + if isinstance(node, WhitespaceToken): + + Every node also has these attributes and methods, + which are not repeated for brevity: + + .. attribute:: source_line + + The line number of the start of the node in the CSS source. + Starts at 1. + + .. attribute:: source_column + + The column number within :attr:`source_line` of the start of the node + in the CSS source. + Starts at 1. + + .. automethod:: serialize + + """ + __slots__ = ['source_column', 'source_line'] + + def __init__(self, source_line, source_column): + self.source_line = source_line + self.source_column = source_column + + def __repr__(self): + return self.repr_format.format(self=self) + + def serialize(self): + """Serialize this node to CSS syntax and return a Unicode string.""" + chunks = [] + self._serialize_to(chunks.append) + return ''.join(chunks) + + def _serialize_to(self, write): + """Serialize this node to CSS syntax, writing chunks as Unicode string + by calling the provided :obj:`write` callback. + + """ + raise NotImplementedError # pragma: no cover + + +class ParseError(Node): + """A syntax error of some sort. May occur anywhere in the tree. + + Syntax errors are not fatal in the parser + to allow for different error handling behaviors. + For example, an error in a Selector list makes the whole rule invalid, + but an error in a Media Query list only replaces one comma-separated query + with ``not all``. + + .. autoattribute:: type + + .. attribute:: kind + + Machine-readable string indicating the type of error. + Example: ``'bad-url'``. + + .. attribute:: message + + Human-readable explanation of the error, as a string. + Could be translated, expanded to include details, etc. + + """ + __slots__ = ['kind', 'message'] + type = 'error' + repr_format = '<{self.__class__.__name__} {self.kind}>' + + def __init__(self, line, column, kind, message): + Node.__init__(self, line, column) + self.kind = kind + self.message = message + + def _serialize_to(self, write): + if self.kind == 'bad-string': + write('"[bad string]\n') + elif self.kind == 'bad-url': + write('url([bad url])') + elif self.kind in ')]}': + write(self.kind) + elif self.kind in ('eof-in-string', 'eof-in-url'): + pass + else: # pragma: no cover + raise TypeError('Can not serialize %r' % self) + + +class Comment(Node): + """A CSS comment. + + Comments can be ignored by passing ``skip_comments=True`` + to functions such as :func:`~tinycss2.parse_component_value_list`. + + .. autoattribute:: type + + .. attribute:: value + + The content of the comment, between ``/*`` and ``*/``, as a string. + + """ + __slots__ = ['value'] + type = 'comment' + repr_format = '<{self.__class__.__name__} {self.value}>' + + def __init__(self, line, column, value): + Node.__init__(self, line, column) + self.value = value + + def _serialize_to(self, write): + write('/*') + write(self.value) + write('*/') + + +class WhitespaceToken(Node): + """A :diagram:`whitespace-token`. + + .. autoattribute:: type + + .. attribute:: value + + The whitespace sequence, as a string, as in the original CSS source. + + + """ + __slots__ = ['value'] + type = 'whitespace' + repr_format = '<{self.__class__.__name__}>' + + def __init__(self, line, column, value): + Node.__init__(self, line, column) + self.value = value + + def _serialize_to(self, write): + write(self.value) + + +class LiteralToken(Node): + r"""Token that represents one or more characters as in the CSS source. + + .. autoattribute:: type + + .. attribute:: value + + A string of one to four characters. + + Instances compare equal to their :attr:`value`, + so that these are equivalent: + + .. code-block:: python + + if node == ';': + if node.type == 'literal' and node.value == ';': + + This regroups what `the specification`_ defines as separate token types: + + .. _the specification: https://drafts.csswg.org/css-syntax-3/ + + * ** ``:`` + * ** ``;`` + * ** ``,`` + * ** ``-->`` + * ** ```` tokens are not ignored. + + :type input: :obj:`str` or :term:`iterable` + :param input: A string or an iterable of :term:`component values`. + :type skip_comments: :obj:`bool` + :param skip_comments: + Ignore CSS comments at the top-level of the list. + If the input is a string, ignore all comments. + :type skip_whitespace: :obj:`bool` + :param skip_whitespace: + Ignore whitespace at the top-level of the list. + Whitespace is still preserved + in the :attr:`~tinycss2.ast.QualifiedRule.prelude` + and the :attr:`~tinycss2.ast.QualifiedRule.content` of rules. + :returns: + A list of + :class:`~tinycss2.ast.QualifiedRule`, + :class:`~tinycss2.ast.AtRule`, + :class:`~tinycss2.ast.Comment` (if ``skip_comments`` is false), + :class:`~tinycss2.ast.WhitespaceToken` + (if ``skip_whitespace`` is false), + and :class:`~tinycss2.ast.ParseError` objects. + + """ + tokens = _to_token_iterator(input, skip_comments) + result = [] + for token in tokens: + if token.type == 'whitespace': + if not skip_whitespace: + result.append(token) + elif token.type == 'comment': + if not skip_comments: + result.append(token) + else: + result.append(_consume_rule(token, tokens)) + return result + + +def parse_stylesheet(input, skip_comments=False, skip_whitespace=False): + """Parse :diagram:`stylesheet` from text. + + This is used e.g. for a ``@wI`g4cBb0G05xgVu0x?Qz}>c=(W?q$m{LeAcp6>7zV z77#M-@7m)hfItK9nrq8#rkO>|^1w*rU*bTsr8A8R-qoX6Akm*GhwzDV3 z@xra}ktrDm%x0NJ47!9&5roewlZEdTNZ5)G&;2SGeA<~ybcm|u`F8Q4CZQY*cc1`*0;uY0Omhk1X70lU z1O-RP$j=@gRgv4vHNSkT98v>~qz~4%jDu9Xj|F$ehptG++Zm@NyDWxj8MZkGo&g?$ zjqb7%2xNT!08TJIv`0czEUF(J0+MQES=tFU?2(c){{Xjvf_~I%e|9C15)b&uL6( zKqs#h=DUUE2Y^#})#%$_O2%IGN*Y%StLuQYFck1Hfg-SAZ9 zdempTisn)zeX#+{dee(eI&_h+BH#iCOq^7CEaX<)SU;W{IjIrJrCjaM$Y3Py5j zXmDXnI)yx(n#)R6f(Y=-YRS(kdY@V&*=g61IC!Nl4;f+rtJ%nsG5nBt{Ku)NPXQmD zNJc*i9(3ZBT@8~V?;*L9VCb8O+wwW7h31fgw=$E^sm2e_ifzW6OnZ@cW1YF=)L7nD z%tqc={{ZR>kwz7nxt=kXhBn6>x&FY>e~6$1C}Ri4sb;^H-WCrNGbkhs;Ga&F3O>|{ zqe#x3J)>inkvJ#IBCT1ivOARB%z%PCJSfvD6x>I805}G!!xV#LNvC=m%Wo=CQ z-Ji9v_@lXziRr&2kG)Nkv+?R`l6T)4t}wX$Ydx!dR*$C5lt9=}6cqUrkeoxpXOoiaeo#{=&~SheY0pMCsS2)PDGM{Gq^sw5I_<`cP!kAa4Kx@Wn}v)nh*iZk|+V zz{kafK1RD^j;Y(TQ9GFgj~Q;f@%vHNMvgd&Ex}?=a@^vq+}If4cwH5E$vG3 zx|;17?^gd!_0b~ikd4J*P+g;GyaeJNvDVjIhbB#xP; z#{rCzG0Dj$oZku+>V9>SF))P22TnYE>tNkOQjP$7ut*&+yjHNf_08U*%Z#90;0*KS zn%LR|bsK>rr8Gqp03>m!EO}s{AE~T04YZzHkRQ1*oPSX1Mea7LV0>8TJ~Y;!Vh}I@ z&oxgcY^?2MA$X5X49Wzl}yGG(uy<82z8i7A-pqe6LCpgb4 zLHYC2r0F+tO9$sNG3w;x=gPC&S5R;`fLomXaZkUB=TNsIRuM+I;Tx$H zYjnHeD5n`1Jor^@Qx{^C;m;J1H)K=2@X zj8_Y5)5b{_eV**sU`pSiH3ftN{@CW$F{e^7PCDfP2i3w~Ml`GYYXfAK3vjwyw>$lWxj3agNL`(mhdF2~PrrAG_TJ=!qIXn+_Q;B@&{K2_U< ziVNP>T6U9Mn%hcKX9}DrcmdnM1cCQITH5`ec5rJtmCUz}>8ILou6XZXp*2O>{>$mM z`h?QVtpfxM!LhxMJbde-v@N7|ZXSEEa@hW$4m#I4J=c43Vg07nX1jE-w~ULqh)9Vz z2s}yo13_t*L9q8`21X}4qd3X)$BjYkXhYk;z(4+xEUTMtmfRx zLJ(AS0ChE8f7$faV*dcuOjB48g9TjwVa;L=>pu>>(I25%Gds8HM8TQM>?V1J~FjwZ)zGlJOw9}LrvdWb;a z`Ox8chEIX;sS7sagZk99T`Vr(i6j_48UEBOZ5AeSz>Vguj4{gCIAcy&Lhy<>@~aPH zt?ZT+0C;-TkrCT~20bW97~+xMU~r`3oMUOvrL3!yftmzb6iCE`+P^W)9wQ)a&G#mm zb8#jJ4dc%pD;7qzjixdDrwiz5V$+N+cRoQK4>aiH*$`)8pF_Lg+5-=o@&oorDVI~GZpvscU7_6hq;^{@SlHxW6 zg7NEAg3*%Iala>iK6IB7Y)z^;^Tiol@A^{70CglB9~#~>sAldsq06CW=m4iOLof>H zK?6NAPfKs+0!Td5ZzLd<2N?3Ht@RS&p;F2jRDr^ps+wmvsEU}6#q*k7Nm<-?aWlwH zGv!uR*0R81cR)jManx2Zy$(BQw>BA19Wz9<)6t)MZQ7?G5zRhpScK*Ag$Kf)3kewb z3a1g+%bOc1LlBX$&I@g-Ti(c6-bCpc?i7QKxCENGxYOQ2wHV->;8P>g{vo<&W*k*` zuFVqD*=)L9@VT_Vaf6aG$^EE0#+#_w19NjM@{ygP0b(nqt+#Q78=PmaQ~FVwI1~{g zWc9%ZHFZ;)km&uQx|253FL}6hVa_Uxx064(tQPj_3z7?}^Ig7v&)D3fN-fo7Vfn)I zT1RPn5p$?C5n7$mhRYY@70$}*$CR!yt@d9@vanV|-rT6=it@~SI#ms?vty`Cki`Q$ zj5j*uj1%i!mssrlHn)~`t!~#dG=n=+I39JpY5kbAutO|xD3Qk}9ML6Ll#e~d*{i)0 zSkhur(jovrdY>xqUe6)7I(u9Q{{We^DwZ89R`!plq$_VMzsiKU0y1C>Svf$DrJ9QQ2h2I5;MBym-eM|Uv-)yyfo zEx^a^M3O0&0GB7Py zkb{OCxd8L#Y0%qST16OzQ9>vRtBeYbc|5mZs^wz`83z>pnMb(NWs%DZmM%^U930T& z(&UJZ^8!bS9chj4h~&apmHv~)X|m6A8txwp9|q=vB+{5k!j{KUDa?1py-=<>#xYUh z)!N*Teu+wFf}*Tm@ihp0&~~mcs0{_IY8E#}biIjp$NvD<#}sb)uB{Af83Z4Q4r*Sl zc{P*5@xo<*oG{4)pIS6mkW8gfFh?w^JZmjzFu>c8#^ew%R8@m&lfe;*R7m}KG>sUU zLm>#`jl#0p7H3g#${WCs8s0J$)FR>?#oRILgH=Paw%Uctn~B+N(C2P(xcb)ALPhbe z20DTTLy4L9ZAjZE$Bb5T9aT-HSldb6+Cmi+aKK}lj`|u%rQ{|+PdsB4cRUhCd(evD zbpyhY=iP0$xEnh4IW>#Lt!vtjnQjPw{wKJ?6=1$~-Z|7!rHJp1!%WBFz*CR_`Bj2m?l@7uo}-Fx<)1k}YCI~75AzjY z%Aj8GfV_nV$W)Y-Er4YKm~))sqX5gd-~%JT=7%=IKrA;m^oFNUtEtU$>mi90sp65P zlsO?6?@W!OhCR)IGvH`O{x&<99hvHQ2Av5ITu2<57vu##>TTe8=cZ~5w}Uy{Ip_iD zQD#&7JEEhF(5r`&3ucwHbdb%D^6c zG4#a{YUkm}ZuITXms*nx#~3})Ad!;ITKLg5HjHBB2w&+VC-$kf+IFKFe=)`f_&Cin zElvJVV$UJT=i(e@u(@Xrm|#3{K{|6j8PCLg{64htX*6IeIW6<27Ko^=l7Bay4BADE zI93GsVv`Wm&ixM(5Tmg^SoP6(i-&Q`@+aSA}r zDxO=Ds7fM0HjqhhaZxobI7=y(OR3QT{EEXLY-WdS_WEd%?F-2~gQK?`c;g&aEoozDETIo>7wlpIxETb%b{VF_A$uL*Bk(tTdKwc`*r4k|ooDU;M zwP_8`pQn{k3cQD_geAX9NUn{;vPBc%axyVTvyK*5kd;t4%kqC}m2Vo!2z47d##CeU zt;jV_@!U&rhCpCdIXi!q7Mr`!yB1+pJJ4Aq2a#^VXzAr&?J)=pc<_=tw|vX>RpWcT6LaL{Wf& zb3<)UQkKUS_UxG?l12yXS;OeJS7yt6u%_Iv869X=*0-$`bF(VS{ZluQXLxZ@@b?i9kAns9}ONo8us2Y z!SJ}x^3F*g+O6aYjl_~HXRbI6RUNXp)Z?;;_%`^bE(gXk0)_Iy>U?omR;QyyrCdgY zKX~ZJBtCihdDctW`)idO;B``Ya7YCCRwlQL6z}fjmPG(dH~2kH@|=4ronp2 zAAGAQ1Yjuy{{Z5tAhw4Vn-!o=<_tODKd08RNF;+fo05O!hsZQPc$Rr2?_>*+kTOUV z87^@fM!|5rv#%Ae8TBgGDE2bOvOvqoY@B9~5h~1v;baH%FvC=FcW-ZN#NZa_ck@xD z)od+KdAGcG}zhL;Y>=oPM=x#jKFQD|J2M_zn&!vPBw_pkR^y`c-A_r+X#PSoTLA z-_GlkQSGkUDH&zBXAFPEk@T$gIJlECs8$Goaqu=t{V876d$j>b&m8ep@@qEssulo9 zCz8O?m$VA$ghJ<~Q(-ABXcAh@6nT>BRZ-A$f%?^T#i6)xuI;gUv$4tj zD#rf+wH7c(8X4xEVtyjaxM#x{=~ddT<>l?MNTp^3B|DSKc_WPI~c7|jF+-nq2X|w$@J+?v9W1U-`^$O)DQq)wkoDh*6y=imJc_@`AlvA z`qO6D^#*ikEje-dKxQAHqgF58&S_pZZ9o8{kjsGHoDbfHmeL`S&}?9E0Ovm{p|#aD zOS{KQcZ5iTbdaz)Uy;RFrS78VWRD+s*v`(Csadf;Jt5j6(#-xOHgSXCI28ge%-mcV zWV*bOTpkQ^k_!BfO0kaq;ay>AAqsgb;(m0!?b6~@iC!_rV#Xk2^z0h6C4*Yh@R0DGiW|jO_?8es!B#cs4AIVkek^ z;C!ga*3>wyirhp*Qp){H07?2(*&`CjMgn1Y;A9_K6zZ)YSk^@=(V0m7MrbibG%~b` z$8&H&=B>c4)w>|tyxdPJH$`N}KQYZ!pJ$hG$WUL*Q91xf+J0HZZ2k76j1@^m{*qLJ zezccbuB!}NBY`Gn;Ip27wVZ}EDSH>G%{ek^mrn}+07e1aD`v6N7ArN(1(*y6ke$>K zd)fnRL4pX|svnA*2DREfK0HdPFm86a+COa7G8?L`Rp7Oex9C#bal_jjeNJfomzKk{ zDojz&6tOnb9KHwX#cbMcp>L>Lcb5^Q6EG#zoceX3-J}+Y-dQ@U_4qve>Bl`C3AR1k zO3L0Mwf%S66^@s66^cBPUG#JbfCpUU)a@zdyeGbsymEPF>MB0FqFP6Eg>B)uob_iv z-n3!*LtH$PO4kMBZbIW2`qb@4;Dr(7?jII+W`%0kc4$%T?b0B*J=ENfTvbM^t=iej zs;mUh`B2H>RZ*sUO4Y7ru3YwJmxN5N?j`~%aDqPEV_ zYcZbFMG?22NL=xg@RR=k0D2C$?9yF6dwaN&OX%l);v8U(K|BsR8pE_m(==H&sux?e zY!#bv#y+DWrrhXzpKReiA23huD`nFxj6yBYy|Q_@#%gw_vF(p=n_Wij?c-UiT3`Gz zq+Ca~O*`UYg7GE^^XC-n4`;egpCFnGBCDUuWXbvC6}xC}-rnIxD zblYzRdM-{!)}~E-q$=-4amWkskKVMwmyk*z8Hz~zwaE^769HQrIQK-`zdR?j=mAv?}-xI?;k!n;184%+V}+dMFaomJ}RfJ6}T<`0B7{8W?4)K&(LmQe$^67D^!q2 z66|x%GuE3nmfKTenD-o%kl_CSdNdkjam$8&SNe&~7_=7BE)}wp#tG=GDNdKDL9tro z<2l>ZeTb>@S-KG?eYAAzlloDTAaLFMvV7N%zG=o)Kf~X?!MM4TJ}ktq+N6kMwsmJ- z@-ft&nX6dF)Fl{(9E<>S_oqD0TTfsc!t zY+*rSRdeITHaSx}%m}OxTn;J;DR&qwp$ZIj*am*oDfJ0i(m0|jGt{mqkzL2Vhy!O{ zI(=yb(D&R1Bd%3(TGfPmoAwxDfOvd8D?6P+Xi40w{{T@q6i)diJn%p2IQ{9;Y5^5M zyNwe(jDmkm)u$DZ>1*DxxFOh&%uQQIHLMYV6lz&U2B>%9C28z4;!#Y2NjZNW|ZxDG3B-Sq-XA8*s_TwEziUb z1upPka)mhlmdMZPL=vQNuvpY*l0``Yt>$Bgnn0(*Hmbv;8E?T3%B%h<31jljY?0h; ze8v|Zs%ewm!wa)8h@ACYQ>8;~qQAU@x@_km3k-gut!A)g3RsQ9rrHwgc9&AJ!wWQu zamo?;(#LQM5Vj7ae^inayVIHu4GPFe-1`^&d=h?H6d75gxH}w!j-*tCif2&mA9tT8 z-GTC>+lbNGor@FU$N5kwP;PL+%AAkQ#%Y2HGH?~+&rmu406Hv|(8zM6HaW&_7r^20Yqkzlr6C%c(ejZQjMGT~9Tm2yC+2aQt(xM>4LVe}D{|5tZ9qr| z=11*KT^dzpYq_MkLP-(rA%48ng_b*5mLUoi$Qu!GKDCz6Ery`Gca&Rp81C3^KT4l1 zg~hX5JZ&1Qu^W``amSW8sV^`y9`vd(_<}OvbmJ5ubuOr&#A3E}Y&4iSA5M9x4STx9 z73Y{-JDeyO82Rujwp&>svuWix4&6HNd@)T~ZX&+exO|*t*ED@X+R)%nV;r{(FrcyI z_r@AO&RLbH#=ga_qQ%BTv)`d5$kXS-b z^B|4OJB(uo2Z}bBbo)08vS?MmD(qvQspN`il)-O2w#=5E^%O*vA~{JJKBuKwXnK3v zLK5RM%m#ip+9;TZWvRqrFaVefOA-lowg(K4((Jd`zM_r+ImB$Ae`3fSc>4g$mmOk*~1;@mE zhJ1cisKpNU*6v8V^o~gwHcCmsKYFOX)n3?sdsC4bXGSq2*J<9YSPtvn_a3{oMBH|#x=29bERodv`H*8OgS-}=RZmmQQAbs zEi6-U>KZZt`4h!h*`IcKl5}85$bGm!dWy`C8%w#wiPzN9G#O{Oc?pr82Ivc5iX>Wu zDFE)S*5Q}oeX4PvEaRV*Rn4tIaW8Q(XaVXFWt-NmY>twVD@LsvfsDG43H|=HAU}xQ zZXqE-5gcWC%{)tgGBU-;10{bbKYE?tS;>}!77N#JB%eW2t*&j$se5)(M~dQ@Dm|>1 zGFvZw7*CsyDqitwRavs9p+m(-xM-)1;bdbQ_%B*pD>a7L#^KeMI7S{7rc+)G(w8i| zGyWQMi4!Rq55_T!)EKobp;RzXP8)DNDow*c@r4rpZlrO=J_LKYuWe%6Y^fMO)VL&7 zX50H?xXdKql2wV_`&EV3t7&Z)bgolq0Yic}XFWc~p_|U(_emfTk<|E6Yf>lL-b*11 zJcqqi;a8&b){I-cEH~~rVk;(w%RhL2v`es@qO;>r-RXql{r=_;Zi|!89z2 z`&g7as-sPwLCNN)8wk_llH4{29MqMzLmM{TxEbT;MgAERqe|doJREiU(iHDuZ1KE{ zX%Z+oEKYg!=8`)&;v1ogG;_};te;P}nMZhmWCI`ryX(aSY3~#A!Q*ZVXE?0ZvihTc21ImW`=nihg@1VvYp zv^BT>lsP-o{seH&Q2>m9rsK|8~Oew%7cmzPdLuAl^Xaqn10a)~w06`k$18$y)ka6!rNye< zoTgGSo_7Gm{pjPpnmzK%xRZ=v159I7t**VAo$23X@~D6s6y39od=gu=v~7-Ax8v7= zSJyU?70cTsgU+H|_IA$b2JVDR1_A0m)mcoj6*U`OMlIsyO6SFK`_gTOc2ca4!~7K! z{tt$Gf@70t9dIzjRG7Ob4Y?pl^A4)g0s2ujuM(~xw{U`coG2M8j(@c=ZN}wzbqQKL z{#Tpf1M5gM7+zHj%*)f|>rZ~o+eX|g6ALGrB)5-3!}%9kJ<1-?|okk@1`0+K#e z8YX#X-6HLbbQ#SRpFI=;Jm_J|WNjZXD@zGk3FDQ0hGHF(36kemUMXM zfH%RpkD17+KL}j)C-taFZ?F&u&s+@gPVQtR08h`YO$RN()2!y2;(WOrB6xXH=(n+I zHo`@hE6z&t4i8Fg%Bm!gm}8s0;f#YkQC7?}5r+Z@BN$N@7xbx=xu%K>e)p=LfDDsW zOFWLtBS(bmlE8ufv|`A?RY^Mz>~6_EpQQz@=DHFoAR@jOXu;c_Gg2My4D12&@~KNQ zSjFA~T1;V7j~_aXYZ$a}N!_=Q4H6db?hAZ7d`mV6twB|fcPw&9SqpQ(Jagw!CD!km ziH_86^L(7u?|hdxOu4`u0!LHhRo6PqihbJJ#z|)_gCRk&7tD}zTE`F+FK+WjkkL%blRE8`PHP`m;y%w zpv5}I06`fzP;;NXX2zpI)GZkjO_um(;Dr@sp~&PI)NCdC9ssR^c)Zx7b0wXV=FX0%TF_HeF?mmWF)00`%; z3ffrhr;`5RnVj;9;NTBT3g?f9g0JOShhrr6xu+8APqJBSr< zP;fKHg*N{2S!1`BK?HaV;xo9h@~cuds2cv^V~HJYfd_LQTC259O%m!mILA9ia&Q!U z==b;2OK&s9h@)Q#Ln%KXet)HDS2qtN*7{bIRj#Ky?k8;FLG%0mp0%3S7?9Bp)M`dH zidEBXNiQaT85@s>{rS}U%Qqw7Vs^ej+^uXQp;_CAhxTZY9}uGtaUugcW|h4mx9xrEi+l zYy3T7bG_IFArIx_&+A(6WP2iEj>g@to*1o_%!Vln?msc}{p#}S^4>d_%z#=z3m0Z2 zvHJC_Yo$S!1kQa(;QMxa1JR zT5tKMuHOn`wYEY=!HMS`O(d3zRImW^cT(d!K^)*7X$*!)+AzeEllDI<$!>NB$WnbNB{4^kFwf1@#wJjU6^63|B8TUr#CkLf%`i7?r3J|kyJx>E3LZa?jNdjVk5BZF9 zkF|O1+VpX`8zzZ!Xtw_E233b8g->KvVS>bT*rO0~rFg82OoW0GJaW)Z<|q>5pa;r02@ zl|XVi=bB?knZSLcIL!$pIw~FBUIu}0cp^vO0$U*ZP_86Jj|jxE^Q$QB)7{VzG8A)) zVhTHzl|}|J)Si_dT{byx(Uo{S#yZkpjh= zB=s$t6GtOR%^ZXl#~pD}1WtDlI?+*95*Hl!;-CsFkOFyg<3g8PirBY$4^9TcLHl!4 zA8QT8jt7-e-c1P%27P#`V+Nx4mm+M1LBL(4AJ(lmMBor-ujcRYDg#}Mw@$oNo94_e!p&fy;enptHD7eSvRQN${r7$uvhCWUi&VH<)L zTyg;2S=OXKyh%7*gX5kkQt5_f3}rYx@OYv@s4S3{YjGPB#zh=zNcau35IO-tLz2Qw z74I0WHFUIzbGYQ3=QT0rR?BYUg(c7&96pYMx2L^-hPI+O+&X!A!s#uN0cp7ywc|>^0$vkt%HD2~t zH#YzVP@N799ya%^nUH!^m6>B74=bhwT$gnM>EF1%p08Z zz~EF_d&{{nfPx1=D$KNgE(vaNSfV>@xaNf_uwDDF!74E0z;RO`x`kp~4n1nJ_fZ}G zS};e;tvWUr3<8V_&+Vo4w0e8Dcwvk%=)??B3pAu?7vJc1y9;TpOTZco80nl?!1JdpU87!k7 znf{b{CpCp~YR0>_2 zjyh(f#Wql3KtMPcr%v&x55Xg*YM~LW=L^GZ1E}+;2UB9rZxjtFAN!g3MH5rKzr1Bg z%10MM6RUk{ZLH}EBCKO_fCY=ZOIr1!i*=9Xqkf}HaHa@Sdcql6Y%;BREYbyf0nTlJk3=>eR_yYu_|-a5_qEj z02yhfz}f=%)Rr^cLkP@;M;roiO@zgF;J6i6cN$&p-6{jubydx#T|BDx)4Il-@Yv6$ zI#zVz_VZ4T_bON5UN+}Bs;D%F(+i0AjmJ4HMbY&QKusde006fz+XBPaJAX*Buqp)Z^`DehPAtiJH`ou*&jNqz0@R$+2UQr zc>s7+>yQj;<#GWafk_RtV+2OalbjzK&KRwaQjX=3XNW7eEZ8_v=bEsB#?ChHBP6lt zK_@>-B=&JOPjZJmlfWM%=R}PJWNnXVAC(aGra)VLGTrV{;znQ>frEikujIE;vN;!V z-~ehR!%{tG;5o!QTwBvuy@ID9r&z#g(Ueqo?iL zw{UK_28#xtYbXsGsKC$0KhCrN0O;#gzP@<~TX?=8IT)kZSYJ%N>#8dM0M)^*zB?FL zZf1>m@In2ld#KqkN`zjRII3#azZ7#MhDii_K*FzysI%YB))xEN(_aj-s_h{{YlDp}dv?WeFMSfO^(Pq=~)%QN{|7+|;P;qD*9S^UW+HyiMV@$;XWjSe@hw zr{X7|;;cHb7V5|fsRVK=EV0Xz@r>t%CaSJY>5wEd5HZLg9)7hA?DadADsBX0>Cf0! zX^Sh%ONrEhv@ec&QrhV(hzznJ^y^Ee>FtIx&hoJ4rOPyUE4Z%SymY2TXmLjAF9I?= z&lGqbNCDj%H;8O>rnHeD8(1*&Bdrep^jpTHl?i|koo~p`qFmm{vA1^)PI3VQ1kfR$ zQ@W2gQK~5D6QC65o;aadcW%k*SHg!jz7YbztmO48MQS15Swj#r%LJ0XP70Dh`cx&7 zS-{1++pmd!Gy2u*-4{jP!X_gpb}KF!rH^Ued^6UujcSr8>_ppTnc7AEl?R%WCa$YC z$ZZU&qw^Dw?Nd_Mx<(kFrTjB*@!h7@AdIBvJX`?jOMKnFumPNl1)!Z+I* zfrWJ)MOfZl+F9+9)k_YF2U>l$p&ipB#TGC@+C^Bk7Aq^enWCO+h9Ni*g*ZN>)#PX( zU9O5*hI8dn8vbEB#N!IY;g`UA)AcL$u(Xass7Bth<)~01*I@90qNbVX8EGg`imhZOjR$M^xqAaq7V12gah_8N{YFfQ21c zo)5~RTn^#jkTGdv{G&Kp9o?>_e*x~?d`Fa1kwv6=t?yD0@yw(WHmN5y8t+HHzn(UV z`de_H3r0`E-aRPsY12Z;vRrS#`C_c?w9n-L(i7qjooDRJfLiHGXvrE%9I^QKw~bAC zx0j4g$f?6&us&SSWl2#AgpE&wXPS))+*(B`XyR*k{KfeukbJh0K0`AjAMh~gRCgrA z>k7#1tZ)u9<3+r`jsndRWdP_rDJ`X%c;lErR5v?_1b+3KNk)exmjJZrvGg2ahti~4 zX)vwM*_<+G`h`kZp7t%um|%LTBlISmkx3B?DsRV$9ML$P7WUp4B*BpqAMmK_Mrk5j zZtgOw2O#*=T|fsAsgEF@0UYPfoc-i~%wLUq6#})4>5|)qc*wyk*FIFpELK9rmNEg# z5ylNlkiU9k44vUzggtOSYKT>~=2=3%bL1-)Ln$QFhSoCeDo#${8dkH36|iW7DgzI`Y8IoXTxvG~qnyKUfJ#Q#$@x_!-hp*_G;#~Kj7Hzo{vX<_bLhy}Ure)&OEAhwwNxUNTHHAiR7auNfl50HakmoSW6G_Ge2LQ zWE$PIj7BJJ-Q@=b(2@meGgf9BJIQ5$5GIXw@=6eV53N@B{{X|ns&~88^4ROooii&# z7xR<@pHomJx7Ve0DpuM6a=9Ug*wO7RH4wwRxg&SxRZyyZc&zPjBm&b{pKP&7Y8_5? z>?bq`Z?z3K{z#PL`nP1L^5(V=;oHt09`$j|fv_nffvjS6v)s)765+?~M3n4T8Skzn zS>(2D!~@=}faCkoEVZbWq>Z8OR1j2iD8DqN)Klvnn)Us&Sv#4n;#BsMm z6rs=QQ9t0Hd@Ru1O$blR@sn1ph}XAQ_ZJOjphp1cQL{yj194Wt{VJLbZ6(X^WJc z*&acTpsz|0vo`j9^m3`$oCgO7{pPk9p?IMz@s!+i!5JSqqU{7$_jYe*bS6bAa8wby zjN|?BTC*5d4QBq-vCJfL0gW-uWc{E9*$Z08?l@-JN7kWsdB2!#&6Lr_9|+C~{{Y2b zy_E7c)VyVkjzb`9eds0yO;XWX)>Z(1V8D+`)7P*vziEGn&v4HI@E5}syDah9*s>(i z83Fj&Mlv(yNqAqmQx(KgM%dh$$@^4eMc4ZuWqbwAzk3!>f8$ zZ`-84Hh%6qt8`C&SCIz=@Co{P{Hl)TD}=id?gcZ9XF2*+h1RKQpS_5pI#{+R{sFgh?Wv(@s(6$eQG6|$~i(yc{jYs z0PfI$0)46SUS7!1l`Nq$suhk1^%WAv5qlsV$Junv8m!sFB-FhynPJ4oBA%>x+Adr6w!445yL1jDF^iXQR() z9J86hBxfgz$W)ta)pU6-uoPqYXE{E(s|$FQnS1!lvCbXN<;Ti{1oB1cdvOyr0 z6id-Qf0riCJ`qzx$);J73rD-h;2TJ&GHKRvo$*OLUl(1$u|b}BuA^AxW=Vm@>PEP| zi);%Fb1r#3=Yxv9%>v56B~G-Ie)cVqOZSGsk8#IiyJ;C-pO zewAcbdPYb-XEaJ`RpzB{6eBw%KlF2-tuj4#`9Vdbsh&SKhszXIiWmq;qaYs+xv5(| zHCIgMp*Z_f=-6lRyG4tT%OT(b1u{KS3ETn*9yzu@E>NgeJaR=G!5?}yuI_rD3Xt~Cjfp5Dua+rgK|Y;$*5RR$C-8UB-+5ZE{^$C)%%rBuxmNdmjf=Lehue_=yeEsTjC zXOYiWNSH6&jw;e+jZyoo7GZ;y%_Y3@!hm;-xZ?=iQ4Kp!w2D~dMvbEbsbQ7_&aADi zEYU+8GWZ4)xEk9vF7oOnlyXA)bOM3zR@(qAkbDs4 zpwDtZ*|kufo+s-;Wdslg$3NDfaX?r!i5EdPJsHLa(wi%yMq9i)faf(8BUBhSK!M~5 zCWCQp6xjHTo~4MP5AX3tHvsN2$x+woOd66*jj%Xu^l$R0_Ru}N<6#d7;I4D^sS|1o zqNtck$j^`yVL3ir50xngP?qB2Ad7bKoLYhbe-TmLmXiIu}6kyn%8uu72S-k*3am8s59zo zctWxKt@#o*B!2$@r3T|rbBLmi-7}I}A_Z&Fk!;dOY(~a+&jC?-&=&cgH|~(Efa7Zd zdG)IOL$ne^kjTi_&H|A~+baL7%XyE56WPUZ9TJ6KxLP%oJt5^%F=l>5?|--rPuk zFpRv6enPqJ*G!GbYj+YItl{P8OpTNEqC ze5%nN(?_1(StPo;3;iN7$IJm+WZ|@zF3)vvxWcml0IagOxRptG#kvql0AQb`Qe4Xu z%F-K-?WAIUG}^e&PHM^ZEjHRX&BmrNjiDm|{u3Jv`{}Yu51b30W9rxO|-X`O%~84x_CA7+M_4A`iW6%hj zx`_l1P6vIThwW0P(=9D7!!(jAf_@OAE%h~9aba?jG+y~Ey#8BeVjJdZ_F7vj;zl{( zbI(6IRxQ?hC>+SjK*v>L2>J>&ziD8N86#y4oG*IkKW?Y*K$}Q`SS{w`7f^R_e%#Zd zwXsBWfC%7U>Ja$+$jwI*BGn|ikg<^G!)8V)_cqq|6Gt@QmK_N>V0`mHSAr3kqjC>T zlooLrJBJ&5KBlS$s31$2 zZDd)bau|ZU)B&F!Ip(FuJeLrNfC(dvksmd!V-^uSai|ind5}oON4mC-KsGB!#{+#t zj1`#@Mj!*#hfhjNy+#NnlVnQ3@Y0jX^aDK7vWW(radHTG6L@R1sQbrzE}=6(27TR56!GKdR#I6pQ6mqB%z1g!WQ7Xw`^w<#9#sto`EuK-5ixRk z&mXNpmrWKo3h=b8B-zL=SOZow-i66QCY$H2VXC?Ff>djfM94)zYSL?a6llJLU zqQsJ741vO_>Y;d|rNodHjE2rW6=6d~i9wC~z}V%B0Z}8Bee1hz?1LW@a!=N@&Lx@L zEQ4X)j1UbX>P*NHq;(#Gog~UwlvZvy1bEbI+o@U*s8J*x6{ec|chfDdMlK>rv(G(hEV^`7q>Eb!7<9yk z$K-m{t2o-(FcMP3`kf6+H=y81szUCsA&hD$g6lryh zE?GV%Qn=fe_;HV&2l&34p;z8l;5^8r;MQA*+t>!)vPugP`9b7X4I17wS1-XN9nFkX z3!Q&YjD}f^tWFndoF7Vkt;f74cIcs8k}!Hwu|0JCIys5lhbNDZIH?n?Fl|(oK|TS8 zN~V*u?{LgWLVv>aBLu@!_??mNhzBdZPo6#1c9;SPi_@as~eTW1)OHFA2XCkBH&g@5H+ z7~#i7=A@7R05jlX@MK_>98+31NfZZZ7r-3gQR7ItAh}`A+;sgZw-=582^m#E{YIp~ z18s6}dU4i}tF+3yo6oOGiw>$;&v_aJ{{S8^Dr`Es&-|kgdEl%KR;D%6DcakC9xQWD zc_d)DlOxL<&{I%xF-EeHj&L@mB)Xm9kd@LHM!c7if{an&4Bn7W#8i1_6_nv~GorV; z#<}MN=M|NL*&|q^JC_PPz^C`n#xhB9ob<^*N{=i7#te&(Al-hnSnT&8P)}Y+=DKRb z((}J?BaEt#6225+C&!F{pmB<9al;uZBycm1FbVsLFS&>0N&xjWsaXxj0Oup;PmRtG zKcM~bO*Z>MCB9xD(Nz>@pyHWFtO{|##W^I}KqH*>#U>eB85?QH%agc_)|aLmrtd;4 zk#ghaQfMdd$S*Z-=2S9VE%m6$ubn& z7jYcaIBy>A-)xA?!zAOt8gWNp0c zqrmrUj`BI_jE|S4Olej)T%(*8ILP3d9MK213nu}(=CxUBl6L;yDMWqDue5WvHaYr% zin-GJMQy3V1_+Sy%E&+;dY^4&Z59`~RRD2NubCi}t-6MHIOF{&+H+P!q@f7LJhRfH zlur1NLv8Q}gHh~-(~P==Pd)j~NpKTC4%O%edefpqF5X$A+xY?KgV)lB3QZ9V%m(f{ z^c4Aq0r`3Ks@Bryy^ye+vZ#(q?5QZB{FQ@0?I;txuPcd5v)8po9ka7Y|gQ~TbU zNip}UjA0H*q>ASDS#oV!ILBP@PtJ=>i_1uhpejM!PsDnPpw?k)i?IXDd$HH&QMFxL zT(^bH1~gDf8BxF=EL9bi=B0U==G(c4EUG|0gCy50$<{-Ad8tREXp+kT?>CQkiC3v} zif>>$EpOS&2rdk2`i$w9ozxcq@<2Ww6-n9zzwI8kVWtR>#S5&mGW10U$ICcAwZBav zjE0P3ow1J|mCkzUxiG7J3}$!O9yq$3<%#j@QK3jK? z07)SD-@p^$^QaossvaKDDeWM+jIgK#g_|6oG^F@?xvDI?cVFk2~B-&~8$ZB8R4 z3w%L2!ugEj>}j2-)Ee)!np8}YNplaxK;=O!Pmjv2efg{))b4;?#kTv#I^Yf$#z6EDuA_9sYN`-FK0 z{IQYA=Op>pT81dCE#r+qP&vn~5^Y?p;{~v>v(c;!Hmeo2x`3b#tY|5r>GpQ=%x#3m zVp*TW)poI{HLyui)vp;21YnVzp1wb|KTp-}wHu|kTM1!6J~G`Fy2&1WsMea+iw*B} z9l2Yd%0>ym`R2CI;t-{-?(BpZJaqp6d7#6jTgJ|Nlnlpl$^%la5gigGL5z&?z~?o% z=Y2ILH#|m#aC+o%O)Dz+9RC1{op4zpF+>MV&BxoC)$a9eZY@l)jULy2P8T>Iy*8;E zAcwmpo!fgJ6p!ywuP0_*s5du7QAum8wd69p#y~hwe=QE;=@l?Z-cRLU0a>-F6_Z&E zpL>osZ_T$GfbybSJZ%w;;|QdH8j^cOjgU&?cKzI*anu9%rt!5yfB-MIAY*@x%t=TdB$UQupeL%w0r%2R&*^ z_^mT_5H4I3lYv*ybg+S*gU+>ctgWTYvxF>+cB$)D7WYf22HtRSo=sYCSJxw&V-DOC zz@xpKDxtgOQ;r7eiuxV2qjuxFu0g1GeVdWP$qnqI3&<)zax+(_7dD$@LPLkZ>N*dd zGE9djAl9cQk*irEHLbuT@>%eILq|<=dtn?mydUu@^`mOV&F-lUs1dg%jyS6EYc0fs zXxfD5B=}NaK^@lC!D4v^gFThQ!Zx{0yZ}uaDo(9p?HWe}r+9702d||P)?3Ak6OF)h zAf9L%a?G5&4Efc%UH3sr%VWniuL3y}M)&ZgVEvPuaC6d<3l(M`86G&N`_x+o*58@|l!M2K#s{CBNjgh3 z3%OlzJnA@v6M}fC*MjB3?RH!qSHgg9=8S+*k2u9iVIsy`YMgoEqa}{UVwpcWByJgZ zZNqiXjX2!5LVoomRkn4PyzfBp#wjI+S)YdBc^WaCFgft1#>7Yl;6eQ=LB|uu*bK}w z$YbR~ofhR!e1vnKfOM;62)zbJog>=`IRIe#<24;p7L5=pNg`llj%y;YRt28r*!TnR zf$LU=!3$-EC|5AVq?S2f9y3~6hXOh_R$bWfV^ZY4#ub@J^s4*Ew?UZPZ^sG^M@!E4 z^9+$iqD8F6-hH9C`cW;C3uYxM5dQjxs|ezA(PCG zm0Ju>2xni5#1U6BTtpWNYQ90Z?hJ87T2zH)U_uO!O0}?na?Qp%)pfnnL~)*eRX!$m z8@Clx*Kdt#1m~O}#BLNH3W6nvCvI4S)Qz;G!6m(B zBcWCB$4W%K7YM;X7#>wNO)fBiFH`G4TTu()c@%^@i`OuP;aeRsRCgB|fx1J#`76l- zALUy$#3+Ea#b-Xe)NyLW?_}f5jwrIVDjMDdbVgI%k&Z&{RSp!;1St&i_ijNW9Cf0|(b^{iX!%ui+C<&|0K7)zHby}4sd7YSK#bY* z6nfJj)S$RgkP3s0(TtYUaT<-e$0DFMhXk0~pAb9}C^BhtzzB+egdUX@n?(dm{KZmF zj(jNA_crA02X;8y;OCmg zR<`)=Kvau42wMN1Lp*1Dk(D1AoznH zN+LK&_Y$h!b&|4&PKlHu$U)PbXXjGm(_u#DILIRyz#^-(i|vsA0O}+R`;Wprs(I9H zcDwJ!Kc#u*w7Z?t&CQ<2@?an;KgxDJM7{1X8q? zw(FOEalp+}N2lJhlGD56t`8LPqqEE!>SCw{K|J$LoEqy~3nmp0rg_aoZD&w)W@y8c zz!=3&h*-c$GsegKN0UOEUbK&L#E)>}@~DW8YdcN{4Em&sH-#DS6hk%SKl5#aubMIc z04k1k+qLA`v~P|Vo|K=(F3JY(n?KRKJQFb zi)oNvv3~VP>y=?ek3zJ;5`06b+(s)tw25k5M5@y7WBpj<`cS6tV{heLLAyWlq3qN19ZfId$R#LJS^U1)gYwPQK zWg;T4#y}YRRZZ3Ip{q0z1zUJChT1vB6w0o=)FexSq&Ie)hCohzDj2`J)SZ&tI>Xa; z(_1~BjRX*oic2p$iSen0TivjW-Sf!cX0wfUjYdsANCL#_B^^m_O-}&pKoq}T^48xy z$wvo=1E{O6=z;@{+2=XwSv|h^SV#y4j;pg=@4M*&cdRqPPNsm_M(%<5osM(;g%%q*%xcX6-<+~^tdXq|^=wL^ql_QwJc`+ht+lS`#*DoI z9crQEk!QdWh9A_?sr#IBRziHnBqd45A)6Tc)C-+T!aHY{Srt_9L2kclyc1}V>?`rc ziy=G}h!5CN(FLq+lu}!gr+|LAt$y#f8hwR=vIdGI_<3U7=j14HcFNN300(_JZax+0 zXzj(WwRv@{*;+y#>k)(fIp9@l_Pa||~s?xS!42;=5@&||%pcqC~p9$2x!WFOzB z&XqI^5a#J2iWVb=PEX64w8@6QYjotfRJfk$N%15E`()L`TE3Za5JYv|oxsip2iBt5 z*hcznt28j}2ONcBN1g>leFIM9L>+keSw_xk^mw(CQns9hw!MhVylrONll7q3q~>W4 ze-*sPsYcy_=5h0?3m(fPlRJ0Jj!pqD(vnWf-X!H=y6-X0(lMW|Yc|&B7}ymq1k95d z=Vm_)@kmBL`8fS)TU5H!^Bh}JOyRr6>*vA#)vBa={+}-EY2zRt`EL8y?}LhzouJh$ zS*|YZY_8aFPH=PS(yqer{x*rPo;HL|pfTm5Rs(m-G#T%jC6Z7;h;%{@MQbVA+f71c z_q$t|B}2ee_*d;$x^3mX?95`gWmX)+D8O%_=AG7h;zgdMFD=6mvj;z!kL}_5(%;)e z*5#b=c*b*s(w@3^c?rZ@Kx6SlPBHQo0_x4KR!CM>D#}3QNa5dy0aC*1tR(fx1mNr6d%v*;c{Hr@F zR$>#+b7yYsmU21HFvPVAKGeLsU{LVLom7G|>02XSq@=uSv@rRaYC#k4RmnyGw&9BD zCVtra`&S)8@hyAErH&;ak_jgtBZ`%!#i`s*k~Qo%5csJBAbDpWHOuTin{b z84B*W92_657qV8r!7QakE3|xB&r{6?Z7nggzm-C^);gv<-GhW zEk;GDo9B5}%o$kYye-fA(`I??ZWRcUJ^f_x6&FmCx(_BBWbAd7NSFS77iU@%mIb?{zI$GFrhUtSaA`0Uz3}XSJ5iS*;pH#~T0~ znvbS-t|XRAZBgDg1C6orK7zT~Tb5!iw71rdu}d2_ADCw~Hho3j##rCJQ~>S-9OKh9 zChxQslETIS>=UEy!20H?2BUSVF+lCJJg(82mO^Rv^F+xq%tTymjHvsXzFAu4GNTT| zr~{K!mlL(JJ7*;qfwraS_fyB-84AQ4V=OUFj9WGBwaN&w+_2#8N;%W*;@YA?&xop< z?J`TIidg0h4?9;J{c1hNpQv2IKuHl4^ShkjZE zz}CH|X}3|%8N2icf}IUq%@lV|Aj_!(kWCV-O_f3^359e0Lb5DEtj{uZ&f`?~S|oDL zz3kI4L7Y48{pwV4S|n$2?!xjwYy(@Bi!nF7_m%h=SPv1!B;&ecmJ0njHCZk6D4^TU zVnE#NP;>O5&v_A0$vEClHnuW-aZ5ARp}k9F%#!j?Oj1d$G=K8`5Jou_UQ#(w7jRFi z(o1V0L9$gi>5=`aB1@<6)BD(+#DG63#f zheD0G{jo#t?`50?+Zv9bj=!Z}SwW>~V=NFk;GaL%nlGT1`QwH@^CRVoj;qIKuC4)Q zeov97j?O%A>}d*fkBPafIA(c^u49jHRR^EF4&o@V8hMTZ;Z?JfSB&c*(Bid$RU=kl zIc8!{`A{1~j!^yVn9o4Dt0-=xVY)5ERCyLdDRqzm;F|$IdeGE!q}w!1BiIj%P@>S{ zX!f~Q8RLqbw+9CUJ#Z+C5rpph3{i_!E!kT_`Xvlk1HL`(}?2CcW6GbsW3IQZY1vqLpw(3I6p}O;mi$1w-0gh>x zJQ6nN#2+erQ)!ui7XbrC-W>s|T}B&Fu0qCfk`p=RkEquoOfdxSF>W{L5&q)&*SmMY5kNRkQRiI_;tz!>|)0Y}QUxG}I@>(RhcC=8}H;BDZ2 z>auNKbaMnTs}ggPoYZ)|-6f7V@2%x%iSHl}&&xg^YS=8U?CxROJ>ENoKk}ABpvEYT*iANM*(4@a9edH9eE$Giwbb>Iro3p72@CPVW1rTe zzijP=w7Vo$ok1Piw(K8Ytyra~arP%jwvsoAqPHLYYz$_n%b;noOp-|q2f%_(56_y{ zpHsb`5_i4Yxjgql&)TJpK3j`mz_XE$jfT_qqrW~DHeIJl1Dc+#BOOGwZo=d=|nBH)6BWaAM(&IhfYtgIP|M6 zLs+-Cl&PLcWPAoY4gmX9n4KnvxcFjB^7t%U{HYSP$)wanN;j&)$NEliJi1V2hVI5i zm_NP}G9X3B9;BMs%+@xuN~Y&}k)4Q{!KjyOE$j~+ngq!F&BIo3%B{8SJ6j-@`W3MQ zCuYJ)^u<_c-LOv4r~Z}&IpCHGT7aI;Ev^+LyqwDCsyGZkTDDHZ*w{xKTBmXW%SRI7 zPtKVtwjO7S=VUk{Ul_QlG0PH>@N6H{2&mI&#wB^I&@IOtzaMk*6!p`u(jfEqd0**V z;QdW*OlMAOg`a-F@u}c2TnY?kXG4aTNfh9!#7G0xjSBl-wb5hRq3$lvEC9kU*BsO- zyKd53Y>wSgTl&ujKkvq?O!a(i`{i7>btXA1ImI+Wo!K+$Wteo0fIz?JT8w(;vv^)D zh(jNRp;pKrKBwtHgG9DzjMo>}6HE^&E0ClA0Fznl*H+sdybB)lAh^bG{C{d?mBi8+ zaDEU62c~mSq0qFuB#vivA` zLTJk(hKU007|A^1r0yN@!fgKltPYeo?@^_4k0Ty|MlfqY)25kr$00a8^`w%(+sWQ7 z(}u>;8?eO^8AP(GF(96br#bo4Ud^ssE$7q1tVsRb}9xuHkToR z>zrbh=bq4*;RAB@^b|{byXQHTcP=^s#VB=2BZ<4c&guvm@ii7Jc6JSN+~bu8#))yL z-NuJ%q;1AI^{9^5MI4}0A;}w!8i#93L4^@MPb^=OYHT*KEM-*`1L3zBs_S^JN|u`C z_koiZFh6>o1=o23`167*BhpQ7skFN}=ZtjuQSPjzNMdABmH4)UQ6<&h+G7(!O5_kg zsVS^H&$lNY867H0-+j9`PV8DW=ms&7NA9I|G8a%WpNJDhzY@r*!PhItJW`gFT834P z&N1=i53U6jsI6YkTV32cnL`pe3zfn7RQ2r6o`A-GnCF)8%>^!5TXcw_K*8?%Q4>&t zBBQ(uDd;OWOt|dS5U>j#P<~O=Q(&@CPV^Cx(NNt{ zrv0Ojl|?NtO8hFgjC3SZu5J%>tr`bx^v)^~(5^&fms63z84IySe!`6uH&)01#DxC< zhpkN(Ij(~cV|9zbk%3kgvMkXOxe7DRIQdgzg68BZH~@}7CWQKJ+$EIA9z2p1H%geP z03s6UBR4)HrAb)~i_{OTKuwnMu#!y3-4`P?8;x$uPmFuRIL{*ymi?dwFK^vfDv*KF)+hMt+nLuIu-4_mF7K6lC%5ErQ=p4Op90x}w`Z z!qA}~;y4upQSGdDpb%nb2LXp5Rd$gEp?uFSr?APAd$`wXsPgrzSv0!|k~NamN}hKz z0zX>HLACA0#q@i4aJpi@7Dn!XQ{#0*^RAsvtA(x9Yq(B9>5_lSmN@T7{{Wel^W^^kYOs~TA#?u# z%JQehKXj|`mgMurIJI8Os5vDVV08FR0S>Vw{{RNk2Zk|MiFe5WVEn1gGa~SDp17+9 zsOD{Oun5rso=X$Jrpqp?8uF^=#m+@tEUe5+;QZ<|k|gqwa>N{QSF2D-y%x(MPU(p7 zJxwfHo~Z(5t#>E*fF`9gEK+VDV00Pgk?%{X1%3tc8LJVHYj+m}mVm^gq4WAxjkWWt z{{YL#9ww{pq)AgH3W9UU$f;3Ei?|4Lr%5|<6D|Zu#jYvfP4t2$*NB50E=sR zb>^bMArd(dIT(axmQ(%OHITc4S-O%s(Qv9(JOX-aG#Q%JtPJMGOo-Y-r=|wpa%!4x-y3(t&`6t40hEH&X~x&BYO53_Wmw7lxdS6L zOR9E+XgU=4uNs)ua*CrI)GMyi*Z^)oi`m!5M6jy*bBDy(!o6U-pMsw$OB-tz~QZ$v>V?>pAl4 z_M>T*x{bxPt&2-;jdLShN~rwAg8%}4gVwi?WqJfNJ^rh5d$hP_*o0t!#GL-M#`|84 z#n)yuyME8vJWLc#{Z0o~$>3JRJG;gpFDv`hacyBFAgsU;a5s_2=~AOe;ZXMV0hN6*@nHgyP7+tEh`Pd&w#D&O|a#5oj5SVm)&bB;L_X~eDM++j}T@baq^aex~D)pT*9$TBu_#yAv4kqaqs zN(13QSh-b9oB`%VRZpti2R+@eF^}peuhSpipDUS3!P=fg(p;kK+JKWq{{Y1z9D3x> zF35VMx)QLRClj zk6Ng>*jPzzbKN&xz=Mj|?yQX9vnEfF992%Cr`sfDriIv!LMYCDKu};d)8CvHxc7mM zPJhy^?Jgt;3q-i}=C$P27C4eU8+6UUH<+xzvg(Uc3XEdF|%N|{@ z2Owsaad92pyqVfS`p_=Bwup_}fvU8%ZP`}<)YXZKjojm!RRJwzjzY=srg-M2#(Es& z&>8T7bBt2PK^<|5f_a&b^yE<4*Qq@G>ay=qFs}sQezgg86M2MCP`8~+7wdMAg3Lf3 z9yzENSMoi;F(CB>)OhS9h~`J?b5hv?u0ZCblN$GcGh?2#uF)=3w#BAJa1t!HC!hnZ zSL&0fLO~$snyQgxZq-yO9FI_F$#7N>NXMmX_Or^-gb%b1Nj)lJOzyikD*!sLg;Oc9 zChJpRHmC#-Gl~uj%bsbe4tXaaR$SjLvJf(J=}-XKB$H=3IqT&~ac|wBSg;)P)}zC4 z!GRou;hHCLEYgPzRQ{EN1+ETgANRku0GUkqN;U{9Z#0MkB zm~a^+OK=R2f_f`p16oZS=n;>1oZ!}$C0amF#VFi= z!&6r9DcjuBm!8@L_y+d3jcn zqUs4vz>+2*$;Z;HZJp6aeBnSnNa`wNc8aJlPdwn$W`G47(8-U=y=x66cgV4vxB!n6 z(wPjv45?BNh&2{S8g&ZC1IP|44cVT+pLZkVMrzfIX{T=Q0dn0pW`zXXmy&W%H6FrK zJR`p(Fgd^&%}$HEj|Xl?nKb}qM0NnFIiddm4@+dipNRheNTS`i?*xg)-b&Lg?_#)Z zt(B9mO-IyuE#_7`5RyhWVydnzecEpIlX1rrE@LNiWS&bJb(jU}2_jXFMvoklF_ZdHETmLTu1_8`8Ki~* zxV|&cdD2TWgZOhqMlvWHkDWwxbWjv-l%8?nMV3PZDqXo9 zM~R@}(n%DKNM3qoqe%>8Fi_d>E6Ars330nP2b>elWS2{AoB%)^;8FBs0y}b`XCs;{ zmWd%7E#`jw94(8Lg7fv$oL3gvcF9&swFsyp?Yh z1PZ&+k&ohp0q1_h|Jy7 zTyhRJgVwd-*2MO<#xOg!E7PWGJeqy7M0Wuila7397xCCEo4ap_XQl}zmGyXUE`qo* z#xO`DnsO}{_&gubSf30U47wasV|y_lYM8gyXysyjsN|O7n{lk#Te!#bTgPdmtXoiz zW^Ccc*O3W1;p)cPz}v<)N*Do;jL;_5Y~=x&_Mh;MYAw#V4%qFGxoBw0Ly6B?o+rRCwo_-qDGZ>K5g;Dfo|(>sX;U&U5}8 z&=W$AGq@;eI`3>`RPm>jwOjt^p@-Q=|u5;nRTkH1SD=GoSqOVVL+4LwFv;9D4*d~#wu;LnYDzhsu+4^ zr%gJfDgv=@LsdGehe3?6XHfj)Zsx6HwvHd>J{4EOfY%c^$0HsYs_W}X=Tt14iSRto zB1P7`kt4+z66eP?Sh|L%ctMQ)yARC>_o&>^^0iB*a@$;$!bQSP;w*dcDa2NrB=OLW<7DyQQIvS`x~mqo z#MGvJMIn_W0Qha=&#C!UlibdX$t*q8E6zd5KPuQ}wYG=3TYvygd&C*~Q7+!vWJe7f zCrmanYMg(kvWn7wc~vMujQDu{XqMM82@1SqVC`1G=9@i@oHqrdf;^CZCF2Lfp{+LO zRJpUAyVzDo2ZmQT{iwGal2+HLYB1WlY#A}m(~O#e{jFP<{#A_s00%i`_9Q-)uodw#( zz0k8G4lunczFl$)J@G_LW;P_DZkh8nk#>p(gACxg;kJr(oKBYXmPFpCK6O)lt}U$l z7Tey)I634G)0!N*oNeAR#EfyzdB{GVl?uk%d-->)YZmW>F8qPdTF$j3Z7F<00w7di zxnQFJQ~UUDqg5qXw>kd+T7?jvHDL2D!NV5ld?`)YwYJPkv9g||XZ?y<7WVo*C5Lke zpW*zfIn7Y&{jj`O!`h2*ypHE3{{VWoyE9)#(iQGY4ZDzxAD20*n6yY%;bNWNcpMfP zC&$LI%hspARpp4MvrxF(JaDi-;sBB=M7k>3q<-%T#TQTIs9(Jj-!1{(#OIPn zhm}ir?o=F|tT01271N}1?LnU0#Rx*Hw2q|ppxfHStYd3&w49OEO&x-jRRxATb4_mY zJ)%9b9*1$pJ!-N+>61brZst2xSR0b@o}WyAdP#%9yrM_6z+I>N19{Ff+dXRDt_Z78hvd429#2saiIXUA4 znqz5}Q%cDa4DP^F(9@QV*aB+SdV`rAyRPi?LUKMvp0?|`uGOV=>E4A7e%LfC%?j2i zoJ^uNJa0$-{uL6!+DmhbTaz0voAniC8j{N{{Ffv#$YPks=|+n9!2Qg`9QiL=m8Zbu zu$_>*9vMzW3j0oLi6mmoH=xQ0%^(dS9(ZwW( zjKnq(`g2g4-Wat5D3az~oRmh+ewB9*Xt%+UX2c#dGJ*Z+msSHNg>`vu(#XSW{{TpA znj&^~D=T9hTh}9?kZ0+i?NRUL)FjVwcJT%uk|qQ96?|~e>ja7B_of- zVDAGw(89U2|9~%+W z)hjkEUQ#8>!i3Z*-qJ@YJ)u`5;GhTl)a~C1BOH2D(7@OvVZ6u`rBI66+BZ~$MH_jK z-l$sjbo;WgDfo#cm3|N_YnH+(!?aRwZgG=Ta_Q_yj#LC^84c6drDn#ZD#>Sa0;>r( z4~XJ2K|eZl&_{770ZK1XxpDfRr6>^D=X|*105%3{VkDEt9EzZY$T&Z(VYC~oiK5#a z3U-5y62f*gzjlRA$nzjjkHt$s-(`fIqOJL#*mgE4Ik?73T^+ z&VriV?9U`(9q6NiKfP;Nv1uNcZv;R&0PW~#zE2v|mkuQ(&?N3+n<1rSO*@D6atCp1~Lb8R2O z10H~KGHI7a>g^Dj%rR%;#swXYCB5?6A%+-~%iwYV`Denb<jJhDd?;yUnu@ko0`ad8&m-JxEXPH|iDmDConsKHg*2N@VN;Gr{}pdOwT zuKUiRa~Wdts*eO-58P30Z7(iVWU$Xa5zRU=cO}#o{GFha*N$qxRMwt2a~x@t;@QXA zmJK1pW=3J-`A0P&^yoP|HxCeb%~dMl)h=&###S{$!6*qoy&K#oxKg_efOI3yr!lv( zRg=01px_oeb5&P;v$R<|t7$h#P6%FbYb^}DoOx7<_o4p)3FG$^*X;e3lI7bC>BT|0 z)@~Le(%igZjsPk_KWc>nNbkLh?PK}eR&}Wx0_ql)NwzWG&PPqS8SS|%^9RH{oTP2AzRKT}5O4)aEuHIIIxv9o@B$C7#l*f0*vU0NSM2@fr)m@4ngYExpNr;CT7&-p4x1!HExh*)7z9YtuRkD0O&+x@ zGRIX-PUCEfV*nkw914$fpc$G;Eu)6u$_PF4>=^OnR>NaFFK@l<86A!YI4A3hW#*@4 z8VhGsjhOr~4oR&IP}=rZ&JbN}+84(n7Yd)RS~@QDF@^5q9AiA1ktVqXpZ=07N#u6t z;9PJV-t=qg}%bpsd0 zCS*9|f$-J~==d!NP{*kt{dlO?TGh3^p4CTi1~L=kKTay8wTRTBkm~Kq1s#9NwW}8Q z8kMA%oy(o>2PnA%(=`??##ad#I6s#>)G={+aLPhN4tNYV8cTgf{tK5QY)zbhE-<pP3puh^hrCdj@!)yz-WRUW~M^p2l z$FAxRGo6YfZb3-$K=mL{um$X+iX^<)rB~eB+3NBcz0|?GoT=K!=aEx_7{=fW3}X$} zpCyBQ62eLnzY>l`7}nKS{5u24%%S3Oj4iU{c-onlZK$G-}Ln z0v!I`DomFHc#PSsqs5*708T2Q`x|R_JI?mNGj$QR-aNRc)iC$CTaB)VbM(tLK{X*} zlG6_)u*5?CSs!UWywyGb0J8=#GNs)1!Om3@KyW^kO&8gXsJ1IShUafByyTy+TEtx zKZ%!?8-Vfgrv=OOkcMHoWdVYY4tW$HeSiqHZpdmA-ffHQf4R&dV@ zcpDoy$j=!2)m`O`iMP3za{mBO0|3w*Up%U*-6{_Q$v=9@UM<`sJEchd8Gz&KL6+?g z0guJNDk`c?Fv%kumjzEvo;4*(z%Zvc85{9ZOo|JZ_?B!c@sr6EbS>R8J|!dkOll9l z_d}Iu8PCDfG@|-R!OSuR^JS?ePYtUL;Zi5@Bgf}Jl1pNtimNj8AZHXw-@J?A$C=`y zZO0%gli`|lVezUwipqf*dNxX$o+HBNy*cVgJCEL~CS;4^xVc^iah{a6n!F51iFc<> z-|wv&uw6#zTI~_W>>TsA&V>%AJ7yaVmoL?Exnk zW74fMCqUEg{&cGxf8t}$+KZgI!-BpIilvy{J<7%)mP7~h#=C&4<+#}f({2GA46j<1 zfqxHq2IrNWpAu^+-uHOJ;Ep8&%_}NP)Rx^&=Ugs0%XOjm_VUPfwg5f`wYlC`RCgFX zNT~kyA_T`S8~&5W)|*=Et+msu1OSP_B1^P$_% zX%Pg>ySxD)ROyTkq00k~ndwV32``xd0ZV7db4-_2c;i(7`D1MraUtEg6@ThIXdU!$ z%r;7l-X(BxNWe|}sslO@r;mkle@YP4O3KZ*D^ppcmQvDB87ISO`A}q%*(3|O2tGOM zMXL;tSc*w@_b#~~m~uZ#U*hWsY!Vr`3Qh$r(%VM6hB|U_Rm*1u`))ig>|t9T9+jP^ z5}Q|usU7Cm#z;B9q76pa%&_kc*$mh`6M@B4+(l^<0gMk*(9!MgwEGN%Uh+(1A$)0- zV%qlQ?j#$26kb3gqsY>x=KRDA{OY`Fq7#K58*oYHgLSFAC_=tmo>AS(6^ixsrlzMPGi9^5oSY7{Lygwv^x8xaN4U3+Itr+s=~m&K!MKG7 zaax2sKxb@7;ACS28ilO(^G(p9?xnaJ&kBgUnVbB*Y0*|~Dv4V$2!EDaa~`9S{i{gP z9@AFsRn+nV_Lhs?;aBr9^7|jXM%BAx?{+s*EWswYP>4%%2bMmyW1t-qKDYo*wf%w6dW{#kv=0MI%7VQ|o<|jnX>qGw z0%TPd>y4x0CkvC#2Q-?5a5Spj#3FZHki>`b4ml)v^{IBzO$MH+X=+v7b9Fnh1=#-p zNFH9Il@cdGJR&HN&nawtDo@Pxtw*#P%O%?B@x&yIw$_gwK4!KpZ&-^$)8w7XBB~RH z>c_&lrlEK57KwKxaS5&$cvyL2Nx%f2d_I+qSI1rx*2&rBwAM8!?4gD1{oprx(KdIc zG62sbr|Vr|bjxin)opE;WJLe~@@rGy)kbf;%CE;+UMI_^` zc8(M;b%_Cy*s2d9$u#G^jF08U;A8G-x7vY*G!eqmt8>8VOAqsaCNez=;-*d)K~n*C z`r{^tyj(d@hyL!FqY#w(tD<2By~dj!k>$r`O<3g%M?LikaxJq zEWJLQ)rHm4JVgdous|SH9k!2gZFXgAg6WPHPHMz9mvM4NZ+4P=0^=UNDpmN7dq-1} zHsEvCi{5W=tR3C^MaVBYSeoxLXm6*x?`_^@T_PZW;;SQf2j2pF{KJ!V<0x% z3Z`8O{K+Ju{jkIGY#n}eV%E>3!QI* zagKw;`kDpyw_#%z_K^z@9ME4=n^3i25U3#Kya&#xuJk0pGHp2L3Uivxrbf{n#2410 zK_|e&AS((iDI6obEJ}_52dz@+dV8vFVi{ZEKzPMT_n9DOjao2CBk5V~hZbzITuQ&q zDIfSa13x;Pg>6-sHsVLqHLTBdIw9J{jyhwCiyiKy=tIhpvFJF?DEy17V*Vu|kdYw@ zI)&zrmyo(17Dha0ImKwVdTysF8*dz!IVCy|of_XrpHGy3>fT4{a(JS1*1BTXTAo&s zM|85ry;S(p>DGo-8zT^t;5yLaxtKDE%M>5g=TpCk2P(130XPb4Q!6$syOf4JNZYV8 zf+{H0E&Jc*FkW~h({9U)w?-;KA!^jq{$#(5yedRn~A3^*xJ}TM@s2AF=Fyt<^XL%BI%MmXfa(0 zA|&HH^!d}wtKBDfpl6I@!kujdTeF@zfH7KS9xKO^O{*AR4ArbsGRAj`teWyTE>3W( z;ZK_QPM-@No;_<)qs`*(E4#;^O2aDP?BsRpP`jmL&-Hc15HnghR6Xa3^b}f+ICo&f z>E%zfhB)R0Kp#4RJ^b;^?X(3aAPz+mJLwu0bydj60<)_d8@y_n-I8cd>#z)pqkFl4 z1db0qXp+w)(PSKB!1zF?J{X{^vfHR9`GB5D;)=S2G7**O=D4DLoEdjH;zk_j z6dU;(-8sv6^HP>*{WsPan;t%HN|=C@hI3rm-CovZ-zTD6w^LuyO6b~fWIF-%oN zRoVdgii4`Ob4C@Eu>SzJipe(GCz4l?Pr4#H)7wvmdBl!bZT0K=(=5zs5~`9o$6B4; zqb|_c`eLXmL=1pn9+dWyML!77%B$_I(%w=7>>r!wQ$@r;bCP@rtq7;Oy1f1(s!)i{ zT3$|Lw967O2TDmNQ077gM*}rkd#fbJxcCbQS%+!$Spc=!sdvecGy!NIA^1d|QfKQmgFR$@{_PCBVR zIn7L4bwQH(KBKKvHN>&5(SpG9OW#TcSf4%(N)LN~HLxAr3d0=ZlU3F_qDv_=4TPSA zVw`80-#y#9yo5<8fgbDo}{`&^Jc#6;Z6| z-S}5B6_o}@k0;WqWLZe?ouqtzRTSNbivqitaJcZQiz}^87BLv&+uV5@L(jN=Cc(p#NoQ;B6ju6Plg;Cj|$ODSWIb0*f2SLsmZ zGTRJ52`zz-FIu$QED;X%Q)uc%Rm-bEDUn2~g^tAssiXq8Fz-F)cP}LQRo#uj0|Zt8I;@WvWr>OL1Dcs{bKW2i5zmo5 zD8o#XMuo`2ib=HSpo@0ENb>4xP?!h7eHky;Mb8?|iU7+T#wx-ZeCmsf{vatbMpBzxusiL{m zAY1~{_--ptpH|dkWZfU~lymU(t7%zS6(b zy}r1vade+4bpQHr2S)7NJdKTvuYwp{d zclGC!ybFrRUUh>K)+j* zjSMVFZwie4n>S@;p5>lF{UBo%UPe#pw_4;;Cdi^PAL%*d(X5{LQITYx6B>blp!ijk zRx1s%K%sH|A~I;fBuK!Gx_J&OG8=z@NxmdISMm(&p}kWlHN?MyK<&DQR7=JvdYK|$Ppmob@8FvemS^4|gHuEi8w?VB)MUZ*NI>;KWD=B&JS2^>rjrL$?tsxafRE zAht(WVh%{^wRKvdi%s{`R^Og^Uo%9wu(pNbj%8JMZJ^_U$BkNp-KfcBKhh~=wIpwK z>*q!;$lt@_vy|;sa5(G5KVm9wRbKF(fbmV911BiUyX}fZ(uhLROxwxN!r$pi(~Zft z8(JdA{7TgZTfmG-jfQ-8)ah-WMj3o2JSca1aur2Z+^4BESe4^eDuGHjb=Mi-)G7OB z#^ge_a{L1Ux`XLf(dnvNk-(`owifXgJ=h;Q&!w-m)$XG*If%l&al6OmQev{WxDC6i zgV&0w2jXv3(J807Iqn$uSP0Cj7g`fF&xZmhr)_o=Y)pW}+zl&_>ReWOuGJi9HZi1$gCe-#4sw3f#_ay+qcN*RBAg5Y zGglTDa$Y2I$fZs*@eE?2>UzX>MHW{IOJp}V`Bt(;Emq5AcFZD4V&By7Q~jz8Hz6jH zE0r;oI4(itd5qNg^%*Z7M*=q<2Lv9K5-SO{OGzQPyopiH83T}fNB68(NUhZSL2R>& zTR8>7FF(s~%k`o~c`mVRf0`B41q`E+RvK?)^t~}8Sj-I1!!kC1TAe3ntz)(BtmiR; zzZ9U1ipkiix6`Dxl|i^^4mWPwfr_)YnXUJb+8nZ4G#2`kiF3rV5IFi# zC4*B)(Ii1~SK->5elM+R1nBh%V~8; z6Xzwjf__y7^_IhAlPscN>H{P%&~>Kr!6MpSQdy>oD|OzZt{a+NM_#zFiB-Tk=ms;# zty9C=T?HLv6JA3xI6EN(AEtP!ombjLl(*|+Z)b6G1Ac9rey4+3yqcU>k@n8wz&gAV zO(UO#4tV-huj4mbiYS`J-~{A9Bxlb)6-srpeyp&&T1&Tq-GUF?P_(IUt)^zUxe_QJ z2_Zp0YUSFx&J!DjzOag=AA2&6Nyw*FP(+h1FQ@Rq``A6l}o)ZbIyw-78B0eW@KPj*sw6%uEl1XE#)yp-Xw=in-d zlERE5le$Q-Fj+tZ(=V*!xV9gdC^-d3S|ObGjRV9$>Km;iz1_q{Gj=0E(NzXW`O-lx z6jsE{p+b-99GZna?TqkA-o{*G;b0CF{HStiS2F^SdS#7|I@kxzLds+W1x&AkqJyA zs|C(0Q`9?OV)r)|kX|gU`A+m?kn!pVg=X0dn%!@0<4FmH`C)^M9MH83^QLLh#Ih^1 zlBABf6;ENUwXT}8VTys}njV)d`o6R-E+HubkAWM;jf<(5nuLTH<3?o9#go>oSG9H; zYDW~1xpiEfgi|#u=T|llcxa zjMcPrJ>{@i<9NW~ci`0(*!MyI0HU^qj(CW058I^{4MR|k6`lgJALs`-9)^gj@G6LQ zzE#HzK*dIt;bX>6hH+GvI*ss@H+JC<<}9c82NV+x-OJ%-WKuyKV-)Je@Cu;+05Fl{ zwH{kFmCxoVM%*77uNJc_o%h0Ab-=3uGzZ}_wm|8F{$Jj!QmORxn&Z3vWN4=Y134d1 zYW5jowU25OkOvqwM{y~)nT&IQr>JB8buJ6w_RS()E>8t;zwFmNY)wMo$iM-F9Gr>( zm${e?%(ZF?-iV$PQnHc>sA(>sj!-DkwH0-bR|F^dZ4vKr0Exz zle*utv@gaYC3yN)$7Q5Lrh^Y$LfHUb*EwpH@ZSbhEsX07k z{?%eq&8#eEYC|zx*!ti`F2SlQSo#;Txoc5Dg^`qXOMA$FAX1ab%0HCb_OKBGFv-%lrr4<5y_u{8 zavjL<8O1osZS>1iA9lbhXQ>_)F>Ng3Qm7*1q1luBQzVf}ZYp^==Ax{!8FLOkUI+B8 zVAYs{GZ_WdbK#1Kb#-s1##%|^Tn-e}ZMWB@qm#LX4;hKeAE?C#PVBT$%H~8_i8^pDbJ-? zTI_w6l2X0J4N79hlLW%InhwvDy7UH4w zvScP^jK|eLJpR-VkEpEKjYO8z1SoMCVthgA zP_K0Ar_1w zk$PYgf$8C&l`Qh8=9GYdP#M^x} zH>9Xp@^EwEQtot>ypRQ6?ML-=6wuEEUCO)Lk}_BUlj+T2xsXHvnV1f{#&Pzpk5c)VT{)$TITKvX}oK{cR zR$7(K)Qpl_%Nzp%d%=zVy=ZbiqlQ@Kw}~^53}lf~E-!2?Rb&?doqCSHr(d-Q_KMzj z3*C-?#FecWY&J36I5#s1r92kf)9KJu;Q}OqGO9WTJ!%tQg_nB8yc7Al3N_xfJna&t zs5sy-@cPxG5=FdnWnN4kt4<{qcB1#Ez~>bnSj?dq9`78m>QALTnZgxQv=P9?AlZ~i zzY7In!9EmAa`Hj|l05T}1`P>dbl!p0K?6BGPxhzS#IbMVaqEyzKU$K$;^p9#m`S^D zsWlxhro0UzDQQ5$FF~I=y=#4u@CI9)fyc^{IFKVNg)9CLDl)1=T->00oV=(wTmlm#s+dh{{SICk?*JCD9SgMa6a{K z->W!I^>=uhi#)TJ{#yf%hZUBNk4$JF9`!oJ9CD+_>q1>SMhHtdJ5NBZgZ0KK;?3?z zGB9F#mN}vBj?@)0fC1xFWm7Mkq&2Zp{Tvm8r^n3Doh58%oj;{JQ4=1Bxhk z*><(DEPurLsi7X^09qK#oOt*Ou2>%RcSx}LGmaYAh&6u0xxub5DA^`wa*w_T=J zWe1;^)~#e{^#;QPwF?;-RNQbrX9kv8FTg#_3AFUwNBRE%YKM2MS=yIK46nvWDWB9- z8GB*g6jAZA@vsbHoiQ=t)+At)O&maTwlTpJ*lobMCRt=0RAj%nzRXIbWQ>+QeJdvH z{p_rzgO6|;XYEfE~xb@^7T?WMygf=kQE znNC86@%;zuS9YDPw=wrU$yAJB%Osy_wOOgnras;rf#A96Pd02L8IiXRq0K;TQsABH z!6U{#5!cp)w^PX>0(|6k#X2&stqiu|k~xBw>OtvFNm9^lmBVL}+;de61lcbv`9Oce zPZ3+)U>rIF$s>&ViaRVaU0Y9%c{bexlgL&aR#dPw$XS#@Z`Z3t82;6johys0c-U=z zgTQsFYug)iDGD;IlD^bXKQSl#vTD*ft>s*;#_3z22Z~!*p|h91Vctx+!T$gcg?I2x zSI^l9T1CSJ<2nBTTBW}1T&1?baLRL@7@yz!R^KJ!%ro994-uaV#JPn>Qd{)<)@+rj z%EpSFoYyq_jnU2>M?hHf_oGHc+b|Noi@rj z%#gy_E4O)b(v#p`;!u2glQHR#dVZa0Ewou2?mC0Ef2{Ju(oX*X_r*b7K8RU^J;8o+yFF=I2xHo(Yql_0^{G-TJ8kF( z=~154A_*V*xl}$hgPz_rKvfhJ1dm^>K%UjEp$=DZJmWa26S0~Qp_F5iSmP83oGP=t zhFlMa8Nf6d5Yhq;)kY_$6<@3AcXMABE@QR|2`TB+RM>9q~5jJpuw1_2|j4i%C_nX&=S7mQ<%l}LFV;o1(wQO*u3Giq_$#Hz4{Bg>qc zk>WUQ;yb}JV<#O?rE8kzgAT7Xzj*?)JMp`yKRTUttvns<(njGhFrW^-DvDmw3z!;Z zx(p)tfh1rb3eUFqt3&O7W?bsx)(IUjH?ocf+Ms)1ce(C_u3}S-yU$wLbqo8sE+*7v zyb<0_@PaUQ#yWKv^Qt=yA63<5d!d<8j(G#7di1W+xh`y6X^fktD6TQLB;;1jZ`&J~ zG_sJq5?iZn%Uo^i&p7`8I-|3(u8x*Km+i*`h+s&V1vQR)$O~hnmfC(nA zZ97qKr?N#Xax4(|Lm$L`c_OPc%IVs^qYr6y4|gipaKL-pwoVW)Brbf(s;v`G{yo~? zczBi@XxUmML50A^03S-DhuQ|49+P=*5O~^l!lwk2z{_KRa4UWGeXK+*i^~`iXEC+` zJ8(bO?_7CIci~-P&M7YAR+j@TIKUfzRU#{ReOA=G$5-2#{jbq1wK%WSSUO8;14Q+HTBDo(Yl$K<2!m( zsDZY^yqo1CB-dEuW*-YOU>uSLGgD)kbCNN}2Oc#G-h_AnZpq2x!iuaU8?%8-15fQ`7jQGhCQ(Nqczo$vSjsVEnKN0K3DrHZp$k7XUC6pC&wBz-ubEFdB zMxbDERl1g)7NvR--)K(&*vYFKZ8a?83az`;oY2!>)+}Dp;*uEmXO;kFji*>yT{F8{ zhMC9aaaWfw1Vk*70h9ekh?;CAgGR%iat>=a*Jib4rNe1{d+T*|VnT)JD)qG6K%lH6 zaU5o($)@4MzaytLG2l!BxX%L>sTj7X4`yv7V&yR1c<`v#U6)SmlqDE+AlBI&aYn~? zEsWrtR2z$hS;j`#^Hq^cTBV+ub0+v2M*tk|$6BbH^cW=@;6lCWk zrA3zFSc~^=9A_Vzxz^OzdNucX-9tDiz9iIS?7hq+H@p+OB>2_banIiFlq#+=PJgvn zNXsS=Hqnf5d84kKtx)!U@d!ZpRyoFc(O0uK5fblmpnQ%8`}x+u1RRB!gU|wh)`LB) z*LMnDR+2UR!*|2>tMS3wwfkKT;#;X3-ghoA2`2;ODmI~_PZ-Kh=V-|}t)fjhvK_LO z9eUImnAxF^mf-wN&1UdwbFCUHd%Z^N#P<$D{!&H=tNk~zbGnCntf1$UQ`@tmclU&p ztDZPGs|yvsfEdbeRpTJ=c&cz}@>fe>_A&neD3Cl3b5&DYT;84WZ)|z3ZRu+)ibIT# zpEO%*WKV=B9$*UJM=tF`3;UaL6x+UWgYeYI^-HG4Vll6VYS&a~VQ-2&9Pq>ng#`Wl zn2sf6$2@ab%6CJ!)r^i2fh=eSeMTqU3_zgs8K+Hb$su(`FV`Zc>30+NTOA3JdIY{Y8O}XNWH;BoD6j}xm`}I0w@DMHCb^VyX3+)x&Ec#)@ju>-KEJ;gpJ-5 z!P)!wwF=Xy^u=9i=^R;-cLqb}R;#tg=Ku<)6>CA4Mb_iYaa^W6GI{?1IzwZtrWIXf zDn2anT@CCbl>;0c_~)fTyRnS|g-}7`B!7CZ6FIc#q|_09I24i2MI_q%_UVaj+<0!r zMQx`|3>BHxSIU`rVG~7-p|jye9?`AaYDQSM>@GY328$i@NI{kZ7dadnnrvF#fk^nP zi$+Oe3hC3rm@QDgsF9&*2E``?;}qd_1~>g3K4d zZmnwZ8uInuV2N^b&&r7ttl%qQSPYSz)Z4Dl0U7R#E0K)u%~nOFzMn8MvrC>Zcob^b zWMN~vJBb9GfH)Oqml3`;;~hHCpGk^xBoE!6F0~+NP&K#>I~LA!)B95wh}SSg@^5>R zIN^8{=%bBBOJ#q=Y9684MRW&}JSrKt zv$?nvEPy!U0M+zenTLf!2d|9@yC?4VW=MulPEQnI(Cx_w2&O22OE}r~3-8xfa(*US?#IIRLLwTTGfvec2*0yTJKWS#)TlizYHjJdQGGylL#z z=YmxWBo{2GKcu(zt6eJjS}=+P1LRC4qe<1pBG=&g4)vC$QJS`BXV#C(szA&RjOjv zJMQvOxBwBrsjE9I-xk(iEOg?bMlISkkN`YKtvv0OP6m8MQmX{G)C57FZgJo$FTSL# zm`-}&@kLlW!gn7GRW_}s%wIOw4-@!c@M*UMgX+DdI#WdicCT>qoH2}NV5nC&7gEX@ zV`@_&i#Lfr6j|rFf==mMG9Eec zs}^^P0VaOAsODA*TL*FHCY%b}y>@Ls`79`N2i zR0|C@TWgT<;iDY^p)LYO@0LI}ag$DU?s0`pgZjMcRBaQWEWG(bOGE+m~_BFNyh4p|ZHuyQ6X%1P6o| z>FZfr9T;0=vwS=fj#=bsKwOv6ykm*fWowE2goDis+|1 z)E`qrmgS^76etJ!vsH0w5M0ao4n9;x)f1GCJmao-qgD?+?3StULS$j#yRXx&M3V0E z?1k>OXTUaUTu&2a%7DkH>qbks047CM^1-9+pc2EoAV@jJKr}$Gt7M=cc==E-HK>?` zjSFYWmJ3e#ej>^bnW+x162J1olb;H4xH5 zK?907l?whrpOr)YAp}sJ-@sNk;VYxG{GnP}xIHr5bO2qC8r+`@CQ~k-pZrDfCg0`;8%v3UegyVxwj2(3gcq2Ihk3q(0 zGHU!BpmZFD*?>Ra%7Y|uMyF~9IsTEFGOfBM*Z7J4p9(c%5_X>5nUQ0aNb%Zn_vuZa zwHEM^vuTsa8nIhAQZ^Ao7|)j#5NI~r_sE2t^x7)5Obm9DzD?#Zqr?Ht20qwZ8TPfj zfO(KP{c6cHdv#ouC_EHk(EY+08)JT79m`quuLEw-!z1E2ik`HIt-&H4=v9H_`Ow9M zoVODI!B7rCUJfZPEG?Cg#Nki?Q~(Iim0QSovx0c9V%~%m9wLKtduwAGy~LXoeq0Qb zQ5s3o+{bR{jNSlMO~#LLEzB)?!b}{HPDMSh(#W$Nq>RrQwv5a(fFuQfwM>^?Fe}YE z0HovLKj}bCB?Nuq?NSeksnA(>pYwLSL!O*wi7L3MxxTr&*lqXay622jjkU{-^4xzg zbWzP+O$@QJylR^>f=T3kDO-8?iz|`T?X6(c7&O?+N4V~nAC&P^E$oG|w|OAW?f|6T z>dNe(F!L0qW|}gR$h(QiJ9(=Rb1{+8H{nUaqLUm=u|6gqIO{_xu#Kb)9;`akvnJvJ z2aah+#;QZKh(X5y(!dB`FB*nmmE}ecvj;nBNRDrfh$G>^W6;#j86-wom53v0;*o(_ zvm;<0fS$DI*qDnyAb5_oQ+KYxZE&qAEwpqTpPmI9ibb0U!7QY1J~^Q!#CH4M;!p|U zcOEfR_Zp?m^r&pDn{QIhz@)a*2^+4--p!nOR(m&*X=|uQJfuRUlpJTmi!_sf!1rZ( z06NrZq_eb-ayv%eL{wGO$zlLvnEcGR2CW#mwkBw^wRa%KGuER?EQ-Acn|f7Tch{E= zSr@yH@`L^A)XN(oSzil`6P#w9SV-(-nHoaCuYt#nF(h*fD|{*s86GrIdthM^o2{gO zNp7_gEo#zabpejijAI|6=ADZHxXZa=0?&>}JW|}4JEaQC6CR3q=gNdG)Wq!o+7BQ} z*EJO^XS)fMS=OMBsR+Qgk87`v-g%})sNBwWLmMvM3oz(Zv_?_OU{OBRYr@X%;!i+CpHs~^wNHPk-bpEf)-@Oz1msW-jeD%yue{2*PIiRqeGOhTaN7YRgBWp= z+r?E}_J-coT_b5FkRA&0$M>w-Vkpo`4Tf0&9ddZZHXh4aD#-GaAnE|%{p!IlE-wPP zB~*?BC^`Gn(IlDj*~saHRnOQ~b6VU-_aPm+m?BaD=;x&dO&V*p{{Yn8q%r>hg%l|H zcvaI)I_(a3g&0-ELGJEnXKR!Sfcz+{jMI$hcJ{h%lMrDdWN;e*=9WEj3$EXmVAC!Rqo}ud#tU-55x0?!pW3T#RW0Qy zB!2ff=N(q1>MeRL0k@1tu;iJEA52wLx6^kfON-k}b@2l%!|XY%S6(4Or8M)nOL#4% zJp%>DKT4UW_Ht`RXAc38b=U_!xW+2J!X&=A_o(x7Gq-aB0jbBc?k>&5GD!qXekk|l zN2Vx~TDKGDvbwpqK^j{*9JfG6uS$g7j(e!(_oi7;;gI;R*j1dimvLL4bz~9_0V4vU zT-fS&7K)cHyNT-?@M`KiQbpKZK1)#>S*+moZR8)^15xdJ6{p(F>)pucKl`f!zpWZA zKK?0EI4`A0afVRbQ*Jc9UJ032`)qH}s*L?{MKZG2vi4oX-s^LDZy`ULH#r}C@lb9w z3#}?5ZEuW{wthKJkFIz$lgX~yMq`bW0RC{JciYB@miPLU7`rmMf$=%!v#m;_{{V?K zn^tt11u-uS@k_Xq{{U_%t?d9s0q0LWH-Z%8< zv05j3(Ym0=m-C7CvhKk6;}hM4;3N^Vn~nvq#-_C(v*lW4CO9zsumj~#H5&_tk-zmuJ7LLaq`~`Qrrx@d6p@zrPDhxemf&33 zl*=@XahUOK)!*7iihX48Vd%&bi(?+_=;#|%iSnf%@+kvlPLkv8UT7pb6Wnq8iqDJsp9f2+c^1#OlV=^Q3-0X{jS%P4gv zRy98=rk>#~kRJ8MdD>1hRgc;vwwNgg4c9c*Bu~`!3%EhjDSf8c!+k8ta$5Gt#xrV!S137uw#6rpRE$#K(=d@xohJ*hx$W>8T$3C z-bO(5+hX!}GZ^kU{?rq1Z?oZ*BV`?@$G7XF4u>SojipKGK`6PnURyoNd8E@9C(^=IR zl#0<|iH`nV4O-n(Zq@}xcP}7(%|reh0gP>4 zvXM&+1)LCgJb{|&BaONo@b|z3RUUXeRA#k3?m}!Q#C5A7YWdFNj}eSh zo;=2WJQ3t;Sf-)Jr1!i#zB=HxPwPdt())(^U5|()Q-#c6ZQKq#1w7rIhiSuk)V)8s zRBg;kk34m#v&caqor347;;XK;SGJcAH!aXAlUOg^u;9PdcA9l!YG4q`$Da~<(Usku zu+5R-;Z#>Q(@QdhmT~6541T21tbm~`RuNqLsJ)0z6fulMS-JJV{p%x3nPORc$oA)-hZsJ*&=MLesTiK= zvPM)X%~j8%UP*9fGfwUX(5sE8K1ar-URqp8z2F%6_$fQ6?TZjFOGRM8=E;; zE5QB31D}T({iv}_q~zsEIO$5wwSn)HH$WeNX^>D7%c1S!O)JLIr&qA)VsK2v~AK63XXRi0a4pnx3sq=IhJ-O zArR!}=TM`HO;Q&3lQgpfjk7mF=qg3Nj-diPai%;}V-#aZ7kAQM6wTyu$a(IONk1-? zD%~Xvqd9Lj2b!G)g25nQz^;B+{{T9$OJO0xjDzEx3b5*`JvuWnk=0~#*PIHO+(#UW z5kNTLCxuJQLkjysuNiJB=&?TKSfeCLL zesVd*5_2R(D35t37$=XtEHT*?zAORZxC#uHk;V?)x$z)yC{HrlT`_wllOvYgct75X zt7_wUMIdvy$N(Qo2q|+Mabft}+8nWD3 z6Ah!Jy+pEg`VaG~RwPOBOcf>W#&Ax;ar)F7n;2%f8}8LeIV9&l<@(ZD!*wz{%o$fb zUydqi(qXwwvUlXK!WeKXElG$5*2$*~({3JM=k}@A`c<=rF+O~YQbng5cL-n#I)b27 zlq~}U83l(K6-8)+Ns1V^NX7BU3Tf#DxC&KR9C(_@{vrIrK|TYTQ){#Xl5<+dG{z{c zoc-wy-Lis9f$}|QucyT79OX#hob{%rn*wsoSRV}WN<1cs>GmeDoz=uB~O5<@#)CXV6g)j$sAO*$pK~=Wbq|xS~4k! z1^)mKfuwvFR%FjV(rF>NOSdF$0G}g7yOnG}5-E{M{Hyt?2s1$%N?VK{157cA24aVv zyMuUCzkRc1{#e+@j2s+&%{~T4_*C)c2*IPql|tU;KteQ#5BS%be0oZ_3nTAg!ELxA zrb{APe=V+8yv{-f=BjRu)Q|97ynN>Xe|*tQTK@nJir)e}?E}RB0Hr^C5wHc*cLN5i zQW-ObknTQ2)1t6Xc-(vEP&qE%G&HzpAQFhAj}YJ66%J!GxbGc(Ffc_)?}$){FaX9g zOnXIV_}?R_8Ky9-oW@&deWZ0D=91e|O90KdG0q0yYQk7zbsKt)xLj6yoKA`)UI$J^ zG@?hVv6b38bq$Zq6n*ni`s_oGeUa;QQBR{XybF7 zR$EL1PqJ{}DPTV^Adoz%l4`aWOPFn0vH97!0)qyeZZ@~Uw66dTDbVPh%%J3mobo)y zXA!HZ+Q$nafVe-GT0)M*I?#?);BtWEOW+74nYTl^P)wddyYA9Sn_|hSWfq#A<(6u~m=$O!77QJb^y%%p%rpUl8=esvT0ae1nV;MlBXiNL__pr9bHcnIt6+ zHyFY3$3a%MntV+fvLB15#4$#?(?puxbolo}W(KAe`r*E#XIlP1KCh$0X??Cnb+SKHs%lwczg@6P72FoKmBL#43Mujj2>}{JZl>b&J>?N4A$jlz~s4;xxn}dZ0D&p9#@iSGb!4m00G8ocX}Q7fC{f3 zVxqG&w-4Qs;r_KC1;K@mLC1#~`cu31e2}3>g=4|pBB@?T%{#qRgyl|07{y5Fd0d^W z-#Qn1#!{iaFCcn(P!XnS7zG&50250f?wFE3Bh-$yB)@qP1{=tb^f|=<&o&O=SQCy7 z2tym&nG9r-*~@=waw}{j0Y{Y>nIo}ISf~ULGe~!q8Tt&+uy8T{{U`?F{mG3H5->7PJk`NQjZ?jRwl@); zYCN#Cz_Mg|3X(pZ1XiJ1RXe{kVBnfbW?TD}k)s6@@+Nuu)rO@EWyl0{81t&o(c8#a zJ}@}v#;A@_zB9P7B>`la0dK)3R-!T|D z9DsZ)NYrmPPa#OZDf6n^S@qpT)Fd6uAnq)K99L-^_Z`$+=+Rii5uO0>!d=TJ@H@Jz9wD)-~sjkpP8-uMb=i! zPqVdEiKSuu$4JK?Upg$tr=nW+9_71>ruSBjj`J8BJ|C@X{jbuk?IgaQ6|@#ex!R=U z^y!7c>*hbtscIUQou=vV$#rm4x`kCm!NEB2^R9W?`Ele6%y)>ym0&i8UJZ4QYZ=upp=6VlZV#+56U`x>0k?eaw*kREU`Y{%IHVwQjzzSW{|MRBg&(gnh60I+~3p( zg%(R@DmmTq2Ax1^HG)-N<=8F;!T0r>2YO0bkG5K5DksJIy`! zN=n3sIP1E$KK3aYw){$}00Zg%RHP*2J3d#S1aU?UHs4cQ)E^Tl@dRS0MG~k7sP&-D z@P$xvzF_f2NU*BG!6(AE7^3$gT#&gV#-mGavl5aoBf}LTH^!$mk&(M6k6NfyO`$A( zHvmt8rap@&2fR4Pt3~hQGC6D`9)gDVOA?oJu}3*RG+5TEq3om!aIJ9ioD3)rz#lACt-R5| zhA7V+Gn#~*uCbJ1x8P^`az6EmuIYg7iIlS(u~E{qBBj04r<`P5%CYA=RPjx_Wig_# zb}Qs6#7zvyU1Z#t=rKZ8G7+(IJjH7kqQWF*!aEV1@;IxQWih}*u1M#Kr;^@iE|OTc zNsr8f#))sLw1xMnz&Hwe(-~mx9B?^Vle+nelW%mIjtp!z`HERIi)+~TN~1rmM~>Yz zuta3-9vH=HXrf+d$#y;_I6Zl&wz^tb%p-)B$C;};d*!%aG4iR26k&l;&NIlTBP!YL zWG%Rz*c>PnTNs}hc-AxGDtm=MPVc1wA>_74(v%~>6b=RlKROomYy}v{T%1u+`@^)H z)O(nY@H4iGj(v(jBPOFl7$dRUrLktg<22vEL zIb%q=ipafk4@^;a0HJ`%^RBFbVaWyg^ahBwrI|u01J;;cLoV!OQTyBw+n5pHDn)BC zf}{-41-8xy1bI`8lF1=%cKQ0#;+(HLNj@A=i5lwHya3@#^VD-xH#ZknS1$Wb(toD5 zgDiyq05Mo(@#TsI#j?z;@DfP!qR-<}py`_2cTs$J2iBywbvZw^S0`tcUvfywGoA$$ zTgh$Evma4Z6fIXzYm_Ssn3#BiY4#TKq$-k<%sQOrr(3sq`H&Atpr52 zQJw+Mn4?E#fbIjIN|36jB!km|Pw!C&H8K-Ic8m|D5-?H`k+|m`RMx#kH~{lbG6(pM zHuwWoFg1{t!{eT`QxdSoN{nFn)H{g1EXR}zcF(MvUEC&Y^ z*&$qT0)x(Kx*pMv^K7Z{bn>G~t6R4lwx1$KYS?g+*xBu3GShWAITaL}i)Gx79Y4ZP zN|hbmySX3$JkMHHCghb1wMRpqv@f8o^>8?o;rZ2^H_ss1>6SrJ5B!KgfDs&fjrYsPxkUre!t2w4djGUFo@S+q|gj~o}w|1a^NXC6?CZRgpLa|$`GZUS}RGXDWkAFBEkUUL7 zDc-WM;2PDMr9`pUAKn@}g()EN9u;kGcNNTT$k|cXITX~lLcp>sXM)63l+@|@rbneM_^L106nnwI(3h~g4QH^Sw_;uM*JH|O3 zYE71nAwVZ$an~lN%Q=MsOqTxu2Jry;P8R!KzhFd#M4+!b<$=w(C>46M&EaztxeG zTRc`#nDdTlg2h90$n~o6wM!bQB6r^KkOv@@#wZt2!5$qYk#c!OV0rqA+g{NoB{(9o zEhYP(IldjxfUw_MkM)E0GGjG3ALvjQsIiTUuM(xnRE$;N($b zjtgZtjd=8}^`i1?mfAzgpcsigOAZOC149U*GRR!=#PTa)l4XW1;{zkkqfFtGJGU_& zT`0jQVi+y<#<_e9WE|$5B%2p(NOx8xx+Pl(JB!Si< zc*iG-kn%?v8I6@X3}&3NEMVhuXUx$dwAULH4UDHa^AzP>vnXxgHynydX73}*N=Y6I z#RaC8=L37F1B?pLPH3WvU(>uua;eb{Lo-tL>XmYw@JAjTkEyYASJ<^ujc4gdrK&;wi zY|#6;hj+m42a9y5rrX|S4AKS!@y|-Eu+d<$W|DdP)^1K%0rsMuUfore+k3j7%Dz8Z zrC7YVfnbd}!ja-?J6%V@D`(6DRgG_bsmOvxDH%VM)vD=`>9H0$$n)nl(p_bdLT8h6 z20noCM0j?Q!Sxx5pp>>sPU7sIM2yqpwv3j{h5neT zQ?3BDKuW(I=lK%4XV3dm#jMYEB<|qu)d>8@lS1`$EuoPxgoB^WRrfnue&{&QO~b;W zt=06gw$eu4NCU!wZKTOGo$K951045!Vyc$mF)lwg-yb>^IFLAOG^lG-ES;@CVol!)tg)h83Pf! z$C_-{id-VFW1hI_RhqN~#4+Vp=sYSWqjM*Bg^&4%p{cScn66kaJxvbo(3Z&n{VO=q zuG-36E8Q@1K{(F?6)C4IKah$7pXvjeB-<_15@A#PRU7!E2XaLVNJo&sthEv6w$*N1 za+FkVHt~#pl*^4GLWmwi-skC4z3?Tvw1me00N@0gNV}`K(=OoT6U_@%vgl=Qqr{t} z>RX`cN1sFPh;n{Bap6{15T|@twgBmnYCYLEPN2xjsp1b`rC2m4u}e#2LN+=0vPdNT zt0&Y2tOL4-d-NonVx2vNw-L74NhDx#$f8>5M$Qk&vzJI1@o4153?HB+hffcI>V9(l%9Gmo`ucs|y5EQuK}AqkuUJZh5a z`bh~(Ln6L$xQq%Ey0|u=qAL(EK~u#ozNqpAc;Jl+4nwIK{^pBJhqj-8aEtF3Y~wtV zbH~c3TWB!Z$=;U|$VLX>II2eN4f@QHy`T}6;o?>!^{Gr2?} zj4TdSfai{aj&2psTWXy1RGNHOQ?Yr=HhCj~`&9W85pte5=C>HB%Bs?CZ-qxZ_|z+l zxXg~B@V$KnB$ps;-|&S4IPo8Pte;$hEy}j?O3lc^j8jBdHQKa%4)uC~4;2?s)NZDT z8)l6dbXRVIs;@5P)X@?fY1KjKgM;;;rh#)SlQf$#{UN!~ z5>BSAG~UcvLW}&ce9I{P{At!&9gOlTu3AOLNzd+T-gRE(fo|&^2|QM0-?P8NV1_#) zRydKO@BnnBm7tFdLn|LDL*2y^hAK(qFmX`tZ(xrI*EZpR=+X@Rjcdp~NqddSlu*ak zqu<`F7TfTpynqDI?R6^$+#YmtI_x>2NvUaaPN=dD@y7v>^Fd@fwY#9jyqociY;1p( zN1Izn9dThOAoM*O`~HVCczduyf3BkyC9dYs@#$qkF#N@7p6>)O7~{6yJjG^l zUDeB?$8N*B%;z0Jsi|y9RPNa0s3(C(vbR`)VucS}8p((fcD2jC%|me%ijeIC^6p-r zrBh1{#+7lg-cXp~@>xguR_872T8+=~AROUGHBm09Wp_JmlV|-B0ngsEc)HGis;IWr zE~k_p{UnU=GJ#LtuPq$R*l1OP4CP-WeKAolHA@?GBlvtbBoFDr{P62ZhhT+ zQHFk$eKq#lJM$~yT(XZo4H?RaoPfo;WQx{XUAvAE{{W;(*RK+UKd7g{+PTC{3u)_a zj&e+ru1D8#6ze#+vzf$&$bFqST+nqr9(_(xi=OTy&eEiD>CHrgw5yjATRV(@K~u-v zQ7!vKLg(G*XuLiFk^27Ttr?3eT{$h+xgm*+aLwab)5wwR_?JE^U}P1D-*}4P=P-RGNqX02Q_KtbNglF~SKDil6@g4oK<< zeT9GN$uvlNJ98A><;BF3P@ksivt0C^*$q+B~q?sSCe`+1IrRC-1ef+AC zllgXa`r@|eyFO9Giz9A63_sST9Xvql=NTR#R)(PIot?EqyI?QoPHM^>4jWhRRy1Gw z!i<`WE~1uS8-^>K4ZTfAyX^}sC6*^4Hx)4_lhLI zP{W};Dykc+n4`-(XTy%QG95;Biv``smTPh`Xtw%F+T^=#Ip71DJa&dQA&xS0#wZf% z#v}*3V8i@X7AztUmBxXRX{uBUy_lEl5PgftOHuwoSMT=VgAD3a=StlYL& z9A>lHx7L3RUejMm3%quK5yvMq%S-KAMh`PANKfSp$)H88TX)h$-I75!9wLgU-fdc+{7ZV%%o;3#`8JGaudOYHp{ZPg_YjM4 zPaNc$wPS3|c94bI#Ev=Qgmod^WR#6F$$HhNpHaEFJ>A;Iq+{YA=|LI0R3=tt?k70SFs$130SmwvZBLx>&<67Y^z*`&;IRI2)t+m8wyNtL8sp*eOl6=NV zm%EVgdSGDC<0)zxcZSDR-N>rPzrC6ASz%GrU_Cu^OuDm@_4k6W z?-5@dV2(dp3Dj(2i-}Flp!Ea$)nn-KPN-TjCO8Vj06suexU{(5J*99|cn~O9Nqa)J zRt2!wjA z4WJ}vyHI?=s}j4vxsjM-VgdP&IjGBJJcN@uC!PgfN1hb?UK!0Kkndm=h4~DVM^m_> zkF)A0j#n}}4temaCzcdYJC=4GHjIj}4)BetM@$^^O^z|Rw%`aIaZVjprNr36gBtiK zJt?zVO?KEaupYiOU|tl-$UiELbE_@6B~Y@SI2oiNPo@dS#Gv3}j}%T9x>JP%nu;~) zO~QX9Die(3rC9g#Fb~|K=f%8e#1XTO1W;Ele<=evrldqTQog)Y^1^$3z5!9jI0BrJ^4Ap>fFKkBDIbGtH-GO9V;59ai$tNSa9wB7G55-9wjl4^TT z6ib2&YrrQ{22>JHnCVhtwpp#hvWEw$%}AIs4wsx9r(QEF^Vaha{Z*%~)Gm zIv@!m`Eu1_*RfrM3VXF)G2`>6M`;5{phy^=z690|pbg-FuA`oCYFj)kSy{69y< z;$VKXNGz`+?v^Q7#GEkcpPePkOAr!AYlH_9K28VzYd)Na7rmy`=9Bq)JKW*Z2a7^w;H?ieTiYC^!Wa68K z9}v$$U6iP@+eaD&NnS?BQg|QhLI_X*38GyH;wU3+$_E1&rZvV_rcaebmZOw3CVSb5WK;+>sQCQxz-TxSA@2z!<+egy|RPg+}qNbWu$IplGg zf;{p%v!qe8~cc>wK8^)42{bd=uK7?mMM4SF+Z2mqL^<;U`@Kj z7;u5IKWd42dU(R^LU|+hsY_`h?vb&AG63mOE}@#@O{7MVsPg5$^&vg--Wa|X1+mE7 z38=Bj9-v=;b+ix_Rkso9Pl5EPPocDX`?hr?c+A?y(uc4utp)z6>3ci&KQPVGCSoe?%8~_eRI+AM=(tBrd$z|Z+)?-?iB1T!p zaLw16WCIhVWq?q66G2F1Nmf~Nmhn8F_tKc^l1^pX$f`*NxX%@!m8r@lkgP;)3xUm4 z-&@Fj2>DYWNQ+2-TcE-CG7B-u zB=t2KM}o|=DsFE9){f~kh^xvDrHSUC&ND9~IpiN&Yb1HejJpkl43UZ)miw)Qj58h! z9(m0i#3W`6zX@!gKa~pl=GxvC-H^d>wTj$Pc8>Wwm~AbsjIvI7kH=`_{{ZH+PTp#k zb}=+DhVM`+HcmF2XCAx|Yix?*Ya45=QdrY_77@Fg6df=ti1wQHOUuG1b0P0ZEIA&Z zYPij;^QUOguCaK*qi*g#TL%FBYiHA^v$3}zMI*bCQZ{USBaa%@V7z;KF>h@iAaZxI zfs^(B0DWp*xVpZ)w~F2wBz%Qc9}y$Viu8FLe$#b5S5S0}$6_7@a_A2rV?2-6wtr_G zqy8rprg#h~3*^2sx$v#OvmKL;1Pyxu5~BPGjN{LW*do%>Nuz}<%rOv3D2ypSJu8PU zZoFnSFKF7fogZdx?jpF7M`?gw_c;fs>(p_@a&FM;l3m9X?=hMfkHHWdR~hiF{{Y%D z!)tSF)7!~$X%vEKVGH?!5J>dMBxmPZ4x@h;Y;LB!FdJw?7F%@#0XhNm;C{8P7gded zNxS|t*~u*XsDZv#63HVGwE#Uah(`LMN?rfvm9OnhO zC0EDg<6B;frrX;^A%aye9|Vr1*Gqh2PgZ(Oq*n8lC=~7ZejMVr%`ypLwuxf+Bz(8f zW1rMkvtbYuqcfM_ai6|w;`g-hK@+O7s-obMdJmtKdAZAL)yByi)|)E9Y!YS!j#-C| z25#5c%W>|ofcWae1PbGNkF=$_d2KY+mU)Vh8~S>3eE6#_!C74|^X8PatN{RyD8ak* z?%EFs(vi1!AbC}cjl6iWa^s5PQua0wFW0k&#s9Vh?vq+KzSo!rd zF3oC@-^Ay4cOs97`P8W6H;Q9Bw&MrFouzhm-%OE=YDdG!+)Y+p8xx_8w{I*@tznD2 zoE9f6c*hkkEIeC4!Od1)Yqr{C$RtN)P(fu}?fq*^3vp`KNXTVm$3xbu&Wou$n`68T zo}VL*8&j4k(T&ziY)hc7V~B}!!M3cTCpE#q!?2YxM$8u#YfaH653%7)?j(a z9V$ay%{pbi6Od?bL6nvRict|nqiQh&9Y+*&w{#x^Gak4&ry|DDnLj7Wnovr)_zg<)W>-&da-M;*O-DASm2=IUc@sVmILc2EfmU zPHElnive8xJ{h1%8%X&hCnRS)RtT`Aq~{$f1Gbz&IOd z(~0uxaFqeR5O~firuS2^Wy}0bI3O=kNjwtEH+3@iaj5D|4ogdDz*yrlDIC9zWvC2y zS__rmu~XDwe5qFFv+hn-HBfR09EyngZHr6?yPzYT&60CReG1XnXoL*-ij7T4?50vJ znOqK=ejn{qErgE=W@SYuftsX`vL-SfDPAQ0LrP@Ffi<=&VoH{9w4-$H z0mArHXSDtzqFEKABm<0KgXL0!qWm}?FFJ4%m&jr`sz8X4No>E}f; ztYZME)MGOw+J_exQ z-%k`Q$qKs;fOyoxm~4C_j)J4zMZ16~rXpHv(7Gzi8IDuIUnBFW@R-^%M$&ol6&u_w z`>eET&(LwwgqD$8mJ&Vy=O+MG8d^k~co_6G7VgmM0iyb5pB3~h3M7h7H~{sjF`nuz z-5VJ+%x5Ycu9$50rg!7UrbNv;oFf3Isi#M9oE_ZxQPSsNz&HoYR)JF;(JH%*4hXj~ zVx@fOhGhy#Cq5Vy#gjY|dGoD)!5z0ZPDcRKqkX&{wAlid80sk<7B&pQi1HpZ;4JK< z0PIj6xamrhBx|*LdH7Q$3n1YL9!7>?56C-IjBOQSWR7EzFgPRpIn5)oAj#s0a!48c zyi|GZSOb#8R&R|9Wh7Iv3Vte*%CV^|N6^-(acwqO#7uGz4C9K84wqlU)1O z@wY2?yeH-J%@ErFxo*A!wUmzT)ErH{{Q6Tp>slFT)H0qvDtj~4vOEFC2PUG+Ycuey zN2OKUY8U8m>NlSZaZ};dCyj@B8t2f}y0H#jGVxft$ip9M5?@@v<)?*+^Q-mLgQ+Z| z0CY4qx{5^^K&8ENM^?2++RQSL!Vn)nl!`@;(@>KxL~J|({{Tv}n@x&Vz){bRF-&a= z1q7fWyumbK)Hc&ZtMJ@yRq2z`of_R*D)(-#eOs+8+6>q%vk(tJM+T$8rCp@F%eUk+ zP6X&LFa9#|00&GQ=jng;);2z14r^M<8(u8z3m3FseJ)Mgn*n?WjS(#*jTyP*V`-;Z9q+LiEIlwh>7ll%z}$L)kMC92 z45mUes)FW79LIHl++m35J!*V9)GZJU zt^gUvJbdXS_iN;F5^s^0ZsJcKwSBaNvdCn7f!Bkaf+&Tgkb!_OJSZ1BG|3u><}0_T z>zZ_nd2bR8yNMi+8ofg$!(1_mFi1T!#Wvy0YFW0N5x{KoP@=WemN$QbJ;ytIYD9W0 z^Rm6oz-1iaI#kz)SDKqe%0y+6iNdI&*xJviMY`d8mm?U?a4PaE7~qMvg)Df^JSi7T zSpj4vbHT+-?jmWL4W^qolt!}1-0tdg=qqTnA)xPFL_-+b!v?9JPjpr8y;Vib-wn0+mT{JgU@@3}k_W=TYOj?;j*?s4Ejrx}AWMb|86FxpZ*b zcSz)88QsQe#2g_cZ62OA8d(E`Ko|_?6k^m!t)9`a2|rp{eeH+xh(YFRQWTn8Fe4s0 zrtie0BYXhk9Vx(uqVZLWPO8JF!JN_vuHD*CdSFP#0)RhinJv}4L7G{WR1SVBgEwg` zBSkUIxe36>jb0LarNQ`(joKTee*D4V*&xN=T&j%p-Ym%N{W4&OY~xTTf&RUcXq z?>xQM-K(Dl#W377cn6wZ>PJvpuZ0F_Ayylt9pF5SR+-9`9mI^Ff&lfW$$28-A87}n z6&g8&m?3tk^y@|^a-KLHN#eB0A$`&kw2di~Di?V2#bjwB6R}kKmZz<=wm?;5*8qwd zz}bo@!hn4R46{B#U9_@g7$HrqqTe^Amc1};M9R4$AQ<3^`XjD(Bn8b z>EX>(8Sw$L;tP+pI9f!}?mLP90J?< zaRn$xfTla8swfHZ8X8=itgwuL5A`nJ-io27BjE=hr9e2{WjQI$2I&hBdI88Dbu1#r z)RH<#>VuCkIvN6+Xl`FD6tHffbf|4*sL6=?)ja$l3=lm{Y{q0z03AJPu$bMq2INp9ATB#NdW$y1ys$hYBI>(%y9%KqYg;<)3OOITYIIv zSPSFF#p6-$F6=D=_p^Z62)!o`AW%*)+t*3?tD`?0EkOx|GTthNTA94_Q3~@!Yz+vrtadHfW;2xRd821$LUp9H`1b%#|Qi(vucrhB_{ml^lR1+xdJmRk6W6 z**@_ncL(@$ikoo_m81i?0!IG;4ss0|)*4>#SciL*js@hYsC5-owcBOPSgk1vxiizWqW!2$qbvlYHg}X3|VZJCmhv->UQ!? zv0rEdJl08b1B?b6M2NYUC5Lh(soB|V}0zzF(ZHud97?2QEx38epSl!8vyD)bVw~NL`oz^7#KTA=j~Ca*Q1OR zv;a8xdeuGdvvD*304Qx9MQb+5XBxhdBDKL*DFL3dqjrL4)n}o z3z7aJMP#!^@)+Y?q#OgyL7QFE!P_wmb$DKyG)C0mKjI$x~I5izLsIIQNwVo27VD6L;(xP3+h|Ch@S#!o4IW=g- z%rc~rk}fs?x!iO63I&#;A9}XOU}~-nR_-{vl4D$dQC#MplDrTG1tiJjC>0D^HmDOK zV7o`BN=Wbf=Q{#m42~)!a-F=NRZpW>UChqbFtn<9kgg3{ zLvp0H=GsB$G>oB(6=fOfan_p?U%1e0z>$G);2sqT{R?7-ot(P1J?*{xkOm*}okJ=8 zD`N;%vl}4|$277Rl3k=_m}42pto3WNSh~4l6j2lTy->Q8QZwBl?PG^c2_CblC_I zqZTJ5gvCe+X{Rcgj6wVXa4IugX_MRuBDajVINZM*ew5-%mr;dOVmIoBs#sO z_1y%BdFN(F=}$<~?bTxh0m=AE{^F%vCA39U!@Qny6!BV+R5N|Gi$r2lMh5jH{?uct zkpT=NE_k8OZMtm7{Jf7IXrIHQAh86w9I&SWCDf7QUBNdG3}>H8NbUrH6$|p)M2f-y z6_!j$4oPY*)Xu;cBa+Kj3QTY0pvTK3(lVe^@BmMS+A>?pNih-)HGBB-tVVp>txUk6 zSWb7QbLmCzHXsK9M@)(q#(|5RNI$@O8b`P&bKOQqlPUiII!+vyQU>^yO8)?h#)B@o zC6u@jIaAQ%gGMbGMRtgc@$il*(#j+%6e_MT3G=98EV{&(E&^Na!2bXU{`47cZ{%U! zM;6ijGI;%JbVy-8%pCX{b41U%mG}U3HF{@?SWdSzjqg+1!iS`A#0dlDX`jNc9!GgD zq;0f+9{SGB#>wRlgRp1gwYec z$`Ijr%MNo=q1smp;0*Nwj$@R#9pp?1>H!2*)pkXD6q%AoO@&4Q^rpq92aui1v~_=#WY;Xz+)Rca!ySeW{YpZ9DH~KOgDlkLo(w(;itvw zG?p(uT4sr+!W0o z-}sd9L$D)4Atn^|X)PlYl^TAOXBy{*2)I6f?T zf%K&|5l0gibinEx;w1d34Q^ZQUsKF}=iH-msx!!`nr~;HV!hB*o5f=!{`GkU{4ppD zL`N9hR}|B%td8-+36X%${U_^I8*nJJ@o3eoS1GO-BdmxEB&ms#PdV14f z?C_A2G>I;H1HctwZD1_ZXxJ0VKMFCgrn?+kt=-P|l*I!cW5LN4v07-hR;j#3l1bNl z3YQeyK@pFHk3O_lDv7wAfO2w0GBaurM=X92iH(-TA9g57D&qnHfD^ZkbEbXpcju;GJ9l!(h$23b@6o3VdatA}2lw*eKaU;g7v!E2i ze$qOSQ4=@|x2;I_jX(j^((ExMhO^$e^ZJ2G~^W{d25)jD5hTIK3iOKkZ`cakzivzqMo^Wt$3ZOsY`BDH@ zVVoW**m9t`LOiifbl!F-AbE}`W;V%Cay(5-15+n_ei+q#2`BcfX&sns05BbV=p*{+rl4?8NTwE^^KTdoApsan`+{z2N&UiTK zMVDs)F)QG6R7n-Y(UQlf1FscfYh@By6)shQ$-?J9S`x#(h$h^ENa$&%>MVe{Tn>V( zqDbYJ;Znd3x$vph=>X2u367-r)POTd&vv*6&Y9op3Z+s+k34cm_o*z&BjGSW8S8+hu(4dcXj&EpwJ~(-z#kKJ5GPftYW*2@J3HwD<;&SAOgw?{6{9T zk6ku77vW;K9Zeo9RgN&Y7|$LDH39ofkdTo=GDlDkH5T_?ki;g6AkUlu&suzGeAde| zaQHqxc&rx*1Ckh-7Z}~)RC3+wGD8!BRGwP{7!)g!b$4)*y}nost1!)GtX|J}$c5zC zo;$NqTU3rhHnub5D!yA*)wUzX!AB$>hL3Njm3Ae2!UhMBtZi;V-%~LI{I_xDqnZ`I zyWcTYx4AsyagUF=H8mk#?`oml{{T%#mdfE<2^rcs+TaftI-tAKudZ(wzq~;MkII=O51uN@ z+f9NI96}=`E61NSdu!;SLatSS;E+0cQZ}TKf5-*Scpd_^Ahc*KE!B$m(3ZLmHNa8KT$!wuc^j;|n%4~l<&l&PT>-4yakCmwx%^wxC}ZBpgjE}sAv@-|LR zNELH$5=jSlC-X9M&oo;rSoG-DIHCj4oRBJ1V5EbhulTY!qANmz-(r>SnlLy3XBe!h z4#60KDH-R1SxYD}%P1v=0`&r;Nq;P?Sguc#5stNG zx;y}iGCG`8cO}^4^{qjrh$4@PcN|k1XwV!c_C8(|^K9;_2UAQIvaWET_;cY%0Z3*f zlD>k7lQ@n0q*ep^pQ-s%t>YH#OOc-Akbg^5frnWP=0=aZjQDk^_WiH3xYUiXiHSkFN85lrsO`3R$9c9h zj)I}Rngnf-q)5k;j21q%lLs2Lt;u<(7>zO&Pl@uSwY`DbY2KZBZ3FsD{^W z4t&4ZsM`b>JGZ`h!SNKxgq9SF*_DATM*}#;D{3igVQ(A}Zg~mJjB*F3-kEW5B$H;` zWMsBHbHMr1kkCh!ae>JIj!&&>MNxg*Q=JfyF(YxDXP=ja09sCGRAu2o2XVx05Q+{R6CtU8yjhEE~H2i26xCn099Ft_YfkG&N%81N~xaCD~U44;Lk#O z)m&Yo9iY^E*a;SK^SOpN^CSCKN!oor4a&rA94I|~E0wMNH4kW4N_N@9Hag`2=s57L zD^2XBwfx2AEJSO+Y2kdj{cCyDqtkU;#gOe1Ha8G?1EHw8)cSqBw25Zw50LARGJLAz zY-5%*0i?|L`z@ee=qlrLV;IRi{l3-Kdkt-Cq-~YqQ>ZG8X1QLH2Dhq_1cEdKj`^G- z^gI%H@UD;9uFqa*cOLaIkjE!hY&L#XySV4Y(b7W_`_p0M&h4kpt6y2Vmg~N^yB+Ar z0H{#Dc;ht(_|%feBxy1gVT4jJbNkf}p&i_6_SVfDF%EBjqL z$ziDK8in|d#ug}&G3Hax!alXjbO@7Imf@{pxOiC#FT=C~eSSypTd%auZr*Dfe$T@n zeTEY=jsf(lPR)%*!%K@Y)a=%l$*A!CjK1o&0))#ukPOU8jAf-n(B zLf9OUU9pK;blslSyC}C8S1;d2s6YZkmOfReXm@vd;xyWg!z^LQSOaYYV~md`kg%?OyNV&Pnh!&igM6S668WADI4C=rhv02W52s0Cyh(?ErvIeJjs?-kvif zcD8eE5+G1~3B^YeO+KUf3P;yI6s>Y1RZyjmr#YiR9MVDy214Ce#8%^#PHTsS6vUf` z;gji7;g)HnW+VW3>ETd;F~`S+S6z0l8#|M3=*X%DWX3_wXf`ODyOTNa%?ewaZuxij zdCwt$%?b;JyNEPyt(6CI^r$!X7Tx3>>L+`+ks}}^eQ65^Fs!XCXq(R;2*>SDVZ0ou z-BIkcQ((qHGfBUa81eL}Zj7n85%NAXt4$CX&&CN{btA^3T{uXN7a*Kt#;oF*r)Fm* zv)9YzLb|x_qYh&vuK)p`(yAp@q8Q>X<$~uM2*o+u`FoU=8Q>a$HT})VaBSod=Zq=j z{HSA6x--QTc1+(9<-r)N>v%2X(?MlB#qnG?+YstWJXXu0=|f1-?5u#vjy$>l0H~5r z>P!$A=}nJfF#$G#<3MoSMX=Zf;7m%5o^+3s=bGpG;P1 zwz5d<#eiI37N<)RiJLFDXQ{0+uDf=)ol7?()}H)@QNh5+6jci;Zblc%rrTRXELnUz zDB~pYQbO9Opale;rMSo5q{r^<5Mvr_?MAPCC2AaXZgrjPIi<308JWcRzbEC&z>txiqn8j!ICI!8t)$#Hk^Us zLq#c^oVGcmMRVP9FiG9O81qrxVr;Gf9<)^zaqIB}{&Z$0&pU@fR#9GC z-9^0^6*W(&=|bjABB%$&xF5AUPtn&)koVJ;L&(P>u<46-NZ6eDWE0_4x}A#Z17>mI zg*YTr;+<{^C}zfdy3tUpN>PcxI0HP@W~t(e-?Nff<*i((&sOA$mbVwMyD0AFJw7HQ z`x>!#VH-kb2m`xy!KX$iMiw}kfWvj;#+e1gjz}rD9W&!Yd$ig>_>Z1= zr!CV&o$9YWF^;tA!m#Cz(0*ow#BBs92g;akndD}1jGrogJIoRAk6OtIVI}@9rjGbP z69AFV9u<F;e$+*koAW4a_;^!U1NBX+ zJ!;5+8fr|ynFwDXaakp=asWZNj)%siBJEwrfkaz~)B*-iTCpn(S4$vvk%y%{@1}z# zNhJ8yhW`L~$v;YKM2CZls#T43%O3d{40WbS+8cFYwFy3zX4VNaaG{5h6vok_A0KoT zeFs|39Ywd+5?*_=kNSlf^&~|g+m1##6m_+YTRT7lzzUCd1Z;4ilj>_&v@hb?cmPbe zBd!QYP z+RwCRX3M6}uM}aYTFp5Oibt+G(%flrDgcTj9Wo7SYc~XI`+1J#Y_=$(4*fyL!`D6) zTMmHe{qK8|&K9iHOB`yY_W&`9)Qo6;t z&&q%u+D+tPfyNC1Erwhio<7E-%W}&pP^p3AStQP`cO0KVP;M_$)=*gsmKfv0tuiGu za>QT~D!%^K@>D5pD@C6X;X;z?`u1<+F3?6dk>NqQvYfaRY7Y_)3UijM+SVAl6gLuo z>#ldQfAzzGQXMq7!lGhE&jAxB_NWaGm!`|i&vPq(gpz)z6+TTuC@uFx3nBy0Jxyje ziK9@4-W>N%2TW}ugZyZbm~F{F;U@&t2kjiP{0RY-{{W}g>r!oDy}4l|%iVdXJt@{~ zhD)ew7c!_Aj2;3Gzf)6fbcq9*Cw!i#(xqD2d%0-~0#AiVRWfc24Ivgw{iRX`4o9T~ zM|p9%r8xxtOz~6VwpfYVjGlz}Qa$7rQUsD!Z1^DE&(ea5Y_A?YsW)~!G0j4iHA_i1 z`^!s@2P9R2*WgJ?Zv#FaCZ!3j=7hg^H+d0I%B21?dSuMdhB*G5^!rqW?F@x~`kk44 zap6hiHe6kCbte5nIn-O0X8W5j0^J56rR za!N-b1Dvqpq^;<4gpAKTVZJgAaLkAseL;o(qXj#(VMnG57GM=2a? zS<6OoT4U@(kOn#Vibg*U0`1R;=}{k8wt<#1%*@9F1Fc7sS$31Uh+%xqV_M3zNaBf= zcID5B=APDwUj&bpRIameZn;1u1B@`@k}I3r<}77cv*H2%^%cWHsU8CW2R@YweO3!} z$zjJ$r!`wWgz~Uwy$)BZX9pDm`%E%Hup<)O1{G?OE+^L@7#U|I;A|PCw!UWFh+GE$ z01(Ah+pLz6M1ssox1G#zPv~l8_4V{{NB;n(TXa557@E%3vL`7G;7P|pPbvyAKvl8j zk}4cmS5~oaXuA0EN$(fasFo!!gew3LH8LCCL-Y17qP8fQb-a8(o&=Gyk%FWA5GL;;Vxj6dbj3-GGyonU4>EI1ZOG{*k ztfO&0B$35N)HMq$CP<_B$RCwKC-f9HhkK`L8k!VKrh+m#RBAnsXJNOAVwueE)U&=b z_NW&fs)7j>1WpO@DS`UbX**#Ow>I(?V}L;5ew6qzvyDC+ZH6EK{{RW37K3)pjq94B zhg`UlQ5<%y&sJhUsVP3CGwp4$DxM0SqvufdV=kW*kBzy?(6r2%yqt{le{8}Z|ebLr<(lS))oR!~@f zRyn5u4xYJr6*6<56ICinmV3tTS_LQ%496eZt`|l{w@1Q>RX`a$QBwNeU?c@xk3K0b z?z_^8j7L2OH7Z%-DQsK-9~j`%Z7igbRpvz_t|{e+!Eul|BC<_oVUOS#@xiO3TZbE4fH^p%{w`;Pw{`|RJn8^xq%A8sLF5e@aVFtPpmdMCQP-Z8TNJ3$ zw3DeI9*f~qBqnH&2Pde_31B_ZPVZ)VbgbIkhPP<6-NrKKa`<9{Cu+3qq!%s50o&8( zQ49@j6uV$Yko6pMLa^-gvhI@R+9*}J7a)UK?a98pQseC$EdgkdzBmAmv_;ltyth0p zxg9XXezZ93ZS8U2PY?_K6U9&OY~BEota35&RXIMnt8`faiuP$>DWtLBfasyJXg=XNpCwS^I8HY7tQr_xut-|d`01wKC^B?U| ztmnPGn9JSCZi9tKCz{xx(;^B^#*CBDnz#NQg(6N>2Y@^p%;I}A`E71xZHfx-Jk_3` zrORy6G?Fk96@yAy*h}v-k^U&; z#y*`ZVM~8{xO9(eDjZ{h_2#4tDI;tH8Tr)HTDQ<3nF`BwaVxishXj2`>xVSq@7PrME zxVyVMB*7hmTMXC5-QC?GK!WbVV!;zE_y!0B34xG=+&te`?tOpv-u(ghd1qy2x@TId ztEy{yN;>Vb=XMqjDfqo<6y6a^EysUP)~x;PiIJ*_zSraG-P}?%1!*K!T7tjL2z6@A@qXqxg`yQ8D>ioTGq6OE`qbLCvv-FJ2P+g7~V() zd?*X=s-HTJ(x$EYg6XavOWUj}H*eNEfK~;g0?e8N>eDxsdEW4XZT4&LSLFTDRp!C( zo=I#JIo>V2|6Xlc@M*~x)F#3DZNkH{JwQ6)Nj96>x+Er8@_tDN9fxQj{nP|_v9HcO z=n$Y1Q18Ji<1}}OGhCA8A(67G%Fh;9pz17%8Ne8p3^h;UlDm_5$OXLHVrdE$HX{eJ zTJt7FCO@rzDgtRdt%*(hwsy3>17=3t->Ij7{R*@$=IBq!M zzG|9$JDW3+VsP=t$!cZQo1bYiEHx+Hp{x8C=SS*uYS{8thJO6smJ#1beUq1;zjobY zvk!g5nB}LBth_gUrZT}2$1Xx23N7ug9V1WyZJWx3SMXhRMQpP_qmx)y->y}EgEh<| zVA>9&WIfFgG*oB9{RsGcL6vj~*@dG2=1V<6P-3vHWbeB4Xh%O}Xbk_n)~?f8vVkMf zH6zk#ZS527yqwOL;ny1#-m;A8-zCaqGpfdGj`=ZVS+5vgphudi^!r{!bKv~03le|z zyOox_CGP$&Xs(J&vnI&Qm^|}m1Q77qC7^AZ)P-9;;SzW$9}2k`PGzr+B@3VV@clqz z>Jbm-?gPd^&FUmrd;o~QYN^dgwrhoJ zJun@!ZQ*qQ;+|snQ{Yv)d#T=vtbBq1d~JXnMkH%^XJIUNH#numh9*ETn?Avgm`i64 z`ED|oU-?KYAHp@DR-^JmylXZ4c)JZpSG#8E5&!4rh5dt=?1L4 z7U#$?RHFYZ4gKOK?(lJ1Xq~;M=SBbd$Fw&!+3RZ0lO-?f3~dObrf@2qtEC#5?ESXh zh+^I(v-uIogwWZBENVHZfHEE^mmn4^(~coOjcJ_H_AfIn{j;N`@h} zQ2GT&q=T|oK%3Qz7rg}Z<#jjtzIAU~den2`E&QUr_U0$FWTWk6C&Mq*QHowHnv=52 zydCuYY5unrOW3JBW(#U?b=#=>Nz_fB*?9j>|&9_JSf+TMYa z$0*pH!A2+5qBle(i$Uyep?eT;v=66E&sKbPpUPNmroXBTE3ue^22KNTAXP zO#|=x^s^U=wuX`k>aen2<-lNnh%7`6h1EYpoer38FklbaZdmb#WJKNhZ6MFTpm*Ki zU4gosz5PMErJZ$>#Z>Haf2iu%aJ7WdZ&F#wYGRR4Rn#?ysSOJAU>{jp_i^3{|JE?q zc+ON&;(kR%>L6tiD%K9&BCL7(Zg8*TFR1I)Xmw{(ras)~qv1oKtCeEFH}a;OU%np( z6a9aPvaibBJbM97rAIq9x!e{hXLGf;SZjPxkjq1ynvrRAvfub9K9ovTTck&EkRsSg zZm7_!l|6l==Pt5Qv2+jJ=;S&`TKA}7Ob4*-OnVmYNP;|hE58NMo+n^6dG_LmH0!m7?zx_u57*rgiZg7n~ixOua= z?C;(;GcgVpgH{Iq*O2-)w+@YZru@7>4u}Y{ZR|o|l2+ZOKqi+=r~E~SIlV%8e7YX` zh31rq1D%m#k0_buu?E_T(dHQr!F=6MqYe9ArEG{Ci6-`>{`JR692tB}VSV0t?r=&5 z>@fUp4c;E3ul6ki3GfvNlSyt2-%gSc`;}lW-BAI5MT#=-6~iSQtnkO*@-ep(`9wc7 zC9wbrO^hetSALZl*u$)eznwb$1xCc7at-BMI)Tw!IMs?=QZ7<{qW9l zZk6CeXo!KOT~fTwBb+Qid4Ja5pGK0D6;F7K82hE0UF?wn*n(MNei)k@&u{Ju#%vRT z%*-@gw$Z;Rtm;LuXWqvc!`Av#x08>8s$HIJ@9 zy!T4zO}Ct4eG_+keD-zm*UkMOl-5ay0k~fx67JMCZU1nt`m5!e8PL+J>hcJ_R`~Yg zIZkBjfPA;wx9)rw!5FgE63vH|wikmsqb5P*ju(`BCB02$arhP_{M~F)fR~LFbQ8R) zr}>PvG0wSl&o=WhFXQuH3Sm7}K8mZq0y>#yU!8Iw=hMUh2P5?3_ru2%jYI@zxY70K9|xw=jA zn+W55;nR1Goz&JtY0iVi zXuIwoF`E`QGWL;s3OiKPS9D8GITD@ybHZyuf(GiYUODzj93c-LbFK`@Y|Wb)+0w|r zApO?GwDl}zM_*#8+c-$W>D&kRU`C>XJZp(LNtSYi-5XZnC+#_El9*b0a?uWQT^>gK zg!VEyeHLpY?~&n|8_ae-Uxp80ggJmo$Cu8xJUZ3GlGGyFPsH}j0xjNQ!1ZuW3ntu^ zd2i07bicBAlEg_%&RSSLQ#p~2ho+Ut=fx<64pB*$Uy4WKr3NTwAt9g3EiKqH|f-q3NS?c)w@Pq=*?ayF+Y(R8dOBteZ#CA$o0 z%C+$1KIp^1@xqrzH{tco_4K1j1-AzD**=nSOyRs?Dt@Y(1@-NU5Bo;BQL^}H9hBi# zyyM*z?t48iD&_G=lcEUi*qD`oPK8i#9;0>@*6gX&z9zDfU;xP{7EX?>dFODrSp2 z1k1?AqxW)(=2y?;Mvk9w>INmx`Icz)0GxMyr^mz-yX1qD=PAvtt=b(=hJG=VXSOqI zaI?vm+m7vzRg0C@)SXQJ ze-hcQ_b$s6yWq^;7N5s=nFg8o!xI<2a4ni$?1ANo8(t4}i40+Mmn|Wi7N9D8bTt1C1#a$DWB6(e|$=l&%s&q5$Tt2u) z=7JxB0YX7PEY7kjVJi&prx$2P--X+tr9Qi=^U)2_nD$~&sy^c(-PZ02omG+0P;R?R z)cevDU3V9@P|=HZD{d3AAl!y!<7*_rwXS(JkF1FD=K)(lRF{ixDyrcKZbU&qaNSi$ z4A+kTzL6QPxbf`okC7@kIPmflF)cO~Qy-l8WAo;KI<1axvVx0^E>7ZDv5FGNsQYF6 zhRbulXg4yScaleyO}&CdUlkeDMcbzEXCkgN>C$|#@I6HQD8pqgJRqiNCqh%~5aJS? zYHhdlGD&LC4TH!+ZN=ob_TGTG5cIThD{()CR0#5J>BM}Kx?3Rc=?T$C{xB3WYD?(d z=tmd>o@71wxO9vSDb55u%sJL;ru|5!#0SF!mZ@ivpOAlm440Uk#kO|gG_(kpBHKMS z-bO0b2xvM%cJ4l`ADP-QERROEy!6)-Zs4qZp&h?%Jd8PM;Q|3eJkqzG42{Q8UG9d% z34S*$z4hp?R;M;Q(FYMOwRAPA31Y_(y7~|}VBUq8EEe81-5QpqY}f|PGoh&EM7cxP zAyuJ#dD#+Z>OWTo+t$fd2htjUW)Z$>NCBq$d+$h;(%LhVFsGth z@e@0)O9*1z9F}@^+e~8qep$9^hVKmA+_eyEul{)6_`x(+$mR#iJiqxvbCQi$EbD&6 zh}=t>FF#~UQx!T>);Xp)r4fiD(Il%Y&a*Dp@6Cd|XIWT?@$rMA(ACEJAClvBEWylu zl9H&ow?xZBr?|$uHm|)lFHIk%J+XeooY#J+_j+X>+!Fkv%KF$?s}L5Wf3&r{Kic)m z{5>CZN<0{XnTDWdFzpW-+!~D4BxUi2f4v!Qra^Qfx~#?u`wyswV+^WN-Z5k^hU~s# z?EI7aO0_a;YYM-JjHU!D=warRLw)Jhw)$;a<@4*%$?rGKeq(L(9<_>mMLYa@hna-t z8B*ag4ZTlRmO8yZ%=%+}X3SumAu|7533qTm!|r!_{+tgvvAOw`i)`}Fe=Q|@Mp|?I zSmf!9s-2T$&W}_7%^4EqrNp=w>jSf<$Rw4`kQ6cFTM=!3sajx@>8^^!>=*XhUs69&OA++Mvd-!O)+l?5=*O_^Y8dJC|6DVtthSFZ!iIpoOU z&y`%~U*e&!Wa1wUcvrO}z#T#Q?boUtLz_xpn?HDRlx7FelDMpyr%ww$3o?V_FzpTg z?th+syo-=+7Vr3zo3ri@CF_(T>`L+yTCq1AY`qcV zo>42_zCHZ_l3InX_CMPrUQ^vHJHNiFr|Qr%xea%iL5V)z#bH)>ww!rofg2jHiu*wxJo$-E6>z+w3E2P!#K?5^4 zGo6<)3zR^y&^xp_3N#Mw@re~rUYmT+wsF#<^i_5P`B14j%PLTgbLD5fd?IK#oli?o zFHB$l2^x9rAFb`fGY!Aim0M_MyH@bmJbY(8Y%PQw^=s*tiLxkUC>*bzmf8WPzD zLgBz$yW=lU08eIbO}SqxJ6Dapz)YrAh!?!6TgwrgJG4lyov${V59J#y{@9HU#>7)( z2msGTql^o#G~Q8ailIx)7hB@OXPTO~19rYQB=h^%S^^5ZhNZl-T?d)_#;iGh8l-9A zE+EI%A={&#!MHu*E0=Hu>e}_qxrD;-u^E5E+JPb3H#tbOO>81E;);V#t8<*%F_TLI zao2s=*JL5oa5-Z$Tgp(^SAj^9cv-m{DsAiBS4V3wmy}W~xOUzo{bD-@hWr8Nx*zYF z0R>X=N#)pT{L#lcmvj(ZP1lTXd>~Q=Q(mX6Y%8yXZU)v6HBOVmTlKCpMRw?Z=N@Kg zR{#&mt0+S?TwC3bV2z{Y@Tx!X+S2d}te271dUtb!?0)sBHVg0{*zGPK>D_&&MX!;#x(^6Myam?hrK>F}U-H9_9*^7ji%(sT-NM zCauhIm{6F8Pi-&jLNLkrQ30H4k{Ou}%=)U|3UzSv-UV!TPn zEY*pG6E~szE8M#FKwN%0yKpr+mmd|X>_wfB@%Bc0oKwAhw89~?q<~{i&XHxzSeJr(DKw~!BFh-=M zaVrfKVKiFy%^+MC+x&dP;iXy<{V-W78Y+?STsvnn6C*{6W>zpAR2d{esZoR%Y)i4D zAA{yCcu`W5=wQOi|MCLc)s#2R9^z1nW^fp*wB^IC$X%cI5foyOUup4ccm^c_=VI>e z-+~1mEX7o$ShYRvM7LC69gV(9$nwgzxRKbwC)czW+r2wZv@bd96%z#>QxSZK7@UtQJ-G12|Db(ofQvkF;Ncr-R_rs%*J zWTiRoaqnCvknbeHIQPQ&=tdlHUBJN!6VcbUQ`{-4jPVP}dxhODSsD>Zfmi|3?` zz>a;oaR}SnkSIm6+cy;YZ9ma;tz*rl9XDlF75O>MNb!r%PE`s{gepnGB@v={&j~1K zetT{P9P6Fqc~vEEvx-)+Y@OMl(;n-p-SvW>0={9$B@{P(meG@W$SHRiY1#>(ixR_l zy$>fEn!cBui1KO;(_C*!nU{47$M4RC^wg^@x~Rd01dPT9Zn~9VbmbJmpPfqi2bOY- zF)uGQc_cyJtQewMiufu%p$u80>E7ELna?HWtw2RnOq|2DrTOKbpNTf{E|jP3mmL)= zPX~>sMrS=o+g1C9$K)81lHE$YFh$9%MFH2ROYG=)pK(mCV%(M@Y?)#4}BzO3NxcPCjim^pLvD{9M|87HqR06asgzS@q~=8Ux=T zu&bM?w6qJgV&Q%xPrC-X|-?=sVECUeUS@#YRN8Md0LB+0LH!i^}mt zobY)O)>`Gc{ef}vFcXsndov=)2wjQ~=fm-`urI0rFGH`bXVRoI6hBF>#M{)$FXSQ3 zeUx6-;7~~Ox^@Z!qkkR)LD|`GC*rCd=c-^h=WczRzF9y13_Ap)TF82s_z}l=#H>=G zb%rFS8-@e*oNsEiG4V=tm_3g#L}5sdY=TN-nR&!szuIiw-CRvP!_-kP!WXu%``#E> z#s=?4td_QxW#VTDXikv7$m;2}$D3rZtcv+Hp9HvWfeR{SFWSH8H56R~YZA)rJ+f?Ae@Ee%Jecvp;C8i`{|1)&%L6hbnKKd2-lf1j5Cgu-b(M>bN z*7pgGoGldz!ZGF?GOOBL+>Zv0W{N%(f%lyq|-DIM#?!y5N4`1)nSw} zq8WU1Sz&*vW}mE{pp$sqH~;Z=&Bz)CZ)lPdwr^+&G;{tWQv4kzgy|NM$n6#!ocu17 zKr9sFcLQ9S$3v9xc=FP2)^ETgl%-_!QU6^cZdOUOzd4@$z-zEg>B)pj-x+=6W|Q66 zR1r~w{$h1cIdg(eP!sKJ2MDnGbUUt2Q}n~VkdyD$(PlGQuOj@JSSe0ZywP)PCb2f` za62LDuZDr_v?Y=^h(Gx9TT>;j8FOY zs&}bS{5E6+hnroAnMHHWMhdK$>*7Q_y)<&`NACyxVsKVHvyfUX&zv6DB0;^wjG_X) zxNqV_vb$i;l}^cZKW2!Z8y|1+hHroRr~AyrmUk;HUJiK7CQm-oHSToLQqKYkBwL;J z5;(zhVWzdT^b-lOEDTEHFk<%(S`1t_5|U$s=VyVKY!!Xq=I;nfxN?NH@*_3#Cgn*v zMw@S364t2FW=TDoqg~`7r^bBExG zOz&v%*&*~F{oStzua2i`czxq=2lS!KkQU}8{1Hk!Cz&hxAuQ+Ro5FXy*_FL|Ex3$2 zB-@dlZhTE9lTSHbm#eeA(aLpb?o@M31~E7WmRY$KFMs03GhE&W3}1pSDsXUIIqr3Z z9K@H*&Mg%uN9+)yroNThvWSowlM(^qkVZ}ZXv>GE!?nqqufNBh0Y>Dg53AP}Dm3<= zVx)z(t=}$BnzRv`aMFWn-Uor7s(l!-UPX zG#3vBRL(b8y{MD!C=F|QV7Ek9j+7f-u}=`1pd^cY00q=_*jNwpmczsLAx(L@++Ur{ z=KrWC3R_x@L0H(fQgmDZ8#or(jAQ{f~v_{HL>t3P4u}5Tt=$TNtC@k!AvaBjA_V0>^`GbU$2T~+_0LS z-jbzXg%}&@jt@!b?vD!PhI$ccZ`6?Vsv1NRP+dqR&iZl6KnuDMOU2Kd?7aREu!9n* zqxUH1;jASosMYX|6|Ge7jRP z9==g}f^|HsU6xK$4j&4V*$@F6Thz3**iBVtu_ip!8zn;Ad`OW+!HgB0x;gjuW;yBY zdl}NIB8HHP;Bh8w9or1_A>wV&ai^=16#3v11T)t|xzD9#5$AKY0JvAC5hHw&Om`Mechy$iM zIl`?m+lupt(HR=)<=e8dMbCAVg3#ta7x1<}8pL{%MJynIvzF-DOreIC!eu_CA>XYM z`jKfp!XR)9j%8&F7yU*fQLOS#Hnd`npZv3f8hX?;=RO$UB8&aIiSM-1}G}}?E_mP?HPsHI<9;?39z`irE&%6N6 zp6^9z{*DRrI>V|a#Mp~W4ol(BwHmym$NFLB_9AZ|h6xvE!2M-P$S}XYFpc1CnF+7fXYQGcJV9eRepH~RG4i>pen44e0j`%CI6a$N%R_Oxl2uqwcS zGGqKNXfLtSB17*=rAJzyR&o9_diBPS&buPC&szNvntwqX2Dm?ACV4m07L3GfrU=?f z`EFPHcl$=m&F!pik-MFXcsO52%k|f3;{yMJ7B(&0_dQ5GoISp{q-!y8(A%6b9&24R zwOE$xZbQZ1_^LH2_AE;m1_m2x6BZTuU)8G{S$feQrb_H8ywS33CfnN+QvV~1rJD0m zh?|>S$~P);fKb18Kzkria@`+!;kLLfx77qu-!q3WN>z0(?pqgcUrO-(VN-%F-N;hy z4nG7jZ55>uJ;^m4_kYocl)Ld3+b_r!DdbZQp1_qw$FP#Ct=gLBmHotTp7!hy*D-q| z8jpx|rQwJq)551fZweW4v6=CPe#ZRv)MjPJ7&g^j{PC-x@6Af6XM>t%k9X@?P*oAR z3>7tq^@;8x){nvb>Za5WpSMd8jc$)t+uAJA*uo1fumk$wUHt~ADXCUw0^?jMOgtUVH zcyI*n4sm>26vHksOs?mv_x^1UOx-)`g-gRyxd0^5UT13F3^0OCbWD-%#?_$rkuv5- zp>Nr!9RucCD@5n*n@^Z6s>tZDISTlM#3a)+p0qtf0A2>?G4(HF2!{io&*03Jmwbqh zK1=9z*p*r04g9zublIN=1VxvqG-KP;x>Tz|4?U5baCtlHgVg(yb=S+19VnWi%8SMj z?|VA|ZhfD>HLA>c0$H%qOxd>Z84Yx1TuLE1ReB*wHj~)kzYOmt|7;xGpCNueOt0}& zeYNJr+FQ7mv=iXOym8npCSMRHK39~+Ys5JcDmZzn+w(SOM;P}ueeH4Tc7#~14Btg; z?9;r-=c}z$Cb^L-h0t5wJ@lhuh7tCaG|CGbU(*HmHNvy)4KL{HKpgD6^{PB)*D+H}$Ph9eE6w~F_AGdV zU*#kyGX|^?+gQPfxbXWGnYWeEo9!ZUkTe&LWA*UK16`iZB43&!&U?Vq-sS766tN8X z#zd#tVOTwg>Wk1Y<9ayY(xqJpL_yCv>qa{f3t_rEzNt0Pr7IjCs3H%Xbm;Ou)H8D< zW&8ug;H&q5;zkH5Tq07DF>bzIJbmiMQ6Ea&FF{X(72e}{hm$2f4-6!|%cHvpx?}9t zdiyp-2!H1%?0Z$p7pW^q=KijE0@+SxD7zxePqRkTn?Bc$S7rn~N2&Gw3mA#i^Dq$6 zcED+uk&oiG!fRslaza1XN4>?fJ;D9nWjQ)}^K|I+E+>#}%;Ss-LI^N#FFDVlZKP0s%sp-f8NDH;{)+ z`{{DgeQDmV5Fw?UJ5<0X`RK1*|1n>y__AJkv{g|_P}ASHojru|O;nWYC7JQu@A#<+$pMVGN_o6=1hK zFH4KM^vWZ<5$&h8(4-?*kDwJM)-J{O>Nkxq62xiQ*Xgl1PZROyGTt2o|4NjU$Wusx z)xt2WW*k+9R8k43c434Jx@ry-yKAh7QVh#r@qug|(C|SU9E(_Tf1CP%Jf&Q4wa|>} z)6+e@v+DEZ%V}GZGmW=lw<#SG*%ZZ-Ar-pl^8!BA_Hy|0T1j%1;Cx3WbzD?bq^e!B zZUlvWOo1jVMvS8k$zuFtW>cmvgd2j)i_vd0vHa=UM_yg1S*MNISwp%1{0xmuSoM#x zd<$lU{n!kJYE^AHJ`W4vflQJU5*k{ zPOw`TKArMxUO9i9Jl;IH(ObLNGTrD@XxiIV5U|eAY76rG^P3xQIe&~c(3F7|8|SC# ztD!U41y>5!LAK=QH0;+lmnyLr)7$#ze)@io+{5o|UZ#SRrs_!|)%%0}{oktCM03EK zzfbpQ2NTkk5RetrEwn!NrZMIl^yw6%WI7;uCRIo=Mf+B`&KM!H+P7lwF_<|?1~UC3 zajIg`b|f2X&bVBOUTKxbcb)%^*9Wqbsb-x(wn7$rgyNf%_3)kLWWOP3Um4QaSrW4K zYVHreKB}0m0|m*1_c0b$6M6{xL33S?Gu#%E_^;&tU}_BC^%gtOW&{aQ%qKMTbr0Cm zu?>gfjb4P@92?Z0@g~lEndO`}mp@i(dfMDPE}6}W@85gvl4=DWgAq zV^e18;jbLQ!%Qu9>UHCqjaw> zO?X zl2JprQ~|vYnwB-M#e2B6OGj`_n@=#4%)JA$v5EO@EQM!67k7Bl4(JQFTl>awPV&zu zl<8@BApC4EqU?7*2Wmqap4V2|*6vj4nrt%-GkR2_IJLQ2Jza~mM!hg;sa73gi8|Aj zxn>W#h6EvMeS+14f(kp%%EgFdi=mY6UclN%pHz)i`g+!KqLwxUNkzP0 z&ymKBrd_Kp`)gYQT%?(Jlg?@Ic+5vWT`z=hP8H%av_abPi1rG-H=%B^u+GUOMS$`K zx>S`TE2vBb59=(cMJeW5_o%qIMVL~{IR4?R(Xxb=n6DegKkf6heOX^KqIIsLHhw{3 zZ0I$h;T`)+gGOU&EJsPA-bWj{)EIAx?I%4acvWu5!f;Yef?{o^aMYXb?#C!9rGX9| zZfk^tLZH3{ltJ!Lwta%bdF)2Q+S_By19HF6VH8Uf#a02+Nv)hD7?QVdMyrHM9ya9D zqVyVLiK@p7#7kp_O46atlDi%FP{LYsxLLZqA-3U?bk`~c_tGKDLT4P6Vj5LY%>ePb zPZ^t7bgMFTA>3u9%mzl^hR`)}_iJ#lb3ZSB$u{tlO6~(g>$Rt7CTMpkuJ`hm29;Di z)|(c2 z5-b|NW5_I}Y<a4I3 zGcyyd3C+K`pH2YGn7t-zOoNsbDQ6h9jpAk|Ms=6=i@ z0m%Z@s058q7Yy%AR*KK|X-!iB7r01dBHH`DM5R*-v9K#{NeXogZB7i}ssi<0 z?-wAE(^819UPG{k52F#wsR^0B;P&+(D?Ic^ru!w?+1Uz%-Am0)xnvbN^aR9NJcYNN z_TK#F9*i-XO-(He5xY+>cmk7ZPBLXzx*(P{D$ol8{~t|F&BJ^h@R@CbT_e^6;#CNU zp(HRnTYxZqat#wc%mhKitsyJigNAOZ(hll;yUqYeXc412% z0Q6ucNH6mks$eG;hGu$eMfbSZJzCDg($WlyQP$n*3_LspOmz(meiJ%3z3cxD5Y%e5 zVrG}28ho=AQPhsXQcdLREKg{QKKN4BgNLWMyPQu{?lK(B0dudqE(W!8z(|8cI++nK zs5Fl{mNIlvmovu>>;DBoSIx{drbZRgz7`0yyi^y#YEKIK${n%9WM*bio?5n{%Va^J6+c*#^O>rKJ(ns`xuUb1eO3E7o-ex7WMcZEW&G3&wbc?(D2HrJ7o|p}0^) zHP5EiEYr0G2?=B)z(FDxHzGNc(FOH3JFWvb~Ou zIx^OQ&?n*4I7nE!IOc^+vXhg_+W9c&PS48}ZrXKTKVJ$5`8|MD(DNn>TI?C=-w0Il zqFHLbw8em}nwc4C$=$vdyBtA?Qn~HHG7xS6?l5`QWSHB>xn4}xtw)PriG4W|th)qC z;Ax>ScA7Eg-zLUnm-89jZij15L2-PVy_3+JIGI&5<3@6} zl`|&ecN)t-DW>WWW*z4Ej;i*;mp*cT0A{w3p1e*A(Sm0-GV~khN)A{%*~h9$7Y@?_ zj*iyrnaqY7dY9?GF*&ph zaRnfYR{bM%XcDIF{=FWjSOT5aTq%X%@O+Gu6Ihue$ZbU#^zl?BL13_W{ALQET6oMg(%D>V^D@BBs~TFm<|{(`)@p<5+=E7ivStfYev?nop#a$2Rc z%PV2pkq&s_z8FZrfWax6o!vBvl)J;jzw%$r{-GcqH>ZvX%)_ZEC%YGBim8VBp$tYC z>FK~EqD2ytBmufFNO@fSh*>(#URFaAASEIC<;AWUGGZCY1~1d+{NB4g(Sr`uo{qpE z+58koe?8}&6<6pdb>=9`J*M|{BD={Qd|(se7zp4k57}bHDSd%;4Hf|+MTik|iLZ+? z5|iC!lUNMEkS1r7kGMMFindY)(v`A{Q}3C4qy7NR)oN3Qxcvp?vd~@m8(SzbU2p(x zQ&m{E96#HpvItvqxvh)3!f~gXL*W`E%>>V8)3woC7LA&auF_`Mm zufZCvQ2@&`Vu_8o5(AtR8t=vP>tvigSaF>Y1OjYF$W_O6u0aq8zB++CQ{2LsKjNr% za?+4qOV3uDkU>#5iPK+U!blDL(6&m`nwqNY8ii;26h0RcmEhLMej=xQHh&V*)Kr#c zBVcBa$698*nk+iwLF(7i@*6-U8uTw<{H7-L2+G^OycSe?4>1UUVzH5+_kORDk)uL6vwS+)rcfW zKgeW|WuNcCUk`Ejc=->(CPhwT0B0ni)S7>08gGS)v+fQNUtO#NCYZ1Y^kF4Tw9qX> z%p{wIHP(@(qoaho)IXRM?I)^Clw4PhlT=vqXX;qLzCO@zuRM|Mvrs~(TFj_FM5&AU zf<0Zmd@0}W&;g7gaCJVBTqVbVE69+XRFf%_eS0mSZx{*iK(|bmCk-08Lg5nYAl93s z`20wA9-eHtSY`wOc$Eaoce@}QS>METzRGC60qP43aCR2d?m5%%6r{dY{Xoy4#~~Lh z4CdfV4bY=eGW5}OpUnu*{#BO57RqSRK7rBSi`xq#owEDO7l46%P!8IV(-tu!q|(l1NXoQ)-tOq=LW^kH z)@_r=kRdMB3cZy$hvY*y%Y3)U%TRKr*;(bPi!(~9tb&(V3XCree|>5Gq*C}Qh}eUN zD>DA#Iyw;R<0H-Crlx9|X)nrV3NBtX5WQS%mRp-@*H^5B9ST6` zu@GgE#+F`wDIE$Icdm@-70gV4U?gvSl79)HMotvpAU&It{+jn#{k+C&ZWYOovDoH&Cz2a1x(+&~qK1C~ujwnDP6Mn4T85spZQ?Ve7HqP-m z6CzW#g(L{0Fw?}FJmNs%&~TCnb5>^@f;jn z6%D)b1!QQ>b~nG#iPh(Mpu~VScA?rAVgEo$g^MRUu*Z|QxvK!YtjSNE#UWGN2TV~W z0clMzG6pf7kl#4x3RRKQ{kde>k~hF`TP)YaJ=l@M0Si+7P*%vs1;83e-`%&x*lr+{ zLO~|J&D4$|iV(VRsZ}#W9i_hhWxuU;7Q&l6w9@kOby+0x$<_l{BUBYqEr6zktmfl{AJeNZj?M#GP)RRR?6<$y=1 zDlfI}L}}W5rSJwx7A~|u_3!SdScH^WVqn9#xZD8THf-_kcjNk0<;iRsvk?;JOPp z_ay2|O{1>dXoi=gZ>qtDGbud}CCk8NR89 zpr|k0{Y|memk{)8K!M>M?jK;HY3jZAq`Fsn(Hiug&>;tUP>|qNIefOw%dYSVA3BVX z00y$z(cf~y?)*I=ZrkG&b5>w+xS;~UTP;p5R73#?$IY5lsU8kQO?qd%17W|J$layl zP0%qDOYnL*zFAsY!M*C1GAR{9KAI^|FzNN0HpxBf*}W zr{*pz+eT?0+)>hxB6p&+ckv{i zb%-<*6ab5IzUEr;@^6$0xCepdjhvWW%(0>S0CRO?;4?aU={35~6lN0P<((o&wGTY( zG$~GdyA*Hkj>0%u%WF5(>=XRT7%2dhZA%CmS$>}Xs!n$CKb&A5MIp^(!UsrS@}6i&ONy< zUCk#>ckO-L19p=8SEi@6nM5pDFdX~MD7LFU84R$6n;!*QWR)iFZNTV`8cn8vrETLx z0wSI=8lc6=tS8~_*=DU4WhXfgWdNoGPG&jmkBNWkW*S+ravgfZS%F^S3MdKHsOy0s zlz%~q=J;yn!)Sn{X7mAw$fHxGg0X|mnQ3`jg%-o)pAN{9=+?IJ=sWi$Gy!2R4cSo! zjFNCEKm^iYAxLhkH$J@BUrpxDQpE+bipWn{$xxEv=!*j34A$C5G z1^ERYgJeRaLcDyuoC55aLcBb^{iQ-=S^jmI6ma}c@?#dJe_aybAVgBcSE{_EzB_$sV2t5`O;sdVW z^AGh7unXby_GkT98UJ32ij%*CpPNsB+jDQGe@eBpe;ybh%fbTG@^9O}HPF@3&&BIM zEBSA|0YU%>ybf&Et^FtT#^GLQcgN#y?S zfvf}lyrtaypG)}%IR0xN;4dX4C?Y8)#V7a=&VdyE`6C5>gvV7o|Lp(S{_FWa$Nx3` zKl1->fRsTP=;;4^fejP*V&P(8VPaz8z}o(UoCE~~{<-w;Itce4ij)U6*#5U$|M%p7A@IKt_+JS8{}Tf8e?R?SMv;WP literal 0 HcmV?d00001 diff --git a/extensions/botbox3000/livinghinge.py b/extensions/botbox3000/livinghinge.py new file mode 100644 index 0000000..d73e06e --- /dev/null +++ b/extensions/botbox3000/livinghinge.py @@ -0,0 +1,95 @@ +#!/usr/bin/env python3 + +import sys +from pathlib import Path + +deps_dir = Path(__file__).parent / "deps" +if deps_dir.exists() and str(deps_dir) not in sys.path: + sys.path.insert(0, str(deps_dir)) + +import inkex +from inkex import PathElement, Transform + + +def create_living_hinge_pattern(svg, hinge_length, hinge_gap, hinge_spacing, width, height, + offset_x, offset_y, cut_style, tab_positions=None, segment_start=0): + hinges = [] + x_pos = hinge_spacing / 2 + col = 0 + + while x_pos < width: + y_start = hinge_gap if col % 2 == 0 else hinge_gap + hinge_length / 2 + + if col % 2 == 0: + top_cut_end = hinge_gap + top_cut_start = max(0, top_cut_end - hinge_length) + else: + top_cut_end = hinge_gap + hinge_length / 2 - hinge_spacing + top_cut_start = max(0, top_cut_end - hinge_length) + + if top_cut_start < top_cut_end and top_cut_end > 0: + hinge_path_data = f"M {x_pos},{top_cut_start} L {x_pos},{top_cut_end}" + hinge = PathElement() + hinge.set_id(svg.get_unique_id(f"hinge_{col}_top")) + hinge.set('d', hinge_path_data) + hinge.style = cut_style + hinge.transform = inkex.Transform(translate=(offset_x, offset_y)) + hinges.append(hinge) + + y_pos = y_start + cut_index = 0 + while y_pos + hinge_length <= height - hinge_gap: + hinge_abs_start = segment_start + x_pos + hinge_abs_end = segment_start + x_pos + + hinge_path_data = f"M {x_pos},{y_pos} L {x_pos},{y_pos + hinge_length}" + + hinge = PathElement() + hinge.set_id(svg.get_unique_id(f"hinge_{col}_{cut_index}")) + hinge.set('d', hinge_path_data) + hinge.style = cut_style + hinge.transform = inkex.Transform(translate=(offset_x, offset_y)) + hinges.append(hinge) + + y_pos += hinge_length + hinge_spacing + cut_index += 1 + + bottom_cut_start = y_pos + bottom_cut_end = min(height, bottom_cut_start + hinge_length) + + if bottom_cut_start < height and bottom_cut_end > bottom_cut_start: + hinge_path_data = f"M {x_pos},{bottom_cut_start} L {x_pos},{bottom_cut_end}" + hinge = PathElement() + hinge.set_id(svg.get_unique_id(f"hinge_{col}_bottom")) + hinge.set('d', hinge_path_data) + hinge.style = cut_style + hinge.transform = inkex.Transform(translate=(offset_x, offset_y)) + hinges.append(hinge) + + x_pos += hinge_spacing + col += 1 + + return hinges + + +def detect_straight_segments(inset_path_d, min_straight_length, svg, units): + path = inkex.Path(inset_path_d) + csp = path.to_superpath() + + min_length_uu = svg.unittouu(f"{min_straight_length}{units}") + + straight_segments = [] + current_distance = 0.0 + + for subpath in csp: + for i, seg in enumerate(subpath[:-1]): + next_seg = subpath[i + 1] + bezier = (seg[1], seg[2], next_seg[0], next_seg[1]) + seg_length = inkex.bezier.bezierlength(bezier) + + if seg_length >= min_length_uu: + straight_segments.append((current_distance, current_distance + seg_length)) + + current_distance += seg_length + + return straight_segments diff --git a/extensions/botbox3000/offset.py b/extensions/botbox3000/offset.py new file mode 100644 index 0000000..fc6bdf3 --- /dev/null +++ b/extensions/botbox3000/offset.py @@ -0,0 +1,776 @@ +#!/usr/bin/env python3 + +import math + +try: + from inkex import Path +except ImportError: + Path = None + + +def subpath_to_points(subpath, precision=1.0): + points = [] + current_point = (0, 0) + + for cmd in subpath: + if isinstance(cmd, tuple): + letter = cmd[0].upper() + coord = cmd[1] + else: + letter = cmd.letter.upper() + args = cmd.args + + if letter == 'M': + if isinstance(cmd, tuple): + current_point = coord + else: + current_point = (args[0], args[1]) + points.append(current_point) + + elif letter == 'L': + if isinstance(cmd, tuple): + current_point = coord + else: + current_point = (args[0], args[1]) + points.append(current_point) + + elif letter == 'H': + if isinstance(cmd, tuple): + current_point = (coord[0], current_point[1]) + else: + current_point = (args[0], current_point[1]) + points.append(current_point) + + elif letter == 'V': + if isinstance(cmd, tuple): + current_point = (current_point[0], coord[1]) + else: + current_point = (current_point[0], args[0]) + points.append(current_point) + + elif letter == 'C': + p0 = current_point + p1 = (args[0], args[1]) + p2 = (args[2], args[3]) + p3 = (args[4], args[5]) + + chord_length = distance(p0, p3) + control_length = distance(p0, p1) + distance(p1, p2) + distance(p2, p3) + approx_length = (chord_length + control_length) / 2 + + num_segments = max(2, int(approx_length / precision)) + + for i in range(1, num_segments + 1): + t = i / num_segments + point = cubic_bezier_point(p0, p1, p2, p3, t) + points.append(point) + + current_point = p3 + + elif letter == 'S': + p0 = current_point + p3 = (args[2], args[3]) + + chord_length = distance(p0, p3) + num_segments = max(2, int(chord_length / precision)) + + for i in range(1, num_segments + 1): + t = i / num_segments + x = p0[0] + t * (p3[0] - p0[0]) + y = p0[1] + t * (p3[1] - p0[1]) + points.append((x, y)) + + current_point = p3 + + elif letter == 'Q': + p0 = current_point + p1 = (args[0], args[1]) + p2 = (args[2], args[3]) + + chord_length = distance(p0, p2) + control_length = distance(p0, p1) + distance(p1, p2) + approx_length = (chord_length + control_length) / 2 + + num_segments = max(2, int(approx_length / precision)) + + for i in range(1, num_segments + 1): + t = i / num_segments + point = quadratic_bezier_point(p0, p1, p2, t) + points.append(point) + + current_point = p2 + + elif letter == 'T': + p0 = current_point + p2 = (args[0], args[1]) + + chord_length = distance(p0, p2) + num_segments = max(2, int(chord_length / precision)) + + for i in range(1, num_segments + 1): + t = i / num_segments + x = p0[0] + t * (p2[0] - p0[0]) + y = p0[1] + t * (p2[1] - p0[1]) + points.append((x, y)) + + current_point = p2 + + elif letter == 'A': + rx = abs(args[0]) + ry = abs(args[1]) + x_axis_rotation = args[2] + large_arc_flag = args[3] + sweep_flag = args[4] + end_x = args[5] + end_y = args[6] + + start_x, start_y = current_point + + beziers = arc_to_beziers(start_x, start_y, rx, ry, x_axis_rotation, + large_arc_flag, sweep_flag, end_x, end_y) + + for bez in beziers: + p0, p1, p2, p3 = bez + chord_length = distance(p0, p3) + control_length = distance(p0, p1) + distance(p1, p2) + distance(p2, p3) + approx_length = (chord_length + control_length) / 2 + + num_segments = max(2, int(approx_length / precision)) + + for i in range(1, num_segments + 1): + t = i / num_segments + point = cubic_bezier_point(p0, p1, p2, p3, t) + points.append(point) + + current_point = (end_x, end_y) + + return points + + +def arc_to_beziers(x1, y1, rx, ry, phi, large_arc, sweep, x2, y2): + if (x1, y1) == (x2, y2): + return [] + if rx == 0 or ry == 0: + return [((x1, y1), (x1, y1), (x2, y2), (x2, y2))] + + phi_rad = math.radians(phi) + cos_phi = math.cos(phi_rad) + sin_phi = math.sin(phi_rad) + + dx = (x1 - x2) / 2 + dy = (y1 - y2) / 2 + x1_prime = cos_phi * dx + sin_phi * dy + y1_prime = -sin_phi * dx + cos_phi * dy + + lambda_ = (x1_prime / rx) ** 2 + (y1_prime / ry) ** 2 + if lambda_ > 1: + rx *= math.sqrt(lambda_) + ry *= math.sqrt(lambda_) + + sq = max(0, (rx * ry) ** 2 - (rx * y1_prime) ** 2 - (ry * x1_prime) ** 2) + sq = math.sqrt(sq / ((rx * y1_prime) ** 2 + (ry * x1_prime) ** 2)) + + if large_arc == sweep: + sq = -sq + + cx_prime = sq * rx * y1_prime / ry + cy_prime = -sq * ry * x1_prime / rx + + cx = cos_phi * cx_prime - sin_phi * cy_prime + (x1 + x2) / 2 + cy = sin_phi * cx_prime + cos_phi * cy_prime + (y1 + y2) / 2 + + def angle_between(ux, uy, vx, vy): + n = math.sqrt(ux * ux + uy * uy) * math.sqrt(vx * vx + vy * vy) + c = (ux * vx + uy * vy) / n + c = max(-1, min(1, c)) + angle = math.acos(c) + if ux * vy - uy * vx < 0: + angle = -angle + return angle + + theta1 = angle_between(1, 0, (x1_prime - cx_prime) / rx, (y1_prime - cy_prime) / ry) + dtheta = angle_between( + (x1_prime - cx_prime) / rx, (y1_prime - cy_prime) / ry, + (-x1_prime - cx_prime) / rx, (-y1_prime - cy_prime) / ry + ) + + if sweep == 0 and dtheta > 0: + dtheta -= 2 * math.pi + elif sweep == 1 and dtheta < 0: + dtheta += 2 * math.pi + + segments = max(1, int(math.ceil(abs(dtheta) / (math.pi / 2)))) + delta = dtheta / segments + + beziers = [] + for i in range(segments): + theta_start = theta1 + i * delta + theta_end = theta_start + delta + + alpha = math.sin(delta) * (math.sqrt(4 + 3 * math.tan(delta / 2) ** 2) - 1) / 3 + + cos_start = math.cos(theta_start) + sin_start = math.sin(theta_start) + cos_end = math.cos(theta_end) + sin_end = math.sin(theta_end) + + q1x = cos_start + q1y = sin_start + q2x = cos_end + q2y = sin_end + + cp1x = q1x - q1y * alpha + cp1y = q1y + q1x * alpha + cp2x = q2x + q2y * alpha + cp2y = q2y - q2x * alpha + + def transform(x, y): + x *= rx + y *= ry + nx = cos_phi * x - sin_phi * y + ny = sin_phi * x + cos_phi * y + return (nx + cx, ny + cy) + + p0 = transform(q1x, q1y) + p1 = transform(cp1x, cp1y) + p2 = transform(cp2x, cp2y) + p3 = transform(q2x, q2y) + + beziers.append((p0, p1, p2, p3)) + + return beziers + + +def distance(p1, p2): + dx = p2[0] - p1[0] + dy = p2[1] - p1[1] + return math.sqrt(dx * dx + dy * dy) + + +def cubic_bezier_point(p0, p1, p2, p3, t): + mt = 1 - t + mt2 = mt * mt + mt3 = mt2 * mt + t2 = t * t + t3 = t2 * t + + x = mt3 * p0[0] + 3 * mt2 * t * p1[0] + 3 * mt * t2 * p2[0] + t3 * p3[0] + y = mt3 * p0[1] + 3 * mt2 * t * p1[1] + 3 * mt * t2 * p2[1] + t3 * p3[1] + + return (x, y) + + +def quadratic_bezier_point(p0, p1, p2, t): + mt = 1 - t + mt2 = mt * mt + t2 = t * t + + x = mt2 * p0[0] + 2 * mt * t * p1[0] + t2 * p2[0] + y = mt2 * p0[1] + 2 * mt * t * p1[1] + t2 * p2[1] + + return (x, y) + + +def point_in_polygon(point, polygon): + x, y = point + n = len(polygon) + inside = False + + p1x, p1y = polygon[0] + for i in range(1, n + 1): + p2x, p2y = polygon[i % n] + + if y > min(p1y, p2y): + if y <= max(p1y, p2y): + if x <= max(p1x, p2x): + if p1y != p2y: + xinters = (y - p1y) * (p2x - p1x) / (p2y - p1y) + p1x + if p1x == p2x or x <= xinters: + inside = not inside + + p1x, p1y = p2x, p2y + + return inside + + +def perpendicular_distance(point, line_start, line_end): + x0, y0 = point + x1, y1 = line_start + x2, y2 = line_end + + dx = x2 - x1 + dy = y2 - y1 + line_length_sq = dx * dx + dy * dy + + if line_length_sq == 0: + return distance(point, line_start) + + numerator = abs(dy * x0 - dx * y0 + x2 * y1 - y2 * x1) + return numerator / math.sqrt(line_length_sq) + + +def simplify_path_rdp(points, epsilon): + if len(points) < 3: + return points + + max_dist = 0.0 + max_index = 0 + + for i in range(1, len(points) - 1): + dist = perpendicular_distance(points[i], points[0], points[-1]) + if dist > max_dist: + max_dist = dist + max_index = i + + if max_dist > epsilon: + left = simplify_path_rdp(points[:max_index + 1], epsilon) + right = simplify_path_rdp(points[max_index:], epsilon) + + return left[:-1] + right + else: + return [points[0], points[-1]] + + +def simplify_closed_path(points, epsilon): + if len(points) < 4: + return points + + simplified = simplify_path_rdp(points, epsilon) + + if simplified[0] != points[0]: + simplified.insert(0, points[0]) + + return simplified + + +def segments_intersect(p1, p2, p3, p4): + x1, y1 = p1 + x2, y2 = p2 + x3, y3 = p3 + x4, y4 = p4 + + denom = (x1 - x2) * (y3 - y4) - (y1 - y2) * (x3 - x4) + + if abs(denom) < 1e-10: + return False, None + + t = ((x1 - x3) * (y3 - y4) - (y1 - y3) * (x3 - x4)) / denom + u = -((x1 - x2) * (y1 - y3) - (y1 - y2) * (x1 - x3)) / denom + + if 0 < t < 1 and 0 < u < 1: + ix = x1 + t * (x2 - x1) + iy = y1 + t * (y2 - y1) + return True, (ix, iy) + + return False, None + + +def remove_self_intersections(points, offset_distance, debug=False): + if len(points) < 4: + return points + + centroid_x = sum(p[0] for p in points) / len(points) + centroid_y = sum(p[1] for p in points) / len(points) + + max_iterations = 100 + iteration = 0 + + while iteration < max_iterations: + iteration += 1 + found_intersection = False + + n = len(points) + for i in range(n): + if found_intersection: + break + + p1 = points[i] + p2 = points[(i + 1) % n] + + for j in range(i + 2, n): + if j == (i + n - 1) % n: + continue + + p3 = points[j] + p4 = points[(j + 1) % n] + + intersects, int_point = segments_intersect(p1, p2, p3, p4) + + if intersects: + if debug: + print(f" Found intersection between segments {i}-{i+1} and {j}-{j+1}") + print(f" Intersection point: {int_point}") + + path_a = points[:i+1] + [int_point] + points[j+1:] + path_b = [int_point] + points[i+1:j+1] + + def signed_area(pts): + if len(pts) < 3: + return 0.0 + area = 0.0 + for k in range(len(pts)): + x1, y1 = pts[k] + x2, y2 = pts[(k + 1) % len(pts)] + area += (x2 - x1) * (y2 + y1) + return area / 2.0 + + area_a = abs(signed_area(path_a)) + area_b = abs(signed_area(path_b)) + + if debug: + print(f" Path A area (without loop): {area_a:.3f}") + print(f" Path B area (loop only): {area_b:.3f}") + + if area_a >= area_b: + points = path_a + if debug: + print(f" Keeping path A (larger/outer envelope)") + else: + points = path_b + if debug: + print(f" Keeping path B (the loop was larger)") + + found_intersection = True + break + + if not found_intersection: + break + + if debug and iteration > 1: + print(f" Removed self-intersections in {iteration} iterations") + + if len(points) < 3: + if debug: + print(f" WARNING: Ended with too few points ({len(points)}), this may indicate a problem") + + return points + + +def calculate_polygon_winding(points): + signed_area = 0.0 + n = len(points) + for i in range(n): + x1, y1 = points[i] + x2, y2 = points[(i + 1) % n] + signed_area += (x2 - x1) * (y2 + y1) + + return -1 if signed_area > 0 else 1 + + +def calculate_perpendicular_offset(point, prev_point, next_point, offset_distance, polygon_winding, debug=False): + e1x = point[0] - prev_point[0] + e1y = point[1] - prev_point[1] + e2x = next_point[0] - point[0] + e2y = next_point[1] - point[1] + + if debug: + print(f" Edge vectors: e1=({e1x:.3f}, {e1y:.3f}), e2=({e2x:.3f}, {e2y:.3f})") + + len1 = math.sqrt(e1x * e1x + e1y * e1y) + len2 = math.sqrt(e2x * e2x + e2y * e2y) + + if len1 > 0: + e1x /= len1 + e1y /= len1 + if len2 > 0: + e2x /= len2 + e2y /= len2 + + if debug: + print(f" Normalized edges: e1=({e1x:.3f}, {e1y:.3f}), e2=({e2x:.3f}, {e2y:.3f})") + + tangent_x = e1x + e2x + tangent_y = e1y + e2y + + tangent_len = math.sqrt(tangent_x * tangent_x + tangent_y * tangent_y) + if tangent_len > 0: + tangent_x /= tangent_len + tangent_y /= tangent_len + + if debug: + print(f" Average tangent: ({tangent_x:.3f}, {tangent_y:.3f})") + + normal_x = tangent_y + normal_y = -tangent_x + + if debug: + print(f" Normal (perpendicular to tangent, 90° CW): ({normal_x:.3f}, {normal_y:.3f})") + + offset_dir_x = normal_x + offset_dir_y = normal_y + + if debug: + print(f" Offset direction (before flip): ({offset_dir_x:.3f}, {offset_dir_y:.3f})") + print(f" Global polygon winding: {'CCW' if polygon_winding > 0 else 'CW'}") + + should_flip = False + if offset_distance > 0 and polygon_winding < 0: + should_flip = True + elif offset_distance < 0 and polygon_winding > 0: + should_flip = True + + if should_flip: + offset_dir_x = -offset_dir_x + offset_dir_y = -offset_dir_y + if debug: + if offset_distance < 0: + print(f" Flipped for inward offset on CCW polygon: ({offset_dir_x:.3f}, {offset_dir_y:.3f})") + else: + print(f" Flipped for outward offset on CW polygon: ({offset_dir_x:.3f}, {offset_dir_y:.3f})") + + dot_product = e1x * e2x + e1y * e2y + dot_product = max(-1.0, min(1.0, dot_product)) + direction_angle = math.acos(dot_product) + + turn_angle = math.pi - direction_angle + + if debug: + print(f" Direction angle: {math.degrees(direction_angle):.1f}°, Turn angle: {math.degrees(turn_angle):.1f}°") + + if turn_angle > math.pi * 0.9: + miter_limit = 1.0 + else: + half_turn = turn_angle / 2 + if abs(math.sin(half_turn)) > 0.01: + miter_limit = 1.0 / math.sin(half_turn) + miter_limit = min(miter_limit, 2.0) + else: + miter_limit = 2.0 + + if debug: + print(f" Miter limit: {miter_limit:.3f}") + + adjusted_distance = abs(offset_distance) * miter_limit + offset_x = point[0] + offset_dir_x * adjusted_distance + offset_y = point[1] + offset_dir_y * adjusted_distance + + if debug: + print(f" Adjusted distance: {adjusted_distance:.3f}") + print(f" Final offset point: ({offset_x:.3f}, {offset_y:.3f})") + + return (offset_x, offset_y) + + +def offset_path(subpath, offset_distance, precision=0.05, debug=False): + try: + try: + from inkex import Path + if isinstance(subpath, Path): + subpath = list(subpath) + except (ImportError, NameError): + pass + + points = subpath_to_points(subpath, precision) + + if len(points) < 3: + if debug: + print(f"ERROR: Not enough points ({len(points)}) after approximation") + return None + + if len(points) > 1: + first = points[0] + last = points[-1] + dist = math.sqrt((last[0] - first[0])**2 + (last[1] - first[1])**2) + if dist < 0.001: + points = points[:-1] + if debug: + print(f"Removed duplicate closing point (distance: {dist:.6f})") + + original_count = len(points) + points = simplify_closed_path(points, epsilon=precision * 2) + if debug: + print(f"Pre-simplified from {original_count} to {len(points)} points") + + if len(points) < 3: + if debug: + print(f"ERROR: Not enough points ({len(points)}) after pre-simplification") + return None + + polygon_winding = calculate_polygon_winding(points) + + if debug: + print(f"\n=== OFFSET DEBUG ===") + print(f"Original polygon ({len(points)} points after pre-simplification):") + print(f" First 10 points: {points[:10]}") + print(f" Last 5 points: {points[-5:]}") + print(f"Offset distance: {offset_distance}") + print(f"Precision: {precision}") + print(f"Global polygon winding: {'CCW' if polygon_winding > 0 else 'CW'}") + print(f"\nProcessing first 5 points to show edge vectors:") + + offset_points = [] + n = len(points) + for i, point in enumerate(points): + prev_point = points[(i - 1) % n] + next_point = points[(i + 1) % n] + + offset_point = calculate_perpendicular_offset(point, prev_point, next_point, offset_distance, polygon_winding, debug=(debug and i < 5)) + + if debug and i < 5: + e1_dx = point[0] - prev_point[0] + e1_dy = point[1] - prev_point[1] + e2_dx = next_point[0] - point[0] + e2_dy = next_point[1] - point[1] + print(f"\n Point [{i}]: {point}") + print(f" Prev point: {prev_point}") + print(f" Next point: {next_point}") + print(f" Edge 1 vector (from prev): ({e1_dx:.3f}, {e1_dy:.3f})") + print(f" Edge 2 vector (to next): ({e2_dx:.3f}, {e2_dy:.3f})") + print(f" Offset point: {offset_point}") + print(f" Movement: ({offset_point[0] - point[0]:.3f}, {offset_point[1] - point[1]:.3f})") + + if offset_point: + offset_points.append(offset_point) + + if debug: + print(f"\nResult:") + print(f" Offset points generated: {len(offset_points)}") + print(f" First 5 offset points: {offset_points[:5]}") + print(f" Last 5 offset points: {offset_points[-5:]}") + + if len(offset_points) < 3: + if debug: + print(f"ERROR: Not enough offset points ({len(offset_points)})") + return None + + if debug: + print(f"\nRemoving self-intersections...") + cleaned_points = remove_self_intersections(offset_points, offset_distance, debug=debug) + + if debug: + print(f" Points after cleaning: {len(cleaned_points)}") + if len(cleaned_points) != len(offset_points): + print(f" Removed {len(offset_points) - len(cleaned_points)} points from self-intersecting loops") + + simplified_points = simplify_closed_path(cleaned_points, epsilon=precision) + + if debug: + print(f"\nSimplification:") + print(f" Cleaned offset points: {len(cleaned_points)}") + print(f" Simplified points: {len(simplified_points)}") + print(f" Reduction: {len(cleaned_points) - len(simplified_points)} points ({100 * (1 - len(simplified_points) / len(cleaned_points)):.1f}%)") + + offset_points = simplified_points + + path_str = f"M {offset_points[0][0]},{offset_points[0][1]}" + for point in offset_points[1:]: + path_str += f" L {point[0]},{point[1]}" + path_str += " Z" + + if debug: + print(f" Path string (first 100 chars): {path_str[:100]}...") + print(f"=== END DEBUG ===\n") + + try: + from inkex import Path as InkexPath + return InkexPath(path_str) + except ImportError: + result = [('M', offset_points[0])] + for point in offset_points[1:]: + result.append(('L', point)) + result.append(('Z', None)) + return result + + except Exception as e: + print(f"Offset failed: {e}") + import traceback + traceback.print_exc() + return None + + +def offset_lpe(element, offset_distance, unit="mm"): + lpe_str = ( + f"offset," + f"0,1," + f"offset:{offset_distance}," + f"linejoin_type:miter," + f"miter_limit:4," + f"attempt_force_join:false," + f"update_on_knot_move:true;" + ) + + existing_lpe = element.get('inkscape:path-effect', '') + if existing_lpe: + new_lpe = existing_lpe + lpe_str + else: + new_lpe = lpe_str + + element.set('inkscape:path-effect', new_lpe) + + if not element.get('inkscape:original-d'): + element.set('inkscape:original-d', element.get('d')) + + return element + + +def boolean_lpe(svg, element, operand_elements, operation="union"): + if not operand_elements: + return element + + defs = svg.defs + if defs is None: + from lxml import etree + defs = etree.SubElement(svg.getroot(), 'defs') + + hidder_filter_id = "selectable_hidder_filter" + hidder_filter = svg.getElementById(hidder_filter_id) + if hidder_filter is None: + from lxml import etree + nsmap = {'inkscape': 'http://www.inkscape.org/namespaces/inkscape'} + hidder_filter = etree.SubElement(defs, 'filter', { + 'id': hidder_filter_id, + 'width': '1', + 'height': '1', + 'x': '0', + 'y': '0', + 'style': 'color-interpolation-filters:sRGB;', + '{http://www.inkscape.org/namespaces/inkscape}label': 'LPE boolean visibility' + }) + fe_composite = etree.SubElement(hidder_filter, 'feComposite', { + 'id': 'boolops_hidder_primitive', + 'result': 'composite1', + 'operator': 'arithmetic', + 'in2': 'SourceGraphic', + 'in': 'BackgroundImage' + }) + + lpe_refs = [] + + for operand in operand_elements: + operand_id = operand.get('id') + if not operand_id: + continue + + lpe_id = svg.get_unique_id('path-effect') + + from lxml import etree + path_effect = etree.SubElement(defs, '{http://www.inkscape.org/namespaces/inkscape}path-effect', { + 'effect': 'bool_op', + 'operand-path': f'#{operand_id}', + 'id': lpe_id, + 'is_visible': 'true', + 'lpeversion': '1', + 'operation': operation, + 'swap-operands': 'false', + 'filltype-this': 'from-curve', + 'filter': '', + 'filltype-operand': 'from-curve' + }) + + lpe_refs.append(f'#{lpe_id}') + + existing_style = operand.get('style', '') + if 'filter:' not in existing_style: + if existing_style and not existing_style.endswith(';'): + existing_style += ';' + operand.set('style', existing_style + f'filter:url(#{hidder_filter_id})') + + existing_lpe = element.get('{http://www.inkscape.org/namespaces/inkscape}path-effect', '') + if existing_lpe: + new_lpe = existing_lpe + ';' + ';'.join(lpe_refs) + else: + new_lpe = ';'.join(lpe_refs) + + element.set('{http://www.inkscape.org/namespaces/inkscape}path-effect', new_lpe) + + return element diff --git a/extensions/botbox3000/placements.py b/extensions/botbox3000/placements.py new file mode 100644 index 0000000..4cb56b9 --- /dev/null +++ b/extensions/botbox3000/placements.py @@ -0,0 +1,149 @@ +#!/usr/bin/env python3 + +import sys +from pathlib import Path + +deps_dir = Path(__file__).parent / "deps" +if deps_dir.exists() and str(deps_dir) not in sys.path: + sys.path.insert(0, str(deps_dir)) + +import math +import inkex +from inkex import PathElement, Rectangle, Transform + + +def calculate_path_length(path): + if isinstance(path, str): + path = inkex.Path(path) + + csp = path.to_superpath() + total_length = 0.0 + + for subpath in csp: + for i, seg in enumerate(subpath[:-1]): + next_seg = subpath[i + 1] + bezier = (seg[1], seg[2], next_seg[0], next_seg[1]) + seg_length = inkex.bezier.bezierlength(bezier, tolerance=0.01) + total_length += seg_length + + return total_length + + +def point_at_length(path, target_length): + if isinstance(path, str): + path = inkex.Path(path) + + csp = path.to_superpath() + current_length = 0.0 + + for subpath in csp: + for i, seg in enumerate(subpath[:-1]): + next_seg = subpath[i + 1] + bezier = (seg[1], seg[2], next_seg[0], next_seg[1]) + seg_length = inkex.bezier.bezierlength(bezier, tolerance=0.01) + + if current_length + seg_length >= target_length: + t = (target_length - current_length) / seg_length if seg_length > 0 else 0 + t = max(0.0, min(1.0, t)) + + p0, p1, p2, p3 = bezier + p0_p1_dist = ((p1[0] - p0[0])**2 + (p1[1] - p0[1])**2)**0.5 + p2_p3_dist = ((p3[0] - p2[0])**2 + (p3[1] - p2[1])**2)**0.5 + + if p0_p1_dist < 0.001 and p2_p3_dist < 0.001: + point = ( + p0[0] + t * (p3[0] - p0[0]), + p0[1] + t * (p3[1] - p0[1]) + ) + else: + point = inkex.bezier.bezierpointatt(bezier, t) + + p0, p1, p2, p3 = bezier + one_minus_t = 1.0 - t + + dx = (3 * one_minus_t * one_minus_t * (p1[0] - p0[0]) + + 6 * one_minus_t * t * (p2[0] - p1[0]) + + 3 * t * t * (p3[0] - p2[0])) + dy = (3 * one_minus_t * one_minus_t * (p1[1] - p0[1]) + + 6 * one_minus_t * t * (p2[1] - p1[1]) + + 3 * t * t * (p3[1] - p2[1])) + + length = (dx * dx + dy * dy) ** 0.5 + if length > 0: + dx /= length + dy /= length + + return (point[0], point[1]), (dx, dy) + + current_length += seg_length + + last_subpath = csp[-1] + last_point = last_subpath[-1][1] + return (last_point[0], last_point[1]), (1.0, 0.0) + + +def pattern_along_path(path, num_items, item_width, start_offset, spacing, create_shape_fn): + + if isinstance(path, str): + path = inkex.Path(path) + + if num_items <= 0: + return [] + + total_length = calculate_path_length(path) + items = [] + + if spacing == "even": + gap = (total_length - num_items * item_width) / num_items + + for i in range(num_items): + item_start = (start_offset + i * (gap + item_width)) % total_length + item_center = (item_start + item_width / 2) % total_length + + point, tangent = point_at_length(path, item_center) + angle = math.degrees(math.atan2(tangent[1], tangent[0])) + + item = create_shape_fn(i) + + transform = Transform() + transform.add_translate(point[0], point[1]) + transform.add_rotate(angle) + + item.transform = transform + items.append(item) + + elif spacing == "endpoints": + for i in range(num_items): + base_distance = total_length * i / (num_items - 1) if num_items > 1 else 0 + distance = (base_distance + start_offset) % total_length + point, tangent = point_at_length(path, distance) + angle = math.degrees(math.atan2(tangent[1], tangent[0])) + + item = create_shape_fn(i) + + transform = Transform() + transform.add_translate(point[0], point[1]) + transform.add_rotate(angle) + + item.transform = transform + items.append(item) + + elif spacing == "simple": + gap = (total_length - num_items * item_width) / num_items + + for i in range(num_items): + item_start = (start_offset + i * (gap + item_width)) % total_length + distance = (item_start + item_width / 2) % total_length + point, tangent = point_at_length(path, distance) + angle = math.degrees(math.atan2(tangent[1], tangent[0])) + + item = create_shape_fn(i) + + transform = Transform() + transform.add_translate(point[0], point[1]) + transform.add_rotate(angle) + + item.transform = transform + items.append(item) + + return items diff --git a/extensions/km-plot/.gitignore b/extensions/km-plot/.gitignore new file mode 100644 index 0000000..bf388fd --- /dev/null +++ b/extensions/km-plot/.gitignore @@ -0,0 +1,19 @@ +# Byte-compiled / cache files +__pycache__/ +*.py[cod] +*$py.class + +# Virtual environments +.venv/ +env/ +venv/ + +# Editor / OS files +.DS_Store +.idea/ +.vscode/ + +# Python packaging artifacts +build/ +dist/ +*.egg-info/ diff --git a/extensions/km-plot/.upstream_branch b/extensions/km-plot/.upstream_branch new file mode 100644 index 0000000..ba2906d --- /dev/null +++ b/extensions/km-plot/.upstream_branch @@ -0,0 +1 @@ +main diff --git a/extensions/km-plot/.upstream_commit b/extensions/km-plot/.upstream_commit new file mode 100644 index 0000000..52b2272 --- /dev/null +++ b/extensions/km-plot/.upstream_commit @@ -0,0 +1 @@ +b6ebf0b1366ab7e6f68d81e4a30278c015049726 diff --git a/extensions/km-plot/.upstream_url b/extensions/km-plot/.upstream_url new file mode 100644 index 0000000..dc50718 --- /dev/null +++ b/extensions/km-plot/.upstream_url @@ -0,0 +1 @@ +https://git.knoxmakers.org/KnoxMakers/km-plot.git diff --git a/extensions/km-plot/LICENSE b/extensions/km-plot/LICENSE new file mode 100644 index 0000000..995203f --- /dev/null +++ b/extensions/km-plot/LICENSE @@ -0,0 +1,622 @@ + GNU GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The GNU General Public License is a free, copyleft license for +software and other kinds of works. + + The licenses for most software and other practical works are designed +to take away your freedom to share and change the works. By contrast, +the GNU General Public License is intended to guarantee your freedom to +share and change all versions of a program--to make sure it remains free +software for all its users. We, the Free Software Foundation, use the +GNU General Public License for most of our software; it applies also to +any other work released this way by its authors. You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +them if you wish), that you receive source code or can get it if you +want it, that you can change the software or use pieces of it in new +free programs, and that you know you can do these things. + + To protect your rights, we need to prevent others from denying you +these rights or asking you to surrender the rights. Therefore, you have +certain responsibilities if you distribute copies of the software, or if +you modify it: responsibilities to respect the freedom of others. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must pass on to the recipients the same +freedoms that you received. You must make sure that they, too, receive +or can get the source code. And you must show them these terms so they +know their rights. + + Developers that use the GNU GPL protect your rights with two steps: +(1) assert copyright on the software, and (2) offer you this License +giving you legal permission to copy, distribute and/or modify it. + + For the developers' and authors' protection, the GPL clearly explains +that there is no warranty for this free software. For both users' and +authors' sake, the GPL requires that modified versions be marked as +changed, so that their problems will not be attributed erroneously to +authors of previous versions. + + Some devices are designed to deny users access to install or run +modified versions of the software inside them, although the manufacturer +can do so. This is fundamentally incompatible with the aim of +protecting users' freedom to change the software. The systematic +pattern of such abuse occurs in the area of products for individuals to +use, which is precisely where it is most unacceptable. Therefore, we +have designed this version of the GPL to prohibit the practice for those +products. If such problems arise substantially in other domains, we +stand ready to extend this provision to those domains in future versions +of the GPL, as needed to protect the freedom of users. + + Finally, every program is threatened constantly by software patents. +States should not allow patents to restrict development and use of +software on general-purpose computers, but in those that do, we wish to +avoid the special danger that patents applied to a free program could +make it effectively proprietary. To prevent this, the GPL assures that +patents cannot be used to render the program non-free. + + The precise terms and conditions for copying, distribution and +modification follow. + + TERMS AND CONDITIONS + + 0. Definitions. + + "This License" refers to version 3 of the GNU General Public License. + + "Copyright" also means copyright-like laws that apply to other kinds of +works, such as semiconductor masks. + + "The Program" refers to any copyrightable work licensed under this +License. Each licensee is addressed as "you". "Licensees" and +"recipients" may be individuals or organizations. + + To "modify" a work means to copy from or adapt all or part of the work +in a fashion requiring copyright permission, other than the making of an +exact copy. The resulting work is called a "modified version" of the +earlier work or a work "based on" the earlier work. + + A "covered work" means either the unmodified Program or a work based +on the Program. + + To "propagate" a work means to do anything with it that, without +permission, would make you directly or secondarily liable for +infringement under applicable copyright law, except executing it on a +computer or modifying a private copy. Propagation includes copying, +distribution (with or without modification), making available to the +public, and in some countries other activities as well. + + To "convey" a work means any kind of propagation that enables other +parties to make or receive copies. Mere interaction with a user through +a computer network, with no transfer of a copy, is not conveying. + + An interactive user interface displays "Appropriate Legal Notices" +to the extent that it includes a convenient and prominently visible +feature that (1) displays an appropriate copyright notice, and (2) +tells the user that there is no warranty for the work (except to the +extent that warranties are provided), that licensees may convey the +work under this License, and how to view a copy of this License. If +the interface presents a list of user commands or options, such as a +menu, a prominent item in the list meets this criterion. + + 1. Source Code. + + The "source code" for a work means the preferred form of the work +for making modifications to it. "Object code" means any non-source +form of a work. + + A "Standard Interface" means an interface that either is an official +standard defined by a recognized standards body, or, in the case of +interfaces specified for a particular programming language, one that +is widely used among developers working in that language. + + The "System Libraries" of an executable work include anything, other +than the work as a whole, that (a) is included in the normal form of +packaging a Major Component, but which is not part of that Major +Component, and (b) serves only to enable use of the work with that +Major Component, or to implement a Standard Interface for which an +implementation is available to the public in source code form. A +"Major Component", in this context, means a major essential component +(kernel, window system, and so on) of the specific operating system +(if any) on which the executable work runs, or a compiler used to +produce the work, or an object code interpreter used to run it. + + The "Corresponding Source" for a work in object code form means all +the source code needed to generate, install, and (for an executable +work) run the object code and to modify the work, including scripts to +control those activities. However, it does not include the work's +System Libraries, or general-purpose tools or generally available free +programs which are used unmodified in performing those activities but +which are not part of the work. For example, Corresponding Source +includes interface definition files associated with source files for +the work, and the source code for shared libraries and dynamically +linked subprograms that the work is specifically designed to require, +such as by intimate data communication or control flow between those +subprograms and other parts of the work. + + The Corresponding Source need not include anything that users +can regenerate automatically from other parts of the Corresponding +Source. + + The Corresponding Source for a work in source code form is that +same work. + + 2. Basic Permissions. + + All rights granted under this License are granted for the term of +copyright on the Program, and are irrevocable provided the stated +conditions are met. This License explicitly affirms your unlimited +permission to run the unmodified Program. The output from running a +covered work is covered by this License only if the output, given its +content, constitutes a covered work. This License acknowledges your +rights of fair use or other equivalent, as provided by copyright law. + + You may make, run and propagate covered works that you do not +convey, without conditions so long as your license otherwise remains +in force. You may convey covered works to others for the sole purpose +of having them make modifications exclusively for you, or provide you +with facilities for running those works, provided that you comply with +the terms of this License in conveying all material for which you do +not control copyright. Those thus making or running the covered works +for you must do so exclusively on your behalf, under your direction +and control, on terms that prohibit them from making any copies of +your copyrighted material outside their relationship with you. + + Conveying under any other circumstances is permitted solely under +the conditions stated below. Sublicensing is not allowed; section 10 +makes it unnecessary. + + 3. Protecting Users' Legal Rights From Anti-Circumvention Law. + + No covered work shall be deemed part of an effective technological +measure under any applicable law fulfilling obligations under article +11 of the WIPO copyright treaty adopted on 20 December 1996, or +similar laws prohibiting or restricting circumvention of such +measures. + + When you convey a covered work, you waive any legal power to forbid +circumvention of technological measures to the extent such circumvention +is effected by exercising rights under this License with respect to +the covered work, and you disclaim any intention to limit operation or +modification of the work as a means of enforcing, against the work's +users, your or third parties' legal rights to forbid circumvention of +technological measures. + + 4. Conveying Verbatim Copies. + + You may convey verbatim copies of the Program's source code as you +receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice; +keep intact all notices stating that this License and any +non-permissive terms added in accord with section 7 apply to the code; +keep intact all notices of the absence of any warranty; and give all +recipients a copy of this License along with the Program. + + You may charge any price or no price for each copy that you convey, +and you may offer support or warranty protection for a fee. + + 5. Conveying Modified Source Versions. + + You may convey a work based on the Program, or the modifications to +produce it from the Program, in the form of source code under the +terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified + it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is + released under this License and any conditions added under section + 7. This requirement modifies the requirement in section 4 to + "keep intact all notices". + + c) You must license the entire work, as a whole, under this + License to anyone who comes into possession of a copy. This + License will therefore apply, along with any applicable section 7 + additional terms, to the whole of the work, and all its parts, + regardless of how they are packaged. This License gives no + permission to license the work in any other way, but it does not + invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display + Appropriate Legal Notices; however, if the Program has interactive + interfaces that do not display Appropriate Legal Notices, your + work need not make them do so. + + A compilation of a covered work with other separate and independent +works, which are not by their nature extensions of the covered work, +and which are not combined with it such as to form a larger program, +in or on a volume of a storage or distribution medium, is called an +"aggregate" if the compilation and its resulting copyright are not +used to limit the access or legal rights of the compilation's users +beyond what the individual works permit. Inclusion of a covered work +in an aggregate does not cause this License to apply to the other +parts of the aggregate. + + 6. Conveying Non-Source Forms. + + You may convey a covered work in object code form under the terms +of sections 4 and 5, provided that you also convey the +machine-readable Corresponding Source under the terms of this License, +in one of these ways: + + a) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by the + Corresponding Source fixed on a durable physical medium + customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by a + written offer, valid for at least three years and valid for as + long as you offer spare parts or customer support for that product + model, to give anyone who possesses the object code either (1) a + copy of the Corresponding Source for all the software in the + product that is covered by this License, on a durable physical + medium customarily used for software interchange, for a price no + more than your reasonable cost of physically performing this + conveying of source, or (2) access to copy the Corresponding + Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the + written offer to provide the Corresponding Source. This + alternative is allowed only occasionally and noncommercially, and + only if you received the object code with such an offer, in accord + with subsection 6b. + + d) Convey the object code by offering access from a designated + place (gratis or for a charge), and offer equivalent access to the + Corresponding Source in the same way through the same place at no + further charge. You need not require recipients to copy the + Corresponding Source along with the object code. If the place to + copy the object code is a network server, the Corresponding Source + may be on a different server (operated by you or a third party) + that supports equivalent copying facilities, provided you maintain + clear directions next to the object code saying where to find the + Corresponding Source. Regardless of what server hosts the + Corresponding Source, you remain obligated to ensure that it is + available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided + you inform other peers where the object code and Corresponding + Source of the work are being offered to the general public at no + charge under subsection 6d. + + A separable portion of the object code, whose source code is excluded +from the Corresponding Source as a System Library, need not be +included in conveying the object code work. + + A "User Product" is either (1) a "consumer product", which means any +tangible personal property which is normally used for personal, family, +or household purposes, or (2) anything designed or sold for +incorporation into a dwelling. In determining whether a product is a +consumer product, doubtful cases shall be resolved in favor of +coverage. For a particular product received by a particular user, +"normally used" refers to a typical or common use of that class of +product, regardless of the status of the particular user or of the way +in which the particular user actually uses, or expects or is expected +to use, the product. A product is a consumer product regardless of +whether the product has substantial commercial, industrial or +non-consumer uses, unless such uses represent the only significant mode +of use of the product. + + "Installation Information" for a User Product means any methods, +procedures, authorization keys, or other information required to +install and execute modified versions of a covered work in that User +Product from a modified version of its Corresponding Source. The +information must suffice to ensure that the continued functioning of +the modified object code is in no case prevented or interfered with +solely because modification has been made. + + If you convey an object code work under this section in, or with, or +specifically for use in, a User Product, and the conveying occurs as +part of a transaction in which the right of possession and use of the +User Product is transferred to the recipient in perpetuity or for a +fixed term (regardless of how the transaction is characterized), the +Corresponding Source conveyed under this section must be accompanied +by the Installation Information. But this requirement does not apply +if neither you nor any third party retains the ability to install +modified object code on the User Product (for example, the work has +been installed in ROM). + + The requirement to provide Installation Information does not include a +requirement to continue to provide support service, warranty, or updates +for a work that has been modified or installed by the recipient, or for +the User Product in which it has been modified or installed. Access to a +network may be denied when the modification itself materially and +adversely affects the operation of the network or violates the rules and +protocols for communication across the network. + + Corresponding Source conveyed, and Installation Information provided, +in accord with this section must be in a format that is publicly +documented (and with an implementation available to the public in +source code form), and must require no special password or key for +unpacking, reading or copying. + + 7. Additional Terms. + + "Additional permissions" are terms that supplement the terms of this +License by making exceptions from one or more of its conditions. +Additional permissions that are applicable to the entire Program shall +be treated as though they were included in this License, to the extent +that they are valid under applicable law. If additional permissions +apply only to part of the Program, that part may be used separately +under those permissions, but the entire Program remains governed by +this License without regard to the additional permissions. + + When you convey a copy of a covered work, you may at your option +remove any additional permissions from that copy, or from any part of +it. (Additional permissions may be written to require their own +removal in certain cases when you modify the work.) You may place +additional permissions on material, added by you to a covered work, +for which you have or can give appropriate copyright permission. + + Notwithstanding any other provision of this License, for material you +add to a covered work, you may (if authorized by the copyright holders of +that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the + terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or + author attributions in that material or in the Appropriate Legal + Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or + requiring that modified versions of such material be marked in + reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or + authors of the material; or + + e) Declining to grant rights under trademark law for use of some + trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that + material by anyone who conveys the material (or modified versions of + it) with contractual assumptions of liability to the recipient, for + any liability that these contractual assumptions directly impose on + those licensors and authors. + + All other non-permissive additional terms are considered "further +restrictions" within the meaning of section 10. If the Program as you +received it, or any part of it, contains a notice stating that it is +governed by this License along with a term that is a further +restriction, you may remove that term. If a license document contains +a further restriction but permits relicensing or conveying under this +License, you may add to a covered work material governed by the terms +of that license document, provided that the further restriction does +not survive such relicensing or conveying. + + If you add terms to a covered work in accord with this section, you +must place, in the relevant source files, a statement of the +additional terms that apply to those files, or a notice indicating +where to find the applicable terms. + + Additional terms, permissive or non-permissive, may be stated in the +form of a separately written license, or stated as exceptions; +the above requirements apply either way. + + 8. Termination. + + You may not propagate or modify a covered work except as expressly +provided under this License. Any attempt otherwise to propagate or +modify it is void, and will automatically terminate your rights under +this License (including any patent licenses granted under the third +paragraph of section 11). + + However, if you cease all violation of this License, then your +license from a particular copyright holder is reinstated (a) +provisionally, unless and until the copyright holder explicitly and +finally terminates your license, and (b) permanently, if the copyright +holder fails to notify you of the violation by some reasonable means +prior to 60 days after the cessation. + + Moreover, your license from a particular copyright holder is +reinstated permanently if the copyright holder notifies you of the +violation by some reasonable means, this is the first time you have +received notice of violation of this License (for any work) from that +copyright holder, and you cure the violation prior to 30 days after +your receipt of the notice. + + Termination of your rights under this section does not terminate the +licenses of parties who have received copies or rights from you under +this License. If your rights have been terminated and not permanently +reinstated, you do not qualify to receive new licenses for the same +material under section 10. + + 9. Acceptance Not Required for Having Copies. + + You are not required to accept this License in order to receive or +run a copy of the Program. Ancillary propagation of a covered work +occurring solely as a consequence of using peer-to-peer transmission +to receive a copy likewise does not require acceptance. However, +nothing other than this License grants you permission to propagate or +modify any covered work. These actions infringe copyright if you do +not accept this License. Therefore, by modifying or propagating a +covered work, you indicate your acceptance of this License to do so. + + 10. Automatic Licensing of Downstream Recipients. + + Each time you convey a covered work, the recipient automatically +receives a license from the original licensors, to run, modify and +propagate that work, subject to this License. You are not responsible +for enforcing compliance by third parties with this License. + + An "entity transaction" is a transaction transferring control of an +organization, or substantially all assets of one, or subdividing an +organization, or merging organizations. If propagation of a covered +work results from an entity transaction, each party to that +transaction who receives a copy of the work also receives whatever +licenses to the work the party's predecessor in interest had or could +give under the previous paragraph, plus a right to possession of the +Corresponding Source of the work from the predecessor in interest, if +the predecessor has it or can get it with reasonable efforts. + + You may not impose any further restrictions on the exercise of the +rights granted or affirmed under this License. For example, you may +not impose a license fee, royalty, or other charge for exercise of +rights granted under this License, and you may not initiate litigation +(including a cross-claim or counterclaim in a lawsuit) alleging that +any patent claim is infringed by making, using, selling, offering for +sale, or importing the Program or any portion of it. + + 11. Patents. + + A "contributor" is a copyright holder who authorizes use under this +License of the Program or a work on which the Program is based. The +work thus licensed is called the contributor's "contributor version". + + A contributor's "essential patent claims" are all patent claims +owned or controlled by the contributor, whether already acquired or +hereafter acquired, that would be infringed by some manner, permitted +by this License, of making, using, or selling its contributor version, +but do not include claims that would be infringed only as a +consequence of further modification of the contributor version. For +purposes of this definition, "control" includes the right to grant +patent sublicenses in a manner consistent with the requirements of +this License. + + Each contributor grants you a non-exclusive, worldwide, royalty-free +patent license under the contributor's essential patent claims, to +make, use, sell, offer for sale, import and otherwise run, modify and +propagate the contents of its contributor version. + + In the following three paragraphs, a "patent license" is any express +agreement or commitment, however denominated, not to enforce a patent +(such as an express permission to practice a patent or covenant not to +sue for patent infringement). To "grant" such a patent license to a +party means to make such an agreement or commitment not to enforce a +patent against the party. + + If you convey a covered work, knowingly relying on a patent license, +and the Corresponding Source of the work is not available for anyone +to copy, free of charge and under the terms of this License, through a +publicly available network server or other readily accessible means, +then you must either (1) cause the Corresponding Source to be so +available, or (2) arrange to deprive yourself of the benefit of the +patent license for this particular work, or (3) arrange, in a manner +consistent with the requirements of this License, to extend the patent +license to downstream recipients. "Knowingly relying" means you have +actual knowledge that, but for the patent license, your conveying the +covered work in a country, or your recipient's use of the covered work +in a country, would infringe one or more identifiable patents in that +country that you have reason to believe are valid. + + If, pursuant to or in connection with a single transaction or +arrangement, you convey, or propagate by procuring conveyance of, a +covered work, and grant a patent license to some of the parties +receiving the covered work authorizing them to use, propagate, modify +or convey a specific copy of the covered work, then the patent license +you grant is automatically extended to all recipients of the covered +work and works based on it. + + A patent license is "discriminatory" if it does not include within +the scope of its coverage, prohibits the exercise of, or is +conditioned on the non-exercise of one or more of the rights that are +specifically granted under this License. You may not convey a covered +work if you are a party to an arrangement with a third party that is +in the business of distributing software, under which you make payment +to the third party based on the extent of your activity of conveying +the work, and under which the third party grants, to any of the +parties who would receive the covered work from you, a discriminatory +patent license (a) in connection with copies of the covered work +conveyed by you (or copies made from those copies), or (b) primarily +for and in connection with specific products or compilations that +contain the covered work, unless you entered into that arrangement, +or that patent license was granted, prior to 28 March 2007. + + Nothing in this License shall be construed as excluding or limiting +any implied license or other defenses to infringement that may +otherwise be available to you under applicable patent law. + + 12. No Surrender of Others' Freedom. + + If conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot convey a +covered work so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you may +not convey it at all. For example, if you agree to terms that obligate you +to collect a royalty for further conveying from those to whom you convey +the Program, the only way you could satisfy both those terms and this +License would be to refrain entirely from conveying the Program. + + 13. Use with the GNU Affero General Public License. + + Notwithstanding any other provision of this License, you have +permission to link or combine any covered work with a work licensed +under version 3 of the GNU Affero General Public License into a single +combined work, and to convey the resulting work. The terms of this +License will continue to apply to the part which is the covered work, +but the special requirements of the GNU Affero General Public License, +section 13, concerning interaction through a network will apply to the +combination as such. + + 14. Revised Versions of this License. + + The Free Software Foundation may publish revised and/or new versions of +the GNU General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + + Each version is given a distinguishing version number. If the +Program specifies that a certain numbered version of the GNU General +Public License "or any later version" applies to it, you have the +option of following the terms and conditions either of that numbered +version or of any later version published by the Free Software +Foundation. If the Program does not specify a version number of the +GNU General Public License, you may choose any version ever published +by the Free Software Foundation. + + If the Program specifies that a proxy can decide which future +versions of the GNU General Public License can be used, that proxy's +public statement of acceptance of a version permanently authorizes you +to choose that version for the Program. + + Later license versions may give you additional or different +permissions. However, no additional obligations are imposed on any +author or copyright holder as a result of your choosing to follow a +later version. + + 15. Disclaimer of Warranty. + + THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY +APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT +HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY +OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, +THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM +IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF +ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. Limitation of Liability. + + IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS +THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE +USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF +DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD +PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), +EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF +SUCH DAMAGES. + + 17. Interpretation of Sections 15 and 16. + + If the disclaimer of warranty and limitation of liability provided +above cannot be given local legal effect according to their terms, +reviewing courts shall apply local law that most closely approximates +an absolute waiver of all civil liability in connection with the +Program, unless a warranty or assumption of liability accompanies a +copy of the Program in return for a fee. + + END OF TERMS AND CONDITIONS diff --git a/extensions/km-plot/README.md b/extensions/km-plot/README.md new file mode 100644 index 0000000..f78991a --- /dev/null +++ b/extensions/km-plot/README.md @@ -0,0 +1,25 @@ +# KM Plot + +Inkscape extension for Knox Makers to drive HPGL based vinyl/plotter devices over serial. Largely based on the built-in Export > Plot extension for Inkscape but with a GTK interface and Serial Port detection. + +https://git.knoxmakers.org/KnoxMakers/km-plot + + +## Manual Installation + +1) Create a km-plot/ sub-directory in your Inkscape extensions directory: + - Linux: `~/.config/inkscape/extensions/` + - Flatpak: `~/.var/app/org.inkscape.Inkscape/config/inkscape/extensions/` + - Snap: `~/snap/inkscape/current/.config/inkscape/extensions/` + - macOS (Inkscape app bundle): `~/Library/Application Support/org.inkscape.Inkscape/config/inkscape/extensions/` + - Windows: `%APPDATA%\Inkscape\extensions\` + +2) Copy the files from this repo into that km-plot directory + +3) Restart Inkscape, then find the extension under **Extensions > Knox Makers > Vinyl Cutter > Plot**. + +4) Connect your plotter via USB/serial; select the detected port in the Device tab, adjust settings as needed, and click **Send to plotter**. + +## Demo + +![KM Plot demo](docs/km-plot.gif) diff --git a/extensions/km-plot/deps/serial/__init__.py b/extensions/km-plot/deps/serial/__init__.py new file mode 100644 index 0000000..caa4de1 --- /dev/null +++ b/extensions/km-plot/deps/serial/__init__.py @@ -0,0 +1,91 @@ +#!/usr/bin/env python +# +# This is a wrapper module for different platform implementations +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2001-2020 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +import sys +import importlib + +from serial.serialutil import * +#~ SerialBase, SerialException, to_bytes, iterbytes + +__version__ = '3.5' + +VERSION = __version__ + +# pylint: disable=wrong-import-position +if sys.platform == 'cli': + from serial.serialcli import Serial +else: + import os + # chose an implementation, depending on os + if os.name == 'nt': # sys.platform == 'win32': + from serial.serialwin32 import Serial + elif os.name == 'posix': + from serial.serialposix import Serial, PosixPollSerial, VTIMESerial # noqa + elif os.name == 'java': + from serial.serialjava import Serial + else: + raise ImportError("Sorry: no implementation for your platform ('{}') available".format(os.name)) + + +protocol_handler_packages = [ + 'serial.urlhandler', +] + + +def serial_for_url(url, *args, **kwargs): + """\ + Get an instance of the Serial class, depending on port/url. The port is not + opened when the keyword parameter 'do_not_open' is true, by default it + is. All other parameters are directly passed to the __init__ method when + the port is instantiated. + + The list of package names that is searched for protocol handlers is kept in + ``protocol_handler_packages``. + + e.g. we want to support a URL ``foobar://``. A module + ``my_handlers.protocol_foobar`` is provided by the user. Then + ``protocol_handler_packages.append("my_handlers")`` would extend the search + path so that ``serial_for_url("foobar://"))`` would work. + """ + # check and remove extra parameter to not confuse the Serial class + do_open = not kwargs.pop('do_not_open', False) + # the default is to use the native implementation + klass = Serial + try: + url_lowercase = url.lower() + except AttributeError: + # it's not a string, use default + pass + else: + # if it is an URL, try to import the handler module from the list of possible packages + if '://' in url_lowercase: + protocol = url_lowercase.split('://', 1)[0] + module_name = '.protocol_{}'.format(protocol) + for package_name in protocol_handler_packages: + try: + importlib.import_module(package_name) + handler_module = importlib.import_module(module_name, package_name) + except ImportError: + continue + else: + if hasattr(handler_module, 'serial_class_for_url'): + url, klass = handler_module.serial_class_for_url(url) + else: + klass = handler_module.Serial + break + else: + raise ValueError('invalid URL, protocol {!r} not known'.format(protocol)) + # instantiate and open when desired + instance = klass(None, *args, **kwargs) + instance.port = url + if do_open: + instance.open() + return instance diff --git a/extensions/km-plot/deps/serial/__main__.py b/extensions/km-plot/deps/serial/__main__.py new file mode 100644 index 0000000..bd0a2e6 --- /dev/null +++ b/extensions/km-plot/deps/serial/__main__.py @@ -0,0 +1,3 @@ +from .tools import miniterm + +miniterm.main() diff --git a/extensions/km-plot/deps/serial/rfc2217.py b/extensions/km-plot/deps/serial/rfc2217.py new file mode 100644 index 0000000..2ae188e --- /dev/null +++ b/extensions/km-plot/deps/serial/rfc2217.py @@ -0,0 +1,1351 @@ +#! python +# +# This module implements a RFC2217 compatible client. RF2217 descibes a +# protocol to access serial ports over TCP/IP and allows setting the baud rate, +# modem control lines etc. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2001-2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +# TODO: +# - setting control line -> answer is not checked (had problems with one of the +# severs). consider implementing a compatibility mode flag to make check +# conditional +# - write timeout not implemented at all + +# ########################################################################### +# observations and issues with servers +# =========================================================================== +# sredird V2.2.1 +# - http://www.ibiblio.org/pub/Linux/system/serial/ sredird-2.2.2.tar.gz +# - does not acknowledge SET_CONTROL (RTS/DTR) correctly, always responding +# [105 1] instead of the actual value. +# - SET_BAUDRATE answer contains 4 extra null bytes -> probably for larger +# numbers than 2**32? +# - To get the signature [COM_PORT_OPTION 0] has to be sent. +# - run a server: while true; do nc -l -p 7000 -c "sredird debug /dev/ttyUSB0 /var/lock/sredir"; done +# =========================================================================== +# telnetcpcd (untested) +# - http://ftp.wayne.edu/kermit/sredird/telnetcpcd-1.09.tar.gz +# - To get the signature [COM_PORT_OPTION] w/o data has to be sent. +# =========================================================================== +# ser2net +# - does not negotiate BINARY or COM_PORT_OPTION for his side but at least +# acknowledges that the client activates these options +# - The configuration may be that the server prints a banner. As this client +# implementation does a flushInput on connect, this banner is hidden from +# the user application. +# - NOTIFY_MODEMSTATE: the poll interval of the server seems to be one +# second. +# - To get the signature [COM_PORT_OPTION 0] has to be sent. +# - run a server: run ser2net daemon, in /etc/ser2net.conf: +# 2000:telnet:0:/dev/ttyS0:9600 remctl banner +# ########################################################################### + +# How to identify ports? pySerial might want to support other protocols in the +# future, so lets use an URL scheme. +# for RFC2217 compliant servers we will use this: +# rfc2217://:[?option[&option...]] +# +# options: +# - "logging" set log level print diagnostic messages (e.g. "logging=debug") +# - "ign_set_control": do not look at the answers to SET_CONTROL +# - "poll_modem": issue NOTIFY_MODEMSTATE requests when CTS/DTR/RI/CD is read. +# Without this option it expects that the server sends notifications +# automatically on change (which most servers do and is according to the +# RFC). +# the order of the options is not relevant + +from __future__ import absolute_import + +import logging +import socket +import struct +import threading +import time +try: + import urlparse +except ImportError: + import urllib.parse as urlparse +try: + import Queue +except ImportError: + import queue as Queue + +import serial +from serial.serialutil import SerialBase, SerialException, to_bytes, \ + iterbytes, PortNotOpenError, Timeout + +# port string is expected to be something like this: +# rfc2217://host:port +# host may be an IP or including domain, whatever. +# port is 0...65535 + +# map log level names to constants. used in from_url() +LOGGER_LEVELS = { + 'debug': logging.DEBUG, + 'info': logging.INFO, + 'warning': logging.WARNING, + 'error': logging.ERROR, +} + + +# telnet protocol characters +SE = b'\xf0' # Subnegotiation End +NOP = b'\xf1' # No Operation +DM = b'\xf2' # Data Mark +BRK = b'\xf3' # Break +IP = b'\xf4' # Interrupt process +AO = b'\xf5' # Abort output +AYT = b'\xf6' # Are You There +EC = b'\xf7' # Erase Character +EL = b'\xf8' # Erase Line +GA = b'\xf9' # Go Ahead +SB = b'\xfa' # Subnegotiation Begin +WILL = b'\xfb' +WONT = b'\xfc' +DO = b'\xfd' +DONT = b'\xfe' +IAC = b'\xff' # Interpret As Command +IAC_DOUBLED = b'\xff\xff' + +# selected telnet options +BINARY = b'\x00' # 8-bit data path +ECHO = b'\x01' # echo +SGA = b'\x03' # suppress go ahead + +# RFC2217 +COM_PORT_OPTION = b'\x2c' + +# Client to Access Server +SET_BAUDRATE = b'\x01' +SET_DATASIZE = b'\x02' +SET_PARITY = b'\x03' +SET_STOPSIZE = b'\x04' +SET_CONTROL = b'\x05' +NOTIFY_LINESTATE = b'\x06' +NOTIFY_MODEMSTATE = b'\x07' +FLOWCONTROL_SUSPEND = b'\x08' +FLOWCONTROL_RESUME = b'\x09' +SET_LINESTATE_MASK = b'\x0a' +SET_MODEMSTATE_MASK = b'\x0b' +PURGE_DATA = b'\x0c' + +SERVER_SET_BAUDRATE = b'\x65' +SERVER_SET_DATASIZE = b'\x66' +SERVER_SET_PARITY = b'\x67' +SERVER_SET_STOPSIZE = b'\x68' +SERVER_SET_CONTROL = b'\x69' +SERVER_NOTIFY_LINESTATE = b'\x6a' +SERVER_NOTIFY_MODEMSTATE = b'\x6b' +SERVER_FLOWCONTROL_SUSPEND = b'\x6c' +SERVER_FLOWCONTROL_RESUME = b'\x6d' +SERVER_SET_LINESTATE_MASK = b'\x6e' +SERVER_SET_MODEMSTATE_MASK = b'\x6f' +SERVER_PURGE_DATA = b'\x70' + +RFC2217_ANSWER_MAP = { + SET_BAUDRATE: SERVER_SET_BAUDRATE, + SET_DATASIZE: SERVER_SET_DATASIZE, + SET_PARITY: SERVER_SET_PARITY, + SET_STOPSIZE: SERVER_SET_STOPSIZE, + SET_CONTROL: SERVER_SET_CONTROL, + NOTIFY_LINESTATE: SERVER_NOTIFY_LINESTATE, + NOTIFY_MODEMSTATE: SERVER_NOTIFY_MODEMSTATE, + FLOWCONTROL_SUSPEND: SERVER_FLOWCONTROL_SUSPEND, + FLOWCONTROL_RESUME: SERVER_FLOWCONTROL_RESUME, + SET_LINESTATE_MASK: SERVER_SET_LINESTATE_MASK, + SET_MODEMSTATE_MASK: SERVER_SET_MODEMSTATE_MASK, + PURGE_DATA: SERVER_PURGE_DATA, +} + +SET_CONTROL_REQ_FLOW_SETTING = b'\x00' # Request Com Port Flow Control Setting (outbound/both) +SET_CONTROL_USE_NO_FLOW_CONTROL = b'\x01' # Use No Flow Control (outbound/both) +SET_CONTROL_USE_SW_FLOW_CONTROL = b'\x02' # Use XON/XOFF Flow Control (outbound/both) +SET_CONTROL_USE_HW_FLOW_CONTROL = b'\x03' # Use HARDWARE Flow Control (outbound/both) +SET_CONTROL_REQ_BREAK_STATE = b'\x04' # Request BREAK State +SET_CONTROL_BREAK_ON = b'\x05' # Set BREAK State ON +SET_CONTROL_BREAK_OFF = b'\x06' # Set BREAK State OFF +SET_CONTROL_REQ_DTR = b'\x07' # Request DTR Signal State +SET_CONTROL_DTR_ON = b'\x08' # Set DTR Signal State ON +SET_CONTROL_DTR_OFF = b'\x09' # Set DTR Signal State OFF +SET_CONTROL_REQ_RTS = b'\x0a' # Request RTS Signal State +SET_CONTROL_RTS_ON = b'\x0b' # Set RTS Signal State ON +SET_CONTROL_RTS_OFF = b'\x0c' # Set RTS Signal State OFF +SET_CONTROL_REQ_FLOW_SETTING_IN = b'\x0d' # Request Com Port Flow Control Setting (inbound) +SET_CONTROL_USE_NO_FLOW_CONTROL_IN = b'\x0e' # Use No Flow Control (inbound) +SET_CONTROL_USE_SW_FLOW_CONTOL_IN = b'\x0f' # Use XON/XOFF Flow Control (inbound) +SET_CONTROL_USE_HW_FLOW_CONTOL_IN = b'\x10' # Use HARDWARE Flow Control (inbound) +SET_CONTROL_USE_DCD_FLOW_CONTROL = b'\x11' # Use DCD Flow Control (outbound/both) +SET_CONTROL_USE_DTR_FLOW_CONTROL = b'\x12' # Use DTR Flow Control (inbound) +SET_CONTROL_USE_DSR_FLOW_CONTROL = b'\x13' # Use DSR Flow Control (outbound/both) + +LINESTATE_MASK_TIMEOUT = 128 # Time-out Error +LINESTATE_MASK_SHIFTREG_EMPTY = 64 # Transfer Shift Register Empty +LINESTATE_MASK_TRANSREG_EMPTY = 32 # Transfer Holding Register Empty +LINESTATE_MASK_BREAK_DETECT = 16 # Break-detect Error +LINESTATE_MASK_FRAMING_ERROR = 8 # Framing Error +LINESTATE_MASK_PARTIY_ERROR = 4 # Parity Error +LINESTATE_MASK_OVERRUN_ERROR = 2 # Overrun Error +LINESTATE_MASK_DATA_READY = 1 # Data Ready + +MODEMSTATE_MASK_CD = 128 # Receive Line Signal Detect (also known as Carrier Detect) +MODEMSTATE_MASK_RI = 64 # Ring Indicator +MODEMSTATE_MASK_DSR = 32 # Data-Set-Ready Signal State +MODEMSTATE_MASK_CTS = 16 # Clear-To-Send Signal State +MODEMSTATE_MASK_CD_CHANGE = 8 # Delta Receive Line Signal Detect +MODEMSTATE_MASK_RI_CHANGE = 4 # Trailing-edge Ring Detector +MODEMSTATE_MASK_DSR_CHANGE = 2 # Delta Data-Set-Ready +MODEMSTATE_MASK_CTS_CHANGE = 1 # Delta Clear-To-Send + +PURGE_RECEIVE_BUFFER = b'\x01' # Purge access server receive data buffer +PURGE_TRANSMIT_BUFFER = b'\x02' # Purge access server transmit data buffer +PURGE_BOTH_BUFFERS = b'\x03' # Purge both the access server receive data + # buffer and the access server transmit data buffer + + +RFC2217_PARITY_MAP = { + serial.PARITY_NONE: 1, + serial.PARITY_ODD: 2, + serial.PARITY_EVEN: 3, + serial.PARITY_MARK: 4, + serial.PARITY_SPACE: 5, +} +RFC2217_REVERSE_PARITY_MAP = dict((v, k) for k, v in RFC2217_PARITY_MAP.items()) + +RFC2217_STOPBIT_MAP = { + serial.STOPBITS_ONE: 1, + serial.STOPBITS_ONE_POINT_FIVE: 3, + serial.STOPBITS_TWO: 2, +} +RFC2217_REVERSE_STOPBIT_MAP = dict((v, k) for k, v in RFC2217_STOPBIT_MAP.items()) + +# Telnet filter states +M_NORMAL = 0 +M_IAC_SEEN = 1 +M_NEGOTIATE = 2 + +# TelnetOption and TelnetSubnegotiation states +REQUESTED = 'REQUESTED' +ACTIVE = 'ACTIVE' +INACTIVE = 'INACTIVE' +REALLY_INACTIVE = 'REALLY_INACTIVE' + + +class TelnetOption(object): + """Manage a single telnet option, keeps track of DO/DONT WILL/WONT.""" + + def __init__(self, connection, name, option, send_yes, send_no, ack_yes, + ack_no, initial_state, activation_callback=None): + """\ + Initialize option. + :param connection: connection used to transmit answers + :param name: a readable name for debug outputs + :param send_yes: what to send when option is to be enabled. + :param send_no: what to send when option is to be disabled. + :param ack_yes: what to expect when remote agrees on option. + :param ack_no: what to expect when remote disagrees on option. + :param initial_state: options initialized with REQUESTED are tried to + be enabled on startup. use INACTIVE for all others. + """ + self.connection = connection + self.name = name + self.option = option + self.send_yes = send_yes + self.send_no = send_no + self.ack_yes = ack_yes + self.ack_no = ack_no + self.state = initial_state + self.active = False + self.activation_callback = activation_callback + + def __repr__(self): + """String for debug outputs""" + return "{o.name}:{o.active}({o.state})".format(o=self) + + def process_incoming(self, command): + """\ + A DO/DONT/WILL/WONT was received for this option, update state and + answer when needed. + """ + if command == self.ack_yes: + if self.state is REQUESTED: + self.state = ACTIVE + self.active = True + if self.activation_callback is not None: + self.activation_callback() + elif self.state is ACTIVE: + pass + elif self.state is INACTIVE: + self.state = ACTIVE + self.connection.telnet_send_option(self.send_yes, self.option) + self.active = True + if self.activation_callback is not None: + self.activation_callback() + elif self.state is REALLY_INACTIVE: + self.connection.telnet_send_option(self.send_no, self.option) + else: + raise ValueError('option in illegal state {!r}'.format(self)) + elif command == self.ack_no: + if self.state is REQUESTED: + self.state = INACTIVE + self.active = False + elif self.state is ACTIVE: + self.state = INACTIVE + self.connection.telnet_send_option(self.send_no, self.option) + self.active = False + elif self.state is INACTIVE: + pass + elif self.state is REALLY_INACTIVE: + pass + else: + raise ValueError('option in illegal state {!r}'.format(self)) + + +class TelnetSubnegotiation(object): + """\ + A object to handle subnegotiation of options. In this case actually + sub-sub options for RFC 2217. It is used to track com port options. + """ + + def __init__(self, connection, name, option, ack_option=None): + if ack_option is None: + ack_option = option + self.connection = connection + self.name = name + self.option = option + self.value = None + self.ack_option = ack_option + self.state = INACTIVE + + def __repr__(self): + """String for debug outputs.""" + return "{sn.name}:{sn.state}".format(sn=self) + + def set(self, value): + """\ + Request a change of the value. a request is sent to the server. if + the client needs to know if the change is performed he has to check the + state of this object. + """ + self.value = value + self.state = REQUESTED + self.connection.rfc2217_send_subnegotiation(self.option, self.value) + if self.connection.logger: + self.connection.logger.debug("SB Requesting {} -> {!r}".format(self.name, self.value)) + + def is_ready(self): + """\ + Check if answer from server has been received. when server rejects + the change, raise a ValueError. + """ + if self.state == REALLY_INACTIVE: + raise ValueError("remote rejected value for option {!r}".format(self.name)) + return self.state == ACTIVE + # add property to have a similar interface as TelnetOption + active = property(is_ready) + + def wait(self, timeout=3): + """\ + Wait until the subnegotiation has been acknowledged or timeout. It + can also throw a value error when the answer from the server does not + match the value sent. + """ + timeout_timer = Timeout(timeout) + while not timeout_timer.expired(): + time.sleep(0.05) # prevent 100% CPU load + if self.is_ready(): + break + else: + raise SerialException("timeout while waiting for option {!r}".format(self.name)) + + def check_answer(self, suboption): + """\ + Check an incoming subnegotiation block. The parameter already has + cut off the header like sub option number and com port option value. + """ + if self.value == suboption[:len(self.value)]: + self.state = ACTIVE + else: + # error propagation done in is_ready + self.state = REALLY_INACTIVE + if self.connection.logger: + self.connection.logger.debug("SB Answer {} -> {!r} -> {}".format(self.name, suboption, self.state)) + + +class Serial(SerialBase): + """Serial port implementation for RFC 2217 remote serial ports.""" + + BAUDRATES = (50, 75, 110, 134, 150, 200, 300, 600, 1200, 1800, 2400, 4800, + 9600, 19200, 38400, 57600, 115200) + + def __init__(self, *args, **kwargs): + self._thread = None + self._socket = None + self._linestate = 0 + self._modemstate = None + self._modemstate_timeout = Timeout(-1) + self._remote_suspend_flow = False + self._write_lock = None + self.logger = None + self._ignore_set_control_answer = False + self._poll_modem_state = False + self._network_timeout = 3 + self._telnet_options = None + self._rfc2217_port_settings = None + self._rfc2217_options = None + self._read_buffer = None + super(Serial, self).__init__(*args, **kwargs) # must be last call in case of auto-open + + def open(self): + """\ + Open port with current settings. This may throw a SerialException + if the port cannot be opened. + """ + self.logger = None + self._ignore_set_control_answer = False + self._poll_modem_state = False + self._network_timeout = 3 + if self._port is None: + raise SerialException("Port must be configured before it can be used.") + if self.is_open: + raise SerialException("Port is already open.") + try: + self._socket = socket.create_connection(self.from_url(self.portstr), timeout=5) # XXX good value? + self._socket.setsockopt(socket.IPPROTO_TCP, socket.TCP_NODELAY, 1) + except Exception as msg: + self._socket = None + raise SerialException("Could not open port {}: {}".format(self.portstr, msg)) + + # use a thread save queue as buffer. it also simplifies implementing + # the read timeout + self._read_buffer = Queue.Queue() + # to ensure that user writes does not interfere with internal + # telnet/rfc2217 options establish a lock + self._write_lock = threading.Lock() + # name the following separately so that, below, a check can be easily done + mandadory_options = [ + TelnetOption(self, 'we-BINARY', BINARY, WILL, WONT, DO, DONT, INACTIVE), + TelnetOption(self, 'we-RFC2217', COM_PORT_OPTION, WILL, WONT, DO, DONT, REQUESTED), + ] + # all supported telnet options + self._telnet_options = [ + TelnetOption(self, 'ECHO', ECHO, DO, DONT, WILL, WONT, REQUESTED), + TelnetOption(self, 'we-SGA', SGA, WILL, WONT, DO, DONT, REQUESTED), + TelnetOption(self, 'they-SGA', SGA, DO, DONT, WILL, WONT, REQUESTED), + TelnetOption(self, 'they-BINARY', BINARY, DO, DONT, WILL, WONT, INACTIVE), + TelnetOption(self, 'they-RFC2217', COM_PORT_OPTION, DO, DONT, WILL, WONT, REQUESTED), + ] + mandadory_options + # RFC 2217 specific states + # COM port settings + self._rfc2217_port_settings = { + 'baudrate': TelnetSubnegotiation(self, 'baudrate', SET_BAUDRATE, SERVER_SET_BAUDRATE), + 'datasize': TelnetSubnegotiation(self, 'datasize', SET_DATASIZE, SERVER_SET_DATASIZE), + 'parity': TelnetSubnegotiation(self, 'parity', SET_PARITY, SERVER_SET_PARITY), + 'stopsize': TelnetSubnegotiation(self, 'stopsize', SET_STOPSIZE, SERVER_SET_STOPSIZE), + } + # There are more subnegotiation objects, combine all in one dictionary + # for easy access + self._rfc2217_options = { + 'purge': TelnetSubnegotiation(self, 'purge', PURGE_DATA, SERVER_PURGE_DATA), + 'control': TelnetSubnegotiation(self, 'control', SET_CONTROL, SERVER_SET_CONTROL), + } + self._rfc2217_options.update(self._rfc2217_port_settings) + # cache for line and modem states that the server sends to us + self._linestate = 0 + self._modemstate = None + self._modemstate_timeout = Timeout(-1) + # RFC 2217 flow control between server and client + self._remote_suspend_flow = False + + self.is_open = True + self._thread = threading.Thread(target=self._telnet_read_loop) + self._thread.setDaemon(True) + self._thread.setName('pySerial RFC 2217 reader thread for {}'.format(self._port)) + self._thread.start() + + try: # must clean-up if open fails + # negotiate Telnet/RFC 2217 -> send initial requests + for option in self._telnet_options: + if option.state is REQUESTED: + self.telnet_send_option(option.send_yes, option.option) + # now wait until important options are negotiated + timeout = Timeout(self._network_timeout) + while not timeout.expired(): + time.sleep(0.05) # prevent 100% CPU load + if sum(o.active for o in mandadory_options) == sum(o.state != INACTIVE for o in mandadory_options): + break + else: + raise SerialException( + "Remote does not seem to support RFC2217 or BINARY mode {!r}".format(mandadory_options)) + if self.logger: + self.logger.info("Negotiated options: {}".format(self._telnet_options)) + + # fine, go on, set RFC 2217 specific things + self._reconfigure_port() + # all things set up get, now a clean start + if not self._dsrdtr: + self._update_dtr_state() + if not self._rtscts: + self._update_rts_state() + self.reset_input_buffer() + self.reset_output_buffer() + except: + self.close() + raise + + def _reconfigure_port(self): + """Set communication parameters on opened port.""" + if self._socket is None: + raise SerialException("Can only operate on open ports") + + # if self._timeout != 0 and self._interCharTimeout is not None: + # XXX + + if self._write_timeout is not None: + raise NotImplementedError('write_timeout is currently not supported') + # XXX + + # Setup the connection + # to get good performance, all parameter changes are sent first... + if not 0 < self._baudrate < 2 ** 32: + raise ValueError("invalid baudrate: {!r}".format(self._baudrate)) + self._rfc2217_port_settings['baudrate'].set(struct.pack(b'!I', self._baudrate)) + self._rfc2217_port_settings['datasize'].set(struct.pack(b'!B', self._bytesize)) + self._rfc2217_port_settings['parity'].set(struct.pack(b'!B', RFC2217_PARITY_MAP[self._parity])) + self._rfc2217_port_settings['stopsize'].set(struct.pack(b'!B', RFC2217_STOPBIT_MAP[self._stopbits])) + + # and now wait until parameters are active + items = self._rfc2217_port_settings.values() + if self.logger: + self.logger.debug("Negotiating settings: {}".format(items)) + timeout = Timeout(self._network_timeout) + while not timeout.expired(): + time.sleep(0.05) # prevent 100% CPU load + if sum(o.active for o in items) == len(items): + break + else: + raise SerialException("Remote does not accept parameter change (RFC2217): {!r}".format(items)) + if self.logger: + self.logger.info("Negotiated settings: {}".format(items)) + + if self._rtscts and self._xonxoff: + raise ValueError('xonxoff and rtscts together are not supported') + elif self._rtscts: + self.rfc2217_set_control(SET_CONTROL_USE_HW_FLOW_CONTROL) + elif self._xonxoff: + self.rfc2217_set_control(SET_CONTROL_USE_SW_FLOW_CONTROL) + else: + self.rfc2217_set_control(SET_CONTROL_USE_NO_FLOW_CONTROL) + + def close(self): + """Close port""" + self.is_open = False + if self._socket: + try: + self._socket.shutdown(socket.SHUT_RDWR) + self._socket.close() + except: + # ignore errors. + pass + if self._thread: + self._thread.join(7) # XXX more than socket timeout + self._thread = None + # in case of quick reconnects, give the server some time + time.sleep(0.3) + self._socket = None + + def from_url(self, url): + """\ + extract host and port from an URL string, other settings are extracted + an stored in instance + """ + parts = urlparse.urlsplit(url) + if parts.scheme != "rfc2217": + raise SerialException( + 'expected a string in the form ' + '"rfc2217://:[?option[&option...]]": ' + 'not starting with rfc2217:// ({!r})'.format(parts.scheme)) + try: + # process options now, directly altering self + for option, values in urlparse.parse_qs(parts.query, True).items(): + if option == 'logging': + logging.basicConfig() # XXX is that good to call it here? + self.logger = logging.getLogger('pySerial.rfc2217') + self.logger.setLevel(LOGGER_LEVELS[values[0]]) + self.logger.debug('enabled logging') + elif option == 'ign_set_control': + self._ignore_set_control_answer = True + elif option == 'poll_modem': + self._poll_modem_state = True + elif option == 'timeout': + self._network_timeout = float(values[0]) + else: + raise ValueError('unknown option: {!r}'.format(option)) + if not 0 <= parts.port < 65536: + raise ValueError("port not in range 0...65535") + except ValueError as e: + raise SerialException( + 'expected a string in the form ' + '"rfc2217://:[?option[&option...]]": {}'.format(e)) + return (parts.hostname, parts.port) + + # - - - - - - - - - - - - - - - - - - - - - - - - + + @property + def in_waiting(self): + """Return the number of bytes currently in the input buffer.""" + if not self.is_open: + raise PortNotOpenError() + return self._read_buffer.qsize() + + def read(self, size=1): + """\ + Read size bytes from the serial port. If a timeout is set it may + return less characters as requested. With no timeout it will block + until the requested number of bytes is read. + """ + if not self.is_open: + raise PortNotOpenError() + data = bytearray() + try: + timeout = Timeout(self._timeout) + while len(data) < size: + if self._thread is None or not self._thread.is_alive(): + raise SerialException('connection failed (reader thread died)') + buf = self._read_buffer.get(True, timeout.time_left()) + if buf is None: + return bytes(data) + data += buf + if timeout.expired(): + break + except Queue.Empty: # -> timeout + pass + return bytes(data) + + def write(self, data): + """\ + Output the given byte string over the serial port. Can block if the + connection is blocked. May raise SerialException if the connection is + closed. + """ + if not self.is_open: + raise PortNotOpenError() + with self._write_lock: + try: + self._socket.sendall(to_bytes(data).replace(IAC, IAC_DOUBLED)) + except socket.error as e: + raise SerialException("connection failed (socket error): {}".format(e)) + return len(data) + + def reset_input_buffer(self): + """Clear input buffer, discarding all that is in the buffer.""" + if not self.is_open: + raise PortNotOpenError() + self.rfc2217_send_purge(PURGE_RECEIVE_BUFFER) + # empty read buffer + while self._read_buffer.qsize(): + self._read_buffer.get(False) + + def reset_output_buffer(self): + """\ + Clear output buffer, aborting the current output and + discarding all that is in the buffer. + """ + if not self.is_open: + raise PortNotOpenError() + self.rfc2217_send_purge(PURGE_TRANSMIT_BUFFER) + + def _update_break_state(self): + """\ + Set break: Controls TXD. When active, to transmitting is + possible. + """ + if not self.is_open: + raise PortNotOpenError() + if self.logger: + self.logger.info('set BREAK to {}'.format('active' if self._break_state else 'inactive')) + if self._break_state: + self.rfc2217_set_control(SET_CONTROL_BREAK_ON) + else: + self.rfc2217_set_control(SET_CONTROL_BREAK_OFF) + + def _update_rts_state(self): + """Set terminal status line: Request To Send.""" + if not self.is_open: + raise PortNotOpenError() + if self.logger: + self.logger.info('set RTS to {}'.format('active' if self._rts_state else 'inactive')) + if self._rts_state: + self.rfc2217_set_control(SET_CONTROL_RTS_ON) + else: + self.rfc2217_set_control(SET_CONTROL_RTS_OFF) + + def _update_dtr_state(self): + """Set terminal status line: Data Terminal Ready.""" + if not self.is_open: + raise PortNotOpenError() + if self.logger: + self.logger.info('set DTR to {}'.format('active' if self._dtr_state else 'inactive')) + if self._dtr_state: + self.rfc2217_set_control(SET_CONTROL_DTR_ON) + else: + self.rfc2217_set_control(SET_CONTROL_DTR_OFF) + + @property + def cts(self): + """Read terminal status line: Clear To Send.""" + if not self.is_open: + raise PortNotOpenError() + return bool(self.get_modem_state() & MODEMSTATE_MASK_CTS) + + @property + def dsr(self): + """Read terminal status line: Data Set Ready.""" + if not self.is_open: + raise PortNotOpenError() + return bool(self.get_modem_state() & MODEMSTATE_MASK_DSR) + + @property + def ri(self): + """Read terminal status line: Ring Indicator.""" + if not self.is_open: + raise PortNotOpenError() + return bool(self.get_modem_state() & MODEMSTATE_MASK_RI) + + @property + def cd(self): + """Read terminal status line: Carrier Detect.""" + if not self.is_open: + raise PortNotOpenError() + return bool(self.get_modem_state() & MODEMSTATE_MASK_CD) + + # - - - platform specific - - - + # None so far + + # - - - RFC2217 specific - - - + + def _telnet_read_loop(self): + """Read loop for the socket.""" + mode = M_NORMAL + suboption = None + try: + while self.is_open: + try: + data = self._socket.recv(1024) + except socket.timeout: + # just need to get out of recv form time to time to check if + # still alive + continue + except socket.error as e: + # connection fails -> terminate loop + if self.logger: + self.logger.debug("socket error in reader thread: {}".format(e)) + self._read_buffer.put(None) + break + if not data: + self._read_buffer.put(None) + break # lost connection + for byte in iterbytes(data): + if mode == M_NORMAL: + # interpret as command or as data + if byte == IAC: + mode = M_IAC_SEEN + else: + # store data in read buffer or sub option buffer + # depending on state + if suboption is not None: + suboption += byte + else: + self._read_buffer.put(byte) + elif mode == M_IAC_SEEN: + if byte == IAC: + # interpret as command doubled -> insert character + # itself + if suboption is not None: + suboption += IAC + else: + self._read_buffer.put(IAC) + mode = M_NORMAL + elif byte == SB: + # sub option start + suboption = bytearray() + mode = M_NORMAL + elif byte == SE: + # sub option end -> process it now + self._telnet_process_subnegotiation(bytes(suboption)) + suboption = None + mode = M_NORMAL + elif byte in (DO, DONT, WILL, WONT): + # negotiation + telnet_command = byte + mode = M_NEGOTIATE + else: + # other telnet commands + self._telnet_process_command(byte) + mode = M_NORMAL + elif mode == M_NEGOTIATE: # DO, DONT, WILL, WONT was received, option now following + self._telnet_negotiate_option(telnet_command, byte) + mode = M_NORMAL + finally: + if self.logger: + self.logger.debug("read thread terminated") + + # - incoming telnet commands and options + + def _telnet_process_command(self, command): + """Process commands other than DO, DONT, WILL, WONT.""" + # Currently none. RFC2217 only uses negotiation and subnegotiation. + if self.logger: + self.logger.warning("ignoring Telnet command: {!r}".format(command)) + + def _telnet_negotiate_option(self, command, option): + """Process incoming DO, DONT, WILL, WONT.""" + # check our registered telnet options and forward command to them + # they know themselves if they have to answer or not + known = False + for item in self._telnet_options: + # can have more than one match! as some options are duplicated for + # 'us' and 'them' + if item.option == option: + item.process_incoming(command) + known = True + if not known: + # handle unknown options + # only answer to positive requests and deny them + if command == WILL or command == DO: + self.telnet_send_option((DONT if command == WILL else WONT), option) + if self.logger: + self.logger.warning("rejected Telnet option: {!r}".format(option)) + + def _telnet_process_subnegotiation(self, suboption): + """Process subnegotiation, the data between IAC SB and IAC SE.""" + if suboption[0:1] == COM_PORT_OPTION: + if suboption[1:2] == SERVER_NOTIFY_LINESTATE and len(suboption) >= 3: + self._linestate = ord(suboption[2:3]) # ensure it is a number + if self.logger: + self.logger.info("NOTIFY_LINESTATE: {}".format(self._linestate)) + elif suboption[1:2] == SERVER_NOTIFY_MODEMSTATE and len(suboption) >= 3: + self._modemstate = ord(suboption[2:3]) # ensure it is a number + if self.logger: + self.logger.info("NOTIFY_MODEMSTATE: {}".format(self._modemstate)) + # update time when we think that a poll would make sense + self._modemstate_timeout.restart(0.3) + elif suboption[1:2] == FLOWCONTROL_SUSPEND: + self._remote_suspend_flow = True + elif suboption[1:2] == FLOWCONTROL_RESUME: + self._remote_suspend_flow = False + else: + for item in self._rfc2217_options.values(): + if item.ack_option == suboption[1:2]: + #~ print "processing COM_PORT_OPTION: %r" % list(suboption[1:]) + item.check_answer(bytes(suboption[2:])) + break + else: + if self.logger: + self.logger.warning("ignoring COM_PORT_OPTION: {!r}".format(suboption)) + else: + if self.logger: + self.logger.warning("ignoring subnegotiation: {!r}".format(suboption)) + + # - outgoing telnet commands and options + + def _internal_raw_write(self, data): + """internal socket write with no data escaping. used to send telnet stuff.""" + with self._write_lock: + self._socket.sendall(data) + + def telnet_send_option(self, action, option): + """Send DO, DONT, WILL, WONT.""" + self._internal_raw_write(IAC + action + option) + + def rfc2217_send_subnegotiation(self, option, value=b''): + """Subnegotiation of RFC2217 parameters.""" + value = value.replace(IAC, IAC_DOUBLED) + self._internal_raw_write(IAC + SB + COM_PORT_OPTION + option + value + IAC + SE) + + def rfc2217_send_purge(self, value): + """\ + Send purge request to the remote. + (PURGE_RECEIVE_BUFFER / PURGE_TRANSMIT_BUFFER / PURGE_BOTH_BUFFERS) + """ + item = self._rfc2217_options['purge'] + item.set(value) # transmit desired purge type + item.wait(self._network_timeout) # wait for acknowledge from the server + + def rfc2217_set_control(self, value): + """transmit change of control line to remote""" + item = self._rfc2217_options['control'] + item.set(value) # transmit desired control type + if self._ignore_set_control_answer: + # answers are ignored when option is set. compatibility mode for + # servers that answer, but not the expected one... (or no answer + # at all) i.e. sredird + time.sleep(0.1) # this helps getting the unit tests passed + else: + item.wait(self._network_timeout) # wait for acknowledge from the server + + def rfc2217_flow_server_ready(self): + """\ + check if server is ready to receive data. block for some time when + not. + """ + #~ if self._remote_suspend_flow: + #~ wait--- + + def get_modem_state(self): + """\ + get last modem state (cached value. If value is "old", request a new + one. This cache helps that we don't issue to many requests when e.g. all + status lines, one after the other is queried by the user (CTS, DSR + etc.) + """ + # active modem state polling enabled? is the value fresh enough? + if self._poll_modem_state and self._modemstate_timeout.expired(): + if self.logger: + self.logger.debug('polling modem state') + # when it is older, request an update + self.rfc2217_send_subnegotiation(NOTIFY_MODEMSTATE) + timeout = Timeout(self._network_timeout) + while not timeout.expired(): + time.sleep(0.05) # prevent 100% CPU load + # when expiration time is updated, it means that there is a new + # value + if not self._modemstate_timeout.expired(): + break + else: + if self.logger: + self.logger.warning('poll for modem state failed') + # even when there is a timeout, do not generate an error just + # return the last known value. this way we can support buggy + # servers that do not respond to polls, but send automatic + # updates. + if self._modemstate is not None: + if self.logger: + self.logger.debug('using cached modem state') + return self._modemstate + else: + # never received a notification from the server + raise SerialException("remote sends no NOTIFY_MODEMSTATE") + + +############################################################################# +# The following is code that helps implementing an RFC 2217 server. + +class PortManager(object): + """\ + This class manages the state of Telnet and RFC 2217. It needs a serial + instance and a connection to work with. Connection is expected to implement + a (thread safe) write function, that writes the string to the network. + """ + + def __init__(self, serial_port, connection, logger=None): + self.serial = serial_port + self.connection = connection + self.logger = logger + self._client_is_rfc2217 = False + + # filter state machine + self.mode = M_NORMAL + self.suboption = None + self.telnet_command = None + + # states for modem/line control events + self.modemstate_mask = 255 + self.last_modemstate = None + self.linstate_mask = 0 + + # all supported telnet options + self._telnet_options = [ + TelnetOption(self, 'ECHO', ECHO, WILL, WONT, DO, DONT, REQUESTED), + TelnetOption(self, 'we-SGA', SGA, WILL, WONT, DO, DONT, REQUESTED), + TelnetOption(self, 'they-SGA', SGA, DO, DONT, WILL, WONT, INACTIVE), + TelnetOption(self, 'we-BINARY', BINARY, WILL, WONT, DO, DONT, INACTIVE), + TelnetOption(self, 'they-BINARY', BINARY, DO, DONT, WILL, WONT, REQUESTED), + TelnetOption(self, 'we-RFC2217', COM_PORT_OPTION, WILL, WONT, DO, DONT, REQUESTED, self._client_ok), + TelnetOption(self, 'they-RFC2217', COM_PORT_OPTION, DO, DONT, WILL, WONT, INACTIVE, self._client_ok), + ] + + # negotiate Telnet/RFC2217 -> send initial requests + if self.logger: + self.logger.debug("requesting initial Telnet/RFC 2217 options") + for option in self._telnet_options: + if option.state is REQUESTED: + self.telnet_send_option(option.send_yes, option.option) + # issue 1st modem state notification + + def _client_ok(self): + """\ + callback of telnet option. It gets called when option is activated. + This one here is used to detect when the client agrees on RFC 2217. A + flag is set so that other functions like check_modem_lines know if the + client is OK. + """ + # The callback is used for we and they so if one party agrees, we're + # already happy. it seems not all servers do the negotiation correctly + # and i guess there are incorrect clients too.. so be happy if client + # answers one or the other positively. + self._client_is_rfc2217 = True + if self.logger: + self.logger.info("client accepts RFC 2217") + # this is to ensure that the client gets a notification, even if there + # was no change + self.check_modem_lines(force_notification=True) + + # - outgoing telnet commands and options + + def telnet_send_option(self, action, option): + """Send DO, DONT, WILL, WONT.""" + self.connection.write(IAC + action + option) + + def rfc2217_send_subnegotiation(self, option, value=b''): + """Subnegotiation of RFC 2217 parameters.""" + value = value.replace(IAC, IAC_DOUBLED) + self.connection.write(IAC + SB + COM_PORT_OPTION + option + value + IAC + SE) + + # - check modem lines, needs to be called periodically from user to + # establish polling + + def check_modem_lines(self, force_notification=False): + """\ + read control lines from serial port and compare the last value sent to remote. + send updates on changes. + """ + modemstate = ( + (self.serial.cts and MODEMSTATE_MASK_CTS) | + (self.serial.dsr and MODEMSTATE_MASK_DSR) | + (self.serial.ri and MODEMSTATE_MASK_RI) | + (self.serial.cd and MODEMSTATE_MASK_CD)) + # check what has changed + deltas = modemstate ^ (self.last_modemstate or 0) # when last is None -> 0 + if deltas & MODEMSTATE_MASK_CTS: + modemstate |= MODEMSTATE_MASK_CTS_CHANGE + if deltas & MODEMSTATE_MASK_DSR: + modemstate |= MODEMSTATE_MASK_DSR_CHANGE + if deltas & MODEMSTATE_MASK_RI: + modemstate |= MODEMSTATE_MASK_RI_CHANGE + if deltas & MODEMSTATE_MASK_CD: + modemstate |= MODEMSTATE_MASK_CD_CHANGE + # if new state is different and the mask allows this change, send + # notification. suppress notifications when client is not rfc2217 + if modemstate != self.last_modemstate or force_notification: + if (self._client_is_rfc2217 and (modemstate & self.modemstate_mask)) or force_notification: + self.rfc2217_send_subnegotiation( + SERVER_NOTIFY_MODEMSTATE, + to_bytes([modemstate & self.modemstate_mask])) + if self.logger: + self.logger.info("NOTIFY_MODEMSTATE: {}".format(modemstate)) + # save last state, but forget about deltas. + # otherwise it would also notify about changing deltas which is + # probably not very useful + self.last_modemstate = modemstate & 0xf0 + + # - outgoing data escaping + + def escape(self, data): + """\ + This generator function is for the user. All outgoing data has to be + properly escaped, so that no IAC character in the data stream messes up + the Telnet state machine in the server. + + socket.sendall(escape(data)) + """ + for byte in iterbytes(data): + if byte == IAC: + yield IAC + yield IAC + else: + yield byte + + # - incoming data filter + + def filter(self, data): + """\ + Handle a bunch of incoming bytes. This is a generator. It will yield + all characters not of interest for Telnet/RFC 2217. + + The idea is that the reader thread pushes data from the socket through + this filter: + + for byte in filter(socket.recv(1024)): + # do things like CR/LF conversion/whatever + # and write data to the serial port + serial.write(byte) + + (socket error handling code left as exercise for the reader) + """ + for byte in iterbytes(data): + if self.mode == M_NORMAL: + # interpret as command or as data + if byte == IAC: + self.mode = M_IAC_SEEN + else: + # store data in sub option buffer or pass it to our + # consumer depending on state + if self.suboption is not None: + self.suboption += byte + else: + yield byte + elif self.mode == M_IAC_SEEN: + if byte == IAC: + # interpret as command doubled -> insert character + # itself + if self.suboption is not None: + self.suboption += byte + else: + yield byte + self.mode = M_NORMAL + elif byte == SB: + # sub option start + self.suboption = bytearray() + self.mode = M_NORMAL + elif byte == SE: + # sub option end -> process it now + self._telnet_process_subnegotiation(bytes(self.suboption)) + self.suboption = None + self.mode = M_NORMAL + elif byte in (DO, DONT, WILL, WONT): + # negotiation + self.telnet_command = byte + self.mode = M_NEGOTIATE + else: + # other telnet commands + self._telnet_process_command(byte) + self.mode = M_NORMAL + elif self.mode == M_NEGOTIATE: # DO, DONT, WILL, WONT was received, option now following + self._telnet_negotiate_option(self.telnet_command, byte) + self.mode = M_NORMAL + + # - incoming telnet commands and options + + def _telnet_process_command(self, command): + """Process commands other than DO, DONT, WILL, WONT.""" + # Currently none. RFC2217 only uses negotiation and subnegotiation. + if self.logger: + self.logger.warning("ignoring Telnet command: {!r}".format(command)) + + def _telnet_negotiate_option(self, command, option): + """Process incoming DO, DONT, WILL, WONT.""" + # check our registered telnet options and forward command to them + # they know themselves if they have to answer or not + known = False + for item in self._telnet_options: + # can have more than one match! as some options are duplicated for + # 'us' and 'them' + if item.option == option: + item.process_incoming(command) + known = True + if not known: + # handle unknown options + # only answer to positive requests and deny them + if command == WILL or command == DO: + self.telnet_send_option((DONT if command == WILL else WONT), option) + if self.logger: + self.logger.warning("rejected Telnet option: {!r}".format(option)) + + def _telnet_process_subnegotiation(self, suboption): + """Process subnegotiation, the data between IAC SB and IAC SE.""" + if suboption[0:1] == COM_PORT_OPTION: + if self.logger: + self.logger.debug('received COM_PORT_OPTION: {!r}'.format(suboption)) + if suboption[1:2] == SET_BAUDRATE: + backup = self.serial.baudrate + try: + (baudrate,) = struct.unpack(b"!I", suboption[2:6]) + if baudrate != 0: + self.serial.baudrate = baudrate + except ValueError as e: + if self.logger: + self.logger.error("failed to set baud rate: {}".format(e)) + self.serial.baudrate = backup + else: + if self.logger: + self.logger.info("{} baud rate: {}".format('set' if baudrate else 'get', self.serial.baudrate)) + self.rfc2217_send_subnegotiation(SERVER_SET_BAUDRATE, struct.pack(b"!I", self.serial.baudrate)) + elif suboption[1:2] == SET_DATASIZE: + backup = self.serial.bytesize + try: + (datasize,) = struct.unpack(b"!B", suboption[2:3]) + if datasize != 0: + self.serial.bytesize = datasize + except ValueError as e: + if self.logger: + self.logger.error("failed to set data size: {}".format(e)) + self.serial.bytesize = backup + else: + if self.logger: + self.logger.info("{} data size: {}".format('set' if datasize else 'get', self.serial.bytesize)) + self.rfc2217_send_subnegotiation(SERVER_SET_DATASIZE, struct.pack(b"!B", self.serial.bytesize)) + elif suboption[1:2] == SET_PARITY: + backup = self.serial.parity + try: + parity = struct.unpack(b"!B", suboption[2:3])[0] + if parity != 0: + self.serial.parity = RFC2217_REVERSE_PARITY_MAP[parity] + except ValueError as e: + if self.logger: + self.logger.error("failed to set parity: {}".format(e)) + self.serial.parity = backup + else: + if self.logger: + self.logger.info("{} parity: {}".format('set' if parity else 'get', self.serial.parity)) + self.rfc2217_send_subnegotiation( + SERVER_SET_PARITY, + struct.pack(b"!B", RFC2217_PARITY_MAP[self.serial.parity])) + elif suboption[1:2] == SET_STOPSIZE: + backup = self.serial.stopbits + try: + stopbits = struct.unpack(b"!B", suboption[2:3])[0] + if stopbits != 0: + self.serial.stopbits = RFC2217_REVERSE_STOPBIT_MAP[stopbits] + except ValueError as e: + if self.logger: + self.logger.error("failed to set stop bits: {}".format(e)) + self.serial.stopbits = backup + else: + if self.logger: + self.logger.info("{} stop bits: {}".format('set' if stopbits else 'get', self.serial.stopbits)) + self.rfc2217_send_subnegotiation( + SERVER_SET_STOPSIZE, + struct.pack(b"!B", RFC2217_STOPBIT_MAP[self.serial.stopbits])) + elif suboption[1:2] == SET_CONTROL: + if suboption[2:3] == SET_CONTROL_REQ_FLOW_SETTING: + if self.serial.xonxoff: + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_USE_SW_FLOW_CONTROL) + elif self.serial.rtscts: + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_USE_HW_FLOW_CONTROL) + else: + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_USE_NO_FLOW_CONTROL) + elif suboption[2:3] == SET_CONTROL_USE_NO_FLOW_CONTROL: + self.serial.xonxoff = False + self.serial.rtscts = False + if self.logger: + self.logger.info("changed flow control to None") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_USE_NO_FLOW_CONTROL) + elif suboption[2:3] == SET_CONTROL_USE_SW_FLOW_CONTROL: + self.serial.xonxoff = True + if self.logger: + self.logger.info("changed flow control to XON/XOFF") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_USE_SW_FLOW_CONTROL) + elif suboption[2:3] == SET_CONTROL_USE_HW_FLOW_CONTROL: + self.serial.rtscts = True + if self.logger: + self.logger.info("changed flow control to RTS/CTS") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_USE_HW_FLOW_CONTROL) + elif suboption[2:3] == SET_CONTROL_REQ_BREAK_STATE: + if self.logger: + self.logger.warning("requested break state - not implemented") + pass # XXX needs cached value + elif suboption[2:3] == SET_CONTROL_BREAK_ON: + self.serial.break_condition = True + if self.logger: + self.logger.info("changed BREAK to active") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_BREAK_ON) + elif suboption[2:3] == SET_CONTROL_BREAK_OFF: + self.serial.break_condition = False + if self.logger: + self.logger.info("changed BREAK to inactive") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_BREAK_OFF) + elif suboption[2:3] == SET_CONTROL_REQ_DTR: + if self.logger: + self.logger.warning("requested DTR state - not implemented") + pass # XXX needs cached value + elif suboption[2:3] == SET_CONTROL_DTR_ON: + self.serial.dtr = True + if self.logger: + self.logger.info("changed DTR to active") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_DTR_ON) + elif suboption[2:3] == SET_CONTROL_DTR_OFF: + self.serial.dtr = False + if self.logger: + self.logger.info("changed DTR to inactive") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_DTR_OFF) + elif suboption[2:3] == SET_CONTROL_REQ_RTS: + if self.logger: + self.logger.warning("requested RTS state - not implemented") + pass # XXX needs cached value + #~ self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_RTS_ON) + elif suboption[2:3] == SET_CONTROL_RTS_ON: + self.serial.rts = True + if self.logger: + self.logger.info("changed RTS to active") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_RTS_ON) + elif suboption[2:3] == SET_CONTROL_RTS_OFF: + self.serial.rts = False + if self.logger: + self.logger.info("changed RTS to inactive") + self.rfc2217_send_subnegotiation(SERVER_SET_CONTROL, SET_CONTROL_RTS_OFF) + #~ elif suboption[2:3] == SET_CONTROL_REQ_FLOW_SETTING_IN: + #~ elif suboption[2:3] == SET_CONTROL_USE_NO_FLOW_CONTROL_IN: + #~ elif suboption[2:3] == SET_CONTROL_USE_SW_FLOW_CONTOL_IN: + #~ elif suboption[2:3] == SET_CONTROL_USE_HW_FLOW_CONTOL_IN: + #~ elif suboption[2:3] == SET_CONTROL_USE_DCD_FLOW_CONTROL: + #~ elif suboption[2:3] == SET_CONTROL_USE_DTR_FLOW_CONTROL: + #~ elif suboption[2:3] == SET_CONTROL_USE_DSR_FLOW_CONTROL: + elif suboption[1:2] == NOTIFY_LINESTATE: + # client polls for current state + self.rfc2217_send_subnegotiation( + SERVER_NOTIFY_LINESTATE, + to_bytes([0])) # sorry, nothing like that implemented + elif suboption[1:2] == NOTIFY_MODEMSTATE: + if self.logger: + self.logger.info("request for modem state") + # client polls for current state + self.check_modem_lines(force_notification=True) + elif suboption[1:2] == FLOWCONTROL_SUSPEND: + if self.logger: + self.logger.info("suspend") + self._remote_suspend_flow = True + elif suboption[1:2] == FLOWCONTROL_RESUME: + if self.logger: + self.logger.info("resume") + self._remote_suspend_flow = False + elif suboption[1:2] == SET_LINESTATE_MASK: + self.linstate_mask = ord(suboption[2:3]) # ensure it is a number + if self.logger: + self.logger.info("line state mask: 0x{:02x}".format(self.linstate_mask)) + elif suboption[1:2] == SET_MODEMSTATE_MASK: + self.modemstate_mask = ord(suboption[2:3]) # ensure it is a number + if self.logger: + self.logger.info("modem state mask: 0x{:02x}".format(self.modemstate_mask)) + elif suboption[1:2] == PURGE_DATA: + if suboption[2:3] == PURGE_RECEIVE_BUFFER: + self.serial.reset_input_buffer() + if self.logger: + self.logger.info("purge in") + self.rfc2217_send_subnegotiation(SERVER_PURGE_DATA, PURGE_RECEIVE_BUFFER) + elif suboption[2:3] == PURGE_TRANSMIT_BUFFER: + self.serial.reset_output_buffer() + if self.logger: + self.logger.info("purge out") + self.rfc2217_send_subnegotiation(SERVER_PURGE_DATA, PURGE_TRANSMIT_BUFFER) + elif suboption[2:3] == PURGE_BOTH_BUFFERS: + self.serial.reset_input_buffer() + self.serial.reset_output_buffer() + if self.logger: + self.logger.info("purge both") + self.rfc2217_send_subnegotiation(SERVER_PURGE_DATA, PURGE_BOTH_BUFFERS) + else: + if self.logger: + self.logger.error("undefined PURGE_DATA: {!r}".format(list(suboption[2:]))) + else: + if self.logger: + self.logger.error("undefined COM_PORT_OPTION: {!r}".format(list(suboption[1:]))) + else: + if self.logger: + self.logger.warning("unknown subnegotiation: {!r}".format(suboption)) + + +# simple client test +if __name__ == '__main__': + import sys + s = Serial('rfc2217://localhost:7000', 115200) + sys.stdout.write('{}\n'.format(s)) + + sys.stdout.write("write...\n") + s.write(b"hello\n") + s.flush() + sys.stdout.write("read: {}\n".format(s.read(5))) + s.close() diff --git a/extensions/km-plot/deps/serial/rs485.py b/extensions/km-plot/deps/serial/rs485.py new file mode 100644 index 0000000..d7aff6f --- /dev/null +++ b/extensions/km-plot/deps/serial/rs485.py @@ -0,0 +1,94 @@ +#!/usr/bin/env python + +# RS485 support +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +"""\ +The settings for RS485 are stored in a dedicated object that can be applied to +serial ports (where supported). +NOTE: Some implementations may only support a subset of the settings. +""" + +from __future__ import absolute_import + +import time +import serial + + +class RS485Settings(object): + def __init__( + self, + rts_level_for_tx=True, + rts_level_for_rx=False, + loopback=False, + delay_before_tx=None, + delay_before_rx=None): + self.rts_level_for_tx = rts_level_for_tx + self.rts_level_for_rx = rts_level_for_rx + self.loopback = loopback + self.delay_before_tx = delay_before_tx + self.delay_before_rx = delay_before_rx + + +class RS485(serial.Serial): + """\ + A subclass that replaces the write method with one that toggles RTS + according to the RS485 settings. + + NOTE: This may work unreliably on some serial ports (control signals not + synchronized or delayed compared to data). Using delays may be + unreliable (varying times, larger than expected) as the OS may not + support very fine grained delays (no smaller than in the order of + tens of milliseconds). + + NOTE: Some implementations support this natively. Better performance + can be expected when the native version is used. + + NOTE: The loopback property is ignored by this implementation. The actual + behavior depends on the used hardware. + + Usage: + + ser = RS485(...) + ser.rs485_mode = RS485Settings(...) + ser.write(b'hello') + """ + + def __init__(self, *args, **kwargs): + super(RS485, self).__init__(*args, **kwargs) + self._alternate_rs485_settings = None + + def write(self, b): + """Write to port, controlling RTS before and after transmitting.""" + if self._alternate_rs485_settings is not None: + # apply level for TX and optional delay + self.setRTS(self._alternate_rs485_settings.rts_level_for_tx) + if self._alternate_rs485_settings.delay_before_tx is not None: + time.sleep(self._alternate_rs485_settings.delay_before_tx) + # write and wait for data to be written + super(RS485, self).write(b) + super(RS485, self).flush() + # optional delay and apply level for RX + if self._alternate_rs485_settings.delay_before_rx is not None: + time.sleep(self._alternate_rs485_settings.delay_before_rx) + self.setRTS(self._alternate_rs485_settings.rts_level_for_rx) + else: + super(RS485, self).write(b) + + # redirect where the property stores the settings so that underlying Serial + # instance does not see them + @property + def rs485_mode(self): + """\ + Enable RS485 mode and apply new settings, set to None to disable. + See serial.rs485.RS485Settings for more info about the value. + """ + return self._alternate_rs485_settings + + @rs485_mode.setter + def rs485_mode(self, rs485_settings): + self._alternate_rs485_settings = rs485_settings diff --git a/extensions/km-plot/deps/serial/serialcli.py b/extensions/km-plot/deps/serial/serialcli.py new file mode 100644 index 0000000..4614736 --- /dev/null +++ b/extensions/km-plot/deps/serial/serialcli.py @@ -0,0 +1,253 @@ +#! python +# +# Backend for .NET/Mono (IronPython), .NET >= 2 +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2008-2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +import System +import System.IO.Ports +from serial.serialutil import * + +# must invoke function with byte array, make a helper to convert strings +# to byte arrays +sab = System.Array[System.Byte] + + +def as_byte_array(string): + return sab([ord(x) for x in string]) # XXX will require adaption when run with a 3.x compatible IronPython + + +class Serial(SerialBase): + """Serial port implementation for .NET/Mono.""" + + BAUDRATES = (50, 75, 110, 134, 150, 200, 300, 600, 1200, 1800, 2400, 4800, + 9600, 19200, 38400, 57600, 115200) + + def open(self): + """\ + Open port with current settings. This may throw a SerialException + if the port cannot be opened. + """ + if self._port is None: + raise SerialException("Port must be configured before it can be used.") + if self.is_open: + raise SerialException("Port is already open.") + try: + self._port_handle = System.IO.Ports.SerialPort(self.portstr) + except Exception as msg: + self._port_handle = None + raise SerialException("could not open port %s: %s" % (self.portstr, msg)) + + # if RTS and/or DTR are not set before open, they default to True + if self._rts_state is None: + self._rts_state = True + if self._dtr_state is None: + self._dtr_state = True + + self._reconfigure_port() + self._port_handle.Open() + self.is_open = True + if not self._dsrdtr: + self._update_dtr_state() + if not self._rtscts: + self._update_rts_state() + self.reset_input_buffer() + + def _reconfigure_port(self): + """Set communication parameters on opened port.""" + if not self._port_handle: + raise SerialException("Can only operate on a valid port handle") + + #~ self._port_handle.ReceivedBytesThreshold = 1 + + if self._timeout is None: + self._port_handle.ReadTimeout = System.IO.Ports.SerialPort.InfiniteTimeout + else: + self._port_handle.ReadTimeout = int(self._timeout * 1000) + + # if self._timeout != 0 and self._interCharTimeout is not None: + # timeouts = (int(self._interCharTimeout * 1000),) + timeouts[1:] + + if self._write_timeout is None: + self._port_handle.WriteTimeout = System.IO.Ports.SerialPort.InfiniteTimeout + else: + self._port_handle.WriteTimeout = int(self._write_timeout * 1000) + + # Setup the connection info. + try: + self._port_handle.BaudRate = self._baudrate + except IOError as e: + # catch errors from illegal baudrate settings + raise ValueError(str(e)) + + if self._bytesize == FIVEBITS: + self._port_handle.DataBits = 5 + elif self._bytesize == SIXBITS: + self._port_handle.DataBits = 6 + elif self._bytesize == SEVENBITS: + self._port_handle.DataBits = 7 + elif self._bytesize == EIGHTBITS: + self._port_handle.DataBits = 8 + else: + raise ValueError("Unsupported number of data bits: %r" % self._bytesize) + + if self._parity == PARITY_NONE: + self._port_handle.Parity = getattr(System.IO.Ports.Parity, 'None') # reserved keyword in Py3k + elif self._parity == PARITY_EVEN: + self._port_handle.Parity = System.IO.Ports.Parity.Even + elif self._parity == PARITY_ODD: + self._port_handle.Parity = System.IO.Ports.Parity.Odd + elif self._parity == PARITY_MARK: + self._port_handle.Parity = System.IO.Ports.Parity.Mark + elif self._parity == PARITY_SPACE: + self._port_handle.Parity = System.IO.Ports.Parity.Space + else: + raise ValueError("Unsupported parity mode: %r" % self._parity) + + if self._stopbits == STOPBITS_ONE: + self._port_handle.StopBits = System.IO.Ports.StopBits.One + elif self._stopbits == STOPBITS_ONE_POINT_FIVE: + self._port_handle.StopBits = System.IO.Ports.StopBits.OnePointFive + elif self._stopbits == STOPBITS_TWO: + self._port_handle.StopBits = System.IO.Ports.StopBits.Two + else: + raise ValueError("Unsupported number of stop bits: %r" % self._stopbits) + + if self._rtscts and self._xonxoff: + self._port_handle.Handshake = System.IO.Ports.Handshake.RequestToSendXOnXOff + elif self._rtscts: + self._port_handle.Handshake = System.IO.Ports.Handshake.RequestToSend + elif self._xonxoff: + self._port_handle.Handshake = System.IO.Ports.Handshake.XOnXOff + else: + self._port_handle.Handshake = getattr(System.IO.Ports.Handshake, 'None') # reserved keyword in Py3k + + #~ def __del__(self): + #~ self.close() + + def close(self): + """Close port""" + if self.is_open: + if self._port_handle: + try: + self._port_handle.Close() + except System.IO.Ports.InvalidOperationException: + # ignore errors. can happen for unplugged USB serial devices + pass + self._port_handle = None + self.is_open = False + + # - - - - - - - - - - - - - - - - - - - - - - - - + + @property + def in_waiting(self): + """Return the number of characters currently in the input buffer.""" + if not self.is_open: + raise PortNotOpenError() + return self._port_handle.BytesToRead + + def read(self, size=1): + """\ + Read size bytes from the serial port. If a timeout is set it may + return less characters as requested. With no timeout it will block + until the requested number of bytes is read. + """ + if not self.is_open: + raise PortNotOpenError() + # must use single byte reads as this is the only way to read + # without applying encodings + data = bytearray() + while size: + try: + data.append(self._port_handle.ReadByte()) + except System.TimeoutException: + break + else: + size -= 1 + return bytes(data) + + def write(self, data): + """Output the given string over the serial port.""" + if not self.is_open: + raise PortNotOpenError() + #~ if not isinstance(data, (bytes, bytearray)): + #~ raise TypeError('expected %s or bytearray, got %s' % (bytes, type(data))) + try: + # must call overloaded method with byte array argument + # as this is the only one not applying encodings + self._port_handle.Write(as_byte_array(data), 0, len(data)) + except System.TimeoutException: + raise SerialTimeoutException('Write timeout') + return len(data) + + def reset_input_buffer(self): + """Clear input buffer, discarding all that is in the buffer.""" + if not self.is_open: + raise PortNotOpenError() + self._port_handle.DiscardInBuffer() + + def reset_output_buffer(self): + """\ + Clear output buffer, aborting the current output and + discarding all that is in the buffer. + """ + if not self.is_open: + raise PortNotOpenError() + self._port_handle.DiscardOutBuffer() + + def _update_break_state(self): + """ + Set break: Controls TXD. When active, to transmitting is possible. + """ + if not self.is_open: + raise PortNotOpenError() + self._port_handle.BreakState = bool(self._break_state) + + def _update_rts_state(self): + """Set terminal status line: Request To Send""" + if not self.is_open: + raise PortNotOpenError() + self._port_handle.RtsEnable = bool(self._rts_state) + + def _update_dtr_state(self): + """Set terminal status line: Data Terminal Ready""" + if not self.is_open: + raise PortNotOpenError() + self._port_handle.DtrEnable = bool(self._dtr_state) + + @property + def cts(self): + """Read terminal status line: Clear To Send""" + if not self.is_open: + raise PortNotOpenError() + return self._port_handle.CtsHolding + + @property + def dsr(self): + """Read terminal status line: Data Set Ready""" + if not self.is_open: + raise PortNotOpenError() + return self._port_handle.DsrHolding + + @property + def ri(self): + """Read terminal status line: Ring Indicator""" + if not self.is_open: + raise PortNotOpenError() + #~ return self._port_handle.XXX + return False # XXX an error would be better + + @property + def cd(self): + """Read terminal status line: Carrier Detect""" + if not self.is_open: + raise PortNotOpenError() + return self._port_handle.CDHolding + + # - - platform specific - - - - + # none diff --git a/extensions/km-plot/deps/serial/serialjava.py b/extensions/km-plot/deps/serial/serialjava.py new file mode 100644 index 0000000..0789a78 --- /dev/null +++ b/extensions/km-plot/deps/serial/serialjava.py @@ -0,0 +1,251 @@ +#!jython +# +# Backend Jython with JavaComm +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2002-2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +from serial.serialutil import * + + +def my_import(name): + mod = __import__(name) + components = name.split('.') + for comp in components[1:]: + mod = getattr(mod, comp) + return mod + + +def detect_java_comm(names): + """try given list of modules and return that imports""" + for name in names: + try: + mod = my_import(name) + mod.SerialPort + return mod + except (ImportError, AttributeError): + pass + raise ImportError("No Java Communications API implementation found") + + +# Java Communications API implementations +# http://mho.republika.pl/java/comm/ + +comm = detect_java_comm([ + 'javax.comm', # Sun/IBM + 'gnu.io', # RXTX +]) + + +def device(portnumber): + """Turn a port number into a device name""" + enum = comm.CommPortIdentifier.getPortIdentifiers() + ports = [] + while enum.hasMoreElements(): + el = enum.nextElement() + if el.getPortType() == comm.CommPortIdentifier.PORT_SERIAL: + ports.append(el) + return ports[portnumber].getName() + + +class Serial(SerialBase): + """\ + Serial port class, implemented with Java Communications API and + thus usable with jython and the appropriate java extension. + """ + + def open(self): + """\ + Open port with current settings. This may throw a SerialException + if the port cannot be opened. + """ + if self._port is None: + raise SerialException("Port must be configured before it can be used.") + if self.is_open: + raise SerialException("Port is already open.") + if type(self._port) == type(''): # strings are taken directly + portId = comm.CommPortIdentifier.getPortIdentifier(self._port) + else: + portId = comm.CommPortIdentifier.getPortIdentifier(device(self._port)) # numbers are transformed to a comport id obj + try: + self.sPort = portId.open("python serial module", 10) + except Exception as msg: + self.sPort = None + raise SerialException("Could not open port: %s" % msg) + self._reconfigurePort() + self._instream = self.sPort.getInputStream() + self._outstream = self.sPort.getOutputStream() + self.is_open = True + + def _reconfigurePort(self): + """Set communication parameters on opened port.""" + if not self.sPort: + raise SerialException("Can only operate on a valid port handle") + + self.sPort.enableReceiveTimeout(30) + if self._bytesize == FIVEBITS: + jdatabits = comm.SerialPort.DATABITS_5 + elif self._bytesize == SIXBITS: + jdatabits = comm.SerialPort.DATABITS_6 + elif self._bytesize == SEVENBITS: + jdatabits = comm.SerialPort.DATABITS_7 + elif self._bytesize == EIGHTBITS: + jdatabits = comm.SerialPort.DATABITS_8 + else: + raise ValueError("unsupported bytesize: %r" % self._bytesize) + + if self._stopbits == STOPBITS_ONE: + jstopbits = comm.SerialPort.STOPBITS_1 + elif self._stopbits == STOPBITS_ONE_POINT_FIVE: + jstopbits = comm.SerialPort.STOPBITS_1_5 + elif self._stopbits == STOPBITS_TWO: + jstopbits = comm.SerialPort.STOPBITS_2 + else: + raise ValueError("unsupported number of stopbits: %r" % self._stopbits) + + if self._parity == PARITY_NONE: + jparity = comm.SerialPort.PARITY_NONE + elif self._parity == PARITY_EVEN: + jparity = comm.SerialPort.PARITY_EVEN + elif self._parity == PARITY_ODD: + jparity = comm.SerialPort.PARITY_ODD + elif self._parity == PARITY_MARK: + jparity = comm.SerialPort.PARITY_MARK + elif self._parity == PARITY_SPACE: + jparity = comm.SerialPort.PARITY_SPACE + else: + raise ValueError("unsupported parity type: %r" % self._parity) + + jflowin = jflowout = 0 + if self._rtscts: + jflowin |= comm.SerialPort.FLOWCONTROL_RTSCTS_IN + jflowout |= comm.SerialPort.FLOWCONTROL_RTSCTS_OUT + if self._xonxoff: + jflowin |= comm.SerialPort.FLOWCONTROL_XONXOFF_IN + jflowout |= comm.SerialPort.FLOWCONTROL_XONXOFF_OUT + + self.sPort.setSerialPortParams(self._baudrate, jdatabits, jstopbits, jparity) + self.sPort.setFlowControlMode(jflowin | jflowout) + + if self._timeout >= 0: + self.sPort.enableReceiveTimeout(int(self._timeout*1000)) + else: + self.sPort.disableReceiveTimeout() + + def close(self): + """Close port""" + if self.is_open: + if self.sPort: + self._instream.close() + self._outstream.close() + self.sPort.close() + self.sPort = None + self.is_open = False + + # - - - - - - - - - - - - - - - - - - - - - - - - + + @property + def in_waiting(self): + """Return the number of characters currently in the input buffer.""" + if not self.sPort: + raise PortNotOpenError() + return self._instream.available() + + def read(self, size=1): + """\ + Read size bytes from the serial port. If a timeout is set it may + return less characters as requested. With no timeout it will block + until the requested number of bytes is read. + """ + if not self.sPort: + raise PortNotOpenError() + read = bytearray() + if size > 0: + while len(read) < size: + x = self._instream.read() + if x == -1: + if self.timeout >= 0: + break + else: + read.append(x) + return bytes(read) + + def write(self, data): + """Output the given string over the serial port.""" + if not self.sPort: + raise PortNotOpenError() + if not isinstance(data, (bytes, bytearray)): + raise TypeError('expected %s or bytearray, got %s' % (bytes, type(data))) + self._outstream.write(data) + return len(data) + + def reset_input_buffer(self): + """Clear input buffer, discarding all that is in the buffer.""" + if not self.sPort: + raise PortNotOpenError() + self._instream.skip(self._instream.available()) + + def reset_output_buffer(self): + """\ + Clear output buffer, aborting the current output and + discarding all that is in the buffer. + """ + if not self.sPort: + raise PortNotOpenError() + self._outstream.flush() + + def send_break(self, duration=0.25): + """Send break condition. Timed, returns to idle state after given duration.""" + if not self.sPort: + raise PortNotOpenError() + self.sPort.sendBreak(duration*1000.0) + + def _update_break_state(self): + """Set break: Controls TXD. When active, to transmitting is possible.""" + if self.fd is None: + raise PortNotOpenError() + raise SerialException("The _update_break_state function is not implemented in java.") + + def _update_rts_state(self): + """Set terminal status line: Request To Send""" + if not self.sPort: + raise PortNotOpenError() + self.sPort.setRTS(self._rts_state) + + def _update_dtr_state(self): + """Set terminal status line: Data Terminal Ready""" + if not self.sPort: + raise PortNotOpenError() + self.sPort.setDTR(self._dtr_state) + + @property + def cts(self): + """Read terminal status line: Clear To Send""" + if not self.sPort: + raise PortNotOpenError() + self.sPort.isCTS() + + @property + def dsr(self): + """Read terminal status line: Data Set Ready""" + if not self.sPort: + raise PortNotOpenError() + self.sPort.isDSR() + + @property + def ri(self): + """Read terminal status line: Ring Indicator""" + if not self.sPort: + raise PortNotOpenError() + self.sPort.isRI() + + @property + def cd(self): + """Read terminal status line: Carrier Detect""" + if not self.sPort: + raise PortNotOpenError() + self.sPort.isCD() diff --git a/extensions/km-plot/deps/serial/serialposix.py b/extensions/km-plot/deps/serial/serialposix.py new file mode 100644 index 0000000..7aceb76 --- /dev/null +++ b/extensions/km-plot/deps/serial/serialposix.py @@ -0,0 +1,900 @@ +#!/usr/bin/env python +# +# backend for serial IO for POSIX compatible systems, like Linux, OSX +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2001-2020 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause +# +# parts based on code from Grant B. Edwards : +# ftp://ftp.visi.com/users/grante/python/PosixSerial.py +# +# references: http://www.easysw.com/~mike/serial/serial.html + +# Collection of port names (was previously used by number_to_device which was +# removed. +# - Linux /dev/ttyS%d (confirmed) +# - cygwin/win32 /dev/com%d (confirmed) +# - openbsd (OpenBSD) /dev/cua%02d +# - bsd*, freebsd* /dev/cuad%d +# - darwin (OS X) /dev/cuad%d +# - netbsd /dev/dty%02d (NetBSD 1.6 testing by Erk) +# - irix (IRIX) /dev/ttyf%d (partially tested) names depending on flow control +# - hp (HP-UX) /dev/tty%dp0 (not tested) +# - sunos (Solaris/SunOS) /dev/tty%c (letters, 'a'..'z') (confirmed) +# - aix (AIX) /dev/tty%d + + +from __future__ import absolute_import + +# pylint: disable=abstract-method +import errno +import fcntl +import os +import select +import struct +import sys +import termios + +import serial +from serial.serialutil import SerialBase, SerialException, to_bytes, \ + PortNotOpenError, SerialTimeoutException, Timeout + + +class PlatformSpecificBase(object): + BAUDRATE_CONSTANTS = {} + + def _set_special_baudrate(self, baudrate): + raise NotImplementedError('non-standard baudrates are not supported on this platform') + + def _set_rs485_mode(self, rs485_settings): + raise NotImplementedError('RS485 not supported on this platform') + + def set_low_latency_mode(self, low_latency_settings): + raise NotImplementedError('Low latency not supported on this platform') + + def _update_break_state(self): + """\ + Set break: Controls TXD. When active, no transmitting is possible. + """ + if self._break_state: + fcntl.ioctl(self.fd, TIOCSBRK) + else: + fcntl.ioctl(self.fd, TIOCCBRK) + + +# some systems support an extra flag to enable the two in POSIX unsupported +# paritiy settings for MARK and SPACE +CMSPAR = 0 # default, for unsupported platforms, override below + +# try to detect the OS so that a device can be selected... +# this code block should supply a device() and set_special_baudrate() function +# for the platform +plat = sys.platform.lower() + +if plat[:5] == 'linux': # Linux (confirmed) # noqa + import array + + # extra termios flags + CMSPAR = 0o10000000000 # Use "stick" (mark/space) parity + + # baudrate ioctls + TCGETS2 = 0x802C542A + TCSETS2 = 0x402C542B + BOTHER = 0o010000 + + # RS485 ioctls + TIOCGRS485 = 0x542E + TIOCSRS485 = 0x542F + SER_RS485_ENABLED = 0b00000001 + SER_RS485_RTS_ON_SEND = 0b00000010 + SER_RS485_RTS_AFTER_SEND = 0b00000100 + SER_RS485_RX_DURING_TX = 0b00010000 + + class PlatformSpecific(PlatformSpecificBase): + BAUDRATE_CONSTANTS = { + 0: 0o000000, # hang up + 50: 0o000001, + 75: 0o000002, + 110: 0o000003, + 134: 0o000004, + 150: 0o000005, + 200: 0o000006, + 300: 0o000007, + 600: 0o000010, + 1200: 0o000011, + 1800: 0o000012, + 2400: 0o000013, + 4800: 0o000014, + 9600: 0o000015, + 19200: 0o000016, + 38400: 0o000017, + 57600: 0o010001, + 115200: 0o010002, + 230400: 0o010003, + 460800: 0o010004, + 500000: 0o010005, + 576000: 0o010006, + 921600: 0o010007, + 1000000: 0o010010, + 1152000: 0o010011, + 1500000: 0o010012, + 2000000: 0o010013, + 2500000: 0o010014, + 3000000: 0o010015, + 3500000: 0o010016, + 4000000: 0o010017 + } + + def set_low_latency_mode(self, low_latency_settings): + buf = array.array('i', [0] * 32) + + try: + # get serial_struct + fcntl.ioctl(self.fd, termios.TIOCGSERIAL, buf) + + # set or unset ASYNC_LOW_LATENCY flag + if low_latency_settings: + buf[4] |= 0x2000 + else: + buf[4] &= ~0x2000 + + # set serial_struct + fcntl.ioctl(self.fd, termios.TIOCSSERIAL, buf) + except IOError as e: + raise ValueError('Failed to update ASYNC_LOW_LATENCY flag to {}: {}'.format(low_latency_settings, e)) + + def _set_special_baudrate(self, baudrate): + # right size is 44 on x86_64, allow for some growth + buf = array.array('i', [0] * 64) + try: + # get serial_struct + fcntl.ioctl(self.fd, TCGETS2, buf) + # set custom speed + buf[2] &= ~termios.CBAUD + buf[2] |= BOTHER + buf[9] = buf[10] = baudrate + + # set serial_struct + fcntl.ioctl(self.fd, TCSETS2, buf) + except IOError as e: + raise ValueError('Failed to set custom baud rate ({}): {}'.format(baudrate, e)) + + def _set_rs485_mode(self, rs485_settings): + buf = array.array('i', [0] * 8) # flags, delaytx, delayrx, padding + try: + fcntl.ioctl(self.fd, TIOCGRS485, buf) + buf[0] |= SER_RS485_ENABLED + if rs485_settings is not None: + if rs485_settings.loopback: + buf[0] |= SER_RS485_RX_DURING_TX + else: + buf[0] &= ~SER_RS485_RX_DURING_TX + if rs485_settings.rts_level_for_tx: + buf[0] |= SER_RS485_RTS_ON_SEND + else: + buf[0] &= ~SER_RS485_RTS_ON_SEND + if rs485_settings.rts_level_for_rx: + buf[0] |= SER_RS485_RTS_AFTER_SEND + else: + buf[0] &= ~SER_RS485_RTS_AFTER_SEND + if rs485_settings.delay_before_tx is not None: + buf[1] = int(rs485_settings.delay_before_tx * 1000) + if rs485_settings.delay_before_rx is not None: + buf[2] = int(rs485_settings.delay_before_rx * 1000) + else: + buf[0] = 0 # clear SER_RS485_ENABLED + fcntl.ioctl(self.fd, TIOCSRS485, buf) + except IOError as e: + raise ValueError('Failed to set RS485 mode: {}'.format(e)) + + +elif plat == 'cygwin': # cygwin/win32 (confirmed) + + class PlatformSpecific(PlatformSpecificBase): + BAUDRATE_CONSTANTS = { + 128000: 0x01003, + 256000: 0x01005, + 500000: 0x01007, + 576000: 0x01008, + 921600: 0x01009, + 1000000: 0x0100a, + 1152000: 0x0100b, + 1500000: 0x0100c, + 2000000: 0x0100d, + 2500000: 0x0100e, + 3000000: 0x0100f + } + + +elif plat[:6] == 'darwin': # OS X + import array + IOSSIOSPEED = 0x80045402 # _IOW('T', 2, speed_t) + + class PlatformSpecific(PlatformSpecificBase): + osx_version = os.uname()[2].split('.') + TIOCSBRK = 0x2000747B # _IO('t', 123) + TIOCCBRK = 0x2000747A # _IO('t', 122) + + # Tiger or above can support arbitrary serial speeds + if int(osx_version[0]) >= 8: + def _set_special_baudrate(self, baudrate): + # use IOKit-specific call to set up high speeds + buf = array.array('i', [baudrate]) + fcntl.ioctl(self.fd, IOSSIOSPEED, buf, 1) + + def _update_break_state(self): + """\ + Set break: Controls TXD. When active, no transmitting is possible. + """ + if self._break_state: + fcntl.ioctl(self.fd, PlatformSpecific.TIOCSBRK) + else: + fcntl.ioctl(self.fd, PlatformSpecific.TIOCCBRK) + +elif plat[:3] == 'bsd' or \ + plat[:7] == 'freebsd' or \ + plat[:6] == 'netbsd' or \ + plat[:7] == 'openbsd': + + class ReturnBaudrate(object): + def __getitem__(self, key): + return key + + class PlatformSpecific(PlatformSpecificBase): + # Only tested on FreeBSD: + # The baud rate may be passed in as + # a literal value. + BAUDRATE_CONSTANTS = ReturnBaudrate() + + TIOCSBRK = 0x2000747B # _IO('t', 123) + TIOCCBRK = 0x2000747A # _IO('t', 122) + + + def _update_break_state(self): + """\ + Set break: Controls TXD. When active, no transmitting is possible. + """ + if self._break_state: + fcntl.ioctl(self.fd, PlatformSpecific.TIOCSBRK) + else: + fcntl.ioctl(self.fd, PlatformSpecific.TIOCCBRK) + +else: + class PlatformSpecific(PlatformSpecificBase): + pass + + +# load some constants for later use. +# try to use values from termios, use defaults from linux otherwise +TIOCMGET = getattr(termios, 'TIOCMGET', 0x5415) +TIOCMBIS = getattr(termios, 'TIOCMBIS', 0x5416) +TIOCMBIC = getattr(termios, 'TIOCMBIC', 0x5417) +TIOCMSET = getattr(termios, 'TIOCMSET', 0x5418) + +# TIOCM_LE = getattr(termios, 'TIOCM_LE', 0x001) +TIOCM_DTR = getattr(termios, 'TIOCM_DTR', 0x002) +TIOCM_RTS = getattr(termios, 'TIOCM_RTS', 0x004) +# TIOCM_ST = getattr(termios, 'TIOCM_ST', 0x008) +# TIOCM_SR = getattr(termios, 'TIOCM_SR', 0x010) + +TIOCM_CTS = getattr(termios, 'TIOCM_CTS', 0x020) +TIOCM_CAR = getattr(termios, 'TIOCM_CAR', 0x040) +TIOCM_RNG = getattr(termios, 'TIOCM_RNG', 0x080) +TIOCM_DSR = getattr(termios, 'TIOCM_DSR', 0x100) +TIOCM_CD = getattr(termios, 'TIOCM_CD', TIOCM_CAR) +TIOCM_RI = getattr(termios, 'TIOCM_RI', TIOCM_RNG) +# TIOCM_OUT1 = getattr(termios, 'TIOCM_OUT1', 0x2000) +# TIOCM_OUT2 = getattr(termios, 'TIOCM_OUT2', 0x4000) +if hasattr(termios, 'TIOCINQ'): + TIOCINQ = termios.TIOCINQ +else: + TIOCINQ = getattr(termios, 'FIONREAD', 0x541B) +TIOCOUTQ = getattr(termios, 'TIOCOUTQ', 0x5411) + +TIOCM_zero_str = struct.pack('I', 0) +TIOCM_RTS_str = struct.pack('I', TIOCM_RTS) +TIOCM_DTR_str = struct.pack('I', TIOCM_DTR) + +TIOCSBRK = getattr(termios, 'TIOCSBRK', 0x5427) +TIOCCBRK = getattr(termios, 'TIOCCBRK', 0x5428) + + +class Serial(SerialBase, PlatformSpecific): + """\ + Serial port class POSIX implementation. Serial port configuration is + done with termios and fcntl. Runs on Linux and many other Un*x like + systems. + """ + + def open(self): + """\ + Open port with current settings. This may throw a SerialException + if the port cannot be opened.""" + if self._port is None: + raise SerialException("Port must be configured before it can be used.") + if self.is_open: + raise SerialException("Port is already open.") + self.fd = None + # open + try: + self.fd = os.open(self.portstr, os.O_RDWR | os.O_NOCTTY | os.O_NONBLOCK) + except OSError as msg: + self.fd = None + raise SerialException(msg.errno, "could not open port {}: {}".format(self._port, msg)) + #~ fcntl.fcntl(self.fd, fcntl.F_SETFL, 0) # set blocking + + self.pipe_abort_read_r, self.pipe_abort_read_w = None, None + self.pipe_abort_write_r, self.pipe_abort_write_w = None, None + + try: + self._reconfigure_port(force_update=True) + + try: + if not self._dsrdtr: + self._update_dtr_state() + if not self._rtscts: + self._update_rts_state() + except IOError as e: + # ignore Invalid argument and Inappropriate ioctl + if e.errno not in (errno.EINVAL, errno.ENOTTY): + raise + + self._reset_input_buffer() + + self.pipe_abort_read_r, self.pipe_abort_read_w = os.pipe() + self.pipe_abort_write_r, self.pipe_abort_write_w = os.pipe() + fcntl.fcntl(self.pipe_abort_read_r, fcntl.F_SETFL, os.O_NONBLOCK) + fcntl.fcntl(self.pipe_abort_write_r, fcntl.F_SETFL, os.O_NONBLOCK) + except BaseException: + try: + os.close(self.fd) + except Exception: + # ignore any exception when closing the port + # also to keep original exception that happened when setting up + pass + self.fd = None + + if self.pipe_abort_read_w is not None: + os.close(self.pipe_abort_read_w) + self.pipe_abort_read_w = None + if self.pipe_abort_read_r is not None: + os.close(self.pipe_abort_read_r) + self.pipe_abort_read_r = None + if self.pipe_abort_write_w is not None: + os.close(self.pipe_abort_write_w) + self.pipe_abort_write_w = None + if self.pipe_abort_write_r is not None: + os.close(self.pipe_abort_write_r) + self.pipe_abort_write_r = None + + raise + + self.is_open = True + + def _reconfigure_port(self, force_update=False): + """Set communication parameters on opened port.""" + if self.fd is None: + raise SerialException("Can only operate on a valid file descriptor") + + # if exclusive lock is requested, create it before we modify anything else + if self._exclusive is not None: + if self._exclusive: + try: + fcntl.flock(self.fd, fcntl.LOCK_EX | fcntl.LOCK_NB) + except IOError as msg: + raise SerialException(msg.errno, "Could not exclusively lock port {}: {}".format(self._port, msg)) + else: + fcntl.flock(self.fd, fcntl.LOCK_UN) + + custom_baud = None + + vmin = vtime = 0 # timeout is done via select + if self._inter_byte_timeout is not None: + vmin = 1 + vtime = int(self._inter_byte_timeout * 10) + try: + orig_attr = termios.tcgetattr(self.fd) + iflag, oflag, cflag, lflag, ispeed, ospeed, cc = orig_attr + except termios.error as msg: # if a port is nonexistent but has a /dev file, it'll fail here + raise SerialException("Could not configure port: {}".format(msg)) + # set up raw mode / no echo / binary + cflag |= (termios.CLOCAL | termios.CREAD) + lflag &= ~(termios.ICANON | termios.ECHO | termios.ECHOE | + termios.ECHOK | termios.ECHONL | + termios.ISIG | termios.IEXTEN) # |termios.ECHOPRT + for flag in ('ECHOCTL', 'ECHOKE'): # netbsd workaround for Erk + if hasattr(termios, flag): + lflag &= ~getattr(termios, flag) + + oflag &= ~(termios.OPOST | termios.ONLCR | termios.OCRNL) + iflag &= ~(termios.INLCR | termios.IGNCR | termios.ICRNL | termios.IGNBRK) + if hasattr(termios, 'IUCLC'): + iflag &= ~termios.IUCLC + if hasattr(termios, 'PARMRK'): + iflag &= ~termios.PARMRK + + # setup baud rate + try: + ispeed = ospeed = getattr(termios, 'B{}'.format(self._baudrate)) + except AttributeError: + try: + ispeed = ospeed = self.BAUDRATE_CONSTANTS[self._baudrate] + except KeyError: + #~ raise ValueError('Invalid baud rate: %r' % self._baudrate) + + # See if BOTHER is defined for this platform; if it is, use + # this for a speed not defined in the baudrate constants list. + try: + ispeed = ospeed = BOTHER + except NameError: + # may need custom baud rate, it isn't in our list. + ispeed = ospeed = getattr(termios, 'B38400') + + try: + custom_baud = int(self._baudrate) # store for later + except ValueError: + raise ValueError('Invalid baud rate: {!r}'.format(self._baudrate)) + else: + if custom_baud < 0: + raise ValueError('Invalid baud rate: {!r}'.format(self._baudrate)) + + # setup char len + cflag &= ~termios.CSIZE + if self._bytesize == 8: + cflag |= termios.CS8 + elif self._bytesize == 7: + cflag |= termios.CS7 + elif self._bytesize == 6: + cflag |= termios.CS6 + elif self._bytesize == 5: + cflag |= termios.CS5 + else: + raise ValueError('Invalid char len: {!r}'.format(self._bytesize)) + # setup stop bits + if self._stopbits == serial.STOPBITS_ONE: + cflag &= ~(termios.CSTOPB) + elif self._stopbits == serial.STOPBITS_ONE_POINT_FIVE: + cflag |= (termios.CSTOPB) # XXX same as TWO.. there is no POSIX support for 1.5 + elif self._stopbits == serial.STOPBITS_TWO: + cflag |= (termios.CSTOPB) + else: + raise ValueError('Invalid stop bit specification: {!r}'.format(self._stopbits)) + # setup parity + iflag &= ~(termios.INPCK | termios.ISTRIP) + if self._parity == serial.PARITY_NONE: + cflag &= ~(termios.PARENB | termios.PARODD | CMSPAR) + elif self._parity == serial.PARITY_EVEN: + cflag &= ~(termios.PARODD | CMSPAR) + cflag |= (termios.PARENB) + elif self._parity == serial.PARITY_ODD: + cflag &= ~CMSPAR + cflag |= (termios.PARENB | termios.PARODD) + elif self._parity == serial.PARITY_MARK and CMSPAR: + cflag |= (termios.PARENB | CMSPAR | termios.PARODD) + elif self._parity == serial.PARITY_SPACE and CMSPAR: + cflag |= (termios.PARENB | CMSPAR) + cflag &= ~(termios.PARODD) + else: + raise ValueError('Invalid parity: {!r}'.format(self._parity)) + # setup flow control + # xonxoff + if hasattr(termios, 'IXANY'): + if self._xonxoff: + iflag |= (termios.IXON | termios.IXOFF) # |termios.IXANY) + else: + iflag &= ~(termios.IXON | termios.IXOFF | termios.IXANY) + else: + if self._xonxoff: + iflag |= (termios.IXON | termios.IXOFF) + else: + iflag &= ~(termios.IXON | termios.IXOFF) + # rtscts + if hasattr(termios, 'CRTSCTS'): + if self._rtscts: + cflag |= (termios.CRTSCTS) + else: + cflag &= ~(termios.CRTSCTS) + elif hasattr(termios, 'CNEW_RTSCTS'): # try it with alternate constant name + if self._rtscts: + cflag |= (termios.CNEW_RTSCTS) + else: + cflag &= ~(termios.CNEW_RTSCTS) + # XXX should there be a warning if setting up rtscts (and xonxoff etc) fails?? + + # buffer + # vmin "minimal number of characters to be read. 0 for non blocking" + if vmin < 0 or vmin > 255: + raise ValueError('Invalid vmin: {!r}'.format(vmin)) + cc[termios.VMIN] = vmin + # vtime + if vtime < 0 or vtime > 255: + raise ValueError('Invalid vtime: {!r}'.format(vtime)) + cc[termios.VTIME] = vtime + # activate settings + if force_update or [iflag, oflag, cflag, lflag, ispeed, ospeed, cc] != orig_attr: + termios.tcsetattr( + self.fd, + termios.TCSANOW, + [iflag, oflag, cflag, lflag, ispeed, ospeed, cc]) + + # apply custom baud rate, if any + if custom_baud is not None: + self._set_special_baudrate(custom_baud) + + if self._rs485_mode is not None: + self._set_rs485_mode(self._rs485_mode) + + def close(self): + """Close port""" + if self.is_open: + if self.fd is not None: + os.close(self.fd) + self.fd = None + os.close(self.pipe_abort_read_w) + os.close(self.pipe_abort_read_r) + os.close(self.pipe_abort_write_w) + os.close(self.pipe_abort_write_r) + self.pipe_abort_read_r, self.pipe_abort_read_w = None, None + self.pipe_abort_write_r, self.pipe_abort_write_w = None, None + self.is_open = False + + # - - - - - - - - - - - - - - - - - - - - - - - - + + @property + def in_waiting(self): + """Return the number of bytes currently in the input buffer.""" + #~ s = fcntl.ioctl(self.fd, termios.FIONREAD, TIOCM_zero_str) + s = fcntl.ioctl(self.fd, TIOCINQ, TIOCM_zero_str) + return struct.unpack('I', s)[0] + + # select based implementation, proved to work on many systems + def read(self, size=1): + """\ + Read size bytes from the serial port. If a timeout is set it may + return less characters as requested. With no timeout it will block + until the requested number of bytes is read. + """ + if not self.is_open: + raise PortNotOpenError() + read = bytearray() + timeout = Timeout(self._timeout) + while len(read) < size: + try: + ready, _, _ = select.select([self.fd, self.pipe_abort_read_r], [], [], timeout.time_left()) + if self.pipe_abort_read_r in ready: + os.read(self.pipe_abort_read_r, 1000) + break + # If select was used with a timeout, and the timeout occurs, it + # returns with empty lists -> thus abort read operation. + # For timeout == 0 (non-blocking operation) also abort when + # there is nothing to read. + if not ready: + break # timeout + buf = os.read(self.fd, size - len(read)) + except OSError as e: + # this is for Python 3.x where select.error is a subclass of + # OSError ignore BlockingIOErrors and EINTR. other errors are shown + # https://www.python.org/dev/peps/pep-0475. + if e.errno not in (errno.EAGAIN, errno.EALREADY, errno.EWOULDBLOCK, errno.EINPROGRESS, errno.EINTR): + raise SerialException('read failed: {}'.format(e)) + except select.error as e: + # this is for Python 2.x + # ignore BlockingIOErrors and EINTR. all errors are shown + # see also http://www.python.org/dev/peps/pep-3151/#select + if e[0] not in (errno.EAGAIN, errno.EALREADY, errno.EWOULDBLOCK, errno.EINPROGRESS, errno.EINTR): + raise SerialException('read failed: {}'.format(e)) + else: + # read should always return some data as select reported it was + # ready to read when we get to this point. + if not buf: + # Disconnected devices, at least on Linux, show the + # behavior that they are always ready to read immediately + # but reading returns nothing. + raise SerialException( + 'device reports readiness to read but returned no data ' + '(device disconnected or multiple access on port?)') + read.extend(buf) + + if timeout.expired(): + break + return bytes(read) + + def cancel_read(self): + if self.is_open: + os.write(self.pipe_abort_read_w, b"x") + + def cancel_write(self): + if self.is_open: + os.write(self.pipe_abort_write_w, b"x") + + def write(self, data): + """Output the given byte string over the serial port.""" + if not self.is_open: + raise PortNotOpenError() + d = to_bytes(data) + tx_len = length = len(d) + timeout = Timeout(self._write_timeout) + while tx_len > 0: + try: + n = os.write(self.fd, d) + if timeout.is_non_blocking: + # Zero timeout indicates non-blocking - simply return the + # number of bytes of data actually written + return n + elif not timeout.is_infinite: + # when timeout is set, use select to wait for being ready + # with the time left as timeout + if timeout.expired(): + raise SerialTimeoutException('Write timeout') + abort, ready, _ = select.select([self.pipe_abort_write_r], [self.fd], [], timeout.time_left()) + if abort: + os.read(self.pipe_abort_write_r, 1000) + break + if not ready: + raise SerialTimeoutException('Write timeout') + else: + assert timeout.time_left() is None + # wait for write operation + abort, ready, _ = select.select([self.pipe_abort_write_r], [self.fd], [], None) + if abort: + os.read(self.pipe_abort_write_r, 1) + break + if not ready: + raise SerialException('write failed (select)') + d = d[n:] + tx_len -= n + except SerialException: + raise + except OSError as e: + # this is for Python 3.x where select.error is a subclass of + # OSError ignore BlockingIOErrors and EINTR. other errors are shown + # https://www.python.org/dev/peps/pep-0475. + if e.errno not in (errno.EAGAIN, errno.EALREADY, errno.EWOULDBLOCK, errno.EINPROGRESS, errno.EINTR): + raise SerialException('write failed: {}'.format(e)) + except select.error as e: + # this is for Python 2.x + # ignore BlockingIOErrors and EINTR. all errors are shown + # see also http://www.python.org/dev/peps/pep-3151/#select + if e[0] not in (errno.EAGAIN, errno.EALREADY, errno.EWOULDBLOCK, errno.EINPROGRESS, errno.EINTR): + raise SerialException('write failed: {}'.format(e)) + if not timeout.is_non_blocking and timeout.expired(): + raise SerialTimeoutException('Write timeout') + return length - len(d) + + def flush(self): + """\ + Flush of file like objects. In this case, wait until all data + is written. + """ + if not self.is_open: + raise PortNotOpenError() + termios.tcdrain(self.fd) + + def _reset_input_buffer(self): + """Clear input buffer, discarding all that is in the buffer.""" + termios.tcflush(self.fd, termios.TCIFLUSH) + + def reset_input_buffer(self): + """Clear input buffer, discarding all that is in the buffer.""" + if not self.is_open: + raise PortNotOpenError() + self._reset_input_buffer() + + def reset_output_buffer(self): + """\ + Clear output buffer, aborting the current output and discarding all + that is in the buffer. + """ + if not self.is_open: + raise PortNotOpenError() + termios.tcflush(self.fd, termios.TCOFLUSH) + + def send_break(self, duration=0.25): + """\ + Send break condition. Timed, returns to idle state after given + duration. + """ + if not self.is_open: + raise PortNotOpenError() + termios.tcsendbreak(self.fd, int(duration / 0.25)) + + def _update_rts_state(self): + """Set terminal status line: Request To Send""" + if self._rts_state: + fcntl.ioctl(self.fd, TIOCMBIS, TIOCM_RTS_str) + else: + fcntl.ioctl(self.fd, TIOCMBIC, TIOCM_RTS_str) + + def _update_dtr_state(self): + """Set terminal status line: Data Terminal Ready""" + if self._dtr_state: + fcntl.ioctl(self.fd, TIOCMBIS, TIOCM_DTR_str) + else: + fcntl.ioctl(self.fd, TIOCMBIC, TIOCM_DTR_str) + + @property + def cts(self): + """Read terminal status line: Clear To Send""" + if not self.is_open: + raise PortNotOpenError() + s = fcntl.ioctl(self.fd, TIOCMGET, TIOCM_zero_str) + return struct.unpack('I', s)[0] & TIOCM_CTS != 0 + + @property + def dsr(self): + """Read terminal status line: Data Set Ready""" + if not self.is_open: + raise PortNotOpenError() + s = fcntl.ioctl(self.fd, TIOCMGET, TIOCM_zero_str) + return struct.unpack('I', s)[0] & TIOCM_DSR != 0 + + @property + def ri(self): + """Read terminal status line: Ring Indicator""" + if not self.is_open: + raise PortNotOpenError() + s = fcntl.ioctl(self.fd, TIOCMGET, TIOCM_zero_str) + return struct.unpack('I', s)[0] & TIOCM_RI != 0 + + @property + def cd(self): + """Read terminal status line: Carrier Detect""" + if not self.is_open: + raise PortNotOpenError() + s = fcntl.ioctl(self.fd, TIOCMGET, TIOCM_zero_str) + return struct.unpack('I', s)[0] & TIOCM_CD != 0 + + # - - platform specific - - - - + + @property + def out_waiting(self): + """Return the number of bytes currently in the output buffer.""" + #~ s = fcntl.ioctl(self.fd, termios.FIONREAD, TIOCM_zero_str) + s = fcntl.ioctl(self.fd, TIOCOUTQ, TIOCM_zero_str) + return struct.unpack('I', s)[0] + + def fileno(self): + """\ + For easier use of the serial port instance with select. + WARNING: this function is not portable to different platforms! + """ + if not self.is_open: + raise PortNotOpenError() + return self.fd + + def set_input_flow_control(self, enable=True): + """\ + Manually control flow - when software flow control is enabled. + This will send XON (true) or XOFF (false) to the other device. + WARNING: this function is not portable to different platforms! + """ + if not self.is_open: + raise PortNotOpenError() + if enable: + termios.tcflow(self.fd, termios.TCION) + else: + termios.tcflow(self.fd, termios.TCIOFF) + + def set_output_flow_control(self, enable=True): + """\ + Manually control flow of outgoing data - when hardware or software flow + control is enabled. + WARNING: this function is not portable to different platforms! + """ + if not self.is_open: + raise PortNotOpenError() + if enable: + termios.tcflow(self.fd, termios.TCOON) + else: + termios.tcflow(self.fd, termios.TCOOFF) + + def nonblocking(self): + """DEPRECATED - has no use""" + import warnings + warnings.warn("nonblocking() has no effect, already nonblocking", DeprecationWarning) + + +class PosixPollSerial(Serial): + """\ + Poll based read implementation. Not all systems support poll properly. + However this one has better handling of errors, such as a device + disconnecting while it's in use (e.g. USB-serial unplugged). + """ + + def read(self, size=1): + """\ + Read size bytes from the serial port. If a timeout is set it may + return less characters as requested. With no timeout it will block + until the requested number of bytes is read. + """ + if not self.is_open: + raise PortNotOpenError() + read = bytearray() + timeout = Timeout(self._timeout) + poll = select.poll() + poll.register(self.fd, select.POLLIN | select.POLLERR | select.POLLHUP | select.POLLNVAL) + poll.register(self.pipe_abort_read_r, select.POLLIN | select.POLLERR | select.POLLHUP | select.POLLNVAL) + if size > 0: + while len(read) < size: + # print "\tread(): size",size, "have", len(read) #debug + # wait until device becomes ready to read (or something fails) + for fd, event in poll.poll(None if timeout.is_infinite else (timeout.time_left() * 1000)): + if fd == self.pipe_abort_read_r: + break + if event & (select.POLLERR | select.POLLHUP | select.POLLNVAL): + raise SerialException('device reports error (poll)') + # we don't care if it is select.POLLIN or timeout, that's + # handled below + if fd == self.pipe_abort_read_r: + os.read(self.pipe_abort_read_r, 1000) + break + buf = os.read(self.fd, size - len(read)) + read.extend(buf) + if timeout.expired() \ + or (self._inter_byte_timeout is not None and self._inter_byte_timeout > 0) and not buf: + break # early abort on timeout + return bytes(read) + + +class VTIMESerial(Serial): + """\ + Implement timeout using vtime of tty device instead of using select. + This means that no inter character timeout can be specified and that + the error handling is degraded. + + Overall timeout is disabled when inter-character timeout is used. + + Note that this implementation does NOT support cancel_read(), it will + just ignore that. + """ + + def _reconfigure_port(self, force_update=True): + """Set communication parameters on opened port.""" + super(VTIMESerial, self)._reconfigure_port() + fcntl.fcntl(self.fd, fcntl.F_SETFL, 0) # clear O_NONBLOCK + + if self._inter_byte_timeout is not None: + vmin = 1 + vtime = int(self._inter_byte_timeout * 10) + elif self._timeout is None: + vmin = 1 + vtime = 0 + else: + vmin = 0 + vtime = int(self._timeout * 10) + try: + orig_attr = termios.tcgetattr(self.fd) + iflag, oflag, cflag, lflag, ispeed, ospeed, cc = orig_attr + except termios.error as msg: # if a port is nonexistent but has a /dev file, it'll fail here + raise serial.SerialException("Could not configure port: {}".format(msg)) + + if vtime < 0 or vtime > 255: + raise ValueError('Invalid vtime: {!r}'.format(vtime)) + cc[termios.VTIME] = vtime + cc[termios.VMIN] = vmin + + termios.tcsetattr( + self.fd, + termios.TCSANOW, + [iflag, oflag, cflag, lflag, ispeed, ospeed, cc]) + + def read(self, size=1): + """\ + Read size bytes from the serial port. If a timeout is set it may + return less characters as requested. With no timeout it will block + until the requested number of bytes is read. + """ + if not self.is_open: + raise PortNotOpenError() + read = bytearray() + while len(read) < size: + buf = os.read(self.fd, size - len(read)) + if not buf: + break + read.extend(buf) + return bytes(read) + + # hack to make hasattr return false + cancel_read = property() diff --git a/extensions/km-plot/deps/serial/serialutil.py b/extensions/km-plot/deps/serial/serialutil.py new file mode 100644 index 0000000..789219e --- /dev/null +++ b/extensions/km-plot/deps/serial/serialutil.py @@ -0,0 +1,697 @@ +#! python +# +# Base class and support functions used by various backends. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2001-2020 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +import io +import time + +# ``memoryview`` was introduced in Python 2.7 and ``bytes(some_memoryview)`` +# isn't returning the contents (very unfortunate). Therefore we need special +# cases and test for it. Ensure that there is a ``memoryview`` object for older +# Python versions. This is easier than making every test dependent on its +# existence. +try: + memoryview +except (NameError, AttributeError): + # implementation does not matter as we do not really use it. + # it just must not inherit from something else we might care for. + class memoryview(object): # pylint: disable=redefined-builtin,invalid-name + pass + +try: + unicode +except (NameError, AttributeError): + unicode = str # for Python 3, pylint: disable=redefined-builtin,invalid-name + +try: + basestring +except (NameError, AttributeError): + basestring = (str,) # for Python 3, pylint: disable=redefined-builtin,invalid-name + + +# "for byte in data" fails for python3 as it returns ints instead of bytes +def iterbytes(b): + """Iterate over bytes, returning bytes instead of ints (python3)""" + if isinstance(b, memoryview): + b = b.tobytes() + i = 0 + while True: + a = b[i:i + 1] + i += 1 + if a: + yield a + else: + break + + +# all Python versions prior 3.x convert ``str([17])`` to '[17]' instead of '\x11' +# so a simple ``bytes(sequence)`` doesn't work for all versions +def to_bytes(seq): + """convert a sequence to a bytes type""" + if isinstance(seq, bytes): + return seq + elif isinstance(seq, bytearray): + return bytes(seq) + elif isinstance(seq, memoryview): + return seq.tobytes() + elif isinstance(seq, unicode): + raise TypeError('unicode strings are not supported, please encode to bytes: {!r}'.format(seq)) + else: + # handle list of integers and bytes (one or more items) for Python 2 and 3 + return bytes(bytearray(seq)) + + +# create control bytes +XON = to_bytes([17]) +XOFF = to_bytes([19]) + +CR = to_bytes([13]) +LF = to_bytes([10]) + + +PARITY_NONE, PARITY_EVEN, PARITY_ODD, PARITY_MARK, PARITY_SPACE = 'N', 'E', 'O', 'M', 'S' +STOPBITS_ONE, STOPBITS_ONE_POINT_FIVE, STOPBITS_TWO = (1, 1.5, 2) +FIVEBITS, SIXBITS, SEVENBITS, EIGHTBITS = (5, 6, 7, 8) + +PARITY_NAMES = { + PARITY_NONE: 'None', + PARITY_EVEN: 'Even', + PARITY_ODD: 'Odd', + PARITY_MARK: 'Mark', + PARITY_SPACE: 'Space', +} + + +class SerialException(IOError): + """Base class for serial port related exceptions.""" + + +class SerialTimeoutException(SerialException): + """Write timeouts give an exception""" + + +class PortNotOpenError(SerialException): + """Port is not open""" + def __init__(self): + super(PortNotOpenError, self).__init__('Attempting to use a port that is not open') + + +class Timeout(object): + """\ + Abstraction for timeout operations. Using time.monotonic() if available + or time.time() in all other cases. + + The class can also be initialized with 0 or None, in order to support + non-blocking and fully blocking I/O operations. The attributes + is_non_blocking and is_infinite are set accordingly. + """ + if hasattr(time, 'monotonic'): + # Timeout implementation with time.monotonic(). This function is only + # supported by Python 3.3 and above. It returns a time in seconds + # (float) just as time.time(), but is not affected by system clock + # adjustments. + TIME = time.monotonic + else: + # Timeout implementation with time.time(). This is compatible with all + # Python versions but has issues if the clock is adjusted while the + # timeout is running. + TIME = time.time + + def __init__(self, duration): + """Initialize a timeout with given duration""" + self.is_infinite = (duration is None) + self.is_non_blocking = (duration == 0) + self.duration = duration + if duration is not None: + self.target_time = self.TIME() + duration + else: + self.target_time = None + + def expired(self): + """Return a boolean, telling if the timeout has expired""" + return self.target_time is not None and self.time_left() <= 0 + + def time_left(self): + """Return how many seconds are left until the timeout expires""" + if self.is_non_blocking: + return 0 + elif self.is_infinite: + return None + else: + delta = self.target_time - self.TIME() + if delta > self.duration: + # clock jumped, recalculate + self.target_time = self.TIME() + self.duration + return self.duration + else: + return max(0, delta) + + def restart(self, duration): + """\ + Restart a timeout, only supported if a timeout was already set up + before. + """ + self.duration = duration + self.target_time = self.TIME() + duration + + +class SerialBase(io.RawIOBase): + """\ + Serial port base class. Provides __init__ function and properties to + get/set port settings. + """ + + # default values, may be overridden in subclasses that do not support all values + BAUDRATES = (50, 75, 110, 134, 150, 200, 300, 600, 1200, 1800, 2400, 4800, + 9600, 19200, 38400, 57600, 115200, 230400, 460800, 500000, + 576000, 921600, 1000000, 1152000, 1500000, 2000000, 2500000, + 3000000, 3500000, 4000000) + BYTESIZES = (FIVEBITS, SIXBITS, SEVENBITS, EIGHTBITS) + PARITIES = (PARITY_NONE, PARITY_EVEN, PARITY_ODD, PARITY_MARK, PARITY_SPACE) + STOPBITS = (STOPBITS_ONE, STOPBITS_ONE_POINT_FIVE, STOPBITS_TWO) + + def __init__(self, + port=None, + baudrate=9600, + bytesize=EIGHTBITS, + parity=PARITY_NONE, + stopbits=STOPBITS_ONE, + timeout=None, + xonxoff=False, + rtscts=False, + write_timeout=None, + dsrdtr=False, + inter_byte_timeout=None, + exclusive=None, + **kwargs): + """\ + Initialize comm port object. If a "port" is given, then the port will be + opened immediately. Otherwise a Serial port object in closed state + is returned. + """ + + self.is_open = False + self.portstr = None + self.name = None + # correct values are assigned below through properties + self._port = None + self._baudrate = None + self._bytesize = None + self._parity = None + self._stopbits = None + self._timeout = None + self._write_timeout = None + self._xonxoff = None + self._rtscts = None + self._dsrdtr = None + self._inter_byte_timeout = None + self._rs485_mode = None # disabled by default + self._rts_state = True + self._dtr_state = True + self._break_state = False + self._exclusive = None + + # assign values using get/set methods using the properties feature + self.port = port + self.baudrate = baudrate + self.bytesize = bytesize + self.parity = parity + self.stopbits = stopbits + self.timeout = timeout + self.write_timeout = write_timeout + self.xonxoff = xonxoff + self.rtscts = rtscts + self.dsrdtr = dsrdtr + self.inter_byte_timeout = inter_byte_timeout + self.exclusive = exclusive + + # watch for backward compatible kwargs + if 'writeTimeout' in kwargs: + self.write_timeout = kwargs.pop('writeTimeout') + if 'interCharTimeout' in kwargs: + self.inter_byte_timeout = kwargs.pop('interCharTimeout') + if kwargs: + raise ValueError('unexpected keyword arguments: {!r}'.format(kwargs)) + + if port is not None: + self.open() + + # - - - - - - - - - - - - - - - - - - - - - - - - + + # to be implemented by subclasses: + # def open(self): + # def close(self): + + # - - - - - - - - - - - - - - - - - - - - - - - - + + @property + def port(self): + """\ + Get the current port setting. The value that was passed on init or using + setPort() is passed back. + """ + return self._port + + @port.setter + def port(self, port): + """\ + Change the port. + """ + if port is not None and not isinstance(port, basestring): + raise ValueError('"port" must be None or a string, not {}'.format(type(port))) + was_open = self.is_open + if was_open: + self.close() + self.portstr = port + self._port = port + self.name = self.portstr + if was_open: + self.open() + + @property + def baudrate(self): + """Get the current baud rate setting.""" + return self._baudrate + + @baudrate.setter + def baudrate(self, baudrate): + """\ + Change baud rate. It raises a ValueError if the port is open and the + baud rate is not possible. If the port is closed, then the value is + accepted and the exception is raised when the port is opened. + """ + try: + b = int(baudrate) + except TypeError: + raise ValueError("Not a valid baudrate: {!r}".format(baudrate)) + else: + if b < 0: + raise ValueError("Not a valid baudrate: {!r}".format(baudrate)) + self._baudrate = b + if self.is_open: + self._reconfigure_port() + + @property + def bytesize(self): + """Get the current byte size setting.""" + return self._bytesize + + @bytesize.setter + def bytesize(self, bytesize): + """Change byte size.""" + if bytesize not in self.BYTESIZES: + raise ValueError("Not a valid byte size: {!r}".format(bytesize)) + self._bytesize = bytesize + if self.is_open: + self._reconfigure_port() + + @property + def exclusive(self): + """Get the current exclusive access setting.""" + return self._exclusive + + @exclusive.setter + def exclusive(self, exclusive): + """Change the exclusive access setting.""" + self._exclusive = exclusive + if self.is_open: + self._reconfigure_port() + + @property + def parity(self): + """Get the current parity setting.""" + return self._parity + + @parity.setter + def parity(self, parity): + """Change parity setting.""" + if parity not in self.PARITIES: + raise ValueError("Not a valid parity: {!r}".format(parity)) + self._parity = parity + if self.is_open: + self._reconfigure_port() + + @property + def stopbits(self): + """Get the current stop bits setting.""" + return self._stopbits + + @stopbits.setter + def stopbits(self, stopbits): + """Change stop bits size.""" + if stopbits not in self.STOPBITS: + raise ValueError("Not a valid stop bit size: {!r}".format(stopbits)) + self._stopbits = stopbits + if self.is_open: + self._reconfigure_port() + + @property + def timeout(self): + """Get the current timeout setting.""" + return self._timeout + + @timeout.setter + def timeout(self, timeout): + """Change timeout setting.""" + if timeout is not None: + try: + timeout + 1 # test if it's a number, will throw a TypeError if not... + except TypeError: + raise ValueError("Not a valid timeout: {!r}".format(timeout)) + if timeout < 0: + raise ValueError("Not a valid timeout: {!r}".format(timeout)) + self._timeout = timeout + if self.is_open: + self._reconfigure_port() + + @property + def write_timeout(self): + """Get the current timeout setting.""" + return self._write_timeout + + @write_timeout.setter + def write_timeout(self, timeout): + """Change timeout setting.""" + if timeout is not None: + if timeout < 0: + raise ValueError("Not a valid timeout: {!r}".format(timeout)) + try: + timeout + 1 # test if it's a number, will throw a TypeError if not... + except TypeError: + raise ValueError("Not a valid timeout: {!r}".format(timeout)) + + self._write_timeout = timeout + if self.is_open: + self._reconfigure_port() + + @property + def inter_byte_timeout(self): + """Get the current inter-character timeout setting.""" + return self._inter_byte_timeout + + @inter_byte_timeout.setter + def inter_byte_timeout(self, ic_timeout): + """Change inter-byte timeout setting.""" + if ic_timeout is not None: + if ic_timeout < 0: + raise ValueError("Not a valid timeout: {!r}".format(ic_timeout)) + try: + ic_timeout + 1 # test if it's a number, will throw a TypeError if not... + except TypeError: + raise ValueError("Not a valid timeout: {!r}".format(ic_timeout)) + + self._inter_byte_timeout = ic_timeout + if self.is_open: + self._reconfigure_port() + + @property + def xonxoff(self): + """Get the current XON/XOFF setting.""" + return self._xonxoff + + @xonxoff.setter + def xonxoff(self, xonxoff): + """Change XON/XOFF setting.""" + self._xonxoff = xonxoff + if self.is_open: + self._reconfigure_port() + + @property + def rtscts(self): + """Get the current RTS/CTS flow control setting.""" + return self._rtscts + + @rtscts.setter + def rtscts(self, rtscts): + """Change RTS/CTS flow control setting.""" + self._rtscts = rtscts + if self.is_open: + self._reconfigure_port() + + @property + def dsrdtr(self): + """Get the current DSR/DTR flow control setting.""" + return self._dsrdtr + + @dsrdtr.setter + def dsrdtr(self, dsrdtr=None): + """Change DsrDtr flow control setting.""" + if dsrdtr is None: + # if not set, keep backwards compatibility and follow rtscts setting + self._dsrdtr = self._rtscts + else: + # if defined independently, follow its value + self._dsrdtr = dsrdtr + if self.is_open: + self._reconfigure_port() + + @property + def rts(self): + return self._rts_state + + @rts.setter + def rts(self, value): + self._rts_state = value + if self.is_open: + self._update_rts_state() + + @property + def dtr(self): + return self._dtr_state + + @dtr.setter + def dtr(self, value): + self._dtr_state = value + if self.is_open: + self._update_dtr_state() + + @property + def break_condition(self): + return self._break_state + + @break_condition.setter + def break_condition(self, value): + self._break_state = value + if self.is_open: + self._update_break_state() + + # - - - - - - - - - - - - - - - - - - - - - - - - + # functions useful for RS-485 adapters + + @property + def rs485_mode(self): + """\ + Enable RS485 mode and apply new settings, set to None to disable. + See serial.rs485.RS485Settings for more info about the value. + """ + return self._rs485_mode + + @rs485_mode.setter + def rs485_mode(self, rs485_settings): + self._rs485_mode = rs485_settings + if self.is_open: + self._reconfigure_port() + + # - - - - - - - - - - - - - - - - - - - - - - - - + + _SAVED_SETTINGS = ('baudrate', 'bytesize', 'parity', 'stopbits', 'xonxoff', + 'dsrdtr', 'rtscts', 'timeout', 'write_timeout', + 'inter_byte_timeout') + + def get_settings(self): + """\ + Get current port settings as a dictionary. For use with + apply_settings(). + """ + return dict([(key, getattr(self, '_' + key)) for key in self._SAVED_SETTINGS]) + + def apply_settings(self, d): + """\ + Apply stored settings from a dictionary returned from + get_settings(). It's allowed to delete keys from the dictionary. These + values will simply left unchanged. + """ + for key in self._SAVED_SETTINGS: + if key in d and d[key] != getattr(self, '_' + key): # check against internal "_" value + setattr(self, key, d[key]) # set non "_" value to use properties write function + + # - - - - - - - - - - - - - - - - - - - - - - - - + + def __repr__(self): + """String representation of the current port settings and its state.""" + return '{name}(port={p.portstr!r}, ' \ + 'baudrate={p.baudrate!r}, bytesize={p.bytesize!r}, parity={p.parity!r}, ' \ + 'stopbits={p.stopbits!r}, timeout={p.timeout!r}, xonxoff={p.xonxoff!r}, ' \ + 'rtscts={p.rtscts!r}, dsrdtr={p.dsrdtr!r})'.format( + name=self.__class__.__name__, id=id(self), p=self) + + # - - - - - - - - - - - - - - - - - - - - - - - - + # compatibility with io library + # pylint: disable=invalid-name,missing-docstring + + def readable(self): + return True + + def writable(self): + return True + + def seekable(self): + return False + + def readinto(self, b): + data = self.read(len(b)) + n = len(data) + try: + b[:n] = data + except TypeError as err: + import array + if not isinstance(b, array.array): + raise err + b[:n] = array.array('b', data) + return n + + # - - - - - - - - - - - - - - - - - - - - - - - - + # context manager + + def __enter__(self): + if self._port is not None and not self.is_open: + self.open() + return self + + def __exit__(self, *args, **kwargs): + self.close() + + # - - - - - - - - - - - - - - - - - - - - - - - - + + def send_break(self, duration=0.25): + """\ + Send break condition. Timed, returns to idle state after given + duration. + """ + if not self.is_open: + raise PortNotOpenError() + self.break_condition = True + time.sleep(duration) + self.break_condition = False + + # - - - - - - - - - - - - - - - - - - - - - - - - + # backwards compatibility / deprecated functions + + def flushInput(self): + self.reset_input_buffer() + + def flushOutput(self): + self.reset_output_buffer() + + def inWaiting(self): + return self.in_waiting + + def sendBreak(self, duration=0.25): + self.send_break(duration) + + def setRTS(self, value=1): + self.rts = value + + def setDTR(self, value=1): + self.dtr = value + + def getCTS(self): + return self.cts + + def getDSR(self): + return self.dsr + + def getRI(self): + return self.ri + + def getCD(self): + return self.cd + + def setPort(self, port): + self.port = port + + @property + def writeTimeout(self): + return self.write_timeout + + @writeTimeout.setter + def writeTimeout(self, timeout): + self.write_timeout = timeout + + @property + def interCharTimeout(self): + return self.inter_byte_timeout + + @interCharTimeout.setter + def interCharTimeout(self, interCharTimeout): + self.inter_byte_timeout = interCharTimeout + + def getSettingsDict(self): + return self.get_settings() + + def applySettingsDict(self, d): + self.apply_settings(d) + + def isOpen(self): + return self.is_open + + # - - - - - - - - - - - - - - - - - - - - - - - - + # additional functionality + + def read_all(self): + """\ + Read all bytes currently available in the buffer of the OS. + """ + return self.read(self.in_waiting) + + def read_until(self, expected=LF, size=None): + """\ + Read until an expected sequence is found ('\n' by default), the size + is exceeded or until timeout occurs. + """ + lenterm = len(expected) + line = bytearray() + timeout = Timeout(self._timeout) + while True: + c = self.read(1) + if c: + line += c + if line[-lenterm:] == expected: + break + if size is not None and len(line) >= size: + break + else: + break + if timeout.expired(): + break + return bytes(line) + + def iread_until(self, *args, **kwargs): + """\ + Read lines, implemented as generator. It will raise StopIteration on + timeout (empty read). + """ + while True: + line = self.read_until(*args, **kwargs) + if not line: + break + yield line + + +# - - - - - - - - - - - - - - - - - - - - - - - - - +if __name__ == '__main__': + import sys + s = SerialBase() + sys.stdout.write('port name: {}\n'.format(s.name)) + sys.stdout.write('baud rates: {}\n'.format(s.BAUDRATES)) + sys.stdout.write('byte sizes: {}\n'.format(s.BYTESIZES)) + sys.stdout.write('parities: {}\n'.format(s.PARITIES)) + sys.stdout.write('stop bits: {}\n'.format(s.STOPBITS)) + sys.stdout.write('{}\n'.format(s)) diff --git a/extensions/km-plot/deps/serial/serialwin32.py b/extensions/km-plot/deps/serial/serialwin32.py new file mode 100644 index 0000000..e7da929 --- /dev/null +++ b/extensions/km-plot/deps/serial/serialwin32.py @@ -0,0 +1,477 @@ +#! python +# +# backend for Windows ("win32" incl. 32/64 bit support) +# +# (C) 2001-2020 Chris Liechti +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# SPDX-License-Identifier: BSD-3-Clause +# +# Initial patch to use ctypes by Giovanni Bajo + +from __future__ import absolute_import + +# pylint: disable=invalid-name,too-few-public-methods +import ctypes +import time +from serial import win32 + +import serial +from serial.serialutil import SerialBase, SerialException, to_bytes, PortNotOpenError, SerialTimeoutException + + +class Serial(SerialBase): + """Serial port implementation for Win32 based on ctypes.""" + + BAUDRATES = (50, 75, 110, 134, 150, 200, 300, 600, 1200, 1800, 2400, 4800, + 9600, 19200, 38400, 57600, 115200) + + def __init__(self, *args, **kwargs): + self._port_handle = None + self._overlapped_read = None + self._overlapped_write = None + super(Serial, self).__init__(*args, **kwargs) + + def open(self): + """\ + Open port with current settings. This may throw a SerialException + if the port cannot be opened. + """ + if self._port is None: + raise SerialException("Port must be configured before it can be used.") + if self.is_open: + raise SerialException("Port is already open.") + # the "\\.\COMx" format is required for devices other than COM1-COM8 + # not all versions of windows seem to support this properly + # so that the first few ports are used with the DOS device name + port = self.name + try: + if port.upper().startswith('COM') and int(port[3:]) > 8: + port = '\\\\.\\' + port + except ValueError: + # for like COMnotanumber + pass + self._port_handle = win32.CreateFile( + port, + win32.GENERIC_READ | win32.GENERIC_WRITE, + 0, # exclusive access + None, # no security + win32.OPEN_EXISTING, + win32.FILE_ATTRIBUTE_NORMAL | win32.FILE_FLAG_OVERLAPPED, + 0) + if self._port_handle == win32.INVALID_HANDLE_VALUE: + self._port_handle = None # 'cause __del__ is called anyway + raise SerialException("could not open port {!r}: {!r}".format(self.portstr, ctypes.WinError())) + + try: + self._overlapped_read = win32.OVERLAPPED() + self._overlapped_read.hEvent = win32.CreateEvent(None, 1, 0, None) + self._overlapped_write = win32.OVERLAPPED() + #~ self._overlapped_write.hEvent = win32.CreateEvent(None, 1, 0, None) + self._overlapped_write.hEvent = win32.CreateEvent(None, 0, 0, None) + + # Setup a 4k buffer + win32.SetupComm(self._port_handle, 4096, 4096) + + # Save original timeout values: + self._orgTimeouts = win32.COMMTIMEOUTS() + win32.GetCommTimeouts(self._port_handle, ctypes.byref(self._orgTimeouts)) + + self._reconfigure_port() + + # Clear buffers: + # Remove anything that was there + win32.PurgeComm( + self._port_handle, + win32.PURGE_TXCLEAR | win32.PURGE_TXABORT | + win32.PURGE_RXCLEAR | win32.PURGE_RXABORT) + except: + try: + self._close() + except: + # ignore any exception when closing the port + # also to keep original exception that happened when setting up + pass + self._port_handle = None + raise + else: + self.is_open = True + + def _reconfigure_port(self): + """Set communication parameters on opened port.""" + if not self._port_handle: + raise SerialException("Can only operate on a valid port handle") + + # Set Windows timeout values + # timeouts is a tuple with the following items: + # (ReadIntervalTimeout,ReadTotalTimeoutMultiplier, + # ReadTotalTimeoutConstant,WriteTotalTimeoutMultiplier, + # WriteTotalTimeoutConstant) + timeouts = win32.COMMTIMEOUTS() + if self._timeout is None: + pass # default of all zeros is OK + elif self._timeout == 0: + timeouts.ReadIntervalTimeout = win32.MAXDWORD + else: + timeouts.ReadTotalTimeoutConstant = max(int(self._timeout * 1000), 1) + if self._timeout != 0 and self._inter_byte_timeout is not None: + timeouts.ReadIntervalTimeout = max(int(self._inter_byte_timeout * 1000), 1) + + if self._write_timeout is None: + pass + elif self._write_timeout == 0: + timeouts.WriteTotalTimeoutConstant = win32.MAXDWORD + else: + timeouts.WriteTotalTimeoutConstant = max(int(self._write_timeout * 1000), 1) + win32.SetCommTimeouts(self._port_handle, ctypes.byref(timeouts)) + + win32.SetCommMask(self._port_handle, win32.EV_ERR) + + # Setup the connection info. + # Get state and modify it: + comDCB = win32.DCB() + win32.GetCommState(self._port_handle, ctypes.byref(comDCB)) + comDCB.BaudRate = self._baudrate + + if self._bytesize == serial.FIVEBITS: + comDCB.ByteSize = 5 + elif self._bytesize == serial.SIXBITS: + comDCB.ByteSize = 6 + elif self._bytesize == serial.SEVENBITS: + comDCB.ByteSize = 7 + elif self._bytesize == serial.EIGHTBITS: + comDCB.ByteSize = 8 + else: + raise ValueError("Unsupported number of data bits: {!r}".format(self._bytesize)) + + if self._parity == serial.PARITY_NONE: + comDCB.Parity = win32.NOPARITY + comDCB.fParity = 0 # Disable Parity Check + elif self._parity == serial.PARITY_EVEN: + comDCB.Parity = win32.EVENPARITY + comDCB.fParity = 1 # Enable Parity Check + elif self._parity == serial.PARITY_ODD: + comDCB.Parity = win32.ODDPARITY + comDCB.fParity = 1 # Enable Parity Check + elif self._parity == serial.PARITY_MARK: + comDCB.Parity = win32.MARKPARITY + comDCB.fParity = 1 # Enable Parity Check + elif self._parity == serial.PARITY_SPACE: + comDCB.Parity = win32.SPACEPARITY + comDCB.fParity = 1 # Enable Parity Check + else: + raise ValueError("Unsupported parity mode: {!r}".format(self._parity)) + + if self._stopbits == serial.STOPBITS_ONE: + comDCB.StopBits = win32.ONESTOPBIT + elif self._stopbits == serial.STOPBITS_ONE_POINT_FIVE: + comDCB.StopBits = win32.ONE5STOPBITS + elif self._stopbits == serial.STOPBITS_TWO: + comDCB.StopBits = win32.TWOSTOPBITS + else: + raise ValueError("Unsupported number of stop bits: {!r}".format(self._stopbits)) + + comDCB.fBinary = 1 # Enable Binary Transmission + # Char. w/ Parity-Err are replaced with 0xff (if fErrorChar is set to TRUE) + if self._rs485_mode is None: + if self._rtscts: + comDCB.fRtsControl = win32.RTS_CONTROL_HANDSHAKE + else: + comDCB.fRtsControl = win32.RTS_CONTROL_ENABLE if self._rts_state else win32.RTS_CONTROL_DISABLE + comDCB.fOutxCtsFlow = self._rtscts + else: + # checks for unsupported settings + # XXX verify if platform really does not have a setting for those + if not self._rs485_mode.rts_level_for_tx: + raise ValueError( + 'Unsupported value for RS485Settings.rts_level_for_tx: {!r} (only True is allowed)'.format( + self._rs485_mode.rts_level_for_tx,)) + if self._rs485_mode.rts_level_for_rx: + raise ValueError( + 'Unsupported value for RS485Settings.rts_level_for_rx: {!r} (only False is allowed)'.format( + self._rs485_mode.rts_level_for_rx,)) + if self._rs485_mode.delay_before_tx is not None: + raise ValueError( + 'Unsupported value for RS485Settings.delay_before_tx: {!r} (only None is allowed)'.format( + self._rs485_mode.delay_before_tx,)) + if self._rs485_mode.delay_before_rx is not None: + raise ValueError( + 'Unsupported value for RS485Settings.delay_before_rx: {!r} (only None is allowed)'.format( + self._rs485_mode.delay_before_rx,)) + if self._rs485_mode.loopback: + raise ValueError( + 'Unsupported value for RS485Settings.loopback: {!r} (only False is allowed)'.format( + self._rs485_mode.loopback,)) + comDCB.fRtsControl = win32.RTS_CONTROL_TOGGLE + comDCB.fOutxCtsFlow = 0 + + if self._dsrdtr: + comDCB.fDtrControl = win32.DTR_CONTROL_HANDSHAKE + else: + comDCB.fDtrControl = win32.DTR_CONTROL_ENABLE if self._dtr_state else win32.DTR_CONTROL_DISABLE + comDCB.fOutxDsrFlow = self._dsrdtr + comDCB.fOutX = self._xonxoff + comDCB.fInX = self._xonxoff + comDCB.fNull = 0 + comDCB.fErrorChar = 0 + comDCB.fAbortOnError = 0 + comDCB.XonChar = serial.XON + comDCB.XoffChar = serial.XOFF + + if not win32.SetCommState(self._port_handle, ctypes.byref(comDCB)): + raise SerialException( + 'Cannot configure port, something went wrong. ' + 'Original message: {!r}'.format(ctypes.WinError())) + + #~ def __del__(self): + #~ self.close() + + def _close(self): + """internal close port helper""" + if self._port_handle is not None: + # Restore original timeout values: + win32.SetCommTimeouts(self._port_handle, self._orgTimeouts) + if self._overlapped_read is not None: + self.cancel_read() + win32.CloseHandle(self._overlapped_read.hEvent) + self._overlapped_read = None + if self._overlapped_write is not None: + self.cancel_write() + win32.CloseHandle(self._overlapped_write.hEvent) + self._overlapped_write = None + win32.CloseHandle(self._port_handle) + self._port_handle = None + + def close(self): + """Close port""" + if self.is_open: + self._close() + self.is_open = False + + # - - - - - - - - - - - - - - - - - - - - - - - - + + @property + def in_waiting(self): + """Return the number of bytes currently in the input buffer.""" + flags = win32.DWORD() + comstat = win32.COMSTAT() + if not win32.ClearCommError(self._port_handle, ctypes.byref(flags), ctypes.byref(comstat)): + raise SerialException("ClearCommError failed ({!r})".format(ctypes.WinError())) + return comstat.cbInQue + + def read(self, size=1): + """\ + Read size bytes from the serial port. If a timeout is set it may + return less characters as requested. With no timeout it will block + until the requested number of bytes is read. + """ + if not self.is_open: + raise PortNotOpenError() + if size > 0: + win32.ResetEvent(self._overlapped_read.hEvent) + flags = win32.DWORD() + comstat = win32.COMSTAT() + if not win32.ClearCommError(self._port_handle, ctypes.byref(flags), ctypes.byref(comstat)): + raise SerialException("ClearCommError failed ({!r})".format(ctypes.WinError())) + n = min(comstat.cbInQue, size) if self.timeout == 0 else size + if n > 0: + buf = ctypes.create_string_buffer(n) + rc = win32.DWORD() + read_ok = win32.ReadFile( + self._port_handle, + buf, + n, + ctypes.byref(rc), + ctypes.byref(self._overlapped_read)) + if not read_ok and win32.GetLastError() not in (win32.ERROR_SUCCESS, win32.ERROR_IO_PENDING): + raise SerialException("ReadFile failed ({!r})".format(ctypes.WinError())) + result_ok = win32.GetOverlappedResult( + self._port_handle, + ctypes.byref(self._overlapped_read), + ctypes.byref(rc), + True) + if not result_ok: + if win32.GetLastError() != win32.ERROR_OPERATION_ABORTED: + raise SerialException("GetOverlappedResult failed ({!r})".format(ctypes.WinError())) + read = buf.raw[:rc.value] + else: + read = bytes() + else: + read = bytes() + return bytes(read) + + def write(self, data): + """Output the given byte string over the serial port.""" + if not self.is_open: + raise PortNotOpenError() + #~ if not isinstance(data, (bytes, bytearray)): + #~ raise TypeError('expected %s or bytearray, got %s' % (bytes, type(data))) + # convert data (needed in case of memoryview instance: Py 3.1 io lib), ctypes doesn't like memoryview + data = to_bytes(data) + if data: + #~ win32event.ResetEvent(self._overlapped_write.hEvent) + n = win32.DWORD() + success = win32.WriteFile(self._port_handle, data, len(data), ctypes.byref(n), self._overlapped_write) + if self._write_timeout != 0: # if blocking (None) or w/ write timeout (>0) + if not success and win32.GetLastError() not in (win32.ERROR_SUCCESS, win32.ERROR_IO_PENDING): + raise SerialException("WriteFile failed ({!r})".format(ctypes.WinError())) + + # Wait for the write to complete. + #~ win32.WaitForSingleObject(self._overlapped_write.hEvent, win32.INFINITE) + win32.GetOverlappedResult(self._port_handle, self._overlapped_write, ctypes.byref(n), True) + if win32.GetLastError() == win32.ERROR_OPERATION_ABORTED: + return n.value # canceled IO is no error + if n.value != len(data): + raise SerialTimeoutException('Write timeout') + return n.value + else: + errorcode = win32.ERROR_SUCCESS if success else win32.GetLastError() + if errorcode in (win32.ERROR_INVALID_USER_BUFFER, win32.ERROR_NOT_ENOUGH_MEMORY, + win32.ERROR_OPERATION_ABORTED): + return 0 + elif errorcode in (win32.ERROR_SUCCESS, win32.ERROR_IO_PENDING): + # no info on true length provided by OS function in async mode + return len(data) + else: + raise SerialException("WriteFile failed ({!r})".format(ctypes.WinError())) + else: + return 0 + + def flush(self): + """\ + Flush of file like objects. In this case, wait until all data + is written. + """ + while self.out_waiting: + time.sleep(0.05) + # XXX could also use WaitCommEvent with mask EV_TXEMPTY, but it would + # require overlapped IO and it's also only possible to set a single mask + # on the port--- + + def reset_input_buffer(self): + """Clear input buffer, discarding all that is in the buffer.""" + if not self.is_open: + raise PortNotOpenError() + win32.PurgeComm(self._port_handle, win32.PURGE_RXCLEAR | win32.PURGE_RXABORT) + + def reset_output_buffer(self): + """\ + Clear output buffer, aborting the current output and discarding all + that is in the buffer. + """ + if not self.is_open: + raise PortNotOpenError() + win32.PurgeComm(self._port_handle, win32.PURGE_TXCLEAR | win32.PURGE_TXABORT) + + def _update_break_state(self): + """Set break: Controls TXD. When active, to transmitting is possible.""" + if not self.is_open: + raise PortNotOpenError() + if self._break_state: + win32.SetCommBreak(self._port_handle) + else: + win32.ClearCommBreak(self._port_handle) + + def _update_rts_state(self): + """Set terminal status line: Request To Send""" + if self._rts_state: + win32.EscapeCommFunction(self._port_handle, win32.SETRTS) + else: + win32.EscapeCommFunction(self._port_handle, win32.CLRRTS) + + def _update_dtr_state(self): + """Set terminal status line: Data Terminal Ready""" + if self._dtr_state: + win32.EscapeCommFunction(self._port_handle, win32.SETDTR) + else: + win32.EscapeCommFunction(self._port_handle, win32.CLRDTR) + + def _GetCommModemStatus(self): + if not self.is_open: + raise PortNotOpenError() + stat = win32.DWORD() + win32.GetCommModemStatus(self._port_handle, ctypes.byref(stat)) + return stat.value + + @property + def cts(self): + """Read terminal status line: Clear To Send""" + return win32.MS_CTS_ON & self._GetCommModemStatus() != 0 + + @property + def dsr(self): + """Read terminal status line: Data Set Ready""" + return win32.MS_DSR_ON & self._GetCommModemStatus() != 0 + + @property + def ri(self): + """Read terminal status line: Ring Indicator""" + return win32.MS_RING_ON & self._GetCommModemStatus() != 0 + + @property + def cd(self): + """Read terminal status line: Carrier Detect""" + return win32.MS_RLSD_ON & self._GetCommModemStatus() != 0 + + # - - platform specific - - - - + + def set_buffer_size(self, rx_size=4096, tx_size=None): + """\ + Recommend a buffer size to the driver (device driver can ignore this + value). Must be called after the port is opened. + """ + if tx_size is None: + tx_size = rx_size + win32.SetupComm(self._port_handle, rx_size, tx_size) + + def set_output_flow_control(self, enable=True): + """\ + Manually control flow - when software flow control is enabled. + This will do the same as if XON (true) or XOFF (false) are received + from the other device and control the transmission accordingly. + WARNING: this function is not portable to different platforms! + """ + if not self.is_open: + raise PortNotOpenError() + if enable: + win32.EscapeCommFunction(self._port_handle, win32.SETXON) + else: + win32.EscapeCommFunction(self._port_handle, win32.SETXOFF) + + @property + def out_waiting(self): + """Return how many bytes the in the outgoing buffer""" + flags = win32.DWORD() + comstat = win32.COMSTAT() + if not win32.ClearCommError(self._port_handle, ctypes.byref(flags), ctypes.byref(comstat)): + raise SerialException("ClearCommError failed ({!r})".format(ctypes.WinError())) + return comstat.cbOutQue + + def _cancel_overlapped_io(self, overlapped): + """Cancel a blocking read operation, may be called from other thread""" + # check if read operation is pending + rc = win32.DWORD() + err = win32.GetOverlappedResult( + self._port_handle, + ctypes.byref(overlapped), + ctypes.byref(rc), + False) + if not err and win32.GetLastError() in (win32.ERROR_IO_PENDING, win32.ERROR_IO_INCOMPLETE): + # cancel, ignoring any errors (e.g. it may just have finished on its own) + win32.CancelIoEx(self._port_handle, overlapped) + + def cancel_read(self): + """Cancel a blocking read operation, may be called from other thread""" + self._cancel_overlapped_io(self._overlapped_read) + + def cancel_write(self): + """Cancel a blocking write operation, may be called from other thread""" + self._cancel_overlapped_io(self._overlapped_write) + + @SerialBase.exclusive.setter + def exclusive(self, exclusive): + """Change the exclusive access setting.""" + if exclusive is not None and not exclusive: + raise ValueError('win32 only supports exclusive access (not: {})'.format(exclusive)) + else: + serial.SerialBase.exclusive.__set__(self, exclusive) diff --git a/extensions/km-plot/deps/serial/threaded/__init__.py b/extensions/km-plot/deps/serial/threaded/__init__.py new file mode 100644 index 0000000..b8940b6 --- /dev/null +++ b/extensions/km-plot/deps/serial/threaded/__init__.py @@ -0,0 +1,297 @@ +#!/usr/bin/env python3 +# +# Working with threading and pySerial +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2015-2016 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause +"""\ +Support threading with serial ports. +""" +from __future__ import absolute_import + +import serial +import threading + + +class Protocol(object): + """\ + Protocol as used by the ReaderThread. This base class provides empty + implementations of all methods. + """ + + def connection_made(self, transport): + """Called when reader thread is started""" + + def data_received(self, data): + """Called with snippets received from the serial port""" + + def connection_lost(self, exc): + """\ + Called when the serial port is closed or the reader loop terminated + otherwise. + """ + if isinstance(exc, Exception): + raise exc + + +class Packetizer(Protocol): + """ + Read binary packets from serial port. Packets are expected to be terminated + with a TERMINATOR byte (null byte by default). + + The class also keeps track of the transport. + """ + + TERMINATOR = b'\0' + + def __init__(self): + self.buffer = bytearray() + self.transport = None + + def connection_made(self, transport): + """Store transport""" + self.transport = transport + + def connection_lost(self, exc): + """Forget transport""" + self.transport = None + super(Packetizer, self).connection_lost(exc) + + def data_received(self, data): + """Buffer received data, find TERMINATOR, call handle_packet""" + self.buffer.extend(data) + while self.TERMINATOR in self.buffer: + packet, self.buffer = self.buffer.split(self.TERMINATOR, 1) + self.handle_packet(packet) + + def handle_packet(self, packet): + """Process packets - to be overridden by subclassing""" + raise NotImplementedError('please implement functionality in handle_packet') + + +class FramedPacket(Protocol): + """ + Read binary packets. Packets are expected to have a start and stop marker. + + The class also keeps track of the transport. + """ + + START = b'(' + STOP = b')' + + def __init__(self): + self.packet = bytearray() + self.in_packet = False + self.transport = None + + def connection_made(self, transport): + """Store transport""" + self.transport = transport + + def connection_lost(self, exc): + """Forget transport""" + self.transport = None + self.in_packet = False + del self.packet[:] + super(FramedPacket, self).connection_lost(exc) + + def data_received(self, data): + """Find data enclosed in START/STOP, call handle_packet""" + for byte in serial.iterbytes(data): + if byte == self.START: + self.in_packet = True + elif byte == self.STOP: + self.in_packet = False + self.handle_packet(bytes(self.packet)) # make read-only copy + del self.packet[:] + elif self.in_packet: + self.packet.extend(byte) + else: + self.handle_out_of_packet_data(byte) + + def handle_packet(self, packet): + """Process packets - to be overridden by subclassing""" + raise NotImplementedError('please implement functionality in handle_packet') + + def handle_out_of_packet_data(self, data): + """Process data that is received outside of packets""" + pass + + +class LineReader(Packetizer): + """ + Read and write (Unicode) lines from/to serial port. + The encoding is applied. + """ + + TERMINATOR = b'\r\n' + ENCODING = 'utf-8' + UNICODE_HANDLING = 'replace' + + def handle_packet(self, packet): + self.handle_line(packet.decode(self.ENCODING, self.UNICODE_HANDLING)) + + def handle_line(self, line): + """Process one line - to be overridden by subclassing""" + raise NotImplementedError('please implement functionality in handle_line') + + def write_line(self, text): + """ + Write text to the transport. ``text`` is a Unicode string and the encoding + is applied before sending ans also the newline is append. + """ + # + is not the best choice but bytes does not support % or .format in py3 and we want a single write call + self.transport.write(text.encode(self.ENCODING, self.UNICODE_HANDLING) + self.TERMINATOR) + + +class ReaderThread(threading.Thread): + """\ + Implement a serial port read loop and dispatch to a Protocol instance (like + the asyncio.Protocol) but do it with threads. + + Calls to close() will close the serial port but it is also possible to just + stop() this thread and continue the serial port instance otherwise. + """ + + def __init__(self, serial_instance, protocol_factory): + """\ + Initialize thread. + + Note that the serial_instance' timeout is set to one second! + Other settings are not changed. + """ + super(ReaderThread, self).__init__() + self.daemon = True + self.serial = serial_instance + self.protocol_factory = protocol_factory + self.alive = True + self._lock = threading.Lock() + self._connection_made = threading.Event() + self.protocol = None + + def stop(self): + """Stop the reader thread""" + self.alive = False + if hasattr(self.serial, 'cancel_read'): + self.serial.cancel_read() + self.join(2) + + def run(self): + """Reader loop""" + if not hasattr(self.serial, 'cancel_read'): + self.serial.timeout = 1 + self.protocol = self.protocol_factory() + try: + self.protocol.connection_made(self) + except Exception as e: + self.alive = False + self.protocol.connection_lost(e) + self._connection_made.set() + return + error = None + self._connection_made.set() + while self.alive and self.serial.is_open: + try: + # read all that is there or wait for one byte (blocking) + data = self.serial.read(self.serial.in_waiting or 1) + except serial.SerialException as e: + # probably some I/O problem such as disconnected USB serial + # adapters -> exit + error = e + break + else: + if data: + # make a separated try-except for called user code + try: + self.protocol.data_received(data) + except Exception as e: + error = e + break + self.alive = False + self.protocol.connection_lost(error) + self.protocol = None + + def write(self, data): + """Thread safe writing (uses lock)""" + with self._lock: + return self.serial.write(data) + + def close(self): + """Close the serial port and exit reader thread (uses lock)""" + # use the lock to let other threads finish writing + with self._lock: + # first stop reading, so that closing can be done on idle port + self.stop() + self.serial.close() + + def connect(self): + """ + Wait until connection is set up and return the transport and protocol + instances. + """ + if self.alive: + self._connection_made.wait() + if not self.alive: + raise RuntimeError('connection_lost already called') + return (self, self.protocol) + else: + raise RuntimeError('already stopped') + + # - - context manager, returns protocol + + def __enter__(self): + """\ + Enter context handler. May raise RuntimeError in case the connection + could not be created. + """ + self.start() + self._connection_made.wait() + if not self.alive: + raise RuntimeError('connection_lost already called') + return self.protocol + + def __exit__(self, exc_type, exc_val, exc_tb): + """Leave context: close port""" + self.close() + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +# test +if __name__ == '__main__': + # pylint: disable=wrong-import-position + import sys + import time + import traceback + + #~ PORT = 'spy:///dev/ttyUSB0' + PORT = 'loop://' + + class PrintLines(LineReader): + def connection_made(self, transport): + super(PrintLines, self).connection_made(transport) + sys.stdout.write('port opened\n') + self.write_line('hello world') + + def handle_line(self, data): + sys.stdout.write('line received: {!r}\n'.format(data)) + + def connection_lost(self, exc): + if exc: + traceback.print_exc(exc) + sys.stdout.write('port closed\n') + + ser = serial.serial_for_url(PORT, baudrate=115200, timeout=1) + with ReaderThread(ser, PrintLines) as protocol: + protocol.write_line('hello') + time.sleep(2) + + # alternative usage + ser = serial.serial_for_url(PORT, baudrate=115200, timeout=1) + t = ReaderThread(ser, PrintLines) + t.start() + transport, protocol = t.connect() + protocol.write_line('hello') + time.sleep(2) + t.close() diff --git a/extensions/km-plot/deps/serial/tools/__init__.py b/extensions/km-plot/deps/serial/tools/__init__.py new file mode 100644 index 0000000..e69de29 diff --git a/extensions/km-plot/deps/serial/tools/hexlify_codec.py b/extensions/km-plot/deps/serial/tools/hexlify_codec.py new file mode 100644 index 0000000..bd8f6b0 --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/hexlify_codec.py @@ -0,0 +1,126 @@ +#! python +# +# This is a codec to create and decode hexdumps with spaces between characters. used by miniterm. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2015-2016 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause +"""\ +Python 'hex' Codec - 2-digit hex with spaces content transfer encoding. + +Encode and decode may be a bit missleading at first sight... + +The textual representation is a hex dump: e.g. "40 41" +The "encoded" data of this is the binary form, e.g. b"@A" + +Therefore decoding is binary to text and thus converting binary data to hex dump. + +""" + +from __future__ import absolute_import + +import codecs +import serial + + +try: + unicode +except (NameError, AttributeError): + unicode = str # for Python 3, pylint: disable=redefined-builtin,invalid-name + + +HEXDIGITS = '0123456789ABCDEF' + + +# Codec APIs + +def hex_encode(data, errors='strict'): + """'40 41 42' -> b'@ab'""" + return (serial.to_bytes([int(h, 16) for h in data.split()]), len(data)) + + +def hex_decode(data, errors='strict'): + """b'@ab' -> '40 41 42'""" + return (unicode(''.join('{:02X} '.format(ord(b)) for b in serial.iterbytes(data))), len(data)) + + +class Codec(codecs.Codec): + def encode(self, data, errors='strict'): + """'40 41 42' -> b'@ab'""" + return serial.to_bytes([int(h, 16) for h in data.split()]) + + def decode(self, data, errors='strict'): + """b'@ab' -> '40 41 42'""" + return unicode(''.join('{:02X} '.format(ord(b)) for b in serial.iterbytes(data))) + + +class IncrementalEncoder(codecs.IncrementalEncoder): + """Incremental hex encoder""" + + def __init__(self, errors='strict'): + self.errors = errors + self.state = 0 + + def reset(self): + self.state = 0 + + def getstate(self): + return self.state + + def setstate(self, state): + self.state = state + + def encode(self, data, final=False): + """\ + Incremental encode, keep track of digits and emit a byte when a pair + of hex digits is found. The space is optional unless the error + handling is defined to be 'strict'. + """ + state = self.state + encoded = [] + for c in data.upper(): + if c in HEXDIGITS: + z = HEXDIGITS.index(c) + if state: + encoded.append(z + (state & 0xf0)) + state = 0 + else: + state = 0x100 + (z << 4) + elif c == ' ': # allow spaces to separate values + if state and self.errors == 'strict': + raise UnicodeError('odd number of hex digits') + state = 0 + else: + if self.errors == 'strict': + raise UnicodeError('non-hex digit found: {!r}'.format(c)) + self.state = state + return serial.to_bytes(encoded) + + +class IncrementalDecoder(codecs.IncrementalDecoder): + """Incremental decoder""" + def decode(self, data, final=False): + return unicode(''.join('{:02X} '.format(ord(b)) for b in serial.iterbytes(data))) + + +class StreamWriter(Codec, codecs.StreamWriter): + """Combination of hexlify codec and StreamWriter""" + + +class StreamReader(Codec, codecs.StreamReader): + """Combination of hexlify codec and StreamReader""" + + +def getregentry(): + """encodings module API""" + return codecs.CodecInfo( + name='hexlify', + encode=hex_encode, + decode=hex_decode, + incrementalencoder=IncrementalEncoder, + incrementaldecoder=IncrementalDecoder, + streamwriter=StreamWriter, + streamreader=StreamReader, + #~ _is_text_encoding=True, + ) diff --git a/extensions/km-plot/deps/serial/tools/list_ports.py b/extensions/km-plot/deps/serial/tools/list_ports.py new file mode 100644 index 0000000..0d7e3d4 --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/list_ports.py @@ -0,0 +1,110 @@ +#!/usr/bin/env python +# +# Serial port enumeration. Console tool and backend selection. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2011-2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +"""\ +This module will provide a function called comports that returns an +iterable (generator or list) that will enumerate available com ports. Note that +on some systems non-existent ports may be listed. + +Additionally a grep function is supplied that can be used to search for ports +based on their descriptions or hardware ID. +""" + +from __future__ import absolute_import + +import sys +import os +import re + +# chose an implementation, depending on os +#~ if sys.platform == 'cli': +#~ else: +if os.name == 'nt': # sys.platform == 'win32': + from serial.tools.list_ports_windows import comports +elif os.name == 'posix': + from serial.tools.list_ports_posix import comports +#~ elif os.name == 'java': +else: + raise ImportError("Sorry: no implementation for your platform ('{}') available".format(os.name)) + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - + + +def grep(regexp, include_links=False): + """\ + Search for ports using a regular expression. Port name, description and + hardware ID are searched. The function returns an iterable that returns the + same tuples as comport() would do. + """ + r = re.compile(regexp, re.I) + for info in comports(include_links): + port, desc, hwid = info + if r.search(port) or r.search(desc) or r.search(hwid): + yield info + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +def main(): + import argparse + + parser = argparse.ArgumentParser(description='Serial port enumeration') + + parser.add_argument( + 'regexp', + nargs='?', + help='only show ports that match this regex') + + parser.add_argument( + '-v', '--verbose', + action='store_true', + help='show more messages') + + parser.add_argument( + '-q', '--quiet', + action='store_true', + help='suppress all messages') + + parser.add_argument( + '-n', + type=int, + help='only output the N-th entry') + + parser.add_argument( + '-s', '--include-links', + action='store_true', + help='include entries that are symlinks to real devices') + + args = parser.parse_args() + + hits = 0 + # get iteraror w/ or w/o filter + if args.regexp: + if not args.quiet: + sys.stderr.write("Filtered list with regexp: {!r}\n".format(args.regexp)) + iterator = sorted(grep(args.regexp, include_links=args.include_links)) + else: + iterator = sorted(comports(include_links=args.include_links)) + # list them + for n, (port, desc, hwid) in enumerate(iterator, 1): + if args.n is None or args.n == n: + sys.stdout.write("{:20}\n".format(port)) + if args.verbose: + sys.stdout.write(" desc: {}\n".format(desc)) + sys.stdout.write(" hwid: {}\n".format(hwid)) + hits += 1 + if not args.quiet: + if hits: + sys.stderr.write("{} ports found\n".format(hits)) + else: + sys.stderr.write("no ports found\n") + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +# test +if __name__ == '__main__': + main() diff --git a/extensions/km-plot/deps/serial/tools/list_ports_common.py b/extensions/km-plot/deps/serial/tools/list_ports_common.py new file mode 100644 index 0000000..617f3dc --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/list_ports_common.py @@ -0,0 +1,121 @@ +#!/usr/bin/env python +# +# This is a helper module for the various platform dependent list_port +# implementations. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +import re +import glob +import os +import os.path + + +def numsplit(text): + """\ + Convert string into a list of texts and numbers in order to support a + natural sorting. + """ + result = [] + for group in re.split(r'(\d+)', text): + if group: + try: + group = int(group) + except ValueError: + pass + result.append(group) + return result + + +class ListPortInfo(object): + """Info collection base class for serial ports""" + + def __init__(self, device, skip_link_detection=False): + self.device = device + self.name = os.path.basename(device) + self.description = 'n/a' + self.hwid = 'n/a' + # USB specific data + self.vid = None + self.pid = None + self.serial_number = None + self.location = None + self.manufacturer = None + self.product = None + self.interface = None + # special handling for links + if not skip_link_detection and device is not None and os.path.islink(device): + self.hwid = 'LINK={}'.format(os.path.realpath(device)) + + def usb_description(self): + """return a short string to name the port based on USB info""" + if self.interface is not None: + return '{} - {}'.format(self.product, self.interface) + elif self.product is not None: + return self.product + else: + return self.name + + def usb_info(self): + """return a string with USB related information about device""" + return 'USB VID:PID={:04X}:{:04X}{}{}'.format( + self.vid or 0, + self.pid or 0, + ' SER={}'.format(self.serial_number) if self.serial_number is not None else '', + ' LOCATION={}'.format(self.location) if self.location is not None else '') + + def apply_usb_info(self): + """update description and hwid from USB data""" + self.description = self.usb_description() + self.hwid = self.usb_info() + + def __eq__(self, other): + return isinstance(other, ListPortInfo) and self.device == other.device + + def __hash__(self): + return hash(self.device) + + def __lt__(self, other): + if not isinstance(other, ListPortInfo): + raise TypeError('unorderable types: {}() and {}()'.format( + type(self).__name__, + type(other).__name__)) + return numsplit(self.device) < numsplit(other.device) + + def __str__(self): + return '{} - {}'.format(self.device, self.description) + + def __getitem__(self, index): + """Item access: backwards compatible -> (port, desc, hwid)""" + if index == 0: + return self.device + elif index == 1: + return self.description + elif index == 2: + return self.hwid + else: + raise IndexError('{} > 2'.format(index)) + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +def list_links(devices): + """\ + search all /dev devices and look for symlinks to known ports already + listed in devices. + """ + links = [] + for device in glob.glob('/dev/*'): + if os.path.islink(device) and os.path.realpath(device) in devices: + links.append(device) + return links + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +# test +if __name__ == '__main__': + print(ListPortInfo('dummy')) diff --git a/extensions/km-plot/deps/serial/tools/list_ports_linux.py b/extensions/km-plot/deps/serial/tools/list_ports_linux.py new file mode 100644 index 0000000..c8c1cfc --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/list_ports_linux.py @@ -0,0 +1,109 @@ +#!/usr/bin/env python +# +# This is a module that gathers a list of serial ports including details on +# GNU/Linux systems. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2011-2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +import glob +import os +from serial.tools import list_ports_common + + +class SysFS(list_ports_common.ListPortInfo): + """Wrapper for easy sysfs access and device info""" + + def __init__(self, device): + super(SysFS, self).__init__(device) + # special handling for links + if device is not None and os.path.islink(device): + device = os.path.realpath(device) + is_link = True + else: + is_link = False + self.usb_device_path = None + if os.path.exists('/sys/class/tty/{}/device'.format(self.name)): + self.device_path = os.path.realpath('/sys/class/tty/{}/device'.format(self.name)) + self.subsystem = os.path.basename(os.path.realpath(os.path.join(self.device_path, 'subsystem'))) + else: + self.device_path = None + self.subsystem = None + # check device type + if self.subsystem == 'usb-serial': + self.usb_interface_path = os.path.dirname(self.device_path) + elif self.subsystem == 'usb': + self.usb_interface_path = self.device_path + else: + self.usb_interface_path = None + # fill-in info for USB devices + if self.usb_interface_path is not None: + self.usb_device_path = os.path.dirname(self.usb_interface_path) + + try: + num_if = int(self.read_line(self.usb_device_path, 'bNumInterfaces')) + except ValueError: + num_if = 1 + + self.vid = int(self.read_line(self.usb_device_path, 'idVendor'), 16) + self.pid = int(self.read_line(self.usb_device_path, 'idProduct'), 16) + self.serial_number = self.read_line(self.usb_device_path, 'serial') + if num_if > 1: # multi interface devices like FT4232 + self.location = os.path.basename(self.usb_interface_path) + else: + self.location = os.path.basename(self.usb_device_path) + + self.manufacturer = self.read_line(self.usb_device_path, 'manufacturer') + self.product = self.read_line(self.usb_device_path, 'product') + self.interface = self.read_line(self.usb_interface_path, 'interface') + + if self.subsystem in ('usb', 'usb-serial'): + self.apply_usb_info() + #~ elif self.subsystem in ('pnp', 'amba'): # PCI based devices, raspi + elif self.subsystem == 'pnp': # PCI based devices + self.description = self.name + self.hwid = self.read_line(self.device_path, 'id') + elif self.subsystem == 'amba': # raspi + self.description = self.name + self.hwid = os.path.basename(self.device_path) + + if is_link: + self.hwid += ' LINK={}'.format(device) + + def read_line(self, *args): + """\ + Helper function to read a single line from a file. + One or more parameters are allowed, they are joined with os.path.join. + Returns None on errors.. + """ + try: + with open(os.path.join(*args)) as f: + line = f.readline().strip() + return line + except IOError: + return None + + +def comports(include_links=False): + devices = glob.glob('/dev/ttyS*') # built-in serial ports + devices.extend(glob.glob('/dev/ttyUSB*')) # usb-serial with own driver + devices.extend(glob.glob('/dev/ttyXRUSB*')) # xr-usb-serial port exar (DELL Edge 3001) + devices.extend(glob.glob('/dev/ttyACM*')) # usb-serial with CDC-ACM profile + devices.extend(glob.glob('/dev/ttyAMA*')) # ARM internal port (raspi) + devices.extend(glob.glob('/dev/rfcomm*')) # BT serial devices + devices.extend(glob.glob('/dev/ttyAP*')) # Advantech multi-port serial controllers + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [info + for info in [SysFS(d) for d in devices] + if info.subsystem != "platform"] # hide non-present internal serial ports + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +# test +if __name__ == '__main__': + for info in sorted(comports()): + print("{0}: {0.subsystem}".format(info)) diff --git a/extensions/km-plot/deps/serial/tools/list_ports_osx.py b/extensions/km-plot/deps/serial/tools/list_ports_osx.py new file mode 100644 index 0000000..51b4e8c --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/list_ports_osx.py @@ -0,0 +1,299 @@ +#!/usr/bin/env python +# +# This is a module that gathers a list of serial ports including details on OSX +# +# code originally from https://github.com/makerbot/pyserial/tree/master/serial/tools +# with contributions from cibomahto, dgs3, FarMcKon, tedbrandston +# and modifications by cliechti, hoihu, hardkrash +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2013-2020 +# +# SPDX-License-Identifier: BSD-3-Clause + + +# List all of the callout devices in OS/X by querying IOKit. + +# See the following for a reference of how to do this: +# http://developer.apple.com/library/mac/#documentation/DeviceDrivers/Conceptual/WorkingWSerial/WWSerial_SerialDevs/SerialDevices.html#//apple_ref/doc/uid/TP30000384-CIHGEAFD + +# More help from darwin_hid.py + +# Also see the 'IORegistryExplorer' for an idea of what we are actually searching + +from __future__ import absolute_import + +import ctypes + +from serial.tools import list_ports_common + +iokit = ctypes.cdll.LoadLibrary('/System/Library/Frameworks/IOKit.framework/IOKit') +cf = ctypes.cdll.LoadLibrary('/System/Library/Frameworks/CoreFoundation.framework/CoreFoundation') + +# kIOMasterPortDefault is no longer exported in BigSur but no biggie, using NULL works just the same +kIOMasterPortDefault = 0 # WAS: ctypes.c_void_p.in_dll(iokit, "kIOMasterPortDefault") +kCFAllocatorDefault = ctypes.c_void_p.in_dll(cf, "kCFAllocatorDefault") + +kCFStringEncodingMacRoman = 0 +kCFStringEncodingUTF8 = 0x08000100 + +# defined in `IOKit/usb/USBSpec.h` +kUSBVendorString = 'USB Vendor Name' +kUSBSerialNumberString = 'USB Serial Number' + +# `io_name_t` defined as `typedef char io_name_t[128];` +# in `device/device_types.h` +io_name_size = 128 + +# defined in `mach/kern_return.h` +KERN_SUCCESS = 0 +# kern_return_t defined as `typedef int kern_return_t;` in `mach/i386/kern_return.h` +kern_return_t = ctypes.c_int + +iokit.IOServiceMatching.restype = ctypes.c_void_p + +iokit.IOServiceGetMatchingServices.argtypes = [ctypes.c_void_p, ctypes.c_void_p, ctypes.c_void_p] +iokit.IOServiceGetMatchingServices.restype = kern_return_t + +iokit.IORegistryEntryGetParentEntry.argtypes = [ctypes.c_void_p, ctypes.c_void_p, ctypes.c_void_p] +iokit.IOServiceGetMatchingServices.restype = kern_return_t + +iokit.IORegistryEntryCreateCFProperty.argtypes = [ctypes.c_void_p, ctypes.c_void_p, ctypes.c_void_p, ctypes.c_uint32] +iokit.IORegistryEntryCreateCFProperty.restype = ctypes.c_void_p + +iokit.IORegistryEntryGetPath.argtypes = [ctypes.c_void_p, ctypes.c_void_p, ctypes.c_void_p] +iokit.IORegistryEntryGetPath.restype = kern_return_t + +iokit.IORegistryEntryGetName.argtypes = [ctypes.c_void_p, ctypes.c_void_p] +iokit.IORegistryEntryGetName.restype = kern_return_t + +iokit.IOObjectGetClass.argtypes = [ctypes.c_void_p, ctypes.c_void_p] +iokit.IOObjectGetClass.restype = kern_return_t + +iokit.IOObjectRelease.argtypes = [ctypes.c_void_p] + + +cf.CFStringCreateWithCString.argtypes = [ctypes.c_void_p, ctypes.c_char_p, ctypes.c_int32] +cf.CFStringCreateWithCString.restype = ctypes.c_void_p + +cf.CFStringGetCStringPtr.argtypes = [ctypes.c_void_p, ctypes.c_uint32] +cf.CFStringGetCStringPtr.restype = ctypes.c_char_p + +cf.CFStringGetCString.argtypes = [ctypes.c_void_p, ctypes.c_void_p, ctypes.c_long, ctypes.c_uint32] +cf.CFStringGetCString.restype = ctypes.c_bool + +cf.CFNumberGetValue.argtypes = [ctypes.c_void_p, ctypes.c_uint32, ctypes.c_void_p] +cf.CFNumberGetValue.restype = ctypes.c_void_p + +# void CFRelease ( CFTypeRef cf ); +cf.CFRelease.argtypes = [ctypes.c_void_p] +cf.CFRelease.restype = None + +# CFNumber type defines +kCFNumberSInt8Type = 1 +kCFNumberSInt16Type = 2 +kCFNumberSInt32Type = 3 +kCFNumberSInt64Type = 4 + + +def get_string_property(device_type, property): + """ + Search the given device for the specified string property + + @param device_type Type of Device + @param property String to search for + @return Python string containing the value, or None if not found. + """ + key = cf.CFStringCreateWithCString( + kCFAllocatorDefault, + property.encode("utf-8"), + kCFStringEncodingUTF8) + + CFContainer = iokit.IORegistryEntryCreateCFProperty( + device_type, + key, + kCFAllocatorDefault, + 0) + output = None + + if CFContainer: + output = cf.CFStringGetCStringPtr(CFContainer, 0) + if output is not None: + output = output.decode('utf-8') + else: + buffer = ctypes.create_string_buffer(io_name_size); + success = cf.CFStringGetCString(CFContainer, ctypes.byref(buffer), io_name_size, kCFStringEncodingUTF8) + if success: + output = buffer.value.decode('utf-8') + cf.CFRelease(CFContainer) + return output + + +def get_int_property(device_type, property, cf_number_type): + """ + Search the given device for the specified string property + + @param device_type Device to search + @param property String to search for + @param cf_number_type CFType number + + @return Python string containing the value, or None if not found. + """ + key = cf.CFStringCreateWithCString( + kCFAllocatorDefault, + property.encode("utf-8"), + kCFStringEncodingUTF8) + + CFContainer = iokit.IORegistryEntryCreateCFProperty( + device_type, + key, + kCFAllocatorDefault, + 0) + + if CFContainer: + if (cf_number_type == kCFNumberSInt32Type): + number = ctypes.c_uint32() + elif (cf_number_type == kCFNumberSInt16Type): + number = ctypes.c_uint16() + cf.CFNumberGetValue(CFContainer, cf_number_type, ctypes.byref(number)) + cf.CFRelease(CFContainer) + return number.value + return None + +def IORegistryEntryGetName(device): + devicename = ctypes.create_string_buffer(io_name_size); + res = iokit.IORegistryEntryGetName(device, ctypes.byref(devicename)) + if res != KERN_SUCCESS: + return None + # this works in python2 but may not be valid. Also I don't know if + # this encoding is guaranteed. It may be dependent on system locale. + return devicename.value.decode('utf-8') + +def IOObjectGetClass(device): + classname = ctypes.create_string_buffer(io_name_size) + iokit.IOObjectGetClass(device, ctypes.byref(classname)) + return classname.value + +def GetParentDeviceByType(device, parent_type): + """ Find the first parent of a device that implements the parent_type + @param IOService Service to inspect + @return Pointer to the parent type, or None if it was not found. + """ + # First, try to walk up the IOService tree to find a parent of this device that is a IOUSBDevice. + parent_type = parent_type.encode('utf-8') + while IOObjectGetClass(device) != parent_type: + parent = ctypes.c_void_p() + response = iokit.IORegistryEntryGetParentEntry( + device, + "IOService".encode("utf-8"), + ctypes.byref(parent)) + # If we weren't able to find a parent for the device, we're done. + if response != KERN_SUCCESS: + return None + device = parent + return device + + +def GetIOServicesByType(service_type): + """ + returns iterator over specified service_type + """ + serial_port_iterator = ctypes.c_void_p() + + iokit.IOServiceGetMatchingServices( + kIOMasterPortDefault, + iokit.IOServiceMatching(service_type.encode('utf-8')), + ctypes.byref(serial_port_iterator)) + + services = [] + while iokit.IOIteratorIsValid(serial_port_iterator): + service = iokit.IOIteratorNext(serial_port_iterator) + if not service: + break + services.append(service) + iokit.IOObjectRelease(serial_port_iterator) + return services + + +def location_to_string(locationID): + """ + helper to calculate port and bus number from locationID + """ + loc = ['{}-'.format(locationID >> 24)] + while locationID & 0xf00000: + if len(loc) > 1: + loc.append('.') + loc.append('{}'.format((locationID >> 20) & 0xf)) + locationID <<= 4 + return ''.join(loc) + + +class SuitableSerialInterface(object): + pass + + +def scan_interfaces(): + """ + helper function to scan USB interfaces + returns a list of SuitableSerialInterface objects with name and id attributes + """ + interfaces = [] + for service in GetIOServicesByType('IOSerialBSDClient'): + device = get_string_property(service, "IOCalloutDevice") + if device: + usb_device = GetParentDeviceByType(service, "IOUSBInterface") + if usb_device: + name = get_string_property(usb_device, "USB Interface Name") or None + locationID = get_int_property(usb_device, "locationID", kCFNumberSInt32Type) or '' + i = SuitableSerialInterface() + i.id = locationID + i.name = name + interfaces.append(i) + return interfaces + + +def search_for_locationID_in_interfaces(serial_interfaces, locationID): + for interface in serial_interfaces: + if (interface.id == locationID): + return interface.name + return None + + +def comports(include_links=False): + # XXX include_links is currently ignored. are links in /dev even supported here? + # Scan for all iokit serial ports + services = GetIOServicesByType('IOSerialBSDClient') + ports = [] + serial_interfaces = scan_interfaces() + for service in services: + # First, add the callout device file. + device = get_string_property(service, "IOCalloutDevice") + if device: + info = list_ports_common.ListPortInfo(device) + # If the serial port is implemented by IOUSBDevice + # NOTE IOUSBDevice was deprecated as of 10.11 and finally on Apple Silicon + # devices has been completely removed. Thanks to @oskay for this patch. + usb_device = GetParentDeviceByType(service, "IOUSBHostDevice") + if not usb_device: + usb_device = GetParentDeviceByType(service, "IOUSBDevice") + if usb_device: + # fetch some useful informations from properties + info.vid = get_int_property(usb_device, "idVendor", kCFNumberSInt16Type) + info.pid = get_int_property(usb_device, "idProduct", kCFNumberSInt16Type) + info.serial_number = get_string_property(usb_device, kUSBSerialNumberString) + # We know this is a usb device, so the + # IORegistryEntryName should always be aliased to the + # usb product name string descriptor. + info.product = IORegistryEntryGetName(usb_device) or 'n/a' + info.manufacturer = get_string_property(usb_device, kUSBVendorString) + locationID = get_int_property(usb_device, "locationID", kCFNumberSInt32Type) + info.location = location_to_string(locationID) + info.interface = search_for_locationID_in_interfaces(serial_interfaces, locationID) + info.apply_usb_info() + ports.append(info) + return ports + +# test +if __name__ == '__main__': + for port, desc, hwid in sorted(comports()): + print("{}: {} [{}]".format(port, desc, hwid)) diff --git a/extensions/km-plot/deps/serial/tools/list_ports_posix.py b/extensions/km-plot/deps/serial/tools/list_ports_posix.py new file mode 100644 index 0000000..79bc8ed --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/list_ports_posix.py @@ -0,0 +1,119 @@ +#!/usr/bin/env python +# +# This is a module that gathers a list of serial ports on POSIXy systems. +# For some specific implementations, see also list_ports_linux, list_ports_osx +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2011-2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +"""\ +The ``comports`` function is expected to return an iterable that yields tuples +of 3 strings: port name, human readable description and a hardware ID. + +As currently no method is known to get the second two strings easily, they are +currently just identical to the port name. +""" + +from __future__ import absolute_import + +import glob +import sys +import os +from serial.tools import list_ports_common + +# try to detect the OS so that a device can be selected... +plat = sys.platform.lower() + +if plat[:5] == 'linux': # Linux (confirmed) # noqa + from serial.tools.list_ports_linux import comports + +elif plat[:6] == 'darwin': # OS X (confirmed) + from serial.tools.list_ports_osx import comports + +elif plat == 'cygwin': # cygwin/win32 + # cygwin accepts /dev/com* in many contexts + # (such as 'open' call, explicit 'ls'), but 'glob.glob' + # and bare 'ls' do not; so use /dev/ttyS* instead + def comports(include_links=False): + devices = glob.glob('/dev/ttyS*') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +elif plat[:7] == 'openbsd': # OpenBSD + def comports(include_links=False): + devices = glob.glob('/dev/cua*') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +elif plat[:3] == 'bsd' or plat[:7] == 'freebsd': + def comports(include_links=False): + devices = glob.glob('/dev/cua*[!.init][!.lock]') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +elif plat[:6] == 'netbsd': # NetBSD + def comports(include_links=False): + """scan for available ports. return a list of device names.""" + devices = glob.glob('/dev/dty*') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +elif plat[:4] == 'irix': # IRIX + def comports(include_links=False): + """scan for available ports. return a list of device names.""" + devices = glob.glob('/dev/ttyf*') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +elif plat[:2] == 'hp': # HP-UX (not tested) + def comports(include_links=False): + """scan for available ports. return a list of device names.""" + devices = glob.glob('/dev/tty*p0') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +elif plat[:5] == 'sunos': # Solaris/SunOS + def comports(include_links=False): + """scan for available ports. return a list of device names.""" + devices = glob.glob('/dev/tty*c') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +elif plat[:3] == 'aix': # AIX + def comports(include_links=False): + """scan for available ports. return a list of device names.""" + devices = glob.glob('/dev/tty*') + if include_links: + devices.extend(list_ports_common.list_links(devices)) + return [list_ports_common.ListPortInfo(d) for d in devices] + +else: + # platform detection has failed... + import serial + sys.stderr.write("""\ +don't know how to enumerate ttys on this system. +! I you know how the serial ports are named send this information to +! the author of this module: + +sys.platform = {!r} +os.name = {!r} +pySerial version = {} + +also add the naming scheme of the serial ports and with a bit luck you can get +this module running... +""".format(sys.platform, os.name, serial.VERSION)) + raise ImportError("Sorry: no implementation for your platform ('{}') available".format(os.name)) + +# test +if __name__ == '__main__': + for port, desc, hwid in sorted(comports()): + print("{}: {} [{}]".format(port, desc, hwid)) diff --git a/extensions/km-plot/deps/serial/tools/list_ports_windows.py b/extensions/km-plot/deps/serial/tools/list_ports_windows.py new file mode 100644 index 0000000..0b4a5b1 --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/list_ports_windows.py @@ -0,0 +1,427 @@ +#! python +# +# Enumerate serial ports on Windows including a human readable description +# and hardware information. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2001-2016 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +# pylint: disable=invalid-name,too-few-public-methods +import re +import ctypes +from ctypes.wintypes import BOOL +from ctypes.wintypes import HWND +from ctypes.wintypes import DWORD +from ctypes.wintypes import WORD +from ctypes.wintypes import LONG +from ctypes.wintypes import ULONG +from ctypes.wintypes import HKEY +from ctypes.wintypes import BYTE +import serial +from serial.win32 import ULONG_PTR +from serial.tools import list_ports_common + + +def ValidHandle(value, func, arguments): + if value == 0: + raise ctypes.WinError() + return value + + +NULL = 0 +HDEVINFO = ctypes.c_void_p +LPCTSTR = ctypes.c_wchar_p +PCTSTR = ctypes.c_wchar_p +PTSTR = ctypes.c_wchar_p +LPDWORD = PDWORD = ctypes.POINTER(DWORD) +#~ LPBYTE = PBYTE = ctypes.POINTER(BYTE) +LPBYTE = PBYTE = ctypes.c_void_p # XXX avoids error about types + +ACCESS_MASK = DWORD +REGSAM = ACCESS_MASK + + +class GUID(ctypes.Structure): + _fields_ = [ + ('Data1', DWORD), + ('Data2', WORD), + ('Data3', WORD), + ('Data4', BYTE * 8), + ] + + def __str__(self): + return "{{{:08x}-{:04x}-{:04x}-{}-{}}}".format( + self.Data1, + self.Data2, + self.Data3, + ''.join(["{:02x}".format(d) for d in self.Data4[:2]]), + ''.join(["{:02x}".format(d) for d in self.Data4[2:]]), + ) + + +class SP_DEVINFO_DATA(ctypes.Structure): + _fields_ = [ + ('cbSize', DWORD), + ('ClassGuid', GUID), + ('DevInst', DWORD), + ('Reserved', ULONG_PTR), + ] + + def __str__(self): + return "ClassGuid:{} DevInst:{}".format(self.ClassGuid, self.DevInst) + + +PSP_DEVINFO_DATA = ctypes.POINTER(SP_DEVINFO_DATA) + +PSP_DEVICE_INTERFACE_DETAIL_DATA = ctypes.c_void_p + +setupapi = ctypes.windll.LoadLibrary("setupapi") +SetupDiDestroyDeviceInfoList = setupapi.SetupDiDestroyDeviceInfoList +SetupDiDestroyDeviceInfoList.argtypes = [HDEVINFO] +SetupDiDestroyDeviceInfoList.restype = BOOL + +SetupDiClassGuidsFromName = setupapi.SetupDiClassGuidsFromNameW +SetupDiClassGuidsFromName.argtypes = [PCTSTR, ctypes.POINTER(GUID), DWORD, PDWORD] +SetupDiClassGuidsFromName.restype = BOOL + +SetupDiEnumDeviceInfo = setupapi.SetupDiEnumDeviceInfo +SetupDiEnumDeviceInfo.argtypes = [HDEVINFO, DWORD, PSP_DEVINFO_DATA] +SetupDiEnumDeviceInfo.restype = BOOL + +SetupDiGetClassDevs = setupapi.SetupDiGetClassDevsW +SetupDiGetClassDevs.argtypes = [ctypes.POINTER(GUID), PCTSTR, HWND, DWORD] +SetupDiGetClassDevs.restype = HDEVINFO +SetupDiGetClassDevs.errcheck = ValidHandle + +SetupDiGetDeviceRegistryProperty = setupapi.SetupDiGetDeviceRegistryPropertyW +SetupDiGetDeviceRegistryProperty.argtypes = [HDEVINFO, PSP_DEVINFO_DATA, DWORD, PDWORD, PBYTE, DWORD, PDWORD] +SetupDiGetDeviceRegistryProperty.restype = BOOL + +SetupDiGetDeviceInstanceId = setupapi.SetupDiGetDeviceInstanceIdW +SetupDiGetDeviceInstanceId.argtypes = [HDEVINFO, PSP_DEVINFO_DATA, PTSTR, DWORD, PDWORD] +SetupDiGetDeviceInstanceId.restype = BOOL + +SetupDiOpenDevRegKey = setupapi.SetupDiOpenDevRegKey +SetupDiOpenDevRegKey.argtypes = [HDEVINFO, PSP_DEVINFO_DATA, DWORD, DWORD, DWORD, REGSAM] +SetupDiOpenDevRegKey.restype = HKEY + +advapi32 = ctypes.windll.LoadLibrary("Advapi32") +RegCloseKey = advapi32.RegCloseKey +RegCloseKey.argtypes = [HKEY] +RegCloseKey.restype = LONG + +RegQueryValueEx = advapi32.RegQueryValueExW +RegQueryValueEx.argtypes = [HKEY, LPCTSTR, LPDWORD, LPDWORD, LPBYTE, LPDWORD] +RegQueryValueEx.restype = LONG + +cfgmgr32 = ctypes.windll.LoadLibrary("Cfgmgr32") +CM_Get_Parent = cfgmgr32.CM_Get_Parent +CM_Get_Parent.argtypes = [PDWORD, DWORD, ULONG] +CM_Get_Parent.restype = LONG + +CM_Get_Device_IDW = cfgmgr32.CM_Get_Device_IDW +CM_Get_Device_IDW.argtypes = [DWORD, PTSTR, ULONG, ULONG] +CM_Get_Device_IDW.restype = LONG + +CM_MapCrToWin32Err = cfgmgr32.CM_MapCrToWin32Err +CM_MapCrToWin32Err.argtypes = [DWORD, DWORD] +CM_MapCrToWin32Err.restype = DWORD + + +DIGCF_PRESENT = 2 +DIGCF_DEVICEINTERFACE = 16 +INVALID_HANDLE_VALUE = 0 +ERROR_INSUFFICIENT_BUFFER = 122 +ERROR_NOT_FOUND = 1168 +SPDRP_HARDWAREID = 1 +SPDRP_FRIENDLYNAME = 12 +SPDRP_LOCATION_PATHS = 35 +SPDRP_MFG = 11 +DICS_FLAG_GLOBAL = 1 +DIREG_DEV = 0x00000001 +KEY_READ = 0x20019 + + +MAX_USB_DEVICE_TREE_TRAVERSAL_DEPTH = 5 + + +def get_parent_serial_number(child_devinst, child_vid, child_pid, depth=0, last_serial_number=None): + """ Get the serial number of the parent of a device. + + Args: + child_devinst: The device instance handle to get the parent serial number of. + child_vid: The vendor ID of the child device. + child_pid: The product ID of the child device. + depth: The current iteration depth of the USB device tree. + """ + + # If the traversal depth is beyond the max, abandon attempting to find the serial number. + if depth > MAX_USB_DEVICE_TREE_TRAVERSAL_DEPTH: + return '' if not last_serial_number else last_serial_number + + # Get the parent device instance. + devinst = DWORD() + ret = CM_Get_Parent(ctypes.byref(devinst), child_devinst, 0) + + if ret: + win_error = CM_MapCrToWin32Err(DWORD(ret), DWORD(0)) + + # If there is no parent available, the child was the root device. We cannot traverse + # further. + if win_error == ERROR_NOT_FOUND: + return '' if not last_serial_number else last_serial_number + + raise ctypes.WinError(win_error) + + # Get the ID of the parent device and parse it for vendor ID, product ID, and serial number. + parentHardwareID = ctypes.create_unicode_buffer(250) + + ret = CM_Get_Device_IDW( + devinst, + parentHardwareID, + ctypes.sizeof(parentHardwareID) - 1, + 0) + + if ret: + raise ctypes.WinError(CM_MapCrToWin32Err(DWORD(ret), DWORD(0))) + + parentHardwareID_str = parentHardwareID.value + m = re.search(r'VID_([0-9a-f]{4})(&PID_([0-9a-f]{4}))?(&MI_(\d{2}))?(\\(.*))?', + parentHardwareID_str, + re.I) + + # return early if we have no matches (likely malformed serial, traversed too far) + if not m: + return '' if not last_serial_number else last_serial_number + + vid = None + pid = None + serial_number = None + if m.group(1): + vid = int(m.group(1), 16) + if m.group(3): + pid = int(m.group(3), 16) + if m.group(7): + serial_number = m.group(7) + + # store what we found as a fallback for malformed serial values up the chain + found_serial_number = serial_number + + # Check that the USB serial number only contains alpha-numeric characters. It may be a windows + # device ID (ephemeral ID). + if serial_number and not re.match(r'^\w+$', serial_number): + serial_number = None + + if not vid or not pid: + # If pid and vid are not available at this device level, continue to the parent. + return get_parent_serial_number(devinst, child_vid, child_pid, depth + 1, found_serial_number) + + if pid != child_pid or vid != child_vid: + # If the VID or PID has changed, we are no longer looking at the same physical device. The + # serial number is unknown. + return '' if not last_serial_number else last_serial_number + + # In this case, the vid and pid of the parent device are identical to the child. However, if + # there still isn't a serial number available, continue to the next parent. + if not serial_number: + return get_parent_serial_number(devinst, child_vid, child_pid, depth + 1, found_serial_number) + + # Finally, the VID and PID are identical to the child and a serial number is present, so return + # it. + return serial_number + + +def iterate_comports(): + """Return a generator that yields descriptions for serial ports""" + PortsGUIDs = (GUID * 8)() # so far only seen one used, so hope 8 are enough... + ports_guids_size = DWORD() + if not SetupDiClassGuidsFromName( + "Ports", + PortsGUIDs, + ctypes.sizeof(PortsGUIDs), + ctypes.byref(ports_guids_size)): + raise ctypes.WinError() + + ModemsGUIDs = (GUID * 8)() # so far only seen one used, so hope 8 are enough... + modems_guids_size = DWORD() + if not SetupDiClassGuidsFromName( + "Modem", + ModemsGUIDs, + ctypes.sizeof(ModemsGUIDs), + ctypes.byref(modems_guids_size)): + raise ctypes.WinError() + + GUIDs = PortsGUIDs[:ports_guids_size.value] + ModemsGUIDs[:modems_guids_size.value] + + # repeat for all possible GUIDs + for index in range(len(GUIDs)): + bInterfaceNumber = None + g_hdi = SetupDiGetClassDevs( + ctypes.byref(GUIDs[index]), + None, + NULL, + DIGCF_PRESENT) # was DIGCF_PRESENT|DIGCF_DEVICEINTERFACE which misses CDC ports + + devinfo = SP_DEVINFO_DATA() + devinfo.cbSize = ctypes.sizeof(devinfo) + index = 0 + while SetupDiEnumDeviceInfo(g_hdi, index, ctypes.byref(devinfo)): + index += 1 + + # get the real com port name + hkey = SetupDiOpenDevRegKey( + g_hdi, + ctypes.byref(devinfo), + DICS_FLAG_GLOBAL, + 0, + DIREG_DEV, # DIREG_DRV for SW info + KEY_READ) + port_name_buffer = ctypes.create_unicode_buffer(250) + port_name_length = ULONG(ctypes.sizeof(port_name_buffer)) + RegQueryValueEx( + hkey, + "PortName", + None, + None, + ctypes.byref(port_name_buffer), + ctypes.byref(port_name_length)) + RegCloseKey(hkey) + + # unfortunately does this method also include parallel ports. + # we could check for names starting with COM or just exclude LPT + # and hope that other "unknown" names are serial ports... + if port_name_buffer.value.startswith('LPT'): + continue + + # hardware ID + szHardwareID = ctypes.create_unicode_buffer(250) + # try to get ID that includes serial number + if not SetupDiGetDeviceInstanceId( + g_hdi, + ctypes.byref(devinfo), + #~ ctypes.byref(szHardwareID), + szHardwareID, + ctypes.sizeof(szHardwareID) - 1, + None): + # fall back to more generic hardware ID if that would fail + if not SetupDiGetDeviceRegistryProperty( + g_hdi, + ctypes.byref(devinfo), + SPDRP_HARDWAREID, + None, + ctypes.byref(szHardwareID), + ctypes.sizeof(szHardwareID) - 1, + None): + # Ignore ERROR_INSUFFICIENT_BUFFER + if ctypes.GetLastError() != ERROR_INSUFFICIENT_BUFFER: + raise ctypes.WinError() + # stringify + szHardwareID_str = szHardwareID.value + + info = list_ports_common.ListPortInfo(port_name_buffer.value, skip_link_detection=True) + + # in case of USB, make a more readable string, similar to that form + # that we also generate on other platforms + if szHardwareID_str.startswith('USB'): + m = re.search(r'VID_([0-9a-f]{4})(&PID_([0-9a-f]{4}))?(&MI_(\d{2}))?(\\(.*))?', szHardwareID_str, re.I) + if m: + info.vid = int(m.group(1), 16) + if m.group(3): + info.pid = int(m.group(3), 16) + if m.group(5): + bInterfaceNumber = int(m.group(5)) + + # Check that the USB serial number only contains alpha-numeric characters. It + # may be a windows device ID (ephemeral ID) for composite devices. + if m.group(7) and re.match(r'^\w+$', m.group(7)): + info.serial_number = m.group(7) + else: + info.serial_number = get_parent_serial_number(devinfo.DevInst, info.vid, info.pid) + + # calculate a location string + loc_path_str = ctypes.create_unicode_buffer(250) + if SetupDiGetDeviceRegistryProperty( + g_hdi, + ctypes.byref(devinfo), + SPDRP_LOCATION_PATHS, + None, + ctypes.byref(loc_path_str), + ctypes.sizeof(loc_path_str) - 1, + None): + m = re.finditer(r'USBROOT\((\w+)\)|#USB\((\w+)\)', loc_path_str.value) + location = [] + for g in m: + if g.group(1): + location.append('{:d}'.format(int(g.group(1)) + 1)) + else: + if len(location) > 1: + location.append('.') + else: + location.append('-') + location.append(g.group(2)) + if bInterfaceNumber is not None: + location.append(':{}.{}'.format( + 'x', # XXX how to determine correct bConfigurationValue? + bInterfaceNumber)) + if location: + info.location = ''.join(location) + info.hwid = info.usb_info() + elif szHardwareID_str.startswith('FTDIBUS'): + m = re.search(r'VID_([0-9a-f]{4})\+PID_([0-9a-f]{4})(\+(\w+))?', szHardwareID_str, re.I) + if m: + info.vid = int(m.group(1), 16) + info.pid = int(m.group(2), 16) + if m.group(4): + info.serial_number = m.group(4) + # USB location is hidden by FDTI driver :( + info.hwid = info.usb_info() + else: + info.hwid = szHardwareID_str + + # friendly name + szFriendlyName = ctypes.create_unicode_buffer(250) + if SetupDiGetDeviceRegistryProperty( + g_hdi, + ctypes.byref(devinfo), + SPDRP_FRIENDLYNAME, + #~ SPDRP_DEVICEDESC, + None, + ctypes.byref(szFriendlyName), + ctypes.sizeof(szFriendlyName) - 1, + None): + info.description = szFriendlyName.value + #~ else: + # Ignore ERROR_INSUFFICIENT_BUFFER + #~ if ctypes.GetLastError() != ERROR_INSUFFICIENT_BUFFER: + #~ raise IOError("failed to get details for %s (%s)" % (devinfo, szHardwareID.value)) + # ignore errors and still include the port in the list, friendly name will be same as port name + + # manufacturer + szManufacturer = ctypes.create_unicode_buffer(250) + if SetupDiGetDeviceRegistryProperty( + g_hdi, + ctypes.byref(devinfo), + SPDRP_MFG, + #~ SPDRP_DEVICEDESC, + None, + ctypes.byref(szManufacturer), + ctypes.sizeof(szManufacturer) - 1, + None): + info.manufacturer = szManufacturer.value + yield info + SetupDiDestroyDeviceInfoList(g_hdi) + + +def comports(include_links=False): + """Return a list of info objects about serial ports""" + return list(iterate_comports()) + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +# test +if __name__ == '__main__': + for port, desc, hwid in sorted(comports()): + print("{}: {} [{}]".format(port, desc, hwid)) diff --git a/extensions/km-plot/deps/serial/tools/miniterm.py b/extensions/km-plot/deps/serial/tools/miniterm.py new file mode 100644 index 0000000..2cceff6 --- /dev/null +++ b/extensions/km-plot/deps/serial/tools/miniterm.py @@ -0,0 +1,1042 @@ +#!/usr/bin/env python +# +# Very simple serial terminal +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C)2002-2020 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause + +from __future__ import absolute_import + +import codecs +import os +import sys +import threading + +import serial +from serial.tools.list_ports import comports +from serial.tools import hexlify_codec + +# pylint: disable=wrong-import-order,wrong-import-position + +codecs.register(lambda c: hexlify_codec.getregentry() if c == 'hexlify' else None) + +try: + raw_input +except NameError: + # pylint: disable=redefined-builtin,invalid-name + raw_input = input # in python3 it's "raw" + unichr = chr + + +def key_description(character): + """generate a readable description for a key""" + ascii_code = ord(character) + if ascii_code < 32: + return 'Ctrl+{:c}'.format(ord('@') + ascii_code) + else: + return repr(character) + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +class ConsoleBase(object): + """OS abstraction for console (input/output codec, no echo)""" + + def __init__(self): + if sys.version_info >= (3, 0): + self.byte_output = sys.stdout.buffer + else: + self.byte_output = sys.stdout + self.output = sys.stdout + + def setup(self): + """Set console to read single characters, no echo""" + + def cleanup(self): + """Restore default console settings""" + + def getkey(self): + """Read a single key from the console""" + return None + + def write_bytes(self, byte_string): + """Write bytes (already encoded)""" + self.byte_output.write(byte_string) + self.byte_output.flush() + + def write(self, text): + """Write string""" + self.output.write(text) + self.output.flush() + + def cancel(self): + """Cancel getkey operation""" + + # - - - - - - - - - - - - - - - - - - - - - - - - + # context manager: + # switch terminal temporary to normal mode (e.g. to get user input) + + def __enter__(self): + self.cleanup() + return self + + def __exit__(self, *args, **kwargs): + self.setup() + + +if os.name == 'nt': # noqa + import msvcrt + import ctypes + import platform + + class Out(object): + """file-like wrapper that uses os.write""" + + def __init__(self, fd): + self.fd = fd + + def flush(self): + pass + + def write(self, s): + os.write(self.fd, s) + + class Console(ConsoleBase): + fncodes = { + ';': '\1bOP', # F1 + '<': '\1bOQ', # F2 + '=': '\1bOR', # F3 + '>': '\1bOS', # F4 + '?': '\1b[15~', # F5 + '@': '\1b[17~', # F6 + 'A': '\1b[18~', # F7 + 'B': '\1b[19~', # F8 + 'C': '\1b[20~', # F9 + 'D': '\1b[21~', # F10 + } + navcodes = { + 'H': '\x1b[A', # UP + 'P': '\x1b[B', # DOWN + 'K': '\x1b[D', # LEFT + 'M': '\x1b[C', # RIGHT + 'G': '\x1b[H', # HOME + 'O': '\x1b[F', # END + 'R': '\x1b[2~', # INSERT + 'S': '\x1b[3~', # DELETE + 'I': '\x1b[5~', # PGUP + 'Q': '\x1b[6~', # PGDN + } + + def __init__(self): + super(Console, self).__init__() + self._saved_ocp = ctypes.windll.kernel32.GetConsoleOutputCP() + self._saved_icp = ctypes.windll.kernel32.GetConsoleCP() + ctypes.windll.kernel32.SetConsoleOutputCP(65001) + ctypes.windll.kernel32.SetConsoleCP(65001) + # ANSI handling available through SetConsoleMode since Windows 10 v1511 + # https://en.wikipedia.org/wiki/ANSI_escape_code#cite_note-win10th2-1 + if platform.release() == '10' and int(platform.version().split('.')[2]) > 10586: + ENABLE_VIRTUAL_TERMINAL_PROCESSING = 0x0004 + import ctypes.wintypes as wintypes + if not hasattr(wintypes, 'LPDWORD'): # PY2 + wintypes.LPDWORD = ctypes.POINTER(wintypes.DWORD) + SetConsoleMode = ctypes.windll.kernel32.SetConsoleMode + GetConsoleMode = ctypes.windll.kernel32.GetConsoleMode + GetStdHandle = ctypes.windll.kernel32.GetStdHandle + mode = wintypes.DWORD() + GetConsoleMode(GetStdHandle(-11), ctypes.byref(mode)) + if (mode.value & ENABLE_VIRTUAL_TERMINAL_PROCESSING) == 0: + SetConsoleMode(GetStdHandle(-11), mode.value | ENABLE_VIRTUAL_TERMINAL_PROCESSING) + self._saved_cm = mode + self.output = codecs.getwriter('UTF-8')(Out(sys.stdout.fileno()), 'replace') + # the change of the code page is not propagated to Python, manually fix it + sys.stderr = codecs.getwriter('UTF-8')(Out(sys.stderr.fileno()), 'replace') + sys.stdout = self.output + self.output.encoding = 'UTF-8' # needed for input + + def __del__(self): + ctypes.windll.kernel32.SetConsoleOutputCP(self._saved_ocp) + ctypes.windll.kernel32.SetConsoleCP(self._saved_icp) + try: + ctypes.windll.kernel32.SetConsoleMode(ctypes.windll.kernel32.GetStdHandle(-11), self._saved_cm) + except AttributeError: # in case no _saved_cm + pass + + def getkey(self): + while True: + z = msvcrt.getwch() + if z == unichr(13): + return unichr(10) + elif z is unichr(0) or z is unichr(0xe0): + try: + code = msvcrt.getwch() + if z is unichr(0): + return self.fncodes[code] + else: + return self.navcodes[code] + except KeyError: + pass + else: + return z + + def cancel(self): + # CancelIo, CancelSynchronousIo do not seem to work when using + # getwch, so instead, send a key to the window with the console + hwnd = ctypes.windll.kernel32.GetConsoleWindow() + ctypes.windll.user32.PostMessageA(hwnd, 0x100, 0x0d, 0) + +elif os.name == 'posix': + import atexit + import termios + import fcntl + + class Console(ConsoleBase): + def __init__(self): + super(Console, self).__init__() + self.fd = sys.stdin.fileno() + self.old = termios.tcgetattr(self.fd) + atexit.register(self.cleanup) + if sys.version_info < (3, 0): + self.enc_stdin = codecs.getreader(sys.stdin.encoding)(sys.stdin) + else: + self.enc_stdin = sys.stdin + + def setup(self): + new = termios.tcgetattr(self.fd) + new[3] = new[3] & ~termios.ICANON & ~termios.ECHO & ~termios.ISIG + new[6][termios.VMIN] = 1 + new[6][termios.VTIME] = 0 + termios.tcsetattr(self.fd, termios.TCSANOW, new) + + def getkey(self): + c = self.enc_stdin.read(1) + if c == unichr(0x7f): + c = unichr(8) # map the BS key (which yields DEL) to backspace + return c + + def cancel(self): + fcntl.ioctl(self.fd, termios.TIOCSTI, b'\0') + + def cleanup(self): + termios.tcsetattr(self.fd, termios.TCSAFLUSH, self.old) + +else: + raise NotImplementedError( + 'Sorry no implementation for your platform ({}) available.'.format(sys.platform)) + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - + +class Transform(object): + """do-nothing: forward all data unchanged""" + def rx(self, text): + """text received from serial port""" + return text + + def tx(self, text): + """text to be sent to serial port""" + return text + + def echo(self, text): + """text to be sent but displayed on console""" + return text + + +class CRLF(Transform): + """ENTER sends CR+LF""" + + def tx(self, text): + return text.replace('\n', '\r\n') + + +class CR(Transform): + """ENTER sends CR""" + + def rx(self, text): + return text.replace('\r', '\n') + + def tx(self, text): + return text.replace('\n', '\r') + + +class LF(Transform): + """ENTER sends LF""" + + +class NoTerminal(Transform): + """remove typical terminal control codes from input""" + + REPLACEMENT_MAP = dict((x, 0x2400 + x) for x in range(32) if unichr(x) not in '\r\n\b\t') + REPLACEMENT_MAP.update( + { + 0x7F: 0x2421, # DEL + 0x9B: 0x2425, # CSI + }) + + def rx(self, text): + return text.translate(self.REPLACEMENT_MAP) + + echo = rx + + +class NoControls(NoTerminal): + """Remove all control codes, incl. CR+LF""" + + REPLACEMENT_MAP = dict((x, 0x2400 + x) for x in range(32)) + REPLACEMENT_MAP.update( + { + 0x20: 0x2423, # visual space + 0x7F: 0x2421, # DEL + 0x9B: 0x2425, # CSI + }) + + +class Printable(Transform): + """Show decimal code for all non-ASCII characters and replace most control codes""" + + def rx(self, text): + r = [] + for c in text: + if ' ' <= c < '\x7f' or c in '\r\n\b\t': + r.append(c) + elif c < ' ': + r.append(unichr(0x2400 + ord(c))) + else: + r.extend(unichr(0x2080 + ord(d) - 48) for d in '{:d}'.format(ord(c))) + r.append(' ') + return ''.join(r) + + echo = rx + + +class Colorize(Transform): + """Apply different colors for received and echo""" + + def __init__(self): + # XXX make it configurable, use colorama? + self.input_color = '\x1b[37m' + self.echo_color = '\x1b[31m' + + def rx(self, text): + return self.input_color + text + + def echo(self, text): + return self.echo_color + text + + +class DebugIO(Transform): + """Print what is sent and received""" + + def rx(self, text): + sys.stderr.write(' [RX:{!r}] '.format(text)) + sys.stderr.flush() + return text + + def tx(self, text): + sys.stderr.write(' [TX:{!r}] '.format(text)) + sys.stderr.flush() + return text + + +# other ideas: +# - add date/time for each newline +# - insert newline after: a) timeout b) packet end character + +EOL_TRANSFORMATIONS = { + 'crlf': CRLF, + 'cr': CR, + 'lf': LF, +} + +TRANSFORMATIONS = { + 'direct': Transform, # no transformation + 'default': NoTerminal, + 'nocontrol': NoControls, + 'printable': Printable, + 'colorize': Colorize, + 'debug': DebugIO, +} + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +def ask_for_port(): + """\ + Show a list of ports and ask the user for a choice. To make selection + easier on systems with long device names, also allow the input of an + index. + """ + sys.stderr.write('\n--- Available ports:\n') + ports = [] + for n, (port, desc, hwid) in enumerate(sorted(comports()), 1): + sys.stderr.write('--- {:2}: {:20} {!r}\n'.format(n, port, desc)) + ports.append(port) + while True: + port = raw_input('--- Enter port index or full name: ') + try: + index = int(port) - 1 + if not 0 <= index < len(ports): + sys.stderr.write('--- Invalid index!\n') + continue + except ValueError: + pass + else: + port = ports[index] + return port + + +class Miniterm(object): + """\ + Terminal application. Copy data from serial port to console and vice versa. + Handle special keys from the console to show menu etc. + """ + + def __init__(self, serial_instance, echo=False, eol='crlf', filters=()): + self.console = Console() + self.serial = serial_instance + self.echo = echo + self.raw = False + self.input_encoding = 'UTF-8' + self.output_encoding = 'UTF-8' + self.eol = eol + self.filters = filters + self.update_transformations() + self.exit_character = unichr(0x1d) # GS/CTRL+] + self.menu_character = unichr(0x14) # Menu: CTRL+T + self.alive = None + self._reader_alive = None + self.receiver_thread = None + self.rx_decoder = None + self.tx_decoder = None + + def _start_reader(self): + """Start reader thread""" + self._reader_alive = True + # start serial->console thread + self.receiver_thread = threading.Thread(target=self.reader, name='rx') + self.receiver_thread.daemon = True + self.receiver_thread.start() + + def _stop_reader(self): + """Stop reader thread only, wait for clean exit of thread""" + self._reader_alive = False + if hasattr(self.serial, 'cancel_read'): + self.serial.cancel_read() + self.receiver_thread.join() + + def start(self): + """start worker threads""" + self.alive = True + self._start_reader() + # enter console->serial loop + self.transmitter_thread = threading.Thread(target=self.writer, name='tx') + self.transmitter_thread.daemon = True + self.transmitter_thread.start() + self.console.setup() + + def stop(self): + """set flag to stop worker threads""" + self.alive = False + + def join(self, transmit_only=False): + """wait for worker threads to terminate""" + self.transmitter_thread.join() + if not transmit_only: + if hasattr(self.serial, 'cancel_read'): + self.serial.cancel_read() + self.receiver_thread.join() + + def close(self): + self.serial.close() + + def update_transformations(self): + """take list of transformation classes and instantiate them for rx and tx""" + transformations = [EOL_TRANSFORMATIONS[self.eol]] + [TRANSFORMATIONS[f] + for f in self.filters] + self.tx_transformations = [t() for t in transformations] + self.rx_transformations = list(reversed(self.tx_transformations)) + + def set_rx_encoding(self, encoding, errors='replace'): + """set encoding for received data""" + self.input_encoding = encoding + self.rx_decoder = codecs.getincrementaldecoder(encoding)(errors) + + def set_tx_encoding(self, encoding, errors='replace'): + """set encoding for transmitted data""" + self.output_encoding = encoding + self.tx_encoder = codecs.getincrementalencoder(encoding)(errors) + + def dump_port_settings(self): + """Write current settings to sys.stderr""" + sys.stderr.write("\n--- Settings: {p.name} {p.baudrate},{p.bytesize},{p.parity},{p.stopbits}\n".format( + p=self.serial)) + sys.stderr.write('--- RTS: {:8} DTR: {:8} BREAK: {:8}\n'.format( + ('active' if self.serial.rts else 'inactive'), + ('active' if self.serial.dtr else 'inactive'), + ('active' if self.serial.break_condition else 'inactive'))) + try: + sys.stderr.write('--- CTS: {:8} DSR: {:8} RI: {:8} CD: {:8}\n'.format( + ('active' if self.serial.cts else 'inactive'), + ('active' if self.serial.dsr else 'inactive'), + ('active' if self.serial.ri else 'inactive'), + ('active' if self.serial.cd else 'inactive'))) + except serial.SerialException: + # on RFC 2217 ports, it can happen if no modem state notification was + # yet received. ignore this error. + pass + sys.stderr.write('--- software flow control: {}\n'.format('active' if self.serial.xonxoff else 'inactive')) + sys.stderr.write('--- hardware flow control: {}\n'.format('active' if self.serial.rtscts else 'inactive')) + sys.stderr.write('--- serial input encoding: {}\n'.format(self.input_encoding)) + sys.stderr.write('--- serial output encoding: {}\n'.format(self.output_encoding)) + sys.stderr.write('--- EOL: {}\n'.format(self.eol.upper())) + sys.stderr.write('--- filters: {}\n'.format(' '.join(self.filters))) + + def reader(self): + """loop and copy serial->console""" + try: + while self.alive and self._reader_alive: + # read all that is there or wait for one byte + data = self.serial.read(self.serial.in_waiting or 1) + if data: + if self.raw: + self.console.write_bytes(data) + else: + text = self.rx_decoder.decode(data) + for transformation in self.rx_transformations: + text = transformation.rx(text) + self.console.write(text) + except serial.SerialException: + self.alive = False + self.console.cancel() + raise # XXX handle instead of re-raise? + + def writer(self): + """\ + Loop and copy console->serial until self.exit_character character is + found. When self.menu_character is found, interpret the next key + locally. + """ + menu_active = False + try: + while self.alive: + try: + c = self.console.getkey() + except KeyboardInterrupt: + c = '\x03' + if not self.alive: + break + if menu_active: + self.handle_menu_key(c) + menu_active = False + elif c == self.menu_character: + menu_active = True # next char will be for menu + elif c == self.exit_character: + self.stop() # exit app + break + else: + #~ if self.raw: + text = c + for transformation in self.tx_transformations: + text = transformation.tx(text) + self.serial.write(self.tx_encoder.encode(text)) + if self.echo: + echo_text = c + for transformation in self.tx_transformations: + echo_text = transformation.echo(echo_text) + self.console.write(echo_text) + except: + self.alive = False + raise + + def handle_menu_key(self, c): + """Implement a simple menu / settings""" + if c == self.menu_character or c == self.exit_character: + # Menu/exit character again -> send itself + self.serial.write(self.tx_encoder.encode(c)) + if self.echo: + self.console.write(c) + elif c == '\x15': # CTRL+U -> upload file + self.upload_file() + elif c in '\x08hH?': # CTRL+H, h, H, ? -> Show help + sys.stderr.write(self.get_help_text()) + elif c == '\x12': # CTRL+R -> Toggle RTS + self.serial.rts = not self.serial.rts + sys.stderr.write('--- RTS {} ---\n'.format('active' if self.serial.rts else 'inactive')) + elif c == '\x04': # CTRL+D -> Toggle DTR + self.serial.dtr = not self.serial.dtr + sys.stderr.write('--- DTR {} ---\n'.format('active' if self.serial.dtr else 'inactive')) + elif c == '\x02': # CTRL+B -> toggle BREAK condition + self.serial.break_condition = not self.serial.break_condition + sys.stderr.write('--- BREAK {} ---\n'.format('active' if self.serial.break_condition else 'inactive')) + elif c == '\x05': # CTRL+E -> toggle local echo + self.echo = not self.echo + sys.stderr.write('--- local echo {} ---\n'.format('active' if self.echo else 'inactive')) + elif c == '\x06': # CTRL+F -> edit filters + self.change_filter() + elif c == '\x0c': # CTRL+L -> EOL mode + modes = list(EOL_TRANSFORMATIONS) # keys + eol = modes.index(self.eol) + 1 + if eol >= len(modes): + eol = 0 + self.eol = modes[eol] + sys.stderr.write('--- EOL: {} ---\n'.format(self.eol.upper())) + self.update_transformations() + elif c == '\x01': # CTRL+A -> set encoding + self.change_encoding() + elif c == '\x09': # CTRL+I -> info + self.dump_port_settings() + #~ elif c == '\x01': # CTRL+A -> cycle escape mode + #~ elif c == '\x0c': # CTRL+L -> cycle linefeed mode + elif c in 'pP': # P -> change port + self.change_port() + elif c in 'zZ': # S -> suspend / open port temporarily + self.suspend_port() + elif c in 'bB': # B -> change baudrate + self.change_baudrate() + elif c == '8': # 8 -> change to 8 bits + self.serial.bytesize = serial.EIGHTBITS + self.dump_port_settings() + elif c == '7': # 7 -> change to 8 bits + self.serial.bytesize = serial.SEVENBITS + self.dump_port_settings() + elif c in 'eE': # E -> change to even parity + self.serial.parity = serial.PARITY_EVEN + self.dump_port_settings() + elif c in 'oO': # O -> change to odd parity + self.serial.parity = serial.PARITY_ODD + self.dump_port_settings() + elif c in 'mM': # M -> change to mark parity + self.serial.parity = serial.PARITY_MARK + self.dump_port_settings() + elif c in 'sS': # S -> change to space parity + self.serial.parity = serial.PARITY_SPACE + self.dump_port_settings() + elif c in 'nN': # N -> change to no parity + self.serial.parity = serial.PARITY_NONE + self.dump_port_settings() + elif c == '1': # 1 -> change to 1 stop bits + self.serial.stopbits = serial.STOPBITS_ONE + self.dump_port_settings() + elif c == '2': # 2 -> change to 2 stop bits + self.serial.stopbits = serial.STOPBITS_TWO + self.dump_port_settings() + elif c == '3': # 3 -> change to 1.5 stop bits + self.serial.stopbits = serial.STOPBITS_ONE_POINT_FIVE + self.dump_port_settings() + elif c in 'xX': # X -> change software flow control + self.serial.xonxoff = (c == 'X') + self.dump_port_settings() + elif c in 'rR': # R -> change hardware flow control + self.serial.rtscts = (c == 'R') + self.dump_port_settings() + elif c in 'qQ': + self.stop() # Q -> exit app + else: + sys.stderr.write('--- unknown menu character {} --\n'.format(key_description(c))) + + def upload_file(self): + """Ask user for filenname and send its contents""" + sys.stderr.write('\n--- File to upload: ') + sys.stderr.flush() + with self.console: + filename = sys.stdin.readline().rstrip('\r\n') + if filename: + try: + with open(filename, 'rb') as f: + sys.stderr.write('--- Sending file {} ---\n'.format(filename)) + while True: + block = f.read(1024) + if not block: + break + self.serial.write(block) + # Wait for output buffer to drain. + self.serial.flush() + sys.stderr.write('.') # Progress indicator. + sys.stderr.write('\n--- File {} sent ---\n'.format(filename)) + except IOError as e: + sys.stderr.write('--- ERROR opening file {}: {} ---\n'.format(filename, e)) + + def change_filter(self): + """change the i/o transformations""" + sys.stderr.write('\n--- Available Filters:\n') + sys.stderr.write('\n'.join( + '--- {:<10} = {.__doc__}'.format(k, v) + for k, v in sorted(TRANSFORMATIONS.items()))) + sys.stderr.write('\n--- Enter new filter name(s) [{}]: '.format(' '.join(self.filters))) + with self.console: + new_filters = sys.stdin.readline().lower().split() + if new_filters: + for f in new_filters: + if f not in TRANSFORMATIONS: + sys.stderr.write('--- unknown filter: {!r}\n'.format(f)) + break + else: + self.filters = new_filters + self.update_transformations() + sys.stderr.write('--- filters: {}\n'.format(' '.join(self.filters))) + + def change_encoding(self): + """change encoding on the serial port""" + sys.stderr.write('\n--- Enter new encoding name [{}]: '.format(self.input_encoding)) + with self.console: + new_encoding = sys.stdin.readline().strip() + if new_encoding: + try: + codecs.lookup(new_encoding) + except LookupError: + sys.stderr.write('--- invalid encoding name: {}\n'.format(new_encoding)) + else: + self.set_rx_encoding(new_encoding) + self.set_tx_encoding(new_encoding) + sys.stderr.write('--- serial input encoding: {}\n'.format(self.input_encoding)) + sys.stderr.write('--- serial output encoding: {}\n'.format(self.output_encoding)) + + def change_baudrate(self): + """change the baudrate""" + sys.stderr.write('\n--- Baudrate: ') + sys.stderr.flush() + with self.console: + backup = self.serial.baudrate + try: + self.serial.baudrate = int(sys.stdin.readline().strip()) + except ValueError as e: + sys.stderr.write('--- ERROR setting baudrate: {} ---\n'.format(e)) + self.serial.baudrate = backup + else: + self.dump_port_settings() + + def change_port(self): + """Have a conversation with the user to change the serial port""" + with self.console: + try: + port = ask_for_port() + except KeyboardInterrupt: + port = None + if port and port != self.serial.port: + # reader thread needs to be shut down + self._stop_reader() + # save settings + settings = self.serial.getSettingsDict() + try: + new_serial = serial.serial_for_url(port, do_not_open=True) + # restore settings and open + new_serial.applySettingsDict(settings) + new_serial.rts = self.serial.rts + new_serial.dtr = self.serial.dtr + new_serial.open() + new_serial.break_condition = self.serial.break_condition + except Exception as e: + sys.stderr.write('--- ERROR opening new port: {} ---\n'.format(e)) + new_serial.close() + else: + self.serial.close() + self.serial = new_serial + sys.stderr.write('--- Port changed to: {} ---\n'.format(self.serial.port)) + # and restart the reader thread + self._start_reader() + + def suspend_port(self): + """\ + open port temporarily, allow reconnect, exit and port change to get + out of the loop + """ + # reader thread needs to be shut down + self._stop_reader() + self.serial.close() + sys.stderr.write('\n--- Port closed: {} ---\n'.format(self.serial.port)) + do_change_port = False + while not self.serial.is_open: + sys.stderr.write('--- Quit: {exit} | p: port change | any other key to reconnect ---\n'.format( + exit=key_description(self.exit_character))) + k = self.console.getkey() + if k == self.exit_character: + self.stop() # exit app + break + elif k in 'pP': + do_change_port = True + break + try: + self.serial.open() + except Exception as e: + sys.stderr.write('--- ERROR opening port: {} ---\n'.format(e)) + if do_change_port: + self.change_port() + else: + # and restart the reader thread + self._start_reader() + sys.stderr.write('--- Port opened: {} ---\n'.format(self.serial.port)) + + def get_help_text(self): + """return the help text""" + # help text, starts with blank line! + return """ +--- pySerial ({version}) - miniterm - help +--- +--- {exit:8} Exit program (alias {menu} Q) +--- {menu:8} Menu escape key, followed by: +--- Menu keys: +--- {menu:7} Send the menu character itself to remote +--- {exit:7} Send the exit character itself to remote +--- {info:7} Show info +--- {upload:7} Upload file (prompt will be shown) +--- {repr:7} encoding +--- {filter:7} edit filters +--- Toggles: +--- {rts:7} RTS {dtr:7} DTR {brk:7} BREAK +--- {echo:7} echo {eol:7} EOL +--- +--- Port settings ({menu} followed by the following): +--- p change port +--- 7 8 set data bits +--- N E O S M change parity (None, Even, Odd, Space, Mark) +--- 1 2 3 set stop bits (1, 2, 1.5) +--- b change baud rate +--- x X disable/enable software flow control +--- r R disable/enable hardware flow control +""".format(version=getattr(serial, 'VERSION', 'unknown version'), + exit=key_description(self.exit_character), + menu=key_description(self.menu_character), + rts=key_description('\x12'), + dtr=key_description('\x04'), + brk=key_description('\x02'), + echo=key_description('\x05'), + info=key_description('\x09'), + upload=key_description('\x15'), + repr=key_description('\x01'), + filter=key_description('\x06'), + eol=key_description('\x0c')) + + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +# default args can be used to override when calling main() from an other script +# e.g to create a miniterm-my-device.py +def main(default_port=None, default_baudrate=9600, default_rts=None, default_dtr=None): + """Command line tool, entry point""" + + import argparse + + parser = argparse.ArgumentParser( + description='Miniterm - A simple terminal program for the serial port.') + + parser.add_argument( + 'port', + nargs='?', + help='serial port name ("-" to show port list)', + default=default_port) + + parser.add_argument( + 'baudrate', + nargs='?', + type=int, + help='set baud rate, default: %(default)s', + default=default_baudrate) + + group = parser.add_argument_group('port settings') + + group.add_argument( + '--parity', + choices=['N', 'E', 'O', 'S', 'M'], + type=lambda c: c.upper(), + help='set parity, one of {N E O S M}, default: N', + default='N') + + group.add_argument( + '--rtscts', + action='store_true', + help='enable RTS/CTS flow control (default off)', + default=False) + + group.add_argument( + '--xonxoff', + action='store_true', + help='enable software flow control (default off)', + default=False) + + group.add_argument( + '--rts', + type=int, + help='set initial RTS line state (possible values: 0, 1)', + default=default_rts) + + group.add_argument( + '--dtr', + type=int, + help='set initial DTR line state (possible values: 0, 1)', + default=default_dtr) + + group.add_argument( + '--non-exclusive', + dest='exclusive', + action='store_false', + help='disable locking for native ports', + default=True) + + group.add_argument( + '--ask', + action='store_true', + help='ask again for port when open fails', + default=False) + + group = parser.add_argument_group('data handling') + + group.add_argument( + '-e', '--echo', + action='store_true', + help='enable local echo (default off)', + default=False) + + group.add_argument( + '--encoding', + dest='serial_port_encoding', + metavar='CODEC', + help='set the encoding for the serial port (e.g. hexlify, Latin1, UTF-8), default: %(default)s', + default='UTF-8') + + group.add_argument( + '-f', '--filter', + action='append', + metavar='NAME', + help='add text transformation', + default=[]) + + group.add_argument( + '--eol', + choices=['CR', 'LF', 'CRLF'], + type=lambda c: c.upper(), + help='end of line mode', + default='CRLF') + + group.add_argument( + '--raw', + action='store_true', + help='Do no apply any encodings/transformations', + default=False) + + group = parser.add_argument_group('hotkeys') + + group.add_argument( + '--exit-char', + type=int, + metavar='NUM', + help='Unicode of special character that is used to exit the application, default: %(default)s', + default=0x1d) # GS/CTRL+] + + group.add_argument( + '--menu-char', + type=int, + metavar='NUM', + help='Unicode code of special character that is used to control miniterm (menu), default: %(default)s', + default=0x14) # Menu: CTRL+T + + group = parser.add_argument_group('diagnostics') + + group.add_argument( + '-q', '--quiet', + action='store_true', + help='suppress non-error messages', + default=False) + + group.add_argument( + '--develop', + action='store_true', + help='show Python traceback on error', + default=False) + + args = parser.parse_args() + + if args.menu_char == args.exit_char: + parser.error('--exit-char can not be the same as --menu-char') + + if args.filter: + if 'help' in args.filter: + sys.stderr.write('Available filters:\n') + sys.stderr.write('\n'.join( + '{:<10} = {.__doc__}'.format(k, v) + for k, v in sorted(TRANSFORMATIONS.items()))) + sys.stderr.write('\n') + sys.exit(1) + filters = args.filter + else: + filters = ['default'] + + while True: + # no port given on command line -> ask user now + if args.port is None or args.port == '-': + try: + args.port = ask_for_port() + except KeyboardInterrupt: + sys.stderr.write('\n') + parser.error('user aborted and port is not given') + else: + if not args.port: + parser.error('port is not given') + try: + serial_instance = serial.serial_for_url( + args.port, + args.baudrate, + parity=args.parity, + rtscts=args.rtscts, + xonxoff=args.xonxoff, + do_not_open=True) + + if not hasattr(serial_instance, 'cancel_read'): + # enable timeout for alive flag polling if cancel_read is not available + serial_instance.timeout = 1 + + if args.dtr is not None: + if not args.quiet: + sys.stderr.write('--- forcing DTR {}\n'.format('active' if args.dtr else 'inactive')) + serial_instance.dtr = args.dtr + if args.rts is not None: + if not args.quiet: + sys.stderr.write('--- forcing RTS {}\n'.format('active' if args.rts else 'inactive')) + serial_instance.rts = args.rts + + if isinstance(serial_instance, serial.Serial): + serial_instance.exclusive = args.exclusive + + serial_instance.open() + except serial.SerialException as e: + sys.stderr.write('could not open port {!r}: {}\n'.format(args.port, e)) + if args.develop: + raise + if not args.ask: + sys.exit(1) + else: + args.port = '-' + else: + break + + miniterm = Miniterm( + serial_instance, + echo=args.echo, + eol=args.eol.lower(), + filters=filters) + miniterm.exit_character = unichr(args.exit_char) + miniterm.menu_character = unichr(args.menu_char) + miniterm.raw = args.raw + miniterm.set_rx_encoding(args.serial_port_encoding) + miniterm.set_tx_encoding(args.serial_port_encoding) + + if not args.quiet: + sys.stderr.write('--- Miniterm on {p.name} {p.baudrate},{p.bytesize},{p.parity},{p.stopbits} ---\n'.format( + p=miniterm.serial)) + sys.stderr.write('--- Quit: {} | Menu: {} | Help: {} followed by {} ---\n'.format( + key_description(miniterm.exit_character), + key_description(miniterm.menu_character), + key_description(miniterm.menu_character), + key_description('\x08'))) + + miniterm.start() + try: + miniterm.join(True) + except KeyboardInterrupt: + pass + if not args.quiet: + sys.stderr.write('\n--- exit ---\n') + miniterm.join() + miniterm.close() + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +if __name__ == '__main__': + main() diff --git a/extensions/km-plot/deps/serial/urlhandler/__init__.py b/extensions/km-plot/deps/serial/urlhandler/__init__.py new file mode 100644 index 0000000..e69de29 diff --git a/extensions/km-plot/deps/serial/urlhandler/protocol_alt.py b/extensions/km-plot/deps/serial/urlhandler/protocol_alt.py new file mode 100644 index 0000000..2e666ca --- /dev/null +++ b/extensions/km-plot/deps/serial/urlhandler/protocol_alt.py @@ -0,0 +1,57 @@ +#! python +# +# This module implements a special URL handler that allows selecting an +# alternate implementation provided by some backends. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause +# +# URL format: alt://port[?option[=value][&option[=value]]] +# options: +# - class=X used class named X instead of Serial +# +# example: +# use poll based implementation on Posix (Linux): +# python -m serial.tools.miniterm alt:///dev/ttyUSB0?class=PosixPollSerial + +from __future__ import absolute_import + +try: + import urlparse +except ImportError: + import urllib.parse as urlparse + +import serial + + +def serial_class_for_url(url): + """extract host and port from an URL string""" + parts = urlparse.urlsplit(url) + if parts.scheme != 'alt': + raise serial.SerialException( + 'expected a string in the form "alt://port[?option[=value][&option[=value]]]": ' + 'not starting with alt:// ({!r})'.format(parts.scheme)) + class_name = 'Serial' + try: + for option, values in urlparse.parse_qs(parts.query, True).items(): + if option == 'class': + class_name = values[0] + else: + raise ValueError('unknown option: {!r}'.format(option)) + except ValueError as e: + raise serial.SerialException( + 'expected a string in the form ' + '"alt://port[?option[=value][&option[=value]]]": {!r}'.format(e)) + if not hasattr(serial, class_name): + raise ValueError('unknown class: {!r}'.format(class_name)) + cls = getattr(serial, class_name) + if not issubclass(cls, serial.Serial): + raise ValueError('class {!r} is not an instance of Serial'.format(class_name)) + return (''.join([parts.netloc, parts.path]), cls) + +# - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - +if __name__ == '__main__': + s = serial.serial_for_url('alt:///dev/ttyS0?class=PosixPollSerial') + print(s) diff --git a/extensions/km-plot/deps/serial/urlhandler/protocol_cp2110.py b/extensions/km-plot/deps/serial/urlhandler/protocol_cp2110.py new file mode 100644 index 0000000..44ad4eb --- /dev/null +++ b/extensions/km-plot/deps/serial/urlhandler/protocol_cp2110.py @@ -0,0 +1,258 @@ +#! python +# +# Backend for Silicon Labs CP2110/4 HID-to-UART devices. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2001-2015 Chris Liechti +# (C) 2019 Google LLC +# +# SPDX-License-Identifier: BSD-3-Clause + +# This backend implements support for HID-to-UART devices manufactured +# by Silicon Labs and marketed as CP2110 and CP2114. The +# implementation is (mostly) OS-independent and in userland. It relies +# on cython-hidapi (https://github.com/trezor/cython-hidapi). + +# The HID-to-UART protocol implemented by CP2110/4 is described in the +# AN434 document from Silicon Labs: +# https://www.silabs.com/documents/public/application-notes/AN434-CP2110-4-Interface-Specification.pdf + +# TODO items: + +# - rtscts support is configured for hardware flow control, but the +# signaling is missing (AN434 suggests this is done through GPIO). +# - Cancelling reads and writes is not supported. +# - Baudrate validation is not implemented, as it depends on model and configuration. + +import struct +import threading + +try: + import urlparse +except ImportError: + import urllib.parse as urlparse + +try: + import Queue +except ImportError: + import queue as Queue + +import hid # hidapi + +import serial +from serial.serialutil import SerialBase, SerialException, PortNotOpenError, to_bytes, Timeout + + +# Report IDs and related constant +_REPORT_GETSET_UART_ENABLE = 0x41 +_DISABLE_UART = 0x00 +_ENABLE_UART = 0x01 + +_REPORT_SET_PURGE_FIFOS = 0x43 +_PURGE_TX_FIFO = 0x01 +_PURGE_RX_FIFO = 0x02 + +_REPORT_GETSET_UART_CONFIG = 0x50 + +_REPORT_SET_TRANSMIT_LINE_BREAK = 0x51 +_REPORT_SET_STOP_LINE_BREAK = 0x52 + + +class Serial(SerialBase): + # This is not quite correct. AN343 specifies that the minimum + # baudrate is different between CP2110 and CP2114, and it's halved + # when using non-8-bit symbols. + BAUDRATES = (300, 375, 600, 1200, 1800, 2400, 4800, 9600, 19200, + 38400, 57600, 115200, 230400, 460800, 500000, 576000, + 921600, 1000000) + + def __init__(self, *args, **kwargs): + self._hid_handle = None + self._read_buffer = None + self._thread = None + super(Serial, self).__init__(*args, **kwargs) + + def open(self): + if self._port is None: + raise SerialException("Port must be configured before it can be used.") + if self.is_open: + raise SerialException("Port is already open.") + + self._read_buffer = Queue.Queue() + + self._hid_handle = hid.device() + try: + portpath = self.from_url(self.portstr) + self._hid_handle.open_path(portpath) + except OSError as msg: + raise SerialException(msg.errno, "could not open port {}: {}".format(self._port, msg)) + + try: + self._reconfigure_port() + except: + try: + self._hid_handle.close() + except: + pass + self._hid_handle = None + raise + else: + self.is_open = True + self._thread = threading.Thread(target=self._hid_read_loop) + self._thread.setDaemon(True) + self._thread.setName('pySerial CP2110 reader thread for {}'.format(self._port)) + self._thread.start() + + def from_url(self, url): + parts = urlparse.urlsplit(url) + if parts.scheme != "cp2110": + raise SerialException( + 'expected a string in the forms ' + '"cp2110:///dev/hidraw9" or "cp2110://0001:0023:00": ' + 'not starting with cp2110:// {{!r}}'.format(parts.scheme)) + if parts.netloc: # cp2100://BUS:DEVICE:ENDPOINT, for libusb + return parts.netloc.encode('utf-8') + return parts.path.encode('utf-8') + + def close(self): + self.is_open = False + if self._thread: + self._thread.join(1) # read timeout is 0.1 + self._thread = None + self._hid_handle.close() + self._hid_handle = None + + def _reconfigure_port(self): + parity_value = None + if self._parity == serial.PARITY_NONE: + parity_value = 0x00 + elif self._parity == serial.PARITY_ODD: + parity_value = 0x01 + elif self._parity == serial.PARITY_EVEN: + parity_value = 0x02 + elif self._parity == serial.PARITY_MARK: + parity_value = 0x03 + elif self._parity == serial.PARITY_SPACE: + parity_value = 0x04 + else: + raise ValueError('Invalid parity: {!r}'.format(self._parity)) + + if self.rtscts: + flow_control_value = 0x01 + else: + flow_control_value = 0x00 + + data_bits_value = None + if self._bytesize == 5: + data_bits_value = 0x00 + elif self._bytesize == 6: + data_bits_value = 0x01 + elif self._bytesize == 7: + data_bits_value = 0x02 + elif self._bytesize == 8: + data_bits_value = 0x03 + else: + raise ValueError('Invalid char len: {!r}'.format(self._bytesize)) + + stop_bits_value = None + if self._stopbits == serial.STOPBITS_ONE: + stop_bits_value = 0x00 + elif self._stopbits == serial.STOPBITS_ONE_POINT_FIVE: + stop_bits_value = 0x01 + elif self._stopbits == serial.STOPBITS_TWO: + stop_bits_value = 0x01 + else: + raise ValueError('Invalid stop bit specification: {!r}'.format(self._stopbits)) + + configuration_report = struct.pack( + '>BLBBBB', + _REPORT_GETSET_UART_CONFIG, + self._baudrate, + parity_value, + flow_control_value, + data_bits_value, + stop_bits_value) + + self._hid_handle.send_feature_report(configuration_report) + + self._hid_handle.send_feature_report( + bytes((_REPORT_GETSET_UART_ENABLE, _ENABLE_UART))) + self._update_break_state() + + @property + def in_waiting(self): + return self._read_buffer.qsize() + + def reset_input_buffer(self): + if not self.is_open: + raise PortNotOpenError() + self._hid_handle.send_feature_report( + bytes((_REPORT_SET_PURGE_FIFOS, _PURGE_RX_FIFO))) + # empty read buffer + while self._read_buffer.qsize(): + self._read_buffer.get(False) + + def reset_output_buffer(self): + if not self.is_open: + raise PortNotOpenError() + self._hid_handle.send_feature_report( + bytes((_REPORT_SET_PURGE_FIFOS, _PURGE_TX_FIFO))) + + def _update_break_state(self): + if not self._hid_handle: + raise PortNotOpenError() + + if self._break_state: + self._hid_handle.send_feature_report( + bytes((_REPORT_SET_TRANSMIT_LINE_BREAK, 0))) + else: + # Note that while AN434 states "There are no data bytes in + # the payload other than the Report ID", either hidapi or + # Linux does not seem to send the report otherwise. + self._hid_handle.send_feature_report( + bytes((_REPORT_SET_STOP_LINE_BREAK, 0))) + + def read(self, size=1): + if not self.is_open: + raise PortNotOpenError() + + data = bytearray() + try: + timeout = Timeout(self._timeout) + while len(data) < size: + if self._thread is None: + raise SerialException('connection failed (reader thread died)') + buf = self._read_buffer.get(True, timeout.time_left()) + if buf is None: + return bytes(data) + data += buf + if timeout.expired(): + break + except Queue.Empty: # -> timeout + pass + return bytes(data) + + def write(self, data): + if not self.is_open: + raise PortNotOpenError() + data = to_bytes(data) + tx_len = len(data) + while tx_len > 0: + to_be_sent = min(tx_len, 0x3F) + report = to_bytes([to_be_sent]) + data[:to_be_sent] + self._hid_handle.write(report) + + data = data[to_be_sent:] + tx_len = len(data) + + def _hid_read_loop(self): + try: + while self.is_open: + data = self._hid_handle.read(64, timeout_ms=100) + if not data: + continue + data_len = data.pop(0) + assert data_len == len(data) + self._read_buffer.put(bytearray(data)) + finally: + self._thread = None diff --git a/extensions/km-plot/deps/serial/urlhandler/protocol_hwgrep.py b/extensions/km-plot/deps/serial/urlhandler/protocol_hwgrep.py new file mode 100644 index 0000000..1a288c9 --- /dev/null +++ b/extensions/km-plot/deps/serial/urlhandler/protocol_hwgrep.py @@ -0,0 +1,91 @@ +#! python +# +# This module implements a special URL handler that uses the port listing to +# find ports by searching the string descriptions. +# +# This file is part of pySerial. https://github.com/pyserial/pyserial +# (C) 2011-2015 Chris Liechti +# +# SPDX-License-Identifier: BSD-3-Clause +# +# URL format: hwgrep://&o=Um0x*f>Qn78j@egNCNw=7 z6Q2_-<@l?5CYog%&srS#ZB{oYky@g<-XCx6E(;Olw!_GsSs4zrvtpgLwovHXYOU7B ziE^uMGHX4i>uoS^eO3!^!K`S~+B9wA)+~9_p~p2x`R&0YkKeuI7(&FyBf=w}kW8N( zu1GV!;Hk~Y;*ul2yYuqu648n~>)gq8P7dgas7sJbOfj6(V1SD2N0Gb8#wy04rbV21 z;7f=W=62w+91;I=V4rT}OM_hJDN7f1QM92~3-74En2hD_Q_FDt{pfKCtIxgO=M($7 zZNxVv?1ZL`5nGp4zP63N_;v{L#b{?U z{VeLM?=JZU>|r zII;Kf-0<*;xV`}4zGIIp^`Gt!5P%b)0agEBW}|;;32C*T06uU2PPz>IsT%z=`Ty6B zMymUtOQZiX3|n*IS1E)^g}3?@r5*_2DYVf5 zC()}{8|LyQBYW6sRT;-W>W?*7O=<$DTK~*OKbl0K`a_o0jix*N|I9}0boyPG_d-D61)q#JhATc$T>g;Bdk4x}6i`ykI-TI#&eTV(|inxW9s<)jzp!nE~UrG>!D z9u^s|r;|jdjh0%MWI5PafbzVN3yQ%cI>o6x4(SZQ@{G1)U{%H|17mshB6zPtd{DL` zxhSRlu+()>22|VMhXl&(MYXl79b;fD$?k&3E6YieMYe95Z$`3eUi9E$&b4(wId9ta zAhLH&CuBHo&!@@UtJ_K_weQHt8C$EYK>k484La|jOR5JavKrR4?bZ|mXnmdHZVQNh zc8p7&+NHX`H0^#TGSISUAO)K`TVmlo*?sSoV3@{5IwP3RMJ#(`CGx&6Ymb!_MPJzs zaX@oJxCqg_cAP~dn5{ZaRKDKk2v?k-zDHExwA7cqj83F`q0^W@X|IxeQ8KLJth0aA z=fOiLBf^4SrPgmmhx#>4$e2pB~k`GuzebyM|I`3nLN zHcKG(IkQ7eg-O}n9&f(ET9aJ;LBxY-UUCb;FZT0*50Rp>JHkY`>%2ihXM>4ggEUQJ zZ0@b)IE>$y9hz)bS$BD#yoRDC`@jkEermcxodKi5v`y+=|A>ywTmL~efC;NXr1j8bD-EzMUKF`Lkzi_H z5*-26oY(JU6}MTrt}|W{`onncrK~i1ZlgOi3v1~BQnT?EkHzM4X#_4L zYXjv;557hMS>()6zw1rN!cr(DGmzs*ey>CWv8lS=IyuG$t3K7b zBnH}HI#|qW?4U*rm$1i}mL{bQABxusLc1i_3TV3TBFKp)T)p4W-Dzzfs4_U8O>OrL zpB@hqF^XhNi^@;$R@JQ1GYK`AHcS2R)|}Hi6xnX&B;!3nqIAfwlguCb%T?hrQjVcm zS^J%aBCohrOfM(Brwh^Tue-F-mE?#Q9>bkTxX0&yo2sZl&0eu{6H_ z|J`i#S7uhRxjuE`)PnzMWjeOG5u|WtqxS?}o@{PznK*Osd0O2>ZD}1+ICsf>T02y1 zX1hLi*4m4pco9hSdlONqwGVIdB9#C4 z7J6K3|NlnXTXxmCcH5dja0u@14haMZ?(XjHPSD`)I+?h;yG`8P-Q7Jwf(4m}wRXMx z?2^{1TC2Y>K8*W$`sn@YviarUo!YKqAq3}} z4fb8?1cb6KzFJ$uk|F|R5ww+f1=A8h7839bmr|h-!8*3uD9#{+QNw!mruzX=1wvc_ z_qU|xE1A8`pzP*&waR-9A39+}vs|eU{e53V7B>=|A#|@g-~WF1qPEoa&D8iT1Z1;b zjujOVlkcDz8Gu5)(6C>lSB;?B!_enRJv|A0;Jf9V?rd|3>?cIB#QPsftbc}p1wr#M zgol5J@E=^P)khL59Bo55D`GaKIt&YDy)jwYs3V$)o?uf7STGci^VvCR6zy<0lJxs9 z@-v`FHiP8TET8opj!Z5O=7%x8-lVb+6bF)tVi&3m2K%kOU<;ksmZ^f77yr%}XhtZ1 zdX0{9Gnxz3oAX*K1K3qkfkqWxB@qL#%JrKC>|lCpRx8mi9^?yFjP<&G-_H5Gm457Z zprO;k0tSsc{DF{mYhoqpdm#~t5M<&@dkgKEc92p=m7mKCi_t;rR7y|~Y^c=ljpF0< z=93A=viQWhr>fbKSHEfqxO-E!@#AIq6zcT}&;L*4+<)}9R0x*;sLN7yWdC3EH>qGc z)&Cd$&1%-a2mT$Y&b555RLPU)BQ;|)Z76lcoo(}BO;6Hk_9K>ECR=VaUx@qs@})p0 zlajt${CQ$qyF;OVdW*Ly`$JTIg`!z?FftAd|3qbA*UD-#5=H*auZpew2qN{r^tY3l z9MNDB{gx*Ejw01)gX(rSm0(cXxC2iI=hX(tTmg7rKA$b7as41}ifEDDhBdo=t> zGrV#Llu?MJN|qfyP1nY8_cXQw|5?@Zz_mFux51~-1ccc%tWh{(+>{#nQdZELWO}e^ zW?Oh6S|8-5kyE45Uw(d8#4!6fj;fkLNM{rjEsmT30ua^c0--oEfQj%93`bdT)$Hm} z5KTcqEJ!gg6*qWn9zeN?6L={zT$5!rLs<7!iX@cFK|0kn=%XzgLWt^b7C#1BlC5yc zTH;08qy*ts&4RNgRTgBLjk)kl|6x)&R3NVs#u{SCc?A@+ZZ3Zj3ZsKcf=LBNMQvnp zg}1}hPls%>3{QRDr4pSQ;S!u>nTAh2?Z9?uxLH^k5EUy^{qVTXPS+g9pC7)VG)rZb zs(m)532^h4HmXH-eM=f__7vJ8$f!kULRSi#AD`4TM2W4?Z8CVORL7Py&C57VtW}>9 z8q`{t+K4WNK)W#)UobV_oP?{>&Tkvs%#pSP_XUtZdb2h$G(X27`K?-AYBqrr454G# zB7CK4jnGAh%qN1f_Tc@-Dy}c;-^a8@!kNwQeUH@Pjurxk)qHb?iK4aR=0rvdA^+5?L8 z&r4&?v+U=V18X1$*EPW(o%plK`Fw;$}z~aSXdUsPl4hw@`g-Jeg@e$c&Yq>91Cwb=j zU8>!XL^wCHNz^1-X)lGrk07K;9q8DI-cJNyognjwU)iPl8B}hfBoK8FTC9esw?s5C zkSQ^TJcJEnZ(<~ov5n-KB}g0U!|h`ziB6t|dD?H{oSRHZZlojy&gK@lebCBy0ax_C7IDNe&}ye^GQXoMGWH7 z>HYOr$q1OKOxUm!+RMO{`oUsm7taZU57DgyxrD_j68J^qA`M2Yq$g`&QkokxX55a3 zJ+Yi5_<#OHUqeWKpux#L7ToMVyB=>B_rD)Jk>GzGJgJ*J{$Mo9k5#2?G!laU4-k8T zWGEKQ;+*s}v)q&LmD=GiHFa@cJiPs9sz&AUQ6Lk{a;Ft=k0uYQ?6}j+M|}{D^u!*QACj?2txrQW}`5D0PUW6&kr*s|PuB;-k)H%>__&>qXOeNl1@!+qU!*sv z?!;wxJpS5>{SX3}YYflsPIbHWb}~L7w;xQ5ct!ti?;0&_YeZZYHO}{U$R|VpPq0#X z0Ut_1ULZ2gsZr2pky9hOw;N6J034MMpe?R@S$;Tv*oRzDFq^m?Nk_971@RFhjACZ) z#-og3ng7`0-;N^=;=Vsv9mMn0wC>aC7-1?ny;G;h0_FaV7XPahC|DN*_hWG55_O?g zic(dA%8SwzfM>bs2cbY|x>YlvydYxt!5D=gi&}!$6Kix z%84MvYVfOur~Vslhsyu9fJn zSA7M|D=>dsk-MAXJc+rR=6RgFn+g2O^k;^<1%rJ~3Uw=PPWrq3H{R;9&W6Uz#ZQTg zaA(DC<9d!)94qE=4|V;ki-jP)4F2lL!-t82K=T&i$4&XAZH-9qL%d*6 z!&Mb?RX~^Kn&wI|u3q#=GshZ3?%TPk)fq?a?i6Ss>M$))XM!vHi!Bm2Y;5P(u|hz9 z?fH9!!k3GRT0h5gMwPfnp~u~t4xzTY?hc5qPhjusK~!*u;n2?XY-e91|96=g#SUh# z3{&~I%mS;zNX}ks;M7Bg)ja>>no%wP<2q%!{9eJj-+tRUi5e>JoaBW-9jNX=@vzD) z@dyk?FiL$r5u`L85QNxN;fjHd`vGuJd;BK5uYu7PsOMl)X|1fI(1_NuR7(xE8anR2 zt-c5qC8G0D30)*dL8Lwl*@uYZY6=u`Dhn1|r6bbfY!+=48VX+cHhKbHl|V$0GDea# zlQo9lPo;6lch8fKF=VG3np-s?(lQmNITeogn++yDKp)}xs~qoFH6TlUZo;o2-0N0W zPqIHMwwFO$1>a7k0HcgAm-fAxQ_7eub5%rmH55RL!WIFw3PoQ;n{kdELR5J@!qC(g z(AA81#Cl|>(l zP47&rQkIA{Dm42MO@YcJ8?c5dp9leoBEs+^inm?WOr+w~Q{Yu8m<>I3 zJc_>948)!kDG3ht2`Jy!QA@R1Gf_hT$rWO;@U}!S+}je<0m1-Xvf$i^b|piLq|})5 zNPZNrNi9S++OQ@|k(#t2wNB7s z6;#W7)ERUHc+i}!MEu{3LK$Y(P`&N;v)+v)=`_wul)%@bf~G`qazk_DPuAzP(!FKq zp&bZ~O_Y!-U-y5I%T9PzeM%h;ie$08jSiu?jeLNxpb+O>a)tHEOzx(M00Rfn?I3eKui{15--I+=2OXHEL9= z8oP(Pn&Iqbi4>_;3tpjLglPnE5N85siRu%{-g0g6kk~wn$hcqw?<6iOdVHpZRjdzw zi~LLF=Qs&?>qmM8_eohF)=3F1Z6^r=KS!b(3z%mKhA6jL5u)8o<|M@=oB1ZuCZzHa zt~|o_pw+vzX$MD61dkH7H&{$~0Ju6|=Se*w#`jlI?1CjC~lWl?-i_>O&xWj@h1iQ`#C z#_VFXL_{tqI2z=(-RF<@4_%9A-ar43|5yDpMMba0)a^gmjaf$uf;K9lDd(jwm3uo-U2xQ(BAJ>ugfMruz@jw)>%R#`kOh-XYMX11u7x_`a9f^Li>MxG5)rqEgpmMok&oJxmVvS;~FC z>*?vgb_Bn^^nf8o{h>Vkp`ZLeSp~r01t53?AX){yobZ4#TvZeOusr;5v;x~L(Xhoh z_g92nZvsP?0&`Qnsx*TL!=2(DJqTKY8fm>*Jc5{>f>>Lf7*>VFXo3!c0&!b|dGLI^ z=7Ra~LWH3rm+Lh47nrCPjY{~_3hcBckwN-@i7g|@+k z^}vP6gokQ*geqHwaHNGWfP$^*Ld92u)mAam zN?kIRgXpao<-XgU0=*T$kb?0)BP8Gm-R4OIgyk-rBA*fnGPEMy=4sPUBeUqDay%jn zM``onNx2iEibtcets=c{N$lwOCEn2DMU=E`C(lVi?cv8DU8I+Nc zXainPzjI^bU}`7iB*gJOg|@-Rx0EGVjKsB-#irF;Zw19rO9N@NW2P+_>7{|J_0~-I ziAf8@D@iaopGbs@-Qnf5$3nT2c)w)7i zQMV+qR{!wmie1J`5}*cT=82pkw}J3YtQ6XWGM(a|_#4nuxi98nIG!EfV=PVL4g^HKie z?!T9H-fs~tmW@GBsKd=D_!O^q7cy}MXw_zBNQ`%jVr)DsMY73qmnkJ$Db-B_V6~O4 zgQdk3{~*n|n#1kM1tb*05r{C(hnIT>>OXnw>7W@LQ+x_dcrP!8T9?$#vz}AKt9DWg z!7pOp^H9`ec{t5u5}{N~H|AJP2*h)jNv{Ns^&t(3b4Ja>okM@pb~K~dM86SVu^UG>v8`L z(cwz-YpntQP#b6PBVSCfv_g7sFJ5hDoEuakqQ=9afoOL%zWuA;S5Y$@}TZ7J9@2u%oFC&YKEw#(R(kR^!?$zKE)v&J8;GEIG($Th4Cs z{q=ZIQaaD57tT;>gVX9*FZ8=;39)9WMEoY*iwD4~raJW+kLvh<*^@{D6=*<^QE_jJ z#%!iYfv%WI7ivxzQnI4$7=&_OwpG$@?Lmtz=LB-N=Iz9~VRF380nIQ|;Fq={nH0=s zS;I2|`{!i-4z?2lt@ER{t|UyM`#K83di7BYbX}7WW*yMJ4WKWo=-7?`q#EVG5;P!Krr&txvbL zc0XNbKf`7})oVWk(E$Bq|F0@kpxm0E3AvvlcExREFy&>h-fs<1l$cb3A81Ab88?wO;H>q%&tl^&UI7jqh z!>R#CKHMLABd$Ip&c-92F(WRWBgb3=n;zYPuR|0o0}+R<%`dou;K>T*rcw35QNZgc z@NzV1b2No$EEyROMGh3E=U{fD+c=lrLOy)LHQt;sP$fKG5JOlIGhRG7Ub;EnKs3>0 zHx8N{KagcqxgT-v9PfOcs70RaCYl`Nn;hPp7-gCq)0@=Im}m+j{I1tOPc*g2H?^!c zwdymqo;9`EIko*73vn{}cC7DYSCMHqed;rPo;7{hIqkzYyr0ETZkMdh$$ z(C9OU3IB2yMKUk%C|^~hjee}1e!qinwPSU^Q`fSy?}~f&iktolH`C~kt_6!J`X8^0 zA;e2z`l}Jdo$$n~gPh6G{Iig6t3cwlB>h={{aT{^?4#a{`P8a&!$dgodL;jPf&Hpx z2ism2M)?~j*03IfiGmKU;O9ZGA48 zDOi8KXlrxwZPU4ab!L8kQYXmymf+KtgM882vd+vlxNB{9Yimz_=3r{;ka_#mcl&&6 zZT1!^(|esE!32hUCktxbO&HMvdF$`h=4^X_N3SzH+YGAeN*-!WsxV!J8QMc`$1s7)18Pn9ZrV_DY9~>f zNRS6kPBn)y2R;r5eH{eSXy5H`s&yE)Cijac!Gl_IxbiZARR`v-sOo468)^t7CQ;Bk zmVJ>VDDuloQ#oP1uE5!;cr2^;6OfZwl#t3Mq`3{@zB>G-%itdjky!loq zIxzv%fF0`7$R;T#6oZotHC=CcNS*`V?n}S8X|fcE_uB)HZk(_jrrvJrj*xxgV~@)7 z{mcimPfoi%B$ry$-|1)|saZ14r#<29XLu@&1<1z_c~f1om+=&S|H}EDqWk-`=C|wG z?-#$gs`qmz=idW(UtqG-p9aM+dDV9cS~3H!av8tlEumcVoD84WJsuuX+KT&5;*7uF z7)_2){vM(DGD7Wtdz^O56o1R|8%Km%9Tt2wjt8xVHzY@R{L$vDZ{*c338TC<;TlCH zHO;FOm#S>At_C+uK#uY|_x;Zf(Y=!3y^3J}=k1l#j&4=T&W`q|uaIZQ7y4EBxHV(< z)z=YAv0fcjW8ua-cE5+zi^SY+9XTxI(4X+TKhbdy==hvLI*_Wkmp=2H=~$4I+YRg)I3wZdXGlZ* zl~I-cm;Py=)MIj-?}Y(;J+{=8$DMP%R!-1o7~HG%ypHd@ zPJ&;9Em*vUeMt;G54ABZTopPC(#;A2yZLwNZZ%5;}n$o^rle1SYe_;HeVj zP%JL5#UUPWPdp3`%+F^f+bfg8tlu4iulj-2;jr(2eN+sXPUUmlf5lfT;SYq172(Uk zI#Vf@PZw|_z&=+iS1&hc{wo`x5-8H;2Sb=*K3#9F`B%(#xp*eUZfM-@`)$5nyUW$` zkhi9zLAUqY1I+7n(PoX~XHw2rMMjfhWBX=IymUITv1D4^VIOT5i|I`MpRjM*u2%Dj z%{bJEZ8tW{9Als`{X5)44G`F72b4|t=&;r034S0Zdit?9^l`1sd2I>UiZ&H=d?Wb# zCs`+3cW3;z-Tl{6hvg#)$?MbA{zM|!&%oE~;dsMQJ!`AY^){M+@4v7y25fL$5c_Dz?$) zUdF`;eqP#g;n_T3n~GE#cU`kD7U?u9Q~;Ccx(!daJPi=uXi73+W!rJ;MwmCVyE4ui z34KvoW(+f8RR>Rku!6ECAslwrVWPao<91Egd_}T+)rJ|8hk1WejC_Q|F}|M8N*{UPkuCSMdi0bMh0&X`8F=SiTTW<^?LgGcNg}du2UA-Nn&bHlA)B7AN8s2t2FJ*&qJS)DZ!c5{zTV#UC%$%q!CzbQsk$k zr@Hk-9LJ7DynabP3tnDdk#0#vCtCy|Nl=u@Fp;5FBsw#ijFEJnC3%xpVCg$+y`aco z&Pr%Qg9E0(o?fPrSPi%-nKy?#^Yr-&KZbeM-v)44lEer($zc`}`a*SAgKn-%5~%=t zcI9_*%2>e-YzHH`LTV%6@8^nfC z`O^^ngaIq>a= z;!>FjD@H&g(k^A9Ic|7T2rzY19g1p~FIb8kGD2?Ctk)`Wn0n6vV|5UT(u!N{J%M^m zHIh`*xm^e-V!`fYvf*5wJ+)*f*d=Q~_%0kq1rHI+-GuTQmM#NXW)_0+V+=#Il;MdT zCQ=IAMuY9vB2VqS;9k6Gb}P`3%)(Mq6Be9N1&-=OlGZq$|$28Krvk#8L6l8 zM)fKF9S2Vx#(I+~yOgxtRI*5K5*wuqy(%HC2`rBjE5ac()1_#Mbp7=?#Fkwb<*_jm zItDHG%}(~D6YdLNMu@|?t~Bg~Reat@cdCzb~V1ubq|&XzP@r+oQR`Ad7T%?Kt<4I~(#V?p8PLVb<*k zHJYF^*`FB;y;#2kiQhDGd{9G6!v1WiWn+#CH7Vm%$kN@YC_|UT)I%Tc7<0qgM&yW_ z*8i%}2ig%zj4X27Td-wYwTnzM^IGz@TQ?b|0Np3!xo4wg({z;WkJ%g7H^a6~L0$I8 z5xgu*%bYH=%nokhFB{V?kF6_jzdR>+w|_r?x|-j9`Nntb+#k2}jOf#Y&1~Hlsj^I; zbdYMfX|kFX?U}?3x^i`KzwTqX!Jk5l?nN)ylM_vNh*3N{ft|D(h(TuiQTC>%gXztV zrd$=WP3z0uF>z&n&$fD%HldG$%&c%c+1}bVVUK*AFqVJ%NQnhjaEL?s44Y>RInlB+ zYZu=~`{C`Xv-meY&c)2d#mnu^PZ^gMm zyDbX{oaNPgNrwAbF#V)1vd$R31u+x92gSPHX0lR^Qcqm?g~(Z7+rG+(#O}H;WTDW8$i@;mp^B^X2 zVJ|*1=f|%*3`K8!ouD*1A}V`EL0<+bRzDe4e+j+_B@qFc9FCoKzqNJ0T|UqIcwg!T zfm1mWzE~TazqWgw>$Sy-KxC!XpGaO)+X8V-e~m@qEvIz0M&@ z=Ux+AQYK)Ge_Bn8kXYPUex_7TnpNG1OlcBY{zF2L8e0yR%_r4$R4oF^r-UHRr=d4^ zhEsAHmWsSZv{Xa95mtJ!Uk#O_dfX#@z2-W#$1;&fauxV%)mnSlk2;0(Q1#oU2+Bq1 zD4keE!WjYc5{ujsrmv_70i?ttQp#8)1-*pFy@a{rIp75Xp_nS_Vy}pJcY3nO!m60}d;iEhh;_DAfHsagmk)XfrH*|Fxlsz$zw0c=JPok=eO zB_Uh$gl@|e*=bt%#J}6nkv5ELM^W~flzQ#UxC6zM4~vL^q|$0%udgXgWgwK)=nGXy zSTQo!e#my)&;>$d8XHR;;=}7ulr2Dt2RV}}iS^Gwi_G$gP}_w=uLgDQ6|%H9Cd-yC zXp1N17n?1T5R8wzd*sgVk85T~hviLGOF<=jP=b%I=|X*S*US(+fbx)wNa1+FR92xf z(sUtGwBC7S$3~;xDigcks1;NuPX3?@BN9GJ7b{Q{{=FF&)sC186la5gs`RAaEzw+}eqlri+)>c%aS(8c;SHpgO zYQk)Ws5Fn$X4p3Z{l1)5a7kLumOq z=hKu&WJ#Vw*<6`-p5^{{k}T>}9uy1nCRN~-&SuW+`R{HET%ilx*b)d*P|};ZRCgmL zl=P{ynOZzk?~^3DXoRbqRG{5TW}Zw9E)^!8YOjn@34W#3s?q?U1XGk)i%#uxJ8s{3 zUI96hAq1 zL7Sn?#hiR9H3S58$wl(thl~qRlTK7Hl1*L$xblojRBH9c%cp_xF-@6s zL2_Ye%YqeTGn*7iS}WZFy`xdR9-%9vP;Ig%J@kt`0_daLYqcCyW1Lx2o)c* zHHvra+uE%7`rmFc0L@6F*vcI+^$B229$Y~&_|u!{_#Z2Gha&ESny>|8qLl0`F1?K3 zs`{zcgeuhyjuunh*3#_PQl*J~#XrG|*F z7OSt9n6HN1Tn~`+rOP~>Q91GJ zGjKEjb1Zgqv22qyP;X*NZ&F-x+MZ*kcylUSZ|Z7u4n}|eO>ZGvZ<9`9xEkX)cxB>t<^gW_vGIi}-nK-@Ic}zYRR0N#<-Y-qCXk(|a7c zedfD8HehhHw0(87{p)`FH_Xm8_RbCU&Mn8zo%qfl^__e3od>s_$IzXpkXZN; zyLUfN8zC?6q8#s{;uxdS?4hw3qe&QNcpJgG?_#^};fC$urR?FC>=A(W2#5EGmiLH{ z_edW0NMZNMaQ4Y*_9-~`DJAx)H1?@2_G#SrX~XvEQugUf_W2^47>D`%X(bLgEDku`4;Z#Pu%ZsQHTVV-4|uvwc}qz#_8lQF`(?;mybK5TiTTY9f=F

rCGrX1lc@5xyl7{DI0{xYW< zJ~G}mF_y6Sl5#`|!WF3D{Xms!upFtmGusXytK*m}#T`7|S&-%&X@O9gr%{<4EGPu( z{Y*gln7J3(J(q75`O!(|zDGYLdblNyxC>55U=M000HQgV&KmoeDo4)?$H6(r!f_Th z7N>S`j25a^-X!~AaZtT^SfwP$N-F7)n#RIh!h&_$3eas8E^1;jeVPdSF{gb)>r;*C z;}D6{lrZbGI1h%&4~xf{tt_bxtG&8lmnA)+oT7pbz8eZzf1Et zy8r_dOv0lKl8fmF+nE&WIsvQ5lx>Qd%eHPipv9r7z}3+E{xGaHx2?UA0_c0C37KO&vm*tIHFs`RRR;wLOWx_L zt>a(Y0vACz_Q5RVhbfnfDGr?_`~e!aw*rTEoYpR39TEeVOTUUw-5tlbPoEWjZ!9|y zUpn-@JK9d4@WPVzN7L-O8|bR=lh*Em-0&(+|#2UxnUd6@X^N1C`q8Z5r0_oU~F4$kTDA#0P zZU|ZorWBki1@>=g^4+IPX)JFE9i5hyoEdU%QQ-ziG_S|{N=X`TZ}**v;c~zFvtN>! zY(5BrJsdEe2Lw4vJJ}5}pmQ&uL2LIKPTYd)45`S&ki@|0udW~u8Q zZi^oO;F$Vg5&zR6_b27a1z*dZrsN}yz`4HSPt)&LxI5c^C#MeGf>eTEeM;#~X`HW; z-AE2oJgV=HxO1O8XZn1*pJGp*;vSzK)Ssvqo){3||2J0U8bSf04MP6EjPKBO)OC46 zLI3xzge#HWUvL|W#y%{Q40cO0|F*HLq}md@m2w@}rKBlao* zg%TO`3G$M=m@{=Czpk?dV3lY!rfgCHVtO^qq7-2IRV&vTvHTNco@%k_%T;5y#bjGp z#9M3+6uQ#qYIb^bL9aG18hHi~>R^VFiF@1Cpa{72mlpSW^G1C8HCs%wz9sn{on~pD zHumK)TiuUZK%+dHg}UVT2J86Z1!f4)>Z>Lv=y%!!Tch2`-AEkEcQ^^KPmMTXbphef_mMJ#Mou%6yNJ4+Cw!HQIORtXl=YDMf z74wDW>ZSXQX3XDPy67t@*rY*Vpxl;H*Lxcx96NyJN|7>6*GTSK6X=_u5R`Zq@pNp7 z(VT`#&#r4Annq2IE<;6G_*GA8eF4$l3|U$!$~e*DiHd-xT#AcN1;w#!faLZo1)FQc z)B9{{BT#A_7td9iQKGLcsY+Dk^6N5J!Dtk{j1#d&j0skK*^rabO|$_rCEf_#Fq=wL zj3v7%etnw6R}gEAquBugbLcSla6+7l*$_{~C<-8UfE0BxLhw|XOWtY#5W!c($(9hS zWEPwd7jj5R$Sp0Y(*R70F{7cUACq+lCT1=kQj52ZDFWvc^9QLIB+F%FY(#8o%_zvc zv4CLeA{~0wQKmlXBK^M&slAKZUp?t3O)&1#de|-461XSLd0f)O#p2?CtLT;GgCUD* z$U_bIz)#M1UqBz=i4o}pA>cR0W4==D`7;c>b+q7L>{3^YZD~JPs3T6YEQS6DyY3&W zd<%ryf3iS$yQKfI%KsCK`o}7tP*5H9|Cl%bm&Fr?Yxr+L)l?>tKlLI#;H1|O_S0Y% z7gp(9x-b%n{7HDU+H%C(yh5eIsp*Pvxe=1bQwi2A&^ky!OKsQPkvH`Xu*O%PK63xTM)8{(k2Yob#6-n?zDviY&74^CYY;> z&Mb5k{tQMYkVA5m&qJ+;P>i{g=T3wClHF-*yt`?a&NWPZ-c~UBKYjfiNWdyX*IK zX01@+=tNE1Q5e!Mp{f|yXs*gxO!|CnY(5pnU(@Mm*_go`N-EONMXc#I?w$22ME;jf zqf|&CH$!x_gAC(=!^2;Nzo23@3VrKsQBPohX^{1vWYc$ohS=nE2(`9I6$BWT#?4rvD?M2D6y5{85+ zVMm8vFc67OiqdISzb_Gw#Su0*dQ&(WLnT}gVpaFQ+wcDWg1$gt*kNq0$Lg&PkGp<5 z^+w8}9(u@^&vG7hd+|Z&xHM&T^Plb($y(}?Eph+o^;&lXBl z3qOK}92YA!rXRJf-c2GKrH-kns>1hn6u zuhxFF-}!z-RQ|1Po%S#?3(Ti3_&(#;<$Zs>FyTm=`~G?#ceCQ}@81J{e`_ns5c-rO zu`5(a{7*!MW|b@mjpcMV1YLm67~)|zbP!7!(g43L3K zpS?DzgTXW$jk9sXcZ*cBlE~wX{^YX~m-$dh5)XD2P1*$a`SKIDpSNkWxdP|k4gJ7t zmURB%IR8de5RD4ryDb4Jwfa`&p=l}}G6x|HVW(6#6b~HD!&KhbNqs#oJU|XoQ1Zv@VvxJeAAM^ z3Qfo?^$Bz82=S`DOIcJobLc@1l4a-t%=$^zhWZMNdj~A{cGoWkS-Qdm9-A`eF~lYW z!&jPi81E1if*%l>M(}lwZx6g@P2g*{y3!njXlsaSC7%4@9;-))vK35T0qy7>1! zb_JCQ+w6o@q-f~+Vfb~@WzXjL=){P_ve9IjsV_i&hTo8K1De)Eo#T4QnD^p}Z@^P% z3u3fbngbN3$X7|`(|q4oq9>SUr{f2x`lg`Vs`IwtX^p=*Lf5XiL4A_X+5Vyes1L@5r6MNxhHivGK9 z>F8{oz7k-9Hs;WXKwrcx+?F_Y#WRwsAs0`kD`W^kvf7%p1x>DE6}%u-4-;lIL&onC zUxf%&FpCaQ;clT69o(cEQGHM`B2=YQ{CFlkTo2=)G|0I8Nao8 z(Cd*?cS;r~WhjRrGda;0F zy_z~Ey%jZP6fqTT53ykJMOvG~OQF<-81urW(6)vjZgQ8Rck1o~oIgEv;unARhb^b{ z;=vI+ML0BRdD%#XTIqR_2VfCyiZsMLUY5G#|P`P_BkyP>q@8 zgr)N}5s^^~4f_Y68fJjg70ho=8T(=ZY*di~Huf%hokgy5 zF{)_G9Ioo`1FJ$P<%}nIv^stn+iXUC$DgH`ruc|CBk6bOV6=b+>B7*WMedMrI$HTZ zF0Q^Nmm~z0Bg0>6Zeo7QT=wbYvZKuB1;JxSLv0 zvg2VkKFs)`up8b(CD}C%&aw;tQ82QKhULsKjnAQ^r^(il;{7|HGW~~$waZ#w^6x?x zY;&pTm6Zr40eM+mgt3nCq}oraC9J^a3RMbQP5+|h#yE~@R+Ill+gm@y75$5rjk`4t zf#43o-Jx*^?(QBO0>NE^yE`<&U4pv?cXxLP1nJ>^-^_it>ec)<^B?ryU8m03yFP0z z+fLT_B>1<7hXCetW9*mZex>HR6oYf4|JhS-0>}f-0Yv}%#r)sK>i>N875=|i zru1c}@&1#gHJ5QN{dh5JElzxQM)?!S;$QuW8<31sAd|#kAu~oRUI^vE!X*=BwE(8G zBPBVWJL%TE7>N)1kRkladmJmYC(>Z()yx7kqEs|jZ~W{&Cv*Uf(P;(g0jPL=9;^hnUMMV$a$8CbK5Ih@vNK9KVjIXz64 zfVC8ZYD=Mbg#hl~{)b$dJRXKK(6UVw!7q=-da1$kd6}Lb?kg~nN{)v7V)rKKI=n(A5lU+q+O7-!AYxZpJQ-Zh$w)nV9g(OmD9-Z zI|-*2W3voY4~-*Nxrrup?_q(SauY=%^M_}BCz7@e)&zh#rA2H21Z?Yh(Jd}xfw+8S z^yHycmXQI)=GJ@hgbyvIfJ3N3Q-GV8^nMcMvkYajdMeI_y&BQHk`J^4m^uy0OD8@Z zHi0ib!=U*?H%|Tx3x^E&5E|=1DSwD8a6bOKt`E5R_2UxjpY>FW{<+(glzWOK}a$WjSI1;U@&y2 zYH0f72g;m9Cgo6mtHr2Sr3)oXwm>$U!UAIi%j#k*5$YeB2pzv)CYGx1`kpA>YA-hK zB#UehifZirZ6Ve--p{!@;z%K#(~FJef8dfY9e7 z8T%~loZnB?Egp4FSDOMG4+V&zT46(y1h8poCg0YXPbI)zz{LXt)PE(zTO_ij7w0pl z%UY4XE}$2RW>f*;r)_V+%m5%al#F*caxAKLl{NJ{rOl!t zGytcK0d+dImbp$9=rYgHSUX*5470yM_ub4aFo}3|w!H5D4>k73mXrdF02oki|Azb!i|TY{JRbB{?w#Q&v2;8O-VQj=7jGq_ z_XxX+LIfyRE|h{n#Z7m!Q7Kf)q6p=G_yEGSs)QFRk{LA%4Eq_X__^&?$~e$UnOjqh z*8m)A?YaW4eVr|gcjBmHEp}VoelRekOs%Xt{r?rO`*7r%^&rs0e{2ca0f0CIohoX@ zB_Iy!w5eivW$7@mv=>=n!~Nl-`v+6Y^5*?z+UU{os5xA(<=bY54-AC)x7YRFKmvx5 zqhOos;aHZ$hoi$&OfOT?0y`zL!{chB;~NCy%2)8|YJ<`S=%4%hf6?6-{(=IjXo06& zo!uh;<$*)o4uHm!*$#xKiP#Q8CTdj!e4K2Rcni!qOhWN>WeUOw9Mg9~u^s7R!>K&1 zDZ=Uev`wQJE3{2$&YsMb1)v&DV1M0|#xhA18zUy*N=8Z)HDG ziT%Gka729Z0#I(@io6->#}?d1VMvGRreU)O>8qg}rI`fPCze@Gx=*Fq&h@fKIXlK? zhx|Bv1KW9M&;`ER^vGzKl{y*vNAqc}+ zWsZY6V-;O!)LC`uX~n4w1&GRCsvi&bTy*%h;=k!`#*4;zO}mSxF`DsHnRSY@D$$Lg z7YD#jqJU%DvFR^I@m20$7afD}^5?&Ys_m{M+|ZJ1L|-;L>^t7y|NZHK#karig*@H; zQ9f^+W&P-K%pnipNDI~tV#;UV3=)~0I}ek&POvc&CVgTX{Xo3gM;PONJCA=W6467Q;=IOd@XFN4~*A_g{4QG-4<~~sj2$e45DYU|=h;S0h zl{k0inR5HC+MjTX@i>T|-ioSVyx>pr{U*&f&`MdXj|H~cPcQ#VJe=cMsDt!w!% z%lBc`^N-L2>T`RmnB$lEZ#(PJQ?J{PpI$irJjSH5_C7L+#J@qs^o`LK$JdL{|J%!h zJmL4ezkLg!quho_iNW`5oVvh5k-`pBfARQ!=Dg3LFLuhqaKkkaOpcWeHySEz{yo+S zR$vDSB8IG&?_|78D8tPu)_-9g9ELR;g63TQQ^DRUY^BYF2EsYhe>q(%Aif{FdQBmo z5^@?jMDeM9mq)xl!O_pvb^Qe$ukjJ>oD_vv0&t5HV4qwUW8W9XTVE%|6=^E(;zIeU zsbPr!y;j^tcX)MxrZFS`$BpW4}NWrpBFpk$5 zERX#C4kQ2G-gs8tq>qyv(;c=)o&p%oPuEzW9AcK@wXVcFP%wrDqDw6-w+LNU5uVhz zPQ#xdlf`KxY?@&tFOCnuX|7f1!JUZ4B=4t*2TiP_N@gP1Y_Y-ABC(T!kbQS!Z~)Sn zdXnTENd;SYt2c4X@lY`c(MB)ZZMDo1!K823;k;5ekbd{=B+`fJAd3VVigHaRGJMrz_u?vV~)O)Q+g@p<8D_^Cdfd{ z3ZqqtmAq;hTE(w!-e@ElC#rFfQ!g;#$)PU;Le`Imw}|}ZFd|Ep;7CLlYDH6KE;RY! zoJQZeg{Z`>1Oe$>RB)}&b*Ki<-pl@FS1T?QViQ=WU&+*qV~N2Q1;e3LGR^zCqfGD+ zoY#m05;!N%b*e1-7?mAhpz$7dzBl`{E_+OO-`WxK>4B`3cmpH_OjaaFad)CDmaq(( zbwYo@*ZaWvwZ{xS;YAw`Qc8^>Gm}azDWOcD6aHs;czSrzQu!tja3sL^4{iwR__-Mm z9J^75BRTXtS>=y4z`T-F0Uq+%w_ZW~FxZk8dy%T`w%Gc0wgSm(w zjKf7v$kDY*xri%k!|CW?_f)Rg)rW(M#aUbT%@V|FRL%{J#{b6m+`{#(XP=8$H~xNS zurTJh$hIue`Py&70njtH2N3+$p|9nD)F*+!nFlYbB~-?lJq^;CDfL!?R3;{>+J>}{ zN-Lr|Cv3!|vR>~FlCvlZfS&3a#-Iv@X6=mlxv`_}+75E~jisnDCGzYY z!pyyni6^DInkt?9zRU5633j!~ss0#Q=GiDJbIlB#QM(`1wcCYE4RkPTlEkd_aFT!1 zYQvJ~^+_4AzLdEcU&IIai!tsZNb`(gC^dseDmYW<33`bx__~0QICBJgr9_*-Og-@cJ)_037;OQ)4;@9`mDNYZYF8#r~3N{?p+hBv4ZuH_;#6D_&&( zkYIsdwZk5NTPKBG9G!>RYYdWjWTI<58$}*YGSJS%HwrWK`Ib1$sucT>`n4wCa9egX zS1te0XQhY0Ww(yXVrEH^vW!yc*C}>fnB#j5zHme}cSG3KeYwFDW^AqLj7w}yZ`*F~7t1at*)fn&#ZNoT#V|Un9wRr6ykVAmX1*=-V2F~N2vBR}1Ha6fw^gG%>a3K#H zn+%IkkV7#wP6`N9RtEEeOuGVx?Izea8wCID5rujAyZ*f+;Sov}X29PBjjaN23|@3E zD)h7Mujir|XRPMJ1IYZ`D!ched$s7sxahyOZ3>!^dzPGPO^ttnWOS*36VfhgLC#@_ z3gwoLD(YX=tXKmfLmUR2BEPwi%kCxk@6Ci8rEn?G(=m~~*=;lrSx!Dmp+d^p>c;Wv2s8o)Ki9HYVB1MB6;r=HDgufW~>VaAsm{_+Y2=2<( zgQV9_B-WvtYjxu>SC;PU%X8v>Ak_hu|FUYKHP7%(#i5MYodXAnWSAd!kEaRxrE8&)qT=4_Je z>K)!v(w8NOTGEzl(sEMLnW~lAVj{f?_qMiJCU#;jR1l&wFVXjCY@0+yBs;p%WO@Q@ zAR7(|c{1aT_*O7x`v<1EoKije#c(A`fPdT zOe=Oya~nq3(m7QdQ>9a_%vTS8D^hWu+ zGWZiESRy#Hx5d@d)U<}bvkcK^54UAEr1DLjWdBLRB%Z;i8qInXPiZR8sp`v_4$j$@ zWgvs_=91~;Qtxmx5ab4%0hNn$S?NiBTz^BbRJe0%e=B@|Aevpb-&;cN>CybFjj3qG|MklGethY-ub7my$q z`l=Rw&Mc%m;mWVkuO;_=bv)Tw{R_H zNhubMDweM(78@)6dRnZ^U!tm8BA>~GW0H3xn@=ZKTns9PkK)%~jSHkIwTv>fTIDrE zE~N@Bb<`~!tuLbb7_s|T+BaHiPE?9dRq$3`x{+w-V9VzYU+!B`=GR`f(^p0iQX&ZX zmrG_FO>kdApP8+ImrZn9ND>8RXa}eK%W{|czH%(IKp}21hj*Mdq|4B&zH=1#_5smV%s%S+Nmeux2$==?biZ zslDKPjp6HzylqkRoI-GP%TSU43eq3VXu#(q-r{&b5*(j*Dl9O-?(NAOcUi&f03r1|74LW$QQ*PDG?ag)GzvL=-#r~OV*<$Ln{I+ur;L+*kWo6f3rHAmwn6LVB(Y5qt z0KRcIHVd$J)4(BJ8*NjxV5R|DEsOW$%MiwN{*CJ}Cl^ar*yg~n1#&56msCJ!y=iI~TV#y?QjUiVKw=#b1yo=8fK5($AB_j_v<3jm z#-SDbZ5_r(nLj3JLPjh@|7jSe2V2{P`TF)bikDgb3bkG?b=Z(MMyzW*z;T=(4rYJB z$fU*sPNQ>R4V_dJYZI4rdKCH!c01|yj}$2!5)F^c!C%s1(L$D+?R}cRieddz`K5Jg z+#B{g*R2O}!cHkdl@sVXkAs69V`&*<$pNyAYPDpd_7b&H2V%J^B91Lq#APs!%XzvT zdm06mdd(vn+x_bwx$9$DK)*-vLdsVYj1m0MBl*1W5}qkk0bsuqb;$5{d;s1vs9g)q zU19u~oT@UV3$*1RtdigA%jRz5Ne;~SKLCruj0?e7jBcCzcyMP!(fI22y+g1jUW~XR zdhwk$G>(t@U5zi@2$WO2_SUbU?yvBJ5%TsrQGI90TCGhAqf*r<4jHgNXB_#aCs&n} z7b_2vI~3PCSI2M&ZrYyaLhRtjIIz@jKy3V0f1=CyB_TVCx_ZQq*TF!yah=B&)^Ov; z-$qYX*3AFDZglnTrSYpe@~a(=B~v3AS3`);l1{Ezigg-%)qFL@|-xV{tz@^-O2EV=l02MDz+ z735bTjs@n#*<}E;sSPtVY7{NXvjl43b!%Y2<<;_&p}Lb^|5mb?J7j+_ZLAAYyDk2# zV)$~R;DOfTSv6BjvIgIJ)tfOsgKonJ1NH(`RH#QBdGS=5!!@ExvOH&k= zVJ|ixUp8+^wjQ&Z?mIW{es0|;1{tWV9(P96|6GC+-i8%kgL@Zl?3_stZiHNP+l|%J zj{O=#Ye?1IVV2t&$*zo(;dG^H+-SN$UGz zid=sB<_R6k)>b0kV(}qHY~cvrVSMK4myXlkjZ;hX!#;)`6@5y(sg#)Y3a7K?7M9W9 z)n}cXBg(c-&P~hVil>7c{ll^A`WFjhq?Mzl$0d{uj($KY^i!&o8mf`v!i$xH$qQ5d zhMMt}(f7qnC}4cTsz}Cp+572)@MZnwWzOk2r@&(EN4F_5`dH}#J?u=xc5~mbxQ}$V zU-%l@=o-rZS}E#UwBmYS`0NM`tC>tO52P48l`wh>p6y8aqZpFeWB})aq2GYVmHuxD>il#Y8u{9 zaGCt))yRIxjjMwSvf@71-QCCUorvlWDUkeDcVOzzx_(KS2bMv-N}v0)jgCjSg~@|r zePq>E8)M8EBk0X-L^5Q>HJKgArF#c*u$@qxD{6U~Q(RiRo%q+BLpkchq~(ix9@Tx; zB|J$r^;8~gk!*OL`Ks6$t9=Ke97W}IM(aXJC4Nd#Wknd&Q9RqE`tGl#llL;|?cqF8 ze7x6G@X7xaT-0oYaXZnK1akt0cjP@d=m{K~9AU7!6jYlW3cf-3oy55tP^xGi=AZ36 zRcViL;L+rd&^!*K&YP%!1@V0Bu)UDVT>JhuERwVh&+-nP`|hWBuP`y7`nKw$7=kfT zeVGNjPxN{)W!KED#ISA)Ag31n1;`qCMVV#^=mbE$zr9co;`J#OW6IfU-{djVWB60o z;cjd71N4|yU#w1x)$U^#q|h5i@aEz4ge z6BQ%&;dI=!FTdLnNq!uOrx>i?EzQ@n0aj)-TQbHV5|2&%JKLHMBbOLEV1Tj+sL?NB zooK!OX4r#-lDI>!W~@l>FfZ&8!Sib^EAhtGH)_S6F+NG??)8H!v7RZR&qM#2*{HcF zsF7vK{7jxfWeG7@LOsE|RS2tU#*wntAQubOLr+w1buU@($43ei98qEEPvB@V-d~TO zPc?d!aqy1z;F-*A@lE}P*7%@QsN-750}-bG(QtHhW(e7&@%>jV|4rAPeJ!5&D|53r zdlXfYl(+&*ERCvTZ5tDjOl2ja=?G~j-fCfre{sGYS>i~%c#z_BqWEuUxb=#`Tthc3 zDf|{03aF18dwMAn&;2^-&;GFNBLrgd;ARpVaVOAbvN>V_4MoM-h%m%!R+QNck!LOfiC}uw8LRwQQgX#THGD`sUv5343ELZ0iM{%;S9{uqmQ!y;ury!NPRg`fALrTxB7 z1cv(wCiu5`Ej3nHt$9b+9Qpa2)oCIAXk8k5ceq%Qnp5DAjWcu`m1#mae_W&0dVl^J z_YAK3^2gr-@`8{*ZdqUQ5{hoR3XOWmM9a%JGa86&PuBC^!aU3c=RVD_z14NkY!5dL z31;+JffbQqd9;|eJk!Ooset7HX`ER_6-^);MYIxxNrh=h};pHQK`dc*q9>yUJf#Y&yZQnKay#O@D;<_ zNOGi7MWiB8;xP=4Rx*T5WbZMR4Pc5>%0OWyGp@#N;q7K=8lNb1B}9K42`CBtF(~4b zF{W5yit#LYpJ=XPsr;rYKub*~r{!81 zRb(0Cmj7sU^^M?Dnw%Q>d_ttJam8$24=IHlTTAf6Xgc1S3zX?ZO03Svbuk@^NoH%0 zyoR!dFGB;WpKS><#2KS}lT@5RBzaG|Ot}H`)J*gxtby8HHv}A@)0c3FShILxqT>#^ zK}rmBB3b;IOg<+Dv|YgRE@nJCo)tTVszo0dH(&SS;|k6ch<=N$4%F0P3Yt`#)2Snv z`DoG%Fx!SU<4)FxBoCEfwgt%N-VC_XK%q_HG3;wh)Rx#8P%_K( zuQ38XGkXx!6lPzAQ^S!(#i|O%cVtlGLe)@0=b@!i-GP%n(ElsrSv-p-s@-ggdu@y$ z3E)Sv*aoJ8&FAx-xYD_PwPE=+Nu)sm`Xs8jmf3-Ax&hQ?iD?j>+%TB}x;>%1#I8l; zNw)I*J9`y@u0*P!OAhwr6&7*C)u@^GJ~9fZtJpPa$~aP622B34kyPrX1osK9s@jOm znTYP6O^FlVpyJ#yRyUvMZJiZOzkoK@x_>rbvK!wi%8yVa!v6YICWm5cAJD!HGIUYP zOT{UrTToI-%bYJ0-uqqM&QE3wo`s%s?sN=grhHjgY#M69cg+R|;SIpo-8X;{@s zbe-!HZ_Z31IWpzRS{5>`&|m=_}R`rkS)5NU`aanV|uWuBCdGhXu3rTG5*YsKuS6x{357#TO%yk)QZ zM90znebNHGImasEQ1}nuv@fHZ@am6asUyk>->kcb1pPf43En}cGX098>eH8Ael(L- z_bSiMa2_{|=CXUY`m~L6t0fzvg{k$XKT4j;_AeLPQy%Rd1`*cXB%2Rio?U-8uKd4I z4nP^z7tGmb2LHwV@xaepMwv?!j0^{jLyJ;UnmrvMth~WBbwGh~Rv$ zynTigO0219=bmMPuC|rLJ(cOqwWm+0ZKu zT}Z~>)(D`lzeYPD0wTjUzY<|n;3ThE!+rS`$)Q$F`BG}98p~UcmP7$JmChWT#cg9o z2&Ygul31fNPAX&rbNy8Ady0N4n;5=KYzpRs{3+){!J(?n-rSZlD{$I!pk&$N3X-Q>up$~3pkeGF4)kEh)DBI%3@RFT>s z{e%Lfsyz~)PcKNxk(m&{&x91OPy1^+zOx4BMv0K_T^MG&wF&G3J%_%8117Pix(<`i=kABBOD#rCxBF$$~ws zgH!V>d?~Pk;uXW5`V~1rZRt{wnro@0+L0A&YA4k3WI;wfvgmMS@QjNR`CWD{5Hr`C zHKJD9YA5>f7|HEdviw?$(kjjw<=2~Jd=J&848)1Ab)o&@C~xhtoHk$6L~EWykXp(I zsnoG*ZAWLu8iWQos_DkZ*rWS{FvZ5jOzoTfkz2E5ps{u8L(OnWh=pH$zPzci>yl@W zd4F*!_-(q2!YXv#LHkEt718=`GL?-j8e98iO zQs&11D;k$N%pAu;!H0zp((tQMD|%F)?F*YmD_^K;H$|eMo{*pr#$O+iBfS~2f`%w; zb&KRyQMh@bGc^&#o;y9!{X1S3bqW}!?mCzrNiG?_&dBq1RsKPBr88Ch*LmfKc@+|( z#1%1lAt|LQMw#MnO$`l=wRt}_HFxnGxxo$_ajHRAp}Y~^#}}b@7)?|~I$)5Xx`s-G zYm-D_Bgg$1s>&j>Gnbf)W>0`7bcLpEj;75+rsamF!%t1QGfgLVE{QQs=T1!QEd;F=X{;7otd_X1mMXUA z8R&rDQVNT7T~`#s-Kn+4bnW|F>7Q5Qkk@8?mg_EbYX`L(G}am|*6QENxjI)xciPfQ z)>5n1I-1sg53Y4CtaTl%bw8~2z^&gzuFddCa1uujfYt|v^amaE2R0Ojf9j98uUlBG zk1Fa5mYCCK;Zmdd*7$AoYB~)X z-Pbk-4K^1xAe(TTTeyaGCCj9Px-sND-Z`m-J_gqA8%LoV#~*0-#ZN=Nl>3Szz#;2fdm}*1i@67b95ogB2K($1MAE>WzQGCBYuMW1J5`ZrPA_3Mg zd+Cj6G=}vTxPHFe(Z8`*vF;SU5iOdw$9uZhTFBV0UwLA30o^VNq6+;z;@bh!ba?hC) zO%fRv#42bh&}5NYssUUcTe}_YA=tnjyDlJQG&5-?xT!C^xF@{1CknqW_P$3%6A2{2 zDl`9eX(~%;j+B`YNm^+d8NW}O3LUzP9z;MN7O-F`7z3(v_ zdCjf5X;<+^IVQ-K=5w`fuB)Mv@WG7BN`~)>U-e4hlwJ_}aS+~dsHSzOVPw)SYK($4 zB+S|rCLst*aEejDG`2i4!s`!wT~EYyJtb*>O)p||5Y0e9^rOO|O`RD}*q)xBjiAz^ zMb$}KvyD*KiFt`l&f`h$rOg%5*tf%ze%~@KN5-vx0~CiWIF!45hnS6Y<1O1`G9KGF z!PHxr)Y_}DyW2)p?_1E-Yj8->+DZovnifk3h>`DW+AKJTuLD)Z7TW9}gf5ikTZ_*y z7@vLEPS_iMG1aQrA{pw~pu%TcIPST@Yq}|d(MBWa7jDL0}SvKDfZkhkOFeBU@mfo__-aTX8K^SWyIsUkC zUEQ({-*VGlu&3SemEG~T+zCL4Z^ zUMP>z*U-7u$=+W#@g>Gbv6v_g^l*?Y^#sQET)+wzBF58jDE7anxcfzux$|-mVziWE z;j+;OmiLK=Pqf$8blstK_IyH zIZCnHtgrY><(1e{{}HVKOS)M(v`r%~d|Akh$I2KV>1BZ&jPiEH$dHq$6LV?Itl3RC z9mXB)b1Q}fS%h4##7G4QO6g^F2*Gm-CPqwzIq9Y)>mM>Lp4n7RqyQx>$UXZDazf(P zv1-};XNljj6&9gA5x)j(6<({GN5(L8zGRL(^^$dj(lT4~C8QwI=%#tGuR~)q&3J#V z`XM!w0G#PMLkmJUM(aha_M~YxJ;liZQjmh{i`ZRiNHfY2)fGH(`k#ZKj|-2E8}py3 z79M_-VGVdO`qljHA$?XXl^HHa0?O*As6KH!c%kT@RiV$&V8;OskQ_H(wN8Oasi$bq z0=1ixNiB~Tec--j4|Y+M=D#c~S$|RaABV4r{R;qDC6 zKyiP#e`XULVfC`%d*8l$+CFop`sN2v*qn9P`r6{w(D6Pflr~K1DPm(ZcyM<^3%TWi z+(|?3wIB~xkVj9*-*Cv&XV=&i$Sm{nzqHk3o+L8qyLW^L05k%S$@-d1Jm?X~Zhw4D zJ`fI}P?hAZqZo=I`cELqa5x@CENI>O)-=F~Myq~;w|-kZkWFtaMD~tGDh}Of@tn~3 zP$5;!8A!d#fRquW7f_x&efnW+e`Hxrny#i>4Eap>KF8;jq!HAdXpbani9N+^4Wl5K z^}sw-E;}G6TU(nl79oM=$iS$~yxs$S!~N>6afk;ghV4ytu!=r3D1#mr# zL#Ap1jhRi6UNk|Sq|ck_RmmN>uSea9>Z#^7CnWx5S4q($^j2J1dK5+Sg<0l*ty|C- zzTo{r`+8?~5|pbZCp(74^9aZdhp2a0m?V}-k8-BgTF5i%9sO~AR|re)E$_Cp8a{2k zo=dlC>A}F{vIY1uQw>^uO%Nl~&CNkr*FMtFoU_lpQQxwtvM1NG&XRmcH!qgKOtSy_ z)&Nq4X!GI*+7p_8HKkUKm~+H?z%wSEd&4%-afBm-qsNzhQqzV4EGos{$da!_r)@lt z7-z++E(F9W@+^Cb$T}~_e!WRkW=y_ zAo;@6cw~ZU7Vs`6{w}AiK7;hL{Lu&YVi!q5$a6UdBb2{&+b809J5Z(X(J1zE+gMpx zNLi&II$8g%uzp6%Zw2SB{tl=80#G#$0W;+RyH2hp1D`jpWs_(j?iGtHU+z_#U!B}* z4jpgY9xY%_p7mmMgTE3dCsjmSXm|RL8{fEodP;N@n7hg1(F=H)FgE>262fc&^6sz- zk=_~-cU!g?692R$jE2p{pFg;H{`uI#$nqoK^AjZ%kMju{?29|Rfl`ZX+;Fl^sebMy z(AYop-?TVY^PA5PQ8gN6fe6+4(-29u%U8Lk$QYtKxON*8ceOy!w#=pC!RMMD_Z)t) zom6mnB=xF97?rP*hlA0xEEy>O<0==DVtL;1MEJBSPPS(qA)L8`aTy^Ya?g6cqcN= zTHXvR1TmgX-U!^eq|=du0JxRgemKf7)u4?oPxJ*#Iq_VSPT!t>QD{Nxf4k zMjxSM|Lf}O^2r$dLPuVjbj+I?+;~FPS&41HphidDw42%UEPXdS*myE8MJ7XmL1|Ey z0C6^V6Q9MW&rPOgu$bl-0WOPs9VAsnp1230{xQI`D0szDNNaZ~?;v}U`-Xm{@iO+c z+znPbT2?fCKLeYt<$hcV_p1scQVx~aJ+Xs3juQAJ*Q2-=DWhT_LtkP~)RMDI;c!s= z2)ry+MMwWdHc|L4aObOKWOrzzt=N~U2}q+fru{>SDVq=my}GFk6&s3Pc6NsJEJyOe z!~kDjG|4Y+TI_5?h+-M5tijeMGI34zf`}fHozhHNuHB>t*LPneLtht)Zr}jdcajMs z+Ti)5Py0b|eEO?`^`8#N%6RP^h|I}%m+!e?satL;2Pc+RhNh}rvMEQudOR*v%#1ba zaunH_y)-U_UC1}4FgvnFuWj5mw{*QRI|VbYZ=QOz4hgZibi=Rhv$wQOfj&A7Gw3Ia z!6c2w((ZQ7Ye&!*tqF4jbnN6&_A#Encc%yVo5u}WnLKS7z@apfIa3zL9as7)l=Nm<)Z~}GE#T6%XZ-Yzgx`T8_QKi04Cg+s!}PBW zG7Ff&z&_(w9!G;~qF))GO8uk^FI*MPo`8HNip{@ME0@ThoTe9R4myAjAX(9N5?LmX za;h!*3=Iya`IMc88y6J@6N3GIP0bGb#u}TLt(L0>ZOsV89tO$;(dBSgabYzH@k`=F zU(YHkkv!Nz;UUJo>|pp;7Llek!$pvwnlv~~FsmS0`!%JETMB8&_%J0yok&zJc7dCe z`%|rsi&Tn}F$}gpA*Ig%PihJVCJMEOMOdnUAHs>>&n4-yeALA3UWqcl>s`gX+e-L7 z?}ZMLAk+C?e^dBQ!Hv>)@kz?O)d3!ydBCh$7DkQ=$1sN;E6d?v|5@bQ#HEoEL;2_? zX$?iX6{aeI&XEd|)<%ydV-bSyOp(q^y4PQiSjQA7uJkFm54Y z=tzS}tqrvtIfA%_4QMDQ;+siq5c}UoaWi3<_9q*WOxcc4=Hw)~NBAfkGoCEJDIqQw zvrq)raeoA3H6qfs3NX2(D`5H<2onT0P!d!zy~(~jS_wY|nIR-C=KvX!$67YU$KB>r zVBFQIU1>2ZW8E%BV+ifJo$Y z4x#!SpgAdZN4h&Nd1GmFA&Xro|3T-=WR_+7+p2S3`eb7$OC5EEgKQ{ z@%M(W%KWKM%f^&5Bjw6<4c_*_nIBotSK)g*{I?Sx^Z5_GT$n5h%eia!%O*s4J^P*G zT3Vz(dqennuIA$)Mwxd--cPrU;jh~0_ZFY%AS45|`4$H~a3kb;rnB`FnX6~Ohs_eN^tiey5iNQB4gj>YP*a@r_ri{7s<;)c=Uy^k0 z+F?6?MO3NxzMF+SLfAcAi@;#oo@1_Bc` ziH`QLF6N~V8VPeeHlD}97(k7>?v+;WQQzm4y?+|kiBR)fvk3RC7b=s6O0 zmp$kggE4mxs!rHA%#hbm7(+6cZPL#juMP5=3>KLV{_#Civ^I#QM_HgrzBWhx!#I!D zrbK&*K*E-!qdxpCKgmhm^teqS=YG1jG1BtdASx21U>{l8H2Pfuz7a9fDBwd9n^Ou0 z5Ngfn8pQ8ffQ4a`&m75ecbiMsiP*B9(60m*I*oI@&!CDc<~)O@6?Mu&AeuiEqD;$Y zJu7EwRaO{$W5N^CczL(J#`Hmih~uARGegv6d9z{mXKrqKQ$f zLTgx-gt3`Pr`EE{n>pGenYZ#=*$~`|NA*UHM}Ms8(KuMN%#VlVr%bvDD4GBpVlmcg zvo{QlA1a06;)6`LMVpy)lpGt(MB>$xqs)El!gw`J)90gth~2jMu;SkE<08ZA zjS*aBj?(Z>shvH5jx-dq!GKTU=&xXUX z_~f8WK4qc5Ck*FmcU;9L(f#O*V2M8Jvr4fh_Vfx@*hno0?`a($`ufniJBAeK&Q>L< zSa!}Lu_L_X>Nc2?j!W??WSp9qCUVZJ-%#~*R02K*C}8hDc#T-q-=Rg3>GvD!(FM+G z+0pyY1%KBLU~!zY4giflKs+3gbLTc~>7JCg!5-22%e`G#8xXs9NbT-aPN;tU9tABN9np2_8d00@jqd>3D z`<|H*0vi~aCu&*tcCe}dc8FiG_zcUl1~>VWd&4o$fXDZ~)SCWr3jqopydAM?XVbQ< z+L61POm3L4{IGlI)l(6s_YLB(>(T_<;QMeUhHO4*xy*||9<#B0NDSE)T2Y0{%=J6 z|EoxS`ApFVqHZwO2%albE|SZUYpPiIrQKk=G4>IuuQBeAB9U*d{Ky;6RT$`bP=T7A z_QrBv>PaRvVQ!G;i34i3eh2)8zZ7_?+3pX)B37F4V%tjVhL+4_YGXebPyL^fdghOZ zFSQxE_*!LEfjXRSvfT{=O|41wQED zXNlIb@haP*OD$)HU@BRggc1mslZO%;E}MihX&h&XQX)(5ic*(G>_*WxTkl3Qw14D{ znf`a)ILO*W5?6}qb3C4`%)Xw8hu6NW*oQ(YAwGkK+D2W;#v(=A5L^<#uya`AXzWLC znQlG{kL^B`qn+boJKJjM>`?J!nQ6a>RF>nm3AW0C&pA5sM0dn54-YEju?`FM_AC#J ztWVPkK$P;{E{4~XBP&VMWdN6^J60HnRXWpEgcn(ApN5y`@}Fi1t{zv!@(e-b%*<=s z<&>-VXIB}jt4QzngGhk$RLKK0I+Znp=ysK%ED4s%snd>NYO(Iuq`Zb%&9>Qe^dMat zIkO z>%kn|RHi?n6|)ng+S^<2qJ)TX5_~=X2`UfK2HIg7qQI5exz+zWEUK?OVNwR77YJ^O zUnqRik<`U6uJmUUfUWC%T!r3Al&A?|7NgUOx%SDL%>nx1$9>8dqUeTb$Nyl?fzS7) z)$CwS2bETtF#2-vHZsSR%p;4_b;mHYM0C$*8wcRyw1}Gg;@mZ*d-$o$NF63bF?;e( z0U83KgxABuaOK8-t4vzvmZMK(zsV%cYEcgT+3_g=M>mc!6jt`w{{N!vouV@fx3_b|GRGJ5_df4#z+Jxprvsp~R_sunFn^S-Hp7I`+_Jny>KX%0CH9?JV);cl zky-qZ10hh1P zXrZ}9iehLNof3CP&f?`w@;9tCd@O7>yj6=#UShdjwUyqpfE1T@KN>3=g__+w^oOZe zCbA0KZ-R_m3SqG_(Hebwv*qd}aNM@J;rQB^;sy;Qm>2#p=)Xp!v;`DsY+OCbRxG0C zRjTSFGw3~N`9eZ@2Pe|v>0c&#MlefGkk5N5G7!90`Q>jijJD6vs z6`!RNgg1{l$>=Rh*yT(Op)~OB_=e35#cL++Q}g5|pg8U~21z=Gf7gMw2)XED^K+MJ z&mtx`6wp_p!YsoAq>Ru2$T-xS^RT^P7pCZD8d~2AyxG8w)dK8`$~FgG;V_Arw%?!* zbs@IR2hS_*fAEhT)udyVf9kX=0b% z8#0VOYg-MAN2M4d;Qf&N5)9G|uC2QCSXuY69j%K~`hc(BL11!5JTui?>%Ciw`=QMBZ3sHV@uc{F7)%DjeO-`h-(pH*V_ zSvf76*sUy6%=MGL{Jr-VZ9)`vN%UuBBxCLdeR*}um~kxTpP(X&9!P2B-G#a(ki?oA z@o|-OI1G{zs$NLa|s;H<@DD!s{b}uXE|EiYOft!|81>8?t{6aCIqMH5}h(|2rtH`JB5i* zBv8k7W3b+iF7xg@&bIYD#ozk>>)KUuo2Ub0`Wu2|wl^B^(go4@7r^$h4;IWdM5=HX zt-HOC;o08UBl$DIx0|TtwS8Pt;XWnj(VLraC{Q~)?_BInX&b8!Zp`1 z>pA<7|Id#u|FdJ>-UTTQ{ST2Oqtqfy<6|N3=eg2po{ZT3WtC;|MGs;SRbAba!AtgK z(ckygA%W-LsRUO#Yn>ETJMQ03$Je@)UK@vB9>Gyy>t1cV4N$YFt+6K8)-UeM(Ig1~ z^sm3gT;2Ovzh6gLzwQzwyN}Qmy`7^5?=$`<)?w&jR}qJqi?_sKZEr1U!mL|uK)Xb?$eCE(Pl|du0MR@fg#WTIXH&>Cp2-& zv0(Y-LU(fw|4lZ}N+u=WZ3k=kU%z7x@ahjsQkf-C54z{lxq%TwUMl^Q8hxCr834@q z+wkL#6Ix1jwDaq-uaFT1MS9KeSd$b?D`-?bP#(pfr4WI6Kftz7uL&xctvm>l7EdS@EIZ%;>FfhW>_sApcxM_6C52o}6vD)XR@aYihXvRYLPpO-7mh^B zOAQsn2n7!g1~Ce7B@Pxr2@&!__dEH15~fh7CcTcH{WnBeD_jG`g_9Fe&MF*2*mnpk zTwy%i#0vRHD9|(tl~F3pvOU7|3{RIUqDUy*6g$G?HA1=~#4ak-yFJpkBHZsaGN?U( znJX~pHKg}0oTNQ0m@A^DKB{=B9`}6wt>=m@Y>#RiL!|OT?>GtQSd9hgj|Iny>*b0Y)QTJS ziW|+08*h)Bu!?Psj1ngnii+}GhW2CJM_S4B-N^Lqi;Vx18NXu{t0)|Fpp|f96%6l{ zpp@)3Uy(pk5pjc^Xyf63{S?5&>G~>_cuSf1v7X4ikO0XXPeq)>5aLTNlJup8{_+|I zvyp`8jRtqFCZ(PzsFjQ&oqVo^3~h#NM_ z!B7kgYb%@)ZNEe?9&fjQ=C=`}J zruqMe&Yfzl-D>-f&XsMe`wt`WV&I)^lQCoeeSB zy_n1i$er#s*EJ0&;XVw4pyu=7a)>g9_|6uawHm{z1bN>U`}H=<)4F&(j%`Dbp#SPz z$%Ojihm^Tu(O(QbJWrRaO{Tkb|IxWSya~W-*?@+(`?I-f#cxL9zvu8^&oo890O|MF z+sn4OzFy$RC&=q=02riHK@c?IHzV=c9U@m~On4mM8C64SKOD(~ODO{1z$(dW4F>!m z3M`q*B$_I}!bF-jd;B1lLB{jImA(wRIG*{NNv)AfZjt3J010!H#E<%Bn*8laRg{9d zF@7XYD}bY%rtlv|B9=;8VVa)Ko5@c~i_8@lGYU(KEUSEOV&VPZ({IpAFSTW^+blJv z-_4s=e!j#_*6FWvf33X&;~go(LNY=bq9Q7q%^$@{3^eD(sqbSInL6TDW#I%ao%`ka z5uFyoED>I&@fG=1HVKuDomC07gTQy2Dn8W6qvUqjiL7637qIA=hCUr7_3|cf`1M1L z+~)P88DVw}(-Jx8;-aP2*JZ!H?$=tT*kAGr+#_tuJ?%C{NjeTEaWM0NR}*zUX+5;J z!tgrp);%x>T?G;ExLoE%|2)=j3t)IM>0NV>mun+3J*o=JGii7a-B9Oj8mecrXy++P zjN?e6&`zylM?uK0lExb9w5oqce~M;{9h+;d*Y-czlnD1@iXSFGF>j!>U|@;;7-vKk z88`enQSi_9{B;66rj@e{tH4o{^6IM~Ov#BJ>xvq^OyIfBO z#|QaSp~Smp&#{0bX%4q4(gK9Sw?gWKr;!rNS;ksm?Spb$1VvPD^)d&0B3hEQ1aFhZ zkx(!ml-^1iUU)+o_TGSjck8g}C#d}^l`EJj7W*7Fn_i}X)~w76WRj;}#W$&4U+m*5 zv0s1O(eL(xQ8hqbDxm)DcMN0gpo9lfp@8=kLh|?;@dE?Vd<^8TJhHf48)<&WnJjsL znG|fk(jX%mIA{`^q6Mia;{}$acd1##2W$g$_X>-RS__E^9v%7_ zmZfjwn+vV<0DDJK{i@j#%j$ z$JyuTKq9gjN~XWkHj zol7+UL4g(z$yMh2ExHL7sKV0NL*@0{PYT)AK2{Inq^ne;50zXzic(Z>`{OX7!z{Wj z7KSN*(nVSLCJU&@Ry7^bm|`k29hpUm+nlZ9jb(N+LWolJodZY(q5nOq_4B^722n*` zdF0IXp_x{C4_4yk@lmdiud)K5mUGG4q<)sHJd(A#LxgixsC9FGa)L?DJ|+&&QI0yo7%Gl7;?Gh z!>Kdc)LeJt$ovA~x;7z~gAO|C)h4m!=cqpo9wyf~&Xsskxvey@tGEVREvokdz$`c5qH6{c}iz zl{;WP?)DpXDKq4`3rQDVAvh;fROa5UR^CxbGpBXEsI8(pU2Cg(5tcn;wD$=@KH#?6 z@Z-I$4{-83NEZaR$^oPtd;U8B?@+1&_Pa6_D_+#yclqbraI43HqPXUNXXiZ&pX6iIhPg7!8p zp}>;zv*w6`HESFz>()B2F^A?wg0sDWG#Cy(=zS5Am`NB{aTx!EIj3XVDg!2K#m|DH z+*@qM$-y<3-!!d{9SI;JN1FFCeOgeGm>PX-@e4}+tZCF8~#J9C7Bkv#U4JH5;QHQ>rv#clZ8QrH; z7Q1M!2rN(cO3VFcz->2 zF#?lTi+u>|QmaKbCb`W}8Rssc!|Sg84xR2w*(Vc+(L{Z;Y+#LU3^;&&BFRSG>FO4s zK)#j4f&zBPa0)VxJQT02VdC;&Cpvxd-|%8hcQ^ zAPoI8BrSpQLaI2VkBqWNOmc$iFcCI;Tse`I3>)G%)Zg{cmSO5 zLpu8=|KUp|?fnjcMuTmp{A(B#T8l0tcE$vtrba{4K$oHch{k~kS7(~@+HVY z@BR2@4}5K;THBHjXpkFvG;21UjE905UZi!PR1D`cgo6@^yB5qP%YbC2S-X|g=E{KC zHI6J<$d^j%Bo9iv9k2X^2_oCus8gq{W3MLp*1JNJ^Z=a}f8Nyn@j%_p4I2m|7(HL8 zeTy{e)r_=m{@q>-DNbWrU;EKbQZS(q{+`w|jeIH(BU%^$2@)pNPxgU$ka75r@Yh25 zNe~L)7Q#Oc#fa{}r`|tFFHQ#|$+Vh?Y()Q+ex~0y6d!>79sJt=1Yd6iVEMKqA+!3u zG8hRHD4Z*$1S=ek4)uj*b@>B84dmdSu244WG6V>0l4Q+i^rQh&pws$Y_M|g^fF%`m zu$ZD!KZEYc-6yKa>rz4>j(DLQ{4S6|llnvERJ;UG%z`YiQ7>4HWB?|@_p3TU5!>fEbXO1geH%F*ZHC?wzMqP&4WMpGU&ar*@^n< znytbctu<^GkwQ(fw>PTumUzZT%${Ykp04DCPTp*-vrh%KJ3De@@)`^MH&&Z(>lKXu zIq2#C#7Z@f`Aw}v`jY+brHF>v>p&#EejhymC8AV@Pd%@-Y)wh5zkJz_?@YT(_zwHh-5TR)Ds%yFe;ys z4+qL|*I_IplTOxvTvT#!sU$K$rAF$Ri8c{O*%Iyug`REy;{#q*^Kl5VmZH? zMVg?DpdjCTP5?AG00jJhLC_7qBi8^4|1ZgrXu$CQYdZ6PJ1j`2v?^5nkHf-GCgPN2 z)V&{rnOv?H+Y_m$eSx($kWw2>|0D1vnx7oeDg(vR|5M1mkSWszG}}-X=B@mvkgdNi zVHM;7Y_w_N{Exs_MPVWT{?}=!I6Yka=|a7g_wD0=Y0kN)*d2;Ov$Sg~#rOjdx^nQZ zX>UB9f+)31HnD{ho_H=YA(Yo~oa}%AA+v^PX}(-D+1Rw@!3L-f)w^Ei$6)kl$OE`i zZI)ynZw|*zzeKylMXUfYn;R_o-JMVAg<#E%Kiy?*FV==)fu~$K_IDmt1Br&a^ISK% zx9*#^7;L-%l{>f{+;&4FAOMJhPUH*TIkKwaQVO2=?WQ0!$`1yc_DkgLk6U6O1R+K` zKh&lRQ6#8$=As}}3Ken`yZ?G&3~?h@S}b9Hdr=(y;%iYnGo%xd7%bw^oD$DFb`T@j zhRU3V#43pr{~k)#Vj?Iv4j@eww1YGqhlX4?N!J7CC|WP#{5aDjL;57kqU`)wEITeG zo+_)K`ZULRmD(~dOROk5&u{14@>fudNO{4f8jf)Wz4?o*RSi?(+!o|o>r;I-@R{}TerPm_q0y^;9z!t`=F8R{)+yySBK+8l7zn- zM%9$N8^N@UyBkGqQb9_-zaXP)CX>{?pP(p@Ym6dpySkrZ8oOFdWSg>k@BxygH3{=# zEwc&>?$SNZi(%P6E=W<3byL-c1!{csourb?`pPb-d}=Ne`{-ICD>Q_mubP18)(kHbih+u5Tjzw^B~8ROz`)=rHC;@uBXO_+>guW(?q||<+VD2hgeprLu{7*Na#7cPF|^< zkhXrvudrYww*q-G=z%J5c;mj@_9aE7H|;X?5K=qnM! zpzq9?t#@IZFjyvs?*DV35?*khjr^5rbPEK3MVXSG45KHGv*`6+;xc^{|RF!9}qY-TX{sOU)sHi-jHnY=*g8;*nsR zWB;P4nn@JxJ_P&IDgv#593ClGLX0Inkk@0M;F>c|dJNsonNSvUtNIH@IZ|3-lG$Bj zxCAD!m6PfIuVa353DkzvsD?ud@inP26hDlttjoo zWF$D;%F#57$uxRoY>cofTC&e79KMXI@ZY}P!A(c*?NX+P5*HxP%$6j%hB z{Lb*o*p(?o?aEjRC-ewqMsU=eN0}>*`DjFD-bT216f2?Ab&yeDhO3_IBl{l=K%T}| z!uOb>8^FkJMR-*7GhBWO5|A^6PN-$6xaK+bP*6ozDY!?>XA-%cerkv;`b?%U%G6eb zA-*dIAYvBC`%zK+SQ|t?LAFXnAXI#skZ%=lF3LQvu%PylN+cX<2m`N$1IOYE&7cW=9-!;(x*S!I3#ffP->jz%=k`K=-`|#Fu)8#h8B7 z>{;IeU!Wy9OXUoxm4e8WsHZnIwJAh5MFyFp0&0yrNGgYW#6h9 z_*sx_ol{x~cSkMRwT3&)YE= zQ-y>0Pwr=-whn+4FLdE2mgbjHR8Te$1{t3}e};Y>7;b^<+stC;{W!xaAqwpgZHg{9 zi-H$;u~g+tWi5d^4uakg;YB=i6NW6f_!4_}^iYV|we!DVhv8A|O8EK9Ew9|_N69AI z`@)^L*51U*0P1`S9^;1c%Wg&sn(< zta9issac@2wq@ySCXgR}k%o`nO9Z>O63~A*>%0iq%l7`R@{9#8z@9Q?-nVk`1z`Su zt3DI}{K0w!9;vdRbz~CSZvf*T{_Q}{f*ZlT!U+AFNW>cb*lw~+eBa*~%v7lce%_Tk z!C2a(3Y+!cJ6V!IoHXF*v;}1cW9bsPNm619OTwZifyXyMNE3lnOM1bbVdOTzo8w1!bhNs?=fWcC-GWIRx%oK%kr zSqcgr)hSHOIba-%BxfFS4l1C8DCE}D$8(LOPnbl7$=yylLVG=eoeRAT%7>f_J!)M~ zrX2UD0x}1^=Mupv;;>cJr(u@;$ zIeQvP46COl25{GRWN5@#gNo2-Jo?-Z|Q`Oc7<4Zyc&4*bOxj_r|1T*07CWz)IDr$Dm>6gKW-B7W{7Zxp-_Eb ziqB+Zj29Q$34640W}GEu5;IAJuw<}Gfh$RruKRIWqHgQ%fR@Mr3gtT|ccOE0_<(}e=X&UABaz@;j%!p5g+_mu&jM;nUH0KpE z6#W;pqk`-3!_xJ^Oi>Y9l0i%xUR;)wjT-F&E=akk zZx1QpqzoT7az%oJ0GC?IlA5T~F%%?gQjAE(-Zd11PY zQ*2DF`zCetWJQWiC0ll_w@$@=XYCMW-7#$4QB2)ccHQ?tNfvCC)suokv#f==3TQB< zTsDcUPW2~GjdmyNK<6(7ST>!Q64lL;51x8Mm3sYqR=|{n7Ei;+WNE`iz4d)5lB}i8 zJyub0LFtit=YUY;igs?ZQUnM!xlaY{Wr5?Q5kqwaHf;HxOs*X;JBi(_jXWOP0H-5@xjTahC&$K3iEyu8nI$qlL z@t3*~+2YHKHetN>&(?Mk-}d15_G_LZlAMBmPgzn3)$CZgXHc^|k@7UqPCscf7h)PJ zSVvB{LawQTyNu5Mcca7X&NR?2{EN=ku8KC@uJ*1jY#EdEe>EK3xDaIKjBAKeCf%pP zKi-PE$Gf^Ga=I56x<~PPrhU6tWP9d)G1o4;r(%1ic+nSuwmtJxJxj8^2U|TSmp#XL zy%)Z{mt8$qvb}ecPPsAo4a>-VB*=oOY;Slj)9!6bX~K%QHO-h|6j&~bKCTR>&hYqU zXYBom_+>y@9hL_(A8S;jbcYa3_IL}ciwLL7vH=3VLDjN>VyZ#B+`-Qk6f8O;FJ2cI zX8Tvtp#_a0I68X-;UUf%33h5-20v8#?IFp~pMukxj>5z0t{vi6Xp(%WY}UE5bQl?z z&F1gJ>UO%96@r#xx>EQfWXe(o&r&A%qh@|$rufn-9Mb)lBizm!O0+7De6`M3zHWSD z9`IvcbYqMoqw2!yn#W^7xl$S!agKzKJxwi5wc6 z&(w*{;)&euiTv$}f{%$J{K*nN{)`&5tS1l5(#gv1$-3>y`flwyze)1tkt^nrW_VQl zWhaeoGmecZWhue>CWTgr>A`7n;oK?spT2x?X1#v8qaVY%HN$g$6IwOXhJ5U;aWjnD zm|IuF+ug#QSlyGvjdJ+92tSFn*=8l~W{&ubI+7*-IvatrvE6Ks5pRvYCMoX34BfS+qh{+87~koXg;ttTGD7C zU}$@}DZQ{8qNy(uwD8f?&TE6I8#7Det<3xeCaZXCtMq!RR5Z7llj|+1%~ydb`ohas zKF*hdG)f`#>JGFVKbHCUF6|$U9zQ6+(CdBH$f8|q@cPXB99Zf^%bTqrfZTG6LTkXd z6jtU@<@H}EUzuCJS}bo_8L81(0$(g{H-uUaKrIRz+T?FLk?d(xx&>3N8xo5^nQ@I5 z2NzS&+#ZU$UROI&PK@V(@Lwz0U+5uA*>7?CvdY>Vz>Qd|f%3&P|E3l>%$vnk~f zoLQxLlsnf$IT%^ji|(t%J zD(v~sEZNa!Tb3z3CTK41#VwwpYgI<%FzJ`NV}@=U03)?E#maJJTHof^DnQ z{h*iNBHiQ3r`jeL`*i0brj8QuD%s&ye;%89^A#ZdIf^zd$ z&JoranftJQpHh_|zcWZ10mIL)g-y7N_f6i}SwZKJeYF{wGbX%;?b4DMzm$$ zV1Jv-U(G}XZW1qJ_mh6RUZvb*_$`=f{*DGhByg=4-TyYm*paB|E^_O4tu-7&#A*+>u>5zc@kvK-ya`kEEO1OsB*D!@;8m)=+!mb zSH&JB?^j*#7DY&dMF9_}%^@6(=KR?*VXCd|4q;6SyaPOp#KYh*(u()X?^T6O;H66> zzT@*$K+=EsB-Y<%%+hdGI~DMs#Yp~TSMUkDs%zBr?Q|x^d6d|Ow{z6K zho_Y^wp69x23Uv3Y1DK+OR8kZP))_7Kb#l9tv%Er*w4sM>P8~wd6wPUWwn+(4z92m zsO*{3YK4xo*h%UmakLvp4je48c1+4j74iL+O%!co%U|N_e5YIIN%&Fcy8lD+B;70> z!2)IDQiV@}xJS;w`ykuV0LR>*a;W39L#*Y&ez{J|tdT_k&#YrNg!j0R)ZkLP{)I#B zoF_{(^9m0E&TqCY6Vds6SP(JGv325v*QFaFgJsu43J2TO9*Y#4*4NS|bdOGVf3s;$ zpJu{w{5&7O1de@HV=|_ZP3<{`rmy~Q7eZq9OGc=9vxq|iGZ9%VvG0HbZR(r=8G?eq*@zZ2lSsu50;sG@ zg8>U3aHzPbRIge45UgOo(I(Ci_fLowv@zjBGeNRJdvxF0Pd@{pS$>bN811RY{jP(Tx;fyNco z3@J$#zRNThsmADeX>oEIy;Mg`(gI6NYajmZUB+XWj4$phB@j7EDKU}MF}5m2Y!56m>fj1)a_nToF?~4;hjxOS)NARd;1H6X5q77Le3)0S+t10 zCbU+WwF<@>n!@1&HS`9B8;`wM0jHPt{2dN-9#fX=R)pG(~_&T(ymL zvdACQ$CC5ZB_ZL~tQidmq5<#q$=S;`0q`0cWTnCf@Qtd?Bt)edA=02SRdl)5iU2}U zaxaG}186;TZ1(Uag$*!KIh{!<8nJ~WaHqlzaM=h3^1?<)c54H6YM_i~c%h1U1(E1? zMroHEMlBC5^)!&~pq7eKsx1yGja=?u1*5hr)}W>=ZK5I50s}L=sJL}x6??>!O-oQh zIfk=H4W<68sl>_;s!3i?MPd~Z z8A8?ch+iv*tz;($ABz0f_Ovh3C|~cq^lO zB*l;sv%OPwSLqERXU5NDac+ZDl+R62E*}do9-L985HoZ+1XsxcPB2=tu8Y>zXem?1 z0K8~E?bhr{g+a=MeRyZNBCMNsi?{W(xK<2tURx1Nt!Ze^ zLzs8CHFiX{RWDC&sdye;%dnZn;kjG&sVtQaFI@i#aYiN97@gkbyFzd4hM>a(t-2xZ zYN(HUZMyt^tFca}@f}(rA;+KV@9|mB~kDLJ75S}#CMq))AOGGGRD|lCB9I}@8FQ>_ zwXL#Vm%8-#_k8aBYjnv$0*@TmxrXADJafstZl#=`X9|k%OQiyjzgR!dMB03oTk_rO zM0+k(f$yt5H|}*MW5>8ZJqi12&v-+0uk9sYHjOn%(HEe_S*m@ze~OZJ7yFw?RX6Wy z>(|&!Wgmu)Io8Sw7@6*GZ<5QpwfJhfju?L|geZPACw{z+K_M(~K6{Re1C9Jb39oy= zKaM#K2F3;X9tRgOjt`fOGRtuv@G|_WteuK{6&|t#)??Nc>!bo%jC~N}=Y6H|;UB0p3x%L27nlMtaFlMeWUd@2` z)BuK>V0UHa`b&$SU zgkgD*0epzjtex_x_v(Rnic~aS7Zafb8>oMe9UjWT*e#CZZC}d!WzeZGBZ%Dg&L}yr>XL^MDNLDp_ zPs~J5TwQF`R82ydO@P1`+cKALLKg80at`tlD%oj-~q0~G&7vE!-7{T z^hh*Z>_16=7`#*(TKC|Pkf81u(D$fV=1Pp*j?1@ZEb&oFe7HL)l;hbo!N9cdpX$UA zDZ54qS4xfGpy^P$Yvh;&1cKq=0faqir_(a*Z zR2I7Qzyn98ZyPqXke4Z^K~7d=CQeoJB)?5|Nlj+uG+G4PRHWN@v)y2Xq%dfj<+GAV4?rRehICGur# zBa+K_AVb}NX5K%I#XDwgz)mle-s;JIs*b?4UTs=#2tV0YG1*hKsiwHu(`mR>GWIw= z{*k{(4Gnc5ZyC4S^^SLOH`@yR>#(4A3YxrgPik||a&s?YiZ{~(v^j;yu>)_-ZU2S` zK9_~R=-~2=hc(p3Kw3Ip{|WySod;K+hhSH-VC_AJ6TJ5w+bmJqs+k91%m>=eB9P0h zJlEa0ywzg90?i49|# zFAT%0;KVCqu&ZFvFM?kxBOJ@}_{>m#DxsvSP!T9+r;U@dkBR3h!5uHctt_?=tE6u% zFq1E_$j>v;w{Ea40ol!$m`4=Y!k4(xml(VHdCWz5<;NC=mSA(21fG@z5qkN=XN3PO z!J{ujLoAD_FN>QmOSmsf=BZLF3rUqO8_M?kZx2}3EXTR^MuRQMuOw*Y$dbBFqq#R> zZb?kBO(JV&sGBc0hD{e(i>jKdhpMXU!%ZsM_wU;!pA>Kwy-iXLEjLeL$oaQ@rHQvO zDQNny=!H+u#z_i-a9Kd4fCB)wBdfM6t9Hk$_D`!05NnPYYfj{A&g^S0;+l>SL96pD z;^8tcsjG8j-I>0H8h{|*ku|@SHUHzafTwRB<9ZOrdN8>bz>7i&0clRIJx6xMvUH78 z9NDjB)mI(>B$5h>ZPEJ1INJ5B+g`87KWQakY$TCuJAAG?&a5Z@Sx-aI&d}FR3g1Xf z--u4v0yxoy(YJ|)PIrL8TVGCIl)xGI$I7p3S`!llaO>QwY!)BKl&WtQALf_4>r{yA zl=ct@_ir{<|E?I(c^r(Xg4jyQ)T!%%d6d~KIfnO#2+1j0rjB3vrN^Bvy3)7~n_ar@ zVV>nVf!`zEF%h@Yc{Sb!5$oTh9oC`}u`)F-CQ1SV>R%f(!u4}Jo@O!%bE0K?qGx+L zp5})(VPGESR65r56HLsaUL{TG#4GheyxwiSZs^FCApf>XyvAqYIKl!#c8do2f=0}r zKRY9TfZ2c6R*&`l?|DVdK+xA0#k1^L^^)Nl)tX!5E(uq>`oCFzStX1m1_T52fcy-Ko4wqG~?>-t^FKa zLp(rxHB$ujP`pJ>e??D!>^2O%&KF=d0=tO?)iBb;Q%tZj%9%-94X^kl7x>ECX(S5w zhln?{(mNJ6K3R!>dfG+zF!ra9$DGylyWjJkH1azx+bvxuGm2lj-#-93_v5ixA z;7f0C*WJh)ZU&bUwjhKf5^n~~)cS{Q>@OcAdQyB{s$H9896!nMt06L){J3nvWIo9_ zn_gLw0*4baNWQ*^JOQ208fsO3)qS_it?HTdb$h2bp1ikl!UHdddK8V2h z@R82)hTycv+ME#bfN<3k#w*(MgOjzOAmjl zhYa~NA4aaj73j$erZ?a*FvzC32(CqrL0n(#-w4h{bP4U=6GJMQ)hw1eFKWGb@;{Gd z&~n^aeqfT$>0ooy%aKFT`nPUn+iQbWW?^#@C9JTMkYQjgpAq6GJ%+ZT_Nl1CRU30` z8*6Ts=5*PNX@`0eHQKU1baOc@aYeLXZKQ8zADA1W0j7SM4 zBMLoZd>0M`kWOVe`~E$1r;~G>Pp0*22irj^>)Umffcnfn4G>Z`PeieK7QA8bE3=E8 zffv+%*^^y5g1)=sm_6zfrEgZFILL}dAnoHg<`6Od2_!{(HU(TLrp74g{Tb8u59ob} zgYuh0<7)J!ed<2~Cjb=;f=V=aG9;=##%U=z>&G@JDRZ#;x_f6 z*lt2umuP)>mhy)W_ni=R*TfrS-$_m8PSmJ6*BOe^4W1vTAhmu7E_obk7rbg$e|MuX zEQOHVsw3P`o1=WnT%s3T%?NNeybfdfAEgy-t-nyRW*_8lcl|Ic6(*#k9;xooL>HGu6&tImm9f-eG% zPg~la9=DqP&zglq4Q;T`zNa~oeVT1FFaegQIe#@bgJKqtErF3q9`cm03cua`$TQ_N zUXNDHP6(n*jbUd=VrK?5jemRPGQWOYM-}dP1wFm&t?Y^h|4c@?kQ4MantYkzdd_fs z$=O+pDmOKTdQR!H)VGgK^Q4VGeG9@c59l$k_ljxBd|f9K&8Wjs9DDusdROZCKELi9 zO2Bck;_b)(q-nrfEZOLqhOcgkoby!PfK3szE=61wBpF%<8=j{(~#TG8Q842v1W&_3FLS&f+hm%!S@3T!i=0KtfR zY~`(+@S#B2EU);X4DfR0x0*j&({pH~5yuH3wRI#1(=PB-8-d!XXvL|h=bPiRdT0N9 z>7E{$1Z6$lE1pptST8U#Q?(V(w084re_ zQmWKg-TjB;$mx=MHcv8?1pb4At^M!bSOV5Hh!spw++-$;tcBb}{eg5EDM8Fp^j}SY zuC$&5OC{RDSP8XsM)x^dsd6@Jxk@cAYvph;NimK7_;MBfPr&!YuH}=RurDcP_EW{Y z*=ieimVkd$no$=x;L)MbH^oeO;ORy9s=S;m4cs<-Y z*uGjj&|WCnN8W=;Yd!jl+A`dyqwWF_Cya`Ip%ODV-YAF_C!hJ`5Yk`?wfo2S$Z03$ zCu=!>N4;X*9LOy=ZHC=wD|$;)%eel5XYlUQp#Akyjntz|rJ{pXYx+)xu0!LGkCp(% zi^ZIWTgHuQ{mX{(bX&`YBUHJs$}k*-?iq{%1*bpcs7kFZ%@c+=9^${0QLN8&6ep>< z4%BpdJT~3>3aN_Zj7KChJS--(FymP_wMY{+Z z3^P~@n!yWgBo?X~SS!Y4HrnY9XzrEC4nRW+iV`gtGGmHt%c?Aj9NW$fid@G@9LhY` zO>N42lPB^VapUKWa#54}jU2H62XCsPXdUznt$3bys*+?G9_rF`9iPhl8RrVB@;skx zg0jLG9-7Kh5uN4o%BoHq*SOZSAaLnnp6Z&GMW5>0j)TtXx}N*@>fZyPaCT)nG2D_@_xC;E=#G9M#Z`^>JYaDY@JL-$?6 znThQB#FTaFeX=KG-{))zj^&iaKkKfwcVDJKyais3L9&QTvmq4O+zhP?msq-@76fIh0YQz`8K>?3Y?@Jao4L9~YHx9J z&LbObG3Kk$IjiFR z<^INV#0=vsJmx!PA;z(uI_(OF&Evwr2K>g1EXXNdp#J4l%^%lt{>(`A&E;%;OZx+= zy+a(hLQVX}+5_`^X@QjQ8}H#`mBT~WZVs{vZ+?0yES-)Xuaj%Ds^IV7Wd_F&S>WAE zyy6aOvoi8_QO%)YsH%7#uq$V=a#K@fBiZ}U28B?NCjfB(A!uStGLx@494<2VZM0Nj z+m55S#U-RNLc858>Quw30I0g^zwz;M%8^801{Gw9F;3Z;jQjS=`V-l{l2jW_P@?!ny&PDltYAq0Y3@1Apg-&%8> zYp;FI*}vak^;XrWF-FyMKT~6~3c529@mA#@hx4hhOt9bJ3RFv?)4#KDzIZdw{99!+ zVeCZZifUP)$_Qga?}F(MZEudfCz|uR72RSl5yj!hr0eP6M?oYLn3F*^eLuo{g@m{4 z*q8=C8u)rFfp1Hz?ROc!I@M@rr06&~2KABLNA-SA|AAqFmHOfE=WKhnA+9at)8@cJ zlhnXZf*7~NJSrcu#>%zYSlY?9zn)%dzZ>@j*Pg;F^Qw^MsBC^M%CcnqnN#~hnlusvq~>Lv7s zAgM))%u#S-FfxkJ$nq?Yxb~bx5?s%IbX|xRcdih#^&$iwto3U!IWH|ZCjAx``8@YJ zJ7&I?MGL|tXe1=~)Vd(UKPpCONWHZwbvSS{5q?hBz;$T#+ofA_=FKh{-F*$85G>K* z`P3V=`~9bvR`V>z)!8~43`Bo6=W0VgCJ|43m%v<{-e5xR`aOK4wRv4uVUp!4fOljm zCD1m&cPdaon`udr?*(zCa1BzJTUXCbsj$U6f2(q4Wpcg@L9{8>1RBwqYGC(&I&jg6 zYRr*iZl~YncPj6y<%AKiNqs!wv-Yx2B*n!j{DcdIX7I|@A2-uuboA^yx@ChBF<7BRQi zRJp+)=Szcm*FyX6>Co#z($8m|)jofOKin_8Y(5Gh=SJsT2R>`*##&erK#rAliXSy@ zxzb`)OI;)`lr+5)!Kg53rGN5`M@q znvm5R6#RVRRvC%#|A%%<2fz(L0w?}UGx4`5nqBWd$Xm24!a_5K1A(NB)?bHf^M_*T zBqOL~>k38^*wp^5nJ^j6kgfk)yM@wB)E7@>{~turPgu<#;+RcuVc(5S&pyOQ98|nLzN_psuCscc*eBBWV=d z8uq_9A*t2v;I86}7)DPMx!`Vq)fTNo`_5a}}ruaH>cGQeGch~ugBFbl~_%} zLY=MWhwrj&p4RvXUmUL!iXxvX)3BcQZsHfQw)h%)2ON)$aZ?L=OF*$t>P5-AM3G3W zYf?jBjMs(VKjE;Hc_#AEP^bdXME2{ki4JhQs20oKI4+*_c0OyR9oZ1a$CRD2@Yh$@th?Tv8@;Bl4%_vx%p+M(r~;GKfUka5bRM#*HdJJ#IYO$;)6~+DWtRk!M%>V+3R9wYPWiVm7R47P zbZ)vs#HRWVz8IxLXluse7;>CW9FWXgg}PpNNl`Ebm8`q=5cSWvDUwUNAR;u!SSUt! z7|$aHbEK(BHG@(#T>+rGU>03+I%=9(nM(0j6`Is3Zb8IqE9PV9VjKHLF)=`eA;e=? zD&%WEj3+9OAOS*1uu|^okfBJ_=kYqc;Wzs|H16g?J7HIkDb}V!uCSw@)X%bz;i4o& zRGaYq>!NYP4t!I(<6)4UnF)OgRrp_6TLmmSqC*5D8o=M5?Me~^{LLiAOAoiqRgEv4 znQ~$C1VQ$2DA94HpFhnT(*hhxx70&pq^N|>DiY$Rs_i3u75%cpxa)4DG zFQBC#Ly#{3rh-8Sf@=@4g|=dH*#=NQ5QMQgwi4*)5hZW>$R4W8&z@`}%dueg6c-Tih#b60 zR_PHNndZV(<}@Mo>qko$uv?E5maKsO;)`_F+&eWrJZBmg_UC5h)Lk+XXfh{q8ww@9 zG6H46$#@z0?2V-giq`9SH|nLQpfc^o1E;2gxl;4SGQ;yS&33Q(T8Ku4k%+PqFrWCj z5(w~aBZpko?TZDLturQhy1~=B#h~j(W+$dNktVUZs6>GZSA94W6S{aSOL8tbNZEw8 zyr&UzQRfT$IrDmUvE%f--fyBr=}F}BY}!RbiDIR-*4WBI+eKqdbfv9@{OSsF<)W!& zqSD@dZ1vmCMRWJ#D#tMSuNxGXEyIdc&M9MGcV1t%PDfX{6w9w2=w7xhO;ouxkFEXk zx@=#6T`5IwOksE^NBMDeO zGUDS@7uQqY3A8&NCGR~=v@td2@+6Pf$Er_j;-tNbzaF<#s!v-S-w|xTMrkHu>N9o~ zc3-bvPkKz&XQ4#VZ*Q-s{GT-BphVFUlsD7iN)36WC{eWV%?v!Ip@3C!Uk-XRi|)KQ*9yh+P3@uzNNzd%g%SI38w?|DV0uPy`*14F2-zzStC5I{FF`SFN( z@vpHDxO`5|uQ%0@FIjd=^VKug;@qTXtvLcFTtIg}+UU2|vfol0Ve=MgMBBJi*w@I! zllo&=UN}<9k~U4r{j6u8P^7R5>v+uI0C(zF3;p=TMX<`oKbykqDbiC&T81Wmc*VGO z7cyMEGocY7yz&jJH2I)RjhR?6qHk_Fe1zku(n)oE#f5KXTA&H0rSxf4AiKd_!yeA$ zIOc%{tFRQXVJG;;f?M~MQ%?*!6~)gtdsbbS{?ZqE<*Fs&#!NsrE-SeIdisdxd)!G0 zKfOBZOG(Xl>`SKotBdB1w(v$u1XqktldP|l!hmDABNu%%tv9m3On{JOzvQl`7rIPJ zR302vDqbC^Q-0NH2&vaYOVA>#68%t9D=q!)xe5L-p+NNo6F(#6buj@R3E@c~6<0hV z4l4mZj&ZplIGm63XP+OgDq$+GO!`>#Y)OYyj*8a zX=@TSCiyvnGM*splfYd|VV{=5d{OWpvhYBm@L=umP>=9%M0i9?c+^sO4Du=*P6mq?f+cFhl09Gu1T3uu zmazoOx`O49MdS%Z6lg~jc|?>TBFb7KDwZOut|Ds4BI|@A8?+;vJR(~Vk!>xJ9ZQj) zuOhq2qI!j*`n975$*eb62u3^z##*A9!`%aOLlN%--7bSOKSnJr5#UY}7R^TEv4X#s z1SR4yh)t8vhFjeyM#He(4~Iy0*`lUPEKkD8{s>vNGQ=DVvtHv65)MC`WP_cPMMv&h zAra9)Fd3$f-$6@si5uMIBxZ6D-m(XO<{3y!A4k+0%VEU+Jq$!}Z9NqiM^GEB7#=}Z z8pll^hx;l*0}_L#8Xs^H$7bdB_+^4`ZM-1T%5!KbSZ^;9)EdD)n@~N>^&&NPZZGVe z6|tB_)Rkq_W?Ujask;!2823*?hhKBax3j z`p07O2O*oJcmX}nP(#^}2yJ(pAwOjzb6wAfz7$aq!Yrj&u8GJ?@ytz0m>CKS zC-;Eirs9ntETs|2R*1yZ)HGZx-#RZ#tLU84kUSmxT-mgISjuQI0q?$*4>_^%D;q~? z()YuNkEND;r-;a~^q68q$B1>cY^qycx_%3y)hf`5Ed42YsIpc@e`|XDE4Zm8dsi!b z{bfR>PSn_b#yENE>U9R@k9bqd7Oy>) zz7!S4jG1S1L9~W)sWZ_G5e*|#T|ICp1t@46^W1PW2;^qH46K=ta!MFx-v71=jUFYu z%X6h?C3qdiZaNyK?94?#sAZp4^aLwRY}6Q^u*`7OipZ4(v!{5Am+*9l0*nKO5^_V} zG?j3_<_OEfA6#tl7&-|bf*J_~%2X&5nC(-F)6K&K>j{3wzu4pfzrQTT>v1G@VOc7( zT4Apw=3#h?S0X)c8gfH0LrB7wXK#)ddS)$MSV{;rDmJhTMcKX|I;qIEB`zS|id_3+ zL9H3iiyz)h0WA4>@&AfgZps#R8KwmgE$McRW$IbpIM)YK`JNH_9 z%I@ie9y#}J0D`q^0xzvWtOuUc8SWj@`;;RUr>i>84`=G7 z?B&a?Zw4$jzgO!#j7)mP5&463bef^&+00iNer#6QX(FanXY#_CJ#LhCF61P77Mqwu zhF9^xcTU*w32ab=PXD`jfm0nl_y^nBTq)r~{U?(1NZ z&V^j_%#nGNftxNMl$hQ+2uUX*n#Im&n(P(xjOwq4s zniydiaq(j5K&la%R7OHpc;q8kvu=7i{G>qqEki>_*e7R<91Hx^a~g54yoCZTMXv&; z%vpg5c%@urVu1(*T#)cJZ6W)&ya7b9rKGfGf*cdr5zK@1@!NYN5JL z`(Uh#>lP`}rQnrYdsXWVZ`*#t@8IKp53Q=YuRSzrD((sSZG`tS!?E|=oU*p>k*MCu z0RCaQr3ldRXDt_P*jJum#;`}HBj?>ob;C3%Kb=P@vJ(|$mc!#=Yy#gaK1%QnQK_>n z2R~C{lX$A{!iI7FvtBtB!(S1A2o6+aNtL0Nn^V)G?w(gtJK|qlqU$_U{5c1?ST--# zzYuGzIT9>4S?r$^by>8#)NsOocggMg2PvYVp^ce!sqj(S)%}Myan;p&0C7L)dzjy- zhw?{S15arW{i|W z>bU%Md)$r9efPVc)Zy-An6>)ubo}M<-JfY`?)$SjErvC!#yp0KQ|EY%z0@UVqozl{wdQ;^`0 znZXm6eHu)Js*zTBa&KCuJ!Rp5SW$o&mW$C8P36@PNpB*6d_~2J$vT8fkY3_w9^X&~ zLkw-Nu#rWp-t>*=X9KYp6 zmP{o3yiEPBVu56eTnHQJV6Oaexx_iF(PkoFwlm`K^rWVacN5x@#HxJ-G!eS?d5uD= zYBBfCQ3NsUtkj^@75S@?y@g}3_y0?it3<8bV4|(@aIwZ@EK8BHRs`Po_`#ZZ-R)Q4 zXFq%g8S@sW5U33G(;Bl^AGgPHg|n49+s+S{>TSMHcD7$0ulGf^(<*=Nxc;;ErToLx z=g!;9-)?4 zcyqOChniI>r#_>l+|Y(KEU7R?O)~#*wsF}s%!;N0^VFUJ}=-ltr& zbGAfveSPWZ+TUgux03-xM1w3ci&2`5Mm4xp4!7;4Z9!JnBE;@ir>%@Lb)57P0 zB(&5U4%qzGSkg*@wSfIubQU(NNt`3u_4$@>Y8JNGS7xiA#7bzAMCjaFY8HnyCLPcp zw0iV)kl5_uF*bm_2{o0f(4_@DfGp0HzEVq}StMw$R4`ejlIbc3;~5rnj?Tpy_LA;r z@RD3uIU;*^ApgcFIsVO%`ny@&tNDacE<@(8eS`s&=@~xB z!w8@dj%dK48|jK;V?@JoJT)Cn!O?oSbthmM#6Z^~!JsoTmrn-+D==zCSQT?#C{oPaXVarJ&*P!wmi3!s&hU1 z7Hy->{jS{lzAlMlDR1h3zmIk-xy5$Ju}9#eUp=4s&t!wcu;Bjc--ZiAnl36{1ITkF zRFz|*z1`@Lnm{hwM#fi>XmW@ADSV7AnMHg^cooRmxN=d;8m*3+6KP z91I?#+#YpmEl|My|LVE_3q-m$)?EER_1r%#kQjM)#W%D)0{CxtU!WA!Z-m4xru-$d zvBYkwJLfY+|7bj>6ic7>QFKR{`{9>qd8^+x={H^<6U^-BvKuhx^xNfgm-hZF#0wwJ#6lZp^LLKd@F)z*Zm~ zfayQh9>&$bVmRL25Im7xz`<8-KI<=m7kG|N1dT; z0+;w_&~p5yLNcRSS%J=%?XfI;>@uoRKDM#^=lD(a%r*M{noSv4S7zM)ol%c)WKvgUSzt{b}y|#w@`|Sl=zyrSh*GujPKC1 z?`~4==ZsJ3yTWU-(F$p@HI7hm>>tJjEV1J^vKRm=Wq>lqk?Q4zQ7`SwZt=weH5~`A zEH7UlLyNLRR*Xkc($MwZi6*R?Qd?9!PL}KO(Kb{s&nRDAk?3rL9IroJ!8mxrL-$|2 zuO;9hko0f*-X_2glT1j34#oR=Ow=&{T#N&X!}$J=be;4ajEr!l9Z|d4<%cIM_q9cJ zt3QHL9P7%%nQjQcgiPX>o&Lt{-DG=E0ISce)I_e_+n7yf4JFYcnF&VgwtEo3h|AgR<48@WM(y{n?{0o)%nU4 z0b+PE8T?=5ESWLI%7>m>$^Dka>t;c~`~(tb*>M5=Fm!lY2WB@31olzFMdoVPIu1+r zex;!>cUTjOv*UXuVT)1?`{7M zMr3?MwgT{cu~>@#&CONaojbfpJRQ@CXzmrfSS%apztOOW@~TKh*;ZuAz`^}NO3V_O z)-SC6VVdN+6A=Wa?J;s1EA_pk zzai#C?5yxsDHiD=T~qTje|Gs`adjzLm!#AIwaUq;17D zKPapBi$hwUE8_tmHEJ8?Z)+Y)w!_r?9I|+RCFkq_;Un^X4-!AvueA{GA+|lLL_`hs zm;l^8cTJhs?-~r0(D0-*P1!V-B0xBef5x=Z6R`mV03nYb`pZCz86VDVVp7kPi2yaJ!8&n`r%4|h3AdCJFjY(8js>5j;8|X-*DBd}kAt`0 z;V#wZaN*nk^_qc6oGsCdM+fZVMVO?MU<&js75jJ*o-0wH-uwaZ$d@^z&?CfiHu|;k zgxtJa+MuqARON8%dMU$v8+q&tO?D#_#A8a9sJ^^Xow_6nO_CCTjFVA~DEZ-+%;K3; z2JaQ~^!$pZx3`5{JM+Uw%{e+{zX}hV#(uT`8eQaS7L9BC(U3(=SruWqJUhx=i6|{< z#>j@&G>zK}S9e`$wtsbVJ-yX!!Ufx&^pH|koOE1Qksg0GvDYgpAqb1K7-3C+RP_!` z{-<;QlZlnYapeGuKb8FQg;~xRgxi0_MDa=ar^)d2`DaA2-5X|QQN}S}B>D7tB>uU= zLxHnEZvgfGBjo+-ZWf(UBEu3+ClLwav;K-8V3ZCelO#F2sx24^VR}{cW~8pLFNsy8 zD0shar}qOI?n;6s>TWg}!^*lpwZ23(sL7XIu|>^LIHN0ADbdU23nW4Psob>%_u*Km z1Q!;j^;xz$uJjj{uS};oi!qG&O>LIXxHQV218wWxMX;@v`jOvgkhkQCgX2LDHYtQ+ z{+$Jn;%BY|b3t%go{b5xnSDEvR2+EMmXe2gFD&oJU}mMj#(DtsZ5{Dm zYVmP(zADXEo$KcAuOS1@7~OZLX5%=pFK?G_`T7O9N8n|)Cl}&_U%1iFa22hcAzAcB zBrl_CZdL%pe8!*b$13`+fYW#i06Ot@zmImji(X%d_u%e=u2_VM7_S7ENiG^@W4y5f zHP+=YVhRz^9+AXvqOCvXzI$p{x+VIsPKFwLHNdv>A|PNbde>OY=@coB&upt2Z=C01 zxMYEJzz`7O5~Kd3rlk!}MLVDv2a^#3F4{}1nVYETcJ+)LNeqjRd6gzafG~|9-$9rs z!*wGh|=C)`-E1Vzt@XTydK?bjY3k-ex z%T#7`p-WI;)owZ1aj(~}KzBKaeW0{gv+L*b3WiH0Co>h_U)fwa0IrA&R?n8Y53k@W zMSK49SX>8w1%d#isDC!}SFXBbjY_hx>~Iqqev|fw0Ut2obg1+jR%K+C8=uU1~P7-^!-d*$2gN zNo+KLW5ZT;CK`|_=K#bmL#KwWfLX)5*H;b&;@A!d`s+l~6|=~~G0e){*aYzAQpHBQ zxJ2w4ojp{H`V<49R$M=8ch|T8dT+TZ>hzTXWQ^8ImSc`ROxBf88p==YWP6%8Q&7_@ z(Ch#2diMWBz+4Bep$1KY8g$2BgC_F_p>hGt2ODO`vE*QMByK}7oIxtM>p_<8d~9PN zH2r}Y#U5QiEeq&hLoDEm#bsWB;^r`eVYKK=d0@CH0D)r>Lxt#GAIjv!MO#W#Go1k7 z4!;RzBLoAIiBQ%x*L*AlnNLR^ZIwAz3~Dy50O3UI9|of^z)iQsji&vnIOI*WixHqy zH#Fu36O_(ftXmhohM6+Oa3}_-YgZfQOsCQo>c?C3y5@9zT+sr}4)4Q1a5)Mk_69)sCU!P0EJ;^d;kP!8akd@Ks*b8{G`55 z;WHI3SE_uDBHJFwhER4j)u9rX;ovSNyoN<~+@3$8PL(N+xmB(BcCp&Q7d0e4q99X6(>{7bynhB!p>Bc2o#APNhUnT57wyLZ@6eX*zr^QH54lGIH`E zv%}+e=fvs(&2`QBaREL0V7RW=$J&|W=E`D0f8R-TLaiB3jL_Xo;jX34F@u`r9mAl< zF}peT1d}_4+KmEB1`fNJyXj#*JQy=hcUC0&9O+bNA2`gGNK=GOKW%4QT+d(Wxae;; zA%qJsYC=G|wm-Dp_wTo3#F{h0^lTO%52i)LtZmcUWHbc+Frik$S?0ocT=+#SgI?;r zw#-^eo@IK*mZp#Sd?Tq2ZlG&C2za+K2`c;=PpjK3v$*a5>zc&`P;eKxnBH{97NXU4 zCZs~n*TgUYg2KfutS)Tnr$L6Ya?=4YEV>Yo1dS(wUx6)QNKsc5gE&#}6J&#IaUR~a zM&a8!5)wx&v@jwi1K;Eg7R`u4D-KhP=}-|Ir+}a0<2P5f0JBDk(j*+aIQ9nPM#cb; zDVs|QhIb=F4~v~GeNT?}tAhv;w2;UQ5h6|uI&n0)In$gEuh`$^Vu0uN@_ewmN4UXR zB;6oSPpwieR=Xc^@oxpkb%{*AL0B4~IOLiD6BZ57WIHJk?u>Q?_= z3z<%!!v~SrMoZu}#0my6A8@tdo>65A$@K_&7$3i9)6zs+tBHLnkK}RYzyYiNOd3_X z)(WACkWqzwe0)X)MuqhqF_Q@0pCEb;O1l|TJ3{`+nHX4h>~X};BLnaShd4O-niV{Y z2CU(nHoTYD(c>dYbdaLtUDyPnEgzI96%c$Xs2q9DY28;yeEdOpB*=CtA#G)>;b`>B zBypyUgTz5G^Kpn%@HYL0{AZ*BhAu}zL#XA7-XrjdXL-LcEO$%wPCVbp5wl` zs7c5W3r`I#B%rThz`=jqPl4rwO~215^W-Q_@&%WL^40aDDI`Ci)IFxZ>owTe0(1!$ z{SnD<8)3Yt{eIxIvf>kjbJ~?(C_AhnFmhKl*44gN_`G#b)PggTD5*~>pkR-N;E@

)b#K$zhH4RTfCN~3-&wef#Mjo zaVD05a2gIT-Y6_Nh3=mrvMLdfFoFQBHL8)(_jQB@Shm=iJFbjT-8NP_L{Ao3hB@?a zPD9%t?Qr9(_XRwPP5dTHRYEo^8St|vY+rr^8Fwy?NfI8oiK^PkV0pewz#uAJdRetH|8=LQXbv zQjP9Ev+Vyd9;3qUDsTl=SkwF~?0#kVyTFvCM?H2O2%Zl5rKe+d^T%qj3fn=GnS;KYq`pe?fYaj{heBXiAeO7U zTbXV-u8b^zAn8%5ChIC@OR2Wu5&*X>9<8RdoTJKn2JenTgaUw;>r`fC$1` z`Q~Du+>2w(Vsj#@e|L?!E$6tr<1qj8phE+2P6Ee(v;daBe-jdyKK#;F;o$$J+HV0gH7tu=W^M~)9U+pA6LjKXDj%d}j(Rvq;MzwW0cH?snufM8O6 z@04YnOPFH?|95?oza~->i+K8(eY6D(x<6BhH}ZsunGP3F=%_R5BkZx&t*B{nAfhX9AO(c{X5W%0aFzfE zoKPsWq;4ld@VC+IRwp&f!PIwiHqb)#4=w_b(#{W+df!JMcjUJRUu3oGdeb}z8+`vNzgnlEdny*OmF<2u zLC^^}I9N{qrtD{N1^a<{mF1bc7P25#czr?bicVfQr*s0;&NRJHP0aR22MZW@qj-%! z#A%+NjlD+`A1xwe5{Tuv)0Av0!o0D$2L&eQrm7wwJ{D3y=;nHYhuH7jI-P#{6xdL-sN*5yXe%0eg; z4;q9bi5@Y5nOOz`WKmbne~z=o@`1LMbE$^L9MB`%Oi*e8m>dB8*%;x)+bvQE&1yn} zi&?7%bfMijH`mU8Q3S{oDhf|mRtDJ*$@$~BmU9JM6ai%Rs(yV4a3ATGvMP5pYS!gh zX$yhRiASNY$*x7U^6dobi(orq{uJ|$_y^)+ zKGdIc2S|n!9^IqE{pbFAD(!50{?r5z!YY8bwKuah0>{-a;cR7kg|sx_hb5n zz(QNueL1zf%BG`^cvNvruN2UP@fw3}fled99JIGD&R-qFIJR(NjP&lDHzR37q+qS4M zN(4S)^r9+NWg1DqM=ldB{UVhMK>ln58kWzGrDLyFW>^xj_9mfhMj967@ccC;RLhte z>vP7Uki%q|OQS4`5Zr8rxw7AjB)o5p;)xC*hh6o6ah3*Bwb4E}!54!l`~;Np+U1K} z?e+1mp70C3UgBX5dP#4^XYoC4q&wA$5|Ix!n3{$h!|85H$#o&l?SV%HOmTtdY`e4g z&^Y!La)#6bz@Q)&-Ma?s8R%Pd_)6MNQ65b6BB?v^sH+zC1e9@BfC{Efh_Z|f}C8t9~@J{UTe-=l{b9%>9~FQ{jKJq&bt{? zD4VpLa*ivBnww86%F5ZKwlQ7IcS7^KM3cJCOYBak5;)pLZ z{mU*mEG`R9KlVf6awuRmF1f1W`Ivt9eSTgTbjdgtR{F8VzaH~r2qegoD zPmn>3Z5F=s#t?lXN0tzb^cUC6hR?`f!Qn~F>T}+z)O%X7n6+j`_6-8_lu~kKiNTt` z6knmRkW$R*mY8OH@e%vD+uPCaM3`p__?ZK~b7waOQYmKi4w-~j3R!?YO6a-*3%8WyT>)tYW}F}BIn1pIov-v|0fLx zOxxQ$Nw)q_vs$;$`Cd+wbE(#REKlFNsZzJuYO~HqUhDbSR=2~AHSgwXgD$s9y#Kw1 z!z>$@`(GLkMZTc_&~W_wdbIO$Qg7cBl7*f5@~wOH=qe2G1?HJj+Ny zyvkc}VS>7#Rbfomi&V2XD8({!vTo?ecA{21xml7$GOQ@owram9>BA}6Zn_n_&a{Wv zGMb6-pK};Z_KSzV%rBnk?qvnxQCI@Ph|<{dV+G4fa^p1HN($fx*5JZ4w^6I291`}j z{Dc^kp>u9t+g@30-GOy^&1WRLO+~|`wM}J78s0%=$HjFP*C!H8s_Y&KYn56IdSQ4S z8jp>w_~d(Uc*BsAja}oCgm-1rGD~}9b0#5vY0FlOjeYB0R=IuK&#FWF_TQg596Ba% znC$C!HoU9b=CN$@Ri5s@%I@wYi7M~Gp{;Q2eZ>9Kv5!EM)2Sb%Z0j^oMO5MBP5E@3 zXUN}L59D=~d}mwB#$8@F0UFo)B8+#)osmZ-w^q!<5=KlG3ZZ_A6+!Ja?jt4gMVZH9I#R(Rx=1|7v$1zdinpoh|&k z5C6OO$uMp8o0Bohsk=XuHdMUB?YFYOtHvz6?$2Nbq8;buULWo+w_+V0j@R93A8rns zY4hQ zr|?edo0>4OH}v0;Vu-G6fW3iCffi9pNk0qk2}~)90Tkx}zr&1t1e6gYx*!G65d=RP zkdtZK;Tr_YokW={Fj5qjh}-2lIlg-)$1$z-HcJ0zjN3RP&1H*dJhT7H`L^)+h(8J9 zc(!y+@*nVsM}}WV#K!D;7clKF4$DAh<66g_O0eUOC_Nl{q6_0;YGI2*V(MIrIhonH zw0p3MPLsGdjR6JSJpoK&K`$62i7+;rKj4@On$qb|zLBWQs8o#}epAGotzCBy1h}b6 z#$wpd;o*8Xxk=3=JqcbVwyrEPBs3 zIuku=ipt}xITHNT;dkHVmRdfmTAWz3Fj&aG zXYW-=p8hK9Xv~!!PxuKh?_%E z^}cX!5&2CnU6L3Fz(m)?VE$f6n%~wajN|J@+hGxJzJ)Sf9Du&LywPxzuLnda zbYEOHiSW^69BNNkquW_szqYQN)?IY$_-NG1xXl*D2UbMg6N3S*B|0opH9jk74m7ZD z4{3`uz?v}b<6%|+K1Mg;t%eBH48L*Zux%mwMR3?yo!_-h5!r(MKEf=2)I8ETiCHUr zNWj=Q38BhrFCC#3^_(PoY=8l)78ZnQl73%`SS8L3vuhInig%Wae#9#F<=TXSaxVKl ziE~`@b(T0+OUUOuV&NbKGdk$25sksqq_{WRT=L5hcEzb+W(Ab7-Ete{+xj%KwjJC^ zEu`Q6dG&w!UhsKQa!OCldkk{h*Z$>uK}MR^A0*h2N9bcI#{HLpGk?Uh%pN)JX++$U z+9K-CeOYhafs7~T#lnvdR3qEw3NOgZWPOYm?#Y9=7?)*YzAU|2)tzdd6sU5qJTwp> zf8VuG@0>4pIFNk3WcR+QE@9%QnXq^Mo+^jq&hU4GKR5p}aJHL2eHC!%B~ZqwXfKm~ z`(^w6W$RF``cQ>2BwNTK&qmtD?)!^UPzfKeyi>o?Ly#{B{hQ!XHFe_K3~b z`_9Qoz7&h+Mw>}>67lkG12iPmFEIH#%KOtM?Xl3X^z+kr<%}&>Wf`OFV18=)U!JHnujE>+ zMSY+-^?ITCt!t%w=Ajm{ZK+SmtvZGJr@6B5%HmtM#^%f;3%~ZSn@aA@i`2i|ri8y; zzIE@s%se)YF*dSCc?&tG8iHZHR$@Zpy;S628Q%v3AX0F}$yxKwJrv>-zO8vt{?U2ZktHbTrTi?sBW0Bus+;pe1P^KT97Bp>Thh@IdYGa1WHSAw0@5JQ|4zk8KH$5rV;GU|T$DUVDCN zIQ|(eu&gCm&J`?=ETTXtqDVWU#3SO31PC3+TdE|WCdI#YDFPkAjIJ437Z%x!6962H zZ1XVuOcwQIDYEY>vY#yyW#HT!9yNxDoM?$0xQgl~i=G>fn%|3B#ED*LiC!9xURjD> zzlz=vivA`O^TRS`(<5rPBxaw@`$-e0etdAwqUV`V?8TMm6`9vLBKEc<_Hqw}^ozY0 zf}@qPe3SMned%;8&g;_;58s00FPlcX>Kea~BWcwnZ8ao+6-TxlN3kDAbsfh*9?t}h zqqB-B+wmuP88AUY1kYms1@{90{dS9*%g7U>rdg`9Ll*z$n_xm^|?;*>d@f zscfukz~z)+on$+!WW&^y@K%J? zEC1@@S09a^3TcYfXr?B5rY4)GA|-|G=2EAKbW&ld8P}=Yd})~`X=$ETrLAdFjEr&1 zVc157#m%hL{3(sNoH_~VO|9uIBkAg2(z~zI9X!)}VFJOh#LuPaJ*64FBN>ya8Ply9 zAvzhK$y540GrzzxT}w0jQZv7`W`1AJTt~jj+R({bAkW&B&DyuhnqSW9Y0dh*pXK(B zpb$Ip$D(y^YIaU(TGl?On4B0-o%pUbwSp%HYc%bqRn&AiscJW=vp)GLMQ%5G?lbn> zS(Ds3zRaNO6bjv3n$cW3xfF7*TxyCu-&c8TUU}@g2u2D7^FbcVO&%qC9)~qTKrWXl zEgw9Z_c9{4?=ohhj``b5V}xhUyRy`hYa``^g7o@=!s~)8s{#y)LLp)hQnpaet3Wp` z`))t&$0D%=Px|3VrU^yn95~a`t7xuNq$n@zRJO>$E5mv;bDTW;SVv%wyx88W*gYb{ zyR2w;zxZcrk>hCb$F$;5-IB1I;s|6~I;LtiZm_Q~iNVlz!BTKx>a`x4bzwm%2uF$- z5@9u>0UA9mzwYF8%r6E?*D$&r(;jca7UZuY0qatJ$ zNLQ&UqYyX>DOF(Sr}r$JI)&zV5^#o;mV5CUVHK(Lv91YdzcDfT9$y9Zs@9kDP#cbD zmrmcaB7_2zvkS6l#4`rT^Bmbr!h#`Pbwza{D&`cD3#EoQKWc|5Bp1m6UqGrIYN{AO zZ5dQ1P+uz&Q4;yuti1uZ7RjStL-IXKyX(|V$G9x<(=}e#gui+ge%4YSgjkvcVkS|hpmD4pDWAcR@tt~70=Vuig?|2botn^8( zO_F$)xA=N4?H=uQ^~gj~*&57lw>m`tc5PVJl3B{z0$%Z{<=0TR`_h*y_`uh+6`5Cxoyri z0>>dn{`}2#+s*g#iWmtUiu0vv6^DyT zh>BM-Wpl&pL0_bTvi2Ew`u_q^K(4>QK~GD?c`V71Y^Ti`wMH=`_ZdL_D=6CQPAbeB zDpnu7qW}VziJa%qY6_Ng4smNPHu)@v|xAw=1<+IC~L*BpmB%VO^X>-PO6> zMI6%9PDex#wj8#VIiI%N$V$g7^~w-z9AA5-%!`a3(;Qh6kjk8+!{F>cWTb=w2!Xq* znC)PoyM}9=-0@DQ@ zx1wwiaqHT8|4PYA8{XhO-XBY!QcJZ%DnKeWN71rlEVEiIvN@9bx-l0RglR2sKU8>^h*vR7ETr_UU;@#^B++nF`8; z3_7du8=>! zV;t{U;_BPt(2C=I$>TmgoN7$uNa^HoiLssa&O{EPpBuj+UgTNMzFST*s#m{0Jfs?K zGVU-CWj^MW#-wTvrJdU5@cQQ4LcDXE%x;dLYtF80ex*pKpuC40fuWHUp-l8+=;)x!X)%w1N zne5D7>_`6WF&gd7?!GK&iy9v|``Kk}Sj>Lf4eiHhn&F||pU-YZiJ?Ev#K z{~z--Kl3(U^EiL=I-m1Auk-bg=Cke?QX2Gu+wZ(SI~}egA1;CO8vvQ02?Fu-Q4jS_ zPxVqS5LTb{Q$G+|kM&#c^;Itrkq`j&py*tVMPxo?P z_jrHzdf)cEL%)!DpC;o90iX?;kPV@b4TXRBiI4aJp!kN*_>QmmjgR<`zxb9v`Ii6q z0buw}eqZ~zp+EZSPWnfG`l8>%_q%;S{1ajtY-5iJnK1iKPy4f<3AG>fw@>@E zzx%rH`@Mhrzd!r3FZ*s2#m;zWuSEndW!QR7CA9X);o8B*j(k|j-^M41w0J6rZzzWiwK z*TVoaZAr8jAZJdT0q*Ja3G`>qp+SiXMS4`JQKm(IK4rQSs8p&`tyaZ)RcltRTfKG# z`&DdMvSZDbMSE6lTDEK5wuLLUolcuIKeqej@}b^Vd-Kw@cT46y!M_L(E_~QdCr{Jmn!C|)HP$Z4)|*J%-hjo27g_9ck zz$~2bIt(eykV6kU1o1-=LnLuT6H7$#L={tHaYYwfgz-fgW2A9L8&Pa2Ip$#UNT!ME zdMn7dh7__$B9AmONhFt4vPmYNbTZ1U7KF|&kCfXnfWGL$$vEMP1M{;B3seoTai{$p#)Y+VS^=hSYwMt_E=?;jf+a4NZkm_y>8kvy*%rjb3^#V#IsvDzr_~ZYsd9A zTyx14w_J4N+;g*OoAZd&K|}o%Q&8`KXV95=pykN@-#(eV2HP5{A&Nug5zJ#q5>0w-NMg4TuQ)hj3*IS4Eb=gmp z=x0+$-^jaOt0)-f-)qr#}1ZtN&8* z&KRfrafKrfy?oHm|2%!p*Ee7N_Sr`t{;Eb_Sfhq@GCg9PXYTpt{&VJ80A*$~01j|} z1mvFp{inbJF3^DgOW*?;7(oYCuz?rc*w66CpqNzY|5t89Tiew3wh)q#Z6*Za2}`&_ z6}B*iFB~BYVR$wd#;}GooMGBn<`A0G|CC`hwJFVOc9WXi{3bS==}oi6%}SWe z$l`=JNk=Bqo$Z8YB;P5|c(RjQ&{1cOK;l92mC~P`{3j^^I#7WY)RdpBRw@gbzc)4% zjt+(BLnRtfinh*nbQD@n78XcAcC;rS1qw);Gt!BWRHP+E=}A=@QkI&ur73;sN?kfr zn9@|HHSH)zndB^uGS89@vu9A}Db#un)u=^9Dm~Lw$(w-BISQlVHpOYpaFTPJI?ZWT zu_{%oQZ<|4454(O3X)YesG?_`QB!H6)`YcHC2xgmT;)1f=1kPCw7MuVo#R2GZB?sl z5tN{`B-mCE*06m+tdcMf~9ohnU18#_)-in_vWYg{KNl=LVfO+tm7vy;-{5yI_*z z9sjh)P4#h*fjs1C75T?T7BZ5F|9oU7C%MT>cCwINLZup4IZsS|*AH`d$K8VUs$ZQd zS4CA~=MGo6#5Hqq(Y)p}w^_|@wr+#v{9rnRxXvX`bDr5uWv_nO&wUP?SYf;oUqlhT z07i6*P`h77_qV+|UXG3-J>*E6_j{A}v7{-DVE`7@b$Pc2@r3bL;p&7`FU{r2?lco(eF~dPwU%v7hHY%!S!p^HkqWej zTRVx6!q&OQ_JLi!Z63;P&=)x^ducmvbKO|Ui&nP6@+(I(DI3Z&{`Hn>=Mu-=&0!J= zACZN-1v0Fa-G!}5JGQWe|28Z~-~|8aM5M3V-SCoP2Z+l0gbf)^twp7jp?%8`GGyNzthdlr2br=62~iMhw}8k5bF( zduhe}_{ws7?49yk*u*a)U)Bdb{Ez{#xaK9W^B)CU)VorSsZ|dmRDXW20Vpt+@yPAa zYW~_APEG)T1(987SsO4tzvDV95kJ(Tn_t+3y^{ifo44?>HlDy6tFt7%v%B^ay1rYU(1Vwm7(Lt( zEPIf+^9q1|YZxGF1-}!vn~;FLGbErRHHvGAR(QOUTAl=0KcZPQAEUDVvohhpGN;lA z^y?kPq7N?vG%*9SwV5zH!-=PZHd3%UzpID_oIVG^Itr8tin~IKNIVaMKf99%34p(< z0}N8QJK3VU|6i~`ePX)lTfn(U0x5XBrYbzeQme+Xh^D&1JxQr58NG>sKiruJ0ML^8 z3%IUg!ar+7YZ5g4!-zs-sMWK?&cho_8$>TW!7X4wg;N;EX&9#ayaR-eD%?AZ=$$=m zj=4BPh_krep+O$}i-@xap+hISxy7yHK^dbu+1i9yyogT(jcTDh#t8r&oIZc+F;auO zOWZitO10O!qu8szYov>x+pxB>2ga)iy|W1M6FR#S!MVvkulpgfBSG1^#fFhSp?f%d zqltkVJWNVOK72TcYd$n=yuM1soY=wc+qL_-MIfjMobwZxqlmh|od?`T3Zp%2BrTuH zl3EBt|NonlJ!|0s^BU)g90yp`LF}oi?I?2tHUHK+=9{ZI|a!JbSt4**r z`6ISbDNo$PFkJI6e|t#JJWmsoBk=rA3bP$%d`!0TPWf!A`z%lL)FABKw)>;V0pmZ{ zx=1=XK2L)(YJ<%NRnX={#{}ig-0U<5#k&iw&ZH1`e8d-3LKwY{32RVWs8JE63C$GIVDmSUGE3Oh(HynSApOxE9nvGk(Iov) z*t|9%MbfKe#2A&*Fyp336bVXXCDcSsbW_qU}`D|1{ zebhm9RF)7cI!&;Nypr$H3yVBa6a5m6Y|tpf&<(}WFmz?zGG#aDpUS4tgNe|1-b71)2Zoq%1~f@N5ORal5U*oQ^f|Avj&ij`P_ zZH0~Hj)=@E0nJp5Do|OCRo#%6jkU}0+mfMN+2}wlmemrNMOl@NS(mL@nw{C2%~_P) z*_XB1p1oO}mD!>FS)#>RqZQhsby0hQBpWdri46@`VG1T- z%B8{WrT+P@tkv7Zb;K#XTdon@!i8L78YaMvMj4w1pT@$wheOlsm z+T$hJ@|>u93u{TJ8{+0aSh+`72ooOyY9>} zp}DrK@z`{2-}iOj`2C|nl0=HIn{`s&;?-Z|UEcoP-=pG6BJ2q6)L!hh-U7bf1V-Qm z1|5Xq-o7=YzkOWE4cuay+zF=K$jx91CR`5IU7mi^VZebc$Tp6xm7XGT<{Y#CI7UA_@{{7z|&R-!m;wSnzP0f+#)rjb2U;~C? z1wP;@j^Zc&B)%;j@68bKHQz2K-!Jy!FjgJ(#VA!XuwHx{|M*p7`DNoZcH^D0x%z$8 zgd^fQ9^yMbVmr>`D|1FlTTwX0RVx-`Dwg6ZCgedj1K5GLVD zhU5<}VNABHvQVNT>iHfBUVW@6TkY5j<51>^$q8S{^o~v=y1kV|8l0I;az85#^`irXN?BnB#t7l z6rY-KQDx?>qA6x%Mro2(=`UhtRT5}}#ub|t5!OQJnvOe|wkUx15{s zNdoJm8>Iui9gN4+!|BLQBXtw(0MltRW@x025++tGkow)tW3|GJsh7&?sxa!)F6z`a zZPgBH)-LVVUhUY1?b&|q+9vJWCaI)ul8Ig@|1I`vzk%w9Q>(}Wik&m5z0)ATB+9+3ahVJXGZtC7{?VfJ#{%-8{?(hch>?UvVHt+O4@A5|P z?pE*j9&h+Q@21UY!};YLu~k3@%Vah=rIEJh^^t+2>idy5A}b?TR&aXmXS}ZAl}_N6 zuA7&x?6f+;HSBDiAi7#KzrTPuo#?xnXanP3Q^_`QG{VXgx9s#a;}tV%-A;>S#E6lc zn}z{MKD=?M+cmFvam|KtAD>??ad96mXP~-oz_A*l3`8yjk}f&JQQ7FZfb9T6@z**M2@ zTS@T>r;$*`>`?~tBl%C9x+&C_?H@<rD!tZ>Lj||Dv$C>R}(6y^ux*TkV~fi zPU(RfLH`EzP7iem4;=}QmQ6daJWrKX;`3Gy-#u6L7xDAg8}dYFi$S+_MbCBJUg~Hm zazuJ`!in8rCw57n4NE_A>ACW$wLJzu^B3I=TPSlh-*Ppdc4uF6YJc|P4k<<^L<*1f z6oGYDCwKK4_i#UvSx@22-u1Jm=9}Q&ZcRI;*kRCZF zCUt22bWun6f-z zmv@tY=w2ssI>vZwaryA5IenM;WRH^+x9=H!d46B^kZ$%gU-0mFxx5Jam&=Tyf4P@1 zZsr(zr4NmkSbETSdZ%xCq9={0r+T87`l_FLtLOUE=z2~4`aTJJrU(12H~X?jd$B+J zR2TZ9cl)-7d;Rcv7;bZpAjnE2kxkZQUpBC?g^;27`wN*<3c20DpOC^|UBZ_bWm^#= z3=zifJP(2VznA>VKYYt4d>5JgtIqt(_x#QW{Sra^ukE~#3AIk_2=D_bXq(;ARa@v6 z-RMtzt_}Rst3`L=ovY?v!>9i5PuuAifA1In)`cp{=X}OjfAVMl>TiGWm;U&#{?Y~Z za}IdU#t4F6_(&NR*$0RK0__DLXs{r{g9;NeT<9?2zgD)|*)nKLBF2gr6aH$~N+899 z0}+lCI8r3ZiX=^<9Qd#0%7+S75OX$L_^T z*YDlBeCdWP_|~G_|A`;rer=e&5S{lrR+EJ;J|$a zqi)Um_3FKx+p?`q`?hVg0w;Ra$n`f~&y#xwEl&J6N94*OmNf1h`9P~VRYouT^}1B7 z6r+Ew{?lT+pH*i%q`4KHHe^t5kffOg4ao>SxuX*gdt1Andad@AnFy9i1uY@qE^_=))9dU{sY-W zy9L)6fgvU6+l_uX2BU)@d1YV#5p8E6f>ni7Bz3%XN2FMxh3KSSMLj8HlqWLQVRI-x zNn(~+QTSkm|6fWNCYfM1IO2d760}8tTTO=5M^wof)tpe-ITf9G66N21JiXW_e}2+< zQhqHmd6|0t9d#jfzkD>FQSL!%OOgahR8vI}A=FAyoLXe5c>;Or=y&Q}6)38L0?HFj zdg6I!ov+Fo>p>R+*rrKRaOYK6xz$-(T1^3~Td>7;24G#HA)A+MqS>dKvu}>}8E4d{ z=4E$`A?e?bl1^A{qlyNw7)9l(Mog4AE`E^uKL_ejB-KB>4XykN3r+PF;6_*_0R2n<&v7Apg zZLzo`vWe?}<5?A!m|d4SrkP-i4WZB*vcy$}ry6i$ zyA(f+b88+q+;UG8w%4G49lF?P z=BUypxLze~oUYR9I_$9K$tThZ{i$^A#jzxjeApqTvP!MI#G=vYu}JBjKN|TWZ}9C# z(WMbd_jB`|hB~hG6j}8ZrM)k`-*?|j{<`et&lFaOi_>;GN6GMbuPi6|xUjLPdp! zM2I+~kB4&iDUKa6cj7`I`?6M`v5l^ZqPyaljMt?ta)~7O!crHl#6>ZN5ljCnpoYju zvRj=DjB0cv9I17aE#1Y9mJ=hDPGd$q@-dEa^P`sPl_o5bu8>v)8%U1zBQ}wuO$7W* z>&!>K^GOnRv=iURn)p2;0xDxhRH7z9shseMvTl?-t`f`M*!QcJS z5|!vvWhM87!-%wk6!}@2SH8o&9+6U1+XK>^Y{DUfyyTyKYNMPowGi)t{|v3{`O43n zV^yZKqOR*PnqlT@7^8JniKc|AQ=@vyM-gOwCTZkvjwH)&GS-{7v0yeq7#vcNfwH7% z!?J$4nTt$oBUO>YLtDhc%Rtc02;2>#_&VmPZ8wNoDC300~4! zaEqG=8S45d&Nd6KTd*pOEZYXkK4lA=5DqCM5U0vkl?+W%rZqvcO~*F2yEKB>VYl*1 zEERSu?mTa2KnBWIY{6TtBSlrMSJ%1PVhg#o$R>_^m8v32Q~@A`l+IHX__DW=_NXd+ zrE?JiZ*8~+uIp~brC0wNIA`-EP<{bCkXB?^C6+~y@O&bXEo_az{}KKLd^aInkil2N zq>#dKZ9&=R)|G%(ZAEbTOAzKFq{YA3L}fQc1{F&fAw*81_{etN8a}a=0g~d9j2clX zPZUfQeWTmJIN;!#=dvC_E{9w3Ww5B&L_-dXK*-<`6}#)QjeIVTs`@BhjZ4J^7L}ck z`{PHk7b!rt?6|^gk2d_7P3;Q67SOzjp^!le)_vZP2}Fwaa@bICeWfk(J1$)j1jy|m zL!$d!5b6F`%mH|=JsNG@Ot;}H`TevM9A(|1Y{7s>3GS>@4d^2WV7b@=M8qhpW|Mf?3ybvC@L(lfuc7dyF zV2!}}BA`9BRU(q;07xNtVF_-KY*Fu2j|bBSCh?@T9q@nH*HZ2M$E4x9*GIFL&#C*= za{sGl>1^Re$K|kd;XN+x%z9kiF?TCsjcEAvipcc7>Q?|x3Rj={BlzC2b^D4{!2-7C z=wqc}T?tDjfrYz1_bzKAi%klCrre*VZ+CoM6(VzZTJc>vyI)ypj|_<*?T~^B1yXBv zSESZuGkLi`0%W8x7sVCNZH+5ZSuZjD;U58uhARz{g?0wcRYg$3oh#!&OE}YE@wKio z+!P5ExfK#9w1(H77|cxkx$xC>spYcvX<|2;B?S7<{~ZfX3oUhG=;>$3(py6uU#ili zzlf>7jc?L3g!Q70DxM|_2n9l4V+tnbXfSI5q=|2FA*YVdTV2EIn-S} zJsc`oozfPl{j072%Z$j$i9Mai6mZKgHZ-@IZCUs4%g_F zxLroXU5b>b8;6-hJ1m#?U0U@W*nD~4_C21gRRx4$59IaTfwh=uq2STgRSC5hWrW|O zP>eue*7U5JxWNTwX@}B<91ohDrJ&iM!50dq|C)aUS5~Z`oLL}dA>dCT;IJ7R0TQ6; zKny`h!hdbWve6U`*&NM1l_gCT?&Q&apqUCT3VH0+Zdirjs0eZ8#DP5wX^F~raF(SE zh4gUGZp6vwNsbB%4Wq=8VT4Cx;6#Oi3aAJ~!X@JUjnsVv$&&ew8J3|Ye#}VZ+!rPm z3-ui4jbaKx7Bxv$WL+2KQCG8#CJ=4%tp3srd-eevrqR{5u7Ghn+cs)sZ0nsHUnR;Q8KAlxr*^WxR z6N>o6N%-M8l0^7eA`iWjJC+0~$(%ci{|q^rBM{w?0W}Ry;SiGfl|g}?el(dU{$H}8 zM;2nCLf%N0HRK;PE~ErOnM#Bq+KAyd9u&3V-%p~GRAE~QcfaI{3AV0;O#C0x>_TkfU5u%cdS6I!0-{8VELsgCCrr9hUG!VzU+cB5l9CS)Fs zRc>WK2_;qfCp3fyIky$+^b4I3fHm5&bB3EwWaRL@$ zIazQDNGKjyV0PzV#^qhgrFe!XdGh67o@ZXBr(K$-dgA4Jf+u!GqhNZcTPT(_ikI3T zM9x8H$h4CTE$4FvD1Q!UKTT$T1|)$Z2SF|sPI3otie_j=S+JE6L{cP7J|u=(D1~O| zgkl+oUZ{q8Xo$Y#hK^`Vf@p`nq;5v&gH{=`iPoAJCQoK&P!?4F0cE71p@8mag7PRP zNhft0r;u98{@}`3#uBg4|L1(Ng<7H~G>W8qM(KF6=X*M-l$IxaW~r4apqQdW&qkGgiaac+-7SA z$>r20Y~m)O9;%`WDx(@|qbBO3E~=v%NsCshQTgUC0w)-{2_zL~kOpaTh8{Y;DXF%p zsXhmQQl_V_YISx>Cvru0!qRq{rIOa_0*RDfs)a{V>6P;8lxnG$V(FF&Yp}-W0G*L~ z%BQW?>X?R?R*WTHY~!hvD#rBWkB*}{W~)y;#qeyawstGHa;vz0>$rNWxrQsbrt7(u zE4r?$y0$C4va7tl|LeTEtG&jnAC6U$AtMoGjPU=>6p>g96|~c`Vr;6=_21q@u0bO6uB1s@tY5+s5tNw(XOw zXveZ>=^)kVbm1pn#c+0NtA1*6hHBOp?$sVHo5pP5%Iuw7rzgg$2hM8KE-NvvqW@Sf zu4XQ>ZZ76>|L)~}uI6^G=z^~2hA!!juIZ+3>8>v7vM%XT>g4XMeYQ}nLTgq?D^`{& z)gmtM8m{jOB+9w0zebTF^`f61uSA`#+`{eLE-&3auk%K4^G+}Gwxr!6FW!a@$S#tM zGL_esY@On${#_f&7SwZ;Z}{G+_^z+|wy(*4FZ;eP_@XcRD(3ep?#wPOSk~;n;%w|P zYhbQO<@~SCdglj41_389&p3+^PT&r-Edl0q;5 zn=u+Iu;!r}S!~@V5L&LKu^g*0HI@a_&arJgPbhYt1L^Aqt7#V_uGbL-n+V@?kr)Xl za!{DC;SR6r0BrVRZ?PGm4BIdeTQVlst;wn2sxjSMWwH;4@+Idc$4WBx7O}D|RT6(O z<2se1Jh2o*u@l3uEL*VO%~y*_Uz}80Ez@!=|1uTN@&&U>FAuXZON|&W6`hqO{V+@} z;gT~)^DNEjEj5faKl3$9GqG$lEpc--V>38wGhBh-fjG~B*+@9o5;UuGHnVd&d-FQO z|8qP0qCCHIH{bI&8_eHu9@J8>{T_2M1Lf{2GC`XSod)s|n=(V< ziBu{v7_+iPQ*>aNM@DxvMt^iA)om$9G;g9Z>Zmf{f^;jtP7`0WORuy_*POgO zXSGZybk;gD);x5;MlwlfQANkJS@-l=b513rHCw}UTZfepi?v+W-;4etBW)^7rSw~4 z^eygnK>sx`+caS3v@a7jKnJ!?!^&UXbYYioTj^<_GsI)X{R=4uQNTLc4e1H^vdStl z*dp2^i|t%XG)>OUQp~Ax*U54#MRO-Nb4RyxOE+{+w{=%Hb~nXyYd3Xs_jP-Bc2@{^ zkGFW2_nDaYQMus@kF`ms4g0LJU%NF}rL{-LcYVwEedjlQyADs|H!C|XtUj6KF12@2 zNGPTYZy>n2(8z)(xPzMugg>~1M>vH~xP@0ZhF`dbXE=v%xQBN*h<~_KC)jyrjj6L_RsI;LOxq%(P@+lB-irfu`KsQ31$A5om{c5o9fc#SQVxB7Dfs%zT! ze#<(o_qna>IIPRLrM7nfXsTBH?G4`gtQRLj5QyI#yRj!bvM;-`H#@UGyR%0-v`@RV zS39*|yR~OKwr{((cRRAbGAhk?K> zN^tGwC+?m)srP%S`#ZqHlep}=l^>*o(mTR)xx&x;!pD2VCp^PPysp=IPIhk+?>WXN z`k)_r#sm7sE4s#ae4%^1$P>EB*C?YKsiQBJy0^T&zr4%GJj}!Vr%Ozz2RzRIyUyqQ zW2X9WuR6p#yu=4R(LcP=5B<>#z0&WaXYy^V0=u*6_qY$c)C>F6U%l05ebrZexogF_ zlUBOVyv&ci*q1%opS{!0wzFcRzPA$3?>yYUz1*+L!24fkUU||NJ<{*}(&xS3^S$2p zy%kZs$T||qmORIYyyBDm;*Y%JpFGGjzT`iC;!i#krM%6q|GZF}J?Epn=XXBnf4&{7 zy;N@&zsEi5&%Nr4y3c<#(Eq*Q$9~|?KJ3#z;MYEv^SZD5EvE+i)>A$3_w@PN_wZ|d z@&7*7BfnR6{Z)MZY;$MmN5AMxKlM+)Q{%gfYoptzKKHM__oIH@LpCho{q2{(?30dK zt99O||J&F;+pIP2o4@-b(q*u4;WOLeH$LQlJpUs;Km@QSP~fkD2MZ!RXprDSg$Wx% zRLF4RLwgh(VssesqD74oGkO%s@nc7lBP*U%nUZD5l`dOuj0sXE!BzwV{0gv>XV0Bv zdbSg2%N|jptvVW1nw05Mr%j(sAN$7T(Cwrtn7Y2U8BTX*l=sXNQ0$on^LN~f1sjC0z|VY|(82@}%rL?YHH47D{rn3t zzyClSQN$8aBvHkUZX#&Cp3eIWF7f0-YONdF|H=`^9mAr~#~* z{L;%i?aVW?&2+kQ$nf+sYA^1pBQ(20yF*mbL!I-nl@=cj;893hX=l=%BE3}7n>5Wd z(oH25Y9~>_1FzFbKTVZVOjq5M(^fN0A^;%NT-4B86J-=vTXUUmRM7$$FTEcJ$_cOb zU`n>8Woc>_I%S)Z^f25MGYo~pQU25NT zH(Ge-l^0uVk=52mbxWo3s3ierGT?!y|2pc-o%G_jE`@p8#N3|(81}PP!gP2Oh99QT z;Zcty*kge~2G~h|&s{ICEN8m6-IQ0Zw&i$PruW{!)C_XY0Mhg^XFBOhQ{s#tKDaKUJX|b;A!Jl6IsSuuVw30{H z$+M-EZl8TFf!4cOIxsQPFD_~@rrWY)EPHIp(9N{2{ zwZutKHaU?`^SnhW4VG$yLg^p}O9doSyaj|D^B_+)*uM}K={&Of3{(Uc!3R>1hBNHV zcNizEAwe#4mh)i`frvRFYA#;>3xEshVzdJy#BV(z$`T_&A)vhNG0QVv^00VCEf#Mk z7+j!_{^qalfhC5^8QfFK=#Vo84u)++qZ`@yMmff@D{c!?plB4nr#!KD%8?#zf;EtK z6i5oc@Sa`tI6g%tl7u7^{}N}66{ak5(PfjY#F2QzhIC;Pc+~u zMTyF$eFtiwX&`BAIKf!TP?m=3nn~y)iC>(DRt`Ie0uQM@3Vl(SKVsall0ZtHj8Hyn ztR*d>SwmUk@HFEA-j8@V#2;!ih(zq>HaAxkBnB@fo9J9Ii`J7?qO&KP_(+x(b{H#a zl6aZ4C(Q0yFE2iiM$t>;KNm?bpC~hU*JLMX1hUS9N(v{R5nWHz7f^ssG)Luo5h zGWDS>l^sQ;of!HV00!WG32+$E7Wx^Krj$Zy8mawo#uEU3)T1@!QUdh_BtQjHlFyW8 zG-vtKh+<@=JVO^t|JQ_6paFq=Q1NL{q54$pP*aQ%>&dKrrYk5z=_ef5nAc|R)r@>qqhHe)SiAyuuva0{InSEd zi~*pp6m_gb!7{S*JOQ>!K6+E#jMmaS_AOp%DG*s>M{u|P@yO;KypJFQY%3Jpp% z=R!51Mir=1)mjW!_@h3GHnFYnOlf_j%ZfO&w#A*TZMn8M*gla++4Lq@xe8scK6i6Q z8Yged%3OX553_OgE@w0A+3zw$iC--0s4hCj$F3K$V=+yI3UsEUVmG_+4N`z?!(RQi zmyMDY&ob%4|F63!FsG?Cuxc?w3Qj3lQVgCIeT_s`b19g?oNDlbTcKd@9hk!i)=Y8; zETo+Z%C5&XE^SSW9QOngt0&xyq=4HKTGd4Y=k?J@8Frp6+zetmqfmNY<6={((1NVd zYl=~vWaR#8E;=L@R@vj$@pc!yQlL9r5 z&5-IzD}b_FHouuC-V0_-<8;-@h!@Lz_A`}NM&7OgiC>$69)I_n=sKQrmp6+sogTfW z&IxTN68_PQA!ccADVo!WcB=XQOIf^Fw!@|NFk{@LX(8>5$B9)nU2I%4vYMLKrw$Bj zJ>yyw|1MWjNS~+Y z(~WLljva3NaZ)mWzOuPDi*A>cw=OmYbzJ=E=}vb#w-F1FEl3e*ac7KQ0rI!+eD~7w z$eZBvhK_$p3^tz#xKBCdXssb`>)`F%tlhGB&&X-(h?^Rxp{2`+9T;sSi#*u9`9^j|n#AUsCk5ps339Z`m z-b2Qm=7{e+$*JAAD4|C^$MW{+rJMR~qaGvcVhH4m$#*hG5pY&+`t6^N`|ys0-LR(6 zyK7W%;Tt@+DHk;CwTGoW9(CYncfRz70{rH!l;JMQc;K-QMdSnR&VY-X6p;9kzF+_C z0%5Xvo^AdaB{fQ4Mlkw<@bPgwYZugwd0Cmsy zaxd=W>-Ao3{>Dw|>_R2Tug`*R0TB=bZ7=FJimp(|uHbF>M3B=^&fy@iOx!6c|MJaP zq=M|W;Q3(ikE9QMoJW$(?*=<8&rT3XUP|c@LJGFvA+lurf&&MQkfsLDs*K6-_^%25 z@2O61O77wTA@K3=0xJ?i^Lm2w`mg<*P=-QpJVx)@N-wKeuiI1)4Oj20YOiK?aP1<) zbuQ}w6)*$suny~`_k6D+m$b0I?AR@pUfB+Tstb ztdHo9@DktW&Ri$~3^9Jb2IIDcVUmEshE53kf(RcD6IIbp&`-qFZ~vaq3u6&$;BVBF z$x=w=Jm9QuWU5H0ut>&fq-^k)tS0{$(Jf>#8N2Xm0FbA0?yB?!{u0mv|LKq#r%}8j zu-t^OvYf|H{6u$bL3T1M!_0#md4dciMq;ESW#(|`u20?W&>A&R9$|(9O)$Xf%IX|( z9}}tGu&^znQR+qwNmx*zHZP50Fd^9@?Jx>(Dr*>5F(N_A(l8?xEfU-cBNaR8;xw`{ z?(FX*G9(cr2?sETV(SZ+5hV?Wn4)8-oF?pGvMDSmI3kKBXHx81@bz@kuVT_H$PQ&v zau!u`s+6m$#!#KgFv`;K44HB%o$@_03IW6FFD^%ET1E~pFdpF%59u)vv&6i9uMhcg zEUU*KlO#3P0xc8qv5sO35t1z7@+_h+5|8p65vdXDC|FDYfoQA;O%Nqgn zJB-C1tmH5gbA7n6FdehuAk+HtuF~>SBrTIMS}{mKuBVi7C_B?oqVNsF4Zn~vC_nQw zccU4dOb(+FS+p`MxpFJJa%M!6;;s=kXHz!O%^s)Djy_Ny6*4$=#0qQktVlC1krPK4 zk_IEGBlq$-@5G4kY&y|II;#^DeL~Z;(>k-UJ1G-8)dM=kGigY&@S5x-g)%)+(>kyu z<(>psX2XJBLq1W1KH<|f>~k*Sb3gHuKj$+(+tL!(Q$0;n*Z{C`3~HE6?esn;O!x;T&NRd<}!%*c0aMa9@K_ApXp)~bs zFGH=g8q=ymUlU8O^fsl8L+@+-Lhvh`jgF4&uNn(Y)wE2{luZe1*!HU4uJA;~XUpD_ zPVp2q3@y}F)D|^TL%lRmFO*(neRNWZr8Fm1D5p+R zHFZ6g^obJmNEQ@ArBqa-v{XrIVVo0C2bJk;p%Z-vF;#U-1yxor2~3H^LrpYSy<*H9 zQdh;N`w#{veKk*0bh7%Cz}9C`71b1hHRY5Qie~Ig|9t6Lmo*}CbP3OsGm~^vO%r48 zPwI$tTOrABh*4b4HOV^l86PK9N3~r`bxJp zPSey)2ez=*)L;qrU_WaCvOg7^VBV7P}FMhPx*CUxwK;^VkfSvT1_oG zD^p|_wLG!)d?GbmFVzd<4k+HMU|3dC4U_1&wPoEeT|tXo-<4G1)m>AB6m;=gEL2}} z6E|^!%{KOEJ=R_?Ne@K~VE?6JDR%5=vTE52qOjIi=Tb#CEqw}%T5mL2O*Z13Q*6ic zS{W!?c@$^e*8fbzQg0Sh{c3J!w*6F-NujX-|2cM6`_^gWv1tF+X!*=BVs&s4muXpo zH;ZIX$8>9{HgX|%a`$UFF}69;Hgn5Xb2<0?3^Uhs^uJd2TVvpQw=>JMbl>*G zbhf#8_Gfz*Xnl4nLDFv(7jU()X$f~}%?)ZbbGg)ua*0=RjkkC`rfZG$YyCtcXPLQc{gznw|vppciH!RyE0#Tv(Th= zc#pS!k=K6lS7a`>Pcv3}{dao*H-K^Ua|thHMVEW;R(riyffE>k7v*&o4k>*i+h(_d zW%q(>mv%MSf-{(dH(0uWw=R7``snw5|4lf5QTT*EjV>eDE-A5jOICno7=US5hMNY4 zb(E*tc7YwZhk5vi8+d`iS6x|?Z`JpR(>ICR7k8D|eVdqxVH17{Egx|;g{@eHulR~B zmwz$0hP`-(!T5_GA_;?+WJcGAgE);Dc#Y9GNp-e7RtnofyckdJqZsqZdv_-w^Ej2*d=U-X9WF>2Tr7S*_oF&T*2Sd;m0h?TI2 z$JczJ*ol{ze4p5qOIegrS<0l?1FNoz3pthzS(cG=i@&yiA^DMYIhU)Ij6-*7GWn7@ zd63Xj1+O6?guK)A8uJ`(`_4=>*8nFF3unBvx4ZE)qTd>WguoIiH z6}v88g;gXQR31C67c>2`HJ(d)vo*W3#nngb*|r2_HTRhtqj8x{JGD`JwV_P4Tbs2{ z`?X~|wrSh7Ya6z0JGXIrw`W_odz-g!`?rNVxNo}yiQBi28@Nq|IEy93l6$!0ccHy{ zy2F~ft-HFh`?|F|ySaP2y}P@?+o*40zTS+4zq=t_&rcunw4IwpGj_e z%f0-$!5q28yvxI!%*Xu8&%Dgh+|1d0&E5PaL(>&jD$UazMuhsj!#mIMe9!f~&-wh% z!#j5bU33V2&<(xN5&h5=J<$ohlLl(hA)V2YS`uB@X<#@qyYaLy9WOEcFg5+tD{Iq5 z9n?o{)I*)rGyT+6z0^_N(^oy!S^d>rJ=SR*)@^;(Z@trXozr=}Gl;V|1Hcu`iobLC z$c?-(BA0o!#kO#Ob0ILWd{xJy>_5-!1FW;ifMMe&7e5!-YLq zzg^&q1X(DiSfcwk0e#~Ayy7YT;w?VolN{J%7@ihte{Z?L4}9c9T);{G!%sfLQ{LoD zUgTRI!&x5XUmnC|zUEba<_}!LJCJ!A!WZg+_9o5}gWlYQzUYbG7H)yVFJd#sy-Jf_ zAjTW&IUMN^;^~pzX$aUAw|(oSo!h;h>#_aoyB_SdeeBIX?8&~`%O35a-Curv{x~x3 zLTTvB#3Y{x%l{=D5PshWLfDl)>J=jDAD{FkA6?ivnNg^y2Sv%LT8Ci+-U4oj=#9fBLIG z`mf*kxBvNBbfbpR=Q%?B5&s`@;>A2Z?z_bne4&$?NB!qs?q3Z32_p3EU+SU0>O;Tk z)1TM@B7new1Ov4DWzSXsTL~Ms5=e?6LWK+~CS2Ii;;(jO>;;IJF(XEc6dO()DU#&H zimh6$4F4(7S(V$0%K5aU6>D8oL=M@WAp+|*Z zWjj9G_SaW}hyx3>J$B)5vRr!;EL*lWa)GV{x(m?!xyR=Uqk5cu>pJh(UC9u%ZqckQ zy9uLGg?(M(-H@=UmPCkNK4Z5Kbszg%n;`Ay^u2$f1U3S>~BQ6RaoDEd_~XB8NkHh?!lESqGOCbIrwDLUnE8 z9bi%Qw}ljK1qT?7t=MNDL3RyD3XWD)^`B>CY*HkRe+|^i7Lg^E7iE2E85fsXe&(fE zVG76Bm}Y{BW|?Vjxn`GbeyL`hZ1UyHm$wmTT>$me+2KH25%lA5fMNxlKrUXy)sz~R z5das+-9lZ8$YIu%S~TJH&`G|vQC2HtB;gWWz7;u;U1ZF~kU(Ty>5@$!_14Cf@<|qe z1T(74X{?%S9dGP0$0CPJGRP)>JXmkN)iRKAy-Kxh zXQNO#P@uN(nOu`6x+^iE0Z`|dLO@q#o6c8G)lP%?(JE?@%K?e&RH>SqbXBd|^GhpI z9E7UH;u&U7j#MGMkwN2i#8(2MQhB7c7`|;`+;Gn=cinW~?Gwgbxoj>$Ec1+2%mhhL zN&r)EWnPMazq=y61c~jRW0*dC^oI}GBW^)uMJBjpwkWD~!3PJ2*pPD}6#pVYrwf#X zabZh=df%uQIBCX;^>sUzi+z@RUcHO;yX3g@PWu-e<$PWurII&!*HhL0{_0*%YfRkg`|EmbWsV@pQ)otDHzm7PQwLs$uz@?_GKV@X?JRMnYRwHVk*P*+2Y=Xl@0nya6;k=AUD)Fw8$xPF_D;hYJ@tXVGkn%=}%PJVjeN2 zM>}SG%j>e4LE@OvV8oeE?hzpiYswR#`qWt~Bd9IEbAN3N>;SSajj-et6SNs*0#b`P*uF+KDixpwRyd1I7ejhSkgyh{YQC&2gLVQp%vyG{!0aq% zKkM1hl0MqKPB#Mta4)BV{yyqoPw#+l*n1Yu(+rrj)ubpjgWBXg)3QxGW z-7Rg2Yuw--ce%=K?r@p=T<6}dJ?vB&^%inNHZopBZ)Nk z{dB49U9WqM%G9GaRjKcN>U{4j-~7gRzwG6%fB&mha<#&%sVbsYvg@`Os4r}!x^@tLjU?<3ojOY-UXkEXx3eYZZ~yPndB%%3uDmAIL0)d zv5jlY%Y{T0z&!48Rz9f{776rB`y}#^^Ept12DG3{R&tV?4CN-Hf!+O>euC;`3Eo)ondLs;JXkL7=&h-ErK3KEIu#1h5V-s81 z#b$Q0k=<-)KbzRoHlv9Ya_uZh`##8CnwB677S-N(+&Ct;xyz02bKm&I>P|O=ZUXF7 zH6-5SRGN^B>)Yt+8{fd)cXIumZ+;^;;QtmlbPX=uf-9Wh4DWaFv=lw=1T^B*|^IZ!)=tTFq(Sd&Sp(nlQ=)H=#-T&S0s6&0~Qm;DIuWof2Z^(?d`}RD$PFt@B z6zsnhJ3q-TJhQ7k>})T4+tdDbw9EbLbRT=&&wlr{yM6C)=lk644tTr=UQ2`zIX?>@ zP{beJ@QQCd;~$@R$S;26V7X2D`OJ?#^`JLB z>r1bC*L(i;sGq&@(t$v<{Mx7 z$dA7Dr+;}wfd$NQMzi<35B~3qKm6n$zxm6L{`0Fp{p?@A``Zuy_sc*2^q;@|>yQ8Y z>p%bW-;lki=wksWfCET?1!#Z=h*y9KsDKN|fDPz?4+wz~D1j45ffZ|0fPcDgEu9EHz*Y~sDn6I5IdNI zJlGWh0RSQS1O*BJ0st&V01p7i0qp?*2>$>D2pmYTpuvLz$Q)E?kYPcG1R)NTD3D^p zg%}%Ve7G@U$B7>+hP$Lhy0z=quw%=fO}n;jw3`m*Hn_WBZ-T!E1{XM7K=I?clk-;Yn>ldj z!l4tFZk#&u<=C5Nf4)6>_vzoOhyTB>y*zjG-qC|sFP?qz+wkMdpHIKO{rmXy>sM+q zYyT|=0cenb1rbP)fde5Zkb(j*=wN^l4j5s96CPM$f)_5BVS^h!DB*_`f@q7|xnW+`TuVUjuKmuHrVrkQL?>86qfNpfRF?;&;9TzIyE zCuDc>=_h7=0{SOtff71sp@<%;sGy7*+GwJWF6!u{kWwmXrI=o-X{4N5+G(brZffaf zNA=dqK<%KaYO1UX(CVwM#{UZItg_Zh>#ertitDbr_R8z8z6J|yJGKavsJvdTisY^&2&`|P%=X3MR&-D(@|x8j0pZn@}^tM0hbQah}$>FSwYQ2?GQ zz^Sd|d+)ya;>#~7{^AQTzxNItu)+TZT(H7=GK{dm4o6II!xKNeaK#cIoN>Y!cYH6t z`u6)V$Rv+!vdAchta8aH8|?DN5O=Jx%pA{bbImx%e6!9uUmWntCx>h?#XI}V@x93^ z)k-@g_v`f2P)9BG)Kph(_0?Est@YMicRe-J`GUQ4zhak7_Ss>h?e*Ghx9#@ZRGXbP z+*vP0hQ0RgD^T8i6aT!o-xCj{@ZbItu6N*u_gy&Rj1S&8;EqQQ`Q(dBUb*0y6aKQ# zn-ksn=Q@MVdFZ5%Zo22Cqkg*Rs<+Pi>!}}Zx$KjFjCsEd9yIpcyZ0`)?`r=peDK8c zKD_b81CRXj$~S+!^T|Iiee~2b|Gd-FTVFl&+IP?W_t}HLefZ=Tuk_wPr_6Ht?62>B z(C@1c|NQdT-#-2K+aG`a{O|8S{{Pb-00$_*0``x92Q**+6Ue{?{%CvmzSJh(zmI5|KExCc^B9P+VdZooF&5O6G}DB-#-5HpIE)?mz%5 zpZCNlzA=vPjAl$@8Q1u{k&*F@Xe61~+^D`es*R2-vm@{DD91YbF^_-jBOnLK#yE;m zX%0kSA{D5}Ml$k|4RmBA8RoNm0jzzOWSQOomPtu!@{=dy7Z5>-GEp*Yl%XUgDod%# zQ@V0ulZ@p9lafgh+VYmTye0bbCLRfdjUa9KB>)m2kR*I;3ji1y)aH`QW;&B?Op7K3 zPl&xQA_R*!lwl3GnN1sNvzy%frZ@xF3IIq!Am{v;Lv%Hp1s@{?kJ!%Ri=Ns2abQZse=9F2++M)f&OnGTKU${rduh)z_ZO~a@~GkVdE za`dAc4QWM33bl=LFmv}5fH60bFDWD;0me+#serJBXGtMxOCv*WE=h)$8ViFYeVRy1 z8dQoB^{7HEsz#OS(V_aT4arQV;GlLw5-LVs_o`~XtU1+I(u|4N4C_~?DAuB7k&0$T zD?VR|GO5B8eRoNxIj^`Lf*dQD3;}`!w$KV=5{Ip(ge73T`m@2N^02H#>?#*)SpCh# zm|IW?F$*hLSPHak)bg324XtRYR*;7p$DY-Zf<1$|G*t0Yo~I&aPc_p9 z0ska`rK8R5+BWJn0Z70e07TBrzHQQp0sjp-z#GX>f8`uP5-Mc~NS^G-BX8|~11OJ!6ANH_-0Sv$2 zb+~NkG!|+>+`PJ=_P)wX?mg35*0qlHtThJfjn%4S8t*t`>67X}&e;lv@UpM#?agKd z^w_*vI01K~q?F0}<0||3$~G=sUErC_RSs=sTej^L(VD)wB=cFDEt!3F%jPyav;WJj zXoFwH!^^w;@~2MQ4H?ooRX)4<&r_RoS9^=vL3gb|(X3b8AXwh#p4ZXng|ws_%{o&i z!LwVmmxUS3LyAd&rF3nDf&6?gK2!S9r;c>z_GJrVwW8IB zP+E?d#T`a4fP;PDVux7Rz#g`;m**<7H5!UcrtOTX?TKzX+uRN} zxW}!sZa3{?85|jFL1u1~vYWI(jao2cRYJ6Fp-$I*be8wsV}4T^%l!`czx|z9_Abnl z5KFUS8`e1$Ru#=F$VX1{lADmxsQ*s6s#QK| zmZ!SqD~~zMXa4e^luaW=tEDs(UtD)rk~sCe1xMK zrT%ohl{;v=v>n#Bo^7sQz3X8A`uDOvM4>x$=}YgR+DjPEq&OUPoXl~==RR?W*PY-Q zzq`bTM$W!Z`R{%YJmB?C_q-ck?pYK(-VuNJf34Z%kdM6NCr^3ZRtqUK$9d*uZgb9S zzVn+8J?KaO`O;?RDOV-S@lK`tOAw zeBA^8_{2xP@srQ|YF-t^!1KL7W_PyX?n|K?uQ zdF9v7{`R~7{Tob5fA&NF`rH5hTA_8d_s=T+Kl}gD1c3e*fCM;z2H1ZHD1ZrAfD3ql z3iyBw2!Re5ffP7_7TACoD1jMRfg5;%8u)=62!b9Mf+RSCCfI=}D1r@wZ+qivutsaT z_JT6#f;1R|H3)+^ID|)3c!p}2hHSWoZrFx!_=a*AhjciH zc36kBVh=KwFEKc4efWp7hBSVNFMueBeQ1b*IEcE2h>NI*g#S2*jQEI$=!lV6iIjMW zg@}oesEL!9iJrKLpV*0@IEtcJiisGCr$~yaXo`)9imj-MugHp$xQetGi?uk5wwQ~! zxQm9khwWl5+VYF*axTM|F5_~H#E6W>n2gN0jLuk$(5Q^j*o@QojM8|G)QFANn2p@H zjow&|;HZsC5?-ElQk)m5&ub(IcbwSiIW$3lP$@UKiQK( z>61D+lt_7$N|}U;sFA?PEd=<6)g~)bxqwnRD^&@AREd>vn3Yj^l62^mV#$@ZGL~ft zmcn9|ucDS)d6sUumShQ+Z`qb|S(kKqmkBs6r*dycu{1##cYwJ=feD!MLYR3nm<(5# ziFud|Czy?Cn2vc+kU5!)8JUWSn3(yPl}VYIDVdx3nVor=ni-mm>6xTynWZV3ra79d zxtgx2ny{IgvWc3s$(gMgo3#m=4da7Oi7mVZf4~`>!a1B4)GK;O6zi0V26s6D6-3S{ zUeB3QTm+reiBi?soYxth?4)MViJjJ&Qo0A8R{tlS7DpVpZD3FmlTV>2reE}NK1UjGwDxe5TbqZRb3Cf@gdY}*5pb$Df z!Ssvc_?HhPOO0f7Gp3=CG@d%7p&UA*ob{gV38EgFqH1QM@(G_N`k|f_qcA$7DmpS@ zl#vJl5wvD2>lSZMgKa7Hv596UzD7$xSaHvi1`Vf+cv3|+OPY0DvL;{ zj~cM^*@(XCqJp@vbSg@Fs-FVOoP$WPjtZV!q^E^*vGFOf9&4Wh8?qmJpPbr@o(iC6 zG!PPSPUVAVuUbaJ@v_qsfLqW8aQ~EIW)w|iz*nwHMnfhAQHDO@10490J=M{wtD3Y( zYdsa3Ef<=Dw%V(r)*uGbtcp`F9XeIhdadlV1*(+Gyf#v$n> z1$MSeQZR2@z*p7rw)qLMyt+OHk_2S%EbDo;-g#*ZvPGOBYPm7BAu6`k$E?)axLn&m z*(!tEDmb4iE8YsG{jv$Z)LMvUq*)bUPRc>(`ZNL}GCb?KX9H2<3OvWsx0stYE<0hk zWiQdzFLQxg0uW(cTCQG-HGgv~w2Ly)R9np!Ha+FKzLiNRHZ3*PyXZ!yqx-sLD!tLW zu7qf>llw7jO0kMlWZL#O>Hp+e%%rmEXD@{|5J@mxev_#HyRo1#AlNlz^#T!CJ7o97 zXAxny74d56WKU6MS}AoGbc^xdbwIozbH+Mw1;dwvHz+pX55#x>OiLgwj#q|QV_n=kuQ`?Amd949BdqOvAKCWtuv-l zN7hqEwo7~~YJ9s1MurdwY{Z+8EWBh3ME1S~;b)z^37@QKr&7ya`?i@iFcxMRn06{X zl%iX($^z03>0~MlK?><~b;4l_0K&?MXsp4YnBsk0r9zom+Qqab`(Y(eh05)3@ z?J!*W@>{vfxzDCAG6l}|J6vnrT4}5*EQMz3mJsdmV7qjs<4Q~`hAN6C#ykwtXYlw1FH@{$Nq$X;#TUxp{L>7j>>Eu_opj}~` zyo>m@b^5W0J8Sw<%_B2g&@33xS1dbAZ?>! z|0ym3YGO>x8FkUOxw}JK0Llza({ko2rR}1p`pmTjPjw+LJKZk|d|Dq9+nD3nOMJL} zT-p3b94%)gv{zUGU?_JY6PRWRzC)K(qZHmukjB5279Nhz&PdxO>Xq-YCLc37Qa z_tH}maA_qX#)o6KmgHB-d^kza+JI`#j$6)P=9k*4rj!dS3eBY@#Y|%pZLC$hA^OJ? zjW^X>qy@84Jz9N49^SJjeZK@_QsdIb{MZ!sf?51Qp%D~s0 z$@&f?b66bLE|zQwf4O)t{?!* z-t5f&?5E=AGM=Fh8?DvOvDkj?kLtJ9S>Ym@?FJj}n$F15s;e;$Hj#-7eL{=4k# z(^vEBx(@6*u16$IT*1zuBa}Swo>V}6uWL%wms1O@a4NN+F9dJ!2w(65aPS7t@B*>y z0_*S%&+rtV@C|?0APer+F76!v@!B4-lYO5c@9`nu@eC~41H1AfJMsZl*)e$8-2dX{ zY)&?pyXNzr^YXs)`A+XT-}65Yp-p?HA z-}Fg;^;#cTjD+$f@AW7D_27=~CSUeoU-o35_Ku6rF{sWviY-4LHSEv|b6@v#fA@Bu z_jteedf)ea|Mz-d^MXIUG*9?%KKMAF_|UufyKDG}&-h*5_=+$2j34K%GUqT+=YDwS z&#namkO=~y36UTWqEGsxANr?X`lxUEtiSrMullf``jG(ong9vo&=&63{rM~;7 z{`yC;ZO@a@AL5=^z=Xf_7C(szsSbDhmRb008y%y00EE+ z3W#(tp}~a+6+UDL(P2c26D=AvC_o&$R-`(9^cWK4NRcH;o-~;fCUNNx1K#Z_U+oMcL)DnJooY5$)7i$K0NyM z>dUu>|6V@(`R?i8cMf-TYg?sF|7R^W(Fk(N9)g^cO*VIQbIu-H7Ie_I2N{$Q!UiXd zkUi+OEDER5KLRv z6q8Ic*`!h^INwxrPT1^}vraw5#B-P(b@cbpOyh70uI7LJws$P)HqJ zl+s2g#q?24E6tQsH>Y${#Q#uBt*EC!YXd}8LtM30R$p~BR#<11wN_ehwKZ2bSKpTr!&*S50!O zEB8!u*HyP&K+nZ4-FMlY*Ijw8djDywp}uBJ0i7jrV`blVJ8rn=mb-4c@3uQ{y!Y0d*s9om7Huh83$WTtvHdo2?7(GQ z@o?iqukpnlM|^V2y}i70%s1D(b8S8E7W6Mgmz?v@PY)gS(N!;`jYGhO^qi>?JUSQE-9i)jjR<^W9N{=eIo6SmbEMw> zNCPG84Q@YFdQH_5WhqH*>QaU*q^A^l$VDcSk&kp_BnR0kNKO)wmTV*@D;X(GN|KYG zBxEN=2}(+Ok~+349PaK1pz7stDg-*>5{)>^B*xN~w3KBnad}H!_HtF!+gaVlt7r%rPpnnan)qGo=|#YBr6StN+a38rfz?Zr-t*-}GiU!8y(XIx#eRY+$G$ zSUVNAQ-d+|AUsd_&K1hjh4zGDJ@x6%cI4HpRJ9a`u#`KlN!)fvTIou@RjjWhLRr6iC`NwRNz|98^s=yQfk$c22!&Rk0dX zt8#U#Q~j#zysA~QX4R}?Ju6ttIyqGG$7V>?-IEA35RBGUqjs$*UN^c|z4rC4ECZ%o z{{vU1O!1{MMeJb}8`H(kG_j0@tp8)dr@f?M^FLC^>BNRARL*YJvz-O)XK__jwxKh3 z3Vfi>2Aa>+;?uPS4QOl$+FIDo_Mf*kXl`Z8THNmTwX_|R0~0FDoC@}@c|9&)lj~RH zHdndMWiE<3THKoTk+38+Y-ArRS?xA54_+6BRH%KesF^!%-?gxrG^hP z&3#+>6uK_g!_fWkb446o5{J0N)0!Sk!w3O7=;Xo65(1H&1 zpVg*lLnr#sjb8Ml5gqA5Pa4vfwsfW$t!YVb+S7w>*l+X9+dY$dU}aOMDnrUjZ5kKE zucl>(AL>vS&3cC^vNbGmU29(N+Se+|HE4Pb>|xXT*TyFHv2UGhW>>{PCWf{Ur`zi4 zHZZ$P7O!Jrnco&;+r`=DBA~xL?)EwPY)BbJ?%2q?DpT2&+uYxiCKhjcvr*m*g}1%y zoo{~6Ti^fgH@^KH@c(xY+~5LtmXq2o=VsNHxNExIe*HV)iA&hx58m1BQoV66@yB5j zOYNOS-f@sCmEX2;J*3OR+-nn>3S>yW3P`D!0{M zLx-Im+;1PRYRnGza@#a}La9f*7arfD_kDkU2mId!A9%tKe#-YQeBuqSc+E2Y?+TCe zX6MYn)3zOgeFpBRMO|v=WIUA`zwm`W|3{~oT;{F#Md_cMpE#8~^%6^yxOvx#O*kp` zAa{_sM%S|k7HJFW}1XoE+M2`uXo zyKA$;4$LAv3q7HDL4_;|dys+xBo$KF#a57lO{fjlfHP*HM&3&TQuxDx*hkgUI4RIU zZ6t`=Fv;-SwxqBj`qM`Tl)*=2KtU@#Kx>5)Yzn$kMnxk_D^aadX_hABJ+X8-x#P*X z6CW%TLhIu~XGs-J^r^y2koJ>`5EOs};K32G2SY5TM;yV`2&6!hfT`HUK0-r!3=L}( zfHnxUL5#?Nyh!|8Om@2-VS|=Ie75_0%mc}x7EB5UVGhYuF{MO3^_wg1qs`Qq82?f! zjm#XpOpLs5n!M5Q#3%zjrgA>cgTBqfyj0weR@g;b5Xy&%&79GhCmBRng3CzTf?se% zD2h!1m?5!bKYz(#@q0QL(hg`64L z@Wwz>vAk48r;NS_l}y*ibcFK@9WZ{qQEc}84G+OD7Cgwtim*vpZ_aS8>2vq zeVk0BU{Us4$N+IkZM;F**o1oo&uzmUx(q48;XQ2hzieDckLbVp915g_N;&z37hJzU zeZ^gLPx&NJ3e}mWupfIAHj#3}_FPO&eak;vJ_=RSzN|Z+S+OnDspAAHgquCnz|t+r z(!N8!5RHp{E4toH%}a#UUK3`cO)nJq|yu?*FOT+dY#vh zi&sfgDt`6Xe66&A-Pd`oA8yS#a@0AmVm=at7z~Z8wQ~Fne-&B<4cgK>w9%+E%j>^Gb5o*C+Me3co~E z_W?{BN)=XHx59K)aDv%(a0`+3)dkvEl!aTzquaN&+mkg}xz*de6PBb>H@dUtgswCMw@J8eHPSR(CPjazw|2wYZOMmCT}9BzXb-eFScVI0;O9`@lO2I3<2;UNBDBW7YG7Gft}VkmCn zC#K>kuHq@S;w;AEEtcXgzG5g&715N<8n)RM!CA2rL;te#-ZefcI03~=d1F&5rBMnc zQo1BN&Llj(ls>^4K5pLb{S;MYifr0d`c2#VMdU+PGL ztz^=DK1{ykP4;BO{bWiuwHXqwENr0jQ_qVmV=^w@RW@E%hUE}L-j5<&DbYzl{^MK@ zTU_2{U1npYnG?HHH}WIj7-8f^M&@Hy=E%zt)j^!GjHsi`kHRk1C z?&W|6=z;#{f_@rdw!T7^u4HEDWp?O>1}%@GJpVh3W~C8jOU7tT2IY;uXpQb@PR?kM z_UKGbTv7(T6+>lZt7m+^=aqKpe12(-n&mwtu3PqHgBEC1hgPLC!#h?ih%E z=%Oa-qYkHLE-iR2WeDnHZH8)fuI6*5>UBovskZ8>#_Fx!=Bw^%t^Vq)7Hh61rFN#* zD0<3x=CGJ%>9%I;w}$Ds2CT3{V?WIjp4I8R?&+P*>AlwL?g3vd6l$a2OZMnJMbYi<=LfGOqNB`~L6z*2!R^j7T zZsuO@=az01rfvvZ*wABYW(>N~=5EyX?$ZWu(|(aN7AB;!>DjjJ^p5S?UT>YoZFSS_ z-j?s*rtkS~WIbZ)J9Ey-wrtAAZ2#8m|L*Sr=kEgF>;s3V>1#W*2JJBX?z)=E2k-9i zo^bI_ZK7Ij9&z?2appj1__jCu4wkCu;fs8g2d?iK@1Hhe zaasxP<@Gq?cJAu#apNwErmWLdd8qiT527iL=1y)OUveNAD8kde;^jduu}#) zgrsn3`z53>kOhp5UvLoHxm6gkVUxqKl?#4ZAmgt>5@XfltU-BbVmOYN2hd2hxAFebVL8KIY+Gb zPH4TOaa;LA1F;9xcs7!3zfw<;KXggnkx&21)0FO>=Y0BNS z2R}zDLX1z-#Kj17N5J3-K7wKouY-k5?X(wtK&)1(i&9bnjsoXZLq^_jq4-d2jc5xA%I-cX+>deb0A#=l6g2_kiDbf$#T$ zH+Xy}-Zn3yna02dV&=Nl>Pgn6) zrS(|(_R%P&1n|WGJrS5xL*2mPqF}{X$N3PM-<)ri9KRvrTPi1yZYI|%)We=;UCQS` zzSl%OHhc~Qq{l(S527D>p@;6PpYG3@k|(eFDF>J9?m2ecIyYbVRw-LBkC3nAy~4D^ z46({PEDE((_-$|NonLb!f^)HxbCQ=I7;{Q7XZbuyMwU;I++Y)Xc+E9o_DARY6L(&x zYr<6!A|)Yf6Aezl{TW0%jfwt{CrjMdB*-YT^Dcz41)wuwBy*x361lSyIAvNf7j=Wl-Xi+<)$ zep;o-=a>HK$A0R+{^_@V=+}Pl-~R8<{_YR|^EdzW2Y>Z1|Mho&3lsnN*M8y;5n#GN z*4A;?j`&BZux|tiTdf2V9B7bWyH)}UGCb(8A;gCgBT}4bu_DHc8Z&a-=&>Wnj|UTq z1li6O%99IE4rFP|B}{}eTh4r0GbYWPHU+f8X-fdmphAZVXjk;8(S=HXGF|GlDb%M@ zqf(tZRpq~|TDNlT>h&wwuwuuOEo=5H+O%rdvTe&&z`v?;t;BxUoY%KyVV6(>f#*l}aUDRDD z-QN9|R`6NHZx0W&{P^$Y$FE24oqc-v@7;5kU!T7E`1tMTpHKe&fBga2UV!`=xF3QA zCP*NI`YHHegZ{zAlSX(i~nK1I3}1om8cU@BNDY2Qb*zSrd@HuxzcgkX*r=*cy?!}b~2W?r=EH8=_j6q z_Q@xpgCZ(up^F-tXrqBX%IKkzI(n(4nJTJjq?>x$DX5ixDr%^3EjFi|siLZsUTqrn zmuQ3aCV*j)(KOkuWXhInOt{9z>rAg{=9#d?8hb3V$tt^Amc=R*o3FP1I<2(T?y8tx zIt>&YXf3(j35;_>+fa|*JAG-p|dmx1GwhOPl^DdY#z47+T@4om7 zd@sTJD##PL=b9_-!sIgbp|?pXw1t|SojK--x{6sQ$6vZgij{ZLII@%^6I(LMA(O0f z%Ksv_yt2zI%N#S!Fx&hx&NJVvbIvuRY$wk_-}&su9v6MI#=25iQ)zwmwW_L7qnd7@ zc!C$`)qG|R7kF8Ft=-pLgFUv`W&e40*l3fjw%KXBz4qH}!#%g$b+dhU+<4Qix7AuN zy7k(D5(G8jQqR?@(|&Pl@k52>_Bd_2MaJ7~l~aCPvL`RQIp>{w{`qFj3j6HjyO~}( z>b0GIt#1%5zS(f!Ce$$P3fs=GbLn!&b$3?x4)*W7x2+!U>=lnT@$eq+b@Br)54`cp zOYi*j&08Nm_1RyKJoei&-#z%;YaRT2zNa@~?6|9+@cIoyjIM|z`jm0UNY|gVivJ7M z`E%8a2C8HK0_eX13b23#JfHy+h`^hAlr2(PFQ*n8r13 zP>mb>MYbR^nurCZIL)b0`)(nPdgM!Lc z2DPr`YGv%~I7eAFla?B+rT*Lsx?fHyiGJy2&~~XZFuJCrDz(x_g}E}v0#I}36zsB; z+1F+M^{<*`4y|DK!NfJOv{5VSP(GR(kxogetPLqSrRtimF)ymKC8^qC>m9J}_HXB@ zA>h(_+jjy_WHpQ{KA9>cnB8+q!vQFC=j6)15R`FaQiwtw1FY>*>x$k*;|4LyIU6|^ zNxsxlWtS@y#`-9|K}jh`-}~Ol(pRxFg0Dr7sT$I?k&WENq8tDF6FB0OA#)sU9fg7} zyQ;Fm7}F_+;E1iG*<^Rc&JNx-_u|T6rKu2O`oM7XZ7Dr^JZ-~$POZ*Pji=UnHW{dXB&u(U#az(H;O{?d+ zpjNf0K{1J2d#8`mh|v6u?I17g!xzhzxHUSijr~U4twnm$SQQ&vv+|kYk}c7Kwvmom z2x=dNTDi#;-E;S>YN!Y_an)_IL2*eFg|>)twqBj&RF}HRaE=sP*g};@^V&9?MzyU< zjh|OzXk~+TAxzdxvX?rnUjTbeWY|QVeu3?w*g^`naQ}_3F{j_u45Xnlt?9YDlx}m= z^ri>Z=}?}1=Mepr$aKB8?X>yY%Z_ss5+DT`q(FvIGqn|l>5Rd@-R*BvNvl8Vwh5Vg z)JRH|DA5+ov$_q2fh0tD696EE zXDAl%;7t6}LK?D>?M>wO(YrKHjxy5Yd|hRQ8#yc|jjx*xa-LKhHQcHCVJ+V9VbzGd zo0+;$z#f`kNTJIAXoVC;1D;lFLEFJ;2iB#z1u_8JKqS9ljud6zoxtO=g@4y^3sPvq z*`)v;h>x4xaPI8kdqwAg&U+tHlXA3xgIVlp5gyWB%6lj0`7Cz%`uzR0Iw!pan zD3*Sp>>TF;KhL#&e(Is5dh-5v$`eu7>u83o6a*Ckn16K_cnMgva8AI{-R`g*$gmxD z@txfng|F$=)Ir}C2!s^yl=o3xu!Wl~_?tp(0aJBK@`|Q9N5!oj zCP=~G{X@WI3+DmiCNNyton0Yj#-{P1!hPY(1zsCC;TG5k5XQwJlAfus940P=`W*+` zbs|vQp8#-QASOf-OcTs;2gC_L8>F3;z#LGtBI8ZsW09g1xCROeKq;c#3t|^wl;BU~ zUtA>OKlqv@P7KKW#c?>Fp^aSriQZq>pF(g4ET&iKLqM6eZ$B6^11l_2NUAFbF~{Q3VPQDh%rWJdle;jgvdI6YlGlHE^aMhYfD zjldx0{lgfJVgBu1Kav5+09;UnpxD91)QO!z+DJamop#9L-l5>Hfec5spRWNQiBw&; z<)B!dqAuRwKhWHHHDXbC+qL~e-nAd_6&`B5SvvM)i7IrZh|TTAtPEz8+71uYzOyUWuEXB=n)0!T}|29118eQBc9#-9ip}k+$g>v z{GH6TF$Gl?;y5AVPn=&?7^77Mh2R0=;!I*qa+Jman=95NA>v(fL?cB?0Qc1(AsSEX z*&kn+X5lW^jue+C+BY8su1xX+{p@a1QYW9M!=E4whuj z;T#2y49FP8USvi7T_z4{+CQM6^qFA%9iKu5$FH5l3I?1FvK&t0Bo=xf4f^6P0b4OX zmPM*mKEfT&ebme82wsBWB;qC8ag^Wf-ooifGR~$}DB-uYpQeSNJxDT;&+{P(Oxjodn2`EjeTY<70y7dN5A(RTnn_&2qanvC<2Av(c7E8@nD{O!t zZky@(UD{FOi}p_EFslVnv^p$2Lp<%n4+7K{n%qXN@;jg^T_>Mq?WvCybr?4_dil7xB2rumt- zEvjdD>Y8opnzf>%+5(}ThYD_|rJhuw*62G4=BN5nJ+axb@T8yesp9!W*a^krR8!=w z8nTuU*U2fzm6K(PlUhw0qoLDn371-tm6O7YwQ>b-L91nU>TdxLIi&}1^%n047pU48 zjhf!>Z7ZgE6^(*b$-Vz8c@)JETIQW1S`C?1wT6dRUD&=_D6`IKXZ~LR9>uE>ptc;~ zcdcQ=CLjVL#OA1(FIB8{s;Zw!s+rO1nn6~onrfmF*2g+3n8jDcHkOP?s(p1VnAz7z zwWGzJte6SP%BE-sDypH%?8t^J&bq7_E}$Ah?8Ej~O~lbdlwnWBp&d;q)7DN=Wh2z$ z;iFC1w?3=Y9#+*N>bWA%xT2g@b*;5h?Y0)uRAFnUDk9i!8gPlNSE;Lyp+}8w)t*@D zShele?yJ{c)uaBAw|;HjPSrcbtJwZl%t%t8MeP#VX`QkXCr%fM#9zgb=MY?+;m=`I(}cCMj9B}lCo%7$3yRte~W#>F{H;sLA2 z0OjDs%20+-vaT9ZB3F-b?#|egZ0T0nOshEEEmrZ?j8Iy+9`C=>R&SZp^oHwM2@mr0 zjZ-=A*(9%NB&DfkW>5XDQ6B88AZ`4~RpY$hY2Mndy>DvHhIn<3_%?}7*6%h6tTAm) zfJRh;2C#t&FoF)S0Sm-}!rQQxuk2t>(<*Mh?a#mxukbe4vKf*lQ5-ud386_?V5pYE z-D+!?Xvk2QJP{nwkgb%QaFL*JT=ksgNy#=Y?gM)Wh~#N3?P=xSF4C-{{*DHImDjRX z7+3Kav}yk?5epj-|L|(~s^#)<6)oO4P9!x!9#NVv@cQuh#xVbK@fOD^`GT<*i!T{h zuo#~)|1uXEe^dWqade@t;>60rDiqL0EE)=J12VB5?=c_mFM!tZ(B3i83RoLXg!)#o z(kd7YFLDHP*x}-#g{_$3PV$dIvL!zA zJ0JhB(K6^xJ!sJtRSoBJb?DnPf0Icib3a3~F)y<-7qmbFG(qnZ3?p>nvN9vD51#5( z4(kMz?QktG-8pBpMsGA}^zubd88CxZ;~_E#UGtt*9zzdwG#hk4w{$|g^hzHzH5>0t zTXVtc85}39V9asQ4suTm@_%u(P!Bcc`Y#|KwZj5(A-j$TCGtb-vxPv|CX+G>Q?*r3 zHCA_WC||W!mvUBvvR8MtC~q~6oHAK=wJJOGDzlp7hGXOog)HkZEn9Rgp~Nk#MmiI< zUhi@3vW7>~^<0~Yu<~x=T=7jyUhwW1|MbuhtF&XMG-TIwWV7^3GwTpFvrU^cHs$~H zHnT5bxNkVauda=Du9fy__OFr@uWI+qY70$k`;2R|wrs~XZNs*07jLrs?@PgRI~TBT z$FpzGvjQ`oJvZ=EA2)~SPTP`|gp^hFj+k>>D|9zEbpwcvO}BMN_jQwNbz`@8b9Z)k zH+X;dbC0)qmp6J#_j#*#dT)1oYd3snMp{EPD@XKcOm1NNvd6H5Z9leT|2JjFG)((< zfD^b(7dVytb$;V+NG~v&k~C=@_DQ#b>Q(riUbuy;9w%b>!*KY9Tlj}xc!+B_hm&}Q zcQ}ZbIEst7ijVk;o4AL!xQw5;i`V#!$2g7Oc#7vZkK?$H@A!|ic#i|Q=1KqfmSZ`XU%8ln`IsMNn3Fl0n|Yag zxtgaro4>i1x4E3dd6&mIovQ?aA+?k5xlb#oAvd+`DDqk(_fgh~s5B~&Av%UBI*ui} zqc8fSH#($Gx};Y+qhETYV>+d4x}|5jr*HbFcRHw#dZo`dq1%-!zY;8KMqE?$N5A?( ziG~SpFj35Ut<(BY*m|zxI>+%k3Ge!?2RpD2d#?+7u@n2RAG@+AJF|;0vOD{-LwmCe zgnk2durdu{m$Z?a7C*nXx6k%%gZsDF_PB>Txr;lxpS!x7yYaU1wmbh(Hm7fBdiF?w zwm6fv{Eo9|uf$&WyT9Xd0q(Xt_cm}BJi+(2a07>fGH`L=^Qj~E(@yq*PyB#Oe8mGe z#aFg~FZ00-y2smaUfuUBSNnpC2~Qn38C^VrW4y{|{KmgLfj2f7D>%txP=gaU0a~%| zzI)+N4G`_nTfNl~B@u4%2+`p1no!mrXT!p9iu664*q*VW96beLwKADJ9#7k=XwI zR4s4c>#wPQJgPS?9fc##!&*pJbjd${nXIGB8+glC{*R~@#(w|V;ENZv!#d=*vlJ5r zJt9nD?|j!Aj?d!^)LVVk5B=4%KGny5)Eidd!joEkEj`IT?9cw|yMF6yz3%&d@FRVy znLf|gMXNy((nf9qlcomkd%oj)Xg|j0>u*Ml)Y@0S7!{xu3H)y#y!XGeyUCiuJ2=-H zcTwa$#A`8-OuofyJmqtoM)?QZx_wkTq}n33Z~j}t#?1UXV<$&M8f{&OfmrNfpDUowojaAwMtHCf)&>2fE` zo-$X;w098WKYId(9%b1IC{L$8pEiX$Rcck5Kd(m3N_GF?uZ0k8g*|C9TTCbJhIS*S?*5ckkc9hd16TNvorzHpkt<^z&Qs@8QRnKi?r! z>-V2a*Pow%^yj|{Lhc~$jIhB88LSY(1`BF!tHT!KkTMTJ z+)%_0NBpqF5O1?Z3Ni}&hZG6^Q4yidepwAg6G{Kf5yu^G?D51Ob-b}Y3ne6y!V8T| z63GXNBB(%wm?{n-_ZZp)%CRg`D=o6L?2^kb#|kYdAAEMhv&=Q8lE6TLq)@Mw zEuvYrG{`7M)msGSRH3{I{B8fUf-Lus`T@^LfS#8SA!b@?jv{EOBQ^+1xt2|DkxHM7@ zE#{y@RwHGZ!){spo=p}%`lzke+G_;>jiFzXkVpb4R1_22amg)rrNN-P?pf-db+%ce z-j&wfXzweCB4P~!mP$tvG7#N_lq_;dfeHUUvfu>8)ice7(QKGah99OW+?G6papKQR z?JO&e6XRGik16I5Mb@It+SNmu-$vA25?=YeIWo#ulFF6f`ql$vVy z4ofpEc$$V!sd$!-|NX<{nFrqa<)8m=s5F^6>uf;fRV&RO;t|^3c$cQ<9;WcWA0Pbl z%}-w@@{vb>eWz+9*7o^vufKMiWsg#4q6N@dY+JGvGy#6?X9Wac(P(uwt053p4OAet zaN;+IsfmIRtKbAJ_&)*;5Nto&SxDf*DyA6jK!Y=3-~^K?0eFRlD_o&HSO`NI#_$(2 zd|?f7c*7a)5QjYUVGn`$Lm>u{h(k1D5s`RAB_@%HOLSrrq4-28wlH`XInoKSNU6dN z=T{;8ib2>@tkcO0Ui6CB7}0n}H4f`Xr*Wfc;P^&4#*vP5v|}Cdct<_vk&k=yV;=$e zM?nUXkb^YjjyzX7vY2jO%rgJuBOU2TFtP<-wm=-9610$i)y{sm<0K~sBfPGR5+Tzw zB`IB4%9XG$mC{?~D;>g0S;Eql#$k|r{K39lI%Jozq~*4LiArGll9;tL<}ipTDod0?8D`$%o3bTmC zO(K(?!n7wj@tIG3CXIY-j3+!%xW!0yF?Prqn(E5Px`ZNBT@B^ZJ|X%|aV9gO`LxgD z7`h+Stq!4U5zr-v^v-EQ^O?@m=JldR0Pz{u5W&aq2|t z$x>skw3Uo?>`ogC*~cn&vXP~%WHEbL&03bTmGx|9I}2LIhKF8*HEpg0Iv0Yjq)x#B zqZrp1NodKok+ZceM{$~4-R_oeR=jN)X$#!nl99M2$?I$LMW9UfOH3vO>T?6OoWtIe zx7D@obzg}Q`;?TsKb@JAmP^f~?v=dgB<}*N)=dUJFoElJZ+hDcUkAQ7YwDFRr(UNK zMDew}dNu4=*!ll564r&Vr%jtjArhd$*h|3;X7Ga(4B-Vwn8Fjbu!Ad%;R{Px!yV@E zhcnFK!CZL64K6W=HymOWr^VhtsUUh$2{c2aon%1zk z^{j6#YhC~M6~KS}N?-|WU>grx*u^IHv5lQp}@>$BeO*Uvudu}8P;9a;O^?>_ao z=RLk>@B7qGa&d81F2FbG_PE1c`D|~}Uxu=Ll0IKA(Qm%(tbdp6Gk@;VzdpsK`KIn* z{PBbTd-?y4DCVf&{9s%E>CoS^_rELt^>4rZzxKhlNS;^&uKedcF8~2>00poB36KCo z&)=Y==Zp^My3PTg?g1Nc0-X+WbkE)}Q0wSz12gafHLwFY@B>BA10k>kDKP3HFa`fj zumU?OQ9erSrm4=l@B6%O2Dxh>E(Oypttxol7gUoi=xNfJh{ z724n}NZ}UaLKkfj7j-cgNg)`2aTtBE7>9-od~t*@tQU{b7=dvYoe>#_<`@5^krb-2 z8h=p}1%M2q4;H;q7HKd^DsH64Z@l2}4bhSDoC8phqK4Y>C}ijzAltDX5z-!m!Yk6z4W}^v^sgiWtp8dL4>7Xy5P}SV z;9M5MAC1Z%`-g5waucM)BvG;?RWc=65-GIfEljeg5TYenawTmNCHrS2Yf>iJh#?Zd z4>K|-ZB7si%D8-NT~2W8R4^&8ZYiA(QR*#QMo$j~APctx4J$DXwNOUjf^*2l6B)v; zs;%I90iX0n#3v_;+FqpvQCO4F#mEe z5dtt5!Y~UnF~!m$+ygOXGBF|ZF(p$lDU&b{6YtjM8}U*zZ!ixP$L<<}f1uFF9`YO` zvi-W!9#CZ?*@LKhtTo3*OkmSBX>&H2LTa>wb9D2ICT{_Ivo>k-H?_k}Mi8M+(=;Jc zQ1(j>8)6Ry>>>d%I%Dn^bfzI90xaETF+=ln@CgXaLny)X<#>gJL@!vrXjnkPShS=R zU5`D}k}cs=+@NwGERpQ^hcEf^J@RuQ@-qp30XG3fT=o+o@RL6clt2%(DhHH1d@cmt z^Fh%PLfcZ?+|sowNnbDt`9ecM?2<3l&IL+{5k$42}J#2ia=NRM++?16vEFbP^}FM!f6j)F=5!rm4F zKxbs~4&q7k0!#5iOP#b!ue3qXBPhyqK`gKZJA#prlK$XtP1Uqb)AUWzG)@<3P6>*tkWTCZX+3@No}l1g3UgIB0Lqf**r1U5pa)m$;JG=r^?V?m&=pX=u?22$yixUJ-Rs6gXP(5%I+cQFObwY2I zRNu1n#&4+TatQBoSao!M^ilw7bV?ay3yp9ns6-?|GFtz2a$2D^C#%&;3K2^55L!dh zTDw(RxfNWy6?PERPvIg5d2~nBl}UVbsG?*cMDx_5kVumgIdP4sR-zjzq#efeZGK@3 zxUp{lU<__CSvSMgfj0!R^} zMhDbYX*Oq*)@EyVjVkmtjn6GIv=xQ5Sgkf)kpxGD24;R+0bCbZ^-dPW{$R<+N`JH!YZxA~UJqfCK}dcoHXCvs8vPjk@*bJ3Sl7Gx88b|D(2eYMvi zev&)6kR5MjW$|}#h;ro?5Is$AX?Hbt0a$jOHd+GCd8b5^TA>T!_nR7+v_1zH5qN^9 z#2!5LRS7tQ2Y7?gt#|_k|3U zv^ukQf~h1lKm&%iF-}Bs8^;oXx4=C%V-KITr6R;cb(1|JV*8HQgiBam$B}irQb@y> zZL=7IM(sB`M?sjJFwFe;TRIP1CGlOJHb$izr%PR z`ICENf5(FXL-$fkxhX9bm5mN>@%2EDbX*>IT;f(cX1P8u7;kTugL4^nUl$c^*Dt#= zcYQW_rFm#CWe3FVbExA>YNR#VG}AUO3-m-%@u7nj`( zo3&Vc6`739cX9J~oeAr6?)aOxql@BXo~81RJ(->H`GiEdAxJO3WHx|%S%7(Yb{kRm zT3MCo6P~w2XDpa^O7$p0qYH1jED0K*D_VmG+Lu2#>_S*WpIM4OdI{;b9e#lnH2IqY zmP7fhce=2co%y9Hq>96X{HC|2%emtYdJ_mDphY$1 zPMWt;wvJ^|YDgz1tHV7cI-~zFdYAcHpx4raeH8}%Wtc%4rd|3jK1V5fQh42jA9p50 zbf$)qOll%G4{6n~Lprnn54=dNsB+jmY5JzCmz=|AR#BHNjtV} zI^`yI4u7qYsXDiD#i|9uo3SfkL&#IjqlWlGIPdwZksCz=t6w8?+S2o)b=j|_JD}%{ zt#{V9t&3UVf;jW_UGSPLEjqmSdb**zgI#c=A60~15wqDFYk~PFNcyw8RuX`jUqXXQ zijbw-`>^?2rokh$M|-wOo0~s!r=>D}gV!yE!#yG=sEJyTk-Cr}e5oH?sU_UPi#lv- zo1a8xv1A3*Y)XB0bU>V$X#*R1dMFEl~<4y043T(T7~G0sBIa zk81aO%QHK50}@hTR7LsmE$E~${mm-j7zil+lKGhoe8t3@NxxIo$x+>~{ad`$R=|yY z%sGgg$I!%2NlX9H)PQW0g5RQ1NWn^ColXLC6W+pgeq01A+|6&)%_^L!Gko05J;KW! z-4WS3&RH@oR;mRZ#Cdzzk|Jesu->&+ZR%aw7Bk+zn$TUeb4NFoX=t=GMxp> z-*tQ5P3!;I#_Fv;P*+0gK^fpB)4BgQ)IFW!$^KSzdZT~YcJZZ>(jG3|zU|@u?d3l1 zOK)E|-9i7wUePxm)Q9i9!w7_PQ@wM3@JpV4YkeUOA0ZN702aUT5&!WOAMzPr@*O|& zEr0SapCOVtyGXwC`#bz*8jFwJ=x3X)v)Wv&kHXa*!zcX0$-VW{UG>kx>C4xhq8`t2 zAIeXknRCDQyAl&RFHRH61{>2gy~ zn+0upHMsR^SgvEiekFU>Y}l@A%d-9YR&3h1?d-vfsrGA7y;h(4o!S@h->QQH6BaDg z7SNhXW4a{c5~s?^E5VMuY&kRL&6+!N{_Ht4=+UA}lRoXxrRmkETeE)cnsZ6Kv0>Y; zjr+Fl+#^f2ObJ|oy)BMqMn2gx=+3`z-8!H9ye;(U(yKS8e%-oU?P#yIRNXzh`0eAv zlRs}heO~nIzupxn#ol(d^rM$=kDqRS`|S1m=da#>WSN8`MiX_HJ z?T8R#MeTH0kcJIeSdoYcX(W3Ts)^;6ZcgQ+Q3>)WS#Xu{wp*Tf?y0A4-w8y9d?EJ9XQ704Hk)dOE_x`V zjFwG=D0s_g`U46y!ima};a<}Y#0y690F9h<0TxyoqiBN+HL3sb8j4*av zW&*OxnIHr1dA)K>n^?R-fJ(3VC5JbR+V}w0I+fX1SFA5CTXye z3Mb4k!bsTzY;p1}?C`-BQ;e9Un6-Iv!yQ+QamWTMmeasI@d#OulG^#@qb@fJv&)vo zO!LdFX*{USHSer5YQ9aH(r`OQ%u<2M1?FtB&?=p@vd=cXG`BmJwX4%i=Nfg^aLt@n z*H>4qHP%p%EjHE#O`F_-F#&9#Kn=F@AiMd>O?SO@*U00bIpcfx+;(@AXiO6L&G+Ah zA5QPSk-DvMaVG2ZapWR{?D6E03-F5+Q=6G)=bL`cG3TI<={a8o%`5*90C5sn*=najTdcH zrm(uoJ*eK3`hBb6vr7K<zyAFHk00bj zs#+(xo`L!`8N(57fqiQrxg_Nh4+oiZ9C<<{GtRM$1I1$BR%U{3(n82P= zFv_V=a+Pc03YDZ70gwS$Vp5gmZssuCm9g^2#yEcM zjL~`H8_Oui_u+AldCZys#dwlRT}wx9`%?!G3BnI5@*=QVBqAM2A=5x|k{+z2iE_j^ z1NI1oMHFHug9yqMvd)gTE9LB9cS_r(@^hqICGK8n${Na&cCn=8Dm!(=>-jE$TI}T( zeF@B83Nx6*L=P$Rrk^-K4_NDndhUXG|?B$Y)(@xt)!zK)5u4qb+eCq z{N@_NX-+f#kyB)qK z@{>e73|mGCD}^?6p$?r7MK3zhj54%UxqOLB1i4El4s-vc#VjdFPioSXI_j9g`6AnT zM8Gkk6OJ=2Cr#7&tUH1er#0Pab;jA#bMkbkH}&I9256u_x-*jw>Zeod`P6?()t^+2 zYE_|%RS{t_ftq9qLNU5giG~%dVl69K&#FNT&-U9NMR3*AQXHE4p2Nu>tZrJ#DVs5bxYu1~!yRPKIvyx|4!cFjvp^1jL> z%v4+B3dmKsxpuYmov(dci(lB@SHB$GsR?L=zd&i&nI_{M%KU1USl+wsQZavwUeSXL{4VG;tiZ-j3agz#lUj$&GF{ zv!A`}Xd7C|0~J6)Yb)v7avIZ??l!l-t!ZzEJBOZbXK|1#VN|Qz)a+ijyG5gFP+zLe zws^Cg?`>y%*LmN2_H(}f&2K*IyWei38o;v`r)sU*G4OqxA*JnXh(p`a60bN`+ablP z)DzN?)*Wuez3p*}Jme$?xus7h1yV>W!R3bUxkJsecgwupG@m)1+VPJh001Urnci=Z zx$u}QlUg7Cwb6M!Y+xt-=)Oj}(x3m%bYVl?=~2&hs#@`n!KrLYR4;aWgTA1GBQW9= zFFV=KK5?{D1nW9?3AZk26OIey+C$5BOod}|aF<-~c^`S-e>;+_JLXvI>rBrf3+M-X zxksXo@1z))?8i4g=98B^p#!9R{Wyvsat*OC476z9FuWs{wSO8-U?DAfBDL9KJ%aN{OCh}`qHmH z^{;RJ>|=lX+V4L1zwiCnK4=8~SNP!J#fe~1N78e_A99G1m^O__iGV1HiI|C&xQUP0iI=Ejp{R+K=!v8VihhW7 zDR&F4002n<7HLC3{RjU@h!~48C1}btTaFiiIjD=hh3f9(SSz&iQ z2!!wWck$?s@>ns7As@;IHvq5&<0fyjVu$~Dh5-qX11XRNNstF=kO>KfHQ^w@!H{s{ zkP+FC6A6(N`H&YWkrk!uNA6C70O4iKh68-N~Kb ziHYDjiQXBWIf~|)p698a+u5F__@1Zep6n@#IffM}VKl9&pRT!|{mGyI>7T8c ziLe-&_&NWeNrj+*WFX2%liBHGf%%t$DWMTcp%7}Jgjt~&dZ81#p`Ul1wO0?07ox;D zoX(jNBg&U3s-c-AP%FV?*w%8H36C;Lk25+^1Tq;vr=vLX#Y5V)cos-elrrO@f6T}qILxsY}ErB>*BA&R2N z8E;KElc4eoKol1z*B1wbiBGYVN{Od;s;7C%r+ccWvM7lRnV$su8?V@-{>h|8dZ?U$&nh_2Ai-2 zJSYDEC@QN`C_^Q>j3L?zWWZjrS_>!oAPQ)hR2Zy}w>Vd-OMW2$8U!CM1Q`UOIhE52 zn=o{R>QKZn6_D{EGa)3^vY9pNtqg;sp!uZtnKAr0Ck5qPe32 zPzx;~tvjlyOPa1xYJ9qBfCNPo39u8VV-^Y#BB~)Do1i(Au`kv_5-ySxOGvOx)f*c3 z71J3(wlEVDR6GR>re*rEAq%o#7O%AG7{YR;A?kLLx3UdUku4jmG4Z3UFd6kgfTN%V zHVcx=(Gr9dD_FRu$`p!PR}goxV++d_bO(p*N*u0eZGl7v3#))+kOZ3Zsyy)?T9N;& z8l)AUMg~p$tkxz4J)y8kpsNN!v;rXkK!PC40Vqi@t>j6c>q)osS-0>xw|1+ycx!Bu z5w3_z3SsLItsu1pR8X3;wBI4MAJQOF3m<}t6^>gpQ4kXv#0nZaIGW?Qx%y>N02y1L zuL&xtHA$(-rm+d|Lk@wsW_y|fK!+`{w#h0SkkJb7r$K>Bv6@4N2oW*u@P+~)0lllS zYhx{ITduncH&PJ0?I5)R>kvzes?n>Z(|fAaTdF_`G#uHogbRa^vAY711mF9rvYSa# zpgEDrRjq)stT2Nt5xc;<33NC(wV(wOzzW|Xtq389n!}JQ8-?0gZFE;0PX_-gs*!)x zQ?!BA5ZdYx1Thd#`wI$t5X!d@uGX#^!7V*Y9LVz$20^u0p%oMHz29LEZ2-65+O0I& zLVwGjNQw|)>nrstxhOG%2I074n>I73R0VQ2qNy09pmiEFxB@W-ra7?68ZZjns8IS8 z{Wzpd6(Z3pu#iEt{7WlaKpfVZ5*tgq?*}Zj+YSi;rLJ3WK&%r9;G$xxu~P7MZu7x8 zA;zkqur>iKTDJxDCIKNevLegJdu*IyI;@n}x@pUJ=9)y>(!be)w2|>&E0HoVA+;%? zIh&Bj?%TsL@x5CZw8wRPLji}HN*sc#6Ct_4Y`hRiTtJ_!AdJxvlHvbVanr%6%oYke z9Aj(7C;_EX(6tQFte=*HCj-oW+NZ-T%*9O1$2^NhLp}K#np|7Rsqq~;(hAlJn&&%r z_({!J5x)2t#H!H}?VBwR(h6|v!il?|k~q4scx;14u>_SV!t$#!v`GemAgoKmv}?$K zBCozn#tL!EZ?grxQ*bi@Bm;pU0GrPU!9%7D#Iv#!feRcS$r9K~3Mo^)7k#}LExj6z zy&EZ!Pb&}t3n*}dAYg2+^$fk?9GP^OGAbLn{YyQ+f)H8D#%e1NAu0*@`_2Bisu$UC zh-sNHm@SZeyY=U`IP4h1TM%Zed*=GkQlLSaqbc7Uyklv|LkIu9HZ2e)TxhZUxh7Gy z1tGy!oH7Npus}cxE8>bMY@= zaKHI%3+DUR&6#r6CINzkxCf!D0m`oYnnb#pk;xa?Ju-(}aetQ*9Qb&_E*j14&<3RG zqDC8sPMIykn<*7>7nm)8678Ay0LmuxQQyiMnV z4CNF_8Od!YdYTg2*aIM2I6fnQnckE3Ip$ve>7fql{R!q^uBacb&Xfw{s}BF?Ezat$-s&+9>(A(q7U|rc+>N8am84(z!88}(}B!M>5VZlDwkU|6o@SFo-y)LzJEZsyrO>e>#V zr7oIH+=O&G=dUj7d^zXmUgzn)tBD?wh<==ePLYES9P$n{f36br4v|e>RZsuSj#}hL`QYGgKUYoqzJ5FZ!NO`k@c!T?O@1FZHXR z`YWsy+**_ERiCj>`!OZ^eT)0Iulu#XJC;)Rzi;-yFZ{vp$IgAC)noiI%QDH&{K)V8 z%O8-wS3G}3i1=;&j$iqqEzpB~PYY+45z~nKf_b+}ZPI(4j?-CSBSz z#T%xpU>vnLno< zz4~$>B z2pmYTpuvKq4kk3X5TU|{3?Vv!ERbP2Cy0z=quw%=fO}n=3+imBj z_Q_MH@7}<93-?IeWO0|rZ6+^^+_>}R(3L-z9-TS$>(;aX9zMNnT-@Npi~k=_9yXbQ z=gX^K&%Qm_EnMM~-tE4={rlt7lO{SBK7ITE1}GqI@`a`wL0f!x&=%*BvPnY=J!ley z6ISRFg%?_A6NVdV$l-?`hM3`q9g+y5i6WM$;)yG!$l{AG#)#sKEz$_1jWV{F5Ge%~ z)dnf8wA0FvLJ~P-D*+st86ozsu^dSb4p34oOs@;=bL%*xo4e#_8I7(f)+|BpMEwNzW*v~thA!&>8+=# zsw=F!Zp!Pgz6Sd#u(ZyaDzUgi*ea4k&DBa9%yuWxk1$ai0JWr8i>#oNR z`|PsEda^=oaAYk_;r`fr$ngFy{J6do4}9_8A|L$m%nzS@^Ts>By!6FW&o8}@imZL~ z*LPno^v_$beD&OiU;gyxlW+d|=(Ddr@ZWF$DYm?O-%u-=GxTz=R7(x@)c)%q00;O# zqu~rC%mNaqkXE#xAuCr8JeIJMwJQEm(1H-0;HZ3tK?!EfWe6Ke-}pwt%8k&3CA8cL zRhYsRy0C@0V<8G>D8m}QkcKz3Aq;W2Lmiqe0QqwW?f-^YJ0cpfh)84|r&LA3N}cS8 zP)wo}qe#Um+Kwm`lUV%hCqMXkv5R2jq8PVG#xIW1jAabt_dpWEE!-}I0!a`4ej)`* zX)6F^s8{_+lChC#?2mp7J zAW7bM5Wk(RkQ)Q!A(JV{EF!XE%v`22of%DPqK#ciXoGxW$QV+ba$3(K$dKxoBq;zu zASa8VKp1qezj>>j$Bd`g+(|BY&QqS(#HT&;dH>IT@-uJx(Of;>=`DktbD!Z93jIje z!3svup|OPMup-*fiayk$pbLN$3bdnuk|I5-M4&*V&?+(#29CqYzd#VWeArLjYg zMqUS>Zvv5tDhr}O-M2iRj<2Wf3+nrZ3RI&0^r+wyYEhSpRPiNsj|~BWNH(ETAOzHx zs3ZtU$vGJ^gj9`YY-;+LnpC5fm8`-8l~a2s)er(ftn+&mF%y|BBQu0ZrAULE+?y;iob9CT%1HH)xTB!QHfY?=Oa zMNES%u909(?HN^@#?`vEwXj9)YrTfKy8pDYKP5}3R?)eIbIONF18FS$7KhAfLesd# zZRT;6yFxT}EIsWY1GCiVH_!$Ev~C;9LNhqg?q2Ys;H7AIz02M2iub&=;_P4xlz_~I zGK7`#C^<`&(eav>ydJ!-emNTesgkmip%aKy&&kq;R_c^)?2)YI7?kb7RjCg)>srSe zVYE{CtQF31SyiISk5-0RiDe}^e@VZCkP?&z`Dtt?>{AT8n8iXBh$?6NycYimqym+& z@w`f~>3XlUAi1oN0Xt;N61i%_B1jUX;9>sUG?WRc<0crKAe&6t$XM>{kyQoUfd%k> zj0};dq6XxGuvWG!el42UeC9T*+5gRC^w*FC7NuX-c_6zpTbJi7*FT;X&TM|OpwkSK zR(^CLhQ?N+?YC$`gDjY>XeC0`36v6tw!E0mZ>A->Url?O)0>{z5>Q#5T)gbq{s#E>xQp5D6AO9D5$w?0KSED!OsZP>e8%DmGqtE6zzq!tH&hwr7yyrmw zxzK}7^r0KQ=tw`h(v!~gr8~XpMQ?4?1D!l+lcL+%26xuOz4fkR{p(r>JJ-ctB545Z zKoh@1(%%6$wAu~6c7(S*?QD;`+vN`Tx!b+&cz?Uz>Av^7_dV}?54_(65BR|wzVL|u zyW$DI_`_Gc@d|;-R*xSB$X2+w1a(SLz>c028*QM?g!u#R>-uT7$ee#13eBujV`OjxQ@}uwk z<{uyW)?a@0r=NZ5Utjvz=f3~=!%u$jn}7S|NB{Z1um1M4|NYvBzxU%$|M}a$`}iOK z`s<(n^vji`hGtlXXc&fRNQP?IhHUtTS?Gpw2!~uqhg*1uV>pL;SciLvhi52Dv+xQ2bW zCPoo0i1z%qiztbZIEj&XiI$j&mAHwN*om0PiJ$0+nkb5(IEtZo zil&%~rMQZu*ovsgim&L3swj)BI21r~D1MTQgQAOu!i%`Li@?~6!T5{9Sd7GYjJ}wR z!>EkL$c)IijL_JO(fEwgSdD)&a|5U(Bc_d=1zg>jh}?K3+vttr_>GDfj#x5|;7E?? zXpZW5j_inz@)(cwxQ_M+kN5bF`sj}QSdRYKj{i81`Ph#DS&#yWj|jPs0a=d;NstGr zkOm1{*qDccNRfjGh!<&x7P*mssF596h#y&zA(@dNNr)n8k|cSO7|D?+$&xEMk}m0y zCfN>$xQOhSfFb{MlREi`J86?V`I9~wl#JMuLkW~cDU>;Blu3z{61bE{`IJr>l}$O7 z2q=|RNtHN>l|*TkS$UOS*_B|qm0GEkW66{cxQ#}kK)iT>Vv;D?Xn@*SCW-==bm@R` zDUNd4mTzg7dD)j|(w2J3C40%1bxD|fd6;wgmwuU!g4vjO`Iw9enRgkPlsTD}S(t;F znU2XO0YH-|)07FJPLyU8qd6@DQXZxGNCT3Zta%Wrd74GBfK5n-(X}w5=M>rz9LupC zyQ!Pf;+qTu7rgnK+!36`2^G0{oXOdn$|+E^S(A)-G)coiT0@=IIi1*9Gum05*~y*T zd7a-WG~xd_p59rW;Ax)Sd7jjnH6N6o?n$2N`JU(rpYj=>^m(82nVwMBa+Gy)p3|YL1ESm6 zp7^<*DCau+nW7u&p(om+wPTp;1Qc}yg@&d`HVQ5yhNB2mPdAD#UbbD7M_2FCqkjWc zM5-`DDx^iqqdNMdIqIWEs-#G|q)7^;OlqZAN~Kylr9j%Ho8qN$6{eK}repf0W-6vp zTBSh>rRriQHzh)gSf6rQqI0UBb*iFtnx}TEr+B)je%hyidZ&WQr-S;Zg$k(sSr9s< zmT>hUl3=k)g$sGgD-uBWgr_%AO%A zo?Ek`3s$GBnyR!KtD+OAH4`(d3ah5-qP`kaOc)eSsD+1>F#`iHhb0jXvqW6_FHj{- zlEg7cN?aMk5(Tw8c;>8EDo!<)I37c$?{uWqgf6F+tlFA333ILq^{wYhrPMmE7iUct z_e}A+T!+-AStzP-8l4R^H0LO%!epp~s-3?ium+1XjzXwUq@v4msIoep@HMb3ld$5H{1W%mN>;+OSwdJB?LG z6U&`et20TmwY92V061k^E45%NTI-Yqr)0J?aUR071v6TxWFoy6M2O-x~-%aX=pi9?;>fBOQvbMrmC3)>5(av29Amq zLprLijz~Yc1vY%PqXp4njB}e?8abAdJIxxV*7_)007^{KSP3OpUM0BB+K4KVh?={u zljukVm_27&rf4dq$9uV!tGr?AV{VF#n<$?!u?4EzpEk9*txy+Ikhci2z2yI-wHCXd z>!g+<^%FIPFz|7=KoYYbmJoL#eAguq5*)?pwfvz3w{33M{zYY?hLwE@srNpN+< zw7r;Sz@3F?^BYG>761UiRd_2D^05%7WM~>2!Wet7iHaZ^XC+1Q zvMNL=h!}u)W|J*jWg~LB3`z>5)G9HQP%az4)ACp^Ob|Bp7@PY`&{e(=p~B2kzao)X zNP=D8M3dQsB$_Ku63|$9)Cv;dMt4!ENMgI5c`|C75$925?ZifqYZFq;NL@@=*J8!r z6jDR%vPG-1M@yl%7^*YKmQH&qmO^}zH5z2lBl1B~kCiQ0g;i06NBsZED(>Z33br7o zrIwqpwgQL|%tE#edmaepVek=9A=SS;n@X zO@%z8#aq9KI2SAfA8Q;;6^ppQY-b2Kn{g6p)^xsntRJVuWVw?|niVZ|CBdg80X92& z@VZc>^r^435D5G)SsbtiVN=E1yN;?#w*w!Z2`xOfNKMiZb@5FF;w<2FYtuDHn|ouv z+rf+@O`Oumjd(wDM7o_hnu+C^j{1Odq)`%pKdQSM9h0ueMXwTl%@o}(_)3NPiZTdD zy*z@y9Feet`?aggvw7txbepl~sI|NdB(;mkF{;nIwY71}&aVF~P77fR=ljZ0rZTP2 zy>2VgG8Ub4q(J;Dz>`(5(c-ok8`LgAQni~Am%J>OaVfUkS?=2^Gin#PEFCPvOCqem zU`@i@S`>HOsPu$4W+qPlD;*~zM{$hCoVrT>(Zr8*!@B$@kJs3n=)<`E$u+hCd^15T)dw_!v!i#awb!S2FF0;BoExOGGWCC$2eQZ|B|$Fva~=!s;?HxED;i~{9p9@wO-}IxP8jAqs*ARTN;rB z>x)3h{a#OYGH#R*QU$-Q^2i$H%2Lb5oYk|b9Du(SS&9D`fNQ+BVT(Gd`zZhAQPs=a zEE7<#Y{?11+Zx5q*Cn{mF<2;do-CT*r~{*KTHB0!ra#(IiVQ8C^>3bSW}f{~$0}*e zySxL%E|y}h7zarSzN2}R!~cd(iB_`L0?pZjmQ7ZGheqH6{&0{4;f01(0HYtVi@X88 zqn&%R5YpN;iV+)r;WHjKmIgQ?;V&5OxDKwS%`4E=76no`hEz(|_<#Ri+m$77iyRn9P-3aUDU{0`R+veCgSb@CCR&M5B zP3L!7!U?PpC_E%c{My%23Iqe_f9|8NO~-~_=mh_2N@oY#j84Z1p|%~~=!ovxWFy-& znbF16wEEo&Q6A>w&7yT4>QkPvQR3;sT|}ZD)>%FzwpyP0{p$54o5IQ`#(Z3}`PqdxZtdTit>kL# z`z)`}`t9Bx?xtxn`3jxDHR@bz=cnaamiu;+w8Y#KM3Z(xa^E5y6Hc#`cQ1dvi^Ecn~JiqfkpYt9+ znRy&~7?C?#p!ae=`*%^RU_bz7HU>E_!@&#Rcw5q%aPoFbc;%3d-O7 z%kTWkKMu^F{M0Y~(Et3@AN|ws{MP^f{G$NWiiq__|D=i7yTTs+l4$-OgZ|~8{_fxY z@X!A8PyX|N{`7zU_MiXjkN^9x{{RtyRDf0i3>F+%@Ss3~1{)@Hh_K;8h!iJ2yeLs2 z#*G>yGVBQQV?~Z_5Vk^@vQ;~WEnR+G*s$PCTQqGFtcmkxtDHP{_5}LVrY%=Bd&)#Q zGwD*LO_@G*8WrkPsa2_7wVD;{R;^vRe)Sp_>{zj7uMULyQZ1>KDchlJ^R}Se0CHW~ z#f$Q;-n^~$`tAEyaNt&M{1!&}mZjplZc#Q){Fv@!$(83?hMbx5WzL#0Z}!|7^ytr} zMVk(tn)GSbs!^|Y-5U1n*R}s;+m5Zd4O_WwTW#5-Hlo7EE<-9^htCu|^tioH0ibcPx=b8+Gh4LV;2uD6s(k128S($YRngC%2-ny!r5R zugWOxvy#dyr_?V$DZRvUOE9_oGRrQ_EK^MO&>}L)me?xNx7ZEKj z%P@>AP(1_1^UpjFH8lTGJ{2u=QAZnv^iE0ljFi$z3B7bsO%Z)GQ%)mA77c@3l8y zeD{@iNR^Cab=M~cZn9v44>mYqgcnx0VTK=eIAVy=a@8OtU*c`gxD5Q%(^E$^^)f$M z0~AnDLq549#b?s$h6T$SM9dh1`_VG&yAbz zxn;b2ZM)sB8*jezetU1Z|0aAxf16?{VCrlQQ%lFsR5S9&)116<$SWt)a>_5~d~?q= z2R(Dq$0S`lTPVKBp|Bl-b58>I+&T82eWqRK*=?`AXWVz!y?2;>zZrO*eQ;aAU$TSbw|#xzcRzmk z=a;{J`tP?tfBg5K_wYEKXBDiF6}r+%u5$!L69NtRxzQ!CfeTb1<_ai52Tt&S52TVr z(!#2Y1?vBGf(lW$^pqeG_GyGCG+_!WL&6ZYFheC=Aqr!tLXpX^hBSoX4QIGR9riGX zKXf4rUl>Fi0&$2(6k-yKNJJbmk%vZ9;_?dB4)ndMKg#Le_`WATE@rWdTl8WW!8k@O zmhp?z`kKYuG`0ch&yD@{Yj&;Q29Vg_!nE>#40%V{C16e^rLJ)%&6l4Su zSx5>RGLeTIq$3%*$mE<(dM>GA>pVy&+2!tdo#fpoZznuZl5&)y^knjox5`qYGL))p zrScf^zg4XNv0eEyT5_e7{b3mVXaDm0-DZK#nth@dJC=O9=l<}Zu6QH^#~m>m76 zM>87IW|^-|6}@Ovnt4r@X49oDh3QLW8dE!N(?Hz>q#`5PNS;!%r#tm&P=PvBofZ|6 zMtx*b*L2B%Y0@{OI3+Bj%F3z6lB%h^>MOHqN~~Jdt5pSSSHmjND=sF0w`A%_)e6$J zij=Kyb!%Kn+SXo~&sr#5W}LP~)0y^_uYdJxU;ztLoBHv27tM}36}!&GHkPrEb!`7+ zA_AJ#Nzy9Mv>-g~Xj5BS)V5Z&u4V0OWgA=CI@Goh z4edfj`%kit2snR4EH2?X*S884sgoq?QI)GyHPO|%8#SqaY^hRb3f8*fB9vscJK60L zj39%(uDc4WxZ+I2xXVTEai88{hfrx4-}4{Cxy)cj^O&tXB)LABmv+T4fTE|8 z>VntKn))9bdz0rZ?-_P{)^MNoJZM1|I?#s(bfW*fXl*fCK#Fd3aWZyiN{@Gq0^@F` z8TPC4degiD1T{=Ljo6rs`dXewHK{)>>QI-u)vI4cf_=M9j5??P`^sY-Z1P+0Je@vY|a~x@1eY*A6zZwY^(Ir7A+dO;RnG>|}EP z60KBD&Zyfo<={dO-Cb@~o8Ud~ch~#OYEJXL^}S|y>owl}7Kxh$&b9yOg6)r4UTJtK zogp&BNhSAwxS1uMZ#G7p;uIelzBLZ^R&RwREJ5f+t;qs= zbsB5pP2|wLATvKmPHcUoi0FJt$ZUttNi6g@9Ys0-w~0c6Giz8cF1;&1FLRM{;max$ zP#+|6)`z_HQ5mFcw~XEgZ<s>-I*{A>XKSTRFk~U%Zi^X{h z{{h?a0{{fH3i13WNew>A;7@EbWxJ1nP5EL^)at@su9YQF^FIfGcb0N8{y`a8G_4ig-{07!r> zsE8PJ2=`mJR@s97Iy{HyJzF@Elt8}2YlZiVy9FGM_XENOEQsNQle%cQ%A1G_13*!G z2__^$G|8`)3qcU13SC2{fMJC~34o0W72Fy&Zc{^SQ>g!KNi*jeh}E0D9=xQoQ62R| ztl%h!!P|rcaGu0zILCO27TW?zkN}og!6sxkS}VN)WC=+Szv63%HW%35du(;u4>NOC~u(xUU00@M@pz~A`;VR|2mk~?!aE4$D~L>#t^feS1ZcsS z079P>h_Im;TX?^B+6W`OD}yjRs{D^{gq|H#is0CUvLOkrL_wuA2p~|4A;djRB7+1- z0J4;?nyg7UgUOkcOA0F=i&C7-LJ2m2JgM?9trHc8__}se!Mv*lQkcPMl);HuL6>L) zx|2Y%^SYLh3yX|HZrn%)#6OWN!dluv{0mGUjEg7?N|R6>m}tz)bO}3jh;O7upxlT8 zj6ykFOj-j+ENjM6+)K&h%OVT0%Tx8i1;(g+`EW`oQY_R%>LsKlvu_+#1^+a8dnU&mIHv|2)kQXG{+BZX4-ys!0e(JHkT%i=Y>EW=4T z#Wl<}FTE{0`OGlddn`=EfWzdH} z#V<|8Gz`>k!%Hf1MQt26&r?(}s;qJXQudUIpi7E5tFjBUR4u#IO2yPog;XI$(x$LQ zPZiZpCDr}{k40TaWO2t6ghytQ#}ge;(LBjnozMsE(0jDFTGiEE<<(vtQSY-yS`Aia zayJQ89|b*$c~rO*y|kB1Ihmx(K;l9srPe4N(rT4bYsJ=U)z)s!)^FujaNX8%_119Z zR+4~Lm5WIRqPi>v6us=r$;(Zza>Fy_(>ZOqJAKpYprxi*_nm1TzQgc zeb%_NUGzHDUfErYmEHep0XUTEP^KN6;uW0Z^&8_&UgXuA<#pcXh2Fq~EMs}qGrlrdh#RZOHCYIt$e&S5#WK3QUxTIfg1W*kI;SVrei*qE5 zhU8=p;vn`m1wkndO&w3(WNOyrYwqM~eydfj;&`->GG=2mUSlxcVl^)3a5iUgK4)@P z=XOr#cSh&EVP)OhH9OAbTdrkVzGqwJXMMKke@ZstT*W`$5^8Ld49#)oZ7r~>6V7+ zmzHUm-rLlHCpy`z)J5IXE!>?Z+`t8Do$l$O4r-n*>Yo=^gyuta$cy&qjMiqU zrfQC!>i+yUgKJglI_a)PX|D$B4OVH3c2-^9XMZ+pfX3&u#$~nc=eCZpIK!+!xhQvgLY`VzH7af=)B%dB>T;Zw#(?b>gVE#pzB?kwd$&l>c)obkg(Y$qq3a+YWxw1 zhHK1KVT`xPz_14G%MNYdWWQ#mxtZ29Tez4c&{1~sBfZ@YN{#8+Ms2HL(b@*5nxr4n+P%^apE(5`^$q=DIUR|ONZlwP0=~hD;8QklB?tEfuigIeQ zHf+bH;G|IP)#HhlFvqqd1+Hv}b|8g(Y>AnZ#M`Fr`Nr+XCMIs4>pA;A(dHlIYq6Nf zKMH)~1T+W}ya*xd78n|B{_YvC&VQMZY1(; z8FC{R@+3#{B`@+OKXNBmawuo=C#Ui#uktCk@+`;lEtm2xzj80n@*%f2zXt5A672s; zJ}am`>@tc9)h5QUVaAC(KsQV`c?;;sUUTr)^DLU|{I2W=UuBy{K$ghIn;OR8@JNwk z@I}8P69x2j8S540!unn(qI`*lycQ0Z9vh4m*`{>*2K7%zC*97{-p=mm#_rpK!cF+S z4D65P;g+{R^malLy3i2m#`RQ(ZtB+c+%nNzKXqPrq3u=-*QMw0#&eBwio`K)qeDQS zkO||C_QYQA6HoSQx9>cs9{fHycCze82Ny+u5pXAWY;tr)U*!lVY_hKBw8rCsF;!6y z^?8@~saSDCdhw>B>%ZpVjFUEfyrQ$?*M5`cf+zTc2fKui)2v?jfme8jhj{;oZ+Lq% z_=lJHh&NS>r}!F4aDG2B-$e5zvt(?43a(M9S)%upulI+cNrb5qkM8rW)~j##;N9l6 zo5%T_*ZH02`JVUrp9lJ&-}!$CfM4kBl8*FQQ+X^B`lfgKr-%Bem-?xvdI|k>QoqZ1 z3U**eB3`oxwfOp%AbP4N`?5FtvqyWNCwhJKj9uq?V!ueIR=#`fJUnOmw8#6r*ZaNa zd!4^qn1^^I3CFnW51L;%oA3L?SNz3ie5h}p4^H}1yZ4?#{KmKZ%g6l8mrQGKaVg37 z4C6ByC-eT*{L(l5({KFGPCJh$tsmu>G#~k>u6)#|{o1#EpwIT0r`Z24Gkgssh|RwJ z;1~Yk&-u@We02|BmX>$KB>v`ie&=WVdB=Kv$LX!_bQJ)5w8nvp^t5%a@h01lS)T~@*k}YfY zEZVec*Rl-&QtMZ-VZF|!3bw0Vxp=L*^(e6F$+27;_Qc5XaN+-`~jo zX%ioAytrGZ456wt?Aa&BoE@Q4*BO1e(BIm(bMH>MX7%aT!%HupSZDU0CxgpXO?Ne1 zx_jfwziVIbRqy)u^Y6d%Eq!^_haZ6h8kkpWeQniFX(SCcm_g4;2-;^AYKEPE8EUwp zeiK^g;e{V|w$NA&j-*^_$EjExiz~*a9)~f?I3ru^4d<0>IKuaujtlOXBWuY)_!mlJ zZ8RQ|;wfn!PfaQW8I4g&Ib}=WIeFccg@Sk}MNrPUD5D%^hNy^<8XDSih=qC3 zX-F;QVvC(}DjaT&iaIKPHhOyMr>F|4=|CxwNFr!D$?DUrwbFWPQt6SpE3cPXxg?iA zVJWPZ6QxI(N$k}^a7Almui0uFS)F%!d*6X=@@Z8Y%06`|La(X^ z>79NrSF?uf6UfZIP}zJH73rODjEfyAI{+(Y_^BtQ^1t3;cDE1wTEuybF7M zHrNAYirU42VT~)?w#prM+#r*Ex2V5%d@{$u^8FY=ET?2{RLt@?t+mz0buHtH+le>i zq;?Cg&ppRXc{}Bvxy2?$t4mnYRVQtCp&jQRFJcYm|<;m0`n z_my-1^LuI!-S&x}e@S)fQH>;l-LP}Q%1`_WzP5~!k8 zv8_38n;Qh_7C{Kk&wv)xjozkryp%03c7c1}_0D9t#wD(Vi*p>}P8gpHvQRtZ3s?Cr z=RGuO4lJDW9M(XWza8SQLKSQw5F?|%A%f;=t$Uqc9s@uHGVwTK3nCOLgTUZX@kdtl z5f&Y`DvP-)V;xK$^)~2{rbV%gXMvs=!wAMCeNZv|vskWV2t)LlZ-!>P<62&5xft?s zPeS7&`$S?i9rjRkJUkK^@u*0b+|Q7OwAa-t)xY5dV2J{}By0${$W6jzicS1vg4PBo zS3OXIrkvm@ACpKCOAXl$t+F`cvp1TkG43<;vFW9 z?p)&)*K zQ;&i@Y9AHK9EPULsabt2GzrT|=~%O}7s@EIjKa}Mg0-_eGMHo+Nm9>#?WD{hrAk|> zT9(#|uAw#H#ol>WH6mrNnce6ud+F1lrm&|x9p-B}3D{x=7HCR6SLc}NSj%Fyox$B? zbE8^B)@9RkvGZtHnK;(xmeH(ht)g1fs>Q9HmYqkcX)hYL`Iilx1HENXuFJJ|F2$u9$8Y`>N(UFJ%Sz5aDxbW>-n)YezC!;@WhJ-gip z*Y6*g%5YfKS>BY6<}?4SUF|6y%;D0-7QO1l>rWD*PpzHFOyuk>j&=LnUEX%Z1_W?% z2Q1(MFQ}`OB;*m)kl6@#N(7tYy>k;@l+FI?lC-ssF%k_O?|eWPOIA?x?BO>uJz>x5Y161q=nGceJV%etpZ zIesbz^wTT~StV1d#8uwtg|VAuux%OA&O1#CH(fgs6OY8OGBJuzOu=Y++H|vmv8qul z8l3JEEPIw%j)A&cpE9}CrUP=J{T#!c;mF9%Z1kiv=IiD?89c~F_Esz0zUzt_tOa}W zvYQv2P=mO%7t?mitj_k`)U56}XGfzn_N(@S&F3I11>NEU(1GdQ=NT&Y zFK2!rp&|^~UfX+Yl%+JZRmxQwQ&Q92K3k^?ez(y++(o7ZchO22>y5Yc(Gm|?d^x^S zTAp`sBGj=8Q|?=p=lWU%|G3V`$6J)Iyym%P4&emCR6!ma;XYS3%prGhf#WaQmu4ol zEB?uA2mNjy-gdQ{Na}w-$#`on_nev6bh6cR-C6HjyI)Qxe*RV8W-oLAezA4333}f` zemi`U14wp4DA{)R;knnIFrrf$vmtDF)CIU4gH=`UIs1r20&mi9Q{8y55_zgq$ydWC z4AhXnJgxsoe(DhBR@XcBJj-d07qL@5TRpY8=u;1RG$p6V$!+SQ@BZ@Tf^%*)RY1&)@y_k3aqMfB*X9fB*XLfBZqq_zl_s z@{7VwA%DoxV6+@I4;~ZlDKtAP9coi-_Q;MIUO7 z2Ii$;=gr*ewcM^*%P=L#=kXvB{$S|!pz0Oj z5E}m>>LH;MD&Y}AVH4(?vjpK2GNBK$N$WYx&NWoeF(3toAsCL~1d?F|mLVDz9d#|7 zb$wL`z99+5Aso)390pLRaa$c`k_npE<0W7BabL()-_->oAP%A-QePn=;vX(ztRdl2nkoO_ zE1n@f#-b_ZV+8Tz_T3{u;-ZN7o|U=bFdk$vCL}^Gq(WBQF}l_CJ>nrsq#_bx_emp0 zQX`Zx;zWL3M+%}WeV-)03@VP|yq#hvo}>T*AzTndOP(M9v0uK;PA$tfu47)h<6gF-U$$HT zNP&HkK_wL?8IS^D9%f=1CSxw9V>TvZ5=3I2M!DbyNFZimN+x6~CS+>nVru^;XfkGQ z7z_|JlwOA8U-l(DqULJKqw9s6Jz}M7q9LIW1OSkNEwq9yw8L)prY-cQZt~`D@@8=6 zCU71naU!R2@@CdFNQ3ZZaz^KJPG@mer*c|nat1(Vh=dg6rdH0TQSOhv9Nn}TWLc8s zB?UlIA_PHfLQyzpmAy_^p+w^mg?+xndkP8}Q5<@n=K!5$xSdx;exxIMB=yP7b~co4 zW=P&ehAl*8Qo_t!$|Z%u&5ZR`d#oQ%f}%}!Xir*U6(&eZz-NUuh+q=Li5^{wl4xKS zMT(xtijszmqG&;+sEy93ii(6iNWe&tB2Jd#2xd}k+~JTGsgNFNkS70WkQk|w`sk9P zRbK#-v9;oNR%v+RM31#iQ6Sz?bSam9sh5T+n2sq!;O0I>DU@8qpM+_0i0MBPM1mTG z6tL8lTIuXfn57}nw_%xo_U8iCMw}u<{)lmDEyhDYR)Qa(kkOv z;Y-Y#XjG;y7L2Z1=Kk=iLGWmi@T#%yDzXBruLdiqg~WP#s_U>Mkd`C0o~EqUs^<|K zYfLGMFj`jDDL+DM0Bk~_3Z@h!fy)F7ak?09CfAF8$+}KNygL8Hyh??4>ZZNgYmEi~ zv6e&<#27~osK8PrO)&$%16CyqYbXsHLh0vCc|zO2oa!jd9{DL(J^G)>&F=WKDP{M6RmOLL<&* z7M_vat#Rmwh9c5>sQIy^N^FJexMzGG9gD(eepYSNUP`OvXLCwz)Nbw6%IFp-3(1_w z#MWe!POFoqE!wW_Og`z^wyoO2E!z?)l>W(L3FXm%>$mRhKt!crj>)>ltGG%AZc4$! zvPIx7r-SU{-h!ue;pyh-DMu;n##Szq7Fa}%hi~9!p{D;uO$I%nN?td~WGFqCG z{H*Gp5@C*nsb759x_O3MA7WhqKN*=A! zmSob}NhqyEzlsm^&h6#KE#1Ct2fHl@bMOXhaNVvC-Xa_Lk0t*l03@+1`EU=v$o?*FGA6JTtL|X% zY<396Ce&W#fdm<3abH~V7Z+yCD)1DuCCSm34(e3&T5I*LvGF4B;uJ(p9A@i<1R0b@ z7l$U8h(zmFQgXE}5cF}_(n%j11ZWXNzxJz%3@RD?Yi24$z9s9jl0q9aM3S0q8&fYE zZ?f^aCKqOJY~t_@BU?X;L^~96d?r#WoMq2X6ICJbn7Kz4{u|7NFLF{H#pz@+@ zYC&A*ai+&i2Q^TeF+X#j8f)?!XEO0}vN{@cR17YuEOeM<1sRm)5S!v^UUgMtby zCl?zi4<$&WboYkDb`tTTY^M#&X^RCgG9UB6dL%Qip|ruTdG540Yc=LFN;QXs5Z<9; zzw}G@boTadI`g$MtFvC$Cb_nbs7U{XWWH!qCs<}J(O{g0V!--J5F6^{& zO=tFW%kfjMHw&Jzs{-#-oAvYpcv_=%Ucxq4M~Pr2wt`?qU_vr$;5I{Fq8kUeRaf|F zuJyJaHwsrbT-#k{&GmxH$tnTB>n#M&QU`VS^*K}aWEc&{C;<%NWi}( zNaqOVMK?B$GcjZbXbrFUUKjtligRCk*6cTH2$PL*W{h@7iMD>{_cNaMnWnZ+0(6$Q z_G;UOR$rr(^x6mlM%qHS9RD_&4>v^taZ1mk~xJPrios+U$uQD*pu!ev{ zPFsXsFAdBdgcRiUb>I0bt~92#^pDs0v4Hmhp$lQM?EopZPCK@DpSK|W^psC|+Z?cl zY{3@1Yv2&IswHSs!da(Nxl37j8sjBZQ#gUg`hbgLQ^9g&f<$teh+s+rA`?UsNWi~3 za%2#DX$t08_~<#d25t}PZj$wc*Sf5qHMKV(hGQ>my7i$ecLOr_7*_>#0_S~4#ODl# zo66WG^>{yE=yYvudCGmb-Q* z!nQ*jd_%i@2FLtLlKIQmJjEKknQJF-?|hrXIh(6_aQpn4YxDt9okJmdhvPYVZ~JxI zy8B2E+8e}rs`}XXJq+?Un19#~T6ncfyWvN>6N^MPFMd}mbf@Oz;nOg@x+?hF6#^ZxJ~fAJGU@FV}II_2^gfAU+U$oqZd{Vq28 zRnd02_M`lUzV^WX+5g34_>aH;m4E-C^0Nay&#QmW|NNV~ztBrG&LP_OW;=32J^l;& zrcZwgdMZG)3(#s{L4pAc7DRYZVMB%w5juf&cSFT@!E_FH5rNFCa6~6SCa3ou|ZQ;I^8<*}}yLIv2)tfi2*@&C=2Iec6 z@LI}VeH0S`LPm@k<8g*;cu35j9 z9hqyOYZPe?pT6C?_U_!V zZ_nMiX3EPZVK!X5F(gR#@7Kq7FTZ_#`12t$yc)M++x{W}%r8KT{B!F+0TCpyqoxu% zP{9NpjL^Ud`J=Ew3k$4J!wWaeu)UKGGVijnU}{Asuu$|$#S~doF}JH$jIqTTi@Hq4 z8)^T{5l0tWdTAuT&O;BQ4hNKwNC+`3GD#$le9%cF8%#hYz$U9QvMa50X%jN`!_vzv zzYG)1k!-0GU(u;mSnoIozyD zR5?YRTGY`-A;rlzffPkZv6T*`^ifF}<#bc%K1DQCO(O-hR8dbQ)l<-LW6I9cf)vt6 zmGHBVzWZ#g71v#F?G-;;0+3QAVg1t8*Ibe1)mV_!3U;MgJ@io7WRIQJ+G??lt0c8h zIrFL1RnZ9;urw0P|tYSH=I$9;0 zgz{=8t!_x5W@-I8Fs-rfn(M8fTr%yfE!+r1G=n6OtP|_4d)~W+LQ7q{`JNZnB-ES~ z@4@?K_g-*;Jg?c4%wD^3vd=CXZO9#;yzOV9g;?{55i@%8&p8i$!in`oXw8dTAqCLU z_8io8)&+%q^*CdvefBwJf8BQ7BT{*_-#gtK)m4cXURC2KO`g%)t^zFh;gSD;{&?uA zpWb@qN5wu>kXuC@*0|r+@9CtWE}#7KnGFE2Eo5?1TJ)QS-+a0VB4dli;~!uD{P~}s z>22Q@fTF2MZZDx5;Sg9ja|Iw%33OoL5Yj*ePVj*(Ivkrymlno}j)S1{V1har!Viv6 zgeCmoK}c6Ri@m80K--xMT?Rv)#qfnSqz&+FI71!wOolvs6b>~NGau5Bh&%jQ4u`0- ze60{C1H{}ykhVYnO;LVTT-swOmqoQ{k!@Yn3l|@^MKOBOa%7a;S^$_H0fG-MCZgaQ zD+ot9#*vP5w4>j?g+YDcZ;W9yW8?r?xibcmawaq+2@!cnMS96}w95bB>E5I|-QjL` zxwB*?F-b{HqAru1++^!6`AO=;35eP&UiC~Fz3fR(d!zGY!Zd04xeB%XQ zRk{E!lAMV&XF1V%PIac!F(~wuE$G<`bX$^rz4M*+YH~G@$e> zs67b^P=%65EOR0n_@JnsW-gPW$9$$mD>_k(Zd9Wky=XJjNTM|=4q9&X=1IAkQk1S# zr7Z;tIP?dn*~3RbkP^{lJw9tL;0pI&~Ht{JT> zNAK!UyY3aQeATN(qp6l@ny#7wIG{@r%TmQAma&U9S02N;$B3?zvh1wvWi6Xo%wox% zj8ma!JTp&(9#o$THK=Jvi`vo(l(hX+t!r8P+JwfIwl&P9L$?5!5zW=FdG&2?f!kN% z{*}1D9j-G&Dp)oe#H5XNu4A7YUFc5NDv*t7toS(8nW)~tB_{ESw+U0+h;y={QY`q2S)^ra=8Xzp1Wlnu@ono~hZI_24`yfkPfz|#ly^I2R+k#p?N&9r z-<@iBBkLsz0Dvv*kzp{yjihZnY^?!q>wphDMguW+0OBQXzUf+=Gkx=({oLm|Lww>7 zx451!{%48bIj4!ax41EWwLm`-wCKUzxHEQgm7@;jEnj)cS^jdD$DHOcxB1L(E_0pN z9OpgXdCqzMbDsyD=s-96(2xG|)R+kX2_HA9D(Q2feFnSyA%)c9?e2NYo9kNd`jy`c zfRF#nZIgxXSnR~5o3LdjY^O`x;R1Jq$o>CEZ@0VK@gDcP>pkyt-@D)YUiZKcgzkj@ zyWshrc)%+j@r!qS;~{VO!LOb1lCM1FA8+~0V?Oef?+n2#Wp`Mwxv($!7DHL=&J3=e z^{sdP>tP>z+0UN#wYUB4ai4qES4J@jNP+~U@DF%C(pIsGXVH%dP?tp_{%^3@2~&- z?N5LG=b!)h_y7F?aR2^K00Xf93UB}okN_1h0T~bh9Z*Q@K>-Fr3IJdeT7i9fB-Eyi zTi%cT!biFK%>fT^1Q$>QOOON`5C#8DFa=Mr1zGR~S1<-ua0Xpa2KTQsO2OFL;2sD< z3P6tk(5^(PDG1SS%^GfBW-1Aha0!P*37e1!H3$j=C<>o+-BWj_T^lawBo$X|+qP|| zV%xS=v27<6+qP}nww-6?{WiMS=rQ^i+}N7)!g1C@m)$~_F#Mj9`yCAWyXE$GN8Im* z38*dxm_B=$qFb1;KQJqQU>9a#_TmUGfz?}$p@9fCHSEvIv`TsA(GD_wap-G`Aci(lN9g%A&P%T4V(dH{UG9Z9DGS`Q+^&hJ5U1n`+T@VPqh zg*x1|JKPmUyd?*`-;sEGb9hif@LKsWFmoaxd9XkwkYJ7keZi1W^^oEY7oE0*4b_CG z_ZD&`@g(=66!lCr38V~;MD&Wp%=JXv30R~FFq(V#0!-{u`y~8Kq)-*`$u_fej3|tZ zWCo68di7+~@nm+2ANv1bVc<7fr-Ic(;m7omVHmL;N?B55l=Vwc*L#m=WxovX(Btng z3KFPn6sRf^Fd7`Gn(nEpn9%FysXLHpdgd`k=4tdC4i7`xPD^Olh@6(^zgO>RVGB^L z_eenyzhU;_AM8m0uL<(Ql>Ot&8PAhdFq79ka5W*5w=8g# z(6dR}y_Y_iV=x;HFK{>2z(PhVmRDa&%<Ltn(;wt`NjJsFQ>+Ow5|nc-o76z07# z6loNebUp=0{n)!oEc6S^><^->%wjr8z+eHhcnH_pwJbkhJNyrA`~gfSkt8Z^C~1xk z^-*F3N>7tUGPO~1=YcjGMY1oBF!kZWH!_x`pT7{&Z`+IydY{wEK-O}Pv!l^MiireH z;iy%_q`rnEV(9&!?TKOZaULCa+k@QPg4{#n`~9gTEXATH93Uamb=v93Ja|pcNJ#h> z#>L#%x*%`vHKj+{5M;3ey5S)>5vesWgLV})d@{{B@}JyNoTY1O_$DYY7L{MlD!`2@ z@Qnh12NknBQO(9^1UjO^UH&`@;oBjeMMLSwdj>2E8K{3~-$`n?P;}OhOfS(4`STA% z`yT+bewv&Z_HJAdl)Mh0+*ET4XUZXC2N49fL+OStkN~ zRBFW&UE2fguY#+>zdVHkB9ltGqUVo_fvAfRTBJl_Bw(yi346xn9@ma)PD`~CAcTbk z1QUqF#AvSp2!!+WL_tSXSl|)h6nv3nP)Gt&#gv9h;?1URb$Ve56Y@Brgnokv{7xeR;XqS^-+zfoF+4nWo?he^ zxS?8BD)er;BFST#6oO9s=i_O{n2;B&EMx=)Vo$XHm*bgq(^ZqQ7?w>?-O+_?oSwxaSF^`{0L@IJ`rUarT9zdCaM4%!>vJykeg7!E{ zpr%8lHdRQu!bY5u%tMG;z5c*UtlARROmh4@+)Nt4p<;<)PINTRw-ThZR7y}tpf)wo zMe|E!8_c!u%8XY?MF&+CVo@Mn&BKIMHCK)34n%Vvp24|77c z3yF;^bM}=83}5`_UcB0GRfk^u4ia>J298Zo0?kl#QB@(`h}9(w{$jjp&y#usHv07+ zhP*wVgL*=KY4zE8m9X2g17$1_`Oy1rjDYANvmLPprakVuqFG#`x*G^7k>3-HrZ`Y7 zsSuSb`nW{@6;YS#@A3}y$NOi;&el<$BvrL&k=9B_*Q8uTM!H^2z(yFp2kun`2JD(S?jD#5S ze|D5DMAs+z*QHQc{7mw_h>>~7>O!k~JkDMz` z?`{tDIbyYw6n!@~qQ9h>nBZz^_4@v7K+Eiff18#2+T4m=)xkkrNrCJoLVZK$d{5{D zXoqR8(=>~gNFdWG_gvzBxBit4LUF$r>2zVFT4R$Dzq0%nS5|zbpFy5#s|gWcJIkH| zxC`*%3iMkKIEW9tgV%xmouG)t+YRzQ1C-8)c`H#dm)%n^n(EJG`6rB!_O#_Ok8UV4HDHz0Wh-Mc3 zzz*!i0nxz$rB#c_{g2wM?g>LVb8f0Q3X6W3^J1iqP)lKLKpjFzAvw8DX~YuM&%&cHc zS$m3*xHv4tzdNL41qBl%zZRj29{ZiJrE%*c+g?={L9BSS1_7uYgG(QSlAnW9TAi|= zbaG}xvYnhJSsmh=4IWnw#vMs6IL&4qBW^q+8;b<2_70UBm<1m#7Y$|cjkM4jW1*XT z;UBMbwMN;P9g#fB*2^7RdKUY%=Mw4>aH`kkoz z-d&N&(<|On$SWEiWj(<5J-kUh0G?TS<=KbK*}Ke{K(1aypE=REGTKC1#7|avr+J8b z7Pr>Yr!-O6fby;q0~@wFca0V#%n`rMk?^lof1WkkJDc>azkp1gm%J|?U)S~A?DcG1!bK-x z{;Spr9@Uo3iFlrgH>b^>?6xWI$(gVA8Jx)_+%0MOI-{?_P+BI>uW9a%4%Egjzz6sM zGNNopBQRc*G~F%)-yCet9IDR_V*NW&*B-9!ydHA7n$kX^Vn3&MB=_e4v+n_8_W|#w zdKA4}w9Z;&*I~TRp~Ci|+0#jIP^4Pg9<-|?S^_B04$ug3*yr?qkjs8Fcu5|PN<(szHAB<;9w^VO+xNogbj=7ob9S&d{edg-W6c$ z--A`$KsOt|ya3y{IIRMEL*e-BIhmaIN8_2|eso)Iju*3aYWUUJ?QSQ#C82;DzMPJ? zi<5?uotW+}&zH-ciCB3+$Lq)8U7(Fie6wF^h6~$*pQE6u3bjl;;U8)nn!()wSn%Gw zKtwqTgJ2BB(!F48%~OLAoRC+8P=Xi=!*Gg(|9sPoQ^Vk2gc5rJ|z7ho?&{(9R#=wmZaVg*q8gZ$h{+w}XAo1x( zDdw)}$Ej8!YsYDJDVQhemY$}^*-rZ!eqYwL|I93w zPU)_L7YICw@3vnyUsTI${WPuW?^VkyMITiy?7H6eJ1V-rrax+WUZAyayMf@X8G4|J zWf%q^ATDqFp~N?92Ql<2>xOWIFCB*N4K-^=2_a-0lgZ(Y@5iA_Xb>id2ech0m;$XI z2H2INn7a#iQxL{)z-b?6zu&wOie_A)ty*OwHy#({#D5%6MK#%{B~^0j`{ggovZo2{ zmh-1{3M(77HT9D0rgiI@E7uK!Sl;H1MKM^50+Exdm+fy(fOYl!*LT-tS3rYQ>rNO% z&TDTld-v;Jg!uI9!C!eg&cpBNj@dzcv+cIt3{^bO`N9sW_p_o{ThH^-n(OxST0gnB zUAUddx6^YZP?nuecunQ&E@T^1K`~+!ju!i#D)0MA`Wx>Dc`GOZqy#d=zbN`x7Z0_V z4sBzbl>xXP4Wo&6-3_N3T-R^sW?H`Q6?k}rFVn(QFY_h)TMNRUH;aJp@81MJzG)%= z_0L}jl00DaFadC?T7O6p2|pqb79fH{sR;kE>wp$CCX^b=Q^j#`nwR$Wt{R^W!(1qp zR=(FJgkW;*{NHZROfY;>vKYq85KTgf%RH7|mA?(40KpvHg#Y=b);dUuXh0XJhmP6A zzYw5>co%`;t#J-_MI7Ce!bu2#1SACDdcp)n-Y69UgoyK}N5w>&7^Cg93$RZh#kr7z zB2_W*6mmwyPoM67eAB{vA=Wq&2}0vvb$PC_}WJBVt z%Cd#1R5;KizgRFPlMQc)jROXWN6}%4fFpQ7*-`zC(J~DQE*QuCp-3du zeA5X&W$)9HWyqMoG}`j)>r&_gmG96Ti>f4c3AH;9VU${@FuMPQFc|M4<`=UtNacyE zS8QfiQb=)U%w>B-oaAk5jChXEZ- z;O1iy^pvgAP^(y9u77T-j<)$~G~&qxNU@d|!ceKWcxmMvKl}H>nyL|EZ0@0@w)Trw zJ0$*`pA5%{dtoM$`B2rTY|GnMmsDKEo3?r!)jD>+s@=P!w=Y6kI@8XpJw`foA5*5f zmSt}|Hl+35>Q}mNRp@;$K6Jl_TY5fJHmV-65#otd8%P7sKM`Au5o(qD$4f~qJy*0*HrNMP3mD83Q+1AR zm)f{5X(N-c^|5=XNk=h57F$J^UdfdjWZalN^14h(B{WA=?CIlb&5lV8lSi~(m=k)- zOlc!D$4qYNlV)sAX$zC4WG!xhsc+ePJp2v>#-+D{_r**nbTNEEo&iR^}dj`-B=r(4adufRLvD*6WQXkr7ZN!ef28>bK zP|$T@rj@xqKFrq8#A{Cx@F^;sI~UZ zG8+F}MMCkGxubB--V30;4S@LE1r>koMYp{T;?DZs}f(ci~Yk(S933(x-WODsOoKK(GM=V0lc%T?VjmHgQkdN1vX{o7CVi9cCZ^4u}A z-L6gCTUVN99~&ETKfWpNwLOH__K>by=P$5BRZ@@LL|x}XY~8akdhdOxnb!g8@4INd z&I4ljw=pf<`?MPGnar3tyrHEBZ4lmAA$;O__It@(`ma;9SkDE$u%~}^yq7BUAL}FE z&y6ErXD$HGjg#+}4hY{HkKFfNY`@ojdcOPEn$P2o?Y9QA?}rlnuOlt~Y7NvkNtte+ zC^x_Ab$CC(SWnN_U1aXZ$&2rMpWXL!!OqutDF4TfJm7W3@B4X%|NBMn`{P9q02uMx zh4}l6;_so_U*NR=WK)RMzZWHc;a(lyo!mTE+)yR_f9|=aEpFK6{+Oq3SQKsq90BMO z0r>xm*`iwYCmi)BN(-Pd4{%-afOYW5a0^UI4P+|~Odkp4Xblut4HSG06jBcoDRn;| z!OtRhSwMG?lW>sda8Oit_(|IO;~uP}9;_J_teO_A-5Q*W?rBpSgzw-u-;B@~5<>oy z-4qa#nHORU8QMh_YF$d;uo~hN7V6R(V)v7@WghAQ8Rq348t@wGEfE?b5f*wH8nzl1 z1$Ye$J`Ib943FdpPf-s~D-FxQ2umLg&*TWp!T1k14X21Gl88uH4bOA`Ym9-y2EzF$ z%nv|{v?`+6d{AvL=eAC!uQ!iuf2HVIjqFH^gd~pYRgdaR`%gCQERC8PjcSpI{P9f} zC8Cy2BPY$H*TbS$IHKpmqV1ld*G8i^IHC^SV~*2eMpmOQ)MG4?{pack@XY=^s>eRR zBI1Oq=!$yPCow8fheWmLB;oQFj%CgV6>$ec`#dOa9~)ZKrN)$m8F=Sr5LuQB96u5OD4LH zr3#d#`fH>Gd8E08r+L3o53q-bmw6CRMj(wy$Njoe71JxZQEMtEQuD zhN94`q82hZTE}O>C}fo?1Of@AL(C_Opm~|43yTD&4Ag^(kVd+`rLqAQm^p`YUrVZ3UL!*mDw8vUTR=Ej#2|S# z9HpZnOVD3=fD>)NnH0&Ml=ncy&>0D}JbN|>TPrRf5>KUtz>4@9z$G4ZmyVAuds65fJLjrm(f(~%H&SRO# zUWu+^DP%ED1s3Y2Cx-7hf>v$$(7+$knnUP4y2{9#G5)0M=uF@bzEQm~oAucrH<@7`I z3P?;kuy@(aKfGZeuTek+6*J=B4Ba9sM9DVU49dnyL1f)T)Zcdv?B^7Dhs>Dk&`^=0 z!;TW%&=?w2f2z(ht;&Cl(xfRz{{blXP7<(RRsxt8=;=}@ABr2-`ul5UsDZ* zs%(>Ls?{2a+9iB`^7a^8;h)NImW+opD%DqrMWvIqy%1nn|Fy6waS3$}S|NgYr69F6 zQaH)ZJ}G2qmTO;h5^wPPjw>@}VBCA;ZESR%yv0EQq`ZD}sS!rh8Z0(O_aS4pLt$E? zN)iC0{6;ztz+U%20J;^N;|lB-F`P5aRY_1zz-hsnDZ5c^PfeTmi_WJhW8@#pJu(uew{T}aO&OBnWPcjt zXP+|?qR@HunHRT%49avyOgrJG9AOOSDu=9M9z7CuWhB%IaIieK|8M(YQ5EB)Fkm34bOazx1R#yxdEnZ4+OK(90PO-D>;jwY0we4KSM~zO)B-y#0=4YegZARh ze5hl)io<&QyCOIZE)-?gLL9<^2G9~U?^61oB}LgKRa_v|swK6lC9UiwJ=i5se^`({ z=zQy8yQ~pgom9IkPJ7-JN1YWL*%ddN6^HB<@2(Z!=oP=JmA|~J0XnNbva6vstG-pE z0)3-W?kav9(7*Q3bYoDF_=$+=Wo$|4rpVYWF++85P-7nf*Fu7fT&n|S%E)3iboZQa$*X}d!E`KW2>BF)0|_o0D{7jV*@-@%Wr3WJYo;IW1jjG ztL>A&F`mA1C!TnxdbX#*0J_t#>63`<)6nbF@bA+EytAa~(?r{|jP!H z>%-}*1K-1w>#Gaf>+|nx`RnVuoa=|}>qp(|136b?7Q__?SXFf0S_aP2k^iK|HyvxKuhr`Mjt5L^C%e` zUFzw~1D*`=pU0;oT2x(WG@u16vcfN!NlB)`%aGYjH&6N3LTrFSzub3I3YW6l3H`9qxM zel68}%>a77ws*dEW50Ijzju2ccpabB(iby&zSDQUQ)j+!Zobp-e+V$ZGd$ph9`M=& zhy#!S2~r7A`~Q+`f{y#MClpe(P9mZnXD|@{i<&4aEZ%T95|`6=6T>loI37=wiX?pA zSTc@AUP!yFzGyNP&8)xEqQO)ui`(eg88fN)Po8iznrOMx{(veL;(aBCz;0g|L#}4$ z|Hn5S%VEt#yV7j3S?hMeM!(i>b2-~?%5>;1( zOospb734@E@ACReG6BBNIPDMS(?x=bd^VbmmWvfiJ+8PNPu9y#0E2~Y8?9#B%?>BP zGj8XL{q~SQGQaI+lbnBgnNT#Bx}kFl38N;2XV<%H`f9S}%`|R_+x@;x3Vg0_r^oHZ zQm$F9&iBjP>DEptpxejy^W$qJHkJ?g>Yzs8HqEgdHi)fGCchjygQkC!EU8uqn!b@i z7>0eZmRb?-yrLZZjjCK2PM(EP^nbo7nqFrFS9CK5BXb~&upGycx0Z zj5{oevK(_s4fR0?%24g$49Ih${05+p@`Areo&UhTdD;S)sibKd6@+nvf96ezgBRr{ zvKs0nWRo`=$K-MkS(N2P!CaJ;q(z^UR06e1Ir)?fji?k zL{--feR^6pbmDbgG5(QGHH?CFQq;}!RUijJpNzxgk;soy=52ePetgp@%Y(jdl!zvx za6^=qEr+e(7ab3^AjrX-$3h1Z$QNFhC11%Wc9p*n-!1z7uy7m(0nw32N}^WE;i_C) zQHlHEC&~-^QHrvn?0B3e@oI8Z`I;5V47J{fF4N`ib~)^3S#HZ~ zG)#>?Y5D2G=jmnzkz()W?zFIz1~~8`nm=-C%74CTO%9h;MbmcU5_YZ;g-#rir-!Cl zJnP3=L$d6cakQZChE0Neh}U&ip-!eo(~B5)ujNg&he)1{oTp+%#yIlb0EAV9!%&^) zXW1x3M(5oi?#QR(6#5R%{Uj&E*26TZ*(P%lJ}vs36EYI_29F+n)}I<=rk8spxD_E`v(kSjXc&e;gZpKOHff4(U(&Q0kE&wPBW z-=h%$gd1jc(Os0TlR7}zu*#8^Q8QLXYv*;C?YZ%v_40nCu&GIxtmQn>R38ZiH>Q-F zZ+(*LJqeX$`nXK>d~!ih5v2yDltwp_X`M2u;v<=)uA*Z?hw}1{e(`8fZ9lyal2P6> z*gyvCbh=QX##IK?lvy`pMn534nAK}k*!Fogdc_-|IOcT#9XK}a;vXdEh&nr2J7|<% z6vlHg@q~LnePXt-8M)eOqIU)pP~m3@-_uyNnj7}Y|`sfnyw6*-Tk6`IhpzzhYwBI5W@nNj-4>p7|rYy1@~G)1Z+CYR5G%uSZk z1#+pABoZlHp=N}(Jf?aAX=NO-Vl(DqG7%79jPoZE%>JawhJrsPhLs3JV0k>rIS-!* zYP|KzsjQ-v%fC!C=h{`}j~A;PysTuk!8r^SS(L`C=a@{)MXje18Nm7|Bzse6gWOq( zF!ss?5`G+^#(0{=_yOYF&c;QbLN(naM_eoGTEDAymAOBIU)XKg>(+t{}N! zfpdBZ-*n`B6*`c@2N9E)IKeQD1g$=oZWtA7425K>I%5J*O@v*&*;bTYL4vxoNf3%i zW4XRo-RgpENb_|ijcCGcy}hPti>e8Y2pge)fCO+1($?uYmXL0!CTu)Q)1;vFIP~!` ztXv$ZiLhY)!K_R5t zrAU8=7~c7cHM*Ti|39@ZB^#kB8JI* z0q#v>Ecr`z;$2`+>QHU56K2#QnVS&=9^;S}BZ92RKyL~C6$txIQ7K_YQBiS%0ubDCaIAyIW|DlE6O}RyP2oXXs;*82PdjYGDlyuS z;{}Sdg@^%~j1mfoIip?qFvt+p$%H_?;caH@whUT6JeqMQXqq8#wb9ZK=3c>fEfo?b*1qTJdLVM=jf^nCB|wicYMdTTJ}Y z;pT4%HRsK|M7gvyvdR@MHL~l2YAtb=j6<3$V~|r&RaD>(|MD`_A}iCn<7=91Z+)71 zNVh2wsNso{HJxzP%OFPits-p+BbfFt!cM#SC)GI)? zlcWGyBI`~Ws#Tc!PJ$e8VbbRhc@$W{yrMphseF2!qUex;^8K4h=r0K46nqFZN5fPR_5#vEoXAwb} zK>=lc%0~|FN|92njxuakCa-=tiw-!JzCR=b=iGt_D56R%EsBNRtVTnmIDJYy19X>z zsE9n11fBRa;pmraI3&5T)TOKML;6AF^h9F%IAYu7JUT%_Xj%PCiM&@v!WDH?Px-@^ zjl))h!#1B#8Aew*zetA57phJ>ZWq7BZ;{r8PnJBO?jod0yh4StHBo zBghqy-i;%*Ya@PHkiIAqe;-Hwl1TWlj3Po2-To19Ijj#MNr6DgXG|1W&Kv?j*0o12 zj&?HOF0PLL29AfA;J}$gI%AT&hQ>tomytJ*A zvJCOSkyfU2fQw{8I*O}7W}@C$x>0$e#acR!TN=K;aXh?tPieUGQ=;o|BDJ#J$+0T= za-wf@qJOh`rGY+nUCQoqe8_onI7p^CNoK=-pr@1)(X+FlmM#pTXL=HH#u{=K2Wn0P zYW{F?Mr3MMW@=7*YTkNkL3wJ`Sa!`>c0FinZE$LRa%y97YWr|%M}`To10%P)Il0F& zy)PoSz%z}}hs<~};!MrgpCmU>C};bN*BpzLRY5A(dA#US?wUpF)_VMQbNb$RyyR2v zL1yORQSRPY{!T>xMSJEgY33bgrg#pjtdr_GeRAY-X4H5RfHDj8G+fg-S+4x2TNWUw~gxkOBH`p|po2u6{hNtTdSk!VYnSXPk)RgR2w8b5fR zFnXRid!Dpvo~&!0Jb9irS>j}K@K|Y%!DNo{Dh1U#-M4=9BT62?Y9r4UJj155z!AK_ z>9fG4BL9)3#O*WlQ2rc6P^4KM)E@QF++&mS}s%pFVh_6>|v#8$^dX zJmW?x??&aR#KNvvql;FP>_&6&MoaQW`_pKLiB_i%tRt-2PuLLSQCO}`DC#fSlW}x! zYn(9;^|+(-!Q>_9Di!;}{`96+0o48t8X6+cbio0*hFkUbPi>weC4rwsxhFyo+F9`} zg{+|!UsClI*y&syp4%|Cs5l)D=`gK^2J6GE?WZlkjx4?(>NYs9dIhbDvEtGhH+N7k z^Ka+ktR2Xg3P_|tB6#LJfUCn21 z`Wejz2s}6;TQ#iAqRq}HZ>t9>duEf```DUA_Ijy`_@M~N2`rS6v}T!&W;U)qgsnbs z%ufj^oPk-lkCO~VN+sZxXZ}s{%5W+^VOyh6xBI9xqKn1xsIEtJrvXF$VJlr5R67_; zSqql^ONDrLi|EpG#xRO#9&Dc%)eskNix6!qE2);~c;_X4^BQ?sBVE{MN^OEs;48An zXrYIOu8xMd_v^us_S%r)d!LHzfPwCSk?jD$B6h%vcEDC#^jFb{5f8y7SSQeg(OT4? zbFgCew7_yb1s>G+56qz;+My8Hq3|~0*>B@hwApUQvs_F9kL73u1Qq~p)!1=y?mroTu+u@ zVo{|j$EOR+hwI;JqAPZ6ta@z1)>(MAAtJrEYQSh(d~Dfls?==)8E=eLe8AMcr!YKZ zg?8dVc4Do)?-_iw{G~=ocjD@L;>Ly#inrZDscZ19c&LKqzI@_yd;(MpCV!14E@qI& zi+g-^5-4_R)jZ(=Y!bhZ{;3lklyV9PS3UN2JR*Zz_6pwDFx5AX$A|zwi~DIM#OcM@ z_UfbYsx2K9BA%tVTI_yRt$LWcY#@bxDG~b`1p1z3AD>x1Zf24h!nyRFfVBt(o6nz~ z6{=c3gwyG=&H}!=C6kl?E~Q;)pH~c@*HNm=RZTFon;Ft&RH9wfZHuLRPwdi;+s&QT znOYU49FIQH4S}9C7h4rIuR6`CIO`@oN+Xl2DAIg|Ay-}W$(`ChUkt>|TS_w-9FGw7 zpVX3Fj^>zaQCt+XP48i!X3(8lq+Cv4pX93U6E|1o4_9KPZ<2;s&Zu6w*;?xPoI9tS zuUsit=w7XpnbBgYd%{t4e4Ya;lT#O)uXat3$Kfs-hIKKo)0@z)k4%qS;PA20Octw6 zj*D%Tx~)o7b;y@b<%v{5*v=-Zu5aZ`5{?zAY3=qpiwvHxFwkzE@$B~5u$XNw(LOgk z-ppTyZ{l4I^3ZIOI&*C4uF8ye(x+}fW{lN1PcEm;!H%x0TyJ+6Zy|GyH+}8fJB`Hp z(dxC%yi;!BZggIke~>8X{tCM+1zUJ=2TK~9{J?Q^T>Ed?JB$`FP<~6{iNdAq8+BiO zs9_<@mpgZGYbstlT3l>2x69z8TYRJmBO|g(h|o{l*rj3$I4ebQ_${( z>bsfJdj_|q&!vlr%~Jr^^pz^3Bcq-p^v|GhpJ9+FH-d=csObYYe$^`CX*j{%WpXO= z$ODz$T^V@G>9->voHJXAL%PpV01H(8n=Kv$L7$v6Cb=Eqi1P#8{NuIFU$|5$_=mLO z9P-d(iWxJbUoQ9%SMyhP!)y1qXZLm~*J$!Tf~NE3@M)%ry@cO`ZpowOjXk@b8Fx1c z=ZO=SpLGH7GpXIZ$C^`q`Z<2awTat};7UR(oAX!EGk%YYyNz>@_oH~EGc;Y7jrg7P z%A+&-*@=ihh^#t>HSq3%$2&zT;s>56=Uq^c1PswJs&U!CdQm#?+x3lpc&g*Z$m%BTb2?0b-J%5@Y^d_pAZ2A z7&SY2_AJ2a%4ahK`X*=bnJxBtpZE5SbzZJ(s4rGI`}cbDYMRRH68%fct*r&^_c6Y8 zmfFv1+2`)&pW*I_C^fIk8|xkP)QOO8I1?1g6}S5mD?dAz`%iCoEwz9Zua}$4ZuZ5M z?F)C1Fdz^JB$(Oqyxu@aR5W9W**$?UD8vNIz+0l>C@glz%hNmJ(f`Lc4gXCq#WMOc zu$hKV+iYnvr=OXEE(u1k6hSVZ3K0rTEA?19S16H6C7W?ixmc=LqF815WI@d&o9?)E z-ek4HCg7I<3x#;O(rCVdMq2blwb|-;GG9gARJ`74{etGhac?Hy3+@AlC)G-`4;YAm zWv092a4;Hl{m(ajb5za|N9R9=X>&53$goj$<7P zYaD1m&t-Xee!V}@t6BT*cFAhCvqQPmb2bMKVB0kV!xO^~fTEH}wE)37CHM;(GaP5( zpTCS~e|v|%;fq^No*0Ug^1K{Cn&G~$2L%kV9}3%dNE8X$WuhcBY0^04fhKl>=lh!f zN*pIh^tffjgC&WJIjf_N5YB-2M&gSF%}JUJ^$cm^f^jy8E8GrMRH-XHIod zU`x`=wvi>ggHA~@U?ZYMMvj`QBSXKbr=V>jiD$r{8wQGy5HkYFFZaEYjwyNCJ<((c`~cKhFzEB zil!0l^QvB`jq93GZk6l0c8hHDiuK6V^QL{I?8}yGfzHdi`%Sjnj^_mI>xMtJF2}w% zxm@dhG_zc*o+7eLQ((Uw40&bEv&eoEAVk}_VR4u()3<2B{QX}UyARhzc|mvkMb!Y` z$3@eGZO1~viLKXV*McwiZTG`>$88^gPU~bj0*|YCJqGSU^p3B+aXLZLmv?YgDTnuE z!;7Eubv=}x?CA*qu)3FTi29)On7+#S>3W2}=ksZ%r~C^b;}>I)x)Vvy+Lpq^2XL|b z3;wAGj406yhR5I!XG{=8g2rIzVJVk6fdOupSPyGDYfQDikjJ+yh-hgaM5BZ`E|b=e zR6iR?OOpTF2yy^3CoYf{M;X$pR0!pMHe}30_qaQm@AW9wSB!=TDYkTwgsF~~mwBdz zuLy6KhLPuy$PhKNbcn`LLHiYZ9KB^Vb^eTwwVta01Y4atKUj*w(%T5@;8lQQS|J9Z zk{ItsonS(iK@MvS;Up!s^9vTqxke-Y1cq`{)UYCMQu>fMc|}4@Xg)rru#kirDsj&q zDL(y^gpj$OHp`h>To}a&T`7EArMy15a`N{(S!*}IKW*Hiy7P$Ip=?6?KEZclUjn}% zMV#wAK5ZCja90^Pl8Y!8vE#jptyOQc33l}dbWLVdS z4c-_tkvY-GggM8uEfY%eln>=X2N-bz?5VOp^91S67Q+4_mIT5U@jrg`VN(sZ3n z>%{8fY>L1ToX@v>av5}f&9%3oslvsE$K*l_>D!)nc43qc z3VW?-6(&C}LR-!y6c5M4>bFo61yO@l--(=6+qez1ApPQIp3h>(@stD-Ou*_pfpOP$ zG@du_M%K6YOXtK~7A7Orda7@5-eclPJ*uRg4EnL;WZ#ID>1LL|1Jt4NoX4V` zFpnqqiRb~yeu*xUW>*QOSH>n}udurq@kn!Qm_omKE+rpp8R2FCC>;@)VvE<- zyh2O*1jbDygV*Ho_lvwYE`v`<)MRAWb=>=uKKYx6Vh%QR3?DUEuCwCGMUEU~ctDP- z`UfFLvq`SJ%}Lx$`XTX))0l!>buxo-*KbZEF{P^A^aVs>?QM670ofrsJ&6vmqT1Qo z4{>?1w&}6Lw{jKUVQ9``b@t#}MQZP*GU={!B)IoKT1Gah3t-}Wgtelr+t??Qt(RPA zj&U>9&sYt-8&+;!8%{VcgxDGU zj-xdc4_zD7pcNBV_2G;uzQ9&@QV-;_1{XE%V^Om&u7 zWTUTZV1koik!KsUZ+~T==56!4xtl$_Mjc#b4fP;Vf+b$05YFWn#1TSH)UB?qT_1gj zX`S_O{df<3$og1^OGTIGk9x9vIM>d3iJcz#nc6pZkh)Hy_bN;fi zUTWPOD)cTxvT9mUE?AlB(@zH;aRa=C-)~frgI}&}zS!d%+i_D3(+K3uB%ICxM(OE~p#< zPy0bIDrz((U{DX(09Y)N0UQG2*$66Omjt{JDu!Sal>`#$P|$XiVl4j&0kv zZFOwh=-9TMe6elYwr%U1oO3nLT+T13%c@;_t#@HB>0|5WlX4c_mca^#>g0YT^;w5S z9>!wZkSMbnleQs{b-`MbEQ`^ij6)4oIYICx7x6C|Kok+4))vvqkSHFGMFxgjq)K*9 z<}h>_Nj()w-xd9}!3FXd`u1$dWEU7%WFmTO=9ozj=NEzt8Z{aZ)u zHg&Mcl5s|3VqijQh(;(w8LEympa+3wDgJ}43DF)u*Q2<^497T=8697r(2w^}&BNHQ z7`EsyNmJz!9wS!8gO2iVawSo6wYOOQorIP+Ej1ofKGb6QR1=qz0nfg$5R4Ujql50& zB7xo_mh=0!lD~}X|o}snXuv{MGB`*?Ec)%`&LrEwPLHKBdaaa)T8gsk}~Tn6KIVK%?x?6^?vrkDzqM#o@zJx3!b# zvlBf*3r~x(9!QD=QvAQENrJHD0UtQod&hp{r|3EsK9u;r(R)}n$bqtE{z#>M=`$Lc zzo+rF#KxAHCc?PlM8w5*?yh6+ME4^&}oB0 z5KUS)-^CXb{}E*}rpZY~qnqaT11|pXRNF<3$z-!rK{+80paf!k;y&CRNme)pv@Bpe zi<+{GxssCsr6|*+yw;J4TRZ=(TrdGK{}_Y@_@9}Qmx(7?bWd$0I2e`tkR~fqo9kL7 zbqyqgSgzVv48Iu;2T=dzYoDQGO))mh2u=M88jmN#1Z39SN<XT*`n} z2r8!u_*Z6z(yXe=uLf7H{?|8M!Thz%YHpH!)+k$1+jdsFR2e8~tTJ&bn>>*Ic`0&Z zZDD4tc63>eMq3*%8+2z9&vHIpj?^%=Q^HG&oM)zpsjQ7e!{>g|)dLJ(oICGStUL+6 z8t=eh&X4OZu9DWNvJrsT88hD*qW%7%L^(%GHHSK0cGZuhG|;6P%&#+KPyr5IJ!lax zOJ6+4df7{9dq-P+|3%whcQGzoot8|I-e&a}eF}d`66`~GD400JTJfS=EL*-HA8q?u zhti8{D&V#Be746TadBsUrN)sRPJB7XYx~7Y2RyQ^EI&Awq&eX|J3*q){WL4;tGv3y z)sclf#iR$9tF-I7yt-4n2Gz5eP1z;1+*_l8!@1rKrvF8BQ= z77y`f`r*`2jpjhu`y4$#iHzD{WM~H+x&-(?-kNX26U4Pt0u6YBKxU6fSG#a@g{Qj! zq^Ln5+mW@P`loV}n}!KtYcE}9IPYw71GRnglMW-M76VxkLE-vwjCw-yI#&Pt;7NxC zsC`^wc&cI;x49N`uHN6H7q5y@k4tjytVXO#gD0BZ9i?l;u0z~~P|?jqV6q3%vc9M^ zB8H(Sm2+53$6n$Ml#yjXr&6~JWc2uH95IMZQR48dP0wXv2i?uMH*~j)HlX5B1HH~@ z9xG7rV}J9Bk#_v9qV}e)?Z$k!0&jng9Isvzf8(+&gHbK+cS#J*6h1Al#MU(_ zQ7y69<*!qRFbhUD(>qo@#;ilCCBaG1>iY%!T>e-hau^_m`3S0p0yf(4J!mcCpAuDk z#OuVjd$VMFh@Z*faThr2x7g#gSj*~MCnUJd48rrb0&-4*$i$Q3BpF-OuuKl0ZV^n5 z4TSbiAK;g<4Kd>Da#Y|9Uq}obF-(7lL=oy6*fShC#ve{U2g$bUWq(EZO{~iHFZl1? z%lXD^wB<>Qm(gw4DfZu~Ib6_1&_fr-mYE^y>ivYRrOk4~ESZ0#r`IN=?FCtRlzu28%#yQM;t)RAN|^3`q^8p!eE`v_qy44nGM>(#f!tJ#jn}lm+dp2xe4jnpN&1>m{2wC z*gAtPsQ%tV%PlBD)w6ov&T>l8;L(xJHI(krUdYuk<0bUpi>=Ia5UY(EAA2MhyOzx} zjY(DHFncszn%g_MyV!ov_iF*z5({kN1q0G~owNCoaritp#}mEA1D_MvTD`b9lGxzm!ED>~;&ggDwc${gT=ut}bQABM8WF9{B1u^VIF(vNq?e4LroW-^t z=W*EAUlV`p4f*C>6H`2r65h&=pA)M&%j-QzF~}2aM+I@!GA$bNggC4C+7z(Mr~F!H zvR$fvwO2`%Xq;1lzPA)Nx7KyP){QH4RP6>kl4g0flxMT&0Nr!6Jex{hvTV7+|J{aL zvLr{Go5HlWdb(e|jpqZ*`r+E!bAX;QFJwXrZMBxCMQmIpOzmA{T&70C0=^y%Lgtpj zx&{(ey?7nkUfYpTfewYTLILN?@gk`b+(y#eN7TWCO5AAs@rG9m6Ty zBQe~A8Qh~e9b+Zj2 zq+X`8E?3H}=j&-wDc=Go`w*tSCD&Fj4?9z21WjPJf%>YlFqUX1TS zuKP|6c(2v{V958V$M1$?h;K%h<_7x%#{n=b|U{0G%t z1{B}deb*Pz=j)!29~@yt@-IjL7z{3RYAnI`iU%HL;tGPnU>G8WZbNDuk!TFsIzF*6 z{Xt(`r6dw}8e@-S9I;-0dczafTwj#FsF|0@+NS=sNj^hMiPzT%jh9 z^(y1pLWxR|;H0E85TFXs?)I1rU!+_G=u8ISL?m0UG#HFG>71+DXn%L)j~W5b)LWgt z?{_LNZa1r?>hKXVk?K_Y1KN0Os?->DY9&$-ZSfs$Mif&?7yywC6ef%bJeK0C7Q{!3 z#Y+A9Gkm{Q3ZX!qjyCc%?$%A1@CO zFCPcTEED)y;vwG$N#Rr@2uU-6Amq z#~i#&G|T{)I68!5-(fF`>wAGXf*z6>Cr%It`yG5pVV;w~Nib5BBy&|PBe@_C5HI`J zv=BB<*$G=uNCWt|BVg1d2px}@vnrLzq9zV4eV_+W(f94NDNXmiOw>;|gEZdD34BsB z%XdF9C(Z~#D51;>;5j?dUTr~-&sEV*qRh*%e9F$3%U>kUSBh?oqe7k=iOZ<4X`&LS zp$9lGh8aaAsc33V{?|8UY1wvzL0i%Hrg~B{4EjWz(6k(c<;kjxL|ao+F+!LuRCh}L zjw5JUYyJDpEYEKb1-raqKTU(a>AYy2vf(-(l(N}*;LN5A0#;f?r#b+EPVI}DF;;6E z2PAn~`IjKFvJ;4*yRsWVpvrC#j2Ec*cVC{bx||DwPGE%Yx82=sxTf$5Cc){Inm036si|p zzgboo)8))z>8{k6vgv5;NOi=B`uQNV@_)-+$v;91;Ze@UKLMBignR5H;R*z#dGUfq*a+6i9nMBmU) zV-;Qr&R0<0Y6Z%}4_KWJc4+`7j5ULS)dV9b{r01-zkdT1;C2<_xD;LU!<{`7xKPb zg{T5Q#Y)(pthLyQ)Zr^b%E85VBcS7Q!k`8DORe?-mWafaXkS{hVo8IGVSqgl84j`3 zq#(XuNTK);dwhNhHVzs0g@^1IV@~=|e7^{GwxBu07yRR5G~NvbMq&dcp9X`}*9NE{ z0=i)&bK^^D<&kKW@^Lv&C_M|1af5^ouF9%nB>L{`j#E$@_2w z9+IR`AW%FYG5sT&f@oiYwmFIlSMti|0=&ou4bFO6C zq!!4}vO*Z7(>y3alZ@u`oVW58HcSV8fQ_SNhkakJia@uZoGAL85(K1*W`#M)Q+JZ) z5pfpU7P=jxkCWG=vRwKjHBf-rYJU5s$|XFX^KC5eBbltd2&4rt?VG^O;i1T^v6=P@szh;o$H5&`)&#FT^jkf6kJ0nTt-_|9nj z_ej#O1qsweW~prNsAIidC^?Tha#@I5a{4GvRr)hx5}YKNU)2RH1 zUbS{LgA-E>&a{KZikeu-t5R2Y!f(ju3M7l-Hp?&6#@#mLl5FrP828O-6_H>@Z3w)$ zLk-~X+JbZ0@+u+sv4@qDf(cQz3{gUf2UdB54!{en+bopZB!J>afi41*Of|O+!`$Fp za=qhHH~%oOiL6CY4F9RDx^s*Z;#e<~F1MF(NFe$L?JVY&B!Y~zwFS}C?B?KA9S6>8 z7I4kcQOM<4P(S&Ax8SH{(ZS^ifdkv zBWe<;N!@RPTClr#Sc{K=)<9iopNm4J7XxMzbKeM!axBg?vCP^B15w)iRB9ji#ogQujH(9D4 zAT3%V!BNdu8ZLEmC$n$HY|UcEPf!r096xt!Qb7t6O+&D>x1+T-4teG6B~YYAnr0n! zhSpA>QWpK?t)pT%GEW56%A8W712(TNtS(f~?j^Cr=Mu{Qgxl(!44m$^(6NKSQ4@Kj!g8 zx<;bDbdI<=hrjr{LdX6zn$dY-3FKP4{HwcUy(kyj0w1Y?4ozQm>K;G zj?Li>k5~&|=j5Dq&vv}@HF>As|9bAk^Qr&4eZtgz_c&|&bqAktmaO<2g^(BSOzfbI*00a2zJF%O1r>ufte_6LPM63s0X6(TZ|6(Q!;Huo*E0E3;2 z;L3qKN^MpB8^kXag!$(v^ zgI6R#p2NYoBLG}#-JHmfBZaAl2XBBA(J>NnI1uqDN--l5b14$@%@Io65z8==xSA2G zD7vaUkVqksDkzd_)w!D8k?Js#Iy#WLI^cQFNxOle)Acip61s#tAV)JU$0Ow?$CK}t zv=s*|W-3w^AW>%2Q6}9{)W=g+*HJabQ*=9gE2q@8NZ;Hib>|)Rq677^1J&vs%_bx5 zBoghhBJJQD?f4vdKN7|B9XasxjsmDi2a!Pci-{iUo*s^g;fEu`FQ&ZTj#LFmu^bN0<96JW_1v=w9P{@a(@H#>2|Ni*yod96`-t4j_nf2mJh$~c zyGneQ^L&H%yuf-sC?`G$X8s?{d@xS@aLfX)j=TiSf+S9Y6b*tj4}uKLLM%>kXZL4+ zCxvXSfxODXLQcXm4Z?B?4;kXhB65k}iREQg6j3c@Q9b5dlLb*rr*v&6G4n(*`vo!Q z2C>gt0dy3B2xWn=1r9bRiL~$h?}J1hvt+l3L{Woe<%47`vlIgpKFI$z#^6B)|F1EI z7|-$lHpXN!3xEHV5pO7+Ef7zj)ER3in=g?skj#>7EMEku*IS6Roc>k&rw0>E!tU}{ z!`~FFQ0KgnM!nf!H$KTSnO3vi;U4N&@e7fyVK=-v(m8-4OY|jR*yLl z4R_UESTi1q}HCndbWgjeW}>lC*Ru0M?*ULCC38Yf72B zVOpSgACijd#VH(Tq3ueTW_w+omSlN@zLjJLphyv6P4LM_Z_G649b@nlbQdtj&{>3gAIK5lwG zd8rv}5Yf472m4*Ta?8m4sU1d$W329EaXnq{Mkty$7@8+~E379*My>8`*!e=J9S0sG zGpD(M)J`+Z=sfqcT*%amLekd@PI7WUl*a{GHMqt_MZ<4sOxtwxaY;AiJN%)U^4Yj* zP$2WPYE`oNv}Q95_q<^tHfY=VbF=cf%j+1p$u#; z_JIGc@kdb31w;JvU74c~D3Kc3>R?L(%GfxU-{YV2iwhzK-`L^_heAoQW56C>2PqKz zGpD`7fA78FY9z{2(pFDW#U2P@dr+?jCV~cj3Kw~ZUt}ZI4-Z^^4;xfl=G(0hGZlVc z#MjpEDiHH05^Vj7So`58$ek}T78>ghLY;*ORv2NNUK3WdqA5j@Gh6klFiW4v#A<04f zESe^+NUNAwBz;JM%E9a(TFVhVJBw=gJ#Mvh7bZ1uC|tfWmRDiHn0rx3U(GbGPkZ96 z*o)naR4ffbtE4rt@aH&NLdI0nF@0J1FH7yHjI~L9+9r4jTM8kB-tWK!>DpY*-4oD=^!ztV*b(8SOZMqSSE}U#TGO9d}4g4AAY4@ z>aXI;Rdb1*g=R!77PFCkqVZw^C(-i%Mg`HX^UEL1B&o_3{2M@J7wf}`zJnv_PohMx z7HfhIoV>BOa(Qr@vhtrzllGV@nc_)D3Q6h8zJm8kYa>cGQ=c-z;Q|Ty& z@xP!?HK8&U4+EGgLq5(GQZxW%EGmuRc+|Rtpyig8qE!cHR-FuIwGQ5hsyPRjhEg~h zb2-4;f`?1PUE+615Mv!2Ncq&%GI{yuK76@-sj=Ay!bUITeR=Q9MWB<*ToL-)7~_0y zN~>m0WgmZzyo7%+R?~MQ`8M*>@gX*SWD-?%3j?bMKeZd2C|qyb-DPN{a6f zhEL+ z#tD6B&p-WmTXvyz)CLF{Ed%7Fwc#Wa1~AR){ZuZsk@_EdzjN4!n6qo6l(hE|pI?Uf zj%tI*R(A-oUPr`b9bCXG4oI;yRAr+XeHYVFk!!_8)Mew6t2>O*jnl^eJ~^c5KNvHF zq)iw$)uk;*9z8o90w*)w@fZP&$9Zo9Q)l-RnPG~i3F^huPlJTn%gck>oQKU5ELSuN zlE%Wvq=^j^B&r-1e`jHDQ{cNszjmIR+MM6!9qye<1-!ZVW8M~u&>oB5#ZOe{)qGro zALYE`*?#;(apnv}g%ovC;6;RKu~YSK5cz9&oQE&NsXv#Y}&>O3>9&>C0xvaPBH_Y!Iqmw2z#$L+h^-;izZYplHU z#_{%P*Pdzld}TzQ+Q zJh9-MC%(W76F;B=I$*fa%wT6EMUi&%me*QQzJR4|EpW!sh&%Z_l4y(}cdP`u#h|bR z%0EC)t_x@$35Yxp0bVCibD$KVNo2%9<82ic$0A=7B|!M@-))=|w2y*D#}=-KUujZ# zK>pc^1JkYaFr8F!-k8e6qcQpHNM5tZkseXuCv(!`>v7g!>Q^;u58Cj>69tZuY1=YL18^2(;>+621Pax302(oZ6SYgli>)!TuS&xI_iqfxOd+r=*ZLGbFZFD#+Hb%FPcu z3Lu#x5~?!%obLjw-MVSmtEwf=v8Db9U7{HqIXi-WsNBJ`&o5Ns-VzD+=5SauVsHWC z0nSGPYQ{yz~T)O+na(8BA~T`7c7F2us&P7pHK*nR)-g|G{96pGZkdekLY68Q6> zrDBe@xx?W2mL7D!HL*y_iYaTjrSgEi(ug5(J$7 z(Y7{=X;$#&4ROvFb;&^oG4ApH3JwD|cTO>j%^!+^aF2y;MgAWAhFNunSe5*F8)oL} zfGXtQapL>o9G6rWLDCXIEN+F15du=`yQ20p13ea|H@?J$z}nQ8ImOqKEy1G1lNs1* z$La3NW*$|G9F*HEUO|r_M1dfpfgmPH;H679{fi#m_Rb3dopBLGD2FiRco>hMVvKMigF0O;wu~eDf{`!Um5!puhuw% z*AzFh_%8C)PWAs7V}7eCL}jV}+);X8%*IpQ8_*I++0r;h6Idt`(k0Ti`_p*L6Vjj@ z)s<7g6`(;8q1N&sN-;pv@r|oiarW4atndRD;-F>_KvqGZR^^c*%~QipQ~X~uBA_xm z!%}bZ~> z2tPS(p^Ux{t{u>DaR7yEEFuK5wb`Z z=!LGNPn3U4ln9BjQZG^oD+(_z>T4`gdn@W1EOJxNJ=+z`J;*kD6S64JwM<8NKP|A+ zL?z*%28CvV$1HJM^Wrr!ZycuMPA~C$6U-I%)z2#w9xDuOD-8E2jR2l`#XprcftR(Q zlqGVOC8wLEP?n{(m8F;SWX2U+VU{ycmfvBN7N?^Y_7>DXl&tHQD7%!`gy-l6nzOv+ zSZkISqyt*o0GIB7*HOSHRK=G>dADXouSG?FIba03e9WU_D!rm_tYY>IFilxGE?GI_ zQ8}Plxnfbdk)CAWhAt6a7^zt$nqGP&Srt`Yb!t(1+*WlpR&~8rb--EuL|OfUS^cJ2 z{W@0t&RGQ#QT6;*4Z2?a1E%^bz2=uxH4Ik`v{ud4nfoLr0EJ4LcLADfjTE)LR`8&r zHjK>{v#x0^hfu1HD5HWTqK+)1j=H^$*0PQsP{*)d$Mjyu2=uIHj;LqNsON64=hdp` z2hZTJ#4tvEP|^dy~%35c6E&MbFb2ttJy)TdDEkLU9#DYtJWo>*?YX%ldIAPt7Q$k z<)3Fua7If2pk;*8rsxm4Hdd=1Rg=C{QxaEW%6en6RBL8?Yj#9y7ED_Xpfz8st`@G#FqNNYe-s#!V8`04Z z(=o2q5tz|2!__PbV=NcfP?piUjMY}k)mo6zxjEih3_S1Lh3Q(?YC8P3%&EGdGO{1V z+pjY4c^{&$xw?01n^3~^XDvHk-#aD&9dGO1?@}FK1sf->F z?ta*hK1S_+2CII~%zkd}9!BYuXbqI5_ulRHUR-JLLp>TtO`Tvhnxsva zlBuqnDX#`A zB0M`@Yc)Q0j`b|qi6u&P20L^*F@?}Hb%{NFeKB>yJ$+v}t%dEEeF-^|?<1K;_rH<|@jz9Ii7{ zOob|h80z~vPvnYS+074%^L9i<_8ZA@i9X1r4=D^kb*WlK@vYv^pr#~BUgm{ z)FzQG;?+^oRYwhsiWp}Iy;{zc^p_W?h025zzO(GpyO{73nP>4{sGeAAlxA)W*bp2> zIS+LgDk=;@$LOLF7bp$OZ;9yuRv<*3m5lRjb$1L6Msap;&NyApY`vrKI<0a4AalLP z=S>7L{(-4OpwQyox2=Qlj>847K5-j87T)7p|*^02KP2;`V&Aw9z$r}*342c+V zIpZ&~Hz&ieIj4otf9V9OGb@zEICB}?(ip(838?+C`_at1{E2~t9{`9z>4yX7M3N@@ z9V9Y|BK2AfoY**^VU~UpyU__s6chJN*+;GQv%V377d=pC5a!q2lHjrDPv3#{-id!l zQOt$#AX9P&EFrX&!(pS2m@-tit(N?V4x3zoygE8NU-?8@wP#r+XBPUHEFK0`$KUe1PRV^VhRsH3d&DeVa;ueFtfh)1$^2`MP`0>ZZ%|At@xjYB^_RLo@<_;G#AZXW9tWS zCypu3{rQ|V&`}@hx{w&VSlPRn1HFjAy<{M|jMTkc*`hPZQtjfUPLH01!nsne?Q@tq zt=2tM#_b#o#f-yQEk#i(mL9v~9g7U+sXaeEjviO#MRkBX?ub4-j_R}KJqM{iv^HLF z6FRn68A-WD`EM%4itoxf0ypKZ(9Ro{agPw8U*6ts=Yy?uGR3 z!Ra0x@SdHnpB!zUo%JRz#@A)HpD$Y;eDGdM+x96>#t5$O-h5tOua+WWULvbsV&U&- z><@p!e}iPNw%N}~z^6>#=d_sDG5rS|+LuCjR7v3XwBB2}uPfgBh8gh90Po$D?%hQ1 zy@v0-#rD0y_q{FWy@T&@J|jSM_BvheVbJz_pW!3p`gPp*BWt_bQ!W_5_gRVDz2N(a zmAyv_^+E^S{tTmgrHB980>114KX-kJOz;nf103HI&F?GdSF@9xxh?<-fm2a8WgtDHIDN(rBGMYT(4e!Pwv$ zQc*2IDnT0+Kie9qzISQH!%5B`E7ofDSBrTpn=aQ{%ntjUwVp3^x?Dc5J^^ZWx_wSC z)8FXo&EA0b4?f%pb^HCE5HhN&^jHg%sVpAfpE#NiW^+X{IifUeMixtzI^DrIT2EGM zB|tUPqZ515-gP2(yo=6^L)(A7QD9=a-0r>K>kmwNve<8qr;8za&rv#VE?4WFY&p1F z9#3M0!^gcraQrBf0-ju>8ZpDkq|il$9? zDu~{iZOjhgIu9@mVTYj9jbQp8FpLm|ao6Rd={TKGLZU|6@k5ndOylrw$n(K4J^3FLb4a4M)62G>*t8E9GKf<%~+tcgOD_>n=k2= zLbDHD@({rAl?Oqpa2j&K5qQit5VYLcboq9()O6KOJD0Z_ZZ_4n`OhKPxBcF6Uba0u z?^rin+7lp`NTM=P4CLjEL)T1DhtvneNzj~CVyJ$m5Kx53plRsC^t<2-t}a^PN74FR z&piF+d0kEqBY8cFC+c_6Ft+}B?U~w{U?-GS_>9|)jWB8ZuJ*ZL4n#ycCj)b7ASHM9 ziVBX}&VzDgAr)0PaNqUo6OujhW2Up+E<;zZQmw*wY2U5e*KJyvG@OsPPO`eATM0Qg zi(2gxKCj;G1|6pyOmonEwdqoc*48X9W2Y)q#?yXs?N2pgr)d3yLVHpEcYFB!AgIK- zxm^b1)9Ey4ir4wHV&1*!60g0D^R#8WoVC5^KaHd5$mRHQ)pDB6#bhDm$=f_xVte_@ zdFaA*F@}iA;c&fK$m?~B9?fJw1chzw`Fjzs+uQ6C(d=%TEz?(S*V>-XcYK$w^K0oN zM?>r^nC<9v+V22Md6%MDN%bpjcrv5Xp! zT7+T3YQl7t2#|}+2)V*W!pv9y+*_%aQ@Gs9X+`SqV6OBNrjJIL3M2l+QNxFml?yWq zBzmNugFe@xwS9^(#AQMmgu{^Zp0kw1&m$DiZjp`&NrZFz**a2!P^e)5fQGj(7JbK` zi?1Wlo`wyIZ}F zquG|pINXKCDG(GAK!8ewi#tRmBuaA}N^lr0DWzpKm}(A5$SF+C=ggEBGnKu_1q@yP zC3GOMSxVy%PM6Gr2s)wt72gpjFyPM{c&ts>HtR)-ob&87K~q1f5WiO!MMPsRxd}P0 z=8x=2S2@e8;vp`=ij?)Q<4BP5Oe(UANsx)8L@a1+_WQ_|Lv9SG=-;M{>5x$7kx220 zT}QQhAH}|m=a)X zedaKgCfjwSOu)qw%0>4_wS4z6R*1#YfNxBqz~(?slEn&WM8dT?zkw>Wm47C9`qmew zuvEYOFrnsu+CQy{R2#ulsWmsoGLrmMX|1AcsdGNvB5PEox=1Kl&Y=ar^ia$SSEz>! zx}uI~-w?2CjjrUmbSQdI8q;XyP{gHk##yJJgqmVvueE&U;+k)ZLZk1E$$3p%+geIu z@snzfWi^?tsK(jW%Th^e#vr=AwQ|63B6^|3ew)yO#4>Vp&J?7N)+Qf_W0?( z2cDE55dK8DjFq?^bc31(C!G;W?xj3aWJH@r^Dn4nL;o-CD>F5$#;0tz>>FqM$nAkS zu~wAs=Su}A;|hA<7g|=|VYaLk_g2pZyBDhe8C{iqLvf*Wkz(GKm#36ok)m`B0q7gYE`(*b4`+^IoNM^w z$;E(88&N0}){Q5ZuG3E|!{>|*$!y5kC!QOiGxA2fY#?zmo3$N^F<1XRT0!nN%Ztq9 zC0zdGT03ibC9nC>d-~MN_Wt-;M2k)=A$7J#39*N%&x84MWFkowU4V}mixF6 z4RT|9N$0Xpv;a_ zgzDQqOq#1fD&AEB(~tdLTE`K~C6(EF?n5#>_bl73+i%bKghTIj6bxlsG2|6e#_KUs zYxA)(q;pb_?tP{HtE6GLbI1|*4#5S86QzxZcAXil>V0Ku>v?6n{oV-ddg`sVy)fmmo~e7fDS3W8ga2}^SL%MDl{t4~(|fxW zo4oH$?VsuE_z))LyFu*!anW^~&{@OJzW~!y+TWEI$NiB&yF*nn8vzGBfKZf?w>MvP zQs4dCiSu-x@An5kyipe-b8j$ZXXqa$5ak}Uk8U7+4=8cZ&3Od4QO|jQFBUVOyl45t zc=sQ7I6Q5Vr~aNis_Y>lK@23`nfe}5?mqYQ?&R`rQh#W4H_4vLIp-@;f5N;2Nez9~wws7D;NSJ|WfDvUt z@BmfXJv8tXnW81Vt{VE4X2bX~J5HKcY!x_^&|&IL1}GJq>HS5+LeLLYyV zp^__J@Euf0s-dsmo}DHVQ-U4RLK|Q`&V3#sq7*oY7AOoSz#2|Iq&r4|!7PU9)oFLo zX||U54?%QIJuOgvc#b_CsbQGDV|eRtQ}Y`F=d94`%kYw$n7LHexB;>~{tO`ofd0N5NYM>iRDC>g= zm6D)Sq(EAxfLd=$h!JHZ2xuckp)zw=(g+GcV0_{N3Ge+taG@Y!9+62yO{gN_0!CJ~ zd6wBcb}93S)q4RMx45x1ck#q=<0c8iOs6b8)<;m8LUir*idlbmA4e_pp@h<9~3~oN( zHn;|q;z987!jDN{G}y##*ce6tsnLP71gxx=(bT79_dkC0+uiRan^us7@$(091_7*p z_!6X;!{p_YH-)3~oCC)flYuLvDjE0_7o*=Rm`90N)zTD`h3JYsp((RSkq7BA_>#uq z_1jFGL0)o0;Id~*Lo(P5A>z|vev>^8{d?uKHW`B#P6CVug7cxn#JMBwN};D#p{f=A zoDZRW(s44JL$|^TYtnSylydIjqOaJHPeyVp#KX07iri(x6hU(QmkZC_e7ujjuGmUQ8W`^l{4)up zfmV?H^>b=TO2K`D(uc806e{j}iUb8SA~Fj#&>e9Ii$L=^JVZH39wkF>B7aZeYO{hb zW=XlvS-DGUb0+{N?9xi8EUo{jZ~TCCgo-)p!Ym3T=_O54{LJEmqAo;_7D=4zH{)GD ztxvOLShNhNUkKC&#F{N+8P4(Es^LMXn-!^wcPzmYvvOr->{&IaM9m=p8tvc~LcLpP zau!-^RsT8xc6M8?}dX}vKwnFL&f z*ffJ%oQ_v`u3b0j*P=+8uD@KL5kc~vj5^UFJH3QF3qm;`+&W#{I@{bjzudYw+%jL6 zm<}p!-cXAY(d^ICiOE9LlGp3Aj&&nZt(eq#nb8)p5JD1F`jk7qS#*C`wR<6ozH(QvJmkZFf%R-FPF7 ze0Nkv-=TkU$(icNc=LQ$`A^edN$s&L8I6E3y*QXT$l&I~&cDaryup4tCR?Yg^N=Hi$@oCk#|h|f zV+?K2zH^1%XWw#SS5&L_5mo=inVOt(5^rewktzJ!;P`?a zN;EWrB@c&}5uFrLEoxV~xKFjw=mQ`N4(BIeXuvJHhN8TLfP2`TTO-i5_oh-2@>fw( zm+#$TmDXo<5%OOX-KB$gLnFCI;{uXH-YG+0DQz>^ z!`Mk)RhL7n-xLoJloGFMI=Fu=wM>k*4l08VkV$aCkrkm-W$k#6jA#w#UyO8$jyyz- ziS7!K5BEK%BFu-5e2XR2pLU}5X6>uyCY=rc9c^&ZPz-^YKzW>q6Po~`Wluz#%v@DZ z!iP@qU1ZKTOv$46zN6hfKTqRm%^}-J)14O&EXXd6Xw@lw~XDU%+i<499#^) z&J}G)Ph);s#6_EU@}63dTGV5oq!d##t6JD(o%ApqWh9?PESYCEot5dbtm2&Ipji|g zStR_nsL@rku{m3{IIXief=Uig8#*huvCJs8XxTDLYm&{OwaEW{UfFeCy>#C3gj%?z z+7L`soUGB?RT%oU*;af4h(1quxyVemY(6r(_u}XtI$-UYOmv4$g1n;a{KA>;>w1PH1uSktrl1NfRwC? z%kti4U^&#B@@xC+P!AY%{hWOL7JdC*Z2N)s_kHU6>*_#7L0hOQK{NPjiS_0z*t8@M zItOcgIaRiA_X_ga25S3~;ntLDsB;M)V&H(jPxX3ZqRSl3ep)oNj~FaW`1VEO)>zX% zyORjKssQUK>QBk-Ua9?2%PmIpEzYn#?(!|}uRA<+hu9H&!e@ITcn4ygPM!UyfHgM$r-k*PnLZ#*oUg{3#RNrNh8Y0?n1$ z1b2#wqX-4Wd)xiAxZ@$qJ?}3)KHwHVydFQ^10S1{0NH~u--DpogNWLLXo!<&%7a*r zlUTEpz;HfDA9u@y6W{8C+_IC*Hf;O>cv7B&({Dd+JpQ^W$Mm_Rg_#{yTZP|jp-Oem zWj&9Y)6QgJ?Tml={mCIdP_Xn&OZq>mSX=Imez|CLH`^B62a^AjnSnfSh2WpZk0Af2 z=nJXBHhtuCZ)`575;Y-p$*0BS3FR6Z<6y{-taNPW2`MD0Y^Fb_y*|_Tm}>=i*&7)Jfmk z_8=MKB#HhSgZCOs_L{)`^krmxY)EMdaoa9n#l3FlHFMcP zZW{V})9$pa0rk$#W1ayqfI6QjNaxl?_`_ZQYmp9qdyVwH6CH97lsFsreSH0{_xQbs z&8wsOy-&=m58Z1J{(ivrV}$Qxn2g0GpF6vM5KvHHgp>i$2g{&oXwryi#+xA2goIL;YKIeJsymh{v&t27Bd#zo+-L=|S9fBfu~3g2K>(zLZLss#i}L51)J)~@{5%Da)htL2P`P=n zv9R3kgbH%6bmN3bNudaYE<)Fm06{~Qq$EzESMPVef3pJvF@iy(F|35|^nI0$HPdpV zNcV-HLC52@&X7um0;x?aQ*VvLV{F9ZjeoKAeg#OCv*pJeizZST&H4*p?usYVc^$qK zv`!`8Q&2@r69Z88ML`nmoD?T&uqYiQpN$f-)u{18ujas_Wh=6 zrV_RPi2;Z{>O?b)IJ`AKjG=smERuOVl`M(^uXJ4lfTl|16X`HW9*t{Zkf$Shs=oFc z$J-!YL`RbH5nn~N4ywpXS!0YiMaT1nGWGLOVQ^O)&3abb34&7cK-<~}@<7U1 zzb!9N^~@z!+G*~vST(CCDcu+Ck+U>67~0}EZx%P4rXZXO@1$Umm2S&H@#ky0yO_?> zg2zrBG`2e=n*WEnu@dt({YxeHSrgqfB# zFYFarI~k64w6-514dkyMrZAc;tw`x#t8n|I^H-mnV1mIuo2IlAT?i96-A?_K)I-9^{y4A_5GjAlC~bAYot!ZrOS%( zA8yw*o0KWeXoPf01? zGT^+iPVW51n#7FkvM9{+>S`TP_<76PCt`IX`mxn+};D=^xN zAsUZDD5Ldp%GU;L<>$8W#>aPn(NQE7Am5x&_oK$w2Bpl)Epv-iV4j5pH~lu~)ua)_ zX=e%H$jn1@`ZYkf7aPj;mWTA4Mx5l81;nzTXGUgTgFsgoChtY20h=OD^GY9X*0J|4 zUpmC-SQi1?kb^xyGdvtu7AenDus3sp!d`qEVdOcjnzKgxNO93D*ufk(wVwy}_cRc1_1tv(_1&6r96S60c^ zF|n9|l8%{TTvgLCshr}F{yVPRp_-y&a`WKK3tL#+!zCMer+5x?;Oc|{ID1MfKh@m@ zTM<87L)tXQF56-wMx;19V6pRvBPC%fKtCaUJ!qV(=yb}#G9hyVq2$}_>Xc*sedZD5 zG2hUtqWkoHS|kLTppbN(x1dzc`+=Fr9dL&5g*_LF@|In#IpzLg3vTCUWWx1?>_(BTaw=xBjGnM=Ng#wkuGUX~c;r~wl0{{%_;LPA) z05AXm77_pk3HiT}fd3yq00%J4fwh4V00_Q*V;LX=M4`#u=?#QNr_&y-%^L_sAs4i! zRL<)P|H?G=uhb^>GJ;#99<;K^1jJGhQkhe;9f|_zwTdZRX7vNq@Oe})ZsE2wR#x_8KBk&Fp+GITt=&E zgAUAZK6fUx2o7yy@FzezP@c3MbA<^E(2D{@o22(+E(2)MC!-2W_8yFbbFbE`hb$a) zz=^=$(9~8WGHTI4tF^XoPUjZ2w`Wep{uJc|s?Tp#ts4mc|G#Wt0EStxb})PZ?$@#% z0U%%zW^8l&zQpg%|59r6#8jF|nyvP04gJ)>E^NSVkPC)Fn>oRxMQ;kkq5zV*9APN= zqlpxk%Eq{U7_^B1@Y2DPS&A|}W~g!oX?AjK01z4+pwehMnh377I`CYh^F5gUGHy)f z?ud%5Q1kW;mcw5_3yi{?66&#Bj7@EzIl;aT^H(kS7{?%N-F`7=6~J1AUX7tY4SLA7 z-hy5RTt#73*Lb}g5x}M?&@KS$;YgnWW*v4p>1cWga2w!^qC#}DD9gQ=b$+= z)pU$-AW~zCMZ{!=Xo4<3h+JVD~58PH&vqp#pV)@NjF#a!$xN) z{V%m<rOMCYk~*a72=c+Q9<3SLMUG08;;7Xbvpd zIDmL=)-WAEdP()&SiEZPya*xMG!xHf1s;9+Ru7F?fAEmD!bIFA@nT1-{1U2As<2fO zeTTWQBWdzDG?f3fpI;Mz27nA;0lx6Tv3U><{NpOk>_!iMRJn1Qs z{#eE4Mvkj1X@;&Zhv_B(Wu_U{-L%x{#?xt3S*BZMB_ThyhStOi0d(d$P)%g9dHSXn zGg$VdXR-MzO?@lLs^1{hi;N6CPlMAO+sleT%Hw4Q`N^`WWrf-0mgSWp?d26!bf2bY zC0Vv(W|axuyh;JFOvY9UvzQuG-3zBCgsmbRTT;R)(!+I_AgWuR9-?BCfliOd)OZsnUbgJ0P*G z?bRUQ{~h&-$b`ohWav)V4gRr}WF43_PxdO=Wd5MyWM4|kaQq{U;JC?8|GOT9(R;fYhPkHcYPjCIs4k?$(CUv+ z-$uPcK4nC;ijFwx`U{oURS#%g78iIvQ6F@bFjZF-?Crv%Ymzj`A&z@LJ@!p#KWA3G zOAIGZ{Fr%6j@}t2GyXB7cvB)2$52C}CA;&^S%L!GvGHP<_@yPC&)3=XT?06qbybfg zu)WHxH4Psfh?ko9!D>uy42pt;#}WoxU?C?)7(>jEV#0zBHeq)rTKz1ng|hrc;dc$M z^#mfvhL(j?R;(OF^Olwv6jAac5ljE+^S8P6=Pa2nhcr&lFM+8|plSs?;gNk4Z6z&S z6u4L3nI;w8eBW7kIXoHe)98rc>uro5LLmu^28#e4O?XfcXda8UUJ@@TF24eA-2vEw~se;8Fp3 z2gTf7{T0g5!*psE!8!{()2{6eu2+#I{7^5<@?`W0B%LLK%o?ApUTX zP!GA#3Zt}*C)EuRcnzYt8z`MV7{~b)kn8fAOE*fPvQL6qNQ4MzDt$8jg|H`-E#Zf z-)h^bbM3#D>fL+assr(Hu!$*$Efw!m66GrmV6=W&p*_~dCKVg+OKbe1TdGTqx-jI* zSRHdsZh-BB7t1Qb*JX|M_&@+!IwZ#}sz3&_r)7w$ov*cj(mLmUQk2>{O=v~(%x1VF zToL20u_Q!tH zKIT+wMVcP{IWf9<*9^48RFiSVtT&*QMH|@pRud}r7KfBGrz{8QASs_|0H^uf$>Qn| z$+yw+H~XNS%)&&q4Mq^Z!leB{XVT|WZk9B~z8k%a*~F`I`vcCy{CiM&oEyCo*naak z(Z4DiBOYLsgZWYkg&@T`#_sjoNRB_NR3y>&h{5 zHA(kFw-8a)BWG=aQXvuK(dOXFE;0V|^w1VGP4;zIRI8DK=Q*pECC?=K%X>(@C57x- zL8i6`CQc~F7#=w;ch~Xx0KZ&wkJ_)(?E> zraWLRfXhluvI(Lu&9NjZwgF6+16l>-0Y>0tUbFVf+O2k@8KBCTH4Z^ni8-FDZv|~6 z?+L9Y4n*;KGU02P)%K4EG*GN=%I&-&qgbQa@f0iJ2jL!ww7TfR(A`HMnA;}@%w$Ru zp)?YwoO)58rs1?3IzM}c2GQtx^!8Bba52SPA_Y@yMmb345EW{!2q+T)5I zpU)BB@1@4^8}5X8z(DVI&w9IsT0YsP_?Q71lG_&2M0}WcRg!TJoO|bv-#f$@)Z$Xs zXO}ImU8Ux4LvH_?f+c0_(YNQQ0q$gRY~jVp)^zAahHBXcZK-w=r26cw5gM#cWBGk0 zn9S6b5i6i<8BRytwM{%kB`Lrx&hKRqE(0tyk2KUsG}PW86hb7FCeQBIl9rddoocbW zH#f*PRnHP95Em?{vCuSq$T9R&TG|#QDDezR#K9_3!!>*M_hyrv8UiIfhpC7NSg)XI zkbE`Cgn}!xG4yERHTHA-(Z>L+Y8`*G9(Y{ z)mXLuSme`K9n3fko;WOAHO#O$>@jP+)i{EeI2hVEBHVafU_4MGo}w*|mM2_3(N*zB zEEHG*BxwSq2MPx*3fCtsfQJWqy~$r=Kfw|rQGz^CFw8)lCsC-4MLCOA?UAB>l%j@}%F^nfx9d;gj%5l$x%6X{pNETjNxcV83nojO7fo9< zObZQ2Tgy+2#!buSNz2hl%kxMpNJ}efODkDT%WX@~|FVdkrWXSYt2aQ(kPLS)7PhmegKsK3<$kSDZmtmi~ns;gx53mgVx6=WCWH$Z|NZ zF@oAliyF%t4N9tcD;hN`++=f$(<@3}%R1A`y2r~pUMsTcDht;tdcXK0&&om1@=?vo z2{?xnL;7&b3Z$M1C@X9D#tae$2_a2Evrw%tM|&QFUPCf z*D9~us~^He`CVDG=F2zFq-x=4U)yWK23gPVY5-cba{d(ua5X@!np@uLyS3UYxH`Ch zweWm3SoC!W6U^J?_;Z%Es+8FH=QYM>b+?UG6u;|pS88bf1+p)*LUz=@6x3_n)!U%f zvwXs%gRf^38Z~g8ORi;%|bF9IoWRQ($q9JWqeNApe%`*=dT@q!0f@|a^Zy6X+Eac2- z^lWC$%i#ExV!kfCz%HR`5Q2{{nK9!=Oxrv~g=>LTjOgGuCs}6g5(p)i!n4XM4O`*` z&%)gT)eI=HuNPazpb0${Wgd*@h+z2vUtQzEvi~D(m`Bjg-x6uxrgT{I_meN=tYBfU zRg@fCh-mxjJaqINQj`Vv2AVB}zfdtf3R5F`ltuvgd3&Kt{bQhbMjT|NdS*Nq%EqUa z*rAl*02ZDE27mJp#$_tU=DE@^KJ2g*l&%z(JZxqrm5R@o7c33UZKrZLXt_JW}?_|XGLYEyG7 zSQrbbL;+>S$@EAC5GJu}4QyGa9}V~R%6n)$!7G^jdMi` z)d*r#Z=}^lWQaba?N}7M>5)vDrXQ`bKSbPBo4~Bl&jARjcemtsHxJi3;Fc5GXX()B zJ>OPJN_(LyG#omDjg}d@=I;bXLkR1fX-G5N;*Tf+eb-PWOE9GPjne|(7?&3jPhu$C_I%0;%UiZkru>ued zC{Y^^i-9YR)i~I6ch5OfS{}uI#OV`PFRQnLCofg#xT|s!|D~rsu=4^GNUxWTRKBW0{?wA zUtq1UE2GGJtu$*5-+#5YZ>{{jpoVb0I!dRGP}-u(oBG%K&iraI>w3F4i`v_Ie-(bG zz(%drMgihP!sYU46su;G?v(f15aDL5Fp#}1C|E~4%(fzNK7Q7tH+15w$Ij120%!fefEyDwl{ z*1>0>0jTGVU1`P*Imp;;Bfw>=?8&k9?KkRFM=N=QV8(<3Pxjv5i|wy?(5lWXeZ_{& zj{`+gL3|I!PB(0Gm_ru$?dEjvW^+{fjqL`_jL0!s=^xG>UTdFKvkjy>V#$hnhFn89 ze+&^*ANY?s@d!2$j~2@J+{g1}i;sKz_tiy4O?8%B6_@Nky-$L(Ph5zo#-C4n5#cWWmlXQ;(SqFiWG)z<16HbXFPTj(V#w zKX2fhY>@9OG0L~_QlnAd7*MLB*V>s*<@=65UeAjK3j;nds*%piyHY27dLC!aAMxiM z%D2RKPv<{$#;2DyKQOj!1(v$eKzGOkf+#ag7cg~KHCtCVwkTJE*SEST4@}p86;YmS zuV1RK-lwmgiEiGQZeBmGuN7}TqHh2~HwZOXS05OSinGeBR}1Cm7(%nVg50IL7l1#v zxW2b1Qwm6^ zZ({{~G@*9zRDJvndbnVyd8moLlmEQv@4mGVdV=sjm$^nW@?|6ZJ!@%q!(xE!evQVS z^Y>fNla~Lz?(LIR&jbAKEdS)(H}V43>&*~bg;&x4yDO5^9_UG#b0`c>O^6awG#+pAmm&)1shC%)N7 zp9wX2=4;V8C~e5^c}##V;`fuB4;cTa zcBC^}JCuWMwEP&5Bmx6 z)K8x_)n5+9{S@G9xNk13C6j@)4)q)>4`o9j=s4ZRZw|+OHPBUXe>GGtHJi2Z;c(W} zuC&|j&bP8wFt2sW@&Dvk{i~?yuLu9I#oeg0({7M!VTvk?jTA`@BBiGo;;!_o`&q}f zh5sMEXq}Fcf#mO5SS4Y*>50neS|au5r)gyP+}=@26r!BF*DU4YMk?cUace`p*jA0p zE7q!0LE-`x;dtTN>cjBaI;-mwk zFDIqp?vnXwxCo(QnSQEyl#ek*@h+Oz_Gr%D^P+1tjTQ-=TMkLBKt@)5Gs=>~DENtQ zqPAp8-)Y7EjV}QGPgH4pVzq@))^|T^EBLtrU$_iq^}^mEa{=~i0>(;M;P{Ow;$e|` zK2grla+TK~dNxUgD)#dl^7p9u?2YlMQO-7NF?D@r(n~BI^Z@}7|6d=C7;al!G8aAA ztiP$UTmnQq#tD2MrOb(oYfHu{%$m)HAyn*2vuO!M$j2Gje=YS^*UG2Lb9Ej#4D%p9 zxGc8$o03ivU+Fye^N1zWKP?Bc1=B?ol$+spE4sA5@1@r>d0G}^VO=XfEcmq9v}}j) zT}f_NEsOrXZsxmgX*c{Q)g}dTYu5)u-Dy8B%gOIBgl*P&+X8<$YC7he&2N@XIKuBV zMTq&hVi@<%?`-I%X74nMQiJ9)ugT)o`?@Cv&Gpu5neVaviO8FLG!B`- z>uH-S%l-Mdq~~LQ8GGU7uw+~B_1?Bc4*-S3FjG`x26cf3jttusMib+62cH9=Tp?ZV zituVo(0LggK>^63dtBWPM_b;TW-ABeG2q{jR{}lf--p*AVW{#e*mv+E4#4|luHJEhGUUY(1It_*7@C(>U#REh0Jq|%O z_F>RW$K6TfeyTbL@4$=?;-uH<2;DGB8Ao&xBo|9v5-fXHA)N~@Q?*AQD(_oJ{EdaR5Y|7!K?dKPq%KES<{Ar$FXA zQxe{V{Y5--g2nfwcGY6f(flj9V=0Apl_a{_a^9*OX-u-LLQa>kM`r@DD6T5)A=)@F zi3){JV12o4Y_8oui}&bawjOs(X67Mn@yqs+8c5gx_2Kp8qlNwAU^nt5W>@HL|n1o?$&^@In|Fo8sfL}9ukIQK9 zuU2l5W4&}u>DZ2%bRFQUYaK3Z^BgQ7cmiz+9yvr`xLkV%Hz*b^q;x;&~_!`HWENPfFuaE zACP`^QHETHt<#UdwBRT%|7GGWn--2JUk=Nsc!f}0;_;y*IT_}d`ovgm#8$dXEYad>{(Qe`U1?mOSPod{Rk zs%Ux_N1M6ixfrkXIB#z;ig5hXGxd)z)0PL~@wOqFQ{n&x$Fq9^qww`j!?zG;Lp_iY z#^bXX?$@)#BCMNdVs-Rs&iO;srj-Jse5^o`B41gDm&~(%{1;~nE)J*MSSIT9M)BjYOS~hsB*&yv?=zWPUu$e&4 zk4^PFQ8p12Yi=G_oH_5AwyrJfo7YTRzhx1HU`>4eB~qB!nXHj03`74EQw36!{K)8 zV$zL>e4?+kd7IsH++Mi`PFfBlv_Ei_%pg<5<@N&)|+jI=6?M2!#1C5p(a_PaHfSN$4^`_(%DhULyL zDpxq-0Xe!2N2(o>ug%*R#LXYtJJ4z*#);4y%0JA_AQ{FF;<1+aj3){1u9KW64eV`~ zTJrCX$fV*=><`u-5-J?@eHige97*!(%%075l@=TD53?y``Gt}DMn4*$-xx1FN=G`@ zn}9uW4)Wp{3v(7T79Zy%;4%@)TrB8bWgi!umxyDCvSJVrD~lWx z4$s|yzxW{?!ZHy@5?JRfS7Xd|lNuQwE3u%}O~Hap3jn9xiA$YLs6Ug7hz(fPLK|NX zVx*~FO0BDvN2ck^}a3h@S)B zUgY}U;uNH(Xc#(UT1i49M+*x_*BhrIYNcB#`r~gVyI96Qn>avFZ&ND-v6OE-&3g*H zr$e3aVciAYIi2vk*3)r*(}$U8<@cmWq>3A>0T2I>N-qd+-|#c!6}xC~r#3jl{026R zWkJ?|iYfjKrG3A6ApPVe1RDg9~m&wW1Vlvt?5tyGCdX12vcStoyHP-c>!0(mn}ftw;&4*(dP znJEhT&QQg|_amQNqDjvh<2L{Rhy^Em@2=*b)nOp`JaYyK`ePBHDtm+bL6ZEyRrq0j zHy3B08;JpHj}Qm(bBqb~2MNwRo6C%_jZ)I!BoW=*xeO>zc*46)2m@6-dNd3XF_V_? zOUR&F^q{(d(TdzPe?f}O>74<^BPNVGuRu6Y>cY=K__IlArZo=jerNvY*eHcf#LvwI zO^QI@ROPaYS#|I~r4$GxHW0d1D*8#vXcANybBoe!vGt$@vouv>2lTZ>Y7t~DedHjE~#z6DltcwXUey-2K3IKpg>BLswpI@6uyxwVQtNit< z5#~jR!Kpvk50}*gBrAe&m2e}FBKbtWtym^Se9Fu6g3&0ZytV3K!m`zdG6Dc>?%|(} z^3YY2;+w>CG~)L=R?*w`xro^%KZG?nhY$j0+6k9HM?spQg-DwlR4#EN6Ll5 z9DqnG7F?Z?2pw@PHZ`(sV%~)SHeiad&%SvQe@R-i>s@tLp0?weXHrrD-~6(SvWx3c zb=~00Nkk~wEHK_2wZ813MRcG9YQ%SfT4bnVFTf;qjVg3vTh&!AqgpKT_Fns0zc!du zYFHKFjw#zjfH*!d5Shg+F0eZJZFOq1RN}BmcTQ$^R?E3-eQr}p*+iRPg6B|vv*|=J z^hSOnYBMZVXQgO!y=imfXP0i{#*$9NXQHu8;^MDeMh%~X+&Z!B;uXGL9q!ixYCs;4 zX;6DQOLvt+Cuej0TtK}Cir5r``pAW={u^%1CdKF>q4J9^mr>6IqVANy!efzcY(BAY z@b(j-?o-uPn9}M#>Nac>5m8+9?4=Uek=Dk>_OQl=4j$ai-{>ko0_ew07)QmYv9R{v z>eK=HtzcXKqV$lOx05fT5p*+PZJTxnO4R)OKZ?){7Pc-Zcd(|ph+K%T->FcsQ1R6W zFt@Ppyo(rT43OK#AEuiBQf|Ce>5)I~fb;6_pYH5Q7*gBnQOQrM%OVm_uepAkHgh(( zpxnex9?<9q5epI#2qF(GQkJ;%e_GJN(>D``Q|?Bs=+h|fkrx{o)-l^B>7h{>nHhHL zjjJWisa=2}G9MW(VWPSq=8B{(axv{q1pbsn+DAd#55-Tz^fKHVGJdNvirC+pve=U+ z(zdD^r9B$H-<_0Ml6nZ*1!HO#3)-R7&3w=<7Z{F+aLFL{UiA_&x)w2!{un1l)Dm9T z9A)3495{4+o<%dj(sXTI?KIR5NKW6}0{{4?f7HbwuPlC5b8ld(hXvGzKGu$Im3lPI z95{@GG{wy>m1Q#905da2GBZ&-p1au~I6HJDLUHasihO7no@N6^8+(~%*;ARjZkhlw zPBwXtg9XL8@sEOhG6F)(KJB9oLD4_0j?5gAYv)gmuayt@n@@WBOp?Nng+(@ELt6Ft zk3S8~5{EOB{LB`)O%<=<TnkObJp}`lE`8Scr%+bqSqhk4$;YFWSsepD~c`Jut=+h&%3tdYmTgF>rW@&tcvbWNeM0}=`5uLF0!;QhIKV8O%E+} zO-73^#+t1~Ifn<|&CNSeh-ySg>o|HtW+ipBo<+%h0yjKKtXn7mUdldslm+)z$~58_9yUhuzjErdNl_wkNI^ z=fgZSRaeJHw)>A)2UoT?(_5DqRu`Pt_mbBS)6^YU*N@Q`*FJVn#aB1cc4EWqY0w89 zYIZf^R-|(Z?@;#Pu=WeyoZu;jU{dxFW{FV5_PIZAppmU%Qf^>NZoqTw;cIRnd~YCo z>=Cc+p^tAeH?C1*sL(!6-}$q&q8bu{O8S4&+O2J&TWftyByK+dv1g0Z;=eH znO>~-Ued&_ZXx-jVNcu5)$aZ*@fK-Y29(xF3=S48S;Pkyl5OAWI9`E^*TZ3Q*1UyN zzuV*TMn_9Ke)&s12iF+@L{pwv`X1QB(h2(@yD?N6t(;sQq$63rp4jjNE`;vkwgXI=(QqGDl%B}8=U~G24tp2$=N_$l8jfbmjgYJ&oX3AN!()}ixi|?&;r6hGts;wVT#0* znWe5VCkP;+WVbpucdcY8u4s5u8@4nH|IPgNDQ;F$Oe`OwM zIu{P*cD(S?ei$ID`?`6>WKHjIy5)ex-KPA$P__5dpJ#CYMuASm3>x19cthQ}lTa>e zCEyG?(c4hiMq|Qp;8_ULC{i7$>th&KMum3Kr)QATce;D*V7oa$n#Ts7fluzApnjZU z{sl>Z!7Rtc{WqWvmY&U6ubSed+}pC z2Nj1}(8!z9rDGF^BJsE!FHUaBM`OvP;u$RN3Z)}~>jcIYGbSRb zkS0ilVRuy1nY?aCjkLX#v~1u%;b3{4b7%9VgYk?tXJ}^vWte$&H1A9M%A`FUFVFtc zuhbfj#D7)H=dU&b!`O^FzEv!=T1w?-Sv_5e=g^#^9q`Rui#6MD!hSN7FO|Tgv&L@O1|^VTd#U+%C=gR?_Jh9G)&{I~ z_Nx0m<;iZl#UB~FI)htutpT2hbLH*Z!^vF9j~d(LCh?p#El1x~fupCi-5O73qog4T zfKhQLRl_p8qm7 z(&=kzuFkA#QlQsqE8{rnB=S+e(W2C&QT$_QL?Dx!X`G$2WNcow>|p%rru=8)Jb|W) z*?O4%o5?6Szk{jca;*v2b~Vn2Ti3eg$=LmLMqgR+w#3Wa3kJ_`FSCc{#nLYh{omNc zf0EAO01q&k|98^)e^>|d|5wsE97Ec&aO}U6&a&Z5|98@PDudhUY-6mUIZU}+v$!;h~2n|`#WA4KQNFfPis6}0Uk{r%7 zOtT-!v1Gm<#eGz|AI<-GvL7Q1O?wb4j%9HWCrwp$5HHVpdXS(bNqd;6s%CMR^vksD zFj?F6^e{y~g!U-aIN9PT&AhnmDBZgG^eDrAnD#i+dCB59%l)YAINR&-^f<>4n(ibw z2+Q&$4@6adk{`)=c2W>4Nq1V9sAhRulxkXjTAb;6c3P4fLU&eLm~44gR$2{{Q`B6^ zYk~i`@)RQNU@&6vEFAY7UB0pSPP(!OTSXM6(JTiq&qMi1!OqMNCVTpDL+7=`ON zsh95v?d~oTnlU#u%dNput@MuN@L<9$bqq=$4%c#{j@K4pA-P$yN%W z!OqYDGD_vHI}2ChApv`Anw5Y;47rewd(ksXaKOqub3SEW$_*7-FV3ZK!!W+Z5O`c2 z5Eq|ojjfOdJxF&TK3=q;kV|T9d^)kY!HNF*0s!IRx1tPkvM4<^dElQ?jH7&)2%QXUI(Z?HBG)J@_8!Sc`X&N=u zEnb_qK+yuH<$fiW&$}S%>gT;kuB+$$SShBLgG6=Pm%~)E>X)NTx2u=q+)$?1lfo3+ z*VEFH>esW%maEtE+7YII7mdrd|1MjPtN&efKIvvGG5=$FyBWl`d%GR2&~?A#o95D! z00a9UZp02u0gMzt@&9lmEW#B5u;_FQD_43QU!1{Oz1g|`U2o`-(!~J{48lP`-j2S@@+m3x9(Vo!29&<2B3m#)Fx>xMBFI|G|DYI9@o+bPmimKGkegq> zvE)kx0@qMGab~dqz()c{{?=MTzZg8?XoizpWANYf$ZLEaDgnc(;97HEJ=XjEX&gGu zaJhH+iU65rYs-0ilL<(`C$;uS_a< zg>I1C_*QbMScK$5d#q|kny^otC8gUTm6p~h3RNZc-T-GICz7rD%FS|K6*SjTYb*P7 zKm-i?a9b*y!FVR3p=l=1{rGe(a3t#2w?>-rz!2!fPK{HtSp zFdUxIa&ok8S2Bi>*aribZBIIZlDc>hww_WZ1;c1u9QeaTA(`1}ZowjfdOAz^H}pGg zBh739c0x8sxwFZ92DaJ%7;yg2xt;YAu_x4GkJ_Dt-?F3K;R4)R%y9cJLIvuJP~q26(>`xjXGmqqIC#x?M?bqP|b=F+8T`iB#RhfRi$wp|0xwKA?j*(KA$gN9?w?j zX#R5L88k$9b+lM*^?08nDSEZu4j0Gus3E<%o2EHke?(lRwCkUT)O{!J>T-5FT^n%v z#Jo|cCQWj_~7?#YGJX<>7gf{)e(3K&1G%uW^`-@Vh8F$~0 z=6%E=wEX(*E( zYow`Rnr`a)UvvAl&6&G`pevQ(~7EMDK&}JluA?@+t!12 z&g!F0xC|g{h&`I6j?tiSCM%)s>mL7+d!!vW$vhyg79}q!Rg&x*&Y z7a&3chCbR0#XIAN7_l6F>;L3j;$F`_#wm<4KkWEiu}U z*vU4`VIpmh)O`eT5 z8{EfvNr41d?-Cbs&&BOCOic^px!xb3|dPAxW2vVx2)9VHK<~ z{gTGCYj-3<#xFD8)zfLuBe<;d!4iR|GFw^}XqBw{gA(D*Mp+NM#B2x!^Ekk`k~G~z zo(QkG;304}+|)el6Tuvhaa{RR8Y3R#vQ*lRecFS}xsXNyeiebYHWpf6pEinClYr`v z@AyNpSzf8Qf7pDsXHlLY;{V0kJAc;!M%|xj(5SI(-k?e2G-<5Hww)$vY}>ZYn>4m< z+qTU+_vL)oteM~DZ+O-^&p!K{vp@9etwl-2l*$os zxLwz%GoQ{DilXL|N-XPDrF8llE9G>oT%nRgzOj0rBVNtg6^``V`Bc5mq$j_lyy0ZF zNqdE7f@i5%v*Fi&OXmc95CX9@PSsj-5G+79vcXQPC76uDxt;T7XDpsYYjWJJ&a47z zgzY_DnersHcq5xS9sky{5onZ>9hH8d5$I~|qT{93WVO)kgP5Yz#$~lS6!k;*KczF2 zWZwIGs{6)i?k}kiECHi!XTA=5(4Uvqp9jN>GdVfq8Yb?KOM4YQ=cuQH59v29iy-13 z1D|gOG`XJF6XIKfismVc8ZH~E+W{{~=DB`ILS}gmiaMnR%68Vr1|f)1G%2A!oUr2f zNQ$}00>7Z+=0z|b_HRf+><(^4q5I<+YIdTftjGK#!zr{sM4~Z{16ucQ$0OcKP||6| z;$+4MLx%0gDRma_CgZLQtuuq_A$`rYTg5Sw)X=%9lEunbsAH)l!S`yamx1JT5Rn?Y z87hyGB{^2~oM^s*yKsA^XfT8Fd7^%FrjSO5&%5CXwZ}?9RtDvC3E(3^iv%!)%%U{y zu^G#@)UCX{lyN7mB-<|vM1NLZI5}D#ZF1*HqkbX;L_J z+?Aaob~>u47IUktU6N8}s9iH`14ONun#!d@2&9`qO4jcxHYGK#5v#Tjw5_!}%mR)& zig`53J3DRww!r#T&1$Qv!!jF)NArID&Nq(r>ORo!*x5hKwlOA~PO##phM+VUqXyRJ zn-9QRP;Qv}Esh-JFqC|w&AATaqzN;fVff)T(>XrVTqxmdhz?P2gc#1<)LuI#hIlqT zARQ8MEG+Z;`8O|FLf*}tX3PO2;FVL08AamKloo(>mflA2=gIkN@E;r`r4V zyzk2UeRqlE6TGa}4v+U{D}+Gzj+pztD&GACf7<&PLr+i^8|^E4zuycu95f7T4}|iy zKl*sC;P+-hB&O*A6leozUWs0mkMRjVo{x!DTs| z=_cVKP^v8g#Nc( z^ganO3hy|_|FaFqgunn-66*h{B)Hp4-FlC3{~I{)f1Vqo8T9)=3EKZ}C1Ilj=gj=q zxp9KwSTg(nR}-$3@y#wcQpzb$*-s71c;mIcVkruIQlo;Ke6H?q(gi*@{y&@WFb%TJ z%0&d!aQ3-2y={KAo^TF1*jko9ZHH%%v z+yGhW=DM?mYB`GNtn~Y}u||d6$^UM`)vAEYY-fA*NMklgZ7=rwlXUptlzw~1Qz{pu zE!`F(LDqF6p?G8xWrUaX{{Fg7pDJtaf#UNuK$+rd4hpo2$2(0QOO5Fv41elFURinMUnCbzth%I zjwE346%)418vjm2HA1e3jVm7if7&jzLK(b1g395s7J?M54itq&GU zrFtd7K%Pg-l}hb7cNN5Bpn8+>&S?Dty#S!q`DSs$s)>24%NzXS49(wn`hqbibSs-# z_J*Pvwp3-*m(AG5ak19uu(!$B z#w4=kXx)Iw|88Tq)1N?~7VX(`cQ_sM+l>Fi?csR7PHQRJtL^D>yE+1N#Q*8>a=ky7 zF_oRrH$=d!e2gye6Zd7Sz z=_@A5hQ%Y)>8fIMq<->^EvBh|SIfWv%kq|z9IsCJ<6QqiJZ(lkadvnfmem6z%2E(1n&p3L$C=K~ttH7ZwG$OKTMim*{KJ3^D>fC@P22W>%cec| zGsXn_T|B0i^Ypf=wu4T9ZTr1<#PQ$I#@f96FOG1l1x0>R>D^P;t=I0e`Dnk4v2xOI*g37#?gT4B!=8?($$1m`7Aon!9+YWi*9#22GPV^# zI$fIY{Nk;=^9ld;=3e5mK-4hTKebkMGq9B5*=B}vRB8(SLb!fAUxD;-KWtXr{y3y` zHg*>ANQ_+mogRdVNrY(L zAK{GWfzHHQ7zjTp-&80RMS0k6IOJ=8W(VZS%cV9lBx8gx%g{cM)4`MVQ08|5#M?Zy zWlN&t)|vri>u^+@c#{*sTp}379D>1$Y_KLSE7M4zJ?y@p+;U*LEwO#5SRXluU9bhg z?!8Su=Uq)~fI8-kj$yp$$M;DCue{t728qGNq#09OwgUVas2+BE7G7(SJ-ngPp49oG z2(@vF*iR)4zUX5Yvx?2fuWmnu5Ww=?5kKLZXoE1*Rj4f+N3OB9pCS9#SlBhmKYTrhV`ancQQiG)3w&g01p2Sc=79Y_cY{d@YMbg*{h1u?RCBMJXi-w#kr^iU&je3~Sw!DXvMTTmzuZiF4KUkI5W2LQBpvE(i zRPFmwp?`+2-i!QL6(o9YaF?#W(9K?j*$`qZ^J8U3S(Pp2L)w(DPGcmyxGq=5RGPnJ zVKzP)vluJGqM=-KzO}KT%*pzXn#bzO*l1&8bqAxBQ^eZFEOukd2cxau+1eU+xMC8s9GM3G&Z(q?i`OB{47=za%l)Lpb{ERhJD5$&oUd9eVMgzUcw?!9T+Vi^ zqE?B-Z_h&l$hEN{(#F}>>ZJdtq7jF{0Rx)1|8uPHAAvak@4eA~1>)=pD`IoH{jZ|= zj{p@>R=6g@M2lEc!3=0Snk63S>QynmuZd40Dksbn5_o!$3zwpyn;`Xk-x zbOmTNH|Ry+Y_nPG_0&j|*?hUx8*wG;?fGoK*PQ_nN6vD)KU=I*+xl$hb-J4DiU6U= zdAqxv9M?FI*nT?RLUiwR*&eh$_H*2?HH>!s^7a0NcwO4^f&415?FU6|p6d_85xVV< z$}_wjfG#Gn6NF)Eo)?Ve43;&d?!(~GR>Pg>(x5o8PFIEnuRG&7wTC&=^DnItO9T9_oMf2u3^Sa&aNdFy-Q6{i}x zYk+49!4}2o=A)s9>H58CrkU2GCx>aai~sSz?VgxrxH?PbY{E*Hp9AM*|`GPwC)W6 z+f$Hjz?SX&3Lx;j>ddC$BKvR-n8T{cT=dkKe%1N-7*XBz3JK=4K*MTZcYmdcyzYhM z^aPtCyqn~F@?@QwIdwOx6RJB$Ez8YLXDk2BiBvW#_XGT;Jj+@;EvTP)G%RZPv^rHP z?3tS{8@oi^FPUW^HLNPu$*?c|^|)|esh&l8EVp6BtZwmm0(~%T`Me?7ZU>^+aBYVm zMuVG5&dbYb4)JK3loy+WLIIT_OQ}Tp!8(`g}W^Y651Ut`2ei5b*Cd z7Ar5y5m>|lhz(4tAZaH-(SYr#&TxO6dj0>hr!HhZGDuPw;3_o3CLL&?iH?**d$EeI zgP5cVt2GT0X8MOoIgIm=4VHU}FTV#zAo@yx^r1v_ql(#mj6$I&UD`Hps>0;wvoK1y zYG5X<{IdN}yah~AB{NOMj7bNu)6fTKq-r9Se;Pr=qe76PiiFQW3iW%d#A=wFM5~Qb z5I>a;@$Z&;l-TVF2p9sgO9z6l4cn6NJr z;Lu1&)q-PDSEqd5d5h?jMx>Nm?USmNix{+4I`wC0zNpj6@a7&wTB&6x_%zriFu5f-f^P4-@^RXA@zuO5RT1cOb%|w+Zi|)#$ z)~AZz6rOv9-`y1g6xCY#L{rPpQ*}at5qge^mvS1dv$ye2?T1df?lWVX53M+5bVOGk zB#NC)?sHy`*2>;Z5nG>&OI=SN)xJ>D`X7+X-B4nG!6Z@ruguGxNWuRYo&W|gTFX5+ zRo{a-D|e9ZIQvKr|Az8O@1Xq$pqc+)r~=`pV7znfckh}=ncsV}t6YQZgEvv|YHLJG z&p94QwYnjZYGgQR!+{%THbD{VR2XVaLqV(wMeoLYvMZy3PPK6w@GXJ$Ph)p5b*X*Q zhb$Q_!SGk%IDN7L{bk!YpQf|J!AIe;g!X0LN8(Fz>Znc9k0X`?dHtjS8&mMST& zqt%>`YX>9{k+|>DobnOT0x%J7>-23A7*B>!+2T_izpN8os94B)Zr|G$mJ^DJ*!*h@1 zifdS$={BBseIE%V=hiRmeVbfCxP|N%7okphmp=D?2pD}Ccd~KF-t#;XxN@8JVY<)9 z_&Da*LyJ`!b6n!cI;r+@pH~4;l=E(!s-(QmRaZGx$`PGvP4O&rO+M6wWStwrwk=If zJ~p&dZyMc0h zXTQUE!I#`jPYm%qr16oNaLK+)Y4SYajCq+#;lD4$={QobbzcbZz6Z*6oEyn`EUpnh zHtF$Qx>Ubyc5ObD9DQ7cka%vlbw2n1>by0}dE5V?_dMKWS_s?wP^z_cxm3;n*i`*- zX~y@qb>t0t?m+pxjo5nM|JC(6H}!ebM)Gl`=kvaX0(u3r#qYbiKJTVLFC`p@5}b~b zG``U0j!@>lFu1;O&AtfBzOcu>@Xx;Jw4{rPzd2@oo{xO+n*H8N{D_AAaG(9ias4Te z{ixvlsZ;%FoBb(D{oj^cbHq{OX#%=gDT-hjIL!mtkKMSM12UHae&h!T4hIM=1Gpsu zC7uIB;R3~u1H?-MC7%No!OTk`{T*FH98yD^OGBKNLtL9fe2+sspF?C|ecyLnQHOmoN<-0> zLnA@Yp<%dT5wu~^5@E5;e#3{&7Xrsz=njMl`1WcYsR!b3`X@B#_0sE5Y3vl6E*Xa^lENZZEChEfNIiCmD)wtwEUaW~TnZ@`F6&;C+$~q!i+bF>YupoV z40c-FW2hu%SR65!imbucPb=~j^H16^^~3@leHaPDOMLEZJS%)cENcRbWI{B^Fo8WR zAvHe%3`YjIB?z@72)`tVt|SPY#Eau4imW7xog_-MBuc?2Nxvkjf@4&;lhibl)LW92 zEa=*vf|qIH$iretEt0{3EfyNd_-@J8U`F#woH=*=-zWZ{%#?v&J*_+<@!oWhspxE?d$#`_D-lK?@0ZQSM`ylmJTUqXpg=HPN?>9R^b%=p@P}h_^FQ z$G2DVnI#vF3PW*P^4^eH$w&jGP)DyY5p^{$@PrxtHkK^G%h-+KzDI08h+z^&na?CA zD39rsi>+)2-?_)e_={%T3aZ3HHf5g}8(MCNFo46P047f*W?r_3BkjR0yH_!ugDSe} zNmNmixvn6+*-dc%g|_@8L1!hQZVqD(j~WGEhN*>GFHJp|O2)&V){ zQ)r}^H$O>dGzkDtLOw&1gB55dMWTqBYa{eE*hwU#SHjn_=okc*=~`YAgI}hNP?kVn zCdp0heD7|k;YDT17>pkXtE>*eNg=$ianUHrMU}@zmK}M5UyeY+@=#zSh=C@Gk?&Yx z1+A#~Pvb9HUROPXsssX?Aco?0K?}K*jR6kp&hIw*w52%`#asaEjENW&dImerpB~X* zDeRAWk`;U)<6xmwc-(7h&bOTybPR`Fmu-|=^E)V(q3ya1#tpaYGK?`F;h`F;+!MPSl>W)0%8=XgPIgyc$i7!pp8-G zCZ!~SvCxq7fVow`?S0u4c{CRbzE-y>^cO8*4^+W6;B}9ZO^>KzEWa=v4K#z9P#0->f4}pe9|{Dt7)ujkO8|s)xjHHo$K!H8=NW z9y@iH8&wh*vC6Xa3<$+0#oFbOn)I`hE=*wgE|u_W=B!4RC!oFCD$4*rVR^-UM;&$J zB>GaL@Fom3E+gOhH!cT{!1sZ+2;+i9DZmDA-Z-cYYr~2{62Ml!KmrZGP$s~-HxMQd z5>`!3_SXz>7{%*`ZVbRIN34ObJ8gW07ijaZGY4Sv@e|-F1+)SJ+zX=D0K})Yuz2~Vd8w95WmBvI1FJSV*phWd zC%72hgfSr3Gm>xwI9^qDu3Oq2g-0{*)x%lx%FUB6C?%!u*}bRT!J62O(9(^;fESGE=CGQZpAp^LwC$-868hiKWCZ`ogGInZm_bpipHyF4;J z?r^tE$2d!CJ)1~07oAm-{K1j*G0WUB9`&&@@olx4p_om=ZRU^HS0s`+Qq*)*2;j$R z717#1zO`DNwR*3$#;mn!BKU&b<-D(!sgG;DMC<*0i-Sn(b$gRO8JjWy84#zq!WS}gn$BQmfX*;*cyv03f`1!QcN^M!J1!Q!B1*{xNbzD#fx<+A#zex;y7PLm zjg`H_ZMZ{NwS(KaLyWvb#;k_?Bxi86IAXBw3jC=sugB-CDrJjAD*?FM7 zd7%4wpubtXqJg@$l2y^52^96R%s%`xnPqi(Xx-Uq|9R+;eQ5USGzJdXT4jwe1z>^x3JK1ty}Nz*+^-8@OZJjvug z)=TU@c_+2jm$}eKeC^4qxJ0O^I=$aHz5jCdh4ieF_^f*Kv?cnit_pngaaPrR`YG5@ z7JXV@bqY*68`(S?V>)lTJRkaWo!LAe{ybmczgT3t7|p(zueunYyx5Mu*zLU7`@A?n zzSz&cJgmAr?!3GN2dH>ooHKz_Qm$?;FP^dw7xrUiGV}8-ocwe{)oG3)r(B^(uHAI6 zp|%{$qOZNHu2FNY(LvW3a@SZ_*VuA5_&GO(F*n3M*QB=B#DHw2&?8lM}g zm|LQ)TZXP%I*{#5HPup<79%GY_$cLkssFCD>W&ZP{@2wVU(C6%?Y$_N#*%X{D0k1h zbuR(B7q7mT?YdW-x>rJZP$qd$-Fi>~J!qpmYW;fD)O*zMc~sANRO@=wC3&=wdo-VV zG_-xR+iE`=%I`Jhr^#?r#Ts;MoJO}1Hhv+?rc0Gr0J;zQx$Ag}O zqPyicP>Y!!oRE()yI!*8j&ezkqRsCAUEUQ|zmziHmsG!&*}ek1UaO{FYf0YfQQjIs zug$;SnyTMg^xitU-a4n=dP&~R%sB%pVIVcXTly z({djyps9})l8;r}j}4!XZN1OUu8)16PcW(Zl;pEQ^bYj2m!x)Hj{N5I>&edc$&vZV zwhIhs&dmZkLn0wFq{@@_1R!Ej8$W;F?FmCA;rSE#-AFVNo!Rof`G!I~7E?SMGmUj$ zDuG_Bw*HuvdOVuhda_-^!L$P6i!1iIhP;$q{+D4)B>f08KoMWks?;bO{d|cMP<4Qw z9iRf#Y4PqjWoK9h8cigN0yr2o8mw13`OY|))*Boy76$;F%sL%jFP|M}oZnS)q*GL> zTH!5boPpjvHW)wXMDo${c#0z33=YNTM7;aN%7nlLtoh}rYorGRFN3app3d^o}I!Ua=Z`y4syTVpzmb`UkLA~grKO{KnlWG zqK*pU1VQ)ml6YD7Gg1^qnDi(cUv37 zeVQ^2Nvb+#2kc9_b}-33*>H)cN|byuiV`Lf+Ku8Ae*JM87FpJhLuS>$WC_cX297oJ zCYUBI8{XUN39esJqb0?IY;`){H%y*%-1dr^#@#M}IJ%zT^~h1`1x9Qg*^S7^(qrV} zOU{$OM(PHE1k_ABp=7d`1|d{cxJJipy3dB;oS)5mVSLnX#t8|Cxlw1tYm@4}z&W`E zJ(I_VLw${gw8IR83B02$+XZg(oS?&(BOMQ>baN1pyp|1 z-U0raUBlNlE8Bt3^grc&pKv3Qkm~jmY)c1Eo8AY-yj!h%jl8z)PuW^mog*T5ZDY_j zbuwH?t!y{aj5>r$gCs6L?FYzmv~LFiL+|zzbX)7Uq6Wn3ypDo0KYSIE_*ak9LQMHi z7X7^WoaWVBI-HlSQ}~=$ZI7}R4LG&$)KQnjJpNQqalD=Gj`8ch>^IpEyYH2lWxMaI zG2qw*tWuwr=5Id6UbTU!eLU|z`1L&Rm(;pGxtDXZG8vD##-4tMBY3EJuv%}7wIt?6hI=94lBGYi0&`% zM8URmF29_E*eT;Jdb9bjGJxTXo7sJ=O&6(1jgR>7UkJxM8M5DVA5k`=2MkL}P4^S! zV^Ve4i9`NdF4q8!szSKx{O@fDj%K+96uYc3!lV9UZr0$MNPUq#+==EvwrqtcYhxoL zTJ`i9?l78?xeWxlW^t@rmKg8#Tw-vg`i0IK>x)U|J#Q?|^i|G7_}+k$jC+J!Q86^B zf1ir|rCnw-HX)}!`x~EV-zAwzm^yfMMFme(wYWB^H1L4_s%YRDM&Em*Z0qBz8Qx4_ zF?+|liJ9xmZ$s6R)IK&-*0>gF1CF~NqmISQc`wqYia*kOK=q~^MH&;1?%y zt$K6|skDJ6ZW>b&nEya0V^ThswuxE7`#>jWls=b>{ZK6QVIdb|shrQWP$n}`Mx{YN zA|1aUid3^rXM*=z)tNS1PbYF!8bS3ccA>(6{Y-tPb+NYgq0&0&OzWV0v3b@hLfgsY z)jSNhm#-MBFm=R48Y9sF*_kbHBGLd$OMQ^Kv1ZD#47BRmqCTYh_#+W)Cec)A^w?w9 zq&1wI3a_oqc&pauidvg@Cuq*rF4hD2tp6DBt}QJ-{%caXAQUz0N!dV)qdKRRP=KM| z^&e^;5WTcZ%FsS!T56dHx^yTa&^i5&fgqJmf_Fx5OtDQ|N5cRkkz}82)qKLy#IOxg zya*+~eehS0tB_@at%p{Z&Zh=jZ*fWRKoF-34CwL%0k$E=mO7SB%-q6C^+|LeENmRm zb*b8`Z+%nZa2o#xvo!Z388!Fe|A%49V2B#C+)pLO@->TfNA1$O`iqtlBSHevTiB1R z3&JCwnGqSnE!-OGYb!5U4&gqSmM+oan%FqdPh$#<7a5sgd*^TC`;;UvBP!0d@zv5M zOw21|YM)tAZtX@aDKDAaHb=#q8bh0t4sAU!mlIs8hi8j;ZO(%ZPLl5i{8uYeG>tYV zxOiMU?(@?@U(+QP2G(GiUCR|ktBr{L_tP4iX1@#HMy^#@NC%|NrhR>|SsAF@hqrB4yxJMEw!*RW?-4CAbF%BmbYqb#v%WZ4fO?d_V1uC6v00J;`g}tW zm83!O$b{P}V&8`F(tFI-#y{7tbiM$-*79SWzs3SOv%Ts>rbbD0^7X`yvN$@*)CVKj z`?P-9C{yPb@_2Y(of9|0C&7stvb^N{P7esW90)1w3gcB-jDG|nMd5kmIP$W_o}N1X z6|-9rM!9GuO!P3B%!X+Ew86;%l}wb9xK3GCj^zRY=ANx$X&>&`MeGyB2qv*Wt7|b{RDiVK7~8$d#=ZRInQR z3m^V?!<~3vssYV?bAJoVQu?OI)iJ=;Q2^Ej;bgkT-oT%R;ycXp|v(7KV$^>Q}*WPTHOl?;lcEgm)JdXX(Vs>;gYQleTk@=4wT_DJdvi7y-{m&3oFrfCXumiEfG)JBdyNyh1~!4UD;vxh zS?*`X9{_)l1R{Njd9^sRt#?*1@Nk0u9zREo*k4Cjxog|Bz;1yZIXNUalZ-e63K;_#T9W!I-R61} z3;SOTddAfGeqzFbqS^!$l?Z@uJVo2tit+7{_ie#r0tL;T2>t`K^PE|L@R)Pdly5mu ze}Z1heo`uYOQ$T-q=id==e&Yw;jQFN3~0*39L+bD7__HJ*<(yi;HC`xAyi0YaVDf{ z9FAGv&ucIFlkFECYme0#yuEZJnHdjOnMendjPBOJ{4(Sq6qPg}Vsp=@L2yjQd5k!`1>y{;`T} z3X46C^v8vFgZhd2`K|O$}k%b$Yr|Wh$H%DO`Ofr%*!Cxb z)`m9E#lN?7&5RU%APSMb3lg8R+#AC|&i7CXH;+g+=OoI8M@&6^<9-^K^DmJ8D3p7D zmkX$y`hrwj$1C>$-Tfdk4Q0Z;F)DNH@rw#mIzy}1_^v$1X!2VY6LsPw@7?sz0NLa5 zIQ>DE%(Wm8c= zQaJxvb>XR^HX$!GH{VmK0`hHZ;vPqo8K*6hS!2t`+nXU!sp?o)Fl1yhx|lI~P%vg^ zG6`BVOj`AZ&jt!8iN3bnlaxHI*gaHG68UnC7^BB2NS!kt8UEfobU#YP#K6)l~W)C1+DER9s_ z^m|_+aZ9${mxb(yMO>gv&ci}ZlEPm`&D^9}LS=Mak2CS}Xtiu&)&r@F zU9hRot)R-OpgM};Ur<5K!|FeFty-+LTG2J`GG%h(_ylE^pXC~9UK*`f{jFJR?E`Ba z9c!I3LeD=?OL{s=1vT^7S97T}`-xTu__Xz9w29G|X2{gaiqtBA>tjXh<3LTEH(^gc zP9H!j7g{cyf9|YT?%W2+Jdw^E*zVEMSzshx7A2ic(t)+#SO!LWA!a3WufRQMfl@wn z(hsySu{O6GR(4=EF%8qZ7gl->R)*NudxJJlOtepcn*{^91AOR38^pyO+~XVC6Ajuo zFk3fBdbD^`oxQBwFXRnQTlGO(bzXWeQCkfSTQ413uOFH5Uekz-L@lD5yHuNd?7D44 z`cSf)(AfGl%j8p{{W~MNLmj#o4V!~en{b`_2!r}|XiJrBMYu zm7+_xnL3MLr^FXY2;)D{!uMhupQugZZc@rs(MiMp!1 z#-mzn)PYvEiFVb2%H)CWrb)b$JTlo&a(;dqjzem(Lm}OLN>x)+{{2D&g`SND>Ec5` zqbcLyzSW_jb?1IPo*4bY1S|1@9g~SXwV4BxS#P%{?wqC%RHb-_5?_>=WR{tC(2<0W zgxlbe$KagzqM1+ekyrM-5B0I{*JEcZt%M5|Gel!iXVW4LS_HfZkde(HjrXxh<8dT) z@MUT#eD+q(5U?t&M^Gl5z{|a`-#+OiMl5#s_?SZd&M$G^g`iw`zSop5nroL zvc-;as+N>&%(`Za^okFB9u5c*Aw1N(;t6SU0##7-+@Ewwf+b;W4H zr%(S)o>qSDd5UU;dz`T6dOYi1 zwCX1Q({p*&D|X(e`X^lT+_Uv~=xdqzA<*K`G&vf7^bT`Ixm8-_=eI;lx%p9|`tzA! z3kK&*=pO%t(0_aMKQ63whD%NekZ&EM+JT)I=*vWGtlzm1;x4bBiiZILxl^m zc>vR~r1^=weDU&P@N%Bl=HRQXx9sKDiLOOc^J@tG zdS`QZvVm&tGdM@2hm6kJSsKf^V`Et>n&|KY72C+o<2%(99ma|e$P-KKlR$GzDZ(Uw zxK_X6pQ(al(o_L3ImmNxm53xr-buxxolwhLW=;kF$U) zu*emoTKU{QIFE*2_AikTtbeu6`LwnQuv5}K@(nb~cQ&a!w5%~ry&CDxfur8LEefY( zqIf#3;kT#Hxut*Vnh?4L9NFtL*$Ob3zU$gP|Kq1jcJ@sm%uQ&M{^&i8{JDq@zL7O`QS&} z-2(@?%{$wx$G@;ob~sP=G*1qkF8oI)j@4IhjcH=Y*McDPSq|cfb0-fqCr^^l5CD?L zl8aB*gU{8IZ`YH5larsgYXHr2fZDUC?X#cRGbmK=In2d1tlBj^cb#kcD@`pU(; z#KpqG4!P!D1|`Bt{7Ibz%h~KD(e@?9Xe(} zl&9yEALFFQ>8_6Qsx9}bLE>H<@>-PgT9WgcALCv=TUH})#VPHa<2lps~x%2 zY`GWtxW{hYW`n5z=taty57vEkTpJP3zo|Jrc=GsL{n7!t%S5~H`&kyF zdn3F19Qowxx%KR4>p5)pKBD(Nn&LSo=NeJ+K6dmzKIA&?<2t?MIRknhit(IsdG0?d zq+_=&cDu>A@_=}$SO&eVmVB%=eK?}LgW6GSWXe3=D@gXT&8%>aO*lV`QrPO$9!-CJ z9=Ld0n0+4md>)2;o}_%94tdu$eO@ftThe?MNSohL6WveRVz|GoOnI%Vf$q&f55HnI zY~7;iL2tfKT7=bZF^`$2xTBfM;SGYM;;A>A zR{a7=+t4z9GFz&c(pU>-TFgSIT3Y~Dlg<{a4g2CBG_fmJ>dlwD2U-^x*PHD346Q{i znRHv-o=z{uo~pOHePI!qq@VxofcgWq=xoLx&(#~^NPY+ZSz(x~lJ1kesC3d-8npHm zLmG7|JDDw1sQzqMdazoo(Q&CvkE`hmY81Q-9&RqYT+a>K>)haNw%Z*Fp|PFR;&wc0 zDEO5U-OlrPvY2Mph5TOhc)8vu492iMx~-NhWa#DKcX-Td2rgkByPZ(8DsP$Ev@HUC zEWd=R`GT_8bB&^r9M$|oxtB=;QKWFmf-p3P)r0)8n#uf#1_yRRpjjJNRL(Y*wqz9X z8Vu#R8q_fr8Afp_WLX*<_pD+4a4;nKvJ)wyIUu<){&J(MQA+Ab!jID?c+7!kLA^`tsuIxvz-I(wDgGB*Ne2*f{LDc}lSVc`&rwG`DWVOmD z$uh)eY?#x0D^vXtwIoSbj!Rw9AswY+^51hew+Rhg93aibZWIp3RHP&u(9!D8=x&!B zPxr<2Y$O+jbdmgG)mA9cZDY_R1vk^(*-&w*6~Nz)(*mo>us!fq>X6oVBOYEQ&7c>K zI*KxbfjX5zMzT^A)VLphkR*k^_7{*L@wXgP3s*!89e(++7FsfLaj*<^rJ#h*gE}jY z@i#N&fH@K)Fm~>1)3^0`Mzg5A85yWE_Cygyx;ycf!OB`Mau;saQR}*o#$*k4EUaO3 zj&Ll?(9yKg&2ZVTEJkp0mALKaOcC;vT5+|a=vw+F%pHwf(O7s;YE);tE{se;{Sk7P z_WP06H3QTEjjXTKOg}mYerI6v%TE@msk~Ab?oqd?Bu!Z^bQPj_=k*6(^0jXbs3jK{ zY|QeJn-|O=>6LJo;e3?LW{B}UR>mI@l>;L=7@qcms=Y)M3E$cKco3CaI-rr(uU|@z z2yJNDz|j`HpM;x-)9$A+F2?mwcb%*ScPAT2!tgGOaYk zeajp4#^E9ZPtXL7Hnd)wus(YLPSTOu`}84svv`q$IO96#mFQig77F@2P#e_eadl&H zJ31fup`EiX-0opBc8%M5D)?du5Xk*@K@J+%kGtQS&g}qR?;6^Vsp8#v6|p~|^HBnZ zF*|6ljFdDKM%Eh}C0|A2leF>1g9C>uqL8c^DrRTtY5W5A|CnV~=zRTM(sh?qOR88& zLIgzr2U4Z<^A$YP$3HL`8*JDMhxMbFPImhKWG(2Ao0!kCMH{r1%KR&bl7LO=w$|MA zBtCIJp1m$?!n!I{nh(A^t<|YX46WMsaG!t&5wnyBjg)fcEwRVhY; zqmN(71aV%HbZ8MV2!qUd?HPfIXC$YIT<+6FN_%_>Dd(|c;$ZXV$Pi9r(h)zVAXOnR zo!BYgdIG3O*NZJxlr(Dzyw{j?x0p#UDo-1&FYcHj5|Kdr$JbEnEpH{>E+#p~nvIfL zaz`h4Un0#GzhnNwjSq1#!(SryUH7bDccK+n5RxOxOr|5BFV<~DJc8B(>iNaR$s-?P*GH`($~5nF0-w;-+~Ok?1;x|MhEdn*YE8y)qiML$ z5$8L2s+>QTP9hp*+2vYPg_WU_|1J`uF=6pHvZJ6x3lDK7V3Q>Z6rR$4p1&GF%~8;R z^@rSnKz;acI$mi6T;TE$WIu-+$melRO}{@uIE< zbgRpX#)WfY%Q`oPdLe*9h?WcA-|w(}1MBLwyMPB(^Ps)UO_4f{fU?d&(X{uV*sfYq z8v>hSjxz0ESS)mN)ellOq;Q303!#Hif@YT9~&dL;tl@7Cs7>36yp+ zM!I&e9bE+m!kyuIi)jj9_0R@?Z?}uG^TZ@r+c%T2$BGTWm}}1dH=MVki*S^Ts`lZk zB4Lx{b(w)d$BRfM=qzgDVeZ>uHOnF(L5UAb}XI>ghc8$I{Obawn7zc_L?k{la3 z>Jc!cO>{pC_6-LK5Uikf!YIa0xg$U#*5^t6JB*G4N8l((gl_O}&RwNe@2>OYUZkD! zJqFe`|5Y<|<9-RB45q*G0P)jHh?)Ebo-$~cqzkUQ0_10@Hs?+U?0l%SBf`?$(_92@ zHdL$dVd;*!)AesQROuj{X=1c33~)5oscf8?{(4(p#CEQ=`>?b=;-Q~A1Udh+W;`>6 z^<5a{;Aj}wu(F+coiFotfhc|?$O>ebheZBsCvLqxzD${EulhGjYh52(>s!y@CVMYR zwx!2=z|L=j<}xzkt6;hH`C5(!Ka>=LfQv5o6EAHv=8&gWrK-5ZU9^__ua zt|0*bO$Z_{J@OORh#HYy?49Qk`qp!$i>yQBljk8_&Wo}%vO~O5=HaM^yT7=|wF3g7 zthemuoTR&A`((qJHt3Z+kLfW0IfwUO&NqS!+hPVAbUDPfz#U zY$)@J#;jrei>*x$#rwsWs?(aajm-cF@x_jFd+md_&2Ub~?Vgxx73gj9(S8Vjk&J}* zSgHP@Ek3)dXlvf{@zt@5o=Q93o3H4CFn>BG>sV^aZOv^nErWUEhI)7_j;D z%hr9$j``094bjb5jO$>~`X5 z@K3tONzPK(@qDx(5}B^xhg#bxAG-=(kWx$6CroZ_ho%|ab|VrgB)Wc+T?QmaF6fIs z&$URqU(`NW$mqdCz2cM929b$YqY#4B#^-j5g7{g<|Cg08o2=m zYt{u!)&ttsg%|OyTMia+)}w|2^5)QtvJO)E&O(nm#2^1ileD|SA&-Bsp7pRqlX*m~ z!JJV$|NOS$gtA*lbT%w928g!TBnc+iGuAis{?YB$Y^=9%?*h3AA*2j}LE2Qo8FMFF z{Yl%@vb&ofn&kO9AiPaDA%be8UAkmLGW6Y}lf3ZK*z~-W^oe|iMZ<@`q8V;0rw8&` zNqRw9Ip=usfPDB}JCgYY?cOXn)++pVB&{X}Jyv?c8PWd>)j%r0BbrR3XZ+m3Eh8CD zp))dJD|RC|LZiYB&(V!zyTN2L(j*y1SW4R9z@?#Y zbqh(6!pNM4Pax%cB&GYU22*N@Qo;!R$>hoXpF|SiHpc2Odix{=5Lx``sL92ktPh@TSy}3NG9h! z#-uF_%+x%^tT+!-yo9Vwrc^Ut@zA8= zfTu;p3n>`p7oAS)InGop&Q&1M>Ex*VKn@#9#pm$-@ry z8fMNwPL9^j<0u7}PQ{n<=t2ypvDv5_`4pDU4-`%2zbu81j!ux~XaG=xjp9_>4%?^D3t2v7L@21`s5iVs*8aX*12P6kklK-$85wQrM5<;PO7E$SWNyy zoh*$6%&8=JO;!8@ow{ioaB6OzT+N_Hzo1%vFh#$J#mSwgR&dTgEEB78#VDZ~Pgp3S zni{P_4WZ6yVKP%{%6(R83}n#43p{&cl)aC{Hd#nb{)tyihFOqOt;JeHh$q@}hsF zV{j@arO_znkcrErD^K3e&1S^PAa5>g>QJVIdY0T+Xlrg7$FAqBJSM4T1*|kI zYGBT3&}XK}O>Rm>8|3D~M(k9?>dA(zoGz?=;%Q^yslVwcSokQcvY}_On_aw`J;+Mw zc-&pM8qmH3s(Fv=a0RD2EIA&{p%H8_7A%0U<7PN2JpP$bgp6{EB-twGRMMoOrX^3V zE!)PMx z84|9HF6xU8C8W%lQ9@-?#>P`_?oxLDu2Zhi**31|j&44>q}W*?>FS}^?Ir8_C8wlb zV0y-2vYufAqc3W0)>3Zj?k?~4uJ6vIZ|3gp3U3e%Cx{hiXP9K)qUebdSJ?e7^hU4r zPOmsMFW-(Wasn=;bcTx#?n*|k4N|Z8jxYK0E~0)f7-Y)+(ume9Z=vnPKDlqZp7T0R# zk-no;fbDTEFFjiC$%HNhk1z>8@ZN&(a;EU#mSp?=n_q!14CCNFekKhkV-4e^4d*Zp z@9<^ba1ZP75A(1O4>1rEu@D#kF%loK5(hC88*vlI+xZr5`W_FXs$u13+2wNX=Wem) zdTtkU@sw$(xq6MhzcC%Nu^qSZ9m{bY$MGKj zu^tC<9uKk~3vwY7@*Ep-A|rAiFY+Njaw50x>bkBZ7nqy<>xs-RFCHcZ53eUHQk^-B zDEkp90}`K{@+g~fDx-2Kv$86;@+!wNEYI>QTNtFdGA_$V^YSk1vM&eoD)SNV zAf_>Qa`AG8`azxYVz1via|?>`9j`GpPqQ^wGd5qdHfJ+8Z?iXdGdO>oY(L^FQN-D{MtUSH(dO zbUz35LJKrQD>Ot0wA7(5MN9Genn(se>igPn{oZd!f3&26G;A=&8g~sOH!@1&@ky(+ zBe!%)^D#@mG$1o_OxuDx-0@8-vP|oAO~bTL&-6>`~FEO1sZaE5Y3J2X}|v{qmBR_n7ZY#1pQbXR9JSC{oepEX$n(xcffTVt(PT<~dR z^w$QiUV8BLKJz81kY}tPU+=YFcSc_W_Fqp$U=#LWOGRNL_M;}YJD|p4m&Ri|wqQ@T zVNI0Jm`0HgN~nOO(Q^jOMyNPi*IQaXa^IKlg4+cW+boZ(Db8 zV>fWK_6EmrMHA0OLtRlGW#*oT7Jo5%o3|H-aS2avW4o!XFa{^w(7%*HdcJpikME_R z%nBvtQT{hn0=R#}E+z}+Xwn%cFK}B=wO80SZ8tVoG&XKecvSHAQdoF)cLs)UxMy&< zhIcrKf4GQG1%?N}&HMswn_3bCKq=%587P4(K%Z22IEjaNjgR<@+jx%Sc!leDkMsD2 zk6j+Q^@0okr!o^KGlOVlWx1eySoz?;0i_0M%}k~cWScPZ=Mi+Q~tF2Mf$@Aep9>%7rdvSZgex8M+hm%D=RI`4$t$Wyz) zt9!sEuW@3%)?Yo>TfNsSch`gc*M}Z#mVMTTebtM-+NV9+Q@z`p{nmf|M4S6DKfN*& z2oA-waIy1Uw;=CK#C-)msSQ485I)x&zTg+W;v>G{CqCmZzT-!J<4->1Q~u*$zT{W` zzUE`TmvB8UiiP+_`>((IKXv)TzxvC6`_upXr_KE1fBozK{ktGQv8@s@11k zyNq)2>sae%)F&>({km&%V7d zHgDa%X=k=w5%})l$Bid1zWjG{+svOk&mBEFXw8{9V;`M8bZ6__uUpL?Kni5YaG3^G z&z3#n_3qmzeJ?-0+q!}Ej@3WcZ`i*7{|eAQ0nhS}t)}8zs=x*J%WJ>~8RQQ@2pjA# zLaFG3Ps0p3oX^7qB@zg|1I?3(r4vJ1DaDdbTCv5CT#OOMj}RiRp&K9n%JD>mbmVbI z9DnQ)NFRwD(nukZ3{uG=ZEW(SB9nx2$s?zXl1eGDyi!Xmbwm&*iDYCk%ooL+vCNXN z+HtZHvqCQbQV6S0PQ(ghY_Y`bd`eHM@S{*d0xO*GLJI>0^ewMOOwUjU2L)_VLjUxW z(L%%8NU+1=q;t+pImJ{x1Q}x!zct4b?Yr$zJylgxGlFiqS8tt2LlDEQ zk5B&kJh#&P*j?9Mb>U4{-ge{756rI;jjY~x=k?D=ef!;4;D8DLrWY)q#7&soam$6T zTTsE|R>(FcYY{sbFE%Npj6uR!OpXh(v85h)YpCRr)g)QvlvyV7WY|nz*=3nyR#Rk! zoV;x2mTTVG=bA{N>}QmRhMDM|kv>{!qfy%U zTI@|dZ4X{SDQ)yov?EnpQVW5Cn9jD-u2AB->CSsnbPpX&)4w~tb8NsH1J%m_Hi?Oh zwkR`E+H0+aR`Tm6*IC%hm%Wu(W-;Gfb7eh$RyX3B`rO&hffFxl-z?`m^JZNSopov< zuf6hAX@@pj%OEOG)ULl>SmA~lE?z;r_f8&C<=JL_ZMon7YU^9Qm+#7|1R!g^dhNM4 z^vmIm7he2wp-MDjZj~HUeKW~ye|;yj1wJv3FMM+=7{3gbMl`N*U}|h58^^LIN5RpJSrJc( z=$OYh?h!xcDdQiJ@1uFbgS#h1}bY~S;2^GyqFpOjj zBp}IXpY1(!nk>YoMd4s2)QHUvUyRCUI<}#dgw{TSH41~@JFN&4Vbh8Q%iP6 zrcI0KN@jY~kmZJGvy)9vfyz^%{&c85HEK}*iJH`-78R*WRccd}763Ak!kjd5>Q$l2 zRINVMpD}&uS7{1XuZESZwp3Y(vQ`y0RWOF$?4|{asVHpH#G@WN z*Z$g9!0Pp{dF5+i1#8&CF7~j2MeJi8>)4=?q7{^lNzew{Si(kjvz^tfT}cSnx3*QZ zn~K{66Np30q!Xd7Z6`aygHO`z23fSVZEbOTTixcCx4ZRiZ-M(;;d(To0a#sdf}7mo z+Lnl}Ehs?`+Dy>xNMUc8xI&e)P8R*f~?bScvA z_?R*@j4b6c?wVSm4CS@ZaI`&kD>vB^ zPH&A4I(BN4(i9U3p9i8V$HyYAvwzNSn4PuC(6Ne40Z+7R)Auexo)TJi%sZE_~RIggq zt!DMBT^(y!&sx^C-X^GVz1^b!+&69#Yw1gIYSWw!TiC^hN_Nc+Xp`1!gd* zVv<%Vzv;_9?(#R=YHNYhn&1OBc)<~VaD^wF;i|?I4NL29Faz$iHay?&R-5TIv)Q?8 z_PEA74)WJxn&fFN`Nltf@{p^1pJH=*Llx(9(14& z{pUsZ`O$@L^j#AYzcA6SiHfAiNd}m}{k1wI2YmIZXC3QR@4D7233f`3o$6vQ``6LF zb+4=4>|AGi+QSZavb#P1?r*ny-SIy6wdeipch@^gY>YzHURlRpj(EQje|W|77~qCy z{J$YT@x(t~@{4!;2msaI9EE+kq-Q%2mklQC;st=pM2pj-}vNXdauz}B$v`O*vBTe^^HAs zWN-ia+V6f%u^)c#XCM6I7k~NDUw!khKmF8qKljP6{`SNF{PMT|`@esG`m0v|8|FOUHd(6kOj%5353@F?R} zZ}xJp1Y>UmW$$tSN~KhAkIh!l1WE7(t)nzxF9vNe1yOJWr)ygv!@5{0J&=$2g0T67 zQ2B`P2!rrzkkAN+unDz`*GL3$S}E$9KmrMtxo`B2CWK^f(~&V|BxLOF%kI* zG629l=20GDq8?!admuv}0{|ZY|O@+46*B~h{_J~1R)@*_jh26r$O%M6TG zaTamX7HP3VRI(?1@+X0^L<({XRw^fN@hFWC3U5dw8LSngP7CMo4CxRmr}7J}@(qI$ zGJ<9zwo)d#5@4)GB@jX^xiTx+CE z9T7|*@hl{f6k(DyMKUH&#Us2ZXf%>3&7(D6vz$yaacI-&q>!9&(>BQrGIBF<&=Mvj zfF)1UG+%N!T{1g%k0$ZR_l$BUozv$4avvY^Ag8k+eKKOAlPj{*EK@RQn)5q#5r5C(Jsqfl+><@ub3NsAeRPNiAp-~~A|}cst@slr(#jLoswiJ+wnX^g>0n>&$Uva7-Ql zCz3N&bT2it5%G{zc!WEF@;7C)BnfoOTC_7alSMPrJ>*6gH_|>|&^Sx;I6<=ZSkOFz zvma};Mgg-)*+c^Fuyi`HIIYwpiBu$Ka!SwRCd2bfky1Qo1RyWYIs-rgk{|$*Kmvd> zP1m$d)s#)uR3_XMP4m+p1H(<@R8Q+PO(#N6W1>&z6i`EuAiE_@!Sp$Y?_r>C7paiC zVvJ*CEK;S0#6o}N+H%@&&-@wCle+1Vj-5L zEEY=>7Bz{}BgI2Ad`DE6Gf~C#WP^??vPVDd0YqFVQP1N!R~8RVwq_Ak2$k~UrVvO{ zBt7RdKHC#Mh4yEMHfUd@J{k5)x^fe`gGTc!HhEJwrEoWM)oQ*dH>nnDr*><#R=+L+ zR~z<2M^tP%bZkSkY|)l%)%I-H_IvK~M4^JMR+L$twOLcNhGaqtq+l!mnL=B)z)YbO zi~=`>=oMXUVGG`MUhP&#@0M;K5Jwv|NIjJWJN9E0mSbJeGxYNzR4SY81ZfeToH z4|rP>*nt-qf(@fafQM=?Q#9AmNIh1AEms9=!ZrPfe??d(fI#s7QZjWnxJXrab=_&Y za!3`i3uT3OhQS3Tb9aQjmneVof{0g!VKHY}>O6}UXo+};jhJYW*l2rp?(U{lahQKA z=sGKgZK>F7tvGF~7>lpCZPAuS?hP-6Np6+3adWhOd-RFXxFo?=V&+kP&A4vi`0y&O zg29+nR=9FGIFFGO6#o<-@i76Cpe@r_gb^Z5@$(@Mc_FE@aWEE-@0fK{_;y~`=4>*C zhu4QOxxRRW6gc@!IGK|LB9XZTa0l6jE31=1`IAqXvObyLdiauI*}llrkaqSVp7JW| zQZD0?Dy6cQb(!}piFC@+JigMLtcw)BwU|XkbiJ}BwWcKhscM)DRU>G$D{Vo5rZ|1S zaecWNeY;tGy_x^ocK|UiS>1Sy=@*?D@kw!2JU)sj52>=GAUcDFnaM+H(=vt1gPf$G zvedM)tP_MuHuCnBfel)M4|;$bSfLY|UK_fg5jvuQ;xjE+^c0FC^_Ybt*^!epg&NW% zMfq+*T2w|_k-4R$C&G#E28C7Eku|!5Nz;XsHZn?oWc32x7n$q8l25=iWMk2vA2}HmkdDFkMHq3gl&tnn2X7J ztj$`i(K5aoGwlZgE89vvrrNA!w#~^?ae)8-cs2e_OciZ=BC@@N!I@mD{iP z+VD90cyYT%;Y106^vN7rqOY5wu^XbbySuadySW>@AK1GUH$*(Jq9YNb3EQv>8>S;? zzj!;kQwV_j$y~DoEv?nP*IU0|+FE3qd$$a;HQTf?87k_LX?0?a<(pePn22E@%i^}Vm%Fch+{aWF!G*cRP0|+Z*+e47JAJgi$#`+!xXIUXj>V~t8M(jr zJEJ8VRdlwIh+IZ7q-C$8SQ*L6$vn$rva)5u2Wz^*OWR~u2_K=m%Y`x^rDr##K*%FJ z-`IT5zZ12$cE46zw&9X4cX_r6y(&liPUSp>m=b&5Od!fbkcG6jLwv(6y~9ELn~VF4 z;nr(@oX43P%E1YAJ))==J!p8^>DXdxj9M4Bz`Dab*2i1CBbdBrUDj)z)+hM9|Jeb`BZ<}R9{VwcY;yuf8b$djF0*z|hx zD^3noFeE(N&ArX(!_OTx!+|Z+rP|$x8`Cen*hYMMx?MU0_)a~vM21bqYkbB5{@(>Y zt=Bq&a(v&!IMn&t$$Q*Ap8G)W9gqApW>3vikX+Ok9@IZw%Eye#S-s3- zwU^(uT&!GNR~*tCZO6J2MJ*TuX}cLBFOtAM_(O&79rxM;`T6_`mUT%_ltQ z`}`}p{q>I;Xh>V=X&)!my_Ok5!^vLL;r+ws9r)qzhSg3&6)51x7Bnu@R3@Eaty)9T zXW(tT`jy}Msh?~Mo}33i9d{h#pFHEiA8dl0?Z=-2Uv0nIe*Mp1GdVuBFmA9ZKjfo5 z%eP$h=l|tazW(|D*#V-Rt#$zj8XQT z+7v0&sZy&xwHo!R)~uu|CfF#{XV9@b$%-wD_N>~lY|Xy3h!X0_jhl#WY}e{y-Zlrp z_AU7rWMGGL1xxgM7;s|40ueV>{FrfJ!j2~ozPy++kjHQC1bzwUI{~i4;*r4L$T*M7M3|p+g`(B;r9FerRHdCzjYDi7URS zVvHo#M`MjP-Y8#*ETY)rh(4z1qKrTG2;`7F9=T(ZFh11YMQ}yu8CKM#)fSa*U1?>O zYhk&imTyt?RYelC7QmPRBw=Qmt)WS#nQWfvW}Iuv3Fn-4)`{nvdeXV)oqgh2rd?Hb zN$8-4a(Sqih{gohQiXwrmtIa9rXi&WS&Gr6nr6zWVwifmDX5)(N@}R3j%sSEs76*1 z8Ie9GDXg--N~?3V#(L|lw(g26ue$aM?5srTMr>`yCU-1u#UjhBvdJ#%Y_rf#`)sw+ z9t#p&xt2p_?>zQiW@Gt+?o5`xaf{Y?z!r|%TjyxrCTn%?$(R%z53F-FT3lq zG~2)J@=LJ4_7;5J!3O7x@W2(Fn-Xa9LU|&Q79+W&kxB|#WXBh89AwBE2X>c-EfNMK z$|tAH^2#pf)-ud5i}=xwA7|__#vI?gv(6&t4D!g&J)BUb?mboLqKYn^G}DPT?Gj!A zgbDT2Rx4d~P62dPGuBr-?RD5-kL?mzOg;M9t$dX%S*H-Sy_wsgzO6FccGrz}ig)Xs zcZYlbhPH*-UQ2kihErQO;)h#{TW2(%%v*BADLXl_l}Apwqw*<-iN~n=r$xH!N`M3MVXY>MQvt*iN`B_|opa>kfR>!S_D=NL*JW1%Bi)_+W$1 zHxGS(4od$#_0j(~J@(b7n^(Q38?9l*K;z8w&*ckkzR&2dPcm5H&m6PLGS4r6{qf&F zGf4K-&e-|m_Z+nUr7wW~E1>!eQacVw;b=|C8ri<)zz9MRC=>y}M<_Buu}M&aFxeU@ zOt%r!W$=Lsu-S1hA^C=4Qq(QRnc%&XyZt57^k=(0&$3m zBO>|ED7IKjQWTeR4 z<4E=?vXPV=U?c@Nq9zq>lb}J`2senrPm0nkohc(IPdQ4awSr8;LZt~^8Om3_g*tL! zA+Od}slL&TZ@l!IF6RbJxd}6F#QfVXeaTDckU=&aInL!E2Tf;w4s)QZCN-~_5PO^{ z02ZtnHl-Q5Xe!5=;(R7J$$8FiQf73uA_xehgt`QQ5sq`LXC2Qt&wQqfC}lhs^Q;F@ z?OiWG*(2!o3_4KWrI3})EGX{+icp9?RGKEvxKyTJ#=F-@%@yir1fbZGh|xSwpO&Doh@reTfU&~@gstx zrBs}1)!4CEdA*lSp=rB-=Gij&?Xa)v~TNt#9q>T(jCT>+N-`cRg!e`5Im=(JPHpkEGw<~4 zy3vhuaqE1}Ip_J#^L+E4huh~w2l_`N7U}cP8+Ilt#pa&>hTYN`WJxycWDPFZ$6a&aJ;90zbAYP7<>-cfDyNLk5Yek zL0yA~frUqSfR}+BsDT~0c!no}8yJElsCXyHcqur7Ac%r1_<@b_eRzRprgs#Qhkomq zc{td9IcR=8c!NF&e>&KCqL&n;hgd{&dVI8h{l|p=CxB1rf34?)QCNFWNL#mOfLEk@ z5%_=%2!UVdg<;r*RWpIMbbJ`Meb=Xb-KU1!_k3?SeQhX*X-J1`Sch zTbYJ{o5qEu2!>;5iei|Gs91({p=uZSf*vUUizUc{DrkbXSc@(=i!FGIx=4$$_=~%U zi@?Z>*k)!j2zfQ=Ux>(zhv8sl8B&Ru_>G4A2#@b5kE%G2pcWy}b!1NB9DCGtUB-|9=#K$eZvxqm18I;2 ziI4z!kP4ZQ1j&#O>5vh*kP_LD6KRnZ=|YH+OZ|8$7YUIbNs%9kkssM8GiMj#hau`w zjm3lt~$tR0)1id6iR%l|QNfm0ektTe*~8nU!A&X)slmXK9vciI!`rmTh@v z?`Dv^^>qM43Mtu*@?w`rs4becmwCyTc*&P~378lnn0INIg^8Gdd6J*_*;?oWrS{#JQZv$(+gQoYmQ! z*GZk&Ii1@no!uFo-wB=J`JBP2kHUg0^p%IFq7pkEZ zN}&bXp^BNGAS$9EN}?lbq9ux=AgUEc*kMYDdiMvTFDj!hN~7;Hqc&QjCWE6ps-r#1 zAw2q{KI)A@N~A+-q*ZpLF`A=Ailj}dq(GXayBQHlD5dI2Z&r$>y?Lctnx$3BrC;i$ zQtG7ah(}prrud1bQlh3?k)~|Arf2%5Z3?GuN~d#br*ev?ajK_vnx}lar+50NeF~_4 zN~nWssDfI2kRqFl8Z0fusP*ZnjrypO3aOK7sgjDRm71xP%Bh#Csh`@Zo9d~d3aX=O zs-lXjrJAawii~}TgoTR#sDUc0usW-UTC1^2tGQ~cx{9m2>Z@|99ddE2!^*3~`m2w) zZCy8L^oE=zv#ifrZ_ui&(Mqk;YOT&%t=M|4&C0D>+O1Oht<37J;|i|iDz4>4XUIaYz9vBfH}$2zeOTd@&4sAUS6pt-T0>9HLPvTDY$BKxr<8?qydvf5&%6!?m(da9}l zv#k2EGV8K68?!Tuvo=e!H!G^e*$QnCAn7%X!sv^|_<|8~j6!*z7;CW<>$FV^wM;9u z7fZEI`=;I_peL&TwJFNATkEx53$_5m9oiUDEefSb%C2Yoq(VBTOB$ta+qPFySMkZk3E`uR$H}E`?yo=nx~r?Yty`%V;<~AOy0MG1NsDGENvj-M zxx34`mfN|$3%tBrwQ!lBUu(Qv>!-)NwOcV4S+SGzCZp5ot{?WEg}biV8m|6mz1xeu zhbC(OFDtHLNuyPG;vE=(b&%XQt8x?~WrwW3!6lEUqfUyrx6OVJhYq@tU7 z5+0Gc_R6ah9H&Zbz`aYsO$@~ajI>=FiD1i@Qqa668=(kF5q0^%8%7bE;KhY0n){hy z^T(p|W~0Da5y!(AVQCO;kOX9)O)~hNC56Yr!naI9rP)@(eY?Ji>$iB@w|YCsdrZiN zYsib7w|{)YDytV#;3{}IR7u#Zn~*%VA_b=7VK@pAzx5;tfpi<3$qR$=-uOE!h|18kAsn7U4!U7%82`!WgEmQ@ao-4e=5#7QN zJ<%lmFqvwE_R$gN%wgB8(E-5Gyot1J4ARaz&I?P*k@zrNlNa=CA%_&wmTJ4<=ZB60 z&P8DhU2!~EtdTkW%2ff(_&UtEj1nqT%(PV0Oq_t!@ykhl%*&k2PyM^ZYodo_6m3lZ z5h7$ZB>_St!LaR!M`@;vPVvksO|lyuA<%q)ApI>KO~w_9&Q9^XY8Jg~Z66599Fsh- zuY#|)ve269(2?5Dy5hcpoyzqauH~E9=sUjV+t`auzKpHd-m6KCs+1Ih((T|8gWV1w zloy+DAN#lkb z)Pj1{6-?Yiz01cv%()D9zRldo?A%cO+!x!-o2F*x?Aai7&aJQoTad-GJl380)q2U& zzAcxmebJBN(Ih&0>ddlkcgMBE(jI- zP4eIT+|UR<;D%k%5>3$$&cY9lw3K?$ZT!qOOc8>!!3Ck=3xq&fZ4tdC%dj%e+q{qT zx6)gKJnhljrUSHOunBy@&7j)D_IWy3;l`X?+NQGwY$gF*BSP(g;m94Z#%$#3T+BqB z+(eG#OuowmY}COG-BT{rQQcouU80f5(QHOb+OGG2(N8G3P79xo2y-ydQq1m zeVm>?o1y-fsod$jNu_<&z(qJl+mTqm?$yKotN;7CXga}hA?3u5)KwncR{rd8om?+p&S z?jEzufyzF7k~IzORQ~VI4)D=F@WE`w2d}&-s+Vt#@C^^i^EcO^2-%K3*$K(6?Yoc_ z|JdG3@sjQFkqz=4AMz7V@|1ni2V3N{o$@HJ@-5Hu2b(J^kFPT?^EL1C{VMTUc!aJQ z@Jn6r0uS^(Pw>($nkjp-C2RCrob*eN^i2=48HSG;-AwXM_3vK)_4r=zSbz0dpDO}e z+rHB2Fi+d64fbUpD`7wLWPkQ%|MhEs5&CYDdi3)`KlejV_d$QaRNa`XshVY6ntlKG zd++zG>F;DKilCY4iJ!=ekI0Q5>6p&=k8kOb59yUJ>5A|8{Ybn8`>&nP`JYd)q3^Gt zKl-A-@}-aZ9)^1eXZNjN_pguluz##uQ#(g*`%3ThxPSXhzx$-Qmr-BtT)*|hZ}r8m z^~Nv!9c@BIC`?>0`(g)jTAAN%Eh_vfFc zU+nPfpYZL^{wS&y5x?>2EAsVU^7McI^RNFJ&;K6}5CH`LwhPcI0KtI;4+>mp5MjfG z2^}&dI8kCmhz~1b+^A8Z$B7dOdQ4c7BSn-ZNuE@hlI6>lF-;@7unE1K&N|cyX

d&u3=f2&$cJR`>htK~1UA+17=8&Gh5S)QB!^7$ zNF|$O@<}73v{A|+r?j$4EQ`ES%PfiXa!D$=6!S|bjqH%Qo(dwRr#0Jb#Z5Thlrv5` z=d`mZ`E7@>=Y$P!fylvS+sQl|v+o8mgz$f-3E`)M9IGw%l&(ZMEQP8*aDb zek<;|c`Y>I_Suwl3b|CBA2Z4$t$PK^2;vA9P-Q{*Bt20 zg#M}X%{%8zv!*}$Y_rfn4~=rrM;qNT(ktVubfF_bgsQ_4SIscQS6jXC*2Yqu_19b@ zt992{Gi$c3XrHZi+H9}wcH60jMUWIM+MDm)cIRF1-cIxXjkn)=iyA=RL=*nE;ej8n zc;bu$KCV4cKXmcNlXG18jJVjkC(K zi8aa2feefx3|Y6SRscXC2^h%YX5*p&B;j$}V~CdjI_EVamW^y<6C2o&xI`ryF^R{D zqOb(Ah4^)^9VgLUE0VB5_z7f0q{!jER?`mFNFWJP7-3m*m_aBOk%>=iq7;wlL^#^f zMiP($DOw@{Hztb=38m-NQfH=#IKa{nWQQyxyn|uQhCW+WB|6HpR&Y~k&qimD0@bRxikcU{R`&* zhAB*8`fwmgARue9Cjm~bMhfU7QSPKbzg8$Dg|*8i8CtOxVtTWf-;~l9Nue-}~vLD5Oa>}gL`DkFh_P$5#t z(oAZCK3976m0t}jSjQ?>N17!++$2drYd0PG>F1;Xy&!Bh0lZnB$UgETT3N};*S-3Q zHNLD}D?_A1SL$?MxqP8I!wJsDGWM~l(y9K+f$=i7D*0;J1?ni}-Gk{`CRL0Fy zT&Lx;=0ftf^aSp3r~6LZ-D$b2R1tQgtEspqcU!rX+K*^@$C;M*rRbGudRt0fl}?Fm z%2Ka<*?Zpk#M6Ur)v$iGtYh6|2up1{0t_H)biJBfw?^0V*$%LGjcZ~5T0X%pcCv?kY-0->*~Dh{ zvz@K%XhXZ%%f9xsvrTPjR~y^b?zXnSz3p&w``qSEH@MebZg!LV-QJG(xaBSGdZXLj z^uBky_YLoP`@7z$Zb&EH%WIKmgM@P;$|;SP^D#3NKvgXBlG1jjgRH?HxH z+au#2=Xl6H4)T(V+~g$xKe@_N&hnAF9OW-xdCXf5^P0=t<}|;#&U4Q5nfn~)Ki_%K zdk*xX3*G2MKf2OcE9QYq{OJ>iy40gi^{HFE>R7+}gZ@$Rg5(G3Lk~OH$G&v2m!0fM zPrKRGj`p>?z3p&6yWH76_qW#_=}jkifb{MkzW2xP`T_jc1tj>8@15|7KfL1mo_NMD z{_l;4{Nn>3dCE_I@Rv8d<2NsP&RgE|mMabn3F%`=NG@p(~th~oB#dmhrj#dPyhMbzx?&b|NYyafBx@Z z{r}f~`Zs|7M}PomfC5;63V47En1BrUfDRae>^Fh(hk)$Iav~%-d{=nb*MZsRfgt#S zA{c@ss3Cl3dpdM-r)Fv_xPmU&f-v|^BG-Ho;dB9#T$f@|6(vDCcu_p4gFyI$LI9RP zX}{=$MA(By*eM4^AlnBKgGYY!` z=p{3FTM{69-vud?{{n~Hl7o`ST$HFUm579wNGY1=h&kwnhBJwl7>9QQikKLRrFe>) zh$*I+ijSy@s8}FtB6v&q5Z#Aqj9j^>z- z?#LsFSc8R!gPG_~$8}MpxQV%ykDOSKq_~QY;xghQkcz{Pm_m?xgOHCiGp@*r2HA=b z`H&Lnj}aM*|1paW(S##MU!#XB_)%m%765vOj68NfJoa(%H8sJsg|8I=`2{P2!YnBn zj3haQHtAlq|Cn)Oh#+>8JNAJu0)dUyf)k}Bl>gB}hEo(xQy^_HLPkk0xw8@%6iV{q zEcTH>c7q?JKuFv8l-bxO-6$Y+m`xwBK?Ftg2f|r z*^Y<#mbk}!&Nq+X1umqp1z?$1gEKNYLy!L$krW9zbYmx@L{Sh~GKlg?_Yq<|saE)* zQ`^ECSouY^c{06+U)k==QT z2PKPR|Cy5?M^y+>DQ8tXc(qO3geC+B;GZRAaOqn#GnR z{~9e8m7Lfk1*FuQT69?4M3pc?SM~vxz9|rGFh-v$N_Xj!nRQuXR8SFBS%egs+US+5 z6PBSjp5bUP5OzPd<4K3w23y%{1*J!f+NQ$h8Umzb;<%r6*-Is|686vrl1iT-G)}hQ zt9N=5`!bmYI!;q+tgi77nl&O*Y9o1RRol^1!+MthwW*C7t)vR2WE4>3G-g&)Ik2g# zd}vLVw#8Ch%omz^orKPC^l|eySDQ%FO0r07y|0O(9 zP^}#lvxdT~{UiaMl(F7=LbG{I`*K3pv}6`oopMmX!Uv+*$^6;arlL-zLP&=_K~C2mqFDI zjJXmj(i+X0DmgYwgff_ROF}u@p!fqq=Q*m?>LZN#A_1GN(kT$!3a=(gA`q1ypT!#a zL8@#)BI&alzrac46r=3gJ-|95Mq8w`Ww6gVLT9?H`if2#N}uf03d+hKC)-A|iLFRm zJGFaON7A&cBBb|ulU7KcGzhUAh%XJwpEXOV+kv|5Lpz~rslK^u&eB48|H-91c%{6n zR^ckFZrUcL)ue(-rfhmi4N9h_IS?omn|x}glr>9ByQEgR9oO`|iW;0mn@xIJu=k-^ zetREmx;`*utcOcWzG{RJDn9$F*-|U3sB`4QYMO^T3Ww7+O_(rx&+mh&ZL(LAs^pb z7aiKI;fo?^;YlRgO>#AvLCdb|`j-Q7l~HOF>WHuvdaG6{pD}7p@SVqNjGQuXY+qECt|FN2mx-JvBBFkkb ztodljr6`2FC~~&Q5}Qcf!zP`~X?i9!z2m8pyiU`(wm)-b*fq(QW@f95C)%Y?(8#(< zcFCQH$`jkRx$L(8XpsOCw?broU8u;kHAKuSq*;P0`NJf78?Vh`EbsMHSo0#BBtU=3 zK7?yuGx<`{JTR*gm%m$;P)l&nRpz zDtv-0{BoNa#sJ;NoH@_|UCab6&;@2c4S&NsNrmV9C4 z)g;o@RgKVQz0hZ^&}z-lY0cIx^2ZJl$e~gT?LgOdUDtSh*Lt1Te7)Cx-PeHa*Y#iv zgB{XNeb|44oxH5nP0cRex!8t1vb!9f7b&ajw@xIY38Rn=qM!+)kO`k1+Mt~Y0WjL4 zUD~4k*{E&Wq|Mr@?b@xK+L^Ep@zvJ0jn=rm*0-(Oxm_&i>=1LvcP_Lat{@895DEbx z3ITxJ%)Q*s-Q3765YRmk(=FZ4P2JaR-2uSaIyBhs|G?Nx9p2zQ-iR&Uud~nJ$b_?s zBmtlatzFvN4d2-y-}Ft|^KIYt9pCu9-}>F(t?k~L5DBzh3prijJZ<0zPGN8@aPuf2 ztiTQr9^nu^;Syfq6n^0rp5Yk2;Sb&l6n-LwU4kM$f+RlTCSKyE_|g_PbFIKyuk{Zw zeh>d3<1!xOGk)VVj^jF><2=6OKHlRnzFIQ=;zaJ^MqcDde&kA?;e&t%8 zaen7;p66|T58fz#G5zQM2j~DO=6Wf} zl8)(>uIZQF=bZlOo*wFy*Xg4U>ZQJc|KK9E*Uu%_;zSO94n2di9_zI3axM<*Opfci zj^w+3-V$Z48e&0cjn_>?&N;%=AQ28zV7PY?(F{V?jG;(KJW5g@AQ7}_MY$fzVG_p@BIGn zDQ?;0=jvh}<_2Hz2!HSjpYRO7@DAVb5dZKJAMq5w@NI%}83^3o$RGdkeI3t#AFqBP z@9!iJ@FrjKD1Y)QpYklf@-E-o!+#lg0)`p72oaLe(gP{`?zoRu&4H(MxL>i_rQPm!XNy^Km5jD{K$X&O}_UXm+=g4 zAf$f#(x3a(KmFEU{n$_Vj{kX5|LxDF&-thy{;CiD;}81fFZ$na{^^hYtH1uK@BZQs z|L2eFt-o4*|F+kk|JlF)`rrQmVegkff&&c}M0ikPLWT<+HiY<4Vnm7)587%s(3ZW8 zw*HX`5K?5wO(QoB{73L#tCTJ6xrF&rW=xthZPvtjQ)f<|JAL*9`cr67qC<@qMS4_e zQl?9tHii0BYRZ!`QI;H;Rb)nvT|54(YO&&2v1Q4gHJcXgTD5K2zI7WH?p(Qb>E5;L z5G>b@T|sKqx-lh6fh=tjc8S=kPQ`;6KaSa0#q8_!saNkyRc4G8|R>RPy7^mq&kIeR}rm-M5FYzMXfKC4mPYjvZmx>HVw!_b)&I z2NbYC0uO9xFO3M=NW0)d5^OT?c+2fH3U%wPLf15ujl1Uc2wX{JJs@K^+a`aYr9}1oB5ArNd~!ul}kr0PY}^@TKtLgYrEoqoi_5 zE33rvN-eY0iN32I6wXMm{u#2&AkQ>2O*Ge3lQ{*6Yfy@i9Ly?0!X{)CF+GzQ-R@!Q}z1GogA^n!oaI?jBvSwcbuF{Zh+-TEc-!&FqdE=!wx+3BHh$O8p zO?9PN|E)D(fCm=1V1l>oSKX}G<;d50ALeyGhWJ}>A&MiuXkv{m-dJLeKlV7}j6oh* z}f6lpF6wm!f-Ae<=v@ds89#uc5 z;e`5WsiUTP|7xqN#`*iw(wmB~9*?V0DKY-xpUx7&vMZMoy7dv3ey z#`|u)^X7YRzxxLKZ@~j6T<=@ePJ5|a&n~*`0EX)|Y*6>QSaQqb1*_r8nHI9;1<8;E zOpwmS6KJ7>_Exu6&bEi3)(3jMb=PNyop#x4$NhHQW9QxW-gEzbci)Exo_OJlNB(%_ zgJ)i#!^K6t=F?>)+VRK5Y?t$ChFn2ce zVGw~h#2z}PUqx&ZePXyo=)sUSL{r#El7=G_erkjw#NrjPmqjiI2PvdLnvKM6Ft=<)D>})Mk`M%Gi)=*zq|ldN zl;o94T3tKjWSrOe^B=biiJVT>iY<`hpj&|1?B)bbCFzqC6#eI>T4xI>kbx8)Pb zxj}&jKrpgArAav=1%ld+h0Dji*Mp2^8A%#%q>;!cB98URxGatkHor;@s2%IoEG zhGDe_Tt8UNo)!q3WLu#_p43RbTBVywgJ&r_DocCdQlDgvD=c4@PLE1JNzo(;|50BO zlD4swup8-W1e<9Kk?=Al`CRNP{jv$uV5+c~Jf}d&3e;k*gqQA&X4^zd)K&88mSxo{ zXU(b7Un~<{_q44$NeRIj_0_l$GmRwIwIH2V(wdjVS{qD?P_`lUwnvSpN;zsAvi?G? zY~$rdq|nF0c2b@8Xah@Ex=F8uu9%!1W&r*%-jhU=I7qbzON;c~R!E?*Dg`Y=$y?Q> zGDw{wVQ*GBYa9uz?z_d=r#%!*QL9RLt5Kutb9ID5SLRhhd!1=GWokOh%&>QY;f_6) ziQ-wRvlXOhg+d#ePEbBm!O!%rQPrDTvZiFbMsyx`Mi=8<&KHx*G}3$3|J$G~U}VNA zE~P$~OiwAO*O#e`=Y+S5E~8>~3%-OfOQPA125gy8wg37hIqu$qa$jR3tav1 zRKq-CCe)g0U$NT4K1wYsVaE#|qw=|=9oZ+JrO;4ibve&fZ3R4s3EzJdxVJ{_3U>z5 zRDslUn7_zX00z?4IBhCU`dN^sjcL?&oORQx#k6FFilYEX;G;^atFP3SXm$!)Q3 zdJCVe@`b_Ti&o<{##*RwOHQdvDO)+8RbKKcOS0&Tu2+}WQRzw!OWu9!2b2Ll@$H^h z(bv5sGlj64yW1{XN?hE)3=Lo$~CX}9KPIN|50j-1F8t0&hYBowT!@S z2#ANBIPjo)KCK`_+nqNyNIH$=mrohnl;!K}V_)IZ+=wsgQL5(R{v_2OuCA%Ce)D(# ze5j5X8JFMJ3YKj+<;P&_e*}BqbI+9gzrFqwzyRbu;xiBqV=@oB6A;_F({n)5GYu1) zBKXrEtFeWx(JTVQjthhu?BT!xyrK#uj*S{YQaZS-Gd&1&vpD+=oZ2EgGe7_VKoHcx z8l=G+6uua=s|jo$W&vOC?n~;U}C@b!#>(e!c}5ITXMoBd_pCZ!c`i-B&ghQ~=zXQak&!M^p zvAUOnGZk#WX$iPFltZuiz(VW@L*$4L^a@2hM5kfIM0CVRgp)_SKu=1+74*YCG#Avc zp4F?fI`pX`97I7R#ZkmTHY62x>A|W?zA~i0ws}6dSHMK!8FUAez8K}7_?hhK3!w|!|2gJmH)Q}y@ z#C>$3e=NvL?8l*zGZ$pNWvoYtl*ov54qsbE|2_P{V${eW+{ljPNHeS;NrD_@q{xXh z$&y6LxR5%r%Etxd!Yx$(qDTnaoL=)XARY$)CJQpA1T%+{vLd%Azbv zD00Y8Jjtd^$)|M6i%>-~suNrRLXX7CkIc%g)Jpa^MliV`hk?qmj7qXhNd&YoU5PMm zGDwBw$G2=t6qHMVTu8Wd%ebV=o8Z6}RJ|88%d!N_zpO)xq)L;>$gbqd#6--+R7|Ki z!`~7~H5ALhq)frA%y(JIwDdu?JW8QNO3wsMq72Q>6wT5k&C~o$(@ag&9L?2qO`%lE zzI;f_q|M8$O_edeU-PgCY)r=V&E5pg|KGHUue6abn#|j@&E!PRAVEuf+)RDE%jlfT zgq%)+w9D$OOT47cyrikUq>-i6l;u>;@f1%WAxz{u8(|a9;AGGBbkF&F%uq|i_*=O0 zB+vV_&*#WY=VV3Bd`;DC%>V_^0cA}B{m%kL&;wOa0ZmW_t;yKbl?g14{KU@+rO@NZ z&5J}8t8C8>ea{c|P=Fy${4h=nHPH(_QHyBKquEf-#LnyFPU(!%7u8PdtkLY0(e307 z2n7=fg+UYr(i9ESkYS&~lo`gkN)T1j5M9zHU6uHpvypTz@)Wp-*c>6n(zCq7scT8U z(oq}D(c1WjqQFra4bw86(KP*1|1>?6)Qixk`O(U3#&}AQ{>jq7ywcmuP$M;)%}7!v z#fiyV5^|D>ml!5Mb<#x5$`J*Ou)NPu>j-t?iZRWYF+B-~A(JunjWIpWJAJM^jmj0( zl?2$sGlfwI^ex4^Cz4CC7xS)*8VFb2HZph?OEHc$JykF@)9S1VHq}*tUjiv#iBqqII!H=RQGHIAMB2$E z6v5zB>Cx1|$Xqr3Ra{Nlq$N0;{an`wR=|(|hFM&|tSyvbUB+!nuocX7^+6=9+nh+d zyv5x{!rR(?34oo?|FP-Rb-2Q~lU7g++ zxj^dO-_g}y&t;M41>pZB-G-D+rlipN{a&vPU$c~5R;1nBRSNW_VD&|q3qA_pMMlX) z*9Oi~J9v$d%$h8Vk_nLTEbUac6piqRE_Ua!8?Ptf4xHts8H+8?B1WNdsG##Phe~E2GmMac>qu0S3wJpn)QF1ML_3L*f#(hht>SBq})0qVU;}>oW??j9_BV%+8=?#n3ZWatls9I#j z6bP~D)j1_hl`fCqsH!+!&RQ0Q+A?c9EHaoc+%gFJ@}-E~v>Ea)*5LLN^3H(C@bquiR-B}(n@BQxNU~=h#$)*A&x%I0<~uC z6smsNEoI3PUS3^haZc``Pj>Nt#7C%ViClr(WfHR<6DWDzAnsTa8WZ9edzrKqa)@f~ zuPVC7`Du_qrFGFQC+R9>@oR

-j<&dqAnN121*+Yxv&fFK_W)Mqv6@V5b$8{{RCn z@W>GfkJL6VEWRi@(dMm{_^1;4Tl5hoAr=XQ0Eta`vFtgBJ|~Ds>xi~l3G{(Jr4uF? z18yG19t{PIev#vTjqh5q)KQ0IwFr@waY5?qN=_*Kr4HqURJ zRMcHYoBiTsH+FRTPF?XY zVD72SrbpmHIeH8^Y^O(Jwx??E_G`~}YxnkW|8{M^c5w%HZ%21?A9r;x_jQN&cb9i^ zKX-Re_j)Jye0O(!$9Hw-ihc+9cE_)}8tzCx%&dHn|3bOVX86EBDC@}z|Am*LF&+tL zt@wr)HH_bLiq{H>-}sJ)_>dR*vgx*wH~Ek!=97Prt&C6Wk<$9iApElSsh#;(i&mRA zCY+aftkrp%$J&L5kc=ORrN$JE$oQbj6<(3+d-s)l5(#I$`H0#1sCW9QUwYm$DJj~t zq^}D30;a9s^OWy-o6q{OH+P?>`k#lSssAstuXzpI&xf62=nQi(Z~Ldmd!)*Hq33(= zN_o8p{J!7&k|%u1Y6BP(HIX`{gLW$iL#h`uvu2`Iy_bB6LokH$`#wTttsrl$DEWn9 zXuv;c5$_I>Dk}u*qpa{Kz=ys~5UIc4dy)r?&yW4uhy9E9{Mn!V|7H&{Uw+?Vt)hAt zetReW8XNxOFMe-trnnosQIe;zlYqOkg(UE=Yu^F@AgXn|6fUa)mLWs{PE1n{kPq5cXRyRITNdjkl20R-B!C9qv9f&&*S zY{>ATLxt@iQjA!U;V*j`H)`z2@uSC(AV-QUNs^LW2?=YP2ZOnM#*3Rcfm#)TlDsZ6O8ImXxOf{%zS3v(=U)t!PS-Vs#6d ziKMnn>eEPT0=20*s>*`0Tb?v&yEg9Ix*rC}$lJHV-VR~P zUMT$caNx#$2f(UxuEB+H1=5APN$Xm)|Dw~CqBEgkyTGMPY%Zlu05XfKN+3lhNrJ3Y z30BS6rt9^bSryiu*fYIVYX#R{0C0IHoCI(+CmdcoO=k-!WxbS9RaL#0V06?er(tp( zF4WFb8_MNja2w`!qHZXvsL^(@u_W6|QWkzBn7R)pnMxY$)_DOFfy|1o-|U}9B0)!0*qNk)c#t$^i~ zXM5E}B~4sKwq^i$krCHgkIkgrR(KUyRb4OHlZ2UhiiaelM;<8}kuyQrTcca?C}fa0 zW~$?+ml8E2PCdN_RYxxxl+cQ)rnqWt7g_WwL|VZ*tE&UmC4qMY{WD#7wroO%J%=4= z&|?yeRU9c2v~$xyPqkr}py}mhkFg60_>X`CRmBj55~OF>jM?fckQ6Z%lxJSQCR>nq z$u>vdb;0IZZFdG$+mpBhiAXE0{?*DaM5+qRD#0t2I-5&?vG!w5sX46L!>NrnT1pcW zHxqSGy%(aLU$Ir!FTdu=WpfdZ1yh71SJnzv|5|z3a!h+}rRFcgW*1ffan4LxOdwiG zVQ^2?)AyAi2#P z+{D2iz}L(HCp%_MdWw6|3(BaPGPW0?N_j?1p6&pq#FdzhZ6Vp6M{?&l*!?0xlL6L1 zb``l^(Ip96aaMOGvluBPVKP~1B6I>Ef%p9lFBwtRO;VB>gER&&jH?T}yoD8g^=3P2 zl!64dptR=Xr7ZcGON;=ikz_SdTd#X!Srqri*vthlWgFfH=_W-ep2S~D{1+#WC`z=Y z#9%Fn5%j>;lN)u7Yp!gi1F;qr|Dt4(mPn~3#+cO;guJVkpt=fiKvl61jzxVC8cQ+9 zl@n0?<7+v|k(=bExajbbE>|IiJ(P*eB-zAGtSrdb;`q&G9&TJ|Do;-KBDbIrN0)W; ziKSN9&U49fmau#!KDD+moCJ|6Lqr%7M=46=5VS-QX&eNTz-HkB*e`L3Q$^u6ym?UFY&bT<$fV zcx`DdY_ch0Qjtn9P<~RH4*l1@NUPe? zuC}$Tg%zdZ*4m*q1e31X7j7dWB2T*ZwxSI!ifW25R6=E+-MlAq^Lfj97PmaieJ*sP zE8Xczw`$Za?sdtk+~jgMc$X4e^8otW@uDcD<}+SIHxwd0QYuoqAm%a48 z?|k!XUlHMVzwGU3d}|xu{vOZ1z{8z>3tV8}lJ_=C74Gwj`&8=P@Uj)oY*c>)*~fnG zQ62tpWI@c~5R-Vs|0Z@UieoF{6xVRWEas|;OZ;LN$JoSIlW~n%eBm8u*uvTSp@RVP z&r>y+!L54jzhu>0Br|!*PHr-kpDg7l^ES#1HFA+dQc9+ljks1*Wy7{BX7185yD~I0 zn$xW2HM5ywXdW}1$s9*8b5_np)w4lamR-XgS=Ruo~(6TKwq7SWT+Af;E zjxK7V87=8Y`#I8-7PL?=ZD`u+InNJfs+U7E;T~gHhgU5%4`;mM8sGTDIevAER~>5{ z&)U_sRyD0*d}~u z&Ue27{_lMcJm3TuxRMX9aO0G_;SlrgTBR~JQ=+li%?2vQO`7qIYh2@c={Uzj4)T$U zyyPT5xye(G@|CN+%VSRRW`11eBDc7ww+vyUi5iDc9k#HIU2Gl`8|ZG$;kbSN z)TJxE>0o|((xJ|DsXIODR-gLStB&=pYhCMIExOQ+K6FwO-G`eM^0JBS?IPP8=36nT zMmrvNpw1ocBd@zeGmdwU-o5X7_q*HyPj|uF{qKek{NV?m_`)N;@rpO8O4@F6oLgMy z!xi_X|Hf%~kM` z+v}e9yZ?IUgTHyrCcVxxx$`9{Z{&<;Qu5s7@be=TeHBl?`q00=^s!HU?MJ_`QnP;c z!@qs;gMa+yFF*RP5A*dazsR3{QK*-K?4Jj{?5DQ>*ujo}vGYId{@?%qk(~hQ-vHKM z0p8yM=AQu)AOrFQvh9kpaapjm-}0@W^If0?W*`R2T=Sh=2X3GSh9C%zAp5OdXn~vL zU>?J0p73#AJQ-FC4qpt;pbXX^4c;I-;b8DV9AZgac+mz0k{1aMp$HZs5lYcXxD-zr z{~;3|VG}+f#|2?heVX&|ocxVi{{f&DCSVqFVE{HD0)in`S&EN@)dHSj7^0y9rXd@y zp&NFg7!KP58sAi;-2|GT5JI6IIw2pHphzHL6z!oP_8}pToD`0i<%OG!fEf$gpd;$w zBSs=53Iz;Gq9sn^C1zrB8CSCTpado#9wJd8j^ZGeB2ayxDW)PRlHwsE(fc*kBKn-> zeW4n{VJ*^P8`@$n;^G_fqAvF07RI434r4IhqGnMQ9hQ^?f>tYz(kiMVG(Mv=Mk6(1 zU^6BU3U-+adPE~)qBm+HIDVrzh9fzS;|_8n1SaFeiB~A*p-)XCJXWJgp<+DN|D!zK zTsyj=HYQ^}reZo~WJ0Dua?fH;CT3oyW=iH|a%En2|Kwl_rf7!d z6owaRj%I_Qq&BMM3eu%($|Y>RWMai8ZI0tja-^y35T|}0w zrDZCuq4`cUws6Lf3Tbh+|L0&}VRkktc0Ory zI%$+bsdPpsX33uTRH=4qsg!alPP!(Tix?{3^~9hmYN0afp*m`!2I`|qYNReI zr8d!}A}Xd@DyKGTrb6nbdg`LijGMp&5M0Hic514MDyy!lt5WKpdW3?WP%I+ll-{bB z=AS`iQ$}Rdu6Bg4W)rZ=2CoY1ul6dj4(qWRtFR*LvIc9hLaVYiE3-yxvN|iZN-MTn z>$6^KwN5LyP6W%aj7-$dw{9!ArYpLx>$zH`yHX{X@+oM>|EihNt7w_ZM4al1*6Wd~ zCX7m$jN+-l$|=Eq3QY_w!ahuoj_8l_tGznxx0MQA$OgoUXObRgYb58EUS*eZER}jJ zu7Yf?0%XU&>&BX_u*EByis{3)Y{kB;%i0E;vL;TjWWnBS!saZ_60Dwr7saw;%)+eD z2JN5DYJ`26gQD!mDs9Lz?Z}EO)H-d{TB+1#ipnmQb+`jE@Ch48@oUNWL)#feU?rq8HZQt_k()w-S0`8n4V+4|D z+$OHvDlS;gY>Z~!*+y>KPOjv>rJmv>@bszMGVbDb|1RgYqR~o1ts-aB3U28V?$cJS z>B6Bz{;lf{?(6Dm5BV(Odamsft#IA$Sb}Yvk{jjzZsh{6@W$ZU%4=@=sqTL6iRSK3 zDep(p?dWFg>P{`{Qg7_0?)0i|^=j|+R?pQ^=e#Db_&V?S>Y3vLEaVQa`UWriuJ7hu zE^d;|=9cdv9mgk0-NBTwwVwAurktbPx3C!x@r3s|7@#a4GEj@2fMIzt#EchaR$4uoEEP? z*&*`oaQoFnKc$5?A%vTNaVv;18Go@Ehw&MY@ficp7_$V3ym3mTaT%jA9jkF2i?KJ^ zu^zjL6}EvE=OgqU=H1q?1QW7z^3GIblp-%OBR8@mKQbgM@+zSRDQHF|7f2*$vLV(%`o;(FzSAVTMO3hid)#s_ z&$27~axepPE&sB6u#9ub#2+`~`F`2B!6y~#=bhXq7A?hn!o)QPKsIOdb0q;+zy=Uw zvrLde59`Dc4=ntuqvoRWSyGEk+$TAY|H|aVh{yoYThKE;-?Ki?^FIGd4^M@!2r1WL_%5@z zkpdLcQ#hwp1p{y;|Q#QV%IQX}GvhV8)ytWe+SQx|DdgtQvPgjkm~S)cV9rS({^ zatmd%2cL|$m~~u}brQ^VTG#bjqjg@p=Q|rlSMR75V=We2^+bQ$QW)q*JH^+WG#tTu7j$EzM3Z(qWbo>AR&HE3a<51;i`p}jt#F%TKLItQWRzPbvu!GKt1(kF&t*C@ zEX5V}7PH7x8;KW@;g_}oF$Z`t3%D((#q^+R&Jg&3FSvpmxM6DOSB!RP=-jp+DnsPc`k{~ZxOZfnjreWp_>ud)CHW$=y21kadtE-5)( z2DY6Ic9ByaN+q^TN41%cb1aR9ghOxRXh_0ypZeJtErTv;(t0?DZ#b_%i zsr#s@!#t`-|M%RCh1>tLyqlR$gmhw$eoTDyoI(1_|Gi1zI-K9U>xZ((mre{ki?~m$s}p$7fBCOIYMcA~#W|g` z_Urp1K-dZ}FaW84_I}xGMUY`bhYuk}lsJ)M#euC3X0)d<;lG6hw`>%7u;WOCCN-u+ zxl(0ImM>k#ggH}YO`0fe*%Ddu-=>Nubp};RXXrca$lg*sJgRjN?i zF(gCu|D#2(U%`fjh_UFurXCwwReN=9TeffA#)W%SXF{R2{*kFzcjrcoH*E$6JXmmH z!iNoO9GGCBL6NqAh?P9~tImVATD9^SU<+rHwn$kX`H}G!vxreAPQ6-nYr^gLlH6#q zon4^z@XFOacXw~zzvC{9Jn*08tdx-_f2c4(W}U6tb-mn5%EikFJthe-{JL$We0_%p zK3;t9;z};8-(-IO_yOdPqX7FOP#}UFvx_n17(~vr z_WWvvlvY?G%`^L0%h0tAHSCZ-_eR=mBJ}PWsyy;gJW<6I5jt+5t%~ZZ!5PJ}M}mmR z|0oW(e|VJ5HW@crQAietEOIGZNK6key(o%JzrQ$)(!(jGtkRyv8p{YR8oB(c6@eBE z004rdcx<5R981Z<0H|!!$~WDd$;pmHlqku&PBT(ZBKZ_jMm8-YrOQDn3Q|yph6~`% zRyt$TyX>|jF1W-nXNEXzHLCMqBc;+3G4ZC2@l-I?Wf#EC9a;@_VyJrC=`r#`p%}=Rr4t zPBidt`wl5cL56+u+bK_~2;z$ zb0mZET*A(qBZUmVxA^{VGA0ZFN#$+o2v}1UPu%^Qj3u>khm@r{_xo{IOIjGAHOv39 ze$k@<4iGy4WJ~1uL^g)x4}T3rSN)c>mxH1nJHW9T>!i?M^+WW0%U}b3B}( z4|&Tg-V&XtMCRFSTl^v61U)6iCr(j|tU+4LJ{ZOj?(A45T-$Smm`2?FV}CQuVeCw% zLpj26j&HPM9O?KL1rlV1eY~IAFc-m;kuZ2-G~^gnl0oU!5swO+|6W2KIlYral9H3O zBqT2>Nlb21lbx)j^eP#y3n7w}Vq}~d1GytVuJUSs8i;mYNf1~DV3xI%O5q>WPS(lAxyw$wekYk$7F4rZl5C&1&h5o3@hTA;For z__1t$43Pi?O|(pPI*X0nbZ3`X8PAY$4063|$lIbBPJM1rAU|7>1YjAs0049#0ww4` z31ZNMF0`NwMQB4I`cR1~G@=xps6!2^og{=QX{Ge2;zl^1gyAta>oh5)BGyQiGLofv zykkpW>e7``?U+E6=S@>YMBCVtA-`MM6@jWUp=Ob&STt%-|BH&$qYibcNez|rHc`}l z>hp^)o9ai~RFdEI1eGPK8cxB=qIMF5e=n3_43mjgIHvWiZDs3Q*9sI-2Ea!rwd;xi zsV)f;@~VBUU=^`CRiyDKu!UV57R$+y$EotJjaAW~7-l=0PFAv&b)#G3sJ6ON&c5dV3Nn#0t&aaA= zxN+H^0E_D||2Z!JVRdfWAefiE_GM+fwXVP#vIPkh&aj9Rh-R=PvFnc4O(C_9Pk?*E zg*}(Oz-a~F&IH=_3Q16j^5JCXn_S)HRXwJCPZFIP|KO$$Sg8eOs(}TJU;^6*sJX7bAiuGfd2@pOMltg?4T)oEhn4A$i1fw32jjb$T)*LWIf*KJceK9qI*(TEV4O z*@PyfWkW9x)xJ9Ps>vw7u40bOmu7E|Bx`Gu|MjTRy2dGg>#64_!J63LeD$%5ebpY1 z=*K1Xb#h_qXlXxNMNqbfln2u3+h&>DTh=mcx9#n2=O@|7Hh0s`47H!EdD`u!w!7gy zBs>ceLVP{&!M$^!`#k91Ci>BJZuF${TxVMaZjC!GbE(su>Li|bi|hU3m8+cVTlYF(`aPR} zuXpNYulm{VituYI+;=%2`qJOtbGR3s|LIDX``v|3_qgXB>3Fw0->)NUAE&a`W;ZBt`45jxHrD-kw0nv?o<*f1AXe}{(9F( zpZctazV)TwdhK6-^{e0NqG_Fc@gJZ3C|W$$8;?ak1ONB!XMcBF9+Abuy!`ba|NW!V zdFP+D`rU^;_x~^Z0C4)Sum1wj0143l0*{<#&#Un70qrjWFH5gVZrI+>{V?zX4NLf* zPEp>7{va>}CD8cPjtrWwQ}}QD{{(Oa5l{tNZ~$Gf0A)}CV~_^H?fWdxenwCPdGPqo zZ}-$M1BFlnhfvuND+eKG2bHh~H&6di@V{P=1!wR8r!WDj&<3Rt3!`ugmq+#}Lb#Z4 z3B}OxbWhmSrwEBK4bjk$IB@JxEDYhW{47hYnvApP&<-)H4sE9dPcZ#JZw=Kj5CaAV z2~i4hkoaCM5ldtd6|oT+@ev&{5+QLCC9x7I@e(aD6ESfUHL(*p@e@5U6hUzmMX?m` z!eA&c>(m4@Sn*3-u@zzQ6=g9NX>k^9u@-Uh7IiTfd2ttgu@`~y7lknxiE$W>u^5r@ z7?m*@nQj8a^BDhD3g*Y zopLFgQYfEtDv44mH!>?bk}C1Y1otl{TQV$Jax7s|EX$HC!4fUaGA+-tEfws|m~AVy zaxUevF6r_v?J_U%axe8VBmX~g9@#Q5*K#n`vM}9}Fb|U@)8!c%Ga4PUF?VsOW-=(}qr?h6-pST2nR+2sR1G zHeYi#akC?Ivo~wgH)9if(CKf!5-|nSFpo1al`}b+(>P5AIh_+a1MEvSE?JtbFZnV% zv2#1MvpX{q6}dA!@$!uRa?GU1DC+7wmoqxoQ##x8J)2W4ttX4xr9LOfJ{Rde^^=qE zvoHEHJ*kUj+K?JK@-#g&H9u1|QPV(6b3sk>K^-(g50pU_bV6SaJiRkR?UE+1tq(sB zKG`!qLDW4(v_wPHWdAH|L{&5`sgqQ|PeWl;JY_USX_PxLv@fr-Mji4-84o0x>L60o zL`n2ShqOpnlt}dxM1r)FG=eW8$w}d8dVZ)KpY$AM>XZ87kp?s_by7mefI2xbfF!g* zEp$vPluXg|Ow}|&*%U$DltSB-L3wm1y%bD6F***E6I~|}KQJN}i#VUKFS=q2wxD`4 z={mGDGlcX=jdW2R6-iAEN;ye3sDm>I6-1oWSSl&X=t`16gF=k#KXIcu(nB_$<8lN- zDCRRgR&`RJ#0w{)A*UsCqyS7$;|=YiIBHc#baY02wO4^vF6VR+YYa0K1$HpgEIdOf zw%}WsvM3XxIsc%Q6qf8b`t(^ZbP>z5?FeZL(gYPZp);6eAr1vp5d>8pwNW8;UDdT+ zEeTqmvvYPOD14${a)o@vRY^ieFJuEGbi!Xd$riLrT!Nxj{UQLW10zVGI=r*@BqcgUkI_#khaLyL|=1L&; zKrlygJ0mETHEDCVR(VArN|ty3fm$;MZ?B|u5LUacgj+0;N4NE!u!vMMVp@jx7m7w+ zuPv$=WwzdyUCY;9;}$xF!c?O)GfH(@1Z7f+hFa_FdHRJ@O|@|ERg(A>C=6C7s>2p+ zw^@O-a0NwpDc3!UhEy%KkuX;NnoSD0mRyk+a+#wpcK5qhc1>Y+gJsr(JNRW!c7$D) zga1i5C}4M4W;Jv@2T(QvWLrTJPB&shiX!|burm>GkKFy_!A-dF5I`1D>-`zIgs%5IqVdLo5MMj1WY#v zl(PqESs9I%SX+TGKgrG5ws@Dnn2UWGI;|(#*taC^SmP9ieUEji(#3X3!eABmEIzLuxWnyk+{wa3~my_&0qb$yKrE;AOkzuLBO`?j%Fx5Km9!g|VDo3({| zwTWA`jhj(ZTBZpbu~(X$nVY7U+qtE?xv3kv4STw+n^TMPxQCm&i#xc#ySrbKwyiU_ z&6~H;`@Gd#M}J##ak-w~dzj&SzU8~V;mE#^`M&i#zxn$)_uIewTT}ylKk56w1suQ; z{J<5Q!0|i58Qj1he8A%y!Y5q93*5phZz9ggM`n|NJiNm}+%-i!HrGFV#7msSLmb6T zJjGAE#aaBtS3Jg5e8yc|#%r9$VI0S8JjZXm$9eq6cRa{-e8^qAN5`UbT2W-VXUUbk z$(j7gojl5+e9EP~%BlRytvt)Ie9N`G%enl^y*$jpe9XnX%*p)B%{fN-}t=iT~Ik{5;T=Y|sIn(6h_Xu?5jVLea&A(f|C=3q8^y zebN(M(kq?P7v0h`9n%|K(>tBhAN|rrebYz%(@QSVZ9;(0stZT z1O*BJ0RSvU01p7h0qp?*2>$>B2pmYTpuvLyNF7vYkYPcG1R)NTD3D^pg%}%Ve7G@U z$B7>+hPpocVI!(1Ax6KAm`V z?#kvt9=WRgWLDP)sBI*H_yM@ng> zj4ui)P?B3}nI({2g8Ai*ysiv52YAL0Re#&X6nTl#^sipoi z=s&6o+A6DyzW>_lFS5qE>a4Z8YOAii(n_kYmCl-|u)BszY_G%qdMvQUD(h^p&o&Ef zuecUlEw$EW%WG3}+4D;~F9u*wxZ{qyrMTgqJ8q!rrc187fv!7HyzrvS?z{KWo3Fj| z^4spd^8VXz!1xYaFTwg63~;^Yf}60z0e~wI#1cmwZp9Q2l<~wDcN}QO_YxFxzXpwb zZpjCk?5@Zuw~X@31*t4^K_FZFalH^XjPuSnm;29BA)9OB&_$JtuF*&zt#r~%FYUC^ z0wo=_(gq1lkktcWJ$2OwX^k$|U>D@|*j<+$_SIQa{q@>Hx1ILZY^&`pQYv~2uD9j> z!nEE?^Z$*s-$w(U_uho}UHIRJ2cG!ghBuD5pxpn~U2y-kwjc zbmc~qj;`sKJB_;KqpR+E(yPb*dh4*yUb^k4OCCDzsn=ev$_7>JHr&I)C7v?31ih(AnX5P?WU7CJG8K3t*_n+QcFK9Ps#yB-#iVvF9fZfcbSW8A`+JGYV1 zi()k67}u!AHm2>2Uo7Jr**Hfxrm>EAyqy;@Cr3SgYj?h*9qahGM>!I5kcLcTAs2~A zMjrB!ifp7LA?e6ITC$Ruj93cUr#|$R?~|SkWfnU*N>G+klx$;{DXDnMR+93StBfTo zW$DWG5v7X-6PPY@$;*W8(wDvTS1=JKOkf(bn8+liG7rYgh23j}f20@3rY6nEam<3{ zvd8{@IYA9duz(-zW(U8iz;Skyn^HvL5RYlDO%`pI@T_G#VL4A)((`ytTaZ22CI1m~ zwE;z2YePX=Av6{>tsS_$Vic*kMTJ_iic@rGL?J3gxN%LLY71gT*LDwG=+`XG^iCRO?Aqd0O?J;j7)sgeHZVTCA(#3Y3cqQmC=E2%+|nDcbUh)u~?9 zt@MPNEs_ub0001OrF1Dmil>xiLQriWETLcnOIW}fmV|{x>|xiISjH~)uZoSVVhI7zm1B%CKS9 zd0!{HGs*OvXFT)y&v=%?bpt?Gh%FP!95r&6JH|5p_?c5h5w3VAJzh#%y3&}wbaRuU z5JeM&4ErP@Xi)^(O-NwSnNGE)RXswz3Iw3v4V0q6yXW_MwkYvcFoYkh>s~i_*T631 zG+A_Of~qoP;9`+Nym%Lh*aF$X{BmXA|l~>O2gqK|7FVDEl zKTh+Q*Bov=TlCEx>++s!Z00eCG*KkY>Qx)P=tw`h(v!~gr8~XpP=9)O190ni@-gQb zOC8obrgcPa{p(&2`_;vsJFt)a>}4l=*U`TAw6nd+Z_hg1-A?zm+kNhLm%HA%j`zOr z-RyPuJKz7VcEJNa?}JbL);WCHbmtr2;C}qSCGYsiTmIfskGkeF&-u+Gk@D(Z8Lm}+ z5T8dJ=%(km%~zj#n71DFEsy=_YySF?hrHys&;8GBzkA&G9;qAOnD2Q{{NWp4_r*v4 z@qf?!kw@aBOIh=Cs{f+0A8CKzxfh=LKAf-Ja#E_i}12!k)Ef-+cx zGNI*h5y)ykobs_$cU5Zh?IDVmY9i=h>4r1 ziIupCM))?Maw)%pDW!OdrkIMTxQeRSimdpGt{983IE%7ai?n!)wwQ~!xQn{ji@f-Y zz8H*!@-v=>5CV3L1A&a_m5j`|jLtY(%?ORpsEpEBjnsIJ(TI)Hn2p@HjoxUD-3X4~ zsEy)Sj^ucb;fRjon2zkYj_zoV?Ff(WsE+bjkMu~6Dr6|jvX9!rEZ5?X{rHap8IS~t zEd~jY2RV=lS&#_XkP7LL4Ec}}8IcsZkQND%7dep`S&|O*k|ybrEcucxIg>J3lQDUdF#nm8G#QQw2rJuiEu*z7LHUzH36w@zlt@XG zN(n4O$&^RAl&#W~QTdcknUqxtmBVP2Q>m3%iIwQZm0#(VQrVSPS(aNVmQ;C`W=WQ6 z*_LeimSMS;ap{(G372DufJlLt&!}xUxsy6+lYiNlfa#ZnIhckin1~seidmS6$(Vb2 z6ls<$(*lwkS(%i1nID;%9I2U>$(fkBnV{L3q4}AjS(>DInx6TPOM#3(qnF^=n#>5B z%P5=BNSm<9ny;CgxVf9LshhpYo3rVg!3mtTDV)VgoVWR#$~m0Nd7RCeoXi=W&MBSH zIi1#7o!D8N)Ty1<$(`A0o8B3o;Qu+EGue}LiHe?rD(ShNozkA9!k+Kxo}@URqgbD# zLZA0(pQi$!__?3*sh{fkpZPhU{u!SJ+MfY>pa9CB3o4)mil7W?kU>d|BAJY2_=Q@S zp%}WMVyK}V%Aptfp&}ZhBOqQrM7uK7;XVsJbLS27x-G`eFp+G965qd8im zINGD_7APT!9PW{Av{^*5^EjZBq@S~-oYSO$^f{3eNJ}-Pm&7_$s#H~)IZmpiTgs$Q z+NEInrDDpZW9p@3nxuksrB<4yx`U>o^QM3lrE&_VZW^bY11=+3jpiwoJKCo{%A-2^ zr+yl!gbJvJI;e-*MLy{(0{=FC#z=Zdq+4)^T#_12;8dxVI;nBkbeJkm9;B(7hczww zA*u3iWD_=pDsQUFQ3Kbit9q)JbvCZbs;_#eScO-ynyaarJ-FJdvkI%eTC1`uthpMj zw0f-W!Ym?*n{&#hXKJR<8m4F3taigYYl@}Vdac@eq){5JWh$-S`mEqOuHRa&*~+bI ziiUJ5ICk2ub^5OC3a^XfIXuZei`pvwhN$`~sQkLC{%WiLx~~D-ukoa)TS=jgdJxB` zuALXJoBFVz3b7I!u@q}*1>u?;)=t6#qs00|(1WY1WUOSvRw8RQ#oDU21gsOKMLk-w zvZ`a91hegSL&JKkD*sEYE_<>#`>Q6KtimFs+E$%L>N?t~rE!WmP(?`L8m>{=n&)b* z=-NmB@U&8jUPyFE_As?eORnPjq{%3)-I}$6qO=F)t~-^c&PuKEy0-HwuWib(FXoBxcGz_<>R;nE3kpP zH3n-dbgQtCT3pq15Pai4e6uxVuxx7zx=43xLY73@grublLju9KuRFC%BfB~jW7@QD z7IlnxbGvS13!zJ`7F%Qq;i!z`yK^WwsC!M~qD{Y0xc3PdgTt<-lRp)!eWH34^kFQf zYO=PJE-d6i9RDl0I%~5q(|E}bE?U1_Nl2P`HsyzF$M8O_> z1-mWM9;UOn`M9bsI=(kczBPNm3S4l6^0Rr#taQ4jWwr_OA+{6oyHn#LLbkP#LlVhm zR=&y*WM%Bz9nBJOlxNWs2B zLuXTkHQnpOqIWLA)gtWiQVk+q47a`qky9`1y*+DuS`%b@Au;_GqY^d{Rflr9y0>U- zBed02Q~#rA?9vV(Jh_mpqnG=Y2wNEoJ9X{*HIJ--dL0gJNVaUxtU#NL zLjPN~Ov4c7GRR5nU$VOizaU+BV{O%Hy5!}Z za755W=Cl!*%ILxng)%oH1J){>R7`t2WMwr!1IHq5wHC7?nFC-+3staO5M+=aZEVb- zb4^!V)L7iteC;`SN{w60l%qt~E|YAz%pt1!X1Y30O&rk^0VBl-Hr1!tE6gJ7BG=|J z*R_T<;G$VuB0TIdelt@aF6L^8ykl}aaDj4bIfZ0S+{l`7(Db_1wav*`Q@^BKxshD3 zSz9fcYY+&?u$^nZmOXH{OL}J2MZ9Zift4xbcPRdAU_@aN|C_pt+sn4B(PFd0^Z)T~ zd0}ngI37}dpYrD+f}225AHR>(|7?sFX{xN_iVW(=z?q2MX7zyB>U2jn}NIi zJGVsQBIw6xd~6aU$`NSBiYwwy?b172<9R0258Ru;8^B-Pa7)?_g7di!>(|p7!AqsI zMr+F13bu!{Q&SA3XqebmZA46qIzt{hvTL-}iZ@zIIj6C3E)wLCK&I_!*pf~C4ZR4<-W0QAz`UZItCA0TC&2Fy$ETjaJsZ;w+!sSy z(^OOsaU<*Y;0v_w3*}<#;)3hDe(SmJ>%G3~zb@>5edfh(=E#obW~=P)dacQR>`WfF z%>L}gUhU8t*jj9_K$+)>%k6dk?cN^la6ayCHOY+16vO>Aw_ppmU=Qow?(gpI$-M4* zL+|ol@AIDT_`dJ=-tX}q?}xtVhn}ecU-0?8-$l{ivGU)xP!A0s01hwf5fAYVU-1!d z@fd&c8lUkTzwsCUv7rv`$8+{6mu($jQ>LrnNSp>AQ0I= z5H}wHIX@6P-}3_T^E!|71Cb3oFA$oLHtqoJOmFSe{`5^x?NSf*P9ODDKlR71=0vgQ zVF|?nAPxZ#4xtbZVIK};Z}w+z_GK^jXutMjul8vF_G!=daBuc<9|{6N_UhoeC*Swo z?)M`9_kv%e+dPcWh$4>K7cE*bHIE6QkPUbr3fK_&0TB6AO77B{^T$I z=3oBkfBx#9{_Ma0?%)3K|NinH|MWlq_Fw<_fB*Bpmx8VB0P!opuYUpq9Q>Csz`unA z6B2C5uwcT84=FmVm=WW~iybX~%(xJw$dDc-jxusy-1#!-$)7@t67`uB=uwwQmnt>t@Sweh11BEDnpG=ShFIGz1j{q*%dry6h9!ws zEK#*&5eB#iHm=yYWZ9Zsn-;HKy=V90?R(enV8Mk0AI_VYuVTQA+csVt8S>=EmH%2M zj94;e!;UX!rOI{d)-9t2p8jWx;%btsT`y(*nrQ6Tt^Z-)HcH#I?cBI$`{w<-_i*9G zgCCcTymoTt%bo9T4*j`q>cFE{C$3!jcI?Kl-wt5!^g!~XM=N~W_3e7F?A5;)?LK~c z`tar7uRq^@e*F9W>j$vE0Qn>EKLHOca6khSL~ua|6@;+C2pOdCK?&sxZ9nrsdk7(e z5b6pj5KkIWFQZJn>%^r{WN}3oRfI7`8C#5z#u;C{u|^zi`XH$LsK(0*W}F2 zILl1)%{u2)^UgNulyk51Mx)Za&B{4$Jb1+i|^>y8mjbuMXGhtg)VYYp=ToTk9OlO%^RE6?X4R zxAGm>V0a6D+wFSUhI{UR;6)J^wwRb!hL>BFeG7Q1%ZZ~xl%+;I<^ zcins6J$MqsGxw^^>svR>zvT`baJrd)p6}?Fm)`H@p|^he>#N^;u))!0IP*eVCLiVU zSvEg?^w(dxeVA2#|7G~+m%o0O??2yt`tfHCE15U1nORu3Is&TBfT=^^01v3Z1QxJ? zrBm9$&;`4vIYoHC!=Udpc)<+<&;NrNu!g(TGPxViJ|OL``8%Ssx+=x&l}w23FC5R$Sl} zwU|XNKG2I;d=-J1R=k;Y5QHNX;ThFvMmDCgjc9};kxCdl^+b_oTv=BQb%;G4_Hl=Q zcEmwC0yo+9j5*)TJ$j=}ToAQ<~1yrd(1UHMyzH zd3lp?rYz?tg(^x+5)~=r`QHzfx>Tk%)u~T~DkCdd)TwH+s@f@~<_K3$ANtd)!1{-H zzCsnU24Ji}q{>;#s#YMfHLYlED_q}N*15vft!9-gUg@e=yXN(-fAwo%_X^m-3bwCh z?J7X~xjqb)uB$cJXVS9L4h~Ni2Sgm*hHyGyEjf} z-PE-;h3#u)8(Z4WR;I|}rD}J2(r!}mc<^+jJJXpK4Lanx4O|y?sc`BUG6e>yWaf;Zigt`$~h6Jg!6~9?D^Hj3hN(V$&YPoJ74+Mm%jJ4 zuV~u)&(sO@byayXY1sn2u~Sxu8mVBAI;_FVWw6s6EMW*w7{Lp+aD*@X-~?yb z!xaW`heM3v5j%`3qLu7uKT2VSpwL(XJV+jSI%D3hkgJK^uRmd&<6glyu|JNFSaM2Z z)aq1%o!cBx&Ht&{QEt}Bz$tEWnLB0bcDKq0zOt0HjMVR&YC6Jn`70eAy0K_>@GK@++Gb4q8;e%!|xBAlr<`!v{ zxm2~?D7D`~@?+3S?jiuPJ*T1GmA!Z79ux!W@825Cqs*Aw@!d{tqd21zAn12sqXA zR`_O4p48T|nmd+p%9&TIX!D1k*?Z?)6`k(w@bRV(cH*#5Mc2L^cxyNPY@Ak_>z785e{)%tM&=gV zpoUgC&FpV@#~2~@fRaI)ex9{|rRAn6_pwzIXJzpm*fuB4d?4~ohDf00g8!_PaJ?0_ z7ytB>tQQ}L*6tst9pvyIDz$Nsm15>&ZH^&L;gNNlQX;vbU2mDLB1SLb&n!2fBMUd)R`*`>FGbr*%WDUtp$X zi6_Qm2$*||yxR)!Ll`eBkDwcfwF^70Si61;v)Q}9E&Hg4& zJe^qx_|m%eNEi)yyTp2!El@ZzAceiFyMtJ_Ef}88BR8zz!mQYYgo!)#`=-&Dr~hd) zK!jluHO#s56BLF(IKZHyFKNQ9laNf?it^Jo$hx*c)EdnbIr@+tDD)rr5{NR~zL`U+ zuh<0e>yXk2ud}g-V}re4i>`6&{(%X!NBpWEa0;v3D7*R zzz-9mzfF^}<-A7UHH^D0n5hMlsOSl5G zwXSe6_&c%`RJHKXM)iOagFBdC+z{Czg;Y5{|5-fqNP;xc`Za$BX2O zcrr+m6Skcjm4kq}s5``@TC?H^NP$$d;QKw2ibBX^!eDu?#t^*4TStkwNlBwDJ*=&q zoT>0~Lz=`%*Ye4t6v~+LNtW8fm<%Y_F}|&UoyzmH=DWNY5yz0Tu#VKqotsFJG(@i4 z%7Y9`^6-U;EX%P(OR!W+v0O{6Ep{`T$?Eh%3vcv zvnW2CEKGPrOjQGn!$h^k%o4_QwqR2^uq(dGe9X&q%*;d!#uQA%)J(!OKUd2wzuYa< znmC1VKnN7V)oe2gL=OvuOQ|L#~m`a{IpCH^~_*9Q58+m6?M@T zh0(@zwi$IA8l_CnjLaH6(Hy-|8Qswz#nBfv(RzGCh%-`&W56Wq$BP5Vlzg1N5WwM- zQsJahShG@zyi(uP%_-|mvaC`p1ye1Z(k#8r+$@!naZ<>!I{zd@C7tBY=)9Gg6A!Y2 zzd7~BwK6O`Ev!8~tUlFKKMfCGs0XrXzU5XqxM z4zaKdHP8axk*zSjw_CS%0M!@^)lwzZQ#C77O;uDCRaRBiR$bLth1GI`FHo)3gu7KQ z{8U_xRa)&;Ti8`y{ncRg)ma7BUqw|~m9`D#RB(Ad54|IMI?{YB%^f?m^*BKH7&Lp# z*814iH{@1T(bjSG*7R~XbA2>(6<2R1*KT#!b$!=xmDl?a%^{=K5w)h%jFNKXvcz%C zB2-S!TFyl2%W1{OgRNEx3|NKjtWuK5==-xbrPN84*#C;9*o%czr1{T*Dw~IFR%WeA zkQLcY4Ox;^v1B?S0Ky{^A<&ZjSd)d>mz7zUtxA107A2e6k4Jz8>QxH`<#mi5`G1=_0J*{l884VoiUJD!9|o&+pduocm;y;rhD zSbR0xYE`80LqD{kE`Lo<f@(-|{uWn7KNddCoe+ zUE7u4_@!UnwclCEG;X}V3VK}O_21Vm-v15Y0rN%ET3G=;UI0$u0cK#`vDtFuUIj+r z36|grZeTVFKRI*XqMhIS?cm%6;SWYy-i2BUE2s;$;00D;3P$0vxl8EViZWap87o`s ztzqeXUL3Ao9k$`Kg{B8K51bv}xgFxWC1Uk8;w0`~^flk~W#aXXv-WM%5*6Y44Ph&; zVh=uA#?2-EJ>eDp8jgsO*-2p*2ICffmj41iIOcuA>viModB^FT-X5M~9=78*_F=sN zVviK!G*wgeXjR&Xw;+KeKQ`n;Hsm$^$QPSkEWRRAkVPPaPDj?_N*)~oq~r&()X|_I zk1gZi2>@V|N{8E4sSvVl`(!lUMcp{#G=AZ$a52I4ydB14>)XeLh_+2QJY8!AU8~nw zmZvIIw0ZsIV*XZRZdZ6!W@0|(W=>{ier9l$W@P5GTFzm2+2iFSC)HeHCmtn%z`4MU zu@-zkg@8F=OTF4F4e^>NB<|)WhUX*hpCW$eBR;}Kc1aG-WCb#ord!@}$%?phymR}y z_cdrbJ7`Kf#)aN9h91mLYM=!Z^dOLiqLE@6a}+EykZjeLs?w8ur{Js%=9 zQ6)990@hPJ){|!Gv0CYq4v&~_X_|&#K|ec07=<{)_e(e_I8Ova4E!?dK0E8QM(aMy z<2zQ2Y^KNvMr6hTXG8l6Uk<^R@F>wRx$|qWMcbIU7VJ+sy20)gMIPGoXk?5opl?cm za7q_4Ahz=Zr(@fMloQP>X6((@Y*yN2s3fT1m1=K!yEbSV`!E!eO9)i_Vl#GagsQC3 zo~&1fh**BHtf1kx&g#sdr~kjy$3{CqYpvtmc5B_%YdXH>GJ)$1mg^^0;=DaEj93ln z{tGgeXK#+@=XPhK8qe+aZt%V5#IBOX?rhV6zw+Ma^yX~&)o4!kV$oJ*yL|2Vrf*TP zZjS~MHCEZp#p?cUo7P5dTK4bZ?r$wI?gMAEB$cZ1F>Fw=wg!iAL{^*#rxe7NU435f z)ge;!&hQTBaEkrx{pB$D#&2)y==m;j$c^p#c0StvYpcd90Y`Aoum^T7ZUUci8OQPG z%<%xHC#LFS=dR~Yl2m#&^6$p(>&|X8VF=bJR9)j{_oMeaW~&_Ij3`%>ha=U?pR}R3g46m=kq_$ zxCsaJN3n3{#BeOnnGM%+4_|ad2dEJLU9uK)7KgJ*C-X6%*%iO^Bze}_-fv)za~&@{ z8z=5kZ*x&kBtV;URR8hKiDd6WT_;a+ktqvQ%j(yl?wR0@H7Vpl=M*4XbsrZD;0eBj@5=)VSWTF>gSU<_^UMJWF+K|LyzksF zz#;)`r~p|_KXYfr+!u$~tG?EEcj4pa);JAg=(UC^Db)9V$9RO#_>0&0j_3G~_jl6$q1cUedp8nWZ&r_#MTN+@ znZd2z9{7s~EmFp{05WCH;XJ+8c}Uy10NVK`t(+pK^lD*lafbORkM__BMIK9DV+44w z42yHzkPzfPyfPITw6~Si4*^QK0QADiMz|`}kXEQi7(Dhy-+CnL;;7y9MIrGwB9u+o z0>HD4EoeWF%!+l>wPc&@eZAB$qdPA&4b791e~U$Wdpo8lbWr`>_cmu$QXSjceyNggZ$On3jlT=~fZDOByV@La7N%o3O zwJ!#U00INF3Se&_!gc~}{R^;ZV8etE2PzEk%U(o#TM$~rh_E3@f&c#ff+&R{N09^# zPTUx>Va16mX9kE^Q|3*YHh1FWsk0~0pF(pI^;tCN(V;vKCQa!SBT11ZA&#tBbtK5E zTC;Ms+7+wUuwch-6*`;ys|SD<5v?KTRO;xT1kngS`u6nIdvz+Y(Lk{)fEtv%6gORqlt)-~(btuv0C z8d8eW+&k^6jqMvY@Y%9uueG`MxK-p;lQUoLJmPYWjRTOc)OaB&S zXkkjx8K)FdMyZ)5n`pY(R8(-bDJPo#eFRj2bn2VzGnr zqlY#Mr%_~jR-2f4nRuy}n0EOZRhxe4nrbA47;0>xnu-;vs6H3hs;Sn7maC$^y49(f z+A3RWntpoguAVMOW2Ft@Muw!C*`+0bS0Ou~vR^IxQnO+`JFT->6=zSBROtkrwnZsh zoVOu?yVJMQj@xOt-tuWKyJMkCuDI=%>+ZSdRx9njNOnu^w*9L6FTViqJFs#Dmsu=j z9EnEQTvU3s;=^b`>@dYsM!eO;7FX;p#3UyBF|!|MEak;qjeN4iDPyd%$^R^u{PM;q zuRL?hG{a0KR5I7R^UWm3?DEex(~BX)#UdxDqe&LbaD0ur*oAtFCRc&DOYYL;Ga8AE`QGSZaUURdQv)6)S6T6Q!D% z#qAU-bcmzdp_p<@o2%n)`x-fIaf)j6)-~}qIp@84ej2!TL+D_H%h^&8T?LV%`dr$M z)J`iru9SBxn-9d}RV}XT`nwZt2d-i{=cE`&edX5*@dFWA5RC916)(s5N*{gZ&KYby z*Hbrlz4q8|pS@Fro{b*S7Bx(H=aPR8mdERxoSjU>>Zb2zm5F3a!vFYLODtCPVSFr> zlEXY}IRrNdnaX)K(UkAS_W3OHflE2GRGaFfGh{kV#3xm_rn@kuYmx zQ;Ka$NR(_PAt%#0Q@lX)JAuegJ$Zvs0OU79o45pNcAA}m{3Hd?5DSMR3{-ozV8eB- zDQqTm;t8V&#jZ7_SiqvxyEK@=^tC37Tr`gH7RQ$-A!HNDYu$LvlQ)+{q#$i@N*kmg zfx+a^DrC@~Vr=M`6)D6?_UV+c@Us{Sk?J~0ipmzuI6NT6?Tc1{oFljBzFkc!Dz6HF z0gYxH08TGj(fgz)LkTiyjgng1`^WDBrb_NnXNV7!A50u*q5sF2M~7;33K`;bqpjhv zKJBn&_`bJ9hww*!4M#MWP;TQfY6q04^oj0%_OByL@89C`V*%3 zWPIAeVw@T|Nl9|`EMDAdx7MfeVs!` zNSTq?qo3!g4k=2q5mIe)qV@p`S-Tn%NN!b&jwN8)E=R+ZjBhucEM>l&8O_a_5|pL9 zmgulq*iCB2JremKF5i0AB-tyCAMu!a#M7{eSk);miBd!OH=cixVTlZ>>DCO}o_F>{ zvz?7r^{6RY?=e@o+H7t$!}n%=eGvmV>nNGi*^BXtM} zLwiJ)QrM{#PN7tfVvhy>(4-BKoh_iI+GS4USpS}B61Q~sktJ>CSOQgv?k2bpPF@Bg z+4_l&pl0GgW!S<#j%tOghdBaUGOG(dvSLf~)h!<8ZlgO+;Xs*LXex_#(0`sYoFAA?JwMmEl)iM;cuXd5mJhod1=^>D7HV^jdYs_( zD5y~_YE_e()#zL`NMW7oSht$is4Vq5ajk1t=Q>`M@}MT=8sr`WSy3zfF|m_9>}4aH z*~NagvVTlfnba0NSX~=~vyEi0Y8B1e_W$;_zpY^47zA+OKKGW?EESvhw6cDXJ_NW5YwZL?!EzCX@6;&x@hb4 z`3|h{jdMI^rw;dmY5nS2&${HYUUh6bE~N{OyXEQQ;Dg5(!jfvb**1qZT%8?loZo!s zKG!+Wdk*v}O6rPUb~(r~xMZZGTii}hx?|1E^r;hv$ZNh_n-l3iNo*{mAyz?EVn|8`|GcNL84}RAlJ$2!E zZFrND{N#;){Kz9uc*fsa@s>|K=KoVY!oZVM*h2q&v5(F3(f=Iur6+yRQGfGk&!pP7 zySA2_4)w`(o9eT_z3g+}MX5hs_gzxA-b~98cZh%~ctyW5O21Pi912P~-MBpDaAOv2Z1!mv`V&Dd9 z;AwRr2!5alKA;DZUcuAqex9hn#%w&5NC4o9s-Pz~PT-Pm9b;^3_4U=Q-3 z4+bF+4&e?K;SU<25F#NF9{(W|2B8f8AMIJ4RlrErk;&H89TwJ`7BXKJa^V&(9~dUz z@hP7ea-A7=VHlEO-mPKZogW(-OvU8}r~R6zT^{4rpB?639`2w1;ofs+2VykW5gSnaKsh%UA9wf5hBT8ZjB@BQ(ArDNZA~IoJTooB?{+Bwk`AZlgDLBREo`ICA3-{Zw^P3KrE~DUPBk zvZFh$BRo>$J2D3h3jfQHU7;-MVm{hpF7jh6;^IH{<1XqWK=R^1GTJYiA29l2FqW1% z8cpD}pCJxn9}=QPRwPCS;zep?MjqludSpjZq#cUX0BX{o2w6Ciqe_0`II`qQrld1cCyMbR%9wkpEFmq+bpuVEUs$5~g4l=3geJad}4iNs0uJ5n+gjYk(w2UZ!Pc zrbue$M0O@1a{uOMZl-8@CcBtVNxIodqGegC=2?zqYp$kiI^s+YS!Bf^T+XFj-ex<`i|$oLEFAK@V%L=b@-2+E7Xd-K2I_XLHWy1{K-*1ONbR!gSi_ufV5d zy_CgG7bhtuVg@9F9;SgVC}SpQU?N|YD4AQ?0{{R(!YIgtDrkdhXc;=@Ln6c+M&w71 zW@wV;h?;0fq9|r==5_9xKvd{{iV|odB8_gOBA%ud_6JIiCwuZ}c(&$`1Su5F1&mr~ z&GjgG0{_Kq65tEkByZLyl=f$oN)Uct%8M51UeKqMR*r3qnMoF(e{QLkj;Z@l5aZZF zkyhwlJ*k*NT`*BrbwwwcPHC9V>8*g7m*{7j#;D;$qn|?KO>m`LU}IPvAd(*Hk0NRU zf<(?Vs@GUVkycxhCaTuBXH6EFZMG?$Zt8a0Aen)QekK7KBtZfY1oEgzol>Q`vDrOJ zM25bqVZ!QSI%urc>a22T$e1bf5h+7#0RR9OuFC3x2J5uE>EES`Ax^6GMePs?0JKowIO~ZrtBo25=LOqWD(a7^C#Cu*y4uu-38{JF7)6{;03^Wx zoptU?Z~Fgn+W7~%LC1nSrW82~_J`fFjy zC#R+bDzY1#)*LI|s<0a9;2g!8O~l8lM9AL6$l?u8l&txjtjDgb%C;=Xvh2&ctjNOb z%*rguVnk}->`F}=%8sml6@&yNL1OeQ&5~?6YOJjyrm+s_g&dfV4(>|-Tax3OStG8zE z$NZ}29r@iy+@BJbnkV&sM`M+ho1cCGYIFZEWh^kuK2Dl`BsRf#ueQI4sih@E9FXX=O%IlQ!oQ7 zvIQ?NBqQ=7`x*v&=jn#A7e|eHn(Olnh$jQeCU-I@e=;eL@(*<}COex5$FAknEgHA) z5+-32#xgA{p)JqyEz3&dxbYePXDeH*3uCMx|L`y$6TnhwTJM&qm@}jJA(aEksx3QNN z3n|o)U|02EQ%7M#bqyu+R0K9*H@0Cr_DeA~Ydtn=^;YM_@++$2cEm+XA!T`ZsKR0wsifgr(Ial|_p)-!!*LUJIai?YhN_7C#b#xOTJ~Ox0 zCUYhYWhOmru{gJJ)b(A*ccBQhwXtPEr}4hRvw#|7MqhMBJ0@-S_w5)>TG_UM8+d>l zxQB*`g@E^;;4*&CrCkQ-O6z6s0C7;iG`t;6N-%eBFqJ8nvWU~XIGius6eq28f3>BS&&ZdWC*Zw`oQ(sE|_goQmFvnfVk1WkCN@^FW$#RLOghkyr0b zgo<@i)41hro@pktjP4 zu(fkDk!O#0RTJ1pIQU$v2aQC81msnd*I;IAC2-bnSsR~>CHHQ^#Y~SaUXC|=+j(yA zC!h=jd-DhBV0m#9a-2G?qKhe+m#*DtwWOE21wOh(bOy~>H>(HGhmmy#Pndk8b%p4- zq_l!~o4QXuw})FudIvzHbMma8IeovLeX}`e`zA;9dS05kv-`S=LwK?ix)k1}GUMY< zXE;#vW4}msu50v@d0*RXoX)`#0;T!h5lC2eUC6@t{lTV=%XeAAHI4v|G>l&3{KWw>r;D?W=Py z5zCSYfp5UOb4n=2>GVa?3xu}T{CMxhVjz7hDE-tk^wjTI$`}1mH2f4I`^)E_+ zCxktB252ahbJK_Yv_jM0xee6^eNlu$%?@C_)x*{Yv1|eIAVd`wkp}_Ec#M6Y;W!jS zd}!m-WK!Xl7pPEcyW<~M!WvD8RkeS=i1RL0khK38MKn5706`krbTY@pQaRuzJnXlp z-`klxt)FYUORga&u)ZVpyJz0S=lML#{6HkYoCm<}_x?caKA8Z&g~+pW3%{gbd`UBN z$IU)iM>!zgsHo4+C1<_D(b37>mVVygLo;!VX zXaBNuM-CFc;Y;{tr{cv{kMCxCOE-Qm1}s1X01$v+L4yYoCRDhPVMB)xAvXLM;NL`w z1t(_2xRId6iyb+B6zP#<$dVvYjx@P4C+}cvrt3Ebh%e=UzmSi2IdQRuwcI`|Jge0m2u;)2^?yae6iia!j}(YCY+h`X3vH{ z2X<($V$aevqXw0_T6OExuQS4CE!%Z$+p}-i#=Tp2Z`!|Y|Eo-MXMo|3ktgT6vvg4A z0Tc_w$lNw{sn&hx2F`nXcJA82e;4mPYJi+`cNUitab{)7sV}yU4?p+($@1&xXKg?J ze*O6U3lP8o=@aRoilS3a!37^8siut_ysyCf`lHao3NgG;!wfmx(8CTvBq*+w7P_mT z^ymVLD5->Ev9=bcig865hjI}%7-#>?u|^tk+)>A%M(il4;}|S5B2ofaZz08AEHA+T zHgQYJDXFZ|Edx>P38L~0{7f^@!2D9o&cY;e?6XWiON#5Hn;If*E{e1iGCcCSYjjaZ$Ags7M=52ovO9H}D9AQBJ!p%GkQ^>L zB$2d;Ecc#^ZlJ4pa;`S)B#pJwNh6(A)>`p0?=(a`it`{sX~M|835k`^*b0k9_SpB9 z<&Rlqp?y|bXQ@qy%TBS?s<=%xI_S>WK>AQz5XUW-+;h!McRp(q0v4gTvV_jcdFid! z-m_H8R^I?xc@UvQF%oL0CvE?<*WiN@HVUpxdrH(@g6`t-!94%0nBt51w74%c_wCr* zb|%79pc>ZfND5mC9+W6vP>sQoY5X}xYX>}b0d@awV(q)r#ktmnXh$Xf+YWVUBOKcOnNBlQY|`M<+*Qud8xtoO~hS=CMfQ@jP7VyvCU>b zZL-G(yM6fQm;Zf#ErLw?Ho2X;$(m4ojkb`Jh7}n@Q5aC6vbh_)^2~C(n)+t7R3vt~90T+PT6+{Y|yVjU+r#cks zP=&tZAz(&BGvkG?dqnhJ5x>`>VClqa_8^!H!GaJa?N3SeD9&791FKfO20Gen+7ZEM zL@_4OX;wpz(54uftUjx(-4g$h0U>$7NKR5+ej`x~|1~-l`G}J}@?_!|_c&2Tu9KjY9OM|c7)pKe zC}ay@c1kJAQHBzOHtFCkafuYsHH>tB`=Jkkxx-+F>xn%S<}pKKob>$?naniiGe0<} zARcOnWDKJ<$B0Bn3CCJleAPF-8P4iB=y=UB=N8e4J?llPiw9DtHm?cKY{qkZ)GUtq z5F$L1tdEUzY$F^2O2>fyQ=qIVX267$&|Lk`BL73EOj^>=heimZ6{VOeB`QgcQj((^ zRpc@=xIhp#Fqb7YX#&T2&UdEMdMkBlOJSB@o&XcTLEo-C9 z*f2C|tsq<*s6XK1L zwp=|c^J>yBms+(Wrm-h)uO?gIV)3`aHEwZ{TRh(?Hz-d;=WU^DR_UTuSJb>n8YLpE zsztZ9+&!W~8G6Z5aS^oT{VYaVn_ly-wxS??2)r~oUE9jnyW{Dmu^_8h$)Zxfk)_d3 z@Rk2r0UvCqqubI{Q>)$tuh*!{T=0YUL^;d-SB`n zDA>!Ana*ggGk?>(<~;8iOLPI48Ur|CL2J3FEG&p(fHLST^AK~+l_;Shy=dOKR?v7j6&E8$2ken;q>dX^Mfp1gfujjq8|Dk0AY$w6=Bk z>~CkA+^V~Pb?$boWV#Og#{?I0 zK?zErh&IIA*dDjV9-YaDJDlPn;j%*lH&S`&`Oas?bH~jbay4rwN%7t@$VZNHjvr1n z_m=j{)w0Qk-omKWZ&M$M-zplNnZ6_D7eZzX!cIbtlaKsINcEuMR?HN0=rE!cJtxrDe%zLSevtD`4*PZfY zOe@wV!fMN`vEZdYc*5gq@FBZ$%7{mNi(oqok-&-MiH_V^0!LJHlg?Xa4U`AA7~ z7VrTfu%!Nuvqos}o~Qc$F9R`f1F=s7J1{1uX}Khi{MK*$OfdaOFa`flkmR@y^h$0^ zNbmISPX_Cc{#4KYYH$Ygj|Okh2JsIEdr${~@CSV`O)xGYc<1I@4uC+#o1uOPs0wn`8MS5O7va1P(F z4t=Km$|nHek7*o?pNLQhi*N@8aR_1sfy=2Qd%{ zF&6=`7ZtG(fsq$~Q5YLB7X5=B(`#MR6QSksM9Y980mabdIWoi|JYs7GLolYk}Ory zEXR@s+pt$8aUXl~CT9{ScM>jZGA`}1F7eVQ@6xV-5`F(1QsWemA_a3W2~#31(k}~w zgu<{Z8Ivm=Q!5+uyv}WSR8cI^@-oXZGtW{p(=u18suo4h2w_q$^O7z}^E6E}HFfeW zS5q!ob1wUG88c}pqmn6Yb189CDRuKHr!qHr^EP+0Hht3?t1|k;@iDg&GLbVflk;o%J27v3LMRXSP@l9*In}c{nX~#P<~{Kx zJ{M^|2hS7jlkDy@SMWrE5D@ed#ow}|RRR=1{qu|n6hIABKnoPd6cj-jbU+(aKob-~ zDRe?D^g%ClK{eDtH&j9~^g}!JKs_`>BUD69v_$_=v_e6YLkD!E4AeyIbX#H+F(IZtt>!p@6ea_1NR^35gVaccv`CfoNS8E8ne<7WG)j?lN}H5Qq0~yH zv`V$~O1Csix%5lDG)%E{OuLj!!PHE}v`p3XOv`jKV~e;%P^GL&I_0!Z(`imskxuW_ zPO%41;Z#rilurS5Q1i4<|I|>Ii%<`BQ46;*#IC}$H!UA0DE6-Q$=M`yKGVf9vJ6<29hS8X*{eRWrV zwO4_4ScSD%d6h*+6j@JHMM;!dl{G~(R7U^9QB|pxJx|qIt2Jh3Cb@cRxI|D?mCIYj z^|->7T)Wj=!S!6ZHC@>iPSv$s*VSFy^;_k&Ug`B-$2DH@6+Rkmei_GMevL@5v>$u3(Vc4u{Vv_2vy*feOlXrTT zH+rA+JQjR*EHxNd#zW8 zsaJZdw}-J;Y=M}Ef4GQ!_=v@odncH<+Ny%Zw|GzFdubGOBkyCL(E1WcK=&Nn%%zWhj8`xQ=6Y ziSCyncJGYJLMQAYdUy$tsiS7}SBnKWk_#AtDOr*ec#X=S3!X9df))+TmR9SO(6m{QZX+vlW^mq>oLXgsUgoU}N=y#1} z_#mPKm{Vd4X2>I^$QJ+H#gWQl3pOE92*#HS$%AnipFG5jL(qIlMKLsNIK1tbg%X5@ zScr`{h_zRpk(h|z*`3*Whvj*D4Yz>}%qM0jQOKYjT0s&F0;&LXm6ij`)})+?)P^uZpdm&w zHsO@xq~>}eE4b;<{-KQlnIdTVWm~~;ZLN=Gk3cZW7dW@KB~R@(yOx zx{n!~q`kYaOB#=J+90w!bJB>HNx~ku`mZ(mknd=hpU)~#T818^WXzg+YPaUBm~avI zWD~SVbBv&kBR$|HiXoV)5!|YyI>8rQ!K*r-YZ-Le5bzjUQ^@-J61rguJV6>5Xl;R^ z18&PGoHG9s`oozh!|Qs3p)WFS*8poxqzxO!c_+X7ra@Cme9B=v!wUSuwOo@)SGw=m%fZ~PN9N0; zo6Et>%+Y+h?MY#Y8oa+d#vc|YP8g8q_#$xl&g~pS#yHRET#j@2&oyGt>3om){Lk@x zzbnoAgbi9p_rM*!!6E&@C7r=1-N6(5jw3wNxqQnt-DFj^)9aek$=r%L5odw-&1D?b zM{$J-P{+x|)#G>oHDp*0molsT$(_8mZ(Y}Oeb;@x*MXhNgZ;M29Je<;&5J$R!`#@J zUD^MUec6@$Ge`AqQ{Bz2o%;M7&j(%G4V@ygoiwt&(7AnX|N73secZ)8-M3xcb6Dt( zFmd}AlBsx$o!ZjvJ<=&X-|xNBIX7m@9MqdV%>CWi2j1BO{@5d!ljpsmyGhlrz1qvM zkLsAYOG3~A{hs~kwlf~%Ctkxl9;-i|+_Bo@M;_!$UgR}CjuH8z}@}CoyCf{_FWY?DZYr_kHZezGR!)f z9^&;r@A;m;U%uySKJaf|=LMhV34ic?KG+Z6@Dm^K5kIwqcd(a!^7o$UEq^({-t0BM z>^Yz8J^$KNmS0kL#ryT=oPK#1_Gef2T|f3`ANOy+_H&>2 zcmH;O-}cFv_JM!+b>H}XANh-)_=TVOdw=AO77x{@=g;>Hq%c-~AaLA$Hp!0K!%PfdmH{ zEQs)+!h{SLI&28>p~Q$3Ct9qC@uJ3z95;IG2=b%IkR(T%EQ!)$fR!v;x_tO4;ib%( zG;7+ti8H6pojiN`{0TIu(4j<&8a;~Crj(>B$!vM)6zWr#QK?RCSrzM5mRY%OZTdAp zSFlpcS~aT`tyi^V&$>*+jy=2f?cBS2PfA8+c&OsblRr<@e0ua) z)wgHQ)qQ;UP3708FV=p3{NvaAfB)Zn0p2&@e%~D^R6qa#A^8La3IG8BEKvX)0K5U< z0RRa900Rgd`0v+1g8>Q-T!?UCfQAem3WRu2;zNrRCt}(vthTQC9Afq+qQ7emPJap?!u@o*~*QZcCX*Qfb|CUI(RH$ z!C>twPU&&6DDCqBKs`(SU~vvCLi{gAkD*2j4dUyj_kbLPrL=0DYm$xiY&h9VvIDxXyc4G z%BW+FIQF>XZ1`blTV5!d^`nnG9;sxKOy<}ml1^ULqLFr)S6y#3wL{{TTz2W@mtaQr z)?bJnW~O0iu63rGX^vSKn{c{WW}AHN=a4NzE~aHGM$PF|MhgCU9-xE{YG`_eB6{du zi88wAnsz$oCZ1tdYAH;OU8?D(lsy@wl%H}K>V}}+XKJaaih8Q5sgla-tFFfXdSRWL8u9Dr~RB23stz#wLp_vaMz|>p)s^DlLgh>53gGluoN{06MY;C4ovxF%|%&4bznb#`P@=tjkiu z%%RM`#{4p{Fu9vjv>%VE6GV7r8S&8Bt!xnhDrMV701_BY^wVClC3RX;S55WRR%ea% z)>?PX_19icO=hgHTBK{q4cn7#tvnOCm(^p34ffn}*S+;hauy{4o_2%(t5w2K2QK*F zgqyvX&V?tQQpysM!CGBS&HH$jEU)UZAz4h61T>bakgRlMg-iL2K`O}w={`INKv`O30$1nf<-!(ORw)exAu>Jb?zux|| z`=9@=0>ApaKbaK&vE>fxB~H?IajM{#7u5w6kCaF_^yydXR$+)L;iUh(8LF zaDpN<;Rsi#!WO3Rg&<7f2TOQC8q)8EILzVT*r&c8rtgP51Y-C9kP^fqz6WPGJD(4Y z$h{`2NmS@TBKkDLIUQQ@iaE@U4SmNygr$Xx8>|W#$N0rEdhv{ZGh-UjC`L85k&P0B zV;9#*$2Zn7j(41+9ruVwKI*ZLfc&E%!x%_H4w8&=G^8RCna2%c@sW^>q$DRv$x0T* zCJIRiK@dWdPU=J;o&@D5H7UwclJbjlGdWbFIu(^mjp|dI z3e~9=wW?U9s#dSMRis+gt6Al$Si#y=rGC|{VI}KW(OOofuGOt-jVoKNQ+GWM~5b!=oI8(7I!ma>DjY-TZASj~2p zvxoI;XhFN!$(r`Er`>F7KfBt|wzjmWg^XT*O5581Zf3S9iH>f;1R59l20FiO4scZz z-01vtx5Q1ZZexkTQI)VE9Pm2ZN|yP*FdC%yLl?|m;a;PDFh!0JVCfYJLB>xvSk z+>Nk=>%vTy^fo!cJ#R^#Bis%ncex;t+HA!{}X2Z=1W~=vKERTEcBiWIW*- z+qfn)UQdc&j9&$-m^9OE@qk&(B?Bi|!zsy0i-Wx2CTpa?0DiKM2|Q&ZJDJJ`$#FtX zdgCs8*_JKYafz#wVT^dnGS(gQiHpl-=B}ClxJq{Mj(1q3JgMZ(CT8-F_e>i-_nEqM z!7f2LV^~XCi!O!sP@=yqTaOAfyi(@xQPehFEgR*?Zj*@gW(JikL($SP+4M$hqLiq> zFL(Bu@=^TiVC*1db}8ZOkfV&{D_c3zwx;#1YmMt(U!=h>F{xcz9i~GQS~4Sx?ZPC- z=tgIk&tz^^OB{zMTWrDDks-E3J}Rk{NPycc0XIya&$$AyU87Lfp98wQbi*<)#U?siM&JrII7TU&w-*?*@CaJ%FLK-~#cQWnD}do!E0 z0kD?ASF#CRiB2UiX}Dq=mg8OTnk7m9u=jP%TbGhS>oblqxvpmp<(gNS<~OgemJ<%) z#V}3^8~2jPErRdn+67OEt~g9ozL21E1|cbPoVit!Y(`fY=ED`wW-@Ydr|5Owf}PlP zqJ`U!BgE;F%ZXC-y69n-`6x=h6^C*nJv_M_&< z4?sH*(squwMAVfse25Iobb&~s@zC?`qs2?>{cd}4F2-AlT;gakK^^8p4?x$0O&6X$ zt5*M*R}#c+b4gPt04|@Ex$R-^y^AU5z)!I7b6xvf1G^={e$039g*JdM#9esC#D(Fs{7f_H^YX*T{F}Q;DqiX&2UQiQ(6gYgowu2VP zgBRFp$@h2@^g%Rugo)FEkC6=`Vh^`45Kkx&QHX?82qNJ?UsafemSGbP_7A=%5ZK@) z^`M1hSQ|XIDQ(jbPdJ5BScYzRNpBd3@{<#mCSwf+fO43J-_d>Gr75|zPkKm$J;xG5 zcxfVXQ4wWPiU?8_#fXUi*odR{h?2O7kw}RX<%pK3QI}YWnAnN2F^JnjQ#zGXq$rA| zh*PGRim14Xqo|6{7KpHzd7?CRei)0kSchB|5(elUk7$cps8@K%C9Zgit;mYRc#OlC zjK-*p#W;$u2#CHIjh_>Y(pZgVxER2giHYcmo7jz-_>J4hiQ?#u;Yf~zIz?*pAwG6QIV7$heI5*o^gvkMy{Y_n43VXo}Vtknn_e$S05n86LsdQ3tt@;E|0h zr;q)}j}SSL{}_=LNs$s+krY`r4B3%M=#e0q9SNCa@#v1|Sdu8Ij^zlCD#?y3`I0Uf zlP1ZM?+BAKX_N8)n1K(ekvy4^K6#Nn36wvHkwR&VA$gQQMUaGuluS7pBgs=u8I=x4 zk~=w+K}nQYd6imem0VerS*e87D3xM4mSh=r62Tj`fw`IUe6wF;SI?AVq$!$SLV!glNlMs}$2l~02#wH$Pp2tuBRGVo*_@z*mIOg# zz?qxu1exFenVFv{5&lq|1bB;<`A+9aNuJa;&sk$_Icm=XYVD~>+-aBkiIcI}o%9(v zc8H%zHBr?$6g_u`zSM{P$)Bm&p!2ksw)vmqiJN~Yj5da#!I`1_U3@V+O zw1umd8Rcgb*!HP0krBCQ6wGF*MFCg}38t{=p!DyHqM7Br8kueHLnBNmr0ten-WSihNZSMrG~gG@VAs7 z(Xas6YWRAYV;VnSI;wQ4t(j3W3fo=vd92xLq|&(%cw#U;vX?T09B2`fTC&{# zx{wCjIrDg`z`Clz`l~_FsxXUnROx3##%D+SXG_LoN-L_U3ba2Ynksv0nN~ zIs2@6`L*2&wt9-NDLc5D6oXd^WO7@#O^dXQJGYBVw~`yV@4B8#YPrQKwwilO|4DyY zr)HnKo1z=Kr0ZcO2)d@LTqEIoR;!_QIuI*sN!T@i070R)JzPdvd$QX>r1Bs*o(*+F_CJ%^Gk-NDNpY^wwt@Z{mZ}XtC{&Ey#VaL z0c^ksT)+xErt@dN_bZTPE4UAglsgN)6a1LyTb>F0zZ`tP3+%xiOpg~l!ZD{94ot!; zn7_Tc!64kiEd0VB46-*1!yz2QHeACv?85yNohXc)eAvT2+@)L!#EZF?5`4otoWnGn z#7u0!H%r9xo1Rb{#C>_KNW8>Ye8pO<#KMWW54y!o48~c^#biv1uRFz1oW5urmGfwu z9lO0f3%GI&$ErHV+Iz=Oi^p+H$F!N4Gc3k{T*hM@#)7;~+-04 zOv!jCr?s11eC)HjY{z-bq_P~fy?nTSOtq|RkBI!syPV6syvJ+V%EHOR+*gDdM@q}; z5Zrdm6K2XfyU3AD%q`(Gr`#p^%UydXzu}A-mt3^Yyi+ZA#F@O#?<~rkEK;^?x14*< zoPy0^V$Mp+&%a2oejCfdJj*%BddXC@1U=Be%*+aX$jH3RcR95?Tg>>V&W%jb@r=>% zT%pj6&tj>Zk@OV$?9tbVflo}*+M>Jk!SibjBzxnreL001D8^ z=f*6Z%nv=2v6|2fUDQN<)C+BnuAf%QJv9L9n*(N%pPO4aPP-))@TOaD6FR-60iRuOGR)^7s>5+t++e%7xpj z4<^Ss73A*?*nj8qVQ~z2W|3!4^H$-8&-dhJ7*yahw6pj$v3b z?A(28i|HC}=jJS-YSfjK+Jv*(8JTLJClUO*67_5pLmu1!?y4}3vT(S<%N?G00^BTm z5i>5+yXv~_TA)}-Mjfw)_xn{WPYmiZJ6Bc<^9yaGs zFjcq>zNMt9w_L8~>|EE6bhd6zVW9pcJg(V-1--Y`=k`P?T4oT{+!L#<)Qy(pdW*^F zYwHu#>C>v}L6I_5=RO3B$(XL)+AR}U&fD6d<+|R16CLR~B|WYj=ab=de%I-H&fG^X zfGcWgHY7^o#(a7e-rSLT13~T*meU7o#ZosR(eXJV=Z|a@4DX8+YZ*f z%jKEF-%o4fhq-}yTk{Gi|RZExz^Z~b0- z-0QgD9$)w>PdK7Z!R0Uaxu5^Lf6D+7K;Xc30}U25C=g-7g$ENVd>Ei1!H5$fKC~#Y z;zo=d8G3ZsQRK&wAxWN$7~tQ)l>%F;WEs^lIHF*)g%c7!JXo<|yo(bv=KEJN;>M5xJFfg#b7szwDSO5Y+VbR> zzg*H)>Nf4_wX9XQhW%PL+}O1LXS=qY8~5(oyl?jg{#&^2;KYafChj+7-m=Y|KZhP& z`gH15=T^s_UHf+KRF4-&9v=L7=7WEBN1tB(`mf*J8;38Rd3ne0<;N$F-+uo4{rUgj zFF^eU^iRM7X&a3_1s7znK?ffUO)>~4q_9G=3sYs7yw#rta zvNYFR6JQk7Wz7n6*T^LNGu>^~h4)=~-L307adpFW zS^yG|LREUf9Z1uou5GqpF#q|5;E0BmRtkZB5g1sZ9A?*GizS^aV>gY8mJBHXAjK9^ zT4{w+f_GB*VwES%7-7^1CYOu=S^;2-h$mgi$MfEt7vO*6{ki8STh{p5+iYovI8 z_tC~{=dio4KJm%xC0csXK^#i{45vQ=4$y#s(HQ;|D4x;H&w&p#Spy+BK?*|Wb=ZsD z@@l6+-38D8c*^tO21D3E;eC*U$U7kjODMt>LN5S10}@gMIKu@Vu!b}&;H$p3t_t?h zhuB%)4~00y>|ASo?IU6mm59C!76pek%;62C7)2@?P=ZUuViujlDlK-=i#!_`>{w{R z5u&h+DkNhI&8S8+j?s-IOk*71xJKhO??*eFA{6!bL_X%RkN&|U{k}LzLf&y86e}ct zriUQw0PsR*c@`m!Xul=;N<~l0%8A0_79>*eLxrm1ANT0TKrK>xp(G_BIhDvlcG8Pn z)S@L>gh{Mu5-hZAWopC-$2qoJ&0-O*}^u7ctOTB@tDN~ z=|@G17+dhODHp|x%*tt@WHQsG%Y^AAU+BEQlt-TNWTZih;!lC_bY=dm)--XNP-;dL zJEVvRQn8}crZ5#LPOYUdL)y}q1}`OG1EmkG$+5&Ft9kH4)>G^_)3G*lEm(a>PzR>a zq57{-*=p-exoK4Ky>qQZjqCQ3;!}elGMq{A>q9ac0H5Yleo2wQKoa|q#cq;&c!g~L zz_Lo$3bj)#R7Iv#N6JDb-gU0?3*BFvGgyI;7L3!8D_a>TrbvF)eU??+TC|72inZ3Z zj`YrCGpo$qzOAvek=bo2BD5Xwdb<5r-4r;%N#P5Rm z+Mw%hmbcg?VP{tq-?0@niIlW&LOt7BB{Eo21HNo_4{TuHrbTDz)J%j`t5J&bx4x@< zZV0k*!}L>eL>>IY7%tMpk)5y$Z#-gL9`w2HOwEbe+ZYNrOSEc@2$FgKEaWJm z_{YW_3vve%V59_C0#rsy#MBDQ7q@uBUZyYbEF3lBW=CKx;pud-G?pSWkIB&sBL-bu zRSwg+z!dT)hL56Wr@S{RV7Bv|PiV&(hxpBHo#>Yg+Z7R`SEFMlBA-`gS_F4l(3Mu< zVIcj$GJ{s8I~Jf^3Qc1W3sj#^hHsETedq_XddVExG=M$*|*y9yKN}{QblCo#YT9b zjqN)fFL>Ui?)54AolAEMJK^NEb-AsIY!Xk&i1Q{i#QiN|X0#UyIXa-I2cOZOq*J6m|Q z;?s`y7iV2=pf8=<*%xf!j^668*X#q;ElFojKIoc%Hm7ml_?AEaxx5A`Z;XY{D&p_k z_?kX`{gTg;mi*rJqCb4huPRo~=XBzoZ?b~1AL<~h_xAVZ%kLWpeZw!)E|QQt+1s`I z8fO0b?B|Wr;Xh*kA{6wne?HaoAAS6nzVh@|y;ZTka3epAE4=yRJ^G@s0KA`jIV@7! zzw$G{IpQKNYq;&}9{0n*)w)0g%p=r$y9k`X1SuIw8$tdnz>u0gN2$K}3$yQ=75N)E zyX!v3^T2q~z`ANS?J~3(tRkROH5gnHQ^UCp)T8?Au7@k06ePW4vp)$$JQ3VD_1g>v z#2HAcHz9pc)`!V{!30+hlz zj6xKnId4LYi*hqIRHTRCu2|y24g|y>^ffswxk5a|f3w3h^qw1}zor92c4ERYq{B?i zLo$pM2xF)o`a?+6A%-KwifcU-yhBXfL`}rQIBd2LqdQ6DzFCsRT2w=AQ^Zx&#a2{B zUSvY#OR?E`Lsi;2P&7qXoS;z5#g!QxQN%sVbH+v-Mjl+oY7D~&sYGkk#!O_2NS<6vgeyuCgUPw<%DTLslO)T$WQuy}EAX;QuG~txnJw8OOq3~14>?Q>GR(z9 z%*mrUw0ujoY)iHb%5sEBAS8-{7(Bh?%$D;+%7o0x1j^8?O!s5P&O}YGSVEf8i5OZ< zLuyT*aLw72&DtCu+l^^8yV zoKN^1&-0|u`;<@p%+KP(Py6)G{j4Lqi*B9?j7o{ZAnU(jhg{A`Q|dMN%gHPSAAADWpadJrw67%|~=X>+nuB z8b8HUPUrm1=nT{4BvUYj&N7wGFHKYbF+Ec=9ZobIQ#V!9I8_O-Il%UKjxKGzH>J`( zm-V2rfGoArlSNRNQnYLaw+Ztw>dfEKywd|+Ya#*ih@P_Az zUN4fBYkBCf%t1W->)8vLI%}#pBUF5zu&93a4C{>Sy6N2&|6#L0O-G$xSwH`#9{}nMY}tGcyfN+ zb^S}g)r|!+QVk=s7H{%*br#L;bi8xgFEn7b>zO77|BZh(ze&E{ZE-WM*zU4V=R(=8 z=|^v5tmW!kdo#TBMu%<03g3v8u@S3kZzb=IT7I{))ghdB?dAF(X7h5RS`KN=U3hb& z4`(g!tyc?f&Q`V3Ym~_1{mTPft zS3#4m`sa3+JzU#kZ@*}WStNU6azIT^K#PWQNI^l8a#MUD#Hr+kddj7k0XwcC}Khs11pJ&_^73toz^ujS;_glWc zM?yUXU)@>38+*Ps?s@CIms9V(I_qDo6t|?}?v1-~oKNGXzld9X;vU0?)*S|MTU_Hf zc3%GPeC>qGw9l!)YV~f=+ZFpoWAb@p{_MS<_w;_@*7(1y5B}}Ft$)!S_h|10wr2q>Z4cfreZZ1-@{6m;57kX_J`<}yJ~;B@0k2r%5t+np;57~$s|=$x z&MdvRvNujVFHvk;oMhX>zcR6vq4!oqJWzT3aLcPi)_;l39JkeZ7`kT0@Q6icO!awL zEE00{%CDz)XHR{!hwCc8R6IAYw&R&3Zo7wieX)Fgkt%K%1T*hRnI%iPJx*9NH__BC z*~~Bbq4eES#k1O?$vpG!Gkm-MNA$toqmLQy-M9IdZ2vCV?p|_UY5c{Wm07yStm3X( z_FcMUlj0F}P%Pz%*S06#$5Nh8*yWSwwe@Mr@-I*P#hwPbnPzjRe&pmpEV`P>$jj)? zpw57N12>1Tmd=e;u?*GR%3gCk1RsfUiWq0zu_)kf&=s)klJUH7Z@(`Cg9nG_CRO)- z&7}@0FE^z*b!Y^yT9Uc>xnn=ddtM}>b$io3?3_0xi-#S89_ZDP68g)I91*`zT2Eb%Iw3>We*?Ux8G#(uK~7Jje$Yu5-`~K z7=(bq7R12F@#j0ggJUBHyOhn04G*1~_}Kp`{m4%`(kP;6Wb(rx`ACnPVAv9ii3ulL z6r78EID=HYJJ`JYS~@o=yY@*$KDu+WNZD&Ld+n_+CqJYeM7AcJNuP<40eIL72MYru O3kx*bfc6iBgf#$x7Bx!% literal 0 HcmV?d00001 diff --git a/extensions/km-plot/gui.py b/extensions/km-plot/gui.py new file mode 100644 index 0000000..33f068e --- /dev/null +++ b/extensions/km-plot/gui.py @@ -0,0 +1,471 @@ +import time +from pathlib import Path + +from inkex.gui import Gtk, GLib +from gi.repository import GdkPixbuf +from plotters import plotters + + +class KMPlotGUI: + def build_window(self): + self.window = Gtk.Window(title="KM Plot") + self.window.set_border_width(10) + self.window.set_default_size(500, 500) + + root = Gtk.Box(orientation=Gtk.Orientation.VERTICAL, spacing=8) + + self.status_label = Gtk.Label(label="No supported plotter detected.") + self.status_label.set_xalign(0.5) + + self.device_label = Gtk.Label(label="Device: not connected") + self.device_label.set_xalign(0.5) + + self.device_image = Gtk.Image() + self.device_image.set_from_icon_name("image-missing", Gtk.IconSize.DIALOG) + self.device_image.set_pixel_size(150) + self.device_image.set_halign(Gtk.Align.CENTER) + self.device_image.set_valign(Gtk.Align.CENTER) + + self.port_info_label = Gtk.Label(label="") + self.port_info_label.set_xalign(0.5) + self.port_info_label.set_halign(Gtk.Align.CENTER) + self.port_info_label.set_justify(Gtk.Justification.CENTER) + self.port_info_label.set_line_wrap(True) + self.port_info_label.set_margin_top(14) + self.port_info_label.set_margin_bottom(14) + self.port_info_label.set_margin_start(12) + self.port_info_label.set_margin_end(12) + self.port_info_frame = Gtk.Frame(label="Driver") + self.port_info_frame.set_shadow_type(Gtk.ShadowType.IN) + self.port_info_frame.set_halign(Gtk.Align.CENTER) + self.port_info_frame.set_margin_top(12) + self.port_info_frame.set_margin_bottom(12) + self.port_info_frame.set_margin_start(12) + self.port_info_frame.set_margin_end(12) + self.port_info_frame.set_size_request(250, -1) + self.port_info_frame.add(self.port_info_label) + + self.port_store = Gtk.ListStore(str, str, str) # device, vidpid, display + self.port_combo = Gtk.ComboBox.new_with_model(self.port_store) + port_renderer = Gtk.CellRendererText() + self.port_combo.pack_start(port_renderer, True) + self.port_combo.add_attribute(port_renderer, "text", 2) + self.port_combo.set_sensitive(False) + self.port_combo.connect("changed", self.on_port_changed) + self.port_combo.set_halign(Gtk.Align.CENTER) + + self.cut_button = Gtk.Button(label="Send to plotter") + self.cut_button.set_sensitive(False) + self.cut_button.connect("clicked", self.on_cut_clicked) + + self.status_bar = Gtk.Label(label="Searching for devices...") + self.status_bar.set_xalign(0) + + notebook = Gtk.Notebook() + notebook.set_tab_pos(Gtk.PositionType.TOP) + + # Main tab + main_box = Gtk.Box(orientation=Gtk.Orientation.VERTICAL, spacing=8) + main_box.set_hexpand(True) + main_box.set_vexpand(True) + main_box.set_valign(Gtk.Align.CENTER) + main_box.set_halign(Gtk.Align.CENTER) + port_row = Gtk.Box(orientation=Gtk.Orientation.HORIZONTAL, spacing=6) + port_row.set_halign(Gtk.Align.CENTER) + port_row.pack_start(self.port_combo, False, False, 0) + main_box.pack_start(port_row, False, False, 0) + main_box.pack_start(self.port_info_frame, False, False, 10) + main_box.pack_start(Gtk.Separator(orientation=Gtk.Orientation.HORIZONTAL), False, False, 12) + main_box.pack_start(self.device_image, False, False, 6) + + notebook.append_page(main_box, Gtk.Label(label="Device")) + + # Connection settings tab + conn_box = Gtk.Box(orientation=Gtk.Orientation.VERTICAL, spacing=8) + conn_box.set_hexpand(True) + conn_box.set_vexpand(True) + conn_box.set_halign(Gtk.Align.CENTER) + conn_box.set_margin_top(12) + conn_box.set_margin_bottom(12) + conn_grid = Gtk.Grid(column_spacing=8, row_spacing=6) + conn_grid.set_column_homogeneous(False) + conn_grid.set_halign(Gtk.Align.CENTER) + + # Plot settings tab + plot_box = Gtk.Box(orientation=Gtk.Orientation.VERTICAL, spacing=8) + plot_box.set_hexpand(True) + plot_box.set_vexpand(True) + plot_box.set_halign(Gtk.Align.CENTER) + plot_box.set_margin_top(12) + plot_box.set_margin_bottom(12) + plot_grid = Gtk.Grid(column_spacing=8, row_spacing=6) + plot_grid.set_column_homogeneous(False) + plot_grid.set_halign(Gtk.Align.CENTER) + + self.adv_controls = {} + + conn_row = 0 + plot_row = 0 + + def add_conn_row(label_text, widget): + nonlocal conn_row + label = Gtk.Label(label=label_text) + label.set_xalign(0) + conn_grid.attach(label, 0, conn_row, 1, 1) + conn_grid.attach(widget, 1, conn_row, 1, 1) + conn_row += 1 + + def add_plot_row(label_text, widget): + nonlocal plot_row + label = Gtk.Label(label=label_text) + label.set_xalign(0) + plot_grid.attach(label, 0, plot_row, 1, 1) + plot_grid.attach(widget, 1, plot_row, 1, 1) + plot_row += 1 + + # Dropdown helpers + def combo(options, active_value): + store = Gtk.ListStore(str, str) + for key, text in options: + store.append([key, text]) + combo_box = Gtk.ComboBox.new_with_model(store) + renderer_text = Gtk.CellRendererText() + combo_box.pack_start(renderer_text, True) + combo_box.add_attribute(renderer_text, "text", 1) + # set active + for i, row_data in enumerate(store): + if row_data[0] == active_value: + combo_box.set_active(i) + break + return combo_box + + # Spin helpers + def spin_int(value, min_val, max_val, step): + adj = Gtk.Adjustment(value=value, lower=min_val, upper=max_val, step_increment=step) + return Gtk.SpinButton(adjustment=adj, climb_rate=1, digits=0) + + def spin_float(value, min_val, max_val, step, digits=1): + adj = Gtk.Adjustment(value=value, lower=min_val, upper=max_val, step_increment=step) + return Gtk.SpinButton(adjustment=adj, climb_rate=1, digits=digits) + + # Build widgets using current options/defaults + baud_spin = spin_int(int(getattr(self.options, "serialBaudRate", 9600)), 1200, 115200, 100) + bytesize_combo = combo( + [("five", "5"), ("six", "6"), ("seven", "7"), ("eight", "8")], + str(getattr(self.options, "serialByteSize", "eight")).lower(), + ) + stopbits_combo = combo( + [("one", "1"), ("onepointfive", "1.5"), ("two", "2")], + str(getattr(self.options, "serialStopBits", "one")).lower(), + ) + parity_combo = combo( + [("none", "None"), ("even", "Even"), ("odd", "Odd"), ("mark", "Mark"), ("space", "Space")], + str(getattr(self.options, "serialParity", "none")).lower(), + ) + flow_combo = combo( + [("xonxoff", "XON/XOFF"), ("rtscts", "RTS/CTS"), ("dsrdtrrtscts", "DSR/DTR+RTS/CTS"), ("none", "None")], + str(getattr(self.options, "serialFlowControl", "xonxoff")).lower(), + ) + resx_spin = spin_float(float(getattr(self.options, "resolutionX", 1016.0)), 10, 5000, 10, digits=1) + resy_spin = spin_float(float(getattr(self.options, "resolutionY", 1016.0)), 10, 5000, 10, digits=1) + pen_spin = spin_int(int(getattr(self.options, "pen", 1)), 0, 10, 1) + force_spin = spin_int(int(getattr(self.options, "force", 0)), 0, 1000, 1) + speed_spin = spin_int(int(getattr(self.options, "speed", 0)), 0, 1000, 1) + orientation_combo = combo( + [("0", "0°"), ("90", "90°"), ("180", "180°"), ("270", "270°")], + str(getattr(self.options, "orientation", "0")), + ) + mirrorx_check = Gtk.CheckButton(label="Mirror X") + mirrorx_check.set_active(bool(getattr(self.options, "mirrorX", False))) + mirrory_check = Gtk.CheckButton(label="Mirror Y") + mirrory_check.set_active(bool(getattr(self.options, "mirrorY", False))) + center_check = Gtk.CheckButton(label="Center zero point") + center_check.set_active(bool(getattr(self.options, "center", False))) + precut_check = Gtk.CheckButton(label="Use precut") + precut_check.set_active(bool(getattr(self.options, "precut", True))) + autoalign_check = Gtk.CheckButton(label="Auto align") + autoalign_check.set_active(bool(getattr(self.options, "autoAlign", True))) + overcut_spin = spin_float(float(getattr(self.options, "overcut", 1.0)), 0, 10, 0.1, digits=2) + flat_spin = spin_float(float(getattr(self.options, "flat", 1.2)), 0.1, 10, 0.1, digits=2) + tool_spin = spin_float(float(getattr(self.options, "toolOffset", 0.25)), 0, 10, 0.05, digits=2) + + def set_tip(widget, text): + try: + widget.set_tooltip_text(text) + except Exception: + pass + + # Tooltips for plot settings to guide users. + set_tip(resx_spin, "Horizontal resolution in dots per inch (higher is finer).") + set_tip(resy_spin, "Vertical resolution in dots per inch (higher is finer).") + set_tip(pen_spin, "Pen number to use when cutting/drawing.") + set_tip(force_spin, "Downward force in grams; higher presses harder.") + set_tip(speed_spin, "Movement speed in cm/s; higher is faster.") + set_tip(orientation_combo, "Rotate the plot by the selected angle.") + set_tip(mirrorx_check, "Flip the design horizontally.") + set_tip(mirrory_check, "Flip the design vertically.") + set_tip(center_check, "Center the zero point on the page.") + set_tip(precut_check, "Use a small precut to help corners release cleanly.") + set_tip(autoalign_check, "Attempt to auto-align the plot to the material.") + set_tip(overcut_spin, "Extend cuts past corners to ensure complete separation.") + set_tip(flat_spin, "Flatness compensation factor.") + set_tip(tool_spin, "Offset distance for the tool tip (in mm).") + + add_conn_row("Baud rate", baud_spin); self.adv_controls["serialBaudRate"] = baud_spin + add_conn_row("Byte size", bytesize_combo); self.adv_controls["serialByteSize"] = bytesize_combo + add_conn_row("Stop bits", stopbits_combo); self.adv_controls["serialStopBits"] = stopbits_combo + add_conn_row("Parity", parity_combo); self.adv_controls["serialParity"] = parity_combo + add_conn_row("Flow control", flow_combo); self.adv_controls["serialFlowControl"] = flow_combo + add_plot_row("Resolution X (dpi)", resx_spin); self.adv_controls["resolutionX"] = resx_spin + add_plot_row("Resolution Y (dpi)", resy_spin); self.adv_controls["resolutionY"] = resy_spin + add_plot_row("Pen number", pen_spin); self.adv_controls["pen"] = pen_spin + add_plot_row("Force (g)", force_spin); self.adv_controls["force"] = force_spin + add_plot_row("Speed (cm/s)", speed_spin); self.adv_controls["speed"] = speed_spin + add_plot_row("Orientation", orientation_combo); self.adv_controls["orientation"] = orientation_combo + add_plot_row("Mirror X", mirrorx_check); self.adv_controls["mirrorX"] = mirrorx_check + add_plot_row("Mirror Y", mirrory_check); self.adv_controls["mirrorY"] = mirrory_check + add_plot_row("Center", center_check); self.adv_controls["center"] = center_check + add_plot_row("Precut", precut_check); self.adv_controls["precut"] = precut_check + add_plot_row("Auto align", autoalign_check); self.adv_controls["autoAlign"] = autoalign_check + add_plot_row("Overcut (mm)", overcut_spin); self.adv_controls["overcut"] = overcut_spin + add_plot_row("Flatness", flat_spin); self.adv_controls["flat"] = flat_spin + add_plot_row("Tool offset (mm)", tool_spin); self.adv_controls["toolOffset"] = tool_spin + + # Connect change handlers to keep self.options in sync. + baud_spin.connect("value-changed", lambda w: self.update_option("serialBaudRate", int(w.get_value()))) + resx_spin.connect("value-changed", lambda w: self.update_option("resolutionX", float(w.get_value()))) + resy_spin.connect("value-changed", lambda w: self.update_option("resolutionY", float(w.get_value()))) + pen_spin.connect("value-changed", lambda w: self.update_option("pen", int(w.get_value()))) + force_spin.connect("value-changed", lambda w: self.update_option("force", int(w.get_value()))) + speed_spin.connect("value-changed", lambda w: self.update_option("speed", int(w.get_value()))) + overcut_spin.connect("value-changed", lambda w: self.update_option("overcut", float(w.get_value()))) + flat_spin.connect("value-changed", lambda w: self.update_option("flat", float(w.get_value()))) + tool_spin.connect("value-changed", lambda w: self.update_option("toolOffset", float(w.get_value()))) + + bytesize_combo.connect( + "changed", + lambda w: self.update_option_from_combo("serialByteSize", w, default="eight"), + ) + stopbits_combo.connect( + "changed", + lambda w: self.update_option_from_combo("serialStopBits", w, default="one"), + ) + parity_combo.connect( + "changed", lambda w: self.update_option_from_combo("serialParity", w, default="none") + ) + flow_combo.connect( + "changed", + lambda w: self.update_option_from_combo("serialFlowControl", w, default="xonxoff"), + ) + orientation_combo.connect( + "changed", lambda w: self.update_option_from_combo("orientation", w, default="0") + ) + + mirrorx_check.connect("toggled", lambda w: self.update_option("mirrorX", w.get_active())) + mirrory_check.connect("toggled", lambda w: self.update_option("mirrorY", w.get_active())) + center_check.connect("toggled", lambda w: self.update_option("center", w.get_active())) + precut_check.connect("toggled", lambda w: self.update_option("precut", w.get_active())) + autoalign_check.connect("toggled", lambda w: self.update_option("autoAlign", w.get_active())) + + conn_box.pack_start(conn_grid, False, False, 0) + conn_scroller = Gtk.ScrolledWindow() + conn_scroller.set_policy(Gtk.PolicyType.AUTOMATIC, Gtk.PolicyType.AUTOMATIC) + conn_scroller.set_hexpand(True) + conn_scroller.set_vexpand(True) + conn_scroller.add(conn_box) + + plot_box.pack_start(plot_grid, False, False, 0) + plot_scroller = Gtk.ScrolledWindow() + plot_scroller.set_policy(Gtk.PolicyType.AUTOMATIC, Gtk.PolicyType.AUTOMATIC) + plot_scroller.set_hexpand(True) + plot_scroller.set_vexpand(True) + plot_scroller.add(plot_box) + + notebook.append_page(conn_scroller, Gtk.Label(label="Connection Settings")) + notebook.append_page(plot_scroller, Gtk.Label(label="Plot Settings")) + + # Footer with status and send button at the bottom. + footer = Gtk.Box(orientation=Gtk.Orientation.HORIZONTAL, spacing=6) + footer.pack_start(self.status_bar, True, True, 0) + footer.pack_end(self.cut_button, False, False, 0) + + root.pack_start(notebook, True, True, 0) + root.pack_end(footer, False, False, 0) + + self.window.add(root) + self.window.connect("destroy", self.on_window_close) + self.window.show_all() + + def poll_devices(self): + if getattr(self, "sending", False): + return True + self.debug("Polling for devices...") + self.update_status_bar("Searching for devices...") + devices = list(self.enumerate_with_serial()) + self.port_entries = [] + for device_entry in devices: + device_path = device_entry["device"] + vidpid = device_entry["vidpid"] + info_text = device_entry["info"] + plotter_info = plotters.get(vidpid) + if isinstance(plotter_info, dict): + name = plotter_info.get("name", vidpid) + icon_key = plotter_info.get("icon") + elif plotter_info: + name = str(plotter_info) + icon_key = None + else: + name = "Unknown device" + icon_key = None + display = f"{device_path} ({vidpid})" if vidpid else device_path + self.port_entries.append( + { + "device": device_path, + "vidpid": vidpid, + "name": name, + "display": display, + "info": info_text, + "icon": icon_key, + "supported": plotter_info is not None, + } + ) + + if self.port_store: + self.port_store.clear() + for entry in self.port_entries: + self.port_store.append([entry["device"], entry["vidpid"] or "", entry["display"]]) + + if not self.port_entries: + self.debug("No ports detected this cycle.") + if self.port_combo: + self.port_combo.set_sensitive(False) + self.port_combo.hide() + self.current_device = None + self.current_vidpid = None + if self.port_info_label: + self.port_info_label.set_text("No Serial Devices Found") + self.port_info_frame.set_visible(True) + self.set_device_icon(None, fallback="noport") + self.cut_button.set_sensitive(False) + self.update_status_bar("Waiting for a supported plotter...") + return True + + if self.port_combo: + self.port_combo.set_sensitive(True) + self.port_combo.show() + if self.port_info_frame: + self.port_info_frame.set_visible(True) + + active_idx = 0 + if self.current_device: + for idx, entry in enumerate(self.port_entries): + if entry["device"] == self.current_device: + active_idx = idx + break + + if self.port_combo: + self.port_combo.handler_block_by_func(self.on_port_changed) + self.port_combo.set_active(active_idx) + self.port_combo.handler_unblock_by_func(self.on_port_changed) + + self.apply_port_entry(self.port_entries[active_idx], update_status=not getattr(self, "sending", False)) + return True + + def apply_port_entry(self, entry, update_status=False): + self.current_device = entry["device"] + self.current_vidpid = entry["vidpid"] + detail = entry["vidpid"] or "unknown VID/PID" + if self.port_info_label: + info_text = entry.get("info") or "" + self.port_info_label.set_text(info_text) + self.set_device_icon(entry.get("icon")) + self.cut_button.set_sensitive(True) + if update_status: + self.update_status_bar("Ready") + + def on_port_changed(self, _combo): + idx = self.port_combo.get_active() if self.port_combo else -1 + if idx is None or idx < 0 or idx >= len(self.port_entries): + return + self.apply_port_entry(self.port_entries[idx], update_status=True) + + def on_window_close(self, *_args): + if self.poll_id: + GLib.source_remove(self.poll_id) + Gtk.main_quit() + + def on_cut_clicked(self, _button): + if not self.current_device: + self.show_dialog("No plotter detected yet.", Gtk.MessageType.ERROR) + self.update_status_bar("No plotter detected.", error=True) + return + try: + self.sending = True + self.update_status_bar("Sending to plotter...") + self.flush_gui() + time.sleep(0.05) + self.perform_cut(self.current_device) + self.show_dialog( + f"Sent the document to {self.current_device}.", Gtk.MessageType.INFO + ) + self.update_status_bar("Sent") + except Exception as exc: # pylint: disable=broad-except + self.show_dialog(f"Cut failed: {exc}", Gtk.MessageType.ERROR) + self.update_status_bar(f"Cut failed: {exc}", error=True) + finally: + self.sending = False + + def show_dialog(self, message, level): + dialog = Gtk.MessageDialog( + transient_for=self.window, + flags=0, + message_type=level, + buttons=Gtk.ButtonsType.OK, + text=message, + ) + dialog.run() + dialog.destroy() + + def update_status_bar(self, message, error=False): + if not self.status_bar: + return + prefix = "Error: " if error else "" + self.status_bar.set_text(f"{prefix}{message}") + + def set_device_icon(self, icon_key, fallback=None): + if not self.device_image: + return + target_px = 150 + base_dir = getattr(self, "icons_dir", None) + if base_dir is None: + base_dir = Path(__file__).resolve().parent / "icons" + + def load_icon(name): + icon_path = base_dir / f"{name}.png" + if icon_path.exists(): + try: + pixbuf = GdkPixbuf.Pixbuf.new_from_file_at_scale( + str(icon_path), width=target_px, height=target_px, preserve_aspect_ratio=True + ) + self.device_image.set_from_pixbuf(pixbuf) + return True + except Exception as exc: + try: + self.debug(f"Failed to load icon {icon_path}: {exc}") + except Exception: + pass + return False + + if icon_key and load_icon(icon_key): + return + if fallback and load_icon(fallback): + return + if load_icon("unknown"): + return + self.device_image.set_from_icon_name("image-missing", Gtk.IconSize.DIALOG) + self.device_image.set_pixel_size(target_px) + + def flush_gui(self): + """Process pending GTK events so label updates are shown before blocking work.""" + while Gtk.events_pending(): + Gtk.main_iteration_do(False) diff --git a/extensions/km-plot/icons/noport.png b/extensions/km-plot/icons/noport.png new file mode 100644 index 0000000000000000000000000000000000000000..a06bbb4f91e1a28f1d7ffc8a29c0b5e51321c5cc GIT binary patch literal 72957 zcmXtg2{=^k`~Qd}$vT*j{got9lcnq#B2yHVvJHue5!s>;MT{*=(%5Q*>}B7{S_zFQ zV+lnJNkaDRe~<6)f4y&4SIU`lo^wC<{n;MjCg%35W5KQ%ZZH@ zzJhM+-4DMpd0aHmW$OPR9|(V7an!-;AP{e3_HE#H!=J_N&tAkL5PmWU#DhlS3* z!6X9VrHDZMvPB?HB_R-kZYkBK>hKq=cIOQA5ZjFZUesmB!&mmYowe{lAQYq+znJc3 zYI(yK_jnp&F?*&sL|EAlM$HEn!G|CW^>obc4*ag`zaw(RuW<9`#K)?ek&;YZ$p4In zehr;jX_?#h?wfym;rBTc8{Ku@foI}2!Rx%g!|G=0xI{Q}Du#}h$;OKBeIh;~eN{V`cqmbl9> z4uL?~zrpUaNR;R}j>IsTo4=H0SEYYXIb(`ky+1m;x$X1Ker-F|;rab8vaAVmHxd(+ zh5wA+uY;8AI1X26R(ydMQl-OJLUAu-*((dzr?=ONw$~1=>Fo`!WJjK2VbQT^tboVQ);VQSZ)FMK*LFu3`?3^-xH^L`ARG$#-zKEA^mvBT%7C zR5S%&_CuBPR+*4cR2yx3D{yQ1*p$2kTd#;#-M z`Bt~v>*{5Rtdbt18WHvvz0aMcBHcx#4C9z|UdytZnTHfkzaa>3Z?@Gs^?dl>7v{3?axu6x z`dO-(z9`d+Yeg?D6-KrL7oxMVzSc%hQFL1vXbxTPU+r)e4xa+x9K@ zI*9kbpA_>ynwu-xQ5=LUI?I%oOO)&wA8TD$is;??mwz{fI}rZz!^P)u{IRF3Xr^*c z1D0nhMz%Ck>sWNiQQ~2Te>!Td_iOpo3^nkbwAV$49W#v_v7vccJ~E`1GU0kgWZlsF z<@EL<4j4{f@JUNZL+*ND=KDd@Qe{w%cl#*bmbI?n1bwJyW^MupCMK*?ra+#9$tCWglzV&f&S=os_* z%npyci!|`H@`h~aA|e+@TiorW-Z{9LeRCi8vk7Dh__ch%o>{VJJHjLSRvGbj!)9Xd z-C%KwK6i_%`*iQoH0iyto#gk0;>4rJj_{n89w;;@-G8rMk;5U?Dosp(vzJE0cmD6w zEcs)^w6^3pnr;5wOAJR_23~rAC$$Uw6{F+y$%J{m>)VcZEjz8YmodL;8bm1z>iLC* z<@Ku*$*fl9J4?rA8OC#zD_Gmxp4dq%&JXgFl^89SKa)mRgI%hax0D%E+rhcOncrmN$!2l%G#gsA;F6w)P?=F>)>j@*RHksjeUE^JwgunxRm-@8qIispHQ6YW#Gd&o6B`S(b=EM2|I=6AsKlcfpgIiscpCZXjQc zaF>rb=8q5>Mxw`5Pw(d?P_IzEza=S9(LA9NdV+5WgP*;ugjPj2pJxnZKQ+SW(_4Oj zl_h>(*Cfj}J>0_;uqn1ZCx-TU%GgOPS;axnSZ)4w*CR#ol53RP?GhVxJ!nj#!|}Dt z$lbx>ciSTuCtHF7G6oEPOa4buuD$oK@|3a;DGNTOSC?q!7g)XVy2`B~(3+IRY~S`k ztj1)2Gow0J;pzG#b{;9oMO0(sZ-h8o{m+!;5-%vGqSxiK5$m z>orakWqkV{M-+3`^eHqp{={XbMlY+4sSiG-6+4$f1&R&_{>2p0){7}l@6TUAF!Lz! zmsz4r^K(&Hvh;kEyrA8ljxO(hb5m~j^O<2R~PMF6NSd&29;6v zVdS&kn(+^$7`xMb>i(P3PY3MXL=5!#*B<+49Q){<5|)HaFSU5AH|S()Au-v4H41Fc z%fkOv=Q515^$CnwlGwQu!S>OOU4qtlNxxp#ip;r!F!G{-Fs#u~N~10NloM^(3mL~( za&$mpbYog9{%c@bL>GOl@RCF?R3$3(_2oRceLP8$D2c@A?26v$q3iC;OR4u#7EW5x zGEE60?eH&%WOzWguJNnlxG_`YZkQjjl>uWt@#^JgOJkjq^(dj5)3I9%mgeRba^mXD z5oFXGal<$kjOha z`kpPdvOHM!QQ>r7--`j2oh322YGLsMaRdE;-r5o-K&*~+s=0N$Ap*JBu5l%(c{Rs3 zt$Eqsg+QPfp8upC$;qVDaer+pyY}m?4@z2+#4K6%*VqT*g;#8e?v{~CedV1P;^GuF zTlzbj$*U;wn~%PJHCMQpep`jbi4>|DJ#ML=bqk5lI4g`9C_LQL#};u3yi-IRDpF~(TGK>W zuKEq;#F@OWO+QOPafWQuVp7v}~>~Hz;BkI;@NKAd0muzB%k0d}c*`MD~~>KZNw5u?Xn4 z?~7gD+>ElB)mQzMWdN^Jcy5cHoU~uQ>ony?0$r^K9fBvBnDfIFS@uuLT3zjk^5VVC zD7w2gqFMnPA#`7x%X#KuX0NBKVG=1~FL5Rd45iymmgeT3@$Y5qekqD_-A`YI$2}2~ zq{8X>dw`V(XM&YvG(?g+WqvK5st;Uao{8G2;nQs z>u05+xsvxAQxg{DFs333y-2(i6yN?5YnqJSwKO_26*;P^pJTSmp2HL=fxXn9Bh;?s zLVL%h_2ll(%gg!H-Mz57>MKhOmL=ZMJ4%#93+bC#8 z-wZY;8O`fFPX&2=5j`|)U)aCx{EukZCjd}a+uB$&v5YEqH_Lz8;gDeTpG8HR+T+6M z&uDCQMqVy^v*MGioZ9%rOB`!Ak=8!1ur3_4N9-7vuIVDZao?`(n%`P;+zV(?z9S&A zrNMuDGtHIES}4no{Qib;y-P(yRrSSY9HXvPT)%zK%_Uze0K%bm=htLdjzxs0cPlmX-sx_StBJdt72Vw29;imYt*JS;F5^yk?a3B4 zJ-ReA7+6L6P4rOp4xMloyVzxg|i+uWa7CzX6b7UFNfF&)2FnHCUgqjXqMpN9`CBzZAlIKtkf8l{1RrdLc?xf37FX4^v$6Qte^<4C?EZd*Vz_Lz0;3yr6+tj5Y*qUzrzb7gwc zU_y|1fa%~#$UB=^NzwxfvzsWyGFk9flz(pcje*q+;ryvK?l5CbMrltE|R<|^B=G~s|Ht|_1!vT!4C7-N7$aDx=^a)IE&5$vh1sE z_#;pd#`KohZ3Q!9X-Rpe1XgjEz4MdnMYNarflS(~gI2FUWR2QQf9YDYG|<{JcYBc| zdU3Oxx;-#ofnT6L%5$rj-QH|MEvgGwq3t#2vy;l*|82L9v@Ty*x^z*0-t6PC)%*2- zrs>6hA3*8cP(45N!>o0dSEc{y@LObRYdu{5Wyp*B-dYjTzpEFuV{&S3W96+I+cn@^0E=sB43-?q%AHSB-n` zLd{sTbL1g31;5~k zqJ8%qo|p?4xQlSJ5{y(*Gf2=I{7qC&d3*2QE1I%#X?WD^tAt6Dg)e+81BxBtCB2_s zez#w+fKKK|xr}UWe1GJ7`=lF5bRZmNei$!b_rl-bt3op$7!@W(D^!bSZg+p;@I1xE z?c3yGT$T1vhV(!v#b)_#ij$DcfSylUZf?)Wta^iur&`1@_hDku)<3#?tg02w5T5Y# zNewxD%Wx0Fq|k_DD=XUg_F>|#k>$BN_Nhw_j3ru5JCK{3i*&eBonu+zBwT*jvf`{r z?~E+@Wp3`r!+dtkJZmW+L%9gl#q^dU4x0@SovEB=?eCZA@Q^G4&A+ zrHJLr!Z&#h^)`T5kRJ9{D{xLQ(7lK{m5(ufB;RqP`kaWfgtQvnHdp3Q5L>g8yL?PC zzCSPp8tIrSG*XMiAdjuCs8}2dq=$g$NF}`GQR{BXzd1bpcV&3F>23DHi;bxXq8c-0 z={FBA{Cqr%zbylx!qL&o>#5kmp8?-kvE-RGZoA*FXbBGer%hk0caKlLxmF+(VgTf* z$yj}BvU}e<@rxsN$mf%yHzVJmwS|zDDGkQOqE|C@_i3 z7G-eNCi}H8v@}%H$B*njA_lG;%>oiTXzY9hIibU$#a&)XXLHQ^ku0||%jWhmNe4X1 z=arL_#5D1GKYzxjg&QnT)tJWCU_ze(>^vMlO-^;sa+2yxuc5yiU0b!CZm;yrC@ zS`=^kt7HXU!ZWFXt~Jt#Z#s#n-aXgMrS*9c14SCm?`-pBdhuAiv`(S}bHuvooHu_H z?0Kg!>~*$Xu?l>#LLJ3F8%pHQz+X?Dj*X_G_m>j_w}zH4Y&|WE>ln|7(Hw0OYMNep zrOHPs-Ov6o5s^RHHTT)hj1dsid7Mafted#JcFOX;EYqq0F&BVYxI*4Y) zS9i}*JzoT1&CSt5QQh0qT-#Wl(!KWMZCF?MPTUC&=0pc31We%_9`_|ok(E5-Pt7pl zKit*o%&&6gLYn%^x@6c#2hbnOn)+x= z6~I^;{X^SBu{4cL=K!OsI=_hNY6WM$7-E|H>2ycK(z^BTbxcZ3FJkaR$^g^5D$Js=`K`fvndP9>EX5JA6r5#Rm-azTF>r>|g=v zwkc94Or0m{G`7^e%dpgHetkOTksL8tk;AYOK)m8=>jxV>(|_Yp!YZ$Lvadb~DcBQU z-oZmS)Y*m9qTRM0++MJ2p>{kwh9k*L(CInXBP)6T4A-p>S{E$~W2uT-S}}?oKoe2+ z7aPMBZcxz|>Twbj@Ba?wfMCeB3&gN?_ct{)`)FQ)o10Xz*Lu+5l?*q&+H8KU+umx} zE-NoBWkLM)4{S`Kme0geGfFgH_$N7a_`3fZg+f&Cjz4H;XX`1_4%o5Cx{f>@-+0pd zSzv6|)H7fl*9vs0Xuw3!%ug-WM(IfpxV_{veRQ`MjSW!1nA$oz?zy*Ty)*#Yj!Z~M z$nN?(V=}-tVWD%(g0t{pWVRF!Uw7EN)n^AOv&+{{giSn5O+8pG6aE%v>+^^S7AqRg zqPKC)Jta^I*5wfPlG?0_A#dp*At@`owH1@!Fwpqtk3zvA;95dQFh+zT)CsVD0`EYAL)R&vxIS%Bqm<7JM&O9j*4uD9Q%POvWb`eqHlG9 zs(vQ(Vh~x@Njdp@%GjdwFNOao`nDp!XhKn}mb6xYuk-5dP=epR?nw_QUVB-@eH$(~ z`6>%Pe-8kSX#$hj$!0~99J9|Z6<}|amzPhTlDcWs2uK8L3YxB&`BQyL{cHywBmxd& zdmsnZgO9u_Sy0GKyD`tIQ#^==Qg^vsJn zfCxU%c;gPpgqQP-q;umpO_k@Cp|JK`L1K!vPXo71#(LI?TG_OGD)#djuc$8EmgzX& zKYlgGtWoVT-4{r*@>p21B!XFL@oZ_GmfEpb2a4a|c_`=S{iG@Smdq8dL!(*vk4U}k zp~G|$SylL)$@IlT!`IX3J-@W|23xf04<9l^MZIt)iboGy4%c)aum^Dg1WYrzcMIx@ zZ9lOT%E=pjemZ1ArPB%QLi?QqSdcj0FNoAx#~7W25qG6^kJ$ajbD6v@gMepaHEl4a zjSK1^S%C=onM)>@)&3i7Bs}TkTTSw?zTQa7*&HYgSqsJaFIOa<{ z$yf_8V^THTV#4XK70IkS#HHIq&s6$x3Eek3iso5i#7!Tc*rQT;HYzt)?zH%NYqHa= zBy)=LtyfCt`BbB&=*IifHB1eF8y3;exl zv1Csw{m!VFS6IDX7zo%s9v&Vxft!JW+viS6?X~m#^R2p*iVne{?i`$+{VYRSO0zF4 zZPw?uqB+Q9(WXDdMT0VHA)ww3F2jv|y0FJ~8}xxxjd;&?J@6pNF5LU~N^YcP9|%{D z?A0J;tbT6$o3dvScjphg1sl002qdw_o&4Yz@K0Ppjc z=OK9cEM-Pdi}Le1Jk3|@xvXf1ZZ)o(bGdaB?`uC$YP(@&km%6kCr*^~r5$Fqo34%q z79+j4yduXsO1zK=ZN?SF3b!<>%Ibz%6u@6{Ke+FQ#PR*$a1teDiN_VQW-D<^juu5` z#^p}U2ky%r?TAyxR2Pa}3;z5Gpa+Y7?j{%>&?{h6!RrULN{5@HU^U5$l9e1<+hGiN zWBQUFMZP1raQbW`T=UI zoB$e-@S9s@BoUXu(O0~@gn9bW4&92u-E&M9sKlB=7zOZf z!Qv0bRNu&-Qx<*VbXub)3r~`-=eIT?W$E;Bh3&T97cqC4l2CW0xK{|9p4u#>(l|T?!ZF8*xgmuu=AHEzrBC{KVNJXDuDNKp(@DU3+RO zfiV^TBeG>^-`LU;(lg&=|?#f?@ z+setn)S}0<&COw>&R0jW9ajn<~jZfj3gv^yNCI4#t_wU~kw})$AF2?E! zyNkg4z*5oEeX; z#Pg^-*{S!}vab}yyV|$1@5&nWlVRM01CMzscN{dY#5iD*H$LiAStj~KrFc{>y$ml* zBIM-CJ$hS+YJoZRbHwIB2dP}z5Kyj}dF#Z4OzJX=l7>pnH#F8F{l8zsPi+c6{{Jk1 zY)|OR>9UXH2?)z>^VSm#-Tu|1K$qAgR%!k9r=!T+GX1rxlUak z3B2HZBwYEE+5Tjww#E=KA)Qbacj99gvBWl;uob5ptiW zr_;e$?6nHt_hWMRJGIAIuaS7+JK3_g2B2H_+7Ldk8gsY21!ASCrNz~jl!7;kRpvOT zdaT21E#Um82mBr>IUn|c%&qS_RNYFSnE0t~?5-qos86=XyBt$EI3pQ7Ca@Qh2In*S zUF2rG*8}pt20K`IYIjNeX$knUy-b#cN`z%sSktD$^jn!G66#)0V3kr6^sRm*=U2 z$B!MNDEHrATjBfTnV(n4`C~As?o*e2R z$+ioGMR0qh4d07_nQhrt>j;E~VYaBHyduBu**5)zo>`{Wy2g4>4P`j4_$pK3bCl`5cuaT(Jt=KrbnE_YjBqkQd{LZ1a60j!_}^(kuwW5rhOE<-@oQvDfNc^BQo|4LKcm%ANk2MmAKgwnSqv1 zHDp;pdkD}{LE%@8=F!_hej@*|jT%+?F36r(`mg4ds3)B=ws76aj5;likZay52u`Y${gGNO6eP7&s`Wm2ih6eYl z&?H#A@M&fUri&4rxwBFmR+y7}Y9Uq`?utic?!TpK>2tt?niN~wSS^mnIyK+b@00J~ z?b=XGQizyo4L>?D6uxW2LVy7M)B}i5BdU38YwO4F&(_bn&IOCN>DPv%bDSb!(Th{; zFJqG56!10?Y+0n}-#@;r^mlGtU(CBw6kzDc_uf*_9(f)_QBZjec@vB>ncjLo7o2`& zN0RwCejM?l-$mEloUunE`A^@gF+zm`OoUe8H57X(BPmYlisUcZB~{Zw8P_(9N+F)q zQ0c$EBm)4vKkfswu=H`IFi&dirdlBBt{aK~f<_wsN9R)F{LSQFG`3*Wg&*Zx zx6be^VacpMy|mjfSbD|C*4L?Mm{8M905RjFSL3>*P5hAd7u#i;#_eR?6CGxgPNbK;2-?tk@l?sVV4KvTfNgRV2M5NQo7j0n?^&j=2O`|+(@jFyV4 z`t=VV)LdtR`a4kWUpYKGOZDR-mi{=^e#s(n_h5Nu8BF2hJ<8K1I$$t)T0LuPk}P{d zS5sC|F?_?rqNJqmJI}JPu<%zshO^CrrERe7ks=4sBw*ujtE-LhGQ5P!@-}9QRRXv; z3#U#^*d%8+I6H_`w8g`@&p(n3I$ z4qjM~f&(zaM}zlt9Yu#5=3ZRRgP7S*Uw~}mEB|$^{+Q&8>b&3iP*vgj_3IE9(KAJ^ zj8%+0xhloBE4~*agyAu!zIqr`;`L15lm$x#hZHa_DGQv~MZbf-X$y6A8Uy>ZPZFMW z6Cc6|`}Zc-V*0_!zMT z;4z?hozH%#pW*(8H_0LoPsK71xeAi93{^tpJAR7dEd;=I1+;^|AWrf2&CkzwgSZNw z^zQ)QK{Dc1*a<8jKIK!X6JJ)9Z`#;;HkwF;YmfbzIW3|pVjx>BG2$rMlphYl%~`7F zcmIgJs-W9ML`0~nszNG)(Ku(g93K&jy54~pQKh&KX+_q}4P?CXyO-iYq9Xm9!PY1ycNZHAeM-&>cddx1 zs!{`t2UPw7sdHj>G7=1Uh2kj$0-8S6>e<1F#b=(;P#x~- zl|G=lKLWFGrJl>QTjqB}bg~#0#?aLOu;0IrCra;ysGYsBzQXhl$LQ_tbt-}d(g`Nu zSN9E;Hz4cncN7g&sM2N0sitFh9Pau&VJIvZ5|%xtI{QL;PZfrnMds_hlAo3K{?z+J zDvQlGi#Ykp+(k0Xh2yFQ;6sa*vM)ny^DDM7=z9!`+<+eB>-V z*}4dj08ms$S1``EUGPtDGyCBZ+eoc<3qAWn_QWpEqq=}tQ?FOxJu?4IuD|v3z;Ff$ z7JP&d()_=Y6j9I$)95->&YDLs1t;%Ive`-c{{7A*c!FFrq#)9f^>31`TkH2C-Io(f zZA8UCoWNXhd@W|3HTrDM4?yj;EmigfE=wid-# zkGrL1ey&~2L&-HpkwqKqmDI)bGlvNBXgL*QWs~C=8 zNbIPq_T7^3y=*N%FouksX*dCjo@M@wMWW$yz~~(wuhC8FBfZtwH>_3u$rm%l)0H{$ zsB1G#O-qn zUYL;nQW{<=i(u45U^|nU9RE*W*F8Fai#*FO`u%IEDU>CG3Sn|XD|(3g&@&tgLJ4@1 z_1(LEaXlG7ZL#qFeULviniYE=b>C#9)|kPJP5vj@aae=ck%~PkBMoK~-8l8CoOI@iw_ERI$89V}JKG%fl3R3l##qDa0O`w&ky>Y$%k6D?m z{L6V)t*s{p2M0@MOxL;aS5j%s|)$%~hDrASr+sVv20V9TjdjGZ;W)AA-=r!CW}~k!hAl7Vq{j zyJZfUo}i{4sQOc&nbls*(WZHUO09N;BuPLGo=s*r`1_#)7EbG$BJVE``LF|yE@v)( zJq>f1(Y3}@A6v=$Dt#pv*wivTDRW75IH*q>IGSHn6mQGu+M>AWBHZb7K4T6M<$11X z)!8l2{-M0)0Ie(H=X^jDrA#m0m>HDMHgr6tQC(WvLKxJC2p@0@wpur*HjYQ>m<1h( zq7+W|WH>oHN3cL(H!0N5p)Ki?G^7mX2U_$#ZGcPy`Y^{C5bB}JK@;cFOd2|ndE&?b z_=h%@mMvRbnlSlM_5ek{-r~>Awayh2Zj+stIi<@4B)sYkVfN1xxLZ5&>W2#fP2jDN zvY^9$y=6X}!Z&toz|0(zc`??s+$b{`GzsuGaNw9;@Ox2kLDU%i7 ziZYFj5%_*bH<&O8mHnDF4cy-_4is8DXXm`Knwmj~K8|nv&Q6~@pMB!{yCuy-lV0gx zniZPR-HoV+U>Mpfut{zkKj`EMTQiot;1OMgj|-I3?RbITQI$i`x4bwvRQqiOxCKPB@J2^sAfe3?l#)%#I=pj}X?wUt|H2?3Q=C4(tNhtd z&gc@Yd)=rXCww7!0@;({a*DMfEdQy zU^qe13OyM+z&aP->`5y9vMn>1_)O!;jPU7wW^!?*pX z;>By4Ukca50u&dmilUmK-79Jsl* z=y7d+Z*U`vL7zx_?AS7RLorUm-k(~=&hvUd3%GyMOD>fMmDQL2yBg%E*I^5<_7&fq z#sN~bZV15gFz^G3fgkRr?XjXw*+#Agcz)aRd^(C|+hu|seB`z;fjvJ#d_084lP<2G zhEBvfX4&qpsG_2R{^-qf@>0uBcICI*8uwS8#5)OlFhq?5_7EnUU_Tk-JqxEP+E4(v z4}a8$Nmum^Lq*?BJ2Vp!HrM~q&8T3&Le#^89HkUGKJIXSilQVFZ4dcH)#!I-gsfw- z-3wo*Hpbt1{+8tjaPaDM$f5!vp1ekJ&5<2J1DHxYN!tzKz&8yITnNG9`b*fsMPg-#zOm+U4j}X2CpxDThf;+o zmv5+94(d$qQS@SVM@0pU9+nD-s$}E17eFolJmrNO5MX!vS*y(yEq!j5TCBs}!jeo5 z%+U>E-)#{mdEtbt$QzDJTL*V*ZSKoZ+p=-M9@ozw;=RNKgmbd6%xaHeA{nvg$^&%w zlZgYKRPBV8Gt1B7qnj;Q{$NBJOfh963*WCQSI=+?&;?(d4{z=_tBv@Ye5BU8sDt!a zz5`t6d37<1(kM^2Ri{Jql##%HdRQtFAUNnqj|hXXMBQl`8Ei0S_&Ojz>04+0m^KrI ztb4wMl%revd1c{=Xe{(u+d*YWrf|3MT)uLJp-ts|1@jVofhL7 z|9VmugzrF&cOIgmTTAH9?2viop?O!T?tLf@s;ZlnkBo}~2!YTC6WWWe@umG78nh2y$uN91fTmz$`5}5qFIs_ts1Eta5mCxj8X+|m? z9sq$PHy0jepT|OqB!T7|tF;ye;W}})8*gvHEoM`h>|JuD2&1deUtkI|U^dg7Y#+)|N7gAR-DgXST%jeis(+)x)Ln@r1Ky(GE93X$^)be zS?RIJdWhoP`su4M2vU2Yxfa{@Ec-+1$gRt<$x?-F7q}_EfB)W@?RLA974AwaLo&cC;fX+>Axc8z1i*Nx#Lbrlq*_L6H`84G$)`XZH8*bsq5A$vHnT@tviD$l zEWPSeC2XFOihIA(-qh6yGI+Y$sq7leKY)D2uWr>VwHucHFlw5DPuw}Q)sKmn-s@?# zhc1FKHEvA}mQDHXUGsjyvcAE($RJMuw#Emr8!LgonVSb>;$igs9C2?gNj|2VkkU>k z^vwe2)CX`Ir|D8Z+lgs`W*~@58r-dod9T6r9+`YaeFXkVdZ4W2?7` z4sfK&{`PGy@`9s}&oeTE!im6{sspo&e#}Fg?Lwt@j4hX)wr53_{JQ7;+fb0dUJNLl zhWHp*%P+4L7`^LVs9W|cskl8d0bGzeWeXn%FV~P4L|2wHE%!@&T?;AXTB1iZgyvxX zDg=Rf)v$~6;0wo>6m82_7KuN=Sb(6_ zBkH|t_S3vFtuS@g?Lg$gTzCI`%X($sZ_iWQ&-3$~SgKsXVgyTN{r9W8H0&d%n$>sv z)3Of3i8!-j4(BTH+1oOJA?4*lpUDcPm?;qk18IiJjjBb!1 z2=s)xmv zPe+iS*r=ZAJZ^8y={I}(6c`y+MSE^ezV{8y+ z=j!Sz*B068EsG7AT6>}=>X6}ovQOL=fP@J zT};lV716Nwd0l*+OPizA*-*B`35 ze7Pz&mvJOZ>81s1*Xr}8q~=FMCLY$~cRCT6BNc8HaDW4{u-zVRU2_|&J5G#koQuZ& z5rcxu!c_{tiaWgwPCANt1uAhc<4{Io%BJ)~&V6WpxO=wX@7I=s7+Aql0m8zHZ4hXH zAqUSlrYhxFQ#fdOh2;UPfkiDN*D#aUNdqpNQZ#n9755_(l_w$TVyF1$4F>lOb3M^v z{?XoMZUAYdEF5$uP&0SNob0=a>O$k}sDU8W8S?%{?Q3Rti$R~on8H+uxSW@1>GNGL zsXO=Ak4I^cw?QX&#?~Bd$4Npbgx3K$7Y?>QhkT_fw(U;6N;9f^=u261^&XxkB#$x< zeRl{1xVp(!5mQ7D`fb0sHF)`q%4@F>`x5enlzq_!t;{f?Ifo)`Z<~#A-8|3 zuJAbP`d|OHK2jJfoCO3G%pw;(l^*lHFZ{)mEc|g<7W0>+@{%3@^N+6HsnP~FzDBc^ z_hEcCug=1`J8-EoF?)lPPz=1=I&mnpzB{;EP~r7MxCgtyKrxVJQ_sU}-eWJ(hX6af zgOLV2en)PXEY-ID$Z;?7h7rrdmXs^z=I&!{`=Q_>aUENnB9u;Q(eLb+JUU3-J8+09 z&b8v)j0nk0aJ_?F(i zz0s|9Fr*|r1r8DbzqCk1-#*EhH6N}`3=LVi)CMeexCd(8F0V)+%l`C?h`;z@?0Air z85~*2rmBhDUc8+A#HqQ4lOnn4%j0t^=>dryWBQi?Kw)y*^15g+&a^&9d7$OM)CD}! z??Q&vzL*22>GVul+T9ThG-yyW_&jNGyMN&%W~C$*tudN=YnS`(sNm6V_g{}hg(==Z z)f6=U-ljYD{OVQQ zReqC$bQ9$FQhK%8oP~t=A9uw`TZ^*Q$mQ>5w6#Nl>I`pf>YJO33gLqO+I- z#(avN@B@f5fj4h*mq$~E4LrM;_2t;W zfMAuAt&z}Fw0=Qh51sRhNqvIDa}k-@bxn{jF#`eu0+127!!3Dd{ zu%tt9g|q8DJPmMQhvUpC?K4-eU2BREJO(Qcg3a*oaNhxXbkjfto%q+8@19Q@{m$gt zE2&ys$f10cbVGIZN5^ZW=0*;$O>7kp8h?G^rX8}2pQvstx#2fl6gw-u;$#Ce4375RLU6)6%#Z~n6XZ!MyG-;3|eHW`J$^^L$22AHcDu*al~-GW`_ef`0GwSr)94k5frGq zHzK4Qd37PnP1}-L{g`dCfXUzH?dHhydX+wO1wl;2=B>@#ro84)JOk%y?Sr%{!Q1O&h&zgwq<`{C>_N>t3}%1H8t%5rb?E*)!DOJ zQeR(qHSxcgc6m=hn`h0fWhtw9Dpx9}tC?|MGMZ-c&-`ew%L2gzf_wDt^myAE7ES++ zy;>b~--9RPnmJ?)hC~bsR;y&0KV=kUG|1b2b0$TfHt6yz{P)aTWSLZXd|-Wg(GT)l zttF1#Z_2!UtsXP9aiFejyZXwb0H#|A5F{M#uW z5N}oQ)UOU;+();EEb-1b&sXR0z|+wW(b#vW)9x=*LW4>gac^^RsM4mW_uDJK9q;@2 zKoe>5vcjKsyXd@X_%O1&*}`h%!a(KY@M6>MIa5q0W_tr;)0{yZ#x(@?EkD-S#wQcu zr*8L8vY_Vai-@z|*Qdee2&LV)2i<2n}E0 zFHnc@e;U0wK-cBhp}pH%*emyY=@znGYkgGm(TuRH4go?&z;@|b8TtlX&ynBZkj9_< z*w68r+bM!l;XU#l3Z32VaJ&OpHLT)b`9>|c!rnE29_5_+g_c$!-q%qKzCUOoGX6bG z3a{5yIhtS6yWcDXev=|3Ixw(Q7T!9?q+$Ln1V7>ExA!H{Lp_Cg^)t1S=grO4o_#`N z`~P&J?wxk*YJ%J~-m7_C?X5FW?$AxdW6rTnkD1U+tz&1Aesu zyGO^Q?GyB`=R6$E8d*yrPyXkmX>GGf%+uI^LZKXrlU=ohbpDIN#p1j`fv-so_D zp82I#2|tX&W*f}F@%FtXc-N~EH&0x=r0@(%PvX=RNRW^x0pB&DBiH`kzeyfJ$YSQ; zHOy!=2sHhh^=)dTrVa%q(daG`crM zwFoOsX_{0Q+CwRWccOm~RIQ4UfIQ2Ilf6@(PUR=M68Uq105|_7Otd6KvBETh9S&;7 z+ECZ9>%-{Y)3lp;+bIHz@8HzcxKj_0kUq8a%n1i$oL_$f9H zi|{1sGtoNe@3U84k(2Jn&3?gHYjzy>l_d6)v+!Fag`pCHGzeUm^WH7{|DK%{i`MqN z_fo9jI%tVOhmSkLpoc@NK(ze*H!s%cwcZeDR?M<{v232d4VkPrhsS1IC=g##?|xfR z@wl@$Q=HCX(s$wje|;UZVL~E@8{|zkEveF4@XL7*^cT2 zp4f$$>R7Vd{Lkt$O0(oV>iD18*^G-hFDOop%bP({JPD%zWu1(ZBG1E#&&tx>bCBJ( zbV(rJc&In%1_zJ;M!-@8Bj5=DZw=0n`&~`@#2h;c!-c$gUaEJEKvNpf`}x#^p+)8J z5YFw3uyiRUU%w@kP|o%&f;)#B2|#BuSQMJX1SIo%1_3-UP_it$#WCIeY%OS7sc+h2 zNS4*!U!DJdG+kv>m21-mL_!cL0TpQ}iA_ig(%qqSm(ty!pmcX5c@XJt6s0zeN=k}= z2uKLh-)!FXt>yW1RAfKg&pk6&&G@%S zD`zY7A4JP{1bpk1lO%9I6u#s=3yM_gbukrW&+P#czx0 zlr>pqPLlbZg{b}hppz5TLpz1`1hj6p8NlVioH_0hM1%PJ^F8RB>s{ni1dTHILQt!j#w}^-pxIgI*4q?3i=?=HH>_vP#4sW?x%#SeWd!a|9&rMWaMhcdJdN{@$ z{@U5WMDARsjqCT&BkDhFNRTLwZvHKlMLK(SCz2^wv*E$qla`q&N!bhc+|>N{x2=e* z9OCTU+*J0(5?a5Rib4Ei;vsA2o1&VN_A-JSQNQSmHt^exRKH1utJH!9XH)1E4UB24 zX)g24uA%pos88iSTb|$(oSuP59hg!}-94qfpo&UhfY0~e*XLe) zKf+yfUu}(C{2mdA9=@jnKL7|l0)O=SjTM8DeSoAXd&Ns8j%9`PD7+c&IZaKemueN8 zUG6mU5`jc*5mCA^He1%%^oNUNd*SJ${2Ncd)HtGGF0?hug#g)=cTNflyhv`)34%$T z=PPfNFR#b=i+4B%KKoyxY`{awS*yCB_I0db=ykV@NhFPW(X5;+}s<=uyBnP4%tE*V6CA z-&sm0qOwMgqlG=;?NzNEo_|qknSmCkCr^qt?|)=?2;MYkNT|?yQpNUo>i_In(hBKh4_1KhaU7huMXUn(ba)wNMJbK&7Pyom)Bm6@d-8e0<-ukA1bTH z^!cjVVwECqDiSW3`_VG=`_T*&7pDk(Am!kV^le`A&MNsKF#I%IMONUxiAQoNC$euI%ydK0dU~bX4 zW(SqhvcbMUjTr`I2qRIfrgM6ClSohJr-Z@NdQkqd< zJGGSFi~M);BO)p3GGFTJ$Djrn4Y1Ds)0dgC3#pL5PJM^wE`O$SHSw-a2_e8o!E8uC z!h=7cy_P^%Cq?x^^?F-_>EDoO;;$wcF*L1aI!?D+zwosPdu}5Zj=Zse5`>c2jUY3- zFyJe(x3s)2EG#^CocHzl(%<1j$4`UG{4lwJDxxM&3_PeG5kK6h4JRRk4ci5rSC){* zRLMMG%Eunn^jey-m(u(2^!zomyL#gbiZ@wqayS_%4N?flEZ5H+fX+l}8IgPO+opz- z$60wgws5KRa_t?9q{{TIy5NXhYRx7%H$EEg5t3iA*1KO(_wuLnWk5>m{gaC|{~=rV zx}NjzD@K=eM^Vl#K~hhO_4!^hEgXTQ!l#{ToGpC(jPV$=WmP!Fb^UK&h}SNNIY8C{ zvk-W9*7gnbUmz&{LCxa*ysXG@llU`5AnAes@n6L0?tpUecIjOHX zxqjdFT9|X@c+*W*;fkPRR(nZgh{#SM|x~mM2SO|@;w&sW}jV0fZ8t-8j^-wgC2F{0L~p zxF>i8-6KT$o4;F9u=CpNccZ}s0EkNPhu>a1&u`>K(_2}X_#}wn3JL*^KC<6q#g(%4 zP3q!Jk}aG&Sx05uE*TdbxRo00_epDQGuq^fCN}cYIJ2JBm79G%et7odDUHnq9kj9Bko)|taNISrV6C_DsNZD&=E!!tKcEYIK#-L6A zFu|nDRJ%fr*#to`XkEMosZO2sY@2x6+HkERcIG`3@tfAX+awwKEq$B+DzJ%A^4{4UJlxVp>m}0x@ROo9?CR6K%+7APasdA%%fslhMN|2%!3T zfEdqo7;o@@WM7mZ!3zk(h6dvi%Bt@j{+a5{lmc4h5G)CI1Mp9>-2T8dnM1N(N{CL* zN5j{zXco!6EDC+Icon)4XBb_nu1v@AQiHk(wqmT1ALV=zbRzy2O2i%h-VGfcF*G<& zhOlecRtAzEf&yDYG*>JEH*6)XOjffbo91T(p|j7~UTUWWh)Bf=^E68TBp8!1Bs!t5 zj?v(F@wo|5N=(#gHT6BMFfe6cP}Ly((#$GP3?&K*71Wwlc#<6lEut_1B_yP~_E0#= z=^v9>2}{EFTq5;wL9iEymukD z3)mXj0Xw(ZBImQ8nU0@I=_N2#7-}w20&z=D6q5ozVE*Q}=afk%!<$o+J zBP53F7F($puxui3XzTp*Nu*FY|9~;7T0FfVPbH^LT9GTSj0Hn?6#b7I-coEbC6njB z@}}d)PpG7hpdgFs@qWg4rr5Rq*-G_{w0qR;lPTuHUnfg*67UkTx8k_Be*YP5Cm%4& zYwfRrmqg5Quol^ME6I85ug@rNv}^quR^0>tM*Qx+kVcAnn$4Es&8mH)Bxhc^`f;ss+6bC7{U>egxqWx)4nduh0QRuOLwb;aWf{O%}LxG(?0^aGDQ zud3l>cIDnW{L=*|?B>9670pk-#@i!cP>dLJ=(EHG;iYqHOnrTQ_>);D0jYXD>5>Wg zufggeVQim-ciOszvSad0!AL|@KoHoC7NKCMIp8DJ8ncW>+n+rrUqU=lE3A8%Ro!CIV0d&^pF`tv9G($*R_eS@cq2T@)`^4JW;svcq0+Ox>>^K-oKp75#`8ddg|@}>p3 ze%(20t`bPbPOaCvi-|7AQ!^U&Bui)jho=X)_j%u)_7Tq8b>;8hBZyNAUwRnwlce); z-wvQx-~C#{oTiv?0fG|y9kjLpp z@aX*~PWT6p!nsX2d)PYl1^{?sAI}FAS~+AO_p`(Ac$b?!57i&G+*d1hhC*7yRsci# zv|WsUwDH+8`LYEO?Q+t;-oP{2p8^EXe1TOMP$Mwm3N1xZn49J8DaP{HOBk-YpYV-N~+~N22#)gKTl-#QbFOc}YmUyXX1dYVDExb@J zmUHWN{jY`}W+xx}HY~4T%&zs>o6~*LLO86Y>wUAJbwUEmOZX#X;7ffj}hKB60=*fqLHgQ{Wx#=FSpn z4c~dLiMag{j0uM7J+cpt^T^3l*4rRx1y#wZsKMlU_u=-iqee?p?ccxd^I?`5jGj*^ z43GM2KaC!c9KDejVgN~{DFw(kynv+~A62R_Y9D~+o8gV7V9LsHtZlnOiIH*50a;)Y zg4q1`+=y0ovcU3sNLKT`#~k0f(zvkXQ@G!f^Vt4yX%^ew+FF8I2iI}h>*zsUf^6M; zak2VQD;j@R<~fgdVrSDzly^&R&J_D!*5#0MR0;b5x&SyFh{WM8bT^!9amPamHPdH8 zFQ-QWdj8u~$L#S5C4M=3c%mk#*qZ=|U=2le9XfbOPt<@7$xvI3c{#@I)-}k7mQwh2(lg8qKGB ztH?o4;(?3=vdnzuux{qRN+Y(7MFKG;9m>kJ0=+LQ#x6x2L!D;wZ0G(J-aIM3?})5H zaV#7#owB~^HhmX_YQuhm*B9o?(4EutdCg+~00z!4c6{DzKESR4J_c7RM6SUz-WkWR z1M8Cs=nPVkyDpF1uMuDcR|h2YKHwg%;d`)wumxk%|HyTHtc^mK<}=}5XHiYkV>v9I z@^kl}cN%bWj(L4+d2jCYBckZBcWhYq-^(56BMVmMd;dNLnT(}RJP5V|9dy50L$92( zMw>f=5;&o#KSGs9^4$VL6K}-`^0N8Q{m1huk9<}J3VJPP$ZR`QPfsRZHPrF=CtC5K znYg<{t3spP$`hYV5Q}>HEfwGs z1$+$rC(NWOgGqb)78Zfsf(jwsO9)&IAU?q;iWC|Vil9SC`aLSV7oE94XRYzGy{&9h2(;90hN`!#$}1~t4LEvdFFidy0ZU2Msk&#qNJ$nc zjp%`z6!Dqv@bC~wuZ*pfq++Wa``Ni!UVO<4Re7|J&XgP&nREIvy!F}it0PEfRV=Vw41^tSw0IR$x)^g_7!}BQxm^36cSwvF|fKstO1Gr|*WK2;!2d z!8HbpMPYvWG2ma^37IsAofeL#ze*S}YxMKEH{`z;2&_EVZ8}$XPY7HKaNcY) zP$qn#cDFVuXygX~NV&=K#jlHEMT=(A9eN@1IBJ+M`~ueGt)NY%?1iBOrW1h6V32_+ z_}a{Sea!iG|Iq##zaOtgc0VU2M?0^5_!7>fEA&+~2Getd_1w9lET@?A2IFJ0|JMTC zSeJ2Z!4o`Uu`&_poa>cdn6uRFaS{jt_w%X?P}-yJkN0)?_9C>klU-lHCx-7TG-A!$ z&kwAA)J)RqKrvS}H}}_Kf8u|8EuscjgF@xAw{Yo1Qb6|MXwCzsO_5wqdzGm=AzRy2 zRi>d&D*6FpD)hK$_}%{`^X7{Zd?!hdgqEFP z3xL6bWVOMoP2cr{mO%KAXVUa^LpAV3zU=FXIY(-6u`LBY78(Ihe!+gM+u88=f25cn zmKJ$HZ$R{|h zeX~D2IIbPU;1?626cY-T3!6If?YY$wuL{1j@=;-p0 zs^ea2&{O~VT4sD6czJvon3WNI+p?f$^p33kkp;i_A+hdtyE=81fujCZmpR5aXO?gn zz>(u-c^e&L? z6_Ilq$yIEcLHHB&sL-iKaS^_Jmwt9bNbBhlR6 z4^6Vav6qO5%ou?ZE?HUn&Rix>=#`(76< z>~tgW0r>^=7=|B8YxTEki^SB4S;k z{mBS?@(bV3&V$~Ir7s(z>)ov=dSZVlum$+!Fk-~ZOioUU4gLDTB<=hw>?7u?I^9T* zbC$O!4iTNxa02tAMK$c@Lh=Idjsq26mY$H+$E%GwZf_SeVzFr&S_o%87ENG#d% zPJ_K`5H|-H{8j{Hxz%)|p4Sg>ihpSr?*C_k{;6QWiP-t{Cws~bn}Xqi_ioQL-b4r7 ze1*1faqehr^;JK~0y|8Mn*(}Ae)$y3C6CIi3!0ze$JfbY2?e_sFuAThk_% zGvDadwBDsn8A&W1<7Fq2G@0}12Zn$?YO`)fG#!o3eA&^nQO9n;~NDdDq?v27B z3azfL9%})^&x^)cfF!8vpnH+!zDAhUKmyb`*fq}V?%-qny9kw~=G^oG)K`h_euKQ% zbCeaA7hIIcnyQAHj16Lz?611EQh9qeq|(+OHA#XS?oC$kEI${B>7K2fP{~!TWl`EY zhNs7d{Npb+QKY_%uBPxfcO=%|$n9Dh=3+SE%hkQl?^z>0a#nThxVrcgVrD(eJp1q< zRZR9$%mD2?MBs%M2jlXiEiss)VTJ{o*E7&@V}l%;eSYXEgWDRfpN{qp`F-ImvS#`MIh(DUy`SS z=t*pG`_2kvE&`M;&F?Hq-PCtwNu|%&fIA1Rhb0fTecig2_K=i!5+7O3;(!aGZgSER zQ*-#}4-h(^DcF_JNm1S?;23xtBxrNMt(=(p}A}LxHOPP!r7cV5}pUSpy5U?9*TxBuwxiBx9 z?-fLH}h-fizU$AOx1N1CFNc2+k;hmf{=lgtn$inTJ%Fg4mA166zcJz7C3PFjl z_@vdFzO7%Lc3$Q#(03aa@`ese%;l~rDksz+Sk!WH>b|!H1jpYM{mxzc%1yqHYcu}+ zzG?=GnzlP_A)Zv2obbH&+I^Xv(BKayW>1OOyo;md{??^}p%I8W0Cus~)0jzbSSS3+ z!xKoB_g}bdd>=DZAR7xX04S??#=@R>MN}odd*`(_f4(sC2_YImNAc!^qnuW7_P0@Q zs-UPf?{sW?H8By1feoXH@EH)ePr6TKvRy5ZcBr@wBjJYmLOK3M<{ z&q9Eb4i#y!==M-}lU*ew%rY86cZ1riwIm2JK~n8R$wa~z(1b>152bdqCCjnMHe;Rm z^F~{_yx>Z|e^%08OWonRU3=(Y0ErbymHGRVd7qDDluzM|euT%Oi#CYsjpOA7Kg(t# zKZbol4>B^_b$d}O6lEV+{#tFM)A$KNgCa`CH zhj=m`_tldiKB8w03IDy_h@<#7gCjy+?C?ZWtBU#O7VX_<7=bAju_e-B-LSH4$n0<|mWr9yA?7*;Q`L|Pw@_E*7`jm<^ zo8sBonwYh2s%n}vrnr;T8?ZkCm=C|8n#d)DfSLj<#js}puginW+VJOf%=^7BVeN~N zN&*c5-p5BzwUdJnP%hGWYt5H@8e^&i3WS(=A8Zx#w+l^Zi)ind11MIwDIG?L&XINc zqdzg+E(G(5$(8p59qX)hZ-NNifyx;OK#@rE5q$OLfg%8rs(b$3JJXN1ly&3 zo9);;7b%1^rM#L7j$|aO+-={u`EHN;$Pcb-``4XsV)}2T;?HBxW401Yi1@$88_jhH~Y{1?U_Y0y7gt&W=H;79=2nECCuBAQ!QMU)l&Y zNx8bPh0kIoOQ}AW>B9I=2)dn4>{2&~($VL4sBuk}EuB~3OiGG+R@l#VW6H**6Oe%w z%jOw6>)Koq>H4yP!PGd#(uiA))Y5b&GFI|?q?{h9GZze((=#)7KO&UA2YJ8GKT7f? zNF=))^*;Moom5PqPbv*1^&a2E^+z}u%q`VlvKpN4pv?2Ie`9&3{smePh$jmsHiyr= z?d|Lk@(F-O(s$*BnF~vE(s%Q*mkb^GSD0LF30tD;FKIt4%^Tt!qAwb==v`;vBTh?f zaO^o`(GN z>lZ5w^B`Av_YQ2ApUsFMXmr~IA-75k@MkRSKiEa<`2=DV_$bgQiK#)y4fK`?;9elS zUHn{@+9|&x2#6mI4j2am{z6-CBy#(MVlh-6gCCdC9n2nse4my#Ne zmwfMNZ-q)i;DcP&0Np%>ePKNP6a5qDm_e+Bbj&#Rqk_gE)3GDI<@@#o@BBXKy9V72 zKWt>t0D%L?8^)-~pA58WHN+>7t~>Ut&bs4Sg+cSj{}l4yvF@&Iv*8g6BQI*BbomzJ zgv5XDM&$odu|gxqm??Ibq9A9oOkJ%lz91`Ad=QaO-zEalfv zyQXl`U|%wz-vZ)bFdZc;tZL;~;{5r2J-IUSGaXhidS7HR7Zxmp+B(uew*!n885(Ey zp{a+42O&38nCKms7rx@ph@F46k>%Ya|47S576}_9w4ZP8 zmWZ9R?E6zYQ|{y4JGO}Eno?qRUyt7v4iYPT+YS8XFpPjo2@LQ|+Ku~DoyY3Lr45uI z>Paf!L0@@7Bh|J=P6Ytdf5#(%!;BdA&=bAa>C2zfOOV+$D-iYct7i-S@?UCxnA_x< z=YoGKYbcyY&=>&K48jA4#?0{cEjl1_!)Ttc`^ASgyr zG#4^q;dQ98_hrc>OjvzgOZn`;v1U{>8W$;^^g4WnB5b-;jJR7%Y{lrsuOYiZ-<;Jo zk%id1FT=zjc_Qp7qdYPE_%*(oYCig}=GEve!V~moq>@h`VdmT-`)uC1!ae9YvY+>k zbrM^X^g2XGPVfrkMEX^uiQzAXe%SFi^swHh*i#=VXx>9~mE0%ifnx+4ZB3p8@Pkp~!`m>6oqPhx7b;NU+L@;D&!p zw^;8IJ+da|?~{~?n)US5>p%fR?89aYG^X$Gl!dKE1zxNLUX*XPKk);LXqVC z26D~||8F~&f4(1WgN=X*b6fV_BD|&5&!n!pL4!oakT8qUbXc$Ax3H#RtSjH3ggNuy zEH_>#NU%hLAqoUAR*qkEbn_9gnNS-3($!Kmf#?YqvpuC@sFHwfz}^LOSgg^#-)3C$ zHwUG;GNrg7AB%hI`krp|3I$kcA$$;mwks<^9*FwhfurDA;HflhJ~?(0@XKeu0o&UY z-@VMzzj7QRlwEBNh!EDS`1@4N2HO+N5qY+H#ZP8GeJ_AfGT_Cy%T&_=?a#b>aRa^< zstgjJY=CWu1juu@!mQUBg5fFBSb)L<5(?QR4?Jgfd$CWF0FMlpNx!hd1?1jjTu zO~iqFXb{cLEv4b1r}pHzNEurSp4>o^oG~LKWuq4 z{syP~Be~Kqjucqf4$hREXWQU^;8pGhoAxu8og~#?c}R@otR~_gEG$AjQfij$Ok{t=2;fr<*uegs{`f_CL3bQpHC zWUKXeK3&n;%D1nSI7Cc%sMs?29r8NdBgjcw@;0h5-mAqq}58R3a3Gr01%cr#&Z)#CRh@TXs`P)sYvUARrDlclnViqMAl2a1zXhhMl#rLb$q(pF}p zC_jF|F9B3QGsPR=#DNSG5q~mG#G055COJaum-^x9)2Ggs z=82X?U%WFqp6;bZ9 zvTdnw6)e@2Q;0X{1JrQm6ejPcfWH~c$sDF23bpZb6*8^Znp`9GvIr_Zc{cqcl^%OW}x2a_T6=m)fz^8Nj zYR-Dwk|C|@kAJT9xrOe}FTuJ&7+CVzV6ZrD3Bz&h(lDHqAMM7!)qDOTb4fegui znAVB5h*&vxsWp%ayJ|Amq9gR>XnQWEZhn*oUx z*7fE4G~7Ob;cx6)ms(9(=)#WDHcCdfDTI1+*f$gdYpDyYC1_!`AXym2X+EBWD5ObopQ7;xLro#WT_6MxtC zbHKgzQ$*pFzJ-c@P2}HLSZJGSre}T1_q1|SA62B`YK<|!($7DFp|+L>XzbF>2N;^} z4=T&cmyVI-rRWW?)sKlSf)3Ii!QNJ`)0|rs)?ah0UqugDvkfQViw2rqV5t_XU+2wk z!e)aQPg|19C~oZ9mLy0hzuEu|a3lzC+KtxCra@JN`jO;|WSql^J&$;zPd14DAJ4Od zLVBZtJ?Dx&T`q&7=;vgGlMk@%RM*ah4Vzt78zJxiT}E*@=EBa=f487Qww1T-lygY-s7Am@yQ7Vlmjq+2&+Je6e6YJO@N6X)Z8~n zlXm~@=U$%e+U8{MN2oHs?W4@JJ^fl4@Yh?z=71r)A@Yl9rp`jdL3m2`rOWtKw3W0h zPthmGtRoHBj@JVTI9rh24tWA2J#zR6-urA3MAvEYl|$+J{}|pP?w-oEb#GQVY28l> z7v197EPhFWpFnr526Jc>UH7AjP4}QKFlchMo0DH|(pZ_OsUTC+NDYz6Yn{s%Ap;ns*ui8v@Bj5hh&g9T5--1z+ZmAJ?-rv=;@~u(S-i`%;Vs5D)Wk zW8At5zldSCc#P;NhNMV9J;6C^z<~`>z_WaIvkvqRE;4pb0r~>P+V6~F+p}@0wt6JT zPU2mR^pVaxnVGKH}S}0_yeYs&+A7w-2VL5^%1%< zh(zQ&#eXrYW`_JW%O6(uFyjg-9icvAm1d7t+f!%YrCUF+-3Y@@5;7LVmd zkGO;DmjBZQvQp&_&?pi4c@U*%Z(09fpkO+z^L)!uL!-qmUeLZk`DM=9{p0Bs2yLkngi5u`&o!wg5Z2aRP*z~53l$hK;?n83(FwsEB#d! z&xTn#Gjc85p9tOqXWS$Mj!;0OfICRl7yeaQ`2SjfN~?>udH=N!YwD!_pep4w2DPd% ze*yDy(Kx-1M3Vt(!Z+}d($=onNCCL0zWz0U&ITM$Z`b0c@68QitUq{7uw1WBC!yS6 z#`Ix0KQfjP*-lp+6WB{hq}-nZ_(4Tn<>pCzg21Gq2WJ}G9n8`kp@(mEo+_KNnT_4|dJuc!4-Wo*!;94iuHQs0gQTONd` z7TeC*hH#@ZJil&=pJ~%yZmYd+*`;bjKm_LG3$T#0Bu0pd8AIPO} zvqe_!;wrC6lfe6H(Cl&@r8YnFu0YFI(Af=a&|;kCBj_FWY5dh8u=&N0}|&?f#2NYpp8opgWr##4cZUCO+i7UXf7hX*(| zwf3j<+|xNsrr+i5-uLJll)jrG(|i_!X6NV`ae}ga!@Y0?h?K@n#m7B|c%HvL{tm6a zT-HK%-Ai%S1R^7la|${`NV#*SbUSTN7pp|&yPa}nAu9Et8oK4$YO2Tra}v&rbCxYTG#_`QDb_SWLMUj$*i&NM^r$jaCXHQ-&Yl%We0Pjz&>df(whvBzqp z^4iwGU>IyAsURM(x{tb^yAe(KB9_N)hHL4M2AaYNSI4}gQ7NvS{U3|yHr^_1j=6s? z5VHSrM@qL*IycA+Ba+a0ZwAi9<@w*s!kGsO8o(fT0fs6BpY{f_MvBqzl{MTvR~v9( zaGesKN*!Okn~()N)KF@tdc7xS=8OaTA{=TUgCj4$O^cC_%cWgD_~ZKI(RsHLFcC28 zf{bm}cW{|;u#hE?v8q~#{WCkm^%!EF{%@-cy^$+-1>qt#==H{tPN0>1g^wG-Kz+<} zE{7jCbs(g=a^N+rUn8*XKD^hG$hVUwh!;RX6DA?W_Qo__jrX>{FPgMwb!}tjjO!IT zO?o@*4ypW`isxakBtICCea1OQ3!9Fo_HjrQ?UcV8Z&iBwnzV_Z0ZX~%g^Ie{0^Q}Q)qD~FsuH}fArEX0($%6jyB>M*w!n_HJnBZ`@E zVH-V3T!;ExcO%I`Rtx>|D&2puZs5f`*sCiuGpiWddk8DHLxvJ*_S zHX?t$SLxn)u6#&S*rTN}PUZ4nbj4I7!e+c=oX~7Tf-DTil)X#3uP-llE>-Fk>%Kn6 zjh0eMK^IdAh2=TWB7sBn4Y%jENfrI-A$E&43&vy|Reeg9zV?=%eR&0C3z&s| z)WsVc>_t))$0onN{77e&U{8{FGxFiE5C#6#%-aoF8*te`EOjapM$oXYo<4x&RdmCZ z4tF5`qn)Euuf5;4tdd@!35VD^+YFJ1fW3gQ%~Db~ab`Kn=K*Ly{Eb%xh&LU@hr8H(4>(Tum1iPd zMm;FSNxCHF>k{w`oo1{Wszqdtso~)*`B`>8kzz&a0^0w*?N_7)6 z2xV#-bp{g%sdVXj707cF0oyq8TIQNy&q2HApW~b-{4no@`pXzJo5;sUJ^nIewe+H$ zArlshTQ%!+DP*ymg+x9QJheoqXUQ_GS2?M9-Htl&j0;EsxVb>z4{I34Y-n;vBC!#S zawO4iQ!vcqcgtO`GVBb1C|t!?ysSepC(4}HD%l^Vv!Kt%$w%vqH&CwD^`mZtz{+>5 zYn=@G1?2ZF@$SD(ug?u+k-3JaOLY!LBaPWHl;9CkP(iB)zX+v?;J8J6&X1c-chUrt z5!k{f-SI=awY=;mD-6xyh$>#hd9pmZ58)D53pL4gjNfbsVghwx3Mg$ zXD?{q9{1pmZR1#u#H)c?Ozm1B)r3k}-&v6d%)>YM5^%|ubY9YbA#^#E%W-G2of|R> z820H%@Gu|8K*X5;7qXntQ>cqO!8>bq5}}XBQSFUC(oh>hpZ!DyTt zl$Xz}hU>3!vK1CE^eR|j>@jQCj3s#UpiTYjlbxEwEG({Zi)mMuskywl0uNBvQ_)6h zA6P@Km+kSc1~An~r5Q}{b^sL%?qZmNqSY~fE(`QP-c!eOPvOq=zrL`@4FS~4rqEh> zv{jHSk5cc;hKZz;{?VL(di%^&U2|(TjLPEC>yLF6gdHlXnFH|NN9Wx9p$WO# zP}6KP;4KDnVwEyUErZUPs?Ii$IhjGLSqu9g9+ZP8L3HntBEgw(1g93|2p)iekLJ#&oIW&U*3*4Dd1wg^sa&E+00>EP; z*r_dFX`yWJK_u9%VT!GYTiLJ0s1se2G^eFDYjKD+qyY4Nt0q^^LbLTRH1Hp`)hr(v zVqxR17AtTIuQ-Lo0R%`Z?&o<6p;9sCZ9eVE)6pKC&NS)8;X^~pT>? z5G)Nl*P(v}T0q)?g0-+EC!CRevcvrauzJQ*7cS{H3!~}X|1F&sl|klviP?OlkwYN%WNvbbxIp&%0H-ERX>hO8MD3~anNk33sk-V zwSqb+x{z$ohR8iq8!Q=;Z--;1;6xcx4RwmSfc+wp;g;a@J$FhKL=GkaZ}9hX4wksoOo zf}?(zBmZCId!&a!%d?S=usSGjtA>k6`0X9>$0{U0@&_bq?`O) zOx4<^1*hzW_f|quVNHYF=X8U;s0j)!rwm`L8dWkQ_Tpuv=!a2K1lcy#f9U@Bv8KBB0+5QVj=a zQ6%t!5-fAj5`b|AEUUNg@WEI4lZjrk^{-ayEAP#UO&4~~afINPYwBR>obo7kWE2I zdo0+ku6&Mgp}^6ErUoKfCO4thnNrMe9kk>tl0G5C3~fo*bfN3rQmxe++4nF~@*zm@ zAUBWNOya0XJ7NpQ{9wy5Zp4P%Bl4g0&LHpIkRrBxU>lHU^fTo4qJjXO#phAac#fN> z%$>-5IlDg;mA{QaPvuPo>gR6)S6bK)h$u

8F(!uzwcQgoNW-YDOEO^{-`x)a;?U zMNA|n5%gw`iP>v1Ip9&LIY0NWZdOfW0a^1^dNfeAaB&$v z+BwBxp@7Iw1?_ziN{mNEiBxrH4s=o$4_p7hOvnWR*t%o}lecf#D?uX(zzWPN`SEb0 z0E&T${)*EHQ)J( z>i8jt3o_H5u>qsKq#3rm+>AN(ALa8aQ+z)2$FfQNK;i-hx|_K+L=&G;a`;~KMRn!L z*X*%I-)Ixt?q{vZ!s|r!S;{b9KG8yX0yEeC<2kH2{Ny}{4uUW!Lm=u_Orm4_;T<6` zF;zdp6A)Qknc;zt72Mdv@X%FbcyIY+5-`Yx$c=|)>Bs`=fPb|6S23u?wr1cl25B_J zaf{S(L2w3;`W4vV*Mx-Y-&+xh>PfO|&#B=9+O1UgtuR=7zm!j47$C336|Xa@dZw>` zdWHgWuHaVZ%p!<))>F3WG?OT$>~*G*Cx%+&Byjd?cY(}iyPH`B{i1ReK4WyHK zFeiAWA0A=u`yTMH^u900^ZS`wx|ewrgPO_msrD@WCWXJ4SnOwK%j=gQd6fY;yuy9~ zr@j)nqpC;?frU1@1@4f?W?6f%|Ck#>oOJ(s)w&wViwx_eo?|WrIi{fsZ++}2E|XWs zs=mDbu+QN$rk|_FgKBYNe3I0onvpo?9o03yAx-%NXt`*69Wk{MP3*@6&3P%hm(&K0 zh*EP(KRkG*`9C!mq`(600;=SWTs9X?OsGZERGZ8mKJgDHZ-kG8lH$AFG00#lch6_p!ACLO9UVau_md$;s<2_E#XF@1TL3Io>jd25i7}o4%So=20II_=q0RoLwo3 z2tOYG?zEd7j*_jk3HvB<8c*GOtRLc>|2SOq|7g1Ic&yv@EeVOTDtkm$k|ZRfl5xvO zsH|*}Q9>m%M0RFnmQ^S_WP}JM$;ytBm1Jdy-*J0>@B4ZFc>UqnDmZUld|W1Wn?|>n(JWV=F8!;hNs?BlO)4?79oo-}Di6mwRq@zsbY zC;o7;Ub1(c->3q!5FnJxKnq46sHk?5D97DEU3*d-jIrifc5nWCf@)Z>IRCKJ=tm}@ zX_Y(LM`THV?91~ErDJ8GJ0RjTe1}NEw0qG*n1RR**a-W!-e9OThfMfHmSyw+3KN?h#d|-F;z`chx;jwGOP( z$-Kz==ymX++=q-KO>>4ZPoB?yWPg4xz-fFi!tN}SKiF#!gU+YXl4pk2PW6>M$*@s= z8$4OoKXJ-J!ZV>9QRBdv`*@qgfa7f`6EQU;YVhx^UL+E!p2H0q8dQVH^V{oqOD4tb zpJm7n+59F!YA@O8>J__=FA;pDk98WRi^L8$2e|fT6Yg3igqdA14;w9}oLP~I^HW`u zk(&M|Gdnm;i}ix{+bA^#A{%jliZnl%Ha)Z*lP)k(aE(y!fl8n?hVrk+l|%uDpeb*F^PC}P_)4OL!HTia138^WL4x!o=RRJ`jwNP%U^ausSp0P(9O_{*Kcyymk#N z7@STWnELe3wQ_S~E!h||KH^~B6$m>-C=Pi_u~8BB(H*Gk@yhsPA{6tnp>wm4^wvIg zTZb^o(UU*U*W~|rgMsC|z|+C$=WQ-3jzsl+aWOcXCzf=`>ZLhoTQs{|P`|;zwqYqQ zDbW@Td^`X7Wb(U~Vx%`l=xC#5Lj^Aj5$=L(7-xDM?Y3FQeFS@P#S~FlXgQ1^?BNaLU;Q3JM>1r2t1nBL6lsarfq5&CNQ2lMD?<-3J>$lOl2&wpTB!y~wcn z&-NH|vKC|d#dlUAx@e72prJe@CSL4Cv`W#Z$fpq1(W#_s9oprc$cSb~)u%Yuf>aVq zr7y92HGG7dFzKYQUR^Ea@h53e75lfoHhrOwof!K>iySeMIZCucSajJ;!xOig6`S~q&nnrM{QM{r-cQo#M4 zNE?*97`0$r&oroGp+|03EILv+EO$=0tcZl|rkg;gYKz2^o3epTOoey;$QT}J%dh=7 z237+J;OASsVdhDSHpOk{etg3MG_%0x!m|eglyACS#wi}o`s2#W;*h`WRN~n(mo)6q z1hpdFC8I7=c-vWPG1kl)zI^%0Y+U*V+gLV`QAd_R8*_7C2qtHiayze~%cNh+S3CC6 zv|W7a)q>=8w@FJcf15#hKF@IRIsNPYiLIMyE5Gjkd=j&>O1||8*=4!j6J_INE~ja4 zco0(Zwq56ye~@A9mI*lDaZJYAvp;#ByaqdcAIJW&HI>V!LBMlyVF^{jm*W+>MV%_9c{C@_I)@E zbjwG{l7DzvK}`Z`K$qU{vkYH34rC0FAX>0$Fo0;`&XjBXyzAg9npt><9C7acOwx6irhDFcq3FO6!k>ya~*YpYqv+u>aBaikt934$#yRW znM8{z9tiYxTD-Eh_O;|96sQ^_^LG&zg_s@~J(6hn6G;LYHeFYo9PZZcjT66Dk<;gz zceYHx>f8?R7P+rJLV1;%~A}+<`njg`*M3|Bkut%tg zC1sOO6V4#4m0^WFy@rLr7SDwf$8cfPxwi{OMixJ7lxB56`WIKncjlth`1*y8zgr}$ zxOt5%fy-0!QYf7T>+_eMDpj&Av7(PI_LBEZn5Z~%aMe%l$l29YfVC@~|M!la*oV63 zKg)_B@!#Ej{*-H621+zYDmHN%p?R{%<=%0+x}8QqA1Gs*&Bxi!Z!MG7i{& zFbJ43Y?F|>7x}#U&NCYNYNlS|K6YwqVkK{VTv^@>eZi6k6z~9^KplZ6q?|YR4YmMH zJ5cz5u82H(9;-&o5>Sdq7)+i$D~?owdcIyiES2m_)5;aD+sX*I?96rWEoa=JY-e}pl-M^BNIqXYzpWE5wMqi(~ zD6rG@`Za-jLU(K5D%l(w@>vYr%BXrqbBn;ExEKE8!8Nw7w^}nQ3iaA{2nG3o+jTPN zrj&a7&$v%oPFDqsP7>%bu_2(2m{O9sT7Rf%E*EJdIg>CS2T)NU42A!^*!9_}D$)fj}_we!jOs^;%XGj}6ame`Snw^yj zzAA15;ziC#g@0g>h0k*fZh?BWt%lffTo%5$bhiO{HLvpu3Ve=S@erJvQs@6OJ{&G@ zm41Q1790T2#jRj9qSGI&{3^d-q2V31&*pi%js3LyonS%rz}{jS+_DiVYv)ZC_he&W zvSqqvv!7~5noSVKVNe1->*$_T*G{v!o8JGs;=N{=+xq8YLCIYRZ>OqC9Mw4m}E9;B^umGJr7INu=v#6&)mq-F*LB_=MhH zRo1B`*V5h2(};0V)Vi~fR8@HG^=gxrY5}eJn3HC&lI;C2&0^=e2L_|CRLG@jC*w@a z%CwYLb&ELAr=vTvNO!&Xn}&;OhqyWlc4^L`TbCw6b*8tt#xFehlr+}4sAd~$O-C}6y5DZDPZv6r>_SYD@IGaO$4@9d@t$s_fMU!FIxl-nr1bjF7qii zsix(H6z(g+=h6dfWON^s3{l80Z(~TCx)vu9*Rj?b?kOJC^#|YJfSH5dzUu*Bro-sO zkASC`C}g@uv=D;Md$J7O1cFx*1kMyq9a%3B4lb$s@0!e+)IR#z$iTpM17Fr8EfvAd zQO6JT`7Uw<=dj1^Z&TVq$s+M|J+vnZoI*fkn58p&{=E`BuU%o@?YAbDQg3 zI<Wu7?HGj&Y|hSTtt&@ScP2^@sR9tMP}7E0XQ2i5&8tpS-VU z$MEu{3pUn_O_muyR^TkD8BCVY(Tjbv#KAnu;=fIvnnceh%l3sNt9EdPewEXsy>=7? zMxH=3MmvhPlc%+H9+z!XjI3#+rr&-!?p`{xaIIh6jfws01x7z7oWC7^^D*y>tGrWu zd}mrkrjiE$188o(ZKy^18CX4(-St}WxO(mP@83UN?53P9`Bsx}$Ezjd?4eP>DA@Fr zSvrN+|D{MV^@~<(@2`fvYYnaV3UUKG{(iQ!KM{h5X1&O35*6 zZHtiEZN8?G=hH8oPHnCJ_3PIsb-hH0wA#?iK{tWbx+3mKxPp=@f7pJOeq*((O2cK` zgfXRj+?P_k@?5JXF7pCm*v(MD-Z3Zx@88x&?<2q_RQCKHGx%Vh2i9K-x+E<( znZ)M1TlJ2XxYEzjB%OJmw!gG;N8%Y#vy`*3mY1(wNm^0HM0;*4?`6*LBgR>PbGSli zE(}(<@~9WSyXEdK?DvaF-6?HSdP@|FxfVYyZYW1Kv>~8#%X6@^tB=f=-M*c;rEdZH zlj|R8oL=o-6#gPz-G(A_-Fn0L`#a7gL_gWEm-liGPc{nwInVcNE}9EX z((QeJ7VcIVbi}VV9jW@Kj7j>neRRv?BBiZn6E@GE6>C<8hEC0SY!aCKiAkXl^A*@- z1@|K8?=s#nbTKhJ+o;vkFahI|3^PY7bL};9jnHDvey(N6BwL%#-Xa`GkPIhkZP0KHO$I)j^D<~a6DtSaaNFI!sJYv{BQ`vR682Var^73%R-l79 z&HhPCIkf17YinwohlfOrN~JX^!Z&}`={_dQ4)!bq^0_G_3n;RcM(+1r(2s|Q&CzAZ zJ%i=^47}d4Q_c{e0syjqF@=a&&JuFDhV}{KN%0L=iMmOj!zT_hS*<8yK0`IGOXr^f zt%Z{G+pPtYXj_J50E{$EcXj7s)`RKJuF1?goV8k+7S}%^()rZSu zT1@^7Hm+P061#l$tT13azkMyfEd`?&b?p$jm$TQFFABPID2OhzHAu)HWY`x`Q9Z^Ss+PMo7+x)wPp_|{#S)qgIG&^%vUUfhnID9 zLyy+WS84V3A-)F8JZW~AX_V%;sUjYp@_1?HdDg367^0F+>&31dKQTRDHh%0A&%M;w z{z-*}3OCDg=1;@KB(Ge)@65kuH`WmMBkT>|Cq-Y?I1joe-EQOSeCx64d}N|*_m&$X zKjtWp-4Vx{XgGDlaeYoGFCFJZaqhUf`Q6iMReMn3|(aTI!(k zApsJ0Sr`@n_O-o{h@tg=z&PTs@sY*5_oXj$gZPT-)LacCeeWGYfMQ*Qgb9n^(@>Ta zkKMJR%ldm8j)w0AT?NZ8VxF=>#inTA-pz1h&pJHJ={5Juq&!mp+J~6ZE6-}xP4B_% zFuep??n0sBTg@ank5xh0OV8bVZ>H3u5n0Xks)#P4sXzUxjP`bP7w1d1ZA?9zd@XmD z{v@8&_+E66T4NyO?io0WL6xSAX{BoteL?57<6U)Av%?K9d+fg5ouqc6=K(Ccd(R%o zC{DFIiXY7qpxQtoXZ2`FT&8lH{#L1Z>CvUf!c7$iRbQRYno~E^3PravZhcp)UHps5 z$EQCn9t!XNb^V2zn81tuQ!Xk@~nqYQggm)!)fF%^{s!N zmGxtJnd!=q=07<-BO}YOVUpP9=VzmMPaHp}s@)MKdOKZ}W2F*I`J~$?tYIFlyFF>;_~^*|ezkV-9NqGl3!zRw zcQC$J6qLxYnezxWi|6`lSMgr0<)k?^eVRc`stM`QgfT+(&)~D=u2iAVB}EcGI||8G zq@`>?zXP4t#jy*uf#5={EP1Fpu1i*NRm=@Lf$K8p@LN z2PSDar`lZ;e+UCpA1>(fD~yVYihvaNfN?suG2y!L??kF1$R60{aZ%Q7Gx1Y}%?aMt z{}5jE1SIBmLUMMjtgOi_{#xlZ6j=}v0-!6++fTxo_oPlRx#(FW@Au}feTOP@lQ)|O zHxPm_ed(-tU`IsQu3cAbc=pJ%Jk9Ewg!SY6L++2N_YYvq76|ljlztUe`{2E#0(r$N z{5A2L;3I8pyyddno@RgE;Nziwrz>|31izYs^=V9TXJ;pW)a5S@2JK3n2c%8g-Kc8w zgdALE{(1v%daa<$e&Prtm6WtJ>5T&th(HTDim+)+WLP)AYqohIYM#i>#0v)dSpfcs zyCK%YCQHY8lhTKVu|(ff++9Ss_{+8|+MYN$YVAdXV7tNm%#!(f!0tFgvJq>&kIVk(0_%)e!l)`?vPXg4~Iv;W>QL{%6 zvg(|r_W9BH_UbBiHq`9a;*h={a@2ieWvoqQs?}@dk(X;cg_9Be_1)JV`t6%2N7VNt zm3RdP$5dgVq%mTLhNFz3@7%d_7^g2?goq2!H)2BLyQuo$0)`0^(=;*>E3Xi3lP_*3 zE$#TUf^ASj>1+MNAl`Iloa)|yG;AA5Ny@WW{Yc&!nQ5K(P&fn%|8o8UVGfkDE(5j< z29Zn%-PG01UC?)hr_}q8AF0B^!y_^#qLi{%Y(IH=3Z!bhABvXisewz5DD`)#&nju5 zf9=Hgx;i`aQnG54Jj^_B?q(ukH2j;D)~^FO2aMXTnS@y;n|b(Vyqy1XESB+!W(X)7 z{MYd#zg_;Z%W*!rW_@i*54*|2o}cj)Hg+%U75Ei}2;tWPAM$=MWS-4=^(sF_yR?AT zC6d1)Th9E_`i7$y0B=|@$dBy4R&SxF^s%7kLnA+skLyQQ&IW1rO)XAiCk-hBAEx3w z@%SuF23@uBG){l+;@fhD6AH^HvTlp`RJGe1-94JSLp@?kcTAVmT;$eGYZD*Y@Q8b6 z?&am>(7(Y6+Yxe_)Bu-kYmc;#zlKcpbamxy?1{Vl2I$Y~l3YI5l);IvK=?`mcdDiC z#nCg@y^;>ono|#WP8&vw7#DLTA6{v(b>N`Wpx@o#7(%?`0u46A(Waym^=zsKbNZ-! zyn{^$XEpc}v?On}HNbuEL36O+01y8ABRn0cIP{B%0AqX zn{WzTcldH6Mu=XrmE*+p;Ii??^Uamnm+H?<>kXcsEiEKswomunE+0r@eYXf80g5bG zV%Ws-xHymNAy)E|512T35=`dU>R|TT>o-OEZ)$MEem>fNDxRwE#axo!(7{sP@Urt# zRn}a_qY=l(f69jY*^7SlQ6blT5Z9bhI@xkMyE76SsfQVYh!(&_ZG6^-G_3!FvR*0y_&%31G<9;+PkZs)srU zDQZa`G4p8QR}7b3>G`kPBf1OMrKnu)kJ_mG7A{FSpq+l<#L`-4(@h~x**lHn;^L*% zpPGEmbiS_nNc;LmU4}bq}V?J=1+Df?Q)s@GjI~IjX)LWxP48@lJwg<$ORuY z{UmF#a^$`Xl<63?Z}8~h+63EV&i-l@=@TpM7Nbx17{K(#9H~kRj72x?Y-|FRbG6nI zg&h7xH(SN$B^nj&zxN_hwj;s;oJo|RJ4qCT$WgO1j8d6-T0uMBZ@hPuX}kJ_cPD)0 zP-744qSfRA%+Wvrv`p7gea`6?D;^| zk2Pkrk@DdxsgP06RqNh(2et;FxjjyJExfiMxJBpcvMFXP>u! z7v#q5-aRm|*McVX^;e4RKPU=4#=es{>lM#fR#myjc$wUYNKmdSK0SXKZduE-!}1Rd zI2BwRz=flKeF7Brbna4Wh-ax4{mBTkFMDq3cZsFqa+(L=O^})-uoW(%EPdcL6 zbfD~Of3B&AkrKWPSPkC{7Qa|a$$F!W1Fn}9Vmi59J4|ak&F04A_FU|SJ8t|nR>#P~ z?K>aY%>6Wti9D@5>dIsPvr)rxx#oA(^^aew=u0-Ni7zNGfqs8|*iFta3()3)x3hmn zAZXe7m;D;iR^LbK-%fMt&TBCg@w=#Vkr?d{8wyYZCl?UL7%;$YLuHj-^^{;0_agP8 z1YL2B@IXATd{pVBefd9>R+X<6cE!(spCM+oTA$I1wS=wWbCb;SV^lUyY+-_BOUS;?of|^zOZI@+OGTi)CCxt48)2r*Uqc-TF3dl6nYTRV%s?*F+1AK zY6Fk@^b0m=>VPEye;QmY`Vw&!++QH^AV8azq$}_AA&JZ2R@cU*dNKR`v5nCI5R)X1 zz(N}!0^-;)xUsRZYw%2XXJ)PPV|S^y56_4H0b@}T?}tp$srco8e6D+h4}gLL(HUGV z0Gc_OPdbi$W+yvMLWq=_{k3rS-_U-t8WlOaM2&!WftE-eiz|QFBV}nKi(Q|v$%g0A z%tgFf+JE(SQz|XzwLq;IF`H;Bk9L-hJQ}KhqEAEVs&#!w(@}#6q9fZcjNE@|_Tr$b zF)!oue-)zC*j8dyiE@Gn>2CEs>=t^rR2!2ldom>&dMJLSQ2Z8J`rA_%mi>0aWgkfh z-5!M`y}!(nCtg_U0Z2jVLHC56=J=vp8>4$SlWZ059G^Y!;V-_y;vPpWNC>at1tIH7YP5x z2IKy?xhjiQJ~xje~?>At!9 z3A#TdmfgP;I`l1OY7B|mgh{Ku<*j7WJvSE_h+P0NAROhpPQf>OqW^1G7qj9F8z-l^ ztLu}7&xn2xjbH@J;J^sBPh#jA;XN z4*DTvVm zjr-3gx^Ajf{a)g9Z>jw@D6mpnD{--4r?i{*MMlW(%y9_egv-2=N%xH7{zJrY5wmyt zrV!2waW3u$7=_@C?ytN1NYee^Y=ajFIZoQ@oEJ-3*dp0R@?M3d7zpkQ{>S;$)8mTj zYB0w~cO!hHgwwQnU^fGsfEzUglNc2Row{XztjS5zraeOl{N>c6vi40#Yq7-@si(*M zE4`>O%A=^}k?KJ>paWEE7snC{5rcUcVFiL_HrCfNX^U0U-wE6b`Wyb!SdsNd-qqVo zg3OPKzIfmfG=4Lbx=M;1w7NCvHhV%%zBD<^aB#9cC=I%|s0gkK zj0zaE#ahzILf31z+h~wY!%C|(rzy0)d_W|3&XD*c!v+Be(Y#6(a@;_R#nC$5orA5W zS4@DEYA=rsebREH=xuVB=zSkd%DsEjQ(0bq4qEzPIjv68!GmHFZPEVMdLE31u-0+s1oor5Ar+=c z!$@<{Uc`{GeO9F}Z|zdMIMO4yD039MAKanah9ws67~^4KLWBO`=g8jq#y;1m?5mr> zM?X0cY`dp!xf*y(n|PA8aN=ErW?XxwEGJxM+>D7l_fy2d2Pp#B^}X|@8P=nTaFx7i zVsOS+s)&QST_MbQSf;z8MI}4Uh6VGDDU-sH-l9W$Yxn8$(QLvxmUwT^l9J|7`~fF(8$BnVj39M1C1UdC|B<%m{RxoHW0BRhg>xVT2Jm&4G}c z^v{3wi|_11Q_QS5immKnp1B(rYNPp!R9MjRLUw?A><5Mkb*?UC&vK-0r!uF;xVx^| zUKAlLizfo-3LB1i z?Sruz#6)d_M$do4oX3I=!+Y!Pv^lsKnjRxPk>>PV`LenidljE#FUERT>&{kAdxUF! z73=Bwa%#7FfWN7fvj+}6o^PKI^ zYOTC#O-F`)_&X5Y=*Cp*8*S4mxuVq1_ff6mYB&D!ms{N}qS5X8^&|VElqFAhqhSFi zh6V`z^6X;byc(zqCO`Pmii94^9#$G^i$^bKFo+24%3 z8Yy$)>RxY3N|u;27?1G`TOGG7yy(HYxFPT|Uif(9$uOZWrfjpdp<}KXkZD^2PB{?C z1Go*b6GaEC6jZ>o6Dc_r?9z{0`lpv1F&ZVs?;KibziM~m&S(ae@_u!woP8EvW`zDz zLk4hmCkx?L$`woc2R>h0;yTR2o)0(XX{$wOAo|A$rruht9!QUbZx5jW?kApAN7UN` z4pS>U&}8IUaetEWLAk}g&!3lo!tZBv16S5e=OtrguLp%Hb3H2c+T1uo@-I+Y6i_S3 z(q%b&3X_PFBdj`yr1)Dt&dwgS>l?LAp7N?ItntmT*x#EB>B)j1Va^ zA(ETz=J_OEe%ojE@xs8X4nkriwHx$(^iy5s>QQ;Ju5*6J!L+MsxZ3-4!br?tmvILu zBB0vCtvpSV5ie`WG9UAZCJqn`2@HKDK6-)^k&h%Dlw4h1d_;A@EN`cW*WFs*Jn_FF zf5ev(e27JX*B<<;z1F`RX5Nk5d!zjZYV4Pe`451=*J26Q8DT z#c$d{44?iWBTg9Gqm>;`G#PqM@0Mow&3Cg9mp|IJh+3CkGqg~llQAwEQTV3XVs=b^ zQ%`7LFv!O7S@NwI5ZTweB4}5~#*|BK7x= zE@Q9bZSfa!4ceMMgjOpg*NU?JIxBob7Fv7b;=ZYtj2`-Qx5$i3QM~tr4jss#dKCNu zp@i^d`H#m8kN^%=g#+|>6pz5P#6<$O4lm)(Ygh#!=p8m#idz1EobbHx7XwuRof>As zD!NOzr6G*KcBDp7sL15=E+t>sB%XOI^nuX+SLfosn+NLo6uKMsa0c!ZoY zG3s&UZOi>yMk|esJkm#lYtdBn4M*YM#_h1?=99PcCp~&v*n(4UF%pvgMq~&gmjzG* zjx>f_fj9kFh`6c4(ql0Akc_L0+gvoP^AjmXxz9N1v?(RN%|0u1C9tS+Gw*O_*4+^= zvSV_gXQugsQts!zHSzoxEm!HaDF-wFj9ct~NvdBTOtrqSj~$}{eiIZXbZ9uZ%dhe( z=}viS?~cO`8%Qllb)mE1$%{m%^Z<}l0Xan+Z#8zGy?@6l194f{&@FxK5I-#W2l)Us z;?0NHqdO;ybd)ULT&ixc1ZH_6$EGmf8M^qAk;ZGimt2M@BHmm7*vqdZb7 zA28rms4)Y#xWha2xyZfXL4`vEHRkhn*EYM7Z$T%|afPFQdwDS%pFLt&hrU(1xg)5> zH%e4dOUkv~g&mVpsoRnW{tWK2`tL<@5Nx&5zyEuZ6x%K8T2`amNAx!vR+cEdV*eCo z?_>HoNy|Pb(X_q&pd-&hBeVJP@`!SZqIB(+v!uVPz)o*Xw@cZ&NF?oY(Jb;LLSW%A zTZeZhCI#Y``HV<50_=p2m9_>amvNWg8Y*X*5!^j30b6 zLfx|(MVUyvN_SZ8fdbePZZf#hLzNT^X{qr)M))WAY9k2#b8AiMs)^L^;V=S-Eea*$H=1eE+8;_kbEKcQ z71<`S95{RlK|NMgC4b>_qBqH?)42CusvR5D=UG6@>Tff@Y!GBNVAw@O=}?S`=F7*N z6z=4?CIewRlori#Dl)@$dNCqn>Z8T9^d^(y;LrDed{sx0l1=GjxX>ICPS6^4<=8UH zyJ2*xNLjhV4j(D@XuwXPQo!@ZKc~CNZU!rdbL4{rrlF0(R7j6=C+1}=Vk%g}Ek zaY$e0n56r7TF`h;i|`SVJzcZ@mHTYmHcbsa`VRjaA|V}M5;uVcfw-17exN*dYj(DQ z^Vkq?M+GEVDB*CcbTM*t6m_S)_aHuJ5|_G3$oJZu7yBrGKFT{`^Kku%2LcAWB`~#$P5-7US zkmj!WqxFp}F=F(&iJ{d( zSpq^2uFLdVzlx-~wg!o)Aw$5$?E6F+_Kznu&13H(Is1CLvnn1IPfFh~j4%3-MM{W> zD4+&E;uj0}5e_WS8wO>}seT=D9(9c?2!1R2Otn|hIOHg7NnGq1P0x%txB8UJLW7pT z9Jia9{)Z^37`g7nryr?ETLLm(JmfZ7#kk0MOa98jSnl0TnzfXf#o!I2px$S0m$Vo` z`3kfz8La)4csvbNVc<+^Cu4m0sXuuIMV}EjPYg(f(Z$K-ZyJhK-1ha{>e58BD% zo;khc6%-RQoE~JF^mqTad^D98s{lZ5SfGu$g5#hU`Pt>Qh$TNO@wPh5(a&0^%;`}F zM`r4Yi_?!BT^OQPR|==&H`L<4n2d|QX2caa#JCGJdU>wt$amMI(tsT|?^Uh$4CZ-O zwG2OpP`NHx{6n!lk4DtF7PSn)AKWi1ewPa-14D6sfLt7Mf;{CVjn%C zTfJAxr2x1dM`(W$^a6PEv6$!4U~r#(zkgAT6kw8U9_IwY>qanZw2GJiBhbyiXSq+Pr8^iuh6(VML-YRTJa zf~TgZp@hJ$x33runh@hfJ?p1A#qw=K2F+Vm7V^HvBFb_OQT82v=Q0p=`HaM7!J!{# zI$BddUeE0+U!2Su7LopY?n|9zT*ki+CssArwlwVQ;a^&?f@$V!-LSY3ree{ppq@Jx zfg~b(f9(zn(eB-5Z=Ex(9-0T;K>?;jEtS3^p@=d2)l1y=zG-$dukTRzGP5_ks5Im$ zdUOn4*ZCo?((Awe??u{t%AFD|LZ9N`$=`$gnx`WR&R+x<|M?;teA*Q0oQ*(Z~lSsULxlxB~K2ab}h zOvg{C&ok)nemp0s9jrSmW%`SN5L9^mctJIO`Q*{Mu`xXE>tNbGMSlbjC{9iYDOB3U zPJDIo5XhGcFH*O)+pOqfSzH}cuMR&`$EVn<^qQCDe$norLW<*0qNJjYOG3q8w)xXd z(UPyfv93jE6z2u}*jvO`1d>GZj+e>l9E-MO)}$1SQN`k=p|v&Qvacsr0MDZ!zO?=R+U(SDz@FjqGMVVjc=)da;zrua z0g1g`9JRtbw=ffAJ)rTxME_v;j*#CJoNc_$>n>cv2`rv^Hkx*o(3eK|oTsXh#MiIv zx=H-ymCY2@z86z{laYT<+wSg#!MKLL1Pe>McxaQ8H5b3CNb=`nL|NJ++YmC-a*r=u zPlcPDjQ=v*O)xl`hlD2fO29CUQxE~ zrPiVWiHS0ewK<<_y~QjF&}DVJ~VkIW$i`D-4~TJX%d3C7c^4>K~jM{C!cD4 z8vM^49I4&Cz4W$g)NJ2qYL{b&(t7$EEZRI&JAY^ijcfDUhYkPZYbqFQJ)j`lUl=Sg zT2%3b$dV|%*zZ^U{<6Nl8Lnd>6zCBdJnETB92H+EH`Pvxi z1?6abhHmSqUw^HSo{!SUq|v&}Ift8XecEwFVFSrFD)8tm-lY zaDtt6Taw;3%kcVNH8W2IwlzHd&;;aMV=$V@S!FRVQLeeOGl?%+&V8ASV`k?NC;)cj zDT(<{ivK=dw7qcuUL%ZGfsx=fM_TcKYAS+=Z)i$)k?AsdSC`gN2`&Y{PG+U%16J8g=!aOfE&;n_UZ)=7x6h z`gIv!C)W!;9(~0)x$*;}++Pe3PjKtG6wNj@i*b|7d(RFT7{F_Jna`Yw{C_w@J?=l? zA03o^_&=%Y;l0{vg7mbH7fy@a?BIXJs^@c7i&I4gRl6Nrh zRovK;-?8=k@9#c&&W2VQN>|^59QNs$3BwSrZpZ6qP zV!VISx}6U^JuD2T*Kj~7hpmP7J0eUF64RVx-0KfBYz)IC{;ucub-FjN{T(mz+I00= z*9xr0;0(YANe;j$X3(PoO4nxo5K^&ZZEO^XP6ODtcFE1+-dllg0 z#AlFkHd)T&BkBpPR+;=Od^G;dJF<;^(@-$k$VUbU0yE*I4I8^~)mVZMZ?tr|j?)P22C3BPcy-@>^QeD>*ySg3*x5-@96P7>E_d7a(;r zGP#`&B|A*xWzCxH`s7CPm5p7wQj5kyZC?c2;0KsFOQvyWw4#ErSDs$Q-;@$wzCtko znCloMNjFBXZ}?B4Afb#>?EtXL#?JnXI2-$=H&{ZoeE-b%j%{b!#eZ{hsQs(S>b$lI zBUCTdmK$5Xeg95y-4jjp+cB~4u?wm&cKt`*E}waL{8LUdh2G9|8!Dr&m71iHYNJPG z^ilnje5$=*UvV6Ay-~z(p9C2hw!C>6YoC7F+)? zjpy4HwfKHbOV6qg;U^8bJeOCEFll>Geww<>=qH3d=c1DHK-5ZHTs{z0JinoyrP{u< zLUfk1R%Q0L1QqK$u*b*#9AjSp!Z&MRB8#6~^FbsKfzk^mE0$?i3EIEJjlKHUf<3DW zcWs!=ZLhau4~-f*k#l0I^r*qG+|}BY7eIKt=36%ZwN&jt^oNb(S8|ofC3W5>l5ONG z2K=Ff-PLODJf%)!pXCo9KD>^Fl5ZyK8$NqerXRI`!no|E>?4^Pj^bQJ3UHiUw4zU& zC`QM#=^2;NFYqXY32kD~`yU^c2-Tnumks2UHjt5#-Snl1U+QtKRVz{Ntse*`H|DqG zPjha2Q_Qe`FFPCCztqXHidVh~SLNlrR)6pRK}QyzQDDznY`>>DJ%Ld$ZX{xQ{-rJX zW`bpppe%)MDMormMId89M<^+OQfYF?CcQbEVDp<9fghh*pYYjNmt@>@4Isu7E@=KZ zD&yF4Np~;02Ut|j5XuS3)$>={kwaRR9@vaA4R2JL2+9(fDFZF-sc-H*4rX4ZpPzX~ z%H4pR>iw#nkn<9XK$}aVo_}CPlte_$oi_T{#Oy(En=t!d>{yAFt@U^7276(r=CxJm)HLZx^pR&dbq0XWlXKC0mWmXmKe@ z&V`26`>9~-)|Qlr1(d$!Cw_5~xfhmApaLapxZQPTyx{W9)2WrDM=={`Ao#HA%Q7_9ej+6C>>KPu} zdrzR?X0#A9O<08B3B`3-GkR9ZzaBJ5x_S0JtU|$8!Ek^am$=aw3Fl9D)(#QqLC8TY z^2~xer&K(Q)e_j2X`Aog-{IK?ZJ#VD75t!C;_@kom|ai8zDEQWBfH#zJm8=OpUk$k!-#GZ2Y^&$|LNU95_++Yatf2H zMMquQiVI5)0XV@FD=$vPcl?@2(`<>JLUu{P6o+esj5MRMbX#g#szvYN` zrO|BPE6K8Su=NUu3R1=}_Xed5jgM0jQKH*_MzeZ}v|aLqqP1~eM}|O(`ENvaHd@4M zg;`nnU=M7lojPU0edG4jZfG{~8-}I8l|;bz zcm2t84Nt#|Nq-W-2grRP0>O|zAU03rtXdCmqZut3cHQ8PEqPRItY#YrAL8NSdU)IJ zTb~IOrGwMv0Cz}m^08k@*cJRzxT(~QY&MRSJ6LjoyzA@N$2pULqEYsE0_iMO7;+yP z{$*)@@lP-=2z>twahEtHj5-~Ti&-!ojpntn=2|Q28~)j@>}dxFz4nPABnyqZiFDl{ zJ3Z5YkKw=P7ml2)g2K^XUB{J^zqW)oaRR~tX$87WMB>3v%poQCruj%@ZLPvisn#;+2>sVjl!W!fkSM`mYvL2F}=))@+f?U_Y(MO zv}EW@5cPitrq;5v1tu zF-erdxCPu&*ybo|Eq6->UPu*KwJaaNK9KmeZosnXB5Z~z<1AHgmwq@KZ;)A(nI*kn z&N%9e%!h&yOnVZ0zE4N{PL%!WR|`mbRc7?Qbfu!AC)+CimNYwBE{zT>gtwT44H&Ji zn(f?AOM97-81GDo6pu8XD3yC$Lenk|C+yJuPaP79K+q(FErh8BeRg>3O9Y3TtL1Ktjl0Rr_ZiMyqqozqh^sj&aPt%q0@ex zA^6R%GUldwFG)Yu$;xKC3yN9*qwV}ZY!Y>3jI}Wtf>;GYzZ$4IuB%~I;waWsKn-3n ztTh%!b(jP9=oXIaiLUY@Gz z5Swn$;c_Oy9mB(iDaQV^Rla>F0l3bn5qv4~$PqyUua>6&d-ei=g*KyLp5p@!3Idme z-~An5+tb%}=Ai@$b|s)_qGd*wceU=|($Q<0?)|?$>Ha-8R=FX1-Y~$P7%m-`vA*+| z#iXg;*G#r0-&Y^)jh4SanBlP2wr%(BgRr-W zE$Ei6`;B#YWXL(9Ifu7!6F$u`>XMPX8@6dv4}m4P7{@IO?tzH-Jgz+)U% zZqy1eAOLsj$NOM|T-ME*0C|gGQA)AQcF1%XwXC)_RWKC7CkvuRsKy?2Ae1Kc;;mRX z0@!qJgKg3M{kpmki@wQRE%N<-HLR$0hZf^~uj)EGLBG8xXoX1mnbXfkI-Im#$7K5( zDst|RT~P_N2euDv83JIl3Qf|LD$m1P*T$}3UIM;f%U;fd&E!r$3Z=VknAL{fsB^X( zR2D#R5`!1eJBn})v_6Em+vtnXGXOk-Jo4Z$zMRxMvK^Zqh*QP7mU%sdzANAXr$ zEhc9Yh7)jhf)18p>)dhY7Zkh$mgssL?asFo<$)SK>dO`Q)5f^J!9u=O?on==sxH=T5u5;DOmZei-z6|f4%H~JPy@hMq{Et+$s9PmNeH49)||Gk(tYf# zlS`i4yxlIEZ7Zn#U^p;e@nogaDyV4c_itqH0g%OvF6<*{3bSMEk)b4ruZw<>Gl?&A z%q6N>%qCTJ%p@C1a6o_v^=iit&6g96_cjHzbNN=$iyY)TlzWo*5?5j1f5wp6l#}p& zZSZ+qaxKmuuQ`tEn>ViZKNcbF;y4ICmTG$BWlN>fF1tQ*bLzL#spkc%9ocZ+;Xj2S zk-^|>UM?<@XXfVUBE!s?{PSsj?HE6}^a&~*)9l4nhOFS*JPc`)rk^F%+P~UKpt`Tr z0u!y&%w3h{^!Q81!!4WWhq3=qGbO(u?C2VfLZ)QOBqb-O6qh08(DD8Yx~b}S#9RRa zb1%;8tBb+>JAN`_)wkqfcfBRn+*_up(&DFKJ9)zRc04P|isS0@w=W&E14Ke=P%wYl zZ*Bo`P~zMF#|40X8bx-Z6>C>qkbBBcZjFDGBxs5{g`4h(QK$bBe)r6C-@4k>TTVoi zk7ME68Yk z{V~1_ZMVGf!zJUE%JuoB`(NgA7I6$reV^HHKO zMq-Hf)DztgudC?{0_{Wz_dZuIcq$=vaC#W`D192urQN?b5?;zb7!nA&nI(OnO+7M6))d#j*Vu9aNhdQ1Z;Ex6oUZM6dz`Q=x3f>%V; zN?|m3A<~DGweOo!){5d6tLqzM6v_eb0*DXT z#5)iEKU`GrGXF$e>QvFxp98>)uZdR_jb0=#HWSM;-?!^0E`GY1`b5(TGW82@w5`f= zfCf1D-;K>P`J8P#w(h~?k0v(RYvTm)$4niVs>+-=W3rrr@U1rwB&Ze8$>B7@5bpmk zDDP@XII7J)Cq(`{5J6dc()C}J_`%+(TUX=qwjKM%agdFJ1NvGKe*|Y9J4DZ>-0gL7 z5|S}^`=$s0t`}90N+#d;{TU04_nvN1$00v%DnOzvwh><@Toljg5MSQsWhbjri@Eom znl}`RfdnDkLqNwS2Jr4TU{QOGuVB-v&C zj(eW>dw=gA@2`4i=DzOhI z-tKLkYC*5Cz#WKzBp3ptV*y^;=FTf^%p85+DHeD^*rqTZ!dnoOmC(oV-L{Ol92+^_ zQQWd zN!H$L2+u$ra3jI7M%FxV`pPZF;6OW~F#;wboT9MCq0!cYMaAYaYFK9bJ)L^s=r*fF zu(x1j{J&${#a4bGvls<>eZG}XzT6nuJ`zv&dU~N))Y(hFJup@S43;8e>K~mVqb*Xm zn)aQfD{1S!HM6&igaiu;B!X^|Y^?un4f1zZhd-yrHDOF)rq06sQiEF4#G^cBwehL!lIG?czp5q)IFZ$oSnmxws~GKju6*w{cda746Rru~7SqC6a;x4dN<6+` z;CN-BV1F!O7})Ld?qWvNgcFK3 zkcyv}Bhvuk4*4XJZw0>IsBvXBa;+50NB2a`WG3D@LzN3>cX;3N;IBUyTSfBA>D@1_ zN{&2!dLrk1t`GatQ&N@4{^%WE1wRjavh{~%Qp4Z&iZ}CYAOhXB7kA7H!OW+$V@3y+ zk3}iuv1E10ugdd^ySm|mLa2396PTTg(LT0~Eg1o)j)|^KyEIa?Y_RusitUy1 zLG7y^hAFv28o#XRN}7^TXI(!7f?%W~!o@Xl+aczQ+DwQyfFAhZ(>2@AO3DN0)T5?; zng@g^`K8mJ%d7?<4Te!Udpu4=*-OVBj)JMdWvRH6Hfapt$a|uf(5l47+-v= zP?ndEEN4MMBN!FJ#4A|^x(9o=Hee3A)Ebx%G7@s=!X}?mvKW?p5AGt28 zlD?J&)O`uaHA8T;8&@TyHZ-L;}E&Q#k?F_TpSkFuw z4olCA73jxGXd?{Z2gAB>ZpuY&YPH&-Ek{7g#|?igg0zm~;CeLSRHOgn>Y?|Amw~FnpVgrLMvBh|LN$FIfXTLziHY0AqC4`C#twf zQ0ShDdrN*MC{yTwm!N&eN7l}3o%@iO^YXtO$|?|~{<9YROr{mO`YY|$AUc0{B?^E1 zkm8DU1dERX?vnbkiy?8QwGKyfj&k21Tth)UU|QNl_daNL+($3iv37@*ga1TfSo1$a zvyYrzEcn5s%%X#RjD559dQKNyFIaAst~^9swJjHrrahM#I@7lAXl6-jWNAfIsg}tl zTUa9!;uOS>u#!uIfZ%5WdBhdCszrG{%p$kNilSM>Y~*4Z9JLz&rrQ$7TFN+El>I)c zo=?ccuJ%?3$bu;B>5S&qE5Gr~&#?D6ZOBhVlr2rES`K`a4P%HQb#QSD*|j&X{ChoE^%O^t===!Kuv!-fAPl*t(CQ z%tC6w#fDS@TLsf+Xwq=~_p(nDgJKefi%V0D&T7#^4dY8z#=l?Co?a8tK2Rues4e<% z?S-?aKe!II%;E&pY zxK+}D`?z0Rst8@hRdvKXtifyXuk6wxWnr0X#h2jBp+uQIzv`_|cLApz_ll1F5y~u{ zx6liQ#yYllp$jOm!GAmweXncFv3!+0!57Tu)pdC~d8hEYZL$Zr*gV#O_Ib(I_t>fz z_M8ToNqTcC5U2Y<25Z;!8&a(JI)SOn@?%>j`-hGlsOY*o@DD;U#Z=-wHAiURRWnPg zvu@F_-iqe0pv41QhLE|>CVaC+{6a#!U64rVI4r9ew9Us`(ILciJf>v$FJJKz*8e?t zI#QAa$*IQWMQ2;Lsk>s~&z`^d5PU2ucc?o_2m9)4kWpHu%a>XsN~x5bArCGb{A&QR z5R?H3fDr?Yi=#{n#GZg&2D`p8XJ;XNY{T1G#7YT(DhObG)QJkLp>3xWghxjmtXlHjz7zqI953&kPGNR7nDVNaogKd` z&mXYfBH`Tp+bK&)qD3THYK${%!nd<3J3G5znQf%C+ET#hgr^oN70DC+Qe^>jrT*jx znbiE|Kt(AbUBJ2sLNw{wNa7`MSl#1UsFn{PY6_Y(FrqPyyBCjfv3btENf&(ncILHu#R~Bc;PxnMdMoz=>|jJoAws(#)UB-<753Od%IrLt@XGrt5$$vR=MS2slrb#XS0 z6RB|LgG1r>L^yg_A&^qkt2$P5Eb>tc!C~CjI_X4i@67sH>Y7gZM2?`MoRZDy2rTKd zi(5R-7yRnlw$$rpO(8;~w!EvOva=yOD$&LfBqH_a&B`r*0Ima9MZZ!vsVZr}o@6SS z#1T$YrE8x{7#L$e6u;0j)8BOE4cU~{ZjFcV!O~UP)KVL8iIbOL>w}g8wQd<+zSR0F zZc2jqWOPW9ywFfNyI>z_$o>3LOkuv{-5C`Y+?{#lfBmV`w=>pnT^N+Va#ShPu6zB% ze+6Y~^|*qiUw6$pD>s~?ydeubf=F}z8nVf|KQD?_hxd}QbG22F;~xrwLIZ28zFcl@ z0oMvqqqBjG6^GqP>R=g-y%}d+RU3Sh+LT*f*Hp1ukls8zeM(JPDN}rhXWy&i=icbW z6!N47%x=?yEd*5U39`{oJ>&VrXshpfqCfp;E(#>(U8hv#AyewE#=v8EBmm*QG&lUx zJB6D~JL&E3#^ftz=94d@^f2lp5cy0fRl)u9>(}XwM6>cBvNVko!zZ!} zHv5AuuQ0woci0Ls1>of@XWoc=XhM$8L%6rEkByoTqzFhFO|@{^zJ$#G-Uk$i+#+c3 zCXAQrt2a(z;KD;za#NyxWCqbWAv;d3jx^5C@f^yE3CTKqta-B7ib zk=y0^pwGIBqI)k=VUM$tAfVCz-_UZWd@`!hRl`GI0Gs8VMH|K}^rYjb1bCb!+T|!* zY+Jqg6g&!lx~sA=gx~&fcdq5d-u0;K{C@Eg997Yt@=HMx!be_KLjvNCo+I5`uE8$L zn$900nyi4&Xc}tGO9Uy1=s#^=t-GYDGJeE&f10NA^WXK#xm**p)&yc)J-lG{-kB)_ zF1D-v1ry!ABfmVG#(^?=TQ4=w)~Vg~BG+cR zqb{wQ6UM)ct5FTp=fIf3S@@`_Nn6YRDKv11FDks}u0Kz*Tv1`5Rfn$q3~Glg&QpR{RTNlThP=F$O3{JkAdcgfh83oR}umTrW5gT1#ES zk6nMU(e6|v2CR`U){tQ0^Rf%(-WOoc;>xBivl2ox#Ij^GSE2JsvLjrn_+SWU+n_DyONLkHcJ0n$lHfTE9Le;KT2T@pe&obm5pj>)G-rX;In`j zagUfW^th@jpQCJTZEeNbMMo#%Z_ zQ{PlK54jYF=r2P)3Iv-U{KKklyGAwe;+{fpsxnF>G}zwF?Iv!WI*$M>g%Sma4AnPs zc#G3I&&gMr13Biuwp>COY)PYM9DO{7j^6tpWAzD}H{`VMe-#$*L!rM`yU~x(&O%K% zaChW~yFt!3EJxBQ@MH~dzcWU&X)f+(Z#=SIPnTaJmE z5V|3b0&?lQCQ>H7@tNDO3j4M0?chF7w=>fH5H$0WCOtOpw&k)uW3x7w*M~!zGq)n* zAaR5Y39*b`5LSMNzInM%?9fu_FWJH&f*63_1`byJPUMHG(eMEQ+71o{d5%ST@2t&* z@qwtZnNd3ovH-TW2t3KR0?=Ia&6|TF)=xPujWyTC$w_jYcKs`#Iv;s6TySh;{wliH zm|VvDzb_X}<6zq1#hwyxo?0B7^bdbD$P*G4sfg0z$iu-<1EDgfzNFqp<Fp; zIlGMKL{a2Q7`2pAivqKOQlu55U@uCCi&4A*((;j2)y2lG4*O5=%l9O2Du4FuDq7l5 z6+^8q!ttP-@pg~XVDnhd?vi^rx*dhfSl~8SX*(yI9KojDpp-MPstf4RuKoJ@{Ndb( z?{d3Fq--|#p)?-tPl8&>Llj_t#~B4*VjW8_qbKi&dZ*M~jx5<0&fZw{BdlLzK_M0lN7+uPfUgFxK$l!HrwCq^+&VTo_ zXe=w5koH-bm5AL+A9&T%q+3G#6uWZF35!_F6vICSj=1`Im#~ zNFdaJ-;B(m?RDugN6f{>bbit%0}04e-C93D`6almo0us6sg= zp49yN(+-Qpl%&NmL~({S_YlTkiL}G?0-U5?5^@#@MKoFjiMYmr-D#NHo+) zTcX{4v`R>{1sOiBA$tqtK3$jQR8C|W7JQIjKlOW@i3B0gv3Gm_!KOGU+b;D`$mn_- z>KtSom>R+ETAWfj!N(C)G|)cZy-Yxvf-=8#2*4(^)7H!_=W)3!^9=4PV6CISU0vTA z$Gz-x!3Py=zGJr~Vr+exI#ZiSMw<=f|0N{D&CIKj>Z7srFgBC9l_)x-5NNkxL?Pb(N8j}W&!l29A1mF4$iD$Sj!g(FzrwR+k=E>ZX&nom z9(kCG>uS%>245(9JiENpqjua%G1&h~lIQ~i$t5P3`~0F2S=4WG1{Lw4t83NjgVUg} z1`3w8q!#~o#JJm4v3l*8!g1S3%xI(mx}ClZQ}Y8ue=hDz)A2OGRqic5Z1h=)@X=-8Wh=bKJL28dDG6@hvFOHr(nq+t54{pa;*)L$jG5ZlSavcJl&5JFbHXihnkIo@ip}H~aIRX3v4*t zZj-mw&EL(5lIYtUzoA&>kRjbHdiVgH4@P*IyYJ|BjCmqdcEZNt!Uc}{{0G!_>g5$- zg<*NVN$$Lu4h5f##11>H-i58+<-Ap_d1+Xk`kh4n^ug79--lAih}$sVNmfKbRH}48 zL|158QsKi9NVkDyy6yzSPn$M;J8xP;d#lDhk{wEKq?+pj{zfjCowx4s0@}Eqoi-IAeH#Hmn{mnp97I zCA|vkiS8IkE>pvn1vhX0oZlL%W)Bj-iXc(mNrwXxP@=?cdRUVE{ojInegZC;E+7}Y zYgkWiGbrFDo!n>nr3>-2T*FB?iTOg)f5a(zxpWdrN z^jy)+17?F&K=#hE5A?Zsd+Gf7Z)0H|{QD)^8+ZP>0gDuDf(sCc%88L^4~_UO0uN~E zmh-`_dwx4a&;UK3ibO&S^A@rRM#h-{2(}C&82;;av)y|yS5;(wd3odBCb-h0AcD{l z#q^AY)IrfI4TgkadQ*FmlqAASo0igsYi|Ny$r~1M-?e`5?`J_IwS*=3@$g#`hUl4b zlbem!-%FjM`B*n^Gg2m>=tmjmm(n{a`q_nx?X2@Jvz+rKn`=DQm?vu}TmFbBTeKFi zZUtcurxYRT`_${f(CpsWbzl8&Ig01*ub!Nlno?%JhD-{%Ge%bs+6eI%N~~_j?v$>4 z89>|`O%I1kyk`cIt|{t$&t$vW@j_>N_{&ol;)^7cU5 zd&?Ytk{w`gSv)KR)^1BkwC9e_gX2Y@7~vuu;DTVX-=9nkG-=~B_Y&|kMgFCZX=qLQT^tR{ z6$&bPqa@7`F3G*7C^d9GP5Sm@6AC^3R&UbD?3nICa>qY;skuXh;AXr%l7<9f9a_{q zb|OmRiUceso@Y={28WCHg38PSd~E)cRG?yrD&@@gj#CP^*vpta+jMGpnt1+d(a<^fkn?w1JHY^zG-$|t7P6A=dr`t8! zN}J^AQ^vHl0$;pC?L>YLke7KUWJw=fPv zr#QepD^gXsI+v&zV#dSgs|6nW30S`j7@faN=dLw(mccD19Uhz2l)8IRn)_g>=J2;c z>F^e$L_p}xKkst-XkSw5VB!6t#Bs;#j9Q1=5)Mo;q3XHt6* zRqhn@G_7*L^+oSF9`>_~9>ORigsGZ=nyJg*t?j-nO1Lwgc z+0bV_7xfxzd5QMS8`-JG%3w!#C-s(&Jo*u+D|FT3SL2D3C+`Lq3COOIXm>R(NcMHE zpL7*lwe{R3RQ#$8rAI0Ec6>SU#Okoxm@a8c6Q1RD6#?j+~u-Pb0q4xmD*lC z99@u(3u^H8&fY<_jhpXkkg0g3Y$YkyC!}%^ZAx6tN|Ya}(MFa`TO;>2sUfb@Q*FmB z8B9#dj}D+4@(sws_{c~v6Ec$rD>t_mi7!%UE_IKx;ul;;JAfd&%j)4*OaLfIo3vne+h)ZTReivDG{-Rl@nc)0^d27mi)i?U?+q zt$r}o_{u{fDG=lv;+>Iu@Y+K~g* zRO^J$ggf*HNnUtO=H~XpC)CWdsR>H&Hof@Eb+dk50A4h}wdO)IrJ=Ppd94`=PhBka zysrDUJo-}<=_je!Z*1mXEDHZ))#x{*x8sba!4gUL*ymaiv|A>&ex`T(8LQ&PUCms_ z{r$RVze>L69rN4NQ*(&Jy7^}xk@KY#J=4Kh_mEEhgh;cV4BM8a330jK_tY3nb5vFq znflwgeMw#lHB!-GqM4`82QgR=f0;YC#y1sl?T)a*H zB{f0HjjJ#HR#57WwzHxw-W@cTcA)!vJjg5k`N%C_4CjXd{;_m7U0GP2vmCcHxwmm@ zU8~YsTuJD^e{~L03<3PWv}|4T_SWNdJyXh}WYZ?^9?sEt`}_awI2~yyU!>90?5JeC zIFY5*EWy5iY%nWzOoXHHp4&x2OhjIv99DAB!w$Wn3pNb}_8)0P3oHE?DFl~25_oC? zjXrn^vU{EuBnr@e$3^;%1Ro0L{>IM^Cmwd2mJ>o*gAj`76^)q0%y zlxgK)k!vV4tf?j6gKJ71AdDmn2tg8?8R)2J*2HglecSs+*ouc% z3iAB!fWQ|f9E;BzgyxS4>vM19UOL9N0{!6I5(sG_wk#}=oQb!`**zHmPcDfb{wGqy z5pPcYDR${VZyPk-`kh~^#KfpQ^Q5hRs{PDdg%3Y$NIzb>tyy{Kdn%3HVm|r$J;)vd zEB?AV+eNZj@6<-?5B1|a$wTE&(?wj}ck+jp{VFPCefy?*SM z*H%ULPIva){_l^v>i)E}kQx`ww3uU~d#G&_6El6Whsxn&m>Mx#?YTCM>u4I|fQ5J1 zK%B|4V{#XzvvjKeis&YB{pl}x-~6>&qP;WE5!eYpP=r3JT53eoIHAm(y%*EGqaN`(r_T=Eoq?mrSA5e{cwft2BNsz~7T(-TAJE3_= zz$7Um+M~?o1~p;k%9WXgmVb6F^;RtSb`DLVOJ$@TA7xT+^4v3lm(egF(OlR@TN^lW zYIV@Q^Rpl>qDTgmhnlTDixZLe49HqVP|f~)4y{4J8y>>-6CD!c);ul|;_Z44t*lwr zVg0{#xUcfAkD;qXYhfH zC-;v$b9H1Xrr^}b)St-;FyX^OT)6~7q1MMn9U?!vk7*arj>7&BulrO^iS_}@f;%e? ze3j2l`ciD*9d~)Lt|#N$sH$tc{ntM}ah@ytf2yf&X9+GNTU@x)MfanbYE&7#Y@U|e zygx47p#9N|(4-n)lc-n}Eo5-#l|5MGt?jy7Ulwfy?u)tPjJ@~q^xq(so!rVK`lz^d zqP2C)(K5)O!*L?(TbcTao92tjX}jI_uL+}Me|zVd;^A)bI;vA9H1~aklwRngV`|w_ zHocC0&Q@vFej}KX+O|r6OPUxZ^rdH&%f!shxoOphMl=@>UCWBD+Syrkq#gi)Pzw#$ zvV|$Lnm+dF`2HO(Hj>SS*J+f{Tb^gApLEvY@|un5U3?U}=Es5Y{8K>rFA2ddYU+!o;jO1{>RN z5F2kI*z&~*d`tIWv&U(BEB(PDI~m;=F2%G8wYo~362BL}ri zhBh*HP?zXRIN8!1SIm+EYzj{ETkth2Kd+rmV7#$+8XKTa^_knyOG66`xyvjPzWWI+ z|B*MAq9Z+?hV+6)6@+jsJ)A#9wpk6h(zKbcme+&SPecb zvh?MKigJdZgpmF=D?dq84^u`32Q79$gfLuPcLOzfCbf>kl`HtE%t1YiCD$X1wRqEq zk;&7diZ1`xBgSpymtyyE2*5L-IJ8uV#;oSq;)}O*g@_NtUNkHiEQwZF(_cXPagapj z9@DtdTMP&h2aALCKrj!&$k#rIb$kQC`=1=pyzlSau;S}$s&$iumksd&1_d#WiRR5x z4R^@uW@osK=#U1vaPddAASz^$G$n-A2Z^~xEC6 zoA>|RSwnK}h~JcY_|S)_`p#HwE+8O4-jS9gD+BV58YYW@5yIY7EH>#RRE5Z zFB6+HQQ4fLDCM9H>ZKAT&ze^s57D6!T3D}#SxYFGpevNPultj)EQP*B>X^bNW>$_5 zR-ynsQ)Qq=fJ}ZXqRN8GiTA{}9C=n&_5sfr@>Uer&QQtD$y=F^oihZsRKsGb*7UOV zzZ>M&6Yn!~VNuRM8D()uXcFY6%*_d+Q4LJpUT?wc!Ea=yAh@UjB9~tp>wB-&Tt`8$ zj89mvITN_6CVe#5AbDp^fRf6Q3uVM1D3qZMmt2wOap^tzJaoV*fxWRfvafW*dI-?u z%T#$71vp`=1(ED8UtS2vIN~REt|QP?OTzX9BxY|*_{m4Dp(B&&WHT&~4RPEfzgK;B z&al8b3gr6|xvD6dbTQXpi^wW;vM+TlQ6PvYa3UGc3+j~b?{7bPehUOf=0@p#Cw9A~ zS+nxvuctc69R)&bPw-btI++{o061<_OdFNW z`TF&@Wz@UM#mZ>8T22Jk7=3u5_S>gx$md*#>rh!&pPIZNN8O0!KQQ6YnaPDZ0oeq+ zepLnn4G;kI?$+oC?jhs#gi`Yh3v1x`mXMkMwm_r6Lgpu}!;C}?2kQt!QUCosukGz5 zyZl1)wqM4Z~N7mvtevN4Ciec!NUCnGcpGd{132 z{>l_B*L=V8`hOqvd`CNAA1`rbLGtwFEvKDr;_cCNem&UmkpMg{ZXurBJz}?8k{6s7 zt?Mrn!g!u06@ywJ|N zaff(O&+8f+*U29;mX`mwe_8YY!s3WQVo`bhu87?f9TPsY=X%8Y`Sl{2Y7m_O1eQR$ zQeAr7w*Nx$*<%HqwodCT3?F+}7<3 z+zV!$oI#MTkhTnKMonfgY#Vl5KjF7XRl9tE zdAyo5VFC-KbQE%Y21ajb|oRtxk`=j)RpEzT3kE>|Jy+Ecmg;Kw1FVC1j>T zT|-&|U4AiyCl`&Tp|-;Buzsros+*K65@L4O$w!HtVSsxrUb&^_&X$V2u_$A|bMS)8 zC<_&lZqegXsdra(F6?lTtj}-KeN*trOMFB*NOdUfXh7W1{^x|Y<~-$Phq=L1ZZ_hd zk3_()&zKalwrM=QR>;msS&XChJWIY#uJo#O>h|Haf%I)_D}{1@SxdGUR+b)c4x&vl zUO9G^8l!kQTg{mfR4VQgO*O-0|6rTGw>{-)({`bSWSY7|vmsTdOs*pKopg!PoELo zboyi`3t4x+bMEOhnbk%4PfOqR-PP^z3@@y27#5BSxk@V(cQ@=EQjDp zWwss4ZAQ}$37JTgFjW5j2ta!zQ6DvRxKyqi-v|_OjmH}*HvHaER*x^Za5&6%vOoHh zhg5mmZcl+IxsrzCazUi6GkQ(iJYqi*M!r&@Pcw;Im7)GFE^D>947#AzlTp#$CH`SO zdUoG6H`xcVklQ&o3+ZqS=z+%(qxx0>v-E$mD(3G`@dXj*CZc*^mR;b5oBcB! z;Igoo6aBLx<;iX-+q3laKyQ!0{H z$@;1el|;wJ@`5P1aBYN|D#CGCoK>64?!r`0@iz%AbhtN%h{CWLTpY@{(GS(#Tew>J z?~<>oM%%k243%uX;y2SOwP_=Baf2@S{_ZTpeW1@AoppHiqRu+=^e+D9Vvp*6`ztxk zj}Cr4dGHd-kSvWqrSm?c@5bjV^};+Uofme$$r613_PRkwx?X6+Id*-a{Z)!90z&VF z+wE=V5JBh-aPvzDoLLC5eK(u$S(Y}lCzI-5(_%Nlxbaq$WCxrM&YHBcK;}~`QlO>O zbWP-z&PxiN&CY1mi~nGCWr1tO^+A+$%X;?5l^QQJGMzrvA5=OJN4B+Sh)cEm#*ynW z_}!1kCHB>*Ug_m(j~x*&JvLvWWj2hz+O<|XtqFdtB)hQ@Yh_RVT9x{p;4C_|pe@v; z#C-cz|2!=%t-n~d87-SkDws?0_E#09R{B6m>#agx=E>iyWb{4tf_2rlZw+wu=DMJE z#5YGUUkxv!>M@rCZI_qXyq?KKnjVX25cn{+CB}R?pRG;O>t=e^Ind5A+2PyxF}K6; z1434@_!fG4Zr=7>#GNj3HYs&!p0V`J_2trT3KR`EiFS3({ZC0;B$^%KAn0Aqk4*j! zRa(7}>8tCJi0<{$-@zGEB#jy_PROv1)p-6NhMxn?uAeWPCQYO-gEE$793}#6SCjUm z*MjUCq^_JnW<(&M%H%yK`N*Swev$E^AJO-M@IRj+Z>-RmhW?8ad+i$4<$`@Rn<)P0S2~F4I!_iv$tk>d-bCI94&c0kA*nbu>A_sI$qd&%0~tTe;?V!;vzh zO>G(xg(kM!7iG^asxtBiWSYDNuVHXHT^jn`ll}`gE0z{UmaaBpt%;L$m8!B&!f-4t z&Q?wESYi6Tcfy|v?l`g5ZwWrUqv_7~uCA=f`2W7RVLdVAd$X66J9JuAIAv6vm%fE$ zx9^R8YxdI}+>_R)l?Qwf2&oBmf{L~`X;eYPvIK{n>PLS+wI}qvfF;)Fzw5>1JMkD? zEPt*nwl0;Y+JEKc<`fz(xO5CHDj$bRX;q4;Le1uRfI6jz^ixDaEqa%h`+ey&u1;G0 QlLh}VBpd7I?mrdue`g+Vh5!Hn literal 0 HcmV?d00001 diff --git a/extensions/km-plot/icons/unknown.png b/extensions/km-plot/icons/unknown.png new file mode 100644 index 0000000000000000000000000000000000000000..310bb07f9e820a9bbd4fcbd01d10f2a3e2f2479d GIT binary patch literal 63055 zcmXtA2RzjO|5sm?RV1sDkjf@qNTP67E_-iTmld+g%FGENBSgrRUG|ocnTv}H*(*++ zy~qD`{T}~P-|x9kpL>7aHumc;mR$JtYN-L-Oyp_3z{1JJgSq4c#dygfEf*9P!SP z^@MMpc&vg#o|va&XE=9;hIzjlK7>L=;jWJN&|>{y^rc~+x!stXLDyeDu+bYxFS~qi zg>%qJxq=kE`{m>Ls6xAsJ)!$_;-^k6+I6-n>QZrG4+^pabad-`56;N7J7_S?bdE)?nWtdS z*B^9vTJOpXZ=j+w>WH;}aBWV$GNp|IE51E7o2{cUol(--k+6;)xu>e%3W-D>d69N*!Lgf?2#7X?9pZG%nxw88e^W%3teWT)uI*lT_U> zET&Q@cAvFA48}IhlOn$CTP)R}XWBkhoP#-687-eftSY3mjikLS6|7N)^;?2l)v zeqi@Hb*tB?kJ45{3<71zc07ckFYdSGsV|}?pZMl6^wm$Y&)iFYTjeBYF>>Yr)%atT zawm&Wxv(u>FItV(b2>Dwv?!8l5Fas5^}krS>*qSMU-@_WDIWKq5T%Z8Xcn(>9HlF} zJRXsZjljw5zBqQN^k!yNeZ5e-f(zSm!LFdZJgQ~}O{TlLx(11%lF|CU3_r8HN6rWs zGqIjEC!T&@sVi85{IumU7J^*9GUSVIYb=a>GwfYB_{YzbkjYCkDXGZbri^D&iL(%8 zFe@ z(YQw@`|uo*o&(LVJ=hzCGsUWF8vd>p^WSH=d00jqUR&^wwRmPTR5icsF|xTURUndY zVEuP;z4)oGlUtpdzkk0)oJZwc4eL>&L0X~PVex~Bgp)tH9-N~7YF2y#kN8wx9?GNA zGBa~I5{cc~O4;aYZkE@~?_b(le&Fch(u_d8P`vcJM)*Jdl1UA!BPhHcd8Vu8ndhXg z?ho5)n%v;`=->T>X`K_NQmWuBI(%(3w_YgKFfbV4)!XRVzd2SjCPHkGb!BfBrF%WX ztr92TbjfmeZ`<8>yURRm&Sz^fQUoTTi@MdelutE>k>YLt!%Y1A9ZjbBm=8oL9bLcH zlB$KsxL`x)&Bzt()xSjlSo2DaI)`7I7Kt9Tp&lEow5`Ny{Yn+yD=J6v2=l?2uH)qz zFPfH@uRSb37s4PZD{J?uUGNH1Wo2b3I^}~7|L@0AeU45kSJdz!b3V_f*lLPkqw%P4 z@0 z5E;LAMHdrGcze#76IV3TJoZp?&rAshwYe4rC|YD!$-Aa7tK*MN!x`j`r)YhR<53xx zJS8k5aypDlG5a*kd6kB=loX@kdjm!cV#$QinynP`-MR7_`zct2-(CT$zk9PA_rn9W z!b$E)Vsy=--RmW_wE|y6L#8Bu4h}XA4o0R8GabAA+CI&{r>Dn&SFAO}D!-qx!s*_{ z7L|+Pa5#s>zlbU@P+Hg-gjuqMRr~4iGxypfEK;zDy>3Pf1x&tstR^o0w06AZ#;bF4 z+pBZZZ`t6|*+en+QwdM%g<+rwROI&xf z9{d&iclQzLryFYM%3-nck#~2x6EBVo4Ox}9ce7#=RFBmhe5q32PU5w=jM7%nq-=AA zz2ET7^s6X5R%HePmEhkfyMCxFXzMO2)~%MA%tIZ-d4~x}VJ6vlF6_uS(jO~Iw>;f( zX4K6V#+Q5xPRs7!cX!g5A_tQx!(Q_-mF7B^Y$rkdn3DXZ4L7B8Z`)cd#hG;|#*I8V zPJzNNZ4A2{20o2^9d_UyfaDPaa?0>$uw~8A~X(x}P_%siTt}ZeKOLC17#cP-n z5-$7GHNWh*>0x@cQQ`09e-D{Wen?kS)-cO-qNRWo#1It94Z~~x<@(q(X_?9z$#bdq9ge%% z05;sYYo}f#E0R{{(JTk>3xiehND` zzp%HF4^K^twB^tj#84DjKYH&5!xrt{&*^_ijYmvKo`Qf^J93<2t05qJA#2c)Ms-a5 zToeOkQ&eTHUVemDF3;*2hm_;P6|PU7Jeg8`vBy{{7dz6GY?3KiJ;`aAd_m*i?WUW8 zPkce3ywgt*JYZv;I(6zL4|NtVqulfN@GGXM6cwc?k2rUd7ZVg2NlV4`v9j`nt}fh@ zp9$$B#YR_DjxyirOKNFtJ;t9vBiQxDTlzS~&x(_9w-hW@^U~LrNo&(Nw9P)7?ZVMZ z4l3QwH%i?F$PY3D8Tk3RsIW)uO0z$NlDgpBHcv39#J#++&@TGI;S;~_dcHaHH(Tvj zT{e_=DR8SF>+7TH>u*1nx?o~vW)%={G0c*^pSbQ&`grm0UmD!1My?KwT^bjRPT}mb z%F${{b!mt&D)f9Xz>4w4{`?PxpQdl_X2xhTbx^RN@b4~PL*WGuX#Y*a_|no6t`E`g zG@N*I6HXU<+rPBYJ|=((dh_Ou16uz*{%)?0TnhH1AZ-fPQj%TO5{o|PI~G1A`H20* zty{Owv)Vp=`t(bM(@lLXgew#B`ILdtO3jF{Q6bC5#)h+kV4rv?7On4js?^CkIalse z`#5irm}s8&fJBgoszC-S*2gvpwh~?4HbRi_@|mNKJ9!&M%^`hTpw9jM1vK zF7|L=2OMC&$oQ_6YoW9%w;#X>{4=XA(x5@>GpnI$3&g=ey}vpb(E*-jrfltZj3 zvySuTi8PJlfwf7W%N%rcF33pvhAlJe2`^Y$>l__wRRln4Uc z>9yzCUzm;Mp;p8HvQLGKn8hmxxJ#EgM{8d7X|t$891m}TD&R0nHf}n3_KO!?)aqpX zc69i}>{751U0wIkGe11`Qzcx@2Ps+vFEgPN6dNv-iM>lWPpbq`bGH>xWP)ey$u`&N z3gHL@>}=k5%66s%3I2A9@vSX`v!}v85QuE2!r_aYVc@93zFb(B@*PuRp!_*BBv(74 z*f=&;CFW-8_3)%k=X(g$Va;5SY`;!jJ05&QSXkKKe`FJJE5okv`Sf+4Ge^X`FPz5w zI!1m-9!oaV=W_cW+9S>Z)YxMTL;izbq|Jn>sRz=&TMS{A~_X@#-8MnG&N`SK^?hbvmUFrse*-y%>GJ{*eKyuF11Gq6)o$hlC?Z6_(X}oF3ud;!*fW2G^ThK;aaxSd4r72N8pB#(4}n_?+j9r0Hsq%5}^itE%~U;2PZcN$jT-9Na*q0;?^6$2xu zyG~mozP`I}jK|)8?=B#8w(^rH`$)H7*RM{&(vqs{yH!lf z^)`sW~OUa%ThlRF&I#M@6KNmDUuiS63d4`1p}UT%jLzG%nO!C)ns}1 z>yHSPI^k}~*c9M6Zas}&Tza_>btf6RT-<2Mf zO>?RvZ~_`q(sw!Qq-6_hrX&?puyDpwu%?C)>Ic@v0i&ge`~b9Wqv~$bzGEzj55qky z;ox}xyuhGrHL8)FY)YreF&n<5>0&tOJS{tjZR4ZAQ0} zJN!JB#FO;o^vg#>7^?pmx6!(BsKl8J24(JMqK5>G zug72hh($eF{Yntquf4A+T^wK=m5)BNE`3^hd$VpXMq#_|SSvR{+KJmNCu8n*4AI-G zXlKuMEW>BY<@L4FhkS%ZIYF0#>GifUuP*+uu*F@!p-JDNtv9}>R(9-46h_O4In}+c z?1)ryQ2{|0fs(Hs(G%Z4Wt~h8+93@KpNGcASZj*1wQ?;G=S)ATsuek|n1#gCPfiDm z^XXinZhkbuYO~>mMfdDCkah*?pWCgkOGkd=o?cf^x9>hrn?5Jx=+{mYh#absPal;FriW5eLl-&qb)qem~7@U%l-RlwL;FW3{rKCfzeF z=c4H<@n^5plRc4(w6l^P!%0OW^kZP(pMS@1;m|N6wL-(dqg!NUaM2g>M;*7SmqLHC zIk~o7HBKSga%__;B+!!Wqtkf`2t~-oF>|z>SzB7qFZamFn!@ulZicT^FWaYtT~$wi ztCz3RMfWEB%6kNA=D$zBLu9+MB)6-jGn15HyI$R`W8KaZ88T$aMGiG~L9@#m-zq@uG}auae|9(&AYn>MDeWMv;{VEEg_4jw;>ZRHuR(%+BeycIrxc zu{4*eoWIsIYdyWsrYK3$=hhXU{rJl7-%5Ya-EPcx7Gf=z?2+mz+fAL5Dr>*~%Bz?+ z+1=>QRSJW|@|C^V&4XUVNmurJ*}+qieazTFM>#yA_m5|if3Ho3$f&a|3nOOmS!p!& zNeW1B0B#_~Q!Mq|B8^W@9<3?ratd-R(@nuvi+n+!*{&-rREbm{U0yA^{d5mK9FP5H_*xR&`j`ckY@f{gR6K9rk&l$r#mJ1m^IHiq!@j|D3nZtbN z+jHw9)4M*gg=02j5%E)YLq$jSoriY)V%=xUWvPzd{Cc7789D{BtR-7#2BaJRMv*uk z&4Iy9I!MsYRvNnbx-G6R%!qTc?pC2b+w_8#T}G zq|J$llai50QUR%_HoR-=rw!?w^snX=~R;UIiMgZKv+- zNnh+jHwAT7$#(A^6oei~OT;Z6&P3s)BR@<@>hA>t++#ulEQP{Lj%sb!kNv`hiB+7e zdDqjFLX4Uv;QAT)#ETeJvmYvK-k(m+`*4IX{6ni9&u;QDL@JsIU7s&(=GL;dG6{ca zxUsVu#E|$&*~u!aJ(9_^-Y?%!+IIW1?SIAC@|@?AMv5UK2is_W{YYt9Rj!G$B8!)3 zzgL9tE{=eepIuuI3m1Z`(D!hHk)EFH#l-!Z?#)m9s@t-0wq;e(HLe>sUXG55@fk1N zMs_XjPaHfjBkTqYdnvedZOzO*_Yn%2lqS-;*NeO&V~^l6$emtb_Zx4C02 z4S208Zl-n;g^v2kod2OU&6YoVwk|TiPM0XbD#YcPy5l_1<=roS|NMhU>VkD8q2eK> zNTHgRLNCQsTVi>g9J=x!;byY%8D)gOU~-`3>Zh0r2*$k>1WYMY1+E`R>{L%ioQ%f zLDt?@({>Ob!>V_GW3t-!RM07%()U#2?hrhF?@TJTp`5e74Gm@YJwpy7eA4Pj#TZLA zsvrt-xMU$7Y`lu_8|c zPk}{?0UP>OTTYiTmgk8wJ1|(fxFyOJxnRO*i zN-j#r;lxHf0!8D%MG56+3iepY}}8T@}N9MrvO5u5K+iSr--7oh3TYm z@mX~RibmXQw>YaWS zDG;GET#@s#+vrb6o=Gv`+PSDLr^n$FAq#ZPbwwXmJ2!>m7i{}NaPw|v{3|bVL^0fa zOLWbFMMStQgB+yCOs!lB3IOPqY*2^9a`U3Jfoy4X2-@5YUDya+HbaJ z)}LH}FQ~`i6P^)key=~-yFxw*&hPy@j4zkA8)s;6-{TGxF#hh!o~@V9h2h?65NV9Z z<}xv2vObH_!KZUl!487*D1_nn=I%$Q)t*h9G!#rb`webBKHHs#eh1rgoxQ!i^g*27 zBF5$>1fU>Z5{Mp9xrz8@jcrAZF|e|-x|#gL!-Y(k!H&nKN3S{Pn)DC)nfClDP0LyB zX?(cL`}?T3<%AX!(pf;8A|x*lNX$^-wTb5Nr+++mtFw5aW}}inEN8*^G%2cQ$m|0d z7|kHpE@Z~|!j;{nZof-L1Q-Kpjxp+dQ8H4e5494{^BkJ?($8Wh1;sEpNf2wIc~ltM zt^q15)N8();aj5dpX~N@{B?@Xd!M+>fNq7nh#qJ`Pr-wuUti9LAaiITYOwHhTD{|! z(@&*X%Va{rQwez+^WTK+6>K1;AVENdQ8K#pqjK8x-rn8-PA-3kx2DKg`MKStG(OCp z)Zf(-D|KC6oqS#YGvrF8lJQM}Q2fz{rrQZ6)f5t+tTKLyWn6*8RQx;_c$M2+Evpa9 zX~s4!Q?A7E9C0$W^`j}Bd@x9a-JX{R<+Fk&Pb;pqwbe*RjR{F+7H9>SDYjjP2C#u_ zCALRjHX%SV&}4$k+*yVyqIgt9&qcjOpMyFOC|S5ERNE#5Ac^6y2RAXm{s2-6DZg;3}jY7R_$4)4RR66<%) z`Td}wz)6D&97r>ogMvWr-kU(sQGI+^j**Op@-&12(3~cdN|SQ+DV66Z?s95(XpAZ| z*7ERgZfwv*%q&g@0`o1E^6koF(>8Bu&{Ooan9qhigTngKt9c-2j1xoOytx249|r~U zn!t;!-$vZ|XQ85;t?6~)KXc&Jv|2|B*jsKJla-WYupZ>Tr=Q&$$S|qOvrJh6f~J$ zbR|8*@f=m^o?A+Poa;~AYAJ>}lox&qpy`>Wg z7AaTgn!gMTBrf@xZ+J0KGRTduti&ZjB!lG1ghAZAUz#}bensZ$)vKLJ4Qn|UAJ>j- zo{KuJql*L{B?Sv3kMp5TV*a7?y0t_Q77V7}v-ZtyedXvAVvOI|VWU7oXC;O2=2VRA z!NIg$=S<13&danHM%0HCae6dduJT_5sgC}5cmo2HkfSvp&&8T$Z^6n(rA5?t89>-# z`x;5)7D%1*(Rz7-gClGB4>w91&BxP)Eh37Yz2Wr7_E=6{9_&-9pum>*ps4|;_{fx1 zCGK;DQ?)57hY=l_+_F3|!4=4Q_iFl_rGo=4L{3+BAYAN+Xa&UfH8>RWHnehe-sa^k zigdo-y7w&gb4h`|f)z(v5G3!g>V7#_BaJ4%!o#f&h$$y1ObE;na^Yj(!|Kh{Y2G?Y zy+Q6g7j&&DdLYU+K0VE|*;S}_uc{~#n3a{2dqg<+jmOQlrY^9vkMHfV!;!Pb^F%|G z%GHUBq!`=G;pGaDZ59Q}PJ=(;k*}{H@{}Pfy6epXKVGj6XrJ(p1Y-TKAdV(i_Oy(Q z=2dCP8uL?ZVO+qq${cJ>=@)H7sS+L@&ONMT{l^isi}CQz@mTw-_bfn;gK4^a%1I)A ziKi=zSmP#8t(E(ERT^03cW8`lX~go+V5eaqvc@joo3%&mxYV1G>U)2;mbbdn;So9Z z>@jVx-GY{xxpIk8K#)yJ3NsacBS-p5Jzg>Wh%Dv#$5L!jieFsWfu2O$7!7bG?{SnG ze_j=(lV4n1ULt3bz7wL+^61!0cawP{3Ji`?%(&h3Uzz@y>^JZ? zA>a>*M8lZ#>TBpx>wl!7_v$x^#?46cz1@tXFP{lgJo5Am+u!#)-FB@3WVh-!>x+Ze zXO@;U=#KyQyC!-Lmtnr`TTwSMKR=&9ilf?H&~Mz)hX+zGNib};qTUnpvSC89(H+-c z(T#4KGDO7>7?07LZ&>o%*UHezS9=trMQRcRv4aP8WG<<;Q=mz(IRB9&;#@%aZ!c+_ zcFjnU+;C64aY&?MsMhD>5lKD}_|x9JfvoE23vQo$TU%kQ|R7zvv{^BX`q6k6oR>i0|OYv?>-9u>hH0;4AW-xF1N_kS)~zg z&zZ1dJj>&9qy6}Y@U8oE(NpbC#H1TZGdI3*qwrtm z`aSmfA_{Ck&@eiUroDB(E}NGI7}N$JxeKKeYev$oQm}L^+ztZN_A9XkI{cwU;jLuV z$lW27+t92eet`cBE3&Vz#mBVV(~jC$wN30?)W_P|$P@G&&$V*PmX4)oWSj?1x)WkE z9F>O0jotFEyZ5irK{YQ&&}9n?!{hB_1s?Ut{@L8^+}^H!@%eJbZN~5)1UX&?xo27S z6gnZ6bfyx^%WX0GfA=__AM|;Q2yC;pO)VQ$>V`7(#XLIezm|P*KX)$bE$`6=*{_kR zH~0dXFx)S(*D5Mfwvqz2JB)^g|7^VCISq6FN|o8?>DE~@#U(XW~qc{tF+-?59cld;{;9s+^aDLFpO?7hde+`w z(!t-0_jmVK=WsDllMrjXH%Gkm{hy*}M28a7y^0UU=?})wAI>!HCCToNjO~wXMy54a zIGyEemILfHEG+(>TAn3Rt;oMxgf(Sk7Djf(_EaW%A-hnt7T19Rs-=;Z@~y31hU;BXI4S-czl z@&73AzMUSKLLXic5Z5c(W+wF$_q0+|dsNADHrF zCWO!VhzNMImE?6C9LRWjRwVvS!{fDqd+#y{($TMe9!dn%Yz0G0>@RiNP55y=es3M;2#<%J{dZ@Btr@wd-E=#s;dKVW^MC{ZGfwb5EkXepukwg*^Y6xLqi)n)| zYY#utd)fW@rx^hU+fV;#U|pQqMuniHf-45-iPigOv}9-?SkJZc`hW(CYDhE5_r zd7pnP)dHY(RT}DA$aHLB&wv#C?8@$)9!}mErKQ?c6A7w0FE!q^bl+tFSA->$f>0*c zM7s?d)?|k@XRbg({k-YtQ&+bVn4oGC!(XLQ_9%|$=kRcIwi5ju_H>r@z_hYCRCVdJ zT%v4r)~53i{WS~qklDQqE_KTwBW5}cmvE~NOr&&Du`q`lUK0p;nR8rMH=(0h6`$>Iz(Ah+sqj`vBmD?LTf6ME1?xt4mMvs`9yQfBz6aTkLwYO@T%8uHq(LTOY=f@b*=YU)&GZLyQq8;0``Hm_k z$TK0~IYCrf8CB2>ajT|lb2Upmp*HTr;lEoM@Ki*dt!LpWV-_ZBd~MB9=>9V}pYLma z3IeB6ea|X(?3S8kHq|ltf>J43lz%Gbw_pmZqt>`}ezrm4We1w1E*rQh9*++_f6uty zhk#DOmc6_geW_BWG>eGjlRODk-#^VM(7(~V3Z+9DbWM{pF7LWCys61lUl1^oG0b5~ z;0pN+r9+`!E%ysG{3|^b%nuehljXDB19k@;>i%we3hi1iBS^bq-xcr(z&>lce}|6q zREui(-z%Bb8e@u(p>Ni3o{Og!GSmy^d^sNjGA1ggo0q$R@C}QLC+PdknPdGTeXkb# z<&P3|V*>C;^iyR522eIejgD5nf_;Z;J>`P5)(i$S?1Q2H;xU(-)h+~VUN%Wr9nzdR z#mJR{od8{|Q;d6=y#6r#C8Lixfbk&GuB5c| zFLPq^s+carzMt5HXKYe2IwjzKEWW}Cgo*YCP)oH@H#-{f7RD{Tftr`qZ**bGgYgBE z;N8o=DZcCd)^cf5is6VzGVcF5I;zOF<1Tv-H85!WO*JUkp4_e$GY zemqom#vTC%iZF(wAZ2IR5f^DoTF!@Y72+VCYP$xki?z?@}EZ+x+Axssup+Zr+EfYHW;guB06ncQ;>S+Ftx;S910C zey%RFO$nf;#<_v}Gke?JLcRF)H-K%xJ2unp*?4%cD=RA{#m^M#_xLf78otFs^iH`^ zC~+gFszmVK@lklhGfq#_!vW9nsL(i7iiiQ75L@sX?hhWA2*}@0xMJDbu0dR*tLmUB zzrNd*!hP+?!7CY#R#R-##y z5S5a&x#aPQU+c3f6HrhJEAs%IfFFQN4F|b;>;~$L92Lk<0N-IK6OW!lc_APd9OU?c zeau4ivxR6Nu_m(eT3iM9@2q}xg^7i7N6hO%>0tLC7u8C6|I|Ud z=XFz4!LmrM$@WdR#`X)tQ{QuFL+e!O z=qWi}xZwUPum^yr;_~EA4^ueC08=3O0ILJwRX8apA$D&G^P@_bp9Ne7;9e;=0*()g zK{=}b0p_$fGo*8PaS^96MNJ;0T{`lUS#iMT^faX<8#z}(IJd7Hc0Vt}e(C|iW5!cD zLb0SL{?VH@b^n!k(&nxoK!IRGFbII343>QIjiosCF6hSB@f05B+;4!rORC`3<7cMg znyzrHHc334Yi)TQbz8qh!}|KMvhIgdCBrXZ9)q}}fPVl%U=JY*;rK`(_y!TEXaA}& zb$WXG!?qazHT8g-?9r}nD`_oBoRQo!?*#doB7x{JAtX?LJlT9F1q=StM4OH^sa4LV zd%e%fjZT6`gFu|wq48gCWgT-VHwqY;e=N#=s(1deTU*zOi@p|%fBtl61wX#P^h!QJ zgflJy{7rj9#rs1Uxp_O4STw*7U}rL-{uxdDwLiT~-92Rg)G6BiHDnSLp<+%lF9QCh zf}dHuG{7^#Jb)#u-b^V4+sDmHX;$?7EZuR4O3_oFJw{xdvqs8J)+oPQd^a{_m*KbE zY4>47lZlJ!C?A`t7sADD_dErO87*IK)XHk^`wS32Q=aziC~(SJEo?5V=kap?RFuRMqsj;Ubed)YrZ$h8t{65GvJVPxDPW1IQ~K;1(}@r z8p3U8RAT%M(Gh!nKTGcN`57qz+5Q^+ZaJPa)tpHJm%Sf7S_%gvk|`|GaLX&}p-n&V z8{rW)w{3vOFR#oBt4j~?vdqI4%UnbbzU^lX@qGT?A$DhFA=p^RJfO!v(6IT}&xIMmz`pj*}b zi+=BwIPOMnbYWLD?hh21&q$Tt%}3zy+)0+$<)P^jgEr2w!NJoFq{BBhhGIxsI#YIQzAsT|m1+pdg(*R=>>=m#riQz0`5z={iV8EX7kB(C<)|#>A&}6cF zT3deYh8PK1yZCc&xA8E%Q36$}arn=Lp%`lAnILy&*wn+ir=pRH{vyY7V5EQtsy9oT zx8$|Dfs-hr;t86RH2bNV+6F#Q%JSE~C#EFBz_d!pha|p>8*oi$9Z+@6ao&(t!~4b@ zy@x6ClsH{=8hILMZKvV$ry~#78xPC_kTXZF>K|aT>I#@12>XrtH{x9Q$xCY+I!XM3 zh?P_qmGSlFjN`dmI{2#NBOhyqC7USS1EFCnz~0dh;IA^Hlf8}u`cg~4BHN3ng6N^r zt9T>7ZR(mDUI9qDyu5%<7>y%=fBq!C{Y*0yhAVxc^(2{FPp&gN8AV?z%u5x{_((*x z-t5h=*CE-2b#>6qFa7~=y>-i9&ui!k`qE>j^R3A|0V)%B#>DGemSkb!v`BSj<)uDE ztFcQxn7WsNo`A6cC+1ukDS2R{BSx*rue<4X-Yci#WVpO!^rcYwdb4oS?$5DGh00-M zjuyFaY1oA7oD?8MWFytB-v2TG_${&KK6Oq<8xKYfI9U42{i@g!&)r=z`~)rxOwJEn zTu7;hYw9HR_4vJY^TU2wKz#wIT%Yzh<=!zJT$PFNRG0Zd+|Q8_WaV(ez;%q#L1nzz_hau&YD?fMWl{fHiQbYDaf9KHb{_(Il*(PfX}U zZeAYz>(5ZpJSB#{&s=YT01+&O6c(kvQ{k%jZUgVNgtm0vl4I{(-)Px++p~ z3h%c;rd#89fT9NX*zljuHN^%}mwTTdR>)(B-;4c3ULLsP3@==!3KG!6@u)n4Upb?j zWr3$_NZ^fbB=p*c0O2(?K2A|@Mi0J>Q9D)J`$uei28Oe6ghdM$r&5uWlP4U0ZCE7N zR<$>v_8aFd5>x+<)olmQ9`7poPTIW2CTNDpGApKi@_yfKRC`7ma3<9F-n&73wwiTa zDte{E0fR}j)K`(3-yOxli3yG#=8Rh<+;NR(sS`Y=X@3n5%fo*914c*~!<+kaIkN9A zYxig@(aoIZnXnlahb*Z%u=X!hE8Y^1vq=zq zu45()wC+UKiW`I{n7-qE8r!!)yaW%UXu47y51HU?27hK3DV`$z)=Ll53Nqa$ zSo#JB@3MtaHESfg{~8@V9w^X|4aQAn^nyCU1B~KiOC4!*hV8W6IN&gSw+nrw($^qr z#!?fMvQI-Ur)$0gcSv?d@cBlJM$W0X71RkB!d4@*M6wncA0pEx&^$J?$)+K)pAsH;qu!7I^|(S zF@4|?_5g}_@Zw-7P0s7Ar>a3dzC(~Kqe;7^lN^mYFhID%{qVndI97WpYQ)t&I;Uq!}Juw=C3e6y)^mC z>hnv!-+n#UAP=5x)>G~*^UsgXAOH6f9_OT#*AcQaPY{=v(8lsC>Q;9-Ei&(I>^Jx1 z8?GW!ynMaa6O^*kP^lMx`LwZ~_y4YUd)9VUlwZ}1`b&RLhS#3-%8KJ`(vq=I%ygc} z6VCPd>U zk5$etqOe8C1%2H;l-uiw`vs99!v5Z>!lWrvQ2ZHl@w347(>2Sv3dP$D@cRr$R+PSc zFu=z^5Xvj6T{%YGW|;V4ajwX&jqEb;aS8#drClzxn)GE^T!g8l=)bkWf?E_$Lh8d6 zMs1~jZ)D8Kc>5#`5~(@aF*SND)|=oEAy(eym#JM(R5-X$y4L=P%2ii=>^77191o!194+d94OT#egYQ+2>KRZ&WUZmX z$>njDiNafTqwvJrhwsdX>JCh?`|)xQQr3M;n>0#SUNhfz24B0=c{!@B2Kr{vX|Ee7 zc?L=f3Ou6tSGZ*K`_UMm{X{R3#Oi3Y&#BV=3&_(j0(1)4I1+6pwzj+% z?DH(D3Ma5U{?FQQ-G=Qr5a7_=g-(HYAZ`=^TKOhGdZW8aSwtN4F@4Qi?tg*M*uGyI z@$}Qe&D9-=m^$fqh^vJT{>dzkowov@ZN%GLxNOjI667*P(C_Na+Q7gJDaOVSxJ|HB zcpvO-cVBe{rOCm3cSwS4R>tP>+h;9$*4mdF0i#E_LS=WstIw^r#~rnL*LZIEz0f%p zLuEny0diP^BL@6^STutibck)o760=|Yl-q2u6AZ9lFWveHAW^N+SpHWpzjp5n^a;Ro9`;G52x=-fR1p+BCM7h4T|HU>W3 zkV3t*Jx0hA$@IxER4V*|QvA`w*oQnDrKn$2Zd90spXYyb-)mv6gCL^92nHNHg5Y_Q zNOdZ;&ipQea>g%Fy3=73!G^#(Xk%=LtR(0zd3{nC?y-J@ikrUwBLe!Es&T(kCCZ$J zzkB#OabJ7-tIlbzz+m_le#vw!j#IXwgCfaeYttr1mY6;bT|D4aU~j9Q%#fsYQ-YlS zQP5##1NTs1y*IB7dSbw^{Ld-1w-heBcYpLKA4DESNW4+QC3a>NjurguI zhW#m*Box{0;qD>`{Vfwv;}o{3#ZiJW-^gJ0+BYR-*$h^)GSBe!2ijh~<$vb8uB zoh3jz0Nj1HSIs}%hn5PQN@QZq+)(g-bOv(QHu2ukeQ*&XP_=Q#ELg%Ul^eUjN3bgc zl7Y1B7%%4FA~{$9N!&Ib;Zi;4GP-YLX8x&Nl;GSx`1zW8k{{LVegTG91A8j-zxwUj z)azqC{SS44sCiNk{v;h`ohvGCmnBAO9Api#_fY&y17O2RKSL0=H=~4K=^il+8fUkd-Ge#kz-v(FS2-dSer#hvxN$v8KK-Z z{g_ifHJHnQA!iFa0-b*D^)`kOmw_Hq9>+`>WP!MZ(xy9pTN-MuFQP5p(qA7*CZ2RD zKL;PE$yArNW=7fZdx!Rt6MGv3M@^ zTvR^>W;!}~sBnPG@~n*-88HQGhh(&?&!9Y*AE2Vj?tMAcgFw-R2PbWM!={41M`(bw zk^O!`sa$O?mnNPw7per zG&L7-Q(-RK{j2K>aBK_*0_ThIZ;XL@g_Fu!^k_tJaBzxRg!~z2@%|G|`8HV(n8%Tv zEgc;lzuYfgxDe4~!6{(zl5Gg!_j^2~Xb??SybT-nW<&y}vSVa+3b9 zE(UB(ga?q#|6G*tn2<#v-YfHTx_|dEAt0gOGks3wBF@?C2?MaiU;h3rdfPJ1W6!(d z1L%}zFQPw~0_O!X#HT{fq8BN{w=W*sPpui9Rfi|@~eqg5{ zEq(+V*bbN8w7D-ZF#TRVV{#t<-iJ1(UNvW>&a8L}UXgk7!|8Z++FfDkr=C(Cb?Z<5 zBX{*O^1QN-178tnI#qRbA;cQ^`_))uU0vFf=+#ws3K2#NuUb=fcJ{YpBuM`M8h73; zy*t(pLkF`>8&uy8uPIjryX2nBcHDn1ee+uPAI5yT>)HgTJG|*H?K|&tr-r31lnw_Q zo*cX0|NmY9**xyGC%1tx*uKD+8fFPn8ZSofbY|Z}Yc_D(gpziF$bgn>U|XvWZ=$H{^=vX#&c+qay;|CZ>nX-kw|ib;1B4rgklIyrzX)*1bE5 zrq$!Py`bDc(CZO7k)1mb=_8)hpVHL@Bd5)p-9UAQpdPqO#tIh2%^S%IgVFq#wy95y z$kX8Q1X~vfBh@CtCfhl@DOf*9ao|aTet8fb*Phh-Sp6`V-h%c>o>^D+E~iDwX!B1G zg_=PXdo}Thw=(fa`(EF*p&2=t=AiMxyky=5kQ;0fg4?MT z+8cCJl>;~RYDa{DH2Y_K6^Lk|3s7%J11_V>I|U2O_t@x<(xk#j8B)r7LxgvnRWi}i z$bwfkpgW2RiCaA|9`GX7;LWYCa;8-ACv+avku*Y?hq8JwUl$WA^76o|`P)RQ0gDbj z%FZ$Y?lTQ#iX1eC`|@#CB*6m)5Ak!^8#)jlKY6m_j&aOU9;(|5j$DC$=(Fs1HEW4W zwUkJS26nw`Y^eFl*xeOTB`knU*GMY^xuCR48LHaVvLO=P^~iFi+q(@Sh0kB>h@KA@WS%xoev^hN z8$@{Ub@EaLR`fKB)=iot{ViU3zO%nD1{MuX{)F}uEAx;XvVAh3`wn6lB~qSs24qDm zF*nZv57OVilZ%UVi8ewyF6F(aDW7f!%*p&zty~T>59)w&JYMmfP&n-atWDv)hb3ON~dthuQs? z_5um2!2f_F+?D-oW}3u=CIx69R6%#{KN;)*QWnI<{RRXo{^raI6hS~Wv+^Kdk7|y3 zfeEpYv;$L|g8T`sSxmgk<4wWU_i$i+15#Eshx?c-hfCxB20gTbQ_i^T?GPGeHrZd@ z)5e$mQs@Cd;;oh6|9HU*@;dNHj^cCa!Fj>J=+@WQ%WY1MkKX}1Mb~pT6dtVRHXI!p zhkJ9t{M4KWr#Fz}mqscpQrvOiqyV4>jecL0VrO2pEddyb;kdo?w{FV!kAwM{G7A0# zRmeB%Pj0Il{MB~uJ{pPn&};wJs1SbKgj}M@lTom=(>7(%K66~)A98I!o*}dw@0VCA zOXNS&!BV(Q8sjGYM6u{p^{mdVBgL;B)Ue2x$yca;+v=Ee9Oid$1=$Ak zecCC-w&;deN5}%{#<`O}E21Q$ZLC)7+(Cd-&4C{&qY}rina8DCa-02>`BDh;@H!#&KQu>iN|Y zn9A-;;5&yFGqX-mIC3eTAZkdP9KvPD%S*7z)!7-Xn}UQ50vI&1o89z}{d`Jw{EY-P z_%CR?N-Tye3O2N?iGHz9@ej)>{bVp%0=ix+e}Q$Z*6asY-o5(V660DQ@bui}P6|r6 zvMT}Ice<^d#bdv#@Md3`78BaSFZx$KekZ0Iu-zNu|2R>i!G1V-M-z|m1$O$N>HlcD z4sfdb{;jR3Br7Q+$zI8hh(ei#WJN|tA$t@`D3rZt2xS%_yCoSBLUsu0Bw5Kg{O{v= z|L@iHJlA_YanAXj@A!P~&plSAYuA%KTHU*(C7BUJq}uUDGra4!>^hOEk(hhH zD(6h^6RoO1-L~)VO)UC&LPm{(IRaJHs!xwhWbPg8FXF=;XDZQGYDuW&n7nqaPrUUf zMpX~fAEi?&KIotNscb44^|g0S*5b(Z;G}!J{x^Qssh;o)HrlfE$KMQOI=>syQ6BZC zTZ^`KylT!0N*8$Sa`ujO+U&z^e#av?!@VLn$t5*J!MB2CN5>pJe!Gu;vP1ogjK2cZFwKjED_S-i=HG86jpGf~EW^sgH zG$q^1N|enevelm^T}zpxV(k}Gm&?gQq0wI_c!PXr+>KssrhO;e6#U+$M&c5is01%v z@&4Z~lyx_%Eq9$_OT(jGvm10X?$!;u^oXnQ7%?pMm{Nmv7_HIu1ie?iYU0+TRi)wI zPN+w=zt3}VQIk5_P#el0tL$gKPrJM^j*s`@vt7H7{^Saev(`>B3THgP7fCub61)|O*w%L*0Hhq8l*$$?JLF}|WPQ5w%#*Fp&i+!whs^|J$F4Gn3 z8vJlm-mFk0HIZd}x=S=h{Uu5C)wilP0?=)C&d=uS+)-j{24XD zm)(OjMxsO?lzId!4O>oog|9rPF12OU_@yzWN}l#wrn?kY(4Q~$Y7>zyfBLcJTd^H= zqHjdl#8I2S6*+hPZ`0MmR5(MSABtJT39?m%FbYZcAB@rw zc73tg{oY|$pCEh41u#e7J*No}@zc`E?-F5Z9vbmlTP;_-%K&25qciuEx|bm71roA!%N)@u_Va7I+Jd(T}hDkQ@LWWJ>t7^`cE)owkz*@Zo7YC zqIJUi@BI8lLRstc;^J*XtnU`_E@6+%L53 z&Am)gAM453)|!{Pa`@WKWGQ+HuR|~S!mCqU9tw#v@h6@W=_|-1Qk`u29`a83xIj?h zicNZ_4GBXp?_<+WXftwhcFp#s&$>clfGb_D4ODitjTBQNfoHpl2 zUYows^X~aMyr3+gUPD&^)kSfSQsn?}XjBzuOx}F!heM+VjIHfu56eqXZ`mN zOOY6K--5my-6FcLqSPO^A(lDApPG`wldpFg?b=1&Xg(>L+)iF_TJn~X+>#_i{4EXi z85}I4vx*{d%ac38m@}S}sY%VdKi1F81Zo%R*L8L6iQs$#zF>;X^-RL@9a_r{zl@Fc zDn-sKr|Ob(vguOG-@m2q+M61p8vZ~EOS82*MKRbcPG8v~yWeza*XMlJe0+wcYPdTVzr7jU|4ukWEiJZtc#p&D`SLs8R*4AgW5{t@Jf*;xkn2Fy{=SH~*0w;i|l!-}H zdo&dV@W_Kc25mV0ly8Ba5JTux{oKx4uXV6ZTB_Y!{Wx~M?)E4uZdDej40G4cKM0JeDYUL1VO&%j+U$!tFi>Iz7gar40 zf0FN6hMwH;B?7>Z(>dE~QZalpZv!6W%ny8Y#x`Hbg(*N^hxDVugu6$|t4o-=eC&pS z-f$~AzXKnud5kam8d+jT0 zFvdpE#*t^SKK1$DTl~$tq@x!}>RCpDaD9tvA|^%=ntp-AhO%v#xx53gtMBbs)bC!= zZWZ3$yFFx-sb>0Io1`YE&T{gMyR3v_LY@L){iR3D6M%dpa(fsd{WD$q*;Ys$*ocs_?#63(m(z=F4t(;UB*`r9lTNONr$#7s+RJ6+LY-Lzs**?{qGReQbsS-_0I9~ zNeW#u7mYuqtBZRLZVL*aN>>^K77$}T(Pk$klsDwHc$e+X1`#BU?g`k}2k!Km+ZU2F zn^@M{GVVj?2%e?ZU>zE3n-X6A4|qU&xnN46hr+;i%Jm=|k;a;0v5VOM{_RcgAP86* z-w?AIStE7tEL0E#O}KVc!TT&74d#3p90a^GGqazw_nu1}X%edS zBP7hmO#r`KrG*+0%xvindFxBIk3dk3ijYu;|9}IfvY$o$GXo@SJ%K}0tj4# z;GLLHB=PAgA~U1j?x#IpTr!^05ZV zX{^g7KY#ggA^ZC23++~pTT>Y6BIM4BhhGnGNRmrE6joc4oomjQC>fJ7B(~o9%bJls z=%T5l@sj_0eWn0R74>aQvYU1?5PXU(v}G>Hd~OBh3_E%v{e1Velx_KWlgmH;&F3|Z z%^L2U>ab-|Zi`;Y(v{9{fm$m1)X|FR8!gQQ)!W6LenqN}i3?dbu2bkMNg700SBFlz z-QRw*NbZ6fJ3|mZo!i1H{$a|UMLODHfGP_>w-o4wM=US4CSl~X? znaH3gHj{a*UwOM!5p(#dCzK-6zh%?n=#33#bY8a1h^4+I=n51uyf^5MS}aZ{@l}&l z2uwfbUXsEOv#7X#=5$8URtNXnW)qqNval3fw z*qooB0dq&+aSTFtl{>!|*;#GS>buNn@SwvhzUFE5q+5@g`ka#dp~U4&(xlxhY`By5 z2q;`V@41Io5#DJ4FyG9{qHARLI|cqUhEUi72N^Br)Bfg)ZGqQIfx#*|Ne3Fi!jVvWNsm4|fSBnpYo+E@#<*C-cC;3rOIScjErwavws z*rayv=rAlYARgSQNqhF?mB-48`+_+Z66YCIJ%tlplAUW`DyK|vg`Lza^=a`m0S@AD z=9spMsTq^8!-I z#>jy3yTP@N&Bp~ao(XKf_lADxQV~b{iI%wz&R`eMCb@y3-R~+KZ6`|`oDMbgd1l>e zy?oSwTeNvitDN)6o{=Zi1oPHKU8%cJ190TsIUt{8Z%3 zCsW(HjF$)7`+R~~ZYv%X3#_JwA28;Ja+c?Po#WDUR$}TTZrb z=C;41Vz_l;=h%GL^+Cqy=yQg*I=pWy`wJTU{8%rvQaQg!c$3QTfDpT5Ru|~(?BFwA z#frV{L)Jr<%PGE=MG9)pYith&f9?&gY9&w|J$f~Jg-55v-;BLTHSJCRptqvjz~l>o zgMK|WC1IR_&2Pch`3x?ZfL+s=XwC9ZzTZk6ejE~Su48xYadz8;!AMXL+qaTX zBhNnJlfxH8JCwJ-%?mShWlJg5jX&v{LX*URV~)d9Z^fc7QHjRZOryA;L27S_eedNM z*N1?E${rEe;umjoe+?{p#4tWNHRJq^s?)t?f1^R{gJ0{BobbqSJaDX?%zUU# z*fyFa5aiL7V|;0f{>8Pn_i>B{(aEQZ_b*fh3ZK-@7O>*f3c7KquxN9t_1$I}qrWB{ z>kJFV{JRXQ+RIC4^E^D{oP+1<^G>N5zAJjhSfuyKKuh@C@+$)IO7EiZt>1b7GsvkL0JE5* zC)d6oum#2C>eVjwzz<(u-aKEq9Wrfrlu*UdC}yc#P5mIDC^97z>!Ol<*PGr!@8YQ& z=0vk_9lyz^qg6zWl}nbSksv$utkC1?-28oV9sD76eVXTXewd%2S{Hqa>?V%N8h79j$?DCWsHLr0UY(&#O#&xro`*v+!Rlxd{?KO#>$4~^GWk7Vx&Xb zg+}|6H7VJGXs;!N({>VqlQ-*jX0xmiN44DOH{1W#H6lznv$kA57R>KA+b-BfGCuod zj^kMzpz6E|E#rlX(qwO|4!VZOIAdzf{S1lMYIW}|1^rEP)*4E;aN8k%a=jqZU{q5& zbmnFAVUIUSlSB<7TaNU0iu(G(U^)KR&GhB6ln0$^7~{49qLE9&avz%=Xoo6jh^OG(mROwr~?o9rSuAznwJgFnx04c$}Rh+9WLyxT{1{*_=& zQDL&GoHnhf;&!UWNS8av!c(TP?ED+$4Up|pjIyr@48VqOy7RpcZP_A6=Jx#(jGCZ- zeI`96zGuUG$6|P!+6kq}+NZSoG+R+BW$FZ~weDiy3N6mf6Vv^lXoI4DNhMQCCi~d* zylV72`B7-d8RaQOeG3x zm*stJK6tvL^I1A~#3tyLns|>99);C#*>roJD5Q72`q-N3 z_buvoH-Z~1d_iT0<8Xx_KK6)YOsB@vAl2RoE2a<87Tts``$+t%v<555a;F1dbXcBy z_QclpR_t2JR)Y%OUM{|-d`Rx$%?sg;JZyYU-8%Tio9*QJ{!&>n zWpQH>fR%z;&vy9kXz1FH(3F312e}^qKNp~8{m#~u2@g=vFYi|UvB@;nL|0dLSBo(9 z*ig8Ccw=w70>W@YK~yP~MG4i;F`E)KbA7PsnwpvpifBzg)Joz~%CbEm zLVetrrRWl9Q{47CmHhMZWbMo}9ZlrW;XU`|YcQ7MU?Mcd*T}YR`QzEA*X?q^jHUhs zKYId0(EQ1rO|~nxeN^#l3@`R&j=$40GEB z7+?n541jNVcGhvKo%`mYo-u$?fn7ZjK_6QNlhN4MhG~jex0gzVyGj$;guLj|Hz;{F1>QOs{+=V z#~(FVaFm@b#LW4h;&zv+z+KxZ(7pr;Qx{%hxc@F~-u{b=@v_(%Z9gapT^9s#;JrGC zqK|@o7j62qVLrppg$hjHAh44;#^lz1R^(v3i$2#P2OoWnoYeskyr_@wrWMB5MeKIO z|17_GqCH>ZRgLgrdlOwMIT)314WaBsXV1Pv|D;dV7x81CIhONFC%2gTEOhFxzv3gE z9@F^zCHZknUmjlLEoHgDV&n+f?0KddD zNWwc5hh?YD!u0u$Rl5xjbx<^a%QdRx4}!|tPwFr}f_w0p4E7XxpPGf8A@>ZvrbF#{c+kq)y`Vf1 z;L`M_e}_pvvWKZ)mLeDnPoDE5>I%XaRsEF`Xf~sv-;lSe)T*e>+a`?bHE|tgWesMd zL=RO{qF{GbaVCrNZB;?6RH4l&PnY^X-&!K6-jQw{r}FRnye^?j8ZUhWzAi7m18{56 zKpz{O`M1A_rnhvraW^c@fPT|7+}PY}Mi99sN6uwTfe>TA%Y zFA}8o2%5&V#I?#ktKA>>2i};0d9GP04@0nB+8~2T&263|x$>)jPLm1F6gbF>4j(@{ zot1B`tbN6R0jQ0+OFtKg!&r=D?}WN*VikWs{wSfUlU0af@H1$0PTcyX%Cp!*E{LB4 zS4EtMQ&Y~|d$DkLeb<8kOfU41)gUF8)o}>m7=yQrPX#+oJym@!X8-u_W|98b?sr#&wJ6}DqagS2d#sAo z!AWbnXH^35{_&%MDKu);vuDqOMb}%JEpd7;8_QlP=o+qp3T4c~`nnxa` zaQQ}LxiR^+&x}bh*^uXuNEBz_s&_&hEFgQwp0;zy#V590DC3(d%cp%rY&`NReu^q0JB?Gc zVNs{UJU)$$Wp1Vb-r~!VY11)YQe^wG#Y%7%0pJIQSs-G; zE5`OoMsA|JnLA%FxloBqY=JT4>_{DzrD!~Mjmllg`14PMv7}HeC=CG=?skcy0AI?l@Gtx@0~$mhwAcWFcS$!(*E%peW{VmWcX(SlYoJ z_Y8z>jCXOp7q`;3ARnlZ1K5t|7S`xsYO=XXEv`Hm;%H@`7 z4$8c^v7W43er0$yldApGRHxMBrk_|!o&%9!<4^zbt+Q_T1r5l30ZH%)cwrd1q?etlK%1I$Nh5$ z)&7YLvIOtw{%Oe+P=CLYbX#(u{}V{BeDHhx2Hp_P?-)z6-~aU?@^^?+b;|YDvp0AC zm-j$%iF42hvp8?D!=ce&_n>}N%S3n&c!l1!RImwp1Tz)?Iu0syEZ~N-D~8vNd>V(t z#ZKQ-U4b=wg3UMF-$AG};@v6vzrVGKLxd#cL(4BrOw#rZt+ybZ({A_7K=97i%sJ_MkVWl9r6rPzh4@KO!hw|7CmgfUaLMptXOUp zow$5Lb1=uFUGGrsIBB42CiBNa{tC%Nyw)4NLuoXM+Igx5lj+ z)rjX~9>LJ77`?DHgp3_GADE@6S|E|efD6vWI_p>h&>d>i0aS%t4&fh&w3)$<{WSFi z{-tq-uk-Hu=F>DA|5z{cASMqD_k~V)s4)e=ZCwug6$D9$FJTzka08A9hkT|K zMeM19WW>oomv@$5v@8|}P~DvDwS?^;(CL&PonlTSB&@c(9D?qtB8|?JG=wZ ziOY@kZ7#-E;!qPH83)y@`gFzb=Eny@$R#R2!-fZJzY)+HP5qPGZ6%=4f150&m5;k=z`@U8*^sU2j;j zot0*^VY&bL;qE6p$SkP&xAACF{Jc= zCyS*RGfd9#Mfa6rQCS?C(8c=*8C5Z@dqky78w^MNjgz?x{8v4$$ej>#k4oCF>gj8K zOy=APPt*wykORTLTVFfl&q4Km>b0R8`8PYQOe~|}f|OM))0b0KPY$Mj5Ke8l3ULR` zzT>MMdjF_j>BXz5r@8^<#Cxo@KKQZX$pz0{6lp|hNC4LSb78ZO?$387f2dexLlqcM zegK462WUEp71w)29*$nhI>BjLw>acu8YE@hAx6oL=L`L(qP>Cq>71k2n6}d?gA+>@ zkdL?N^3&$->Q`s=>1i$G+xy+cPE)9ZA+bo3zIxi_^#jG1i74Wb$U6itO{O@i{+|qg1q@E*|feOce_d*$Mac=jE-jS(mC>B16 z2*o|RHvrk=%>3j9%R>#Nn?BlF=WG%1dllh&cHqf_tFS#LKiA^;Z6g&Srwi~T6)87$ zh>@p5?EWLt+l&WIq^QpP_euj$JsIpx;txUz|N4aO$&KIz+#;i$x%!P2c|n9jaeHjG zQzR>+1Z)0e)twP>AfSi(V!QpJX?f+k3m=$+o)5iJ4lhgj-*>Oc6mZ?}hK?51PA%FX z&j?O^(OcH)A;F3}vW(Q7M~oSR`&u%@Z7t;m)(2mXYBr@hcL?n14&Ncrx7cBeV71s! zUZs4~TPMuE&k!P~YA4rTOnv;lBW%2)M6vr?0`-_{$ z91%)Zca=+&SpQM6XK1nT`vshuxWfkQV&}lM-8kaV0?P=QbEZ#Om3QXl6y>qL-dTqC zT)JmM%Az16RHO_dKyQjXE0^q_f>F%(-@`xGef8f=8Gu^+g62bpVZvqiglbo3&(5i> zGVBZD6fd^hiRPgGe>csZ2TJ3AMFnoUhyTM#LZjS9pL&*ktNq3UZ8j!bNmo^KI7Is^ zNK;DPqSn<-bJ~w*eZz;=)R_Z?7>{T{b7+PBsRK8m^2;I==>+HG;Cv@nXeMF8ZVOV` zN1mv1x9h!3=ljqM&McmeYy+iu9JXfdc2%d6IyWdaiUv%gTyz^SxK+ z?ser&=s%ef_Y%6H-TQlMIk9!IbV90nYWi$A5e%0NVPfWru=*-Lvpr)Eom6nmUb<#Q zDID&|XSvC8-|N3yl#Ac_70m(KdA>=5Z#@37k=9jpX4$EO^Fy-eeR8QekC=4PzQT#w9{uJ2Fcq#;ywEp*dr zkKIiqm)x$53GX90ho4%XnSHZ^^?}Q^6FILHy&jgPtNQ(%KX>_=R-E%jBMaLp(RhAm zMd`zqiza8^kLHYb>K=6J&`y+4jO;Kz#W9f zS}^}UOEXFY&G$~FmP}T$%e+oya0KO0rG>>>j9(uH-nB~7cFbNWp&V{%8|O~i$6wp& zGWq?uE!6qjt+|D{h^drMc#E~tm3y;I^fGn!9H!8B(f_LOXvo% zvt$wn?Sw>fy+il0P(pWYOV!QF&ov#hN(G)?m2z^wmj5LWR(z7%&#pAQWOw;+kGiS6 zu9XN*^+~Pv?!*?a=3jE4gMhEhMwz8&*&x^ILAs!;3k@)O@4ml=sYCC(oL=(XgG7$J z7Hwg-8h@u+=ULv-pHh^YQJ`@LJ?3ttUw^N@vo87ao4;fH+nLvdOc>BiuM@wiYz ze)QNzjQq{u$eq{#i+%WT{ThiDhK+O39pU#}lpCvo%QYVZl@LLMr z%3%rq;(%BY(I!bLDgTwzu)M&V*pTn(%k8ke3ewwn(23;RI~$_nF;5TIqq8(CNobi< z+9yS%37UN4$>=|kbu3bSBG9nj#v-=Qy2C@Z4AqdFPb|Z=s2%o~Q!3S~Se5093%qL! zWb->_W$l(py?_73#~yP?mYYwkS#vSDDsIm)7H(8R%~E^-RmAiPG;>&a@N=-v}zj1u4r!(u{B;XCdP1#^w|hpL;0D&*T<*Ywh*2nmepVloF*diWH7U8*VrIrAS#8QEK!S94YQh;YA z(4T}X5~->+*Fd2xr**TN;(wQY9USz@{C8-dgsCs)c9u{o*E^sLf||90pZYY#>!qco z#c?l_RIVQ}^d5?oUOja5fN@RljJ*j)Fk;Ms(?yexaZ^BP5Mc11xYF6!w5jX3t%wBk z?)Y7xtoJ*5l`D#7OPq@Cf@=xQG*r-Abdlrl)R&BLH5&2 zRx;tfWSxAK9dE=hel^!xepE3Z#*owgQdK7rkr*`+(A&V zNGFqpJq1Mn{J>LO!{T@>!>Yb!3{$MXmR}1u0ZRNjU#S-J9T5VMmN8K?NN2T#29mD} zcahgdLW|QwjKukU$qcOUzJhLi!zFuU#5^tf(EqOaLyUp^bcM0xueIC7QmWcTu9iH8 zRA34K#wScYDieG-Rp7sK-aP!^Z~|G2a?!=#M! znHdVG2svdZPZ|^MjBg-2Rz#{tfEllUopqZ7O&7z0h8$^5YE|x>pFc(UL#{%Mvmu?s zx)nhr-Prx)WdW^R|bJT{^G3*UhzLAyU8BvK$2>^ z_P@}waK}h1pl4=={z}uT;Dy5ObsLlfWELU5a`bo5f+4Q5X*2e5)S8c`IG2g3##_Q3^2vQO0X%5|Tx|LWm5naxyhOM;c~ zdxRuBLWHR^w?z)Nu8qKk-?RJe-XTlI>| zJK6Cn-&W*sW^V*_V9W_(8bHH$!#A()y)^KCx5LCnA@%7&ovwV--0V;CC<$CVuRRhy zSpjB{HEg+azW6Hn)IZG>03fUX#}?hfjMGlp8$Z@L@x^6{%IW#=EE$xBEeW{Ny1GN{ z(nLEH8_1o4Sm92$VH*Hp6vvRWjxOe!o~|nL{{RbUNg^;L}QmVBcW;fdK+!+7wqt_r}~qehC@zdY-c_tZrl$v5-4}9b`&f-Iy`u+_;EZEdAsk%5+!CTmTy0)NY!^yqbj#8tg;SvrLb~qh?!UUgpxKGe* zy~#46_Oq5CZGC8R6J#?Jg%^3E>^Id2LW^^axq%Mr68w7CgQ zZvMK{X1x=^u8*r~`!ZbzTvKY)C!QIOOF6849!OxCcx0G++q=($*6pO`k%RlkMQ%B1 z>XPv-1XCzC^sZ1*)lYJ?m6ClOAzMP)@XDH@tz`asmcZ*`$6J?U{GmEOl86{;fVQFa z@Uz6d3%qwj(0iReP~USxjQwpg47pGXS7OY|fRc}^Ddkwzgx4pW3vWtoQ6<5T0k^`6 z97Y)%UXD;Vz5@;NOvktLr%he`r3>G**I$8ObD!lx<36`aFL9Dbz_48DK^9h4D(uy* zn?UKr8a3)RCQ22J=G%h5y9HplG7KldT?hG_PFa-Hf)Uv+qto9S6%|GJmSYH%qSj73 zCKSlFK4z}*AV^-j)l+H}t zBzRSlCB2)NhV&pfBnUIDI`?tx`}l&}sw{|%*V(OezLN_|d}K3TC;IN!Ve&K#whlwn z86A_bnIQxCP_v7v1J2!;V|2N;RK0-fF)jG6ctIqXOR|ituHLrx>*&RiJiEU$Pl&vA z&GfQ6Z34-#4VE$cRxC>}Gm#dAPy>`(vU>p&iG6xx5=^rhl->>P2*rj~mrr)@^{mhl z(Kq~NOf`CsH&T~~(&^j@e6HfjXYD(hW!CeO&NU6nP<`x7)oc^*cTK4)|n?= z`aAG-ex=qnc(@?c-pz}@*ZFV{&{OYG%X~vcN&sNW+TUGmz>Q<6@76Q3V3b7g2g+}d zYmqoX_P#zw7HI(>9z|m<&25x=6AN{uKY^EKQyd zNhSsbh6(p`qSGKbOFzxw-EXjtY>3{k9*c{M+Xn1e>S3#Z1r=k7c?tSK#8(m$Zp5l9((7UBJ1U7& z2E26C9}cL0*D5PtBE03^{@is2|8n)mhOM`P%^u2ZiekwP_6Mgfd zIIZ9{*O2kdN@QEO)*Yx@L=BPL6pn0WD>V`IxoJ%ejT-&$t5N$!$Y3t651fJE*yG0C znCN0&9*~s-F>`F&?rT}t!_<02Bst*z+R@-6pCaLMlB%GrU9$oK_Oxfpj-f>m z2KS`OdN?M?`Ba-QUi=Lg6%-@jQY2d--WoWG$@`ZNp4k2)sub!9#?Gt^t;3;oKvFyN z0@qE^^(^}v2f|hMN~+Ql?6RWIr(EfMLSy`Q*xo$R{ZKUPc=V>;tZy)Mvz_?S8xUrC z);~jext^-A`ZAJtVZsiljvLag!#UHamvr81@v`*VAafvOl+1N~ zWEg;Y>hFELQzbkHPz|^+UxHq5c%NA4?CM~PE}Md8}{)+F!(hI zW;BlVVDIR>@G+h8cJgw7@7*7ZJx#}EwCNOc zGW>Yq^=#YMel|QWfR0gtBXpI1ZaflZKQH{04hLHGMhuOw>hVVZ0eXzd>LiuHvx_K+ zvFR`jd88r#UNPLCZ2A^@-w<(Ea8d)qZSw37kHbLlH{|^|tq1Jfh~1uW$cBs#OCA5j zro@7WHyb4G@WgkmM8_j3Cx^(6!7$h&+rYs61(g_xHrw2* z58d+ckeZ7FgT8R6VPy%*?SGMPuKWokR$!!o2aLOf;t6;DMP6|H?!CEUyAT)aLc-n$ z5P@@mT#=F^&?odBD6w6L_wOOS;T>>@eO5;|N3g2CFFmB7Txd#L`0|Pi`X;E(f(%dqsvX~~zrRKpeH`d;uZpnW!_*{7=px~ODI$O~d^77fE=5fR? zEcyZpy3)EcsDdsw_}!*7?)IPXz<385&eTSn_^VB|t4+Oy!?CriV?LX;$m!YtQb#1$ zf-#V3u-J^5K75Q+Yt%nk&W%g#+RmW(4HThghp_{)0lvGUo@!y$jcfi`}(rCt$Pi-a_;)4F|fz>-mr1Z8EpM zn<8J2mmtRjM0yAylm2%*c&UJZ0*oNB4)juE}9;ccB-%&T|&^UE6-lePYz-d zJK4XxnpODON)yCLNgVcb@0FJApZcmT8_gHLe3dRHk@(T})h?iYm^s40LLlH}by5v{ z9W4)8R>&90?qYvZd-Q0pV6>V_grC~KY8>$!sed+>I-QC^z?4y6uI+ z5t|bg94uo_v(z8IXUsjeM?tUMIp?saHxg^!oWFZA@u_36lVW&xP_sIXFR`li*OT`Q z1~AkdJs3zYdL`@{rx_hsaqW(i-@7O4Hj|S4_8qOy>L*{C@Sx?$gc}(3=~o4nPMgD( z%rn|fq4@#VV8f&iidRt*b&0WbA-owy^FueR8{p!qXYs6?h!!b|Bffo*qA>p>eSeNfFXCy5%k`{Q>dxvF`<`!lp)ZB-H)z*@^);l z(Qzu}@h*cTyT~x3FCe})e=>QhQ$o|rs~)WU&Ba58)`vjc51y29t&X=~^>KE;Fhw59 z&DeXm*Br~wGl&^n`06r{yq^Kp6tYVoE!v1OM;-u@(%|2OWlX2N5f4UDNR+&geq(46 zohd>z0eaytLAkc5SrW~o14y_hW+O}mP)iVWvYe{k((&gR1_O>YnXuH447d%|!R#23 zBQFD5emX(jWxvXcY6=y?M&be4Cfzvx+X{+v0LB^y49HS-v*Bng<`Ts)`vnM*42W%f zyYF9bMI1wf!8r@ps>iA21)zsmJd?uJNnD_)61-lS+ZTxgEDg_?EN7nZKtr&B^phEQ z)Thx092LrOmt+|~+_6Y1Q{vu645N`yp9=~$#E{3B5rjE7;ENs(t+Nn?6Vs(v1Aty; zVK?O9?Cb~6;zw*f6HEbV{PJ;v$5nniZ6Hfm#h3?v?Bc`hE9>!<=B`iU=qJhtHVWUw zEFNWc-BS(A8J1;P9dbbg)-%38S0jYk!%Ko0lt#z`2h18b=p`mS1O!{5T=!Xu^$Dyc z_0<|Lv!I5bU4zJMAQc&Nnkw#@WiF7OtA5~7b%W1*zTSQe-Lk7q?AfVC!Au*GWFTuj zaZO~NxY^s~1fCHpW#pw5saVoC@JfN|{fqOBVt9ks-QRDki%x`_{oaljM0L361^Bou zm|i)&{9ohPYzNu2Wt!iyUw$c4UP>k6dn@QA$0>Xu-GfLQ4oYr%7s&v+_buqxK#@V) zBAOomzGzeu2l929X?;_#1%YoRM`v+-s$yHhCku?y{y|+``h2}$UnTBuWBXg@-lwNm zwq0ArHOCskoqS>fCcOs7E84EX#1hk?Ew43}BTXdK;Di=3S~cba!r?{)#ieWVYj7VA zt&27F=FzvERC#)EKGJHSdm(BjB{IH*(k2YOcD;-$xF|X)7 z-lz9vu3$b?-E=)GR8vddy8E zfG2~mWh2$v?U>FWKPTOUrI@L+xq3GBC5z}+%R%A>GjigFe=DvTo}Wv*r2Fm3obT8n zd1Ru`?zQV1L58Mx%9!x<8e@63t>MLjBdz^h(?0tb%YGFbWvROkjMNZi_T-vqdb$OT z^Y7wJle*7wVfQ=i-kRu05~}LQk7SDhkCaSMg;M|rE4miB7 z7{t6xYGZmvNa&AXP(+*C$npThzQ>2Lf$>O|oMO~6e*go@~IXMPSUtQg8+rECb%Sq=3XYIjgoU(a}mIdD)RBgo_ z`=bk*qIfOn=e$@UV<+3kk-6+ci!-=n4NnZ?VUdTA%262c3EYA2S<)laJ0QKmxp8Qk zNY`+kX*=pJoN}-<-1h-Psv>^;%zH{*e!hCfe8Mm{*0ID z_EfFcD&DvZuT;rO3WJ!u;u~PwQ`*wn!G!ai0nJv(qqElATn@piaZdJt z_Iat@F!BePwBJGXSlxCuukFuDourSkC+l~JVUmJok^+wnUj`_T7d;P-fY6|Z43ntb z@VvVJ6jmSpu+09K?T%Lt>ES$&~A#w7OufJT` zG(Y5hAf)$YMKL;v#$y-1YrE#`nfQBgjkE$o7nsU@)NvE5)v1yHR+1U*dkSprz7jN) zF2+2rAAA8Zt0Ov7Yehb?X3f~PTgit@Sisigr-(=YEL5R>z~Up}HfwLKLv z7(jXttJFne#-ejSN=bg5MXA6Jv7tGRDmz8rerCK08k;?6TOz z=Fc4c6(0Ub-SqKc1&THJ)us0Kl1}`2u10Wb@e2{tg(x_DX`6&YMgd}xJeb(MzJp(sTqq*uI=2pMfYxqV40Yl~Z!Zmd~B(Tn^E=RGpBR9Bd|SWV80G&{pf z4_<;y0k~kx#w`gYmwj(j@+?Vos@sV%i?WL^tt)H$0g$!~U)>5PD_x5p?l>@Ok;3+; zQ{U9MsrvTPSnO;$Y}pki-Bk9&u^R6FU?~j%7oSc^NfDf98TzhC2Plc+2@|$GwgmEV zn;VzTZw~jp%>D6xeCrv3pek_oi2EZXJcx6p_5*e+YkC9HLkknfnW!Pic-GGle(Bl8 znt>bQNRkNO_X;=NoGf?H=Gg{h6JeF%tvlw59r~;o-ukjL7o%)bW%Ul^0FV)f%lR?r z+2me@tW;K2U5w!LQ0tQG4Z&vvqW+rLAA)L$%JwWWa4dzHjGk4iZ<4@J3IM}U>O#n+ z7#C#=(QWmyXi2eqZ`>@}uJdCRR*c;Hm&pdvQ)v9qOsfZ^UKdx|xF*9Z zgMwdEN^M%2YO}d}-#&`fFE<-pXsHO9e=KWzGes}xsmk!2L07JG%A2Z2E^WF`vS$WG z7(ZQzJLy*ONiR8XykxJ`?dyYChIDT>s8)iUh-BYJ|=d}vif23twj^9 z_j->dbKT?OwJCJo(`g`eD!V$jIA!n2;2So3mPs6~KD{S3i1i(_j~E1Yl%JRDB}}^y zUW!-@Ie)7L0%B+7g87N|tH-zTeU3XhCB?X}i0+|6jF7ar0Zi?pv`fX(sMzh)e@0jp zdys?KF(>Hg)v~KiclyLJr_&p8rZqkY66;FlP_VewW*r(PxbsWFYcHS-4? zzo&GJJ54)uDT#hM@%Wm~C`VwSb-4P2Q_CGVIc-18F6Y(AKxidX|a4>&w5dT)I zL)UxD=YIQyFA56$ZtseFDV)Uhn~*3dBbQklBulj{Lo4tl7Jz~o6U0q=Ls;l&8u?sY zk<`6kp*xFk`AN>t)^!pb;tX?Hig6**_E~6Wy0eSP901se2iPSte znDSUm{!9J+ckJX0-B5VctVbV7wSKhjvERls!h~xI=Gz!Oqw_~&1u2fB>|{eM|B1<+ zR-N=7uAh0O{|Hu6Y1XF&I`+O#Ip*B%6Pfa~qwVS(|HERx!Kwyv(kbZxa&ESh-|HLQ>Xem2JMSDv+7T%#i@I{b26Q5?R%vni_tKuZ@~L)*FL^H4jTm3q0~L! zB1cEBDmXDLc&YWDm!fWH)TmFZx@U1TztaX+=vvZNm_|l0d?~r)AiNpCyuEDlQFX?U&rq_|Z9^vG>n`<|xUVGm!P}Z~Mwn$on#LX>Xe7}D^iMQ5nuHtvnm71<`lAiMt={r>m4_j&HU-K&}J_p`k3Ip;k`pRG~! zvAvW6Lo%qb@Dc4*^yj(Y*?GUyE;+da{canmC223eRF%+F!mVRgn;Px)XxYl|vj1e% zZp#xUQ#++i>aHXiN>ZXNn=T%tzAJuWct&nhUn#?JwZDy3{xidxg3k?0{g#AEDe-HI zmhrW&OA(}jst|?YzM~;8+K1g$JP@l1vl3iKCvL>J^R=zh|MSy%8$*Sz{3gooD9}JF z-O3QKfszs0B8-+-pYh@R)1z(pzr0}=unRi+exJg5`+$jo`Z!boK+PV}=#{KP06%En zt*V+g&$JB}qG&*kIqW4dlh7HY3Vxz#qgQv++PwE9{~SqTtJxrFi(L}t4KOGPbQhFW zTW|8nBhAqBE0UW|$DJ~A`AC0z+}58zTR9{Aq>81}oZ8+mS(bOlMM;A#4Ks1uXVyP1 zvdva1Fetby<)T-!>vKbyBbi*cRb7)RU;86=&#nCP*|)z)4HYTpY{<55d^VTTqDGtw z^;6$_*vP@9xKUk*dj9^D-szUM#8>;Wr7Sh0l&HHO=_u!s*1xcqtYhTv&*Q6Eub{i6 zvO6%zz2up1Mp^VEpTX(U@eaGbNtrgQ$DU|3tH+HxI~fcHAC%y`igSZ z=tI&O9P1E8FCnjxQv0)31|87}>Ds+LV-L)}k)WBsVksi%iL#63;7Zg+E+5_9Wp%WLX8p2u149WUK_Zi?IC4qIDRn!>a}J0-c_&eqHL_-SFr z2Tg^4?abDn*yevDdqyIcQfu*n6j!$7IuXR_aiF$MrB=|qcXnV$Yh{4Vk{EZu{#sJf zQskX8)dv=meeO>5D$gyL^ii}jx68I(Aauq&_*rgYYAVert35qXbK0qXA$uV{n|;jr z?L|Lx|F$*yY9*y-6Mpq3ztXC6S(=#BXepdH6^Jz2{WZS~haGPc8dlBA zahiUJDSPr*X19@UPRC0FlNjpu#3v4xllgH%mL*6up}VF=+?5ifFg{ev-OwH#cscd> zj*83|{yBGp0xSJ%MNaQBhEty1zds+8KddMf@_`+09fYPdVWM%XDy)Tio++rTJZ z^im^=~ z>Z)>A0(+>J(*vY{Fd29sCB9>tS#}4{PB@P!H4GnLneZ$NH5Z1d#(FA12^#A(kir_c zjP7VS=q~|~epl!QV_f*?f_&v?+gyPRBj5#nD#w^w%{t^dFkcuV>lUMgS30ui`Q^%$ zq!NP6Xt(`Ha&JoFrffyl)2kC?EZiS~dQFV~?7?GM;h%K+9hAU&W4)De>URpnMM1&$ zU~AyF{~Z{dv2D2hmQ_x3=FX&(1x=RueLf)O!dm5d5Bn3C2MV`I&bx}3}w z)`fYdIcKMPcu!AH`ROSp;gcoPL=!xrsnZ-hhb;q;vt=#`t>*q| zxmA3veav&mHmSoZDoAMv>GyNhJHwK4&krqFU)L{%mpunNjG3?B9AuZEwNdDmek0Sp z*Z02NCYSwOC|&-*ZXz+us%1h24yH_AWF>?_09DYhBQBdtxOk64g=>pq<^O8|PIKP& zg+bh-^1W6`-Vk##RJPqY@n|ImY{o?jBv16ol7=0>(YX#XwIZIKhIO{>g*YbwI)lQ+ zo%qV?{^Jg@r*c2#CC_`DcZjptDgI`w-e8#60!Q=xH8!+F#NNSH>#rCD=q8p*u-fPu zl)s*dS$7n@pMa6$Uz{*lGR4(*^iEy)Y?|?+!?rus0=tG`MaCw87!LI5K_YJ@o`1nK z5&CaC+3%m2OGiN;rdz<9K-nE(ZEL}ZEBHHgHVlb}uA8Y|VQUdcksb5!fB3FK;!3L5 zAfTMbnlZ7y*>v0$x8OJktnmBg>G)LNiGdi9jE{sngeP>Pa0z2vl|^{5ucc~Z$aNRx zyklY`n4(;#2iqY1|FD)M{vgAqVn2|J*Y!-OAp&V6AIHYVI*eVan`Uh^#OhExAyf8a zY+_+yOz7Q!QKv|e8~3{kSM%q5jsDO2Wj>Xx?rBDR={UPInA8BWN#MeP<`c0g~w3=Fus#ihQd>;8(tvmf2WmRH?xg4n?6(2Ua2c78YcX z4~taEg5qrj$wzE945=J#g^m)%$0Q-&FpF*+_d1IZ)O+=aTK0K?_ur#mRVt@i&#Jv# zI4OPwx(a0V$v9J599wK}NJb7Og%Go>{HG+Pt+>MJ>@RN-Zyb zOoixPdom~Eu-nf=Iei{eORa6y;jRlcWEbnqmdo{1DdyQqP9Ycv2!J8nxt9Vv_+eVHadI1 z4sYR-8LzX;+izWdFhx6I=vsxxUFc|;aMdpF!|>(n1|Fh@zrek&W`UpGW>5hAQbfB> z(pf`)RuqkAX!bF$+0)rr&}u+K&aq|{1V4}?C<*%?F)fd+ zp*LzA_dn8pE2^Tj@@z_ljW>T%1=+~YZ;SKnlIGef=ir2`R)ZHBgyU0=INqry-8@;p z7`MmEf&GKoo>*sf#}*A0mld&lDC2GC66t#d>)SBv_OCCAa46rt+e150lLYXjd~4MZG{RSy$8*5rFZad#C@@|Dc;8~I|M zt_}6`YquO#x~HfrvXgXx>*IjA1ubOv=i%Y@-K)Ia)vmM1-q2Y2gv@m5O#Akq!J3#t0x=1(xZbf zrk^5&K1<6?R^@85jAyQCo2)eva(YPWgzh1=9}gWw7ohB0ZtXZdreQ4q&9AFXDu~xa z%;rxZ8u5UDyXHBet*%I*gtO{$1Xu8Ho1j#-Pzskc;mHu`t(SyKC;7@cpXj) z?&~?b_E{35_y1{*6f>TiR7>?XQY*9XIxFpA8lFufq_J$Q^ak?M;@0&HC#LYMqxC`ML%Gw)scn&(Cu!E^w$Hk87u_N zjmtCw*gE60wBg8s(HFd>>q4$OD(2mBxnzQJXyuV6MKm?my{t3df91 zglI#hwU@S6!um-{_%LO^s?W@^Y{RKQg`$5phlGFH{M=tVfOebe9Xwzm6c^qQ6Q24< zK(IW#rGLn}Ur()MXqSlFzlw|LodSYaI$w0i3;IqnN+S1{%+5`6KgCyBTPw`Li z^lVg?oSi!@I$3)6thMl&1f?ZfCy&%=kG5!##8D2}>G<|hAi zySLjBbp3|Cw^;>S+aF|!XI$DeWAkF8QyDA~jDN-cu49~um);TPk#n##-%-pj6-GNN zyZ@-&{oJ%+^rHt4SjBV7DK-)n>G`kxo%K5}#00?^V%wdl-A2Oj2w;l*5gX&2WIPy0 zks+$DtMIR75nuH8ilM}q!@~SdnkHwCz4~_pal)u)#WgdX4$*C+dkJ*;D~g)GhJxo6 z*+1swEfw}qqMS|(6D}Pe?wlOEWL2U0v@%)n%BIQL?VSUXyJE@)lgdXf4N3>wT3osn zA93)^R{!eUT5BP4_^rj}p7N0~_d^NQEtge4)K+`v1sZ9{Q(+g1;H>C=rL4w5b(3B* zRmH=FUvpNW4=_?c&0?hrF=sy^14k_GfX_|d>%Z_7eV?%t8y zf5Q2cNxqGI~^BLMc#9;6jm_zYov$|`$pUG5d4u=Dp3z%EI91Hd^4&v>*Z340^3H8qP_?F3Yup_vs8{(%t+yg* z(JWcO{BW73HI1%X<{#1Ty@5T)#+I&MD@Eb7^qM!=uRbiz+3c-7Z}FzS)Fom(KgxD= zwyV2a+sw@6T1M;FubWN7G!z}Z)83Yp(o{YMU1|Iywsp3SyPwatEMUfhzL}OwKVGiI z)uL&1W_%N}xQpBel=)4(-|vG*@yl|76*h#`kO-2*cr*jt)n7!8&V@W|*4=00Q#2o4 zyY)}R*Uq1{{ZB)`crG2Y@flh;ww*Y6`*Z%3D0NWlyxFz%3NFf@!{zk8^yFr9%W`^M zv#$zHQJ3P|ZNpR4fbJ!~!1L=gi}R`#R2Ptrup8;{H0Zo! zdLSRs>h60#1U*^r+I;)JW16>GCg*Z^yDw z914TAfju%rp#6mE2>R=pfHFhjG8x0#bDhU0*2E+@%m@4>(oz zF_a*Hj<;8g+#1*|NK|CcZgmY?*3+WuE^G1o`oSQ0)+7L>4zAzPg~?;}r-s7vma0__ z^DIvkkLZ5R^EN4NY;Iab7zNaVfuzL4e*Y;0Pf?yUbLp+(O%)kI1TgbOJ zwrb;5&#sjj(+)5u{yhVoUB=zRn4a3mk$!`%Jda?G<6sgR!0yVQa48~ zkK&wQ{P-BI7ET)I=BbDgq`wv1uE>@O?PEXep|5zgd#jeoaXwr0Y3cLzk@{@8_hf-Qu_t;Oq`Mm_er#l{?UZ3 zK$i2BfsZE3mRuMG`<%~#hD~7x5|~5p@^TbaR8`HLW;vP*8jAax7>w&w2}AR|L#}59$GjHmai2|cYp3a}kPT8R8D|t|O{>{2a~{o9YJ~7gmkUlH z=24h}7z+^A4<{k?=%BJPWyit}5+j(se$qk~%sBK(8Z*8`Ff_Pvbhh>-ZO9f4@1v! z+4|2U(=&RzL2+s>oro|m%W9gdg1xmJ3WIHpg>J3#8(A=#_2}LK`T8c81Eb3C80jX| z<@`wy$2j4E+8lBY#~XDaJk5ktudr?iXn-E*gO;ZEEV=|J|9!P*&R@HB8ZQJ^D-d=- zwP)#*B}Sa@V5q>@JJXpG-@`9(#or%u(C%CLHno}-Y*Yot7t^l4${24 z?=T|3vc2AT$f3m>)<{stBTFrV2=G_`hTp~Tbf1uow!sVXWHQB*1=HfK*EN1TP+i*m zE3V7u?m5j02moW{EO_hNb`zOC}g0a4g9zwEu9O;D&c9Bq-__F%a|9lXl5m#wE5T07p`aDmTuEo{BZ|q;yy&Gm z$!ZKeSZ4okwL<&HzfF^s?$APGzik#O_&8TwehRNzVD;B6R_ zQf&gyn`y-DQ8X zVISyce`fID2GfnDVSLHw_}+5gG4)amq0aZ!CYJ}??s?30og{{PU8H2^5NnxCjuzoY zxE#Yy)>52!kY^*5(1^~{fL{j<*xYME8c%){?$2HA~=%Gsz44In_bi3-%&k?Mz5$YgD3*k%_AI$Hys^ww%;$^-LQczxEJB@F zjjIang@7B3%(miCPs+N&>vMSWOuR@{ektSL_P+1mZ)1bhtVL}4EHhFTP=vi@mESu# z-UvZ+;ca=u|8n@M*<#vN<2U=@lGqe`0eR9|Tf#}vc^<*ROI?BvT0bCJxZtc`Sk)nl~J-mIc#|R$Ewi++T&ayS?Dw_F)*yW`4t}$B@G=d&{nzu**0& zqyN)w^m1GC1rr8fGf;cU=>a&$%aLxD?)u4Ny@#vPeNVM)Q%NKq=8NS3UaYvwX)jff z#;%>^%!~1J$?7k|S2_9^G?}6^7tTiWE9eFf-Fk z%F168`{}E7k&O>$cyH|k`<-x$g0Wq*Rccz=1vu{=-Hd3o`x@sVJ(WAZnFaF;5K$-9 z_BBKq@tymuvgshx(t^R;ID8d@!8p-5{yAnDbt?X`Yqamk7uP{-_&HUa*-5oo@Xk8@ zWE(S_lZZpKu&9VBp~a;2*zBZ>mvTyknZ}R0x<~*EC{`@vzsoHCkZBojTYK{c3S&IW z7Lf+meiiDalSmr2OYEaRUGa}^a8t-h}q{ojTV=G=q0hi~Hq zU)b^)?HPPSgrNEM)2B6lb(J&!nKC9-k2u$p#Ox@qFcKMg0rF;-t@T}9T~yqUAUyxW zM}u80bEJ1B0CUav;mq09p8E-^A$&D5t}m?rO^XyCA0Gt4;!HI&tNbL0$=(avhe^I> z`=rSm9&frhz^ShDc7QqG{?SVr(R)=AL7_L_9zlUmWx(pepGjJDZ$ZFG-dYvw+$6D`36l*XW$e{Ofp#B3|(a+#&ba`ZY#5qnF# zBPh^hCj(4O?={p4*Xi00;$stj}fSb zUN{H%bu;zym3H~DBK0jT@%-&5 zQDNfv(6^C3iQICitD%DwpKQM+c$w2OYoqJz!(orVmCA`9lw2&qD{`3enU+0WcN$1F=SmBxax;g};W7k2;qh*raD2}ubMhbNA-6g~GlAdK^fxKY? zOmENlpT}LaZ0=);!)Yadg=}LaN$2XRJ-ULlVQKXkQko>;uNl^Qw3RSC|5DLh_k{_b z1&t`D`|b`Os<|a*(SEz@O?-~L??fr!yn{UO09vl!QBZc31wJtS-O}>u`T8RTFLpEa z#s8tg#MW<+v*7(PX5qH|5drZ^)l zIZu$QeYlYSC^zd3IX>GytqZN5*5&c7y#Fk3@q)7#MAhEpaK16i_EOP4>f25WC;bQh z&))KDx0>mvp23?cqkVl@XbzLEmIRSrN+h0x6b+s${Yu;$3{cMh8nw-}{&lsTd7`NB z=5=OaE){}ppyMR5%p)%)!)tPb52jIruXR_9PWm^b#h!feH2y&3g|CGRPBc~&1v&{R z3U(4TSU}hT9G$tj|C&XyyE((!n7Uq(xLU2~;?NA4rR;dTJx(+LiGlwf#wKJRn%9eU z`tH%J-DR{PWf}5E`Goy-Zb!omWcJYG!Shq@{fvY8iNm|XZeR!}|4AaX|B6HvlbKFx z?m)+q!Rg&#LQK{Y?%G2NoK&G5Ds@iD5c|=D*&NW%S#@a9v5t~nqY)yGk}sD$)%_W` zg-DZEYN{v^CxYPr$K~SJjt)Yv2u5+pIVEV~Y8JMNSWCA81 z>6CFgoj{Zummvx&<@uTA@V6I!Ji8CY-IWeLy{H$GC$6TN*iEM25^Vk!`*F+qkJDY@1D zYW`>~AfN*7Xc-R{6ce$9ZUdCETRLap;uL|Y1Qy@TYL)IqdkYH-FUQ1}>m0bobj!7S zN!`bxBr%>|=e>}1%Y^#(VA=~^!Wr6X%P6#oPc!aG9;?c~$ERr&@LPTC+qZ$E_kM(L zmtnn=mS1{1L^-nH_n*(NAG)3uOL9uen%Lwj#|<`yNCLx)lNFK(ZO(Dvu5f!|*6(w= zLC_PwTQ=2>c$q_1-w}rCMF0lXvaK~&x-0j3`?_{B!l;-Fs5t;fTLWQTL6Z~+lMIw0 z0Dmdz_AgETM2E;^>5$f&$fg5tV4(`&ux#As)r%Jb4RRlGZj>!dA!6VkbgA=gxD<>VK=)RKJntuBoPB5D$T%*}aAu zMPlpVPL%yUx&r1(e<+s4b-Q9IMJxEJo_3a>o;q$@HpKZI=((C5#%T60wP=&Ogf!EF z7iTQ+CCkmt%#!#T=g+oHI5YjjwLUh;-Iw=i(m+K3QbOIVSu(oz%uN4$D zw>Y}E&|9|u`&HYd!}-nP*~xBePb^)3ZHW!2ftejqVFk!qzcs?TEAg6zi5gaBW>CA7 zkNqi|=}QhKcTY6VThqK{YB}^92{=DBjqt|)7Glr{81QRG4|P6^GF$7H@>TF{{ix5! zO+mj`p-Kb&LGwl-i|(?dK2%*{fz4xV2?cw5Aqo__WAI4M(6#hH>j>VI?H75+R5qdJ z+pPX=e(UPst^cnD2zcd0zkD!Y{QMEFO0PP)qIgZ?d&e8hL*biWDo#$U2nYe2vNo?= z>It6TG@pi~#*z7;;km_2Rr&Lr-rtOcC8(aJW+G~B!^|RfWwV?fo{9=Jrhn#@YNSPG z-78yL1(I)PPs@^lQ9Z`j`->-r_Y&c0bHqq4k-J%L!?_(*R!6OAKc9U+o!K_L>t~V> z(QNX~N6x^AmieKRbo?k`_=TKtUb<@iM-i}&nnd-LbF^`a5K*q6w9E3jGsIjF0I}2W z{SWY@ey^Rj)`$`mC$t{m=;<fYh1@#)Qt!KS>6-W}w z!)ODc)`w6~CZC7*sGb~fVr#K3QLYuAxsMZtV?Ub_Rx`(Eq?HqT4r=jKVAg~Y6?{BbpPM3aZ|Cyfs5z9LL8lNL zU}I}UaCLS4R=!9tN3#fB@5C(S6)IHwwVtW42+?WjhW9SbTQlAsm(Jegy#}INU|i1f8uP-8 z`B?emo%y}{Kc3qy>z9?JM+`BZRnnDZiDpF5d-?|G)ZJX#-qm=F=o;}g7F`~Dc3gb* z;q1O6Mg;6NTtSe&_@(wB@Ub#kYrwlvUYn0EKT&1*PU&;M^yw9M36o_ld>9auC5~_o zv}jfN8ad6e@}ar(b!bS_s1{wrP)Pi|z_I3LDOn<=Z(cRburycnxiq)VNei>knE?Gf zzA`2vru5GPlE>%?jWNnjn(#yOt#{CJFB20uF;PzT`r~4%El9HxYsgIZZ%YaNaiI9l zPZ79v`uW?G`U*H@C+(} zNVr$8CkZ}+l@g~V3_0toKM>noH?tW#?nb&q#0(iOaL^ ze637n+~4qW1?It^;PQSNaJK%;@9gXIs@aWC2?bt<3%)BXKb1AxI3(G}dks_HFMN-^YEw(h;gOP0^9r)N^)LNNz9$T9WCEXi%UhT@jQ+XhbkWLdnhOX5t2W0SWWg zIQC9YpJE0AKxc-wa7npZcJPvpytg_V@WqnX0Jk4fj&f>TY`a5pn)&=mKIX%pxA$7} zCBYX0Cq%9&0Eh|?+|wi`n1})oyw=|E4`5w%c*-_8`>@D{=s#ZRoD^F;?GohU>woGg z>_t`fV~T!SLa))*gq%ncC%niQ=||OE>N~a)T_;fxH5q2|K~OQTtQXO~tE7!T-lIrY zU-=n1nEbV~b1TGhvffTfeIjp9oHvHvI{oC}q~_CpdySrgE~oCqgt$&4GqYt-3IgwM zC8K31r#3Y-cc2MCyn6nve!nXbmrfUD+njj6ueWxSbq-@DK#J32xn-=mw)U|nef2y6 zOv;R zLMiuCfl!BSc>j%Z+grXIe)YuCZoYKj0fc4PV>`l7&S1m@UY9TpD|Ca}_Spmpowbbr zo38F6xetH9hA|Z)Qo}Nl1Kn68?bjW^a##aXPxdvz6-OHRw{NFgnrbwL4Xw!2~HSc zEu9^&b|d}F5{>sZ_;8lh5ZA8)H`F_+K3ioiwC4{yrk_fqn8b^K%)jZCJqlws zt3%3E97(_)(IMkXMXw&+KV7^|lck~Uc9p2_r{#+GK~yT1-jfRt8u9@+)frgRMuoZZ zWFgCvqsrBucy;C8#;jcDp(>H6cRowGZc&i0k;oDVL)CpEDP)(MY&ZTel(bnr^`>Ms zZ>IiB06i5RI3%x!*WZQ8hG|-l$fD@1rw=0*9)=29GrXjj4Bs=oH(RXpWs7t%oM#i|`iQ&lVWQpR2;L>_)$6&MP#` zB$X3;rfH)s%$N$?bR5Un1Trn`0hG&JOoO@Z+=4VU#Kt!hx>6yT? z3mTpzQ7CF(kw$U!ja)Q0+lt=7-tq^Aq+#D%o+s2zhY;eV-KRX=rsnlKm&?y8t!Ix_wIb6rlh1i|0p*{KATy0f$KDibGgfJ zQoj_s*;$5>#G>t6Z|*qS4NsPtW-sLhOe4peAL%XjeH9jG%<%TSLiWzA8}onDryP17 zIlF*Habw^aVTC^ptnh%|_a@sg{LV1#im(jGSq%xHze0lR)MGvf&e+FZU!K*)IgT7H z@I3Bkmumuskr0Z0C_(X!1;ak|;sXjq_Gn+T<&Dt7Bg1PuF(vh1D7$Q+epoB!S;-RU zGiQC=Dkv{rj5P}DE`INHb=es~(lL#8O|%V!#mt0|Wc*)0Ah)JC=6vnJW-&0D*7u zlFV|hx*#NQO}^?>+IqcrV@J0J>#;p{CL$~gh3fK@AQPR5NuN4Sm)*e;WKQ@Z29ycPm+<9&7<^c04N-nd2IePIVf~SDf-zE(h zHyR~n;jW78VY$w;V)|j|j{wz*d(L^5(sZt{qm&L+hbN(T2?-a`jdV0C`^h*NR#vfhsFq3HvE=skN&U@8Tzzl=(fXtnqz zX?mh@!7g~xJv%T|)_k$j=!TrCK9gXOJ`@Yffz2!72s!KmOq^Bkdiun^nLqW~J*iS=25czZwRl^a?|(ZCOSQKlxx zR1B~efFo#StoSykRO6gvlXU;&1|i|ig9j^9MRmD=?fB%`yqTRdiyVwIQ026nWR$Ig zavlD(lFxB#G{~h;dToKalF6q$m-)w;*I&E3786J3)Pg66w!$a1r1KMOnTVw8Oh2Qu z!+N`^5rDs$DNZ}ng>Ibsb4++W+y{`1V?(p0Y}jP9>_9ye zu(45&2}kx^un~fIb|_(JwVBy{ac4~<>4;64Vo` zkFpEC7W0e#wMj-oTAg3o<@A)YqDaObJgcUI^nYK_uRgVQit12rQLWn z&ZTneNhRh;*U_+_@%Gk3Rzd61eJ#=|bJX}WIZ=JVG84fq9IF^J59yqL4~zgD^?A^1 z=iLaO04xrm+3E#Oy|H_DRzo^_ds*DtJFU)j!gQ04cf`G+$94<^uG_a|OXBYMT&EqNU$XIPsThqufJiY-1kULcY5S#)bY8<+;v9h%DlMGvB)Z1VOz z3AZ#N;HpM#L}frmwNbCJMcMvw_vq3y$?CL{-1V>?((+3cs+P6v*&ZeUphQ82ufbQY z`w!Yq6kNbqbP%$ZyGnDXvlaZ;-{N?8lA9e{TwGK;-0X45&Fvh51Rj2z?+85~Z;w0S zQQL6=R%pRS=SIzD)Be^LXQ6jqZ)RripFpxAlT{x?b-AIe1IvlZrtpxxC48q(#jj?T zF8i5$v3n6D*MW;~%P=t@4YmZhzIFZId-6X`A&!XQ9L4u&5}t(hLu>jJKqq<^{LZ8H z8e>B=h{z!BIGF%gsj^z(EzvLtr+_tYlhr7`0J|jZuARK zzbsdxM<%b`bCB2D0x}00Be)1>_^a`8tO>celkORFlOOFo(n+nTfE+^$$z+!;jVb#5 zj)iVZ4~<`8JQ%ehtdI+h)Iy@pcb=WUsDY*lXnd>d)Dv?}j^%RD@gpc`d|Y2f-v;;q zJ11dx11&KkU_s|vM=!vbqL}$>(D7V82sg19>;LZgi+(@ylosXJGxBFH#FYqbU{N~? zAyE5S{ZGZi1oQ7vf`4m{T&5gv!Q*`fG>OPu@*hpHmU0Kn_=i!oYuc9YVAbQy zEIr)6(n7w@N!UXub_H1V4Gj2xF63i`x%^!X zI+jMc6-VONN3Y&+XLu$+IwPNwyEKlnplicEG~@WT%i0o{xS!jB%giq|@1e3ykzr;% z(IQkZ5VSc5{Ltzb*Zl9OgH|3zT3ieTMx^B5aD(e~|D&t29``32Ys87vJE5gRA(^=H zp?>!K;+wMzP7UkjXJCN_F+XT1mSZF*@Y^=mNOTIa4L{!zCX-RHiuW>95=cvdoJ3an zjm5boSLgQpz2FL99Rn{;WI8`oIvMi>9=v|MT>z>wN8_-+u{JP_vaEqoqxgR?!-gw= zKdwi*S<63KU28nz}`d4X}qJMcSpVf=~ISeb*d>_mxY+Q zSt#)IvX;MHOaKZ+P(^6ydk&&9fdFc-#tjJ7i2`CFTrf_O3+H!oH}chH;^Fx~y(AEH)`r>VdL&N9AX zjn=Y-C@ne4amhbUI7U8Eu3l6RU(rZsSDg2|9Nj=W;SfRWqkxGW5h21bu0durUft1GTM1v938a{ zDgI_HDgJB9iYNj(ytBI@KGEb%b~>Q=juTy;>M3Z3@Nq-3?AQeG3m`+x4@h#2!X##? znTd*{2uEKEP6TswT+~Tl+fv_{Y-dW2*t+E@DPTNUR9D(I_?fR0=#mr~d9t&&xM$hU zJ}Q7HuZRW{BY3QP^ri!s_adxKsQAs!89LiFQ7>POv~W{z&uwuCxQQD6NpdhdGqR( z$md0e#M@nh^?r1%1s2Ya%abrbIGzqv+P&kxZpp@!PcV)GNCmo?OBam1pp-o|F+qT% zk8bR5xwvaT<`#3zb6%Y&R7YqkHZjdx{K0bVhC0RY!e`lcF4m~`zaNZzc@y?WkeMds z9E!XNO__M$hb`Q-zU|u9 z0qg?5-}5bAe!BVlvF1GujIJqhx|8w!9Ke%uwd zt%VUNJ!wedR#+C3!_H>SYtgwnoGW1WQN}^I+jCH?nhQR=YKXtymv|DkWIy{+c^ZgT z9j0!X6pd4%j*4`Qj2A?8ez`I^4QK$RG-_(l)%Y9eUUHgoIw6EWdoydm!ht^_OpSKH zW*{weJm`aw%O0q?Q5Spk#(AUNPL_B7vw0Yk}iUaMpdl85f00T(STfU&=^x|Tq zF4|S*a|BOl2Y(3nG=LW4@pRb|nmjxy=wxm3*0vWevo9LZ3?m>T%h@2l?bp?k3<&j^ zGxy|XW>7JQwe7=$83egzN$I^`nNwPNM`>!=RvHqk!9Ic*#vx;bdLdlHL4+y2sacEB zIxrv@%TlJ`4&QE0-Ibr-*Yp zc|YDBu^Q-D%H~E6q3v|)dhVQrmKq}C(wHvJeA8Bt$@u2zE&UjMl`S4Pj8GfO>77dw zg;hJ8rM`d100aOp6lbP=V38i8L&0HYh8hyvs#+Fx&Ecibx26XMZg;QmKA@nWz#4JEi)Ss~G>#C=hhDYM zA>)f})0!Vri|bdyVBsRu&Zfn72m`e+m&k7|&ih*8!l-GcItzct%AyJVeXF^!x@HH< zr~xZE=SFqGM`e{Q&y6^ay?0f3KckeqSbFB< z8UR7!mnXzZy))hjnqJxxMq`KFG88%alE>oh^Nqqu{eUum{kofH?I3me0GuTGSaWK+ z9=Cl;Ns-#mGxc$5s?Va7M2*5-i&z-%>`nItv*=;DyNSouKFSAl;{U#&oPuWzb`!#5 zWNu#~{{MQ6ClFceBrfkP_%R#ink3q+v`A@p3&+oWyLWB^$pW_MH?Z&lSY)i^GZu?I zj0XJ#yC!#M(Z#lzEc(mEVg#0|AczTycf%_1sS5QDEgS!yp6nk>AaX#Dh#Fj%i)Fj{ zAxL%DZoGM8y+1{Ne`1aAv7nWJ86KJLWj{D1m&F;9RM_@3oiJs6>qnsA*XkBgn+0X- z1OSL*0gZ#EiTc?AH})-WqWJW(b0#kxEkE_Vcqnn+GM>OM%!-x-z_aPx^wjW*@K4%j zv5-*kNLEYVIRFqq^v4-G@RdXc4DzW zFActO4{;*)5t8CGV-CaQrs*S3#eT`^5R%x5*3pg$m1?bR7-EE4>OE~c^WNFfSJu&F z`tM2Zq`n_@4hNLnZW$AiNd>Mva@9AIYOdso8BdnzEN0_@ecL#APjTYf`SwCU>iEZ_ zn~%`E!M#XU_trQx%E3eI*K}<@$Iz-*_BL)|6!!7H%oxAwyXVgRwu^M8l?+5dF$duRHe_>tZp@IJKQKl8#_ShlL^Y8*B7v4D&g1bL7lIzktT$O{-u zY%fGVd{^s}$6dgQ0=MLvRh5*!({K5yDt<3z#nTg0=e$0lCM+;*m{n5*2KmTtJZdnp6dJ)0b;D#RHLz+FLK{s5JW zIflbH*D+ZZF5D6-xKPfk^o%Cf<b@0JxaGP6L=b+FZRxyQZDcenQBHKaSw~#qo`Zzhx*=`N{fnGFh7agLif+BJemd zSYfCA5_{me8hS{8M@04qXc+}g*d;a)a6 zC;J0@91ed}(xT%kOJ`U2WTyp5pm^J?uGNG~he;x7c&Ft!vGVV-#1%TOf<_kW2TQ<% z$CD8Ax9{JvYvPy|`{>GMeoQ%A5eyzAnW_t z)7TT6?ghrqHy~ivVzfuexhVO(i_3b(%zW(S*<&s37R7f1^$J>%MuKC8NMf3Ze~Qx* z0hND@HhDs1ZSVI)VRkYZ;{%YGMh4g9|7xjlc+kJb2LYLkqlSFneav<&3u3Mey5J72 zvXh;0IlkJMCfC~WML2r)Nudh$=P4!sI{WM^9aA2Y{X;8F%$n0&T{$$1+P6V0G&m5b z#P{6%7;vsu*TSiOtE+*R(6ZxkwWgO2_&6QklxUBk98Ad}LLHDgUbmlTY}V6KY4ndV zpG$pyudYU6^A>dAXU3Uzl1U*)x5#X3jf7g%sjDE%8AJ+G{bBMtcW!NG!$ctY(3yxK zb50GTy-9uh6IHsO%Dg|fgnaS&(oT0M3xsvAI0v?H8l8F7gi~#~{ev$Z@MFjmE}iMY zA%AQ0Bi$pD4&q5`bIB61%#1M9T9)xICO0r_-pMmd${m*+Mn5#^2{mtn;(WZ0tjU4} zhc*w3gDA+do%4f#Z_Gtbi>(s0g`iITY_WBa?Eq7TWeRc%&}_Kvnwz6m7(Z^l$acJ& z+V82<^1C=L3my|;gg~57P!-VfZ1*ar$P77TM_wf##Vi%{3C3Zl8xKYzA9+;jA?#lI z-uoUX$85_5_dbv7ITC z0UO7{OnbK3Wg3hfa6SA*B)G&$I<0DOP&{0t?@g$T4cbVyvgse|nL}xpLADac>+9>^ zbkmttSfXhivPZq`Nui`ZC+9iYIF33ofQYmS$UVd%3lLX3VE(+hXxT%gr2e z;oZG^Vfe!HlF_;HfvfGojFDmhYs=ZoFol8S__DRnTdOB~bJI>)xpsTS#bDWRe$GGH zk*xJ9A}=MTkQSn7j{+b zCz7It=)fPv+xjIj%#!OvW&EzIHqQ0g%zBR)zXoYS@Baj1zI4o2l6rF)HESH4$k=D- zxO}seDl(1pLQdvZCXc3v3cdin_&F%s{Y3#8$W!pdA-Qv5ecHCKem-369&BRReix8sV;*q8^2_a>7G`IX-jw%73x#|44t7SZh1eORsxmvSb z=1r$Vy9EWDz+{|2ibb#9%AMA`!UPsL;2|#lbGbqLSuAkl^!5(Z?Bk>ouo)4Ik=b`% z%7K^n*Zr*sd7~+VQ_#-mG^5FfUIO)^co z-XcdP6Opom?>^rjyx5=8^1*`#a&SD`J2+-=1i@Hla5_z0tbvM_xsd@x$!OYr-8xwD zF!fYy00L6`ze5Z&>lAw`bHtCh!=zL2IiI{7=h4lVEe`yxtco%1u$o0_V;)%oIHWa= zIVPY&r7fn?F1})wm;Z9N8{$dso&P;1FhZkG=NV?cbXrydSjIzO297mZ@@y`1(i`)% zUi0^)x1Vq349H>EB>ui{&&)KXQ=Y{=taSk5kophaF@lb{FlF^|X)bta6O7p47U>`| zbbe3xE-1GEl1d-5?!eo1PP&qm`1cMgLm&Ou=?BFtnmcI3QNjX^j;p+-F#W3h&+y1d zkhj18tcx`bEJIAz;A3Ugp_;Pa?Ispn#HN}n$F3Z%GR}oUGJR7?&lzLfK+*-}`9j2gA=rd`QSV#<6DA;V0X zG7cNXcg?h)pTFmwdEe)Kp8LM8`?{|925YeoZ!-K_Z$@8Bam#;9QKdV2V&}%}D;^;V za_DOz1vc9#+?M(B)hq1Q&|hGZHafa$RU8aaYQL?VZexT>Dmw^Y)QNH<3Y@=h>B*f9 z}edZ^B9SChs=-)s+?G!K5?#Ek$#2ycJ*YDq?YO&NHl1@GZB5Wz)9-qJ(l?O&SSpQtADunT~D1sgjLKvSqf#xmC!7n6L0 zEz4XojE_IE4^639wAzr6ckS_^=68TOAU-vdhu+xwuW!!zpabvjJm~A%82due`^v|h z)d1cAX#nj2Plb5`VT8Qo%?XZy9p+mnQ#$eNqUHr@5(yW?0}b+*(rf?qKS3XjDqhMa zCzZNxdhxTJWz^`PFJT2bRBH6`V0WcQKMZRG`R}FZRCQKz{M6(8uk`2Bpx9C4xEK2e z!-?gthg@%)Q~REqLG`NTmZeikh`GF=FQk0A^jHFLJ4`d6pOoYT<~i|texd*Df)fhr z2+aF`wrSu_F5WSsCxR@Y`-MH$&*53P2OZpx)_7=`j zcRMDt9P?A2BSX+%4VnrdCD?1QVDJy(P#E&>rH?sou)Kq@-ij!c^P#$tT8Qy^^=9Fj z=GaWQRqO|i_B`HpOtN6+#o~jNyGrH=z>VCXuS0BA2G_^8f3PU%R6r8d zuz;L%k#O9TAbodS=iQkdH>$!oqFoT19BRG(^_%#(xKGApPGW$+8iwRgXKU78A}Y5M zl&+tstPxm0`_4!Gj&aVOR#(Gbo>y%SVh=SlkUbmRaILW8X)s5=A>p5_bo8CtD2+#B zfO>AMK7wNEm+ovb%hA(CS~l*~>?e)c9pa(Cu&viV^@;B7D{6ny_)W^s7y5i1wHyfo z5kvYYh>^!50|5I8f3$k&eXm+P7v$-X{q*6Vy}Y5JAy2*&lmudeG`eVyrZ!ALcVt5A z1$tjP?ns-9yP5EL@pBdPj;&W2F_h#d_I4wyTl-BhlG&JQc=YDF3n@j6P_NP6w#C^= z?soHy~JAKR?dvVY=CK_rWc~NB_ z`iB(7tmjAT00BS~hqmkc>=%~q?T!J$Dmc&zVzz0~X%-(CFQOYyyqu;J>m-?@qn^7= z|Nr&BMe$ea`J>cv(VA5b`ZAc@2_1kSZRJ$p88_H^AIoQiv&zOduX5V!+TC_3B>+=F z0QuNIa?*ZpSER$sbiI$pSlUo903|IaKp8Bt2~$SsUi&cj?ol4rk~qha zeW)TmcS;AGpabQyA)<%rzWiaJo2v)bZ&=kBe1+@wt9p-#7a@n)fJ`C?IqKJB{CBxt zMH%7qu3fv1Cp|ISpZb^B2PE1W_h)IcztdyAzozU^^J3!Hfq9YXX09o@@m*nKnv7F{ zKJjbs3u4Dvmy0P^{nKgn9m`hbDyEn}AvN6`^ri;0w>!(MxcX;`q5D8c;JT!P%0nW4 zp(wtj?of3)BUG#EZ1vLJDjVAbdv?K_oeNq$o&^@n~$(X0&!-axdRa;s9{oCJjo4{tYi2>4!7vor)_ZQzg$vul!IyUR!61VgpeU3f0-Iw83 zptRxbTtfk@J#d%;Pzc>iR#uCtlDUzxl1&1>#WK()0MbdMiGBymTYjpAhf690xU;rh z&z>z#T`#e9_g*LS(0S$Wf+ODU4q%gCmF{58?D~o*cbh}`v3O4JH3e!wS-YQ@H9~nhiF7O^WM#)2 zWhz-LrzOgvTeHtlM}3Dw`AL1cKta4hl;YDT&df7w1o5Qt@^@RR&Tfs=5)^?hq}mJL zM5VEWwi89LLEcorVDC(BUg1cps~#iYnzfcVp_t_DLwtb;x2Z^E?IyW(l9lb=J)X8n zYQUK0*~4ZD(THGpQf#q;jcaL+w*Z!2>fKs;=E!(*Px)BFB@i&G zhAb$Uauc#((V{|Zht%&?nv=!Q8P&v@?(Ak&7vX9;|9;g=Q~GcNDOmCbDfOEbc?5B&wE9a-T{$VDoQ-#%I2p1wIfz68 zmDllR>RHzkObc2X8&}}*HBA=TvFG9e4>3Z)6e5zSrAbk|I@x)srZx|1o3}NKeu#D( zYGwa~J(DOGZnb_oJ`4N)EX*7eGmy_wSU5C3K5orz0uYA~YQ(`$yNz+r1#qZ}L^D0f zQfG6v&<)l(D&dqPb7*r1R9X0qLvzC_9rb!C*mu#fMsWGNGf>`5`cw^M@?-f-Ckgck z{6cQoXiS1oVdIy3rQ;SZHRTGa4&N20ys{DMS^GHVbSb;Z)j9g`K_9%4G zD5GAf^E<7rFMesuZ9!mc>Zye2@^y?(WiCytv@h~t;Bx74UuxxBrfFp^Q2c^US)^N; z$={1#xI&SWthdkXNujV~h6dXW#S3K$=eAf>WhaICdd_$dh~oiQd&176g*r&Gw6V1f z5rrGbIvNZp*(;ge7Zu=O6d%)ZcjrJEcS@OQ=G+>g8Q*M;7 z_S_y_n_Fr-@xE4sN&y5B&up#uvfe2uT7x_ZnDN08wKuIs05bRzDU}tuBpsQ$#&g^1 R*Keip=j!O;P(wU=?tk%J1mXYy literal 0 HcmV?d00001 diff --git a/extensions/km-plot/icons/vinyl1.png b/extensions/km-plot/icons/vinyl1.png new file mode 100644 index 0000000000000000000000000000000000000000..3e96dd708ec5fdaa726402d7e898170c7ca07532 GIT binary patch literal 29887 zcmXtA2RK`8*p6218Z}Fbs#3Mp-YweFqNu&8Eq3hHnnh{NmI~FX8nMORwMVEe_6lML zL5%}*@dCxiT`@GM%@B8ubjmC@HWXxnB5a_n*OJ!{k=mrb~BG4is0*=hG z!(D+t1fJS2o)Jv-@Pz;$2<@J#KLvrx63EXjZvmg#tzT-ZgFyaVAW&#H2y_M<3S9?* zph6(frUeKj{S^dabo*YXB@28(WcBKWGU)31C%Z8(2{=OP_R`Q31QK{~{Y&7RtKbbB zB=%BOS0Ub@U?LEBxOKCm3%ChLRr%>#-|4MJR5524v{;4%nW8I3HM`}at*ul3?&}AF z_FuOR7$|NM1zLY5FKt+mC_U~>g}tvU&w4-IVurc!G68&xNlxaKQc82YMY{4Br^ zrUOGK|K8}t)fCt7@50cK^MJ9V6m58M7AGkUjRQPZABOJOZ4+|Vl|MZ-!laZaE5|Q8 z2Zp5DbOaR#Ko;5y&a#kbWo1o?l=-3zS)_h&7w$(gN0)odE=HEEsTtZ`=Xh{l2-Bq3 zJ<>lq)m=p&|43F#(aw65D{mJ3Fqf{nL&4?bTt05u*BWm&j;zDw(O;miutCilS7&S) zn=hO$(#NNhY*zdW3$7l&%i^sM(YneN3=T2O(owtUcmKY`dLVmclxm}C!`6ds@J(1} z$=?s0&^^#B?95ulUJchZV;j9yId zwmxawbpXo?v+Ou3Jku1W5G}gQ(mQJIuqw+BI_D$#kaC=XKGm6eQP7EOwNNxn)qs^a$Yl)Zg-0z*uGF~< zFZ$+=tp077ePxa5@SLrxL)47XFq#(ssVc2?iKD}jHr5S{DLIqs-H$Nrkt%iW|D=1=vUS6o_FQmD$Rqk&3zv|=O=dYEp@Jz z!??3*T?LzqmrkZA;+nxWxO3u`(bwaP(+mb{EH9oUec5srzKEd3H}MbFn@A>CEfzCU z1~FcuPX45g*^C{XQh@NH8Pcs-S+&Gphtrl!{{rQ?k=SmmZ2Ew$vN9bZ0Y5|R&k36s z0byEn4jhkJ|4c1RN@cL5ozI;&m*Xb(-5s209G%Lh^_X1oex~Nlju!U3=Y_owO!*7A zMnz)nCm768Nc3dy1R`YHx)4z?P@O-ozC&SpSfU>Eb5Jjk@hITsw$H>fC<>Q+I@xzs z$ULvnk@AwY^U3ZMbhb?;p?c9zi=Wc|i*~^f`x5huLS+0-XW+bMBImxZO5$&x+Twbv z@l>ksSDMoGFSL}EE3Ix0HYJuh*D8d-CAvUSa>&j(Rwz zxV@gF6CbaUcW>mjgOtTtlevM+6sJHtcCX-P5skAWSUh6ne$l8~Xnx~E0%%RvM@ZVl zv#Yt_rQ$Q0^%v%UvBu3pNsDQ{XE4JkTP8(@yujOj>heQ;ISSxUW-_TP!^-BT>Z9}t zfCmPFqPqW~M?`-gnN>>#2?T<>(!+C;RJh4CufGeGZ`%c%nm#&TcjcKZFq-?WQ!!8B^B8RDDFzryZy8InpZ)a|IT>tC8*-zBuEjUy>Y zUdk%rM}YrN^qKY>{s$LPmNkiU|FE(iV7rH}KpIsyffKV!z6y8h|IMH&@4*Gd%LVV% z?JSV5rHvDp2d4i3~Cka$k>m7ME}HPSL;19k5m-J_g(pJzxM8Q(M_pvp>j@ zVaKKmOvWO-cZ_XMU0HaWIjH?+lkL=Ro~N2#eg1IEC$r6Se)WaL+UA*)_6v2LhvOR| z8NHtC7o^~EgHS}-Y+#MxJ~!;r-jA`IeP`_SLy?h(|bQMyRH>m0*r%aVAF#UY+UC$a~@(Dq6~hsYm-Q<y?#FLbc;Y$DXD-_}aFbt!-zzamu8)Hkuv8z6q zxo*bX+UYc_IRXl`H@+-p49;M90PUPWkS9TUC%i1nT>A4X)}8RDrp@N#%?&_k$CtV> ze|qi}5D?%dy~`e9M@`7fJxWDCkK;jl_F}((V1IOD3U$XDLVQ_gyo!;}!@%7t0)G!p zuATZUI$Gc_y-l0*G$yvqHO_TuU6PLd))|lpa-GT$xAl`I&0@?yt1<)9g*k4gi-R}+ zo;oxt(Zc-wIGk1q^{H4ldv`mRg=xO@^Syao>MUV~8k|BI(1{zu#xELpW6{#)ik?;y znAoePK@TnH6?C(@zqh@l+{xu}GbA=1!d59_p06H)c7A6o*Z0{0(_5762>G&%NegQF zq~dODSqtxQLPeNP$iuX2#y1pD@oW%&Gu^hjO{~=MQeE)Oc#i2 zu=lIT`6Zp0jLjcg=@`me$zxA-FDjPn&SksY^`?7%qjhW@3a4QRsZ#xm#)9D5Ab6o& zyd^j0y$@4O5TqbOT82zFD0Ei|=CbPX(o$JLGvi;h^e$`y3lvZc>7UqC7p{FT^aMP`uC#MjR5EWyk=h1 znsdZ=QLeu7upuEE?p>SIj-buv#&7gC5qo-gXK`biA5nuNd7AT2o3EX$2Gs;qe~B#P ze&sR0>|ObyfwC`#k=tO48TUqLh6xBfJ?!wPNPDjz5-hL+y$Ba3W*=w|K!-*i8Opkuq2;Gu3+2WunHFS}hGH+fRyDWhuH4Qx>L9TnO$QMMU((`pGBfmgBU!LIkF#{I8Feg)UNie8~c?`9CxwE@D z<@{WWZrDqj|9p5Q3>~I#J2z3D78mw-Ip<*4VBNL%Vg1I1?x!#OZ5h4#519(2Jy;3? zA=75_aVXpI5;#&Ki!{XiA-JFzN#0VPcFyPW^L%N3A6-%(In_Bn+vP0&bKmzhkYl=r z;En6*>ZXrd?Q3V{nJDa~Gp)F`>?wV>t0oRRI&RI*&W8-4_LU<|q%y=TiyDYo#0b+bC;d@_={D>$&B|+~Q8rM@>0{9M&C9_%Kl~)GD_oo`CxpyAUp~C`WGIL!5(uhePbsA#)9&Cd(QmKST+cr1 z3wdy`e0qKb#2I`Z$}Cp1@qQ;e2t(W)srA6?+Ze$p^ZaNk@>P2j19)Vz{chCsCdWK( zUQg{}2HWrq4VDfpn1z}G!7%Ko+nIGEl|_&K!R-LZpBFu$eX8O(ls*#_L?hXUhVBs%cnPUSMoDS(u}aCT_@O^ zUm@1!MReugm-lPNs?NN3L5J{!53>SvpmqFY+0Gl6kyipi52-Ha48cxt9`%vTPS)-7 zq+eN_S=ye!HcE;xAq_fRP5VR^nk^eVi>*C5AD@5DhCSDS$23pXIEk9F4v@?8z&877sZ9hfm$3sDT)8pXDfmMDR0yd z$wE%H55b4)!}!c`pDx_EQxy9KXG5G%F0Lko+C zy$Oa9anPG!iHn(H#+N|-rV)CAII4~%$kI$<-Zp`tnpch#x65n_pLg#^Q&qt*hdh3N ze)U~K*JBZ;$sr>rPELWV2FW(dsZ( zZS)WdC!COg7f=w?w&~G9$$ht0Jt5#jV+O>!;Kt4-!%h=2ZH$k$@ zjbq7nLGKLpIMXby9)VjhFfOEi-EF8`)2M^OLC8R67D7fGq7#g0Y<{fJTC78E242Qe9h>JKWgJn5{?hm%r!ms?t_tz9El_CDXy$fO|XZp%CrM5;)yQQ=BI1$U5M>0DB7QoR^l-(4wQ)^JR!f zG5M_cF8ZXrQ~w61Xjt!UcF=NOD_oWANctqL7tssyRO(9 zY{$EOzl(eVI>^n zqc)Q39O7j}^=o{0xTS%yNsrUZIp5_^5}J(~^&Va8&wLpenymkvAh>sHZoU*Abl=+~ zF~1C4bRq*i`X(!WdO`q-XK{E`Q2(=L=c;o2Fk}9FEsa0+a6~eGH>E_-I$1j=a6WI? z{?JA6a9X(W`A;q05jdtUJ=%*YvO_Fa(VvVRus%>aER~^9t8}MZx{8${ScIbh+ z+}tGNx(B?HMNfqtGRALMFYp~pS@^2hJNd()F1O;F#`g7(3b%P3DG5fSV&LsjY{4f~ z>hl3msBWNO*zF0is)~h`lXusdkAdL9fvm!xCtSst#AV6G5#_B&Ats7-ATN;1m_Rtn zk$+HR(|O}b&W(zB`%PqU4UzxkbW!l8c>5A*%VtZl&8DoeRJJBz9QVSbg>{Co*3f^V ztA7RY->+g74{X6Z@+$KrA3_s3%iMdf3hiu+r}|2Qx}LW$=*BlNu&Dbh1@QMJ> zF?4HWqq1r}+0%z*Qa3@z{aD>gI$kNZqs`y%UhJ(=k=apU3yl1`xK;>DRlh=@pWjEV zYb;slWO}0Mxg`_Bcn4yV+8CLoa7D}`?uTlm>V9+|p}AySNRYptU{icAf{FJNf* zqG`AQ1sie=S@Ll{7428&!nY)VLYE~7;)~~X*yf{Sir&MYFqL)a@TkNu8%PPyi+#5o zb_d7gL~|v56dSPbSdwC*m|G=Pjz*ZVQz^M0hd}~`B;cta5T>WRX!6#}k+(*NWgJp( ze!Zdxbu|f9Eb>Y-QK%vP!O}BGtSmZg;JA~9h4I^fZOD9AJl~M81dh z!7b#Qbv&d5>)4uiN{;~R`r}M6QCPRYj}xK*+!NH9-qHA~Ln-sTjv}25R3rG#*G*qd zi%x|)OYTlKD0Cojua&rW#%NdRiiaf%jXf2Fn4mD_Em1CdYX`N(#wRAFd#^_-A?L+| zyUl_}L6%d z=6hUQU{@|c3u zPD+aNR=A=@XG$lZ_2oIEM6!?y9fV|xjql-ozV0moYWZdz9E921OjU7}!({Wg9^3`} zto!=jeT*zJHZwohvN$N3hlSoTcs{RRMVq}mJt61Mm>8b=F+pfhg-aem&RS_#A79_X zGN}d;3)YV*a<^0<@p+w6lo(Cy&}pEHifHwb^?7JCEcIhe6Z?gXpGtE>f}YfL+J3V} zUAuQL;W3fo@#!}hCTW?qvokkMvQlpw#M{XQ!ZWbJg{gQdZw%9%)zJ?NS!#=VNkhkQr z_D6g>x2-UA^(fo%T)-%up22{rt0uE)wvOdS6B9+bl5W&p=^L&b&nlpdDC!w(GrYr{ zPoDL)i=2<83P}X?20Rb>J?--A6zM^WFbR>k+17Y)6FK(&{@DDmV{LD=n|5FGsV z2@cknn3yO~S^fvr!?eV^38OO4FGrQIhh+*e+hDN3^wX>M#hek-$q$=lFL`tcwUFig zy#zm-;&jS`GHh(L<|;Lqjb#%yMiE7$eSLjdX6EMAjzy}8-~ST&KH|NE9>u+Hl;EgX z7u?&IJ-1^Zd|Fm9lIvDz)Ub;p9!c#e`d+maa zlZ=>s{8bP3`#;g#4y*lXtFjZe*p8(Dhji9~8N0frsUdI>&8qF)sT=*5t&qRIBQVco z_s6L8k$YXkUGLz+>f7ZvpI>9A6b`m6PvgFLl=<-KMVLZ8-x8E|6DuDc8c+y|NYpM% zvaR`D)_p45jPCsNeEEfSQnxVW7DT@kJbPsjNIt+%>+rO&-228*^(8sTegNY!xGtlO zUh$igcJTvuy~xc1h`GaT7E+|Obk#so$}V2-pFx>scUkF9=^&$d;Cn+>5U53q<6;1k zTNAjq&>GeC_67E|!En|EAIVN~C``)R#MtFtt_iC&Hq9*>e zBEy(`Ui=&$|ByF4yUXFbSG*A5z$kBYba!;6W2N)`AAOm4%0&pWj<-mS_zH z(M?{xTDX|uZ_Z{PR)aiqRmH-rvU$|jHB zs`$AT4MZl?zFcHk!GN6eL)i?Nh4e}!=if@{aN>VasuvYVc|1RG311jHs70X5gHn0N z%!A>G3rNP_F+0AZCRFLnfpE1#^A=1e_=~G{9>=5S9U65s0JsZkl%mF8{j5NbHI*bcu!ztkD1zdrpSU0_ZHi6tG}w%pT_`h zzV1*qp-qS{xLM!e>4!gD2oKx&gly~#hetJd0r3-BK>ws;9mK`eME^=5LF%2wG#nPV-)Sg~A+_5-l#<<%=7UH&iIn1B4>eSb{LXb*`l;=(kQts1Tp7GbOU z&Ehcuan<@7smgI9qPC%sl2p&M*)gyvfMmFGX>=fBV3oJ;Cx6ombE5IP30-GEapoOh znl@fB@a!Xg!a^up770`oI!uwqcQsR|EmU@anq@eaQPAip!@9@g5tTXQNvd;&dGP>| z2Osa6WV}M){*uZv4ryDFBk+Med&A4UOza@V*fs5$?crW!Q94-m;5ulvz=o zys@`<+-(K?QAx-rBElk1PtTt~HdS5%`A1Q1n#xbo$Dnx-7wM(4sLvF6jgO9O9KxKk z?|*gVpYzpl^@yq8$iaTrQv0%t&)ogs$ng(`cDQWXEnz1)3E+h)DFY}Ra8ND37wH4e zI{`4PoY#HQ*HVPg+*7}qSKem-uLav} zT@12j1`ksro&$tj6;IX|)J~sMOZhc8Xz(>FMcX(_=kpG~dUZ;nX!{qfLbLBWE}sGm z8gBy#hLM9JDh6AgjqRcf1>6B>QUW0G#n2h~BC8EE;-AljIV~;qVeBLb`Cq0O(nq<6 zR%Ps6?qud4tyN>`yW9(L*QHfq-&Y$Yh=&nOhEU|@H7Vx3cJe4DCi;oU)T@Y{S_ui- zMp?JfapV(<_UbdU5)%bLNpNqqJKs<>V#zM**!rWA81tv1KfzC$Y-Wk?Yqp{NGyn`~ zqUl)d9nm$GYjiN}RC3`ao+ju&#+noL}+N0Emlye7g`|CNAN=jd#k4?3u~-!5@XFx1~&q za?D=jZG02L`ScmwW&>ul~50))OYH;4f!cKl#=VwfdubJ07r%ljwyq^>Gh zC5aXdd0rQ8R-p?rfSECRMd|feInUA86!NM@I$r1RrHL)5h4ZE&l8J)IUpn)jg%CR& z%KIwX-85YzkBJsk`ec4n7Fj(gVDOxpFqxAS^YM4k+X}A55)s-r^M|STdnd*}dKTp* zsbp5NzLZ4<6b?M@8V^f+cG4O~tk60HQoQ=Ak=N@E2BZg~83RS(j-FuR99mFp_g)la zO5E`Eg#VI(WGZOC<38(y@U}V3bDrFLU0+sjfDR|qpB*PTgFt+(#J(#(tR3&F+55q% zrtL}d)lDY0Z6?+HYF_f>5{I?oow|CVAqHm*_c}Hs`Lot0xMTxQ-k=V9`mqh&_sK!) zN4`HL3Bq&XA_g)9r6f4b49^n}^npVkuEhR>b?FCQ zXkg<LC0A!GUKO*nU1b0;ox%$%aAVNrtw0#x`PcRi_NHiA z!}4z!d)C3b6HayT(FsoIdH%Dmi0hKW4w&a9&W>Ik+BB4*Ch<>RY`r-qFG_!tI3#pr>kLND%K$^8mS9e?2+oO509{cp>bRv z*-3U*&%MA=Kmzb6W*xwmpfN0J?F=&~*maj?y1(E=6s4SML#Lu8{A2Iekhl^Mx~HM0z#gGf z8IBp^cXC>5vqGKCOX!kUAjl^WICH&(13W|lC>X;Sb!}`G&!-_fS+rc#jd2ngoT|gH zDYr@kzISnI{Zsd-RleBn_e?R{poDHc#{4m@IpJrVIf_6RSK!@jR{YFFZM)pp&(FU% zogcgsoos)ORs73qGP3k9#cf^NSGVe_9M^~2!e2Tc_9zLk**!3pDAOagqa5wuPUTje zfWo;vd{6d%1Rrlr_1cNFFMi(H*_qs&dhQkcnX^a7PaWhvMP(EBnjy0D$%xtDZum*~DI-9NE|R3ec@IR;WHCxk1+c*|y@FtZG8!G}RpChXwRZP4z&{ z(D>5Su~26*Kdio~8L?G=SzoMxz2K|tn6z^OpFP%{{-@TTW%-)&lf0`a^G44*ZIcS; z!p5Gq#UZ@i*b!>bGHNIFO?B`@ZBFH^79b)3Cy6=V zt1v406N0?Gl#OK4MKZiIGY|Lc%%de(tE8{ztA) z-fXmCaCn{dQ66SGs$%D8;$mKWHK|SW%(CgAm-n!P(cFL~jVSCr42kBwKS!}YweHy_ zGz!!_HLUnpM4A6i?+YLOZ7=f+tih%`ZPP9z(SzFA_|tO>zpUus(paiH)+TVcH$=M4 zXG&t2@+=DNmww@)&bqhBYb%~OtSx86c+dFLG`q7HO@TnprX<; zP?SMntS!kNAI713s|Ju0ppjWW-H$7^4m>#ve5{y4tu53IO7*P2qWz@%%AYUV#QUB|KHZDqDAoR*e$)+g9J!^Bdlju-BFJ))`%NH91!c-g=zTJ9gPr&u&j z`|113BEYZ&^=fCHgCuPw|K7QlQmyB9lnp>fM0Ib^zV%Avtc>;Q1lhxTu7y!(*!s$0 zi688WFsI@w5TMgmBsFMm6k@P9am9nbwOIOXpZqgo{D3_^P8ARow3(K4Td<}oF?omg z-Cw$Opca<&)z^k7b;Ij1@hW0@LN5u*6se+}AgZqK(Qw-ULLCGBi)L&{dW z-6f@-!yopcpAQZWiYDX&LRfGYb*2UP*QRso%!>yx9NT^{$`6XPUz+Ob9(Mw&2%!88 z`1qt(*@5M@!8D>jrD_1YePHzaDCwT2U!Qnid0Q5zY9f7WJIeTcX^Tyb=fA*3prZAb zP{0oB(&4=qMW2FqS63)1;m58uA?S9^3}-}}h;!dM5;7c1?iN>yOq^_G@iCAOrr|?q zhetS7*RenQqVeWl0{K6o(OJsNs8okf*=qx|;Bkz96`g%@`odd{~iF zcA1E+B5|k{Y4%*>IUQrLdA}0tDw$PE7mk;&4P39y@gc})?t7-wqj<$ILk|nLJaI_> z-N6A$VgY4vGqi92{eAMcm(q(eN>y#-&`f&b&dsnYWimI$vL~0$MJsYFQQ}ou&!&1z zV9MccQpBJV(8p+ijl3`N;#zE2ap3uC_*9%G2uQa5V8p|uikVZM8@O5nzLSNBlrKQO zFd+X6uN%lV+%();R{p=S& z@~F6jby95rZ2hfJ#=xWaWvjNPh6WRwgxf@p>dJ>F`_|DKLsGI6fCAELam7>lI-6C389d-aYQ01*{1 z`bMIgphtGK%Wqy!2C8}029yruyrHF$^FNH1zdHAfYqj8xybaU$EkY*^swPg#zJ3c% zRFW(mX$LfuwvN2hBhzkby0#`ma;k|%Cn(8yrLfj)$=Pu|uY)H(rqv`qDZhC-+~c+$ zf!1%5*_Fv|Bg6rF270wbcOmNEMf~>BN|_ z;H>t^&?Zozp9p1jwncV{j37tubDXV7G@p|5$ksmn(C+KYcS8>O;7eZZel|dq#SjA- zzzf4v`c&P)u^7orkTaLM&i|^|97LJv8SdSU{J88^yu7sZOpqa#;~p9q8;SjVm%@vZ z<;hneiq$Df-c$`(vn0KB`tL)aMsHp6dzQ?fbB`kjAdPpweZW#93~d?;%O~<*yT~%R znUsi!eOQ)E*SRXoUbP!E<{R0dJDnu>Bb@CqQ=gH+^3O;I+!e8Y7?fq!;QLf99~zbq zV88cs=>UNW{iUmwF2C0W^4s;VRScT%7$m=s zJ;GsrPwWSo+ZjFw${S!OPB}-~kt=r96urn8?0pfo&tGN01GwIj5vZtT z=Xs!HU8%1lT>o`WX)x=ct<0|<}JS;bOrcxJ;e4W{y?`Sw{C%{HE_lI()GWKNwYR47b7(_nEso8jHA+jQet+GMSe?aPWK}kt=Q)d|NZ-hz?LOv4-mWcv zmB6MDY#w3x2aWYBW9}*lqzg zn>iqho)!5=CP}mCu-OBIS`X@VXh`?o<3t;xk9w5zfO7)5)qSOLoNO+JuXA#ISSM5m zFr$^Pj&ykfKK0C>&Cyt?+G3PrtQ>_BP)I#y1cZZ3us%aCNBC4O1};8v`vZuBzT-i8GTT{WIx z9fVa2D`I}IS2(J?*A3YSZ^Ed|mm|r129KdIG;gpR0CQ=0x~PsMSB|gXgPnd74eN6! z-75n;PS_Y)CqMwn9~GZ!;=$pyCgyL<_jQ{>~OJ9UDg~qKGP$n3F?EpT z9~_VQUt%aSUe^*H`o-2#Q`WSLK&oXG%s&?H!cMygH3)gzGlU%UJc+O5dkm(C`q zF!V6McHS4YsZ$3F+yLG;7eeyT&p%V?3Bgb#hq`2eRY+x-POJ~Z*f1XlGrXAOyOfqhh`;OyTB5DrU)mnUh$9C^RP{X3#o0Ldc=xbA%AD#VuylJD$*?h@@65mNdf=;o9a z(XfN-8;dVJf*d)EZrzIsmp<)LB%as%NT?Wd$M~V&+?rINeAdW25r;~N;$(j+X3%6P zN-NcdH))&75Z#D8DJa&O4UKd;gfBx-&ne7EiD*t;1ke|*U z%}H_HAuB}Wi&M87W?`J9elT1GVnQjB127-RWa)jl>ZqFpM3%L=u{-WE)}VN962@Cmv1+izUE+pBgpoKKKRbLcZ7R@kv4E?1M=^D0(W>edC}F zB>{=% z$8^^U#&Hd%%+TA3oIKBhZxe-C2|vly(4i-MuQ5_7^wEPPo1KI@dZsNVSwGjxsbODS z#*q#%sBm=Z>VzJaJXYg779=iIJ(X6cEfw4GOm$uZQP5gDNjdW#a?+>vid%yfnA3$? zX@C)!HjDbC37Y(;5Wh?}KFHC>a1|zd_l5G_ekq9U(H-8N=Z^9e?aIHElBlS!7w--r z;eO%=XhjQu>(K8G?l(}i6P4z^|K(y>7Z&(XcA#IHgx$&2!VR34f@%wt$MxS-IR^o* z>N}UXHy1D)NGzFz3ColEhpNwjfZ?(d@&rstTkCI; zMsl(MyqtYKzkrIZ>gzWk=KDxW;iMjAcu}IHFCXy*UF+aer8sG4=(O8^DhN}bYigA{ z{LAZKxn~Xde1V0nTo(07S`^SCJRO1S&XE{cIsU2D=scu690!PosV(tep)to#e2B;+ax$FX%wU+P8kbXgs*L``v ziL~mekKr9j`ftES1eH-rZzlr**9rn@6+RNZF7mdMDj4DCb0^JIQUNsK8UfRhT1&6* z1SXmq$?OLLi(ScmgvDY_$@M@8N4rmDDMv;3YuRt&vGSZZP_S@(y8dap)lQf zO914^dq-@>pb4jPmDO?|)38kh}ji+PqR0ybbY#F_tYzR1K@YK+%;HUH5x+ zB5Bs$AMX@`@_{}9!dDPuiT|>R>6&8WejZ!zoZm9>fP|RCx%#He%bUM=q=V+KEJx^* zQl;8fACuO$H5UMlmoX4`R_bX3*^e)YpIQ`yftmY0dER#a2-x5V!8Fg^acr!%S^!Lc z1xb|6qy6)%*5`L-$07xAD<7hI5OcCXspZu6X1%}?=@y&hMl$t+>mCgLUp|;@R zd@E$tWx{-SbXWK*IN+I-JO86*O@(;9MIPG=|5g=jC zNup{V6RUxEo*MzOF96jRg7-36!_e^az{jPlX)3j~H|(W{CZm%c-zxRGDYRVCJJu^M zSi8wnpL+Lv?l3^CWNhWqWTH_&5^9s!j4pRS1-Sd()=c}^pgvrgCV5%}zD3;q01#a6 zvj%5j>Qasbvjjt$)!9~%iO838N@HlxptGiCZ5V{X%p@d`-|$j;JK;(&emP(}$3xLr z{#8YgiJ4h3B+s_~%T-1Gz&E4{LIoQzMYMu;Ka49cPrk_7Vgc0Tm4P07lj6)T#;{)| zQjXefmc*O#S%H?pyAm}T2-6ur6ON$VJXD`D??<5Vm(x0ETbAYdF&+gLKLgG|+lo)i z#`h}6qtkCV;#|2Xlz{U49O)$w+UO9FwnHhQIu#Rw;%IZH8E*VXJwn( zOa)Lt0tqt!J61twpKJZHtN3;lP4JZZ^LQOLDNa_Xg4&#qVU4Fh6*h$E`@S^H~Bx1=A^(cTgmJ!zl zwE>i92eQ@DMEgtOC?~_K#BFuN$8z!Jfv=pqD)D1byo9S~#%eJ$H_(O#v?v!=zLXG$3=y=^Yw|4v4_#+y+e9&VAH9eTE5l$ z7Qt^YQKTmT!}}7H4$Lw9`+qHfhI3C(6n77&>K}(ci9m-3&^D!Vcgn6t?PMxlv7fXt z{=^#`1(+Jc4^$g6{-R5r;H}O3K5XE_P~oiNcd>S+ivrCF*K#{jAg*ioz4<02h`(3; z#9>h+B5!Kq-S33*Gokr*g+65RDu7t8X8`{OApJM*ho;xzZfa(5DEwIeC=gJ;z%+GH zA{ct0}dXVa8DyB`itKX`wpekGS-)%-Oi#@MDCJExx2vwSkqe0h|0fdgpX zd1sxS*w|Qe6I0WmlARm|kmq7o{p~d{O8Et13ONSEH?E|fUW=a0i)2Fkp5BJC?6jrs z-&H^UN;Q7<9f$bn8e02)PAM}BV`tBO`(;&4BVP6!bk&^mmN-@Mfsaj+qP||9G_EK0 zVKED=2*ID^04;HfSmkd6I=T;JU^5sJ1)T;zm_EsAopoqjR38U_Upf4iY%?;BM;})) zB05_z11%XqmDwZ(rR{%~Fr*j&dXA7G)w%+~3^p9i1w{uJYxqssJQ3a}f^?=6aOVdN zf4*GwY-P-t85Ut^uy4bl|^qj-aru*(u`R?U5 z%rjgJGptV-cv|P!tdzUZz6mk<;XT(pfxpr8Z^}CJ-bv*P6CMM%8P8syzOB?%btaGW zNx#{=9VwRQnnz5Sido{4J3q ze7S|8yL61V;b>g9a}_RBq8o&%ReAu39A_LQ>BGumZ)+Hj>gv%MrdXGwJL_UHYwUjJ zx8WZ0yBffn#%{tC6QN27b&aXm!Jdm)ov(bj%!$r^3%ZK{#u}Dzx5(Itk7(;ffc+f5 zH0oNhqcw-wf9z)%$94f&M1_3JG6BU?8`a6G&BBa%Xtq4fwDCh$JDg{MJo1%WrEjm8 zRX@uXGT)lZ&eIbk@5nClE%Q|k{%n~MgZS)2OI+LDKZ3soc9Ua8^Wo_Q1?;tm@-k${ zQ+I7jrfh%`6ud8w=wQ98LoEk`*RG`fg?E=BEG0x(_ZN_tlcl6y zLnGt-wWP3l^>o-j;7^#)xe`eK6)q*A&shD_R3F6?fNCZ91>Zki%^C$R#NKcHCO8Zv zBpRij&E>5rAAGdoJLzJvWifp&Mw$1k#{_amEw-%x0yk&XVCL%U6?b}lJw5Ued(5$j z%e{FI%PFNCEDaImC+n^vM#ANq??k1AwwY7m;T$3j{^BAcp5^(`Iq@7qx+_-YIz`W_ zE!Lr>P)eAV4ozXor|R;LQ4yaiXrV}d4S+&y>b=3B&7g#-MLqs7^PuEv1Gx^`(; z=H=UokZ?}{qy(ZuQD+I?L}xukcS!>|X!hWHXAH-3=4zTr(2KsmH#lQzb-yQ$7*THk zrC-w)!K3bMVaN9b8k&mI9-{OU+cf81HPOkGXGpiRLkk|N#La<)AWgagbFP1#xz-cT z0pi3x4p_|4hlU`SQOm4{XT0UvmxoL}bwhFYem4-*HjV~y&C%F4>{VsFUrD~Ks~Yb- zE_<}Sb8ow$((-q}k;86a-3o4(hd%t^R9`g4nniQi2FZjr0iI}d?s*z0`>%Sc?u2gA z zZQP{+EN;L87T)ICjGZ|N{rKcOJV&yKmCDx985W&#^a$gR$%O{S-vcTMAI|C|lv2j$ zyp#HVHMm*n;y>Sv>}V;pQ>pbHXmmd|UDfHjS5>FZc^&+!uC{3BC28F9(OxZIxk9_V zaXgd04E5j#*Z<0$pBS&M*a)N<)V{@ClP*-P;knI8-axQmxZ3jBslkrmNdX zryUE(s&s!QhAPX3i)sL@^1~$O8$hh%Nm^^-x`$_lu7PS4VvS+Qz~^m?P*`kPh@}_v zdJCFg?|^Slp(Y}}f1YohNUrl~%-hpaS&9G`p4t#>yiQD8EZyc8RI`-5z?bHPOY?%biqR+MWM#3&y7NY7`PT>zn<_IW*xs^-R(0nGreejZCYa!2G82mGL|%)B`vljhtMp&!S~E;?6ETko<94b{I@Mc1uc zCx_H3Ra%(mGFVBzD6@Y8|!N zo$b@gfI>vc9P7o+EQh0J=-Vwbd2 z;OxiN$?Lz%?_@p%+N;p-C6U74L*D`_Ab;KICy+>>eE*ypUqL$3b#haoO@G~sKIbB) zQz`@baw{m_>EHFzKRZfgGC>ToTwMYZ>FQ7C_qyH~*Qvi`cH9WcJ==-BravTcft zuY8%y$uUd6EK$rnhN9NMhIsXR%(8jIS5RI}b1^&msJh_tG|JX%X-n~_wJip#M0Mv9 z*jwFTgZjs$>zL2Xw*dNwKHBBH^U_iBWA1|$;dQ3-X>7=jh~#556xK?1|l{ zl!;(XK$SuMGpFlZ@};m4@D>!m=<{H@A&(}K8RIYU?)*~2|4{^aqE=>rzm8H(z7;Hd zJhQmTZMODIoA_^-E4nF3eps{H7CBn?aZSAHr1V>a-%9$%t6;T7ej_wNx^i*R-dCu1 zB_V-kUuS3M%MX0+gH}xLT0sE^YQ6a$2Y}j0digVfnF>aFb7O!D#jT+GNJ=2BsnLz@ z0%Ld2WvI#pswgd;<+a}%ldf~`7ugm+RMWwEZmien*d$@XydZ4)^?SKtL+-UhA-iq+ zgIRaa1jjJ68KOD$ys@GTD78Iy=OxWoxC0V)oN{V%=8UP(^>aX}?=*AVHkcQ&rEeh% z6S#BGbn2S9s_iN?Z;Ct8_Qac-t{VUW5xmkWrY~y)4$Tv5r)rTs$BXU;EG8Y`jQ2%% z3rA!XhOj7SYLz?OkMjX+`+q?i!ylhdS!((L>^AFj6;Ao=$$IpSme#7KH!<{$uDeOA zf=KV9Y}PYI*?42dxAB45tYu|SFaQ>*fSYgd#2vNhx{8*TNI4?l{Ad!qRAKlo%>Z)ngV$bX7C(=eowuz+7_MOo?WWHa z*fNsWsfo+>lgXgEB>SRsbz)%t9Z~HJ_`(tQ7br^gD%Hg|H`Q?)byeLQC6OU;*7 z2d2Wx8MHSP!>uUMBXx`fSa6bLgNR@BsO{$ZEzQZZlfDUgCpV^aL(A-Fsczo9qKLEq zjJQ2Eca#mx;n#G@=483&kwK{)>r*V4RDf7VCan*uW_AHsDZqS^u-ns)0+1%Nw+ePG z1OY&;+-Sv*iL%SqVj$)MDvRLuM{GIQ{{a@oR>ODS?U8C%`v#K_U4W5o^749UqMLK1 z4hA7*8g~`}bQYeS-Cx|WfBU89F}%~azA!8CNZCSV#b@B8(Ank)7oCdp-`RbXK-M_PK z!#n)ccbzmf9--URLOY)x<-7YWd}`GQeIUk@0efIiU0~h8krKf|Mqi;f@nr6Vy_2Xp z%hAY|=JogJ&gjk-;jbV6eo9`fSNNA4gy11&Ow_*DFR6b!yG*wD7avFZKY{=pp=h<= z_5f|^ke6ksucqjR-EH5UJ>bQ(I?s4ohgRE;K1aeoz{8A&TemC{p8Rg`oy0e7W@Epq z>p>2uc_F+tay`>+oB@B5h>>lM>~) z@2;V}j0ycwb{2PH9saglIpxUv@>yqj?b|pFYnlVpKKAuNgb=@^-z&FlLmCaskS01t zg5Z_!V;>FYKWXXo*7;Y@PQae?XdX6vP9bxeX+@D&d-)b&RB5}DG)BufHp;S4P%h}< zA6JF0nnO`r7{(D%qIcr1+97A(CKdqmFHj&nDCh3ntHW}Y6Q(CvlKC@g?M>*jIQ8!X zg>_9(h4%Z@>^!9z$J(4E7qpLBjrNSp4qtt#?F${O5CSEj-mG=|yhop^^H< zMZaWwMCV77O1R1k6O$B`8uS1;@Jx*b+ z*36EVPgw>Qplr{o8uSu^>gf{VyaRg? zZo13O{w9;EH|r<87abr!Mk0X?@04W7lsBIomhPoQ5Fi;B+i_m+C8p^5+4S{KPAdFt zc$9u^|LUi98Inv^E#;uR%?{AII02oax;N4PRgB6**5#k)@E8nvSp4e967JqGCF*y^ z=Mww(j{gU`f>7PM*Rkq8S}YfKg34|sFV??%h}p2y&C;Rt&S-N%ys$^S{aeMjQyP8L z56?2IFTkF{BA&X-xu^SxK8yEt;Y%{;cI5zc4r-_WDev_XhXhTPM5)nHBWbQ{xF&kBL8({+oPlYObvj z%3<+>-BYZLc7z}m88R)lp)dubWZ^q&$*nTJt;A-y5w29_wdbw;G(k?je6tz;H6csW z73G2OwM$EHtHTOhJeu6EWi!aBAOuS6B(+JezNY?%O}|oEySYydIJqXMsx?nteJ-7E z?$%{#LmWK$m1|J?#Ew+m{kF{(Mpn_q{H{N1qHOD9nf|Xs*(PA{vMaV(PQ`(c+lRdv z0(+knG3FKWu!1x0IUu}SUN>Q9c1D^n(9PB_x+A-nJ}Bgk?jS|p>aYarjkPrwoJ^Gd zMDOFw2HE#%oGO?EP7B4_*ekZ%ZiNR_x&g2fM2Dp`Jp3!sQ5OG;vEQs{LwG?}M}4;J zuD75xz?r{@_XvLbHoS&FA|LAbDqljqRjuosjv9Te@5rfX6``0lSGo<%^!QNqT2NL( z|HVQa^PPhIm|4#m28RWDQMWHy;=VpRMrj06$6|TxHt$%yf#i`)}L>U0Q0fOb9`PwvX z*E~-CE=j2|%`N5i6fVcg;_^16eC)6^^^3{y;=a%0$7kr!#-AA5gHv>eMNxX{rx!#a z3P34iV#3f+B=Qe86T~}U0Xf@D?C%H6#lX16IB(Y1?#xD6?Y{*92a(ON%Q+YvzB z5LvWS8qBy#X(U{2I(Tm70u>}NX|8dB`1k^=M}kKie79|s=`%xc|CjRoy`KL2=}r7W z2dDhEoIhCu1`a|uFqXq3db+CUzP92yZqSg^Ief@BlNeUCX{8%sipEUv=&8@>&a|sx z7XLjYwfoH@U}mWD_Bz7=*7glnrvM?kPoNGSL1;69Yod)z>zizgJ9wCf!xH2MY%6?Im`tePwsYZ`oC}EY?QI8DttPb3d^7+|~`2Mv0bR479l*x&ya@3y2!&N!NkM z|D%V6;infj-}|eNMRx%QD$o*v%qDOT0R@u|4utm5zjiS;B161_cH&=0)p*_E!;zV{ z+vjeXZ$OtGBurW<27fHB+|~Qs74gqj2U97c>V^DC#|~oaWaB-vdYw_EN~u6%QL43z z{f$!{A#fmi1=D^BbWwmafb$1bK}a$^^++wF(d%`bAV%aaHwbu0?_F%tf+EB-#k|ih zukEil)KUS23~kDZHT`NHUS1ZE>UD2cXtAuPtn^DEyWYgbha@havAGrR9?ulxgwB@{ z$18&&!dzB9fFbk)oSytm!8wd^sb3TLYuL>~huA&QV(RBOkT1m9qZM`*NUK4H>wux1 zjg5^rw2b<=K~&T<%IEY#-Qn)v5J8hp}@ijYZT&NGV!{Iwb&y ze?@FnB9%LJS2bx}j zgx=-#+(9lf{ss=)+tRa7ZTSYus2c=QBj%ElEM~6c_E5c2f6g8RKLUDvF}=gl=Zd}! zJLdGkUqMzRGF_Us8-z<#AD>E?KtRL}56EuZ+Ts9H00 z{&f^!Ba2`Tq{uGm*Oz5;wq-X67bCKIQ}Mau8*0xDp&na3G0APuh~8uuae_ZGD>!`W ztAB6_MglMrN?!jNI^sV%F0X~w9`W70UO2Tg{fEX*#RuJ(;^v|R=C2@Lt9&vNr0s^M znr5AqVR?v&!TLlFLQDE@$o@US@Dj@!^=c@tziM%mjAthQ&%B~Nj+n>?7^T!jsTP+= zNQ<-S?RVOFe|JbIZ%epsyC2o`S^!7j8KWrH&EXXD;i@iEDGx|cfnWy+P|0OTpUA3; zR3IuYWf!zvp(%OO4`$8gLSj!umCJ3B&~N{#D>OSC#ulL3#IMsob%C>APmWN9e}0t6 zD24;^Ce0kN<-IEvh_Yz8I?uW~*t+@`bM^1E*!RK;sD?W~u~ji`8;j9Ly;cU-ka&_~ ztYDDO;9FJvkiNxOO-#qhr>r3YPduFEdR@gLCj&kk7GOV{AG+0U2h-JI3!?70=e~+? z1;|_3p8>NE>c|&>0kUE7=sp!;8UazBYA$T=IoP%S6R7l-st{PexdV6pxal4*b_Iql%P8Qfhs|tZL z{{PvKr0J3*4bW*-y*@rd+RY|~)cv{B&rc{-EA9c+R?Mf|{y4y5pZU8pf=p9jAn9cN z8+{Mt0Gz}#pOTs*)visqo%}EEH0QjSG}E^v(o>dZ_jj1_H=gltkDRll=Z#+_#}Bv` z*;d>FZ>YSW{df@6U|OhZMoAK<;wXQcT2@PjqiwbP?dM_{D_Ai=18Sv*{2KCxU6Y4i zb037Df9p7baukGjg1AtSs|Ms8&F83Q2^z@IWA;x5L}G3WK~x5f-g{bRK2b|GaqQrb zbl7sj-g;){fh>Uk62u0VE+!`@<-FZ9^StLKiZB~FNA@eL@tW+{89&YKg?G;IHC`m& zYJYcd3~KnHiv!7mi{Ka+>2Lyz^4h4f_>AQ?2zCMfK+1Y>Amo!Cp+5v$7TxIqJ_3kA z0s(<2uq1#_i|O-UFQ>t6cQ(7ss_^0Dn=&H8&olobMWH1l{|4wY1o3g?4o3#L2ysE5 zz61BXClq$fs*427rS4zzipp1ns*H#QyZE`Sx{)t$Yo@)iv_NhkkN zI<pY#WdCU$YTCnA95-K|m;XwQhl<%Xq zj7k-!wcIiv(hBg&-UkxtJPgLFzj1!KRij>Jn626XY^yu|2|Y^5m1?wPU{ZOmc&A|R z=;(#awO|*FcQ=n?Ed~v@Kuz*+u+zv3VI%}NPnNYO0_65`j6Ro}>sA9o=f%u88*&Jt zvhGKhNb#|;myr1y);rvp%)N7PPXy@aC@^eU+hRdyCaw92{*`2YPuB4GpQ*4l-i=bx z!jE+N2(}H8f8+u&*7sH;lcZAe7OxB(vQlkv7_~&Lzf_L1^GplofeY@?O;X>q#zG#b zFfC}6aR!36ucLt@@oz!`^XRrnSkq*H?0LkWX5p(@YiT5yaf@|`ESR3{eL4^RVJ5UNKNgQ*WJD7m6vIpw=!2j zNcp*Ie>tS5Dc~7sBHl4Q1jf}^)o=h%en$4Epbs7D4cMH?W%=Dg*a>lgRf{qLfNt+Y zH-A*c6mymybbMYTr8P`ofA}wsk8PUJto#AcegHE!aPfy; zKfP^~5;a5(x`RYJ!JL(e50#|F-Qhb}5Vy@5e*4avo9JH-*H9%0qbTw#%6J+F(6dZVsB~?M23xyOB0vN|sDX}n0`sG}6B>pNT+lxi(kTGDsoXzia3R0m7u{LL zJL56sGRC2kAqBbKfH8?@=4J5AJBU@4Bar+8Ec0?~id-|zI?aiyQ}!9cS9c`JFJqql zp*H~b)|OkLgGi(+(1R<3JXg&!2K$~`X4zJ9F4Oc0#^ad7W*08}ALHILy8}FCP+{dKSbWI*_ij-TuMky6fmC>o zO8tT=QFx;!E=ml5Q{d^vW~fyHp&snPin{^fIr8QwyRaX8%`bhtsx$Ex;5alvP0Y%X6} zBpRy%p8a4E*0yuF)Ca0#$l>h%mqa$L+v3f+!C@vsm7F_4QABcVU>U%^$x4VDy_8Q> zGQ9z_rvNIOhj;OvKroGb^E;qu1{W}h5s=2oB|*NT7ZnL^H-@ww%uBNrJJdS1ZQO#a ziSUNht-2$XOMo@WXY6ZY6G^a9T!F!Dr&*s512>E5_g@0*kBl@>FkS9~Xzk#3qc{}{ z{`6ruKl|V3Ipje`H4bm{9USz=J9#+xTZkwde)w-RQOJOAHUOS}h@IDX$VxJsZFNlSPfcz{*ap+o>| z6L_?;9ehF4zqT^ZMMPP;qDCvHa<4eQa{Pqo?_s4+qAGBRgO3et93P(>w@#j%s!dqX zq;nH7O3M44MF_udJ&Oh@d3}_3u&(=-#Gpvt#^xVrb-nr)G?@MOPqH@^LQfn}W&{zU zg9&+4Sk4M^(tHr*#z*-Xz^j4^>Z_+o9b7lRxGddxa^r`^j1!3d_SQq#f!^Ehhg}UF z=!q3a$H$eJ0Iv#sw}Q79dJ`j$x&>{U-bjlZvvb+DYL-?cOTFwnm0Coa7cej|kLZ9-9KGU| zuWK4*`Rn8Jk%Zpwf=*pF1n>t`<_upRf$9_WsobItl+U#>yb_O=AA6MbY=YQi)l|o# z@*xM>Zt@&#Dto1%O7mc?4jGcZXeN&p|AIhwOB(FcnY$a}ccnm?X&GL^idi6qq+>1J zq6FMGO~3Yzmx_%^CBuL~7SxT1&TJ9{%KC33VIjB>+ZF6-cSbF$2wxA1OF8*h-Mbx{ zlym*v2%H_D$y(F45vZOr79gJMuvY*vAoIl3rLplVPWmb3q@_W&#g5+<#GgT!J5 zg`6W+xjuvLyHvX!aCju#^aCE#sZ4@=dD#|5q z3etDTlC-=sHeF)Gfiv39!_SFcQyviYn(__Kr^(Dd3TQRVd^D>NSy=X##1NnRzJv<7 ztZ9OGfp%z~mloUrI`TCATwJ0ATKVTh%@-j|1!>XXE3?<61o7b7BE1PNg9ksLs4)87 z^iWkxsJsY@SA>Y#g#RyIB#+DFOGULh_k*Xyus1IW-wnNW8H3sCASrV!ECVpG`RBY- zIFOR7a_b-DcAG-W@YP)Ak9|vb+hfshY!+*Jw6~=XjVI|)J72;!v%5#bl`<9Y4{OaR zfwLwt8iyD+<>(qd`M_x+1w+W!>iyaZ5>Rw{mIKdwnmcAWxkO9RbOo1^VIdt0;Vv09 zby99>Q6sMM?m~+uZMnZbo|(zr2HMg2ku8_?#YO)}9;c4)@bCnRrF{vkpX#8pnlGq=tVK;SPj^yy_t z=@=M*)Ed>r^;t%T%?4L*q?cL>$h}DLz*kyivlixo0s1@XDfXTVa`kjowaEf}6gI z!u-@(+tc=skD2y3^+IiR^&7y_j2~m0Y?rXoUW92wVq7|!uTv}Ti}TZUf}EPUa$Yim)^Y&icjw4k+5JbL^^kpH3WP2 z!s0p(w{+ft(@Br~Ca6q?n6RZ(B_*XygQJ}QMmNziWLf%PYRjb4LVjZQ&!1ItPJKMT zs7+Y#XsdO|gBryfXl)}G)WzJyTF>TwS-TTYQtvAiv+=wI_|sj`+G{7fWGgz=E+*uz zt1)?$6zb2IntpIwk6PJzv(!@Mae6n4#nTl`n+C-K3u(!>WKqeZxQ5yfxAvydXwOA# zlabWpPiuG(xCj9O0Z0&3SC^S6{*Ypo*EO)4BXt=AsdDnU4dT{;_BMb+Y)P`1JJ*35VsHYe1G&{bdmBdKEw}s z@G!FPNz~>en0D2D+ho-m!B^_wfQ+gN5Y2sUYpK!cr{h?i?Nl?Vh zWYKd8-WK{^8HgWZmtJqGjUBzueV4&p`}jrNQ82I;o6uJ%Qs}J>@rfzb8JVk)tEi9{ zz?s3#az|OsM6cV-4$2?JLsnk%lv)WSA-%TaL|Zk?*fdY>ocLN)qXBM($js#5co?}U z8u#xy zi{;N7dAdN-3%^%yWhITzitW|dtXH5aOegcwA3`K_CecACRHz0o2 z9b0+7j9aPs`0bM)pxG;CtOSbm<`JP?11TnC?nx*`7gafmu2hKfyDdJL7QD+|L0uhL z2)yxm=0)W- zx&_rn%q2jUeR|qtJDBE6B}3|(rAC6_%VLvp(w=kXrrr(z3Os1(9m4dl`K*t*WLV+@ zAP{uq_>>u}e9NjD{XRM8muhr&Xrd}@aTDBoz&32{GPjUfmS!hY!1I*|f(Vh7Rcuvg z$!lh7yR!~v*c*DcOA^`=Ov3(rp*8_-xZ6O%_&KR7)_f^+6c4hA>#Q!E5q6?lHFe_s zt+J}k=C`Wj)+$}_0-!?(wfrB*pMR7K%GI3~{`~1%Y`Ium`4m}s#4J1$J?;;6U;X1rcs+G|n4Q;e_Gxs{ z_{G7o75wdCh7E^O2XJ_~1X)cK^*;Q}zUNR@^Ii^E+Q#d9R^s^|#U+TW7cvD?KuX%% z%F$b&RV4nU#x55svb~x__3~uB(5D0lE<3o|KtrKir^zIkq`K^$$syluqzE?;L|Z9gdjFjOg$j50kz0G?-0c zQoBUZ($-+X$32#}QnZ;7v53UHy6I*Yk6pHQ^Y!v-Kw#Y=en)L#u_M7HFYjCv9S;iz zS}BB0310X#=Q+h`%X!h!(t1gL(^3-S&mo^^(EI%J=TmrAh5AUa71BC>2>4Q6>aDFe z!0Ei&w(X+6Iee>yNO^6dbX21N1`e!oe1RsXBQXNwBqEv(^Pf%8oC%KUB4 z^jc#4vmv7vc#t9HC02N+s4Wv3N@>+aEf?Rx`7OkVHNic(sve8Q&RyUZu4yQcLZ zkP{Eo=q0|FB%&K5d0Z2IY&5Vrce^Cz_(EDNjd%nwFHLQ8MeJed$M7LJxOKr;T}tk{ ztF)=6@doeGhZM%FC-2_$DuV0N&x~+T=5#qhdHY^Sd$C93>^FnrH;o1{BhL|2JNn_R z7B}vAsv$00$Ql!8{ym+b5mEl`VCykUB)hUmt%A2fvhrJCL@{rL=FUf?a{ z;BXSW*Igl9_VC8Y`^Xm$Obo&Z$8=)C;8k&(E6e;TcsoxahUr18Ch>)eX@P7Tz=)m@C``6xyDn$?iXc*hu&8f+R5w| zYN^b<>5T?ERI|$Zg8#KN56M~zbj(~M(B;`HPdeD;I9+Y30#G za1Mi0Z$bzEQRy?8$K_T{TtuZ{EZd+sga;1-?vr(|^S$nvawxU|ioyaOnBOePL|Z760+@S$ zeH&dL0dYmN}3N9H1^~tQm5w^*+h9DhKVe}d5KbFHEX8UF=TtXRtl(I@j<&O zEGqiFy6&I!7>ieH^J<9UTpXwV47o)7*J^dGE=CkYqr+B>l?xifRbA*%xro&lKU=;&)?e?Yz@rE!`%k&4iI=?Y?PJ;2kPYDU|fva z+uLiy%Ed3+XRdxYXpB7x6c5=U@D$cxXzp3|UlPa}a*_vHCEHGpiDRcu0n$mU5zET8 z`T6;AkTm6+)D8CgV%&a9$tA!{exh5B$o>MZmVnll%k*oM#%5{J6s=+4fGi+D1-yvp zsmpP!#*Rac)^2lE--wP}L6RjFkD!H=r*|*)_vSkAZ$ZcZWdiq#J*}gI!q#zyM7#Zj zGZ4M8kVQb9xu*6f8jla2I!_~_SOm&N{{YmgekONm$>fg@xUEH!!-Btm@6CK^(?pUk-KthisEltFhK#ceN*RocH2>J6Ap#aBiOAjz0U>ao0G^5yX< z%U5}H6HH;+#W#>gfvFiOk&g$JySVEU2#!M?WNr(P$|v&~$9!kkTJ0PfsDDHIv+d;T zn5D|++>&(&fLkFgnANqlHG38E>+AvmUk0~-r2r=N7n-pgBUyT7`C+e%1ma>6P{h4U z#bl$Kl7;N^+Xe*g_cr2P|Cn%y4@Oyy>wqZ?4EkMF9H@8@45pMP)qHg+0vCV)s1Q;z z<8`*4M;wv;PhLCu1oWx*WahQrD$y7G3=#`=W{{Ygqli>gW literal 0 HcmV?d00001 diff --git a/extensions/km-plot/icons/vinyl2.png b/extensions/km-plot/icons/vinyl2.png new file mode 100644 index 0000000000000000000000000000000000000000..9f363c0f73393cd950a08ced7a977d1a3c9a63ff GIT binary patch literal 31163 zcmXtA2{@GB+n!P=ds)gFk?bYemlBmdWF2EkV;@V5ErXFi5}?);KLc$yGD0Gpz0*1Bd4>#=PS++&5S^x&}$%2WHbnL z2po!B27%x=K%iAe5J>d{2*l(232mwld_n)j;DHY4_~hqvYjFy2o=Vw|;R$tDE1S`7T2nsS-;YtF5iY z8jPgI#zwP0wc*~t;)M&nc3QP#6OMD24!VvTq{~JqD~Ggx%B`LnuQDRhg8BjfCxR5A zMAl`zi-P&=94JkL(>ApNdRHBekMsAqcPeEmk0$DSS6vBISK^MjrDo!s*U@p!M$_8< zV?|o}bcD@ur5dJ^LW67dr8km01MEHB570-_OZWyG#vgkM$ zdU*n6go34{CVxqt4-rhbUqGfFEomLc&*0<`EhQQDp(_Ig50YkrAQ`jD-gZsUIv77R zq0-HFYGIy$@=r@MAq=##+{AkO%3P>~WwO+RT7OOK%v+1DZ{xh4Z&(GkB6%vC zT?i=-giXTk{^;%@jHlt~0KQN~-t<&Wx8x|*jvd~d2t58e5|K4^jG_=x6uAZyiG|+U zNt99I+#~ig0fB+z;EG=je957wR?n`Y*W-Ry!LstNi})fqv=uHWkfc!rUUfD|^sesF zE^O)a4w|^BON}g>!Zfge?fSS?I{v(yRW1_M3oYcMh}es93{`*|uIpVuH#T0$Um}>1 zP&v|l9<4RfV4Dn6_(E$1Jz@8N5Qs#jPawR?#;aWdRszieDo})cL~#$Q+};HdLA&?i z6G{am5PIMZR<9%xEy&Fk3-tzlPD2`d2*07gu(i2?S!Az)z8(rDMeQ8_rJSgz-*f0$ zd1(5#sY+Do%1E4xP5Nesqp(!;X9XiYeVY;|7-6Z1oMJ^J`&i9ZeC01~WC_>^GonXC z(q3$;g>BP_-8IWKv^ZovtRYsGM@|>(^L!)ldi<>|M40_k39r2(;m#b@eu7!A(#<0} zU`2rV1u^7W%Hlx%{D2AP+xu5nLIk6wPQGY+aY2{k?A<%tQ#)H_%}48yGAJ}65MmVs zI$6NLT58+asE)f|#m4kkR;F@z4^aclin@NS2eW=@IQ8tEkArOZFhH&;D%p# zB=#eCdZVIG9yTmKl*HzGblp=4lB5MGjz``~TH1z$V=^9V*GhP2wY< zB>HO7qD_t(AShu8vG1M`={~dYOH=H@^=(>8eq%Bn(96iipR3Hgl!xSrozL`0ONzbH zKc9P3K_N!eR)X8ek9Tklo??n^n4s-PZkaEKk6lRI#oCPLqayRKn`wTf49bTo6Svgk z<{JGgnq)R4DZjbf%HDo+yknDI^3M)3mBFrUl&H(n{BVDR47c<)k`_mN3_}|pyQV|Z zHl-*u*pi}>_#0SV5^@#$HLQOZMne)EhL+U$495-mp?mm@H&qp{o=?|KpjxXDw{1qp zs>3WHN0#nFy0}3oSP~sRLB&@P(Q8%4p?^!~9I_7y>CigT&CeyiUc;LBw1_N4vr)FP z-A*I2v!9y{_XMh9JHZ1opr=TC|9WqVogF|QnCok+b`pPSI zeKwnPu{RGxa~f{3EK)Euvhl?Ix>FN@x&*GiwAed*CsVZTwsuwLSdH{E{-pz<&UI0a zW|vJ_Q(~u-m|jgjMkyHgt(%`PSK41YeC$wPsc zdLG98-}N9ZtGqBCjyywwuQp+7d0TW~ZAN%0jIfNUKMV@Zd63dGFE}ZE(iC~KeXAu& zmzbD;*RR~2O7S8TeRKTx(O9swjE^Pijx0Bmg>tj+`SF+ghZqx6&J|)phb<^lK0cb) zV4G)X%PS1VJ?hdHeCt=}gfP87^KBx|$&FQ#Q5od8q?~wlM8V<>UEr&dvo^)>Je=yy z_cM)t_cWjHdO-)Lp~B~cA8QgZI;tSh_C*3pZ0X28gL+@zMuI8f;6Qfds=x83Nc?Nf zo6^TJ)s74x&Tk))fim_X>dYPQ7Pk&&YLWILj8XaJmf(nLwzCn%bIN~RPk}%g!PFf* zd2q|TQf;q~N4vb`Yr)^!gr867K#jaife@)RNhV35DWRn9#e*;70Z&2_=7L?3r*)T! z1T`odXqhFxa~2_zzqPexFn&rv0(zBrgKAr}FkY9RF7`~qpYQkdHCmHr*?G|K8$W6c z+27l_2u$~|*0XCTI2|^A5tCl-G=9&Ya9=7eoF}g)fb?okIXl;d4rC`o|MJ_w6H{>d z*vB;Zv=sBb+l#Wf=Kyq3-3RfL&u39iEKtbXeXiy=rTd~P)74Wu9g22dx7<)qnpL(} zX|Y&pq8;ImkK(ru!o>7XJGi>59Q?KIq#YrO`O4LGbdH@5G#@m4dR+ClWkEU7R=7GM zC;YQ$qO(Z8oRT#9*h=e#_4jA>+fa#xl0~NAnxmCeo1*k$7IWe6_k_Q{Trjzytve z*L7^iDCTCNtIqa!Z`m6+Mg~hPzJ3nA|}+OpVpC^#c)1?E@nF=5OTnT zEdSaeIoiqEh2_^{+HrF^Vll+nkN>!kT_nwnRvAP@?5RQFeqmwKxPbxW&*<-J_LKWo zA%7`B8TBjp2ntx-@7zyBdzY{oPS78t~70@Q*~?L^$}2i1%f9#6vav z#Hf4WHlv?vD00lsYK=?Cms&_Ho}q6vgqMLwHX-&7 z30djT*5*$PLcB4;Oa!Zm{iaWQa@f3vzvVl%eIHN%e=uP{1}<&#RoSTX?WGmoAWe`SbPvBd&M5VH5)G%zE_Z> zd8nVWRJh|nAK_z4VArnN_n5-!i{~WoS}J1F-z3%0Ao#Tc?_+PUCXAfhS6m*!Gloc8 zBJ3Tx%v2sQ8_e}iy1Ik4LRGlZDrPj}y8_o}k}Hijm=~T@FF*DE`!aG(rzI0(iT*I% z+19U>u_x>iX8%mACe2)}6|B0SMvVX;-)i;eeD&MCIn;yXZ?$^_eQ7n}zFImPIz4-* zwuPG(LFg&$*~#GShW823GlrFbp6?1}rKY`*(}Ly=T;0Y5Z}m{n^CQuEn@`NOMxdH>CfE zmeMDW9m;*4Z_1D&2!cX=(q*t9Oz%3j!q1tQjz`Uz6EUJgMKYQBhOi&aM5{jVoq=-9Ij$8|@4z7?tt}E$4&F&yc=)Z)CkJn4U2S#(f zoAce=R+t=GgJO0AY)NvJA3nu88Ha_R!e@mC;nNA%QeM(Nq6n{{nqYW&IYj-qXpaZ> zJ`G0NMQn6cTZc4!N5K|M5Rk6~WTVO7_N59pf`8Ur!GQo|Jq+d?CKq?h3$><6JVtfL z)CdgbQz~y^GU}7!G;z;Yx!ST^*ICnp<+AB7fa_FvYyCRV>k2f259wsS=hH0ePxS zSlsFB%}ZJsDI}PuP|9kztl?pJ-8|Xr_&43i)#BA9{2RhSnEi8(8y^iZcQnq4Pb#k7 zb>7H?PB_$zjlic3&bBaNt+*I`zPh;m@pQ-K~fXdOuMrmr!dxq|)I) zzen_YAsVZ92xq4)ioK))z&qH4>Zb&%4-fTu7Kinrrsi1nPo$3`H_s-o<{Baj zx;bbhuNEQqza=Iy!%ZRODLKKq%B0lI3J6>agVp@ACdP4y)1 zc-=8pVajLow>4jX=t>JdCFvlofWGe$u#yQu}k2y0IWvk}DE2G~L7Y*&lWh`#kGEqKUU>FG~6 zR5d%UIf&d_Y?7OfvO;-fbnYueY?8TN4q9Ds(5-`WOziI4?jBj>`aqI7w(fkoT>O~G zEmw+#`{f03)fd1H>ZvW4yIZ`%O4Tscz8b2k`J#Gm0H7!PK^ou}#9JfAo6_f$pW2L% zv;9r4?t5Gx2l--Ie)x?4f$T`mnCTIrkq2}K_eWveYOS#F$r;dg?!ci&aSZaXQx3B~ zOF-~8XBNf5BtxKlS|i9oHmk8P?uj%LWT1dG0;CMu2+f`b5NIn$W%e?gjC{NO)HTA4 z76*X+>$@wuC`AZH#&xv!T*Vl29V>kdpeNwptxL?RO~&ca!*64~QFUy>XH^Dh!~0fX zLnZD?1fyQT^gS7|-loCkwtyf1zNBIQ{+77JSW9aun{js&pNY} zRSL&f!N`t3l7;H)9ZhtgHrgSUUHhPt{_Z0%mR&=up~I13e=ju6^?eb!auL4W; z@pUB-Gfu|FzciID2;t3JD>bJ}y(uXdGjU6)ODeCN9@b76W}g`q=hfhL7`xI-nmtNW zfmpR-E(^VjcxJP*;W5#J*5_N6+}qQ96=!oFdf9LL(4Fr~vvg)RYVN0t4Qk_{EIh*I z?VwREahvMu>Z%}^)Z_Ol2$;PU+k^P*EF~ZPZa;m(o@Qsz#BsyGVC{nF84FDZh4oEb zDXsy@+OJ#*r#Or$K2q4VSi!>P?0lNTroj6iY7-D1jtq>8IOuZ- zM6oYX^hQ$EaVdWM@uhni(93!fa`p8P-DHoHq4IS`u{SxCP#2qVrm{Jo<6R%@QJ({C z^CcQL_$nC4XH$z-3Zv;Tk31HW`W$z;2&vCE zN;i&YOcSG|o@0+JQ{SzHKQ?i#c-7#MAh=s=jFQA{JwheU_$^EwbO&P%=Wz`dUri zJB@41_RSBInpQO6(n`9}Q78q-%eqBl@#ov&3cN#46dK6y_So;ryuLvG@Y72$%MG3ot>9;-rs8M z)XJDME2LD)*gtQ4Qpxq9!JzCbnIbum2_wuaC!!UlGeBNEDDx518+NKAEYJo@(f?#x;#)1-3&4Rd=b)RdVX&kV_L-=xvN}*u{Y6K6= zEq87N(_6XzF&>d1M41Wk0MkNpQkFt`D{kmrfWCkOvE=Q3K82ibw61Sn&tkJWDsi2F zvN#*SB~{PT-QB&ty)t6^ic8nDm==e|()+Llh?O>sDO1`}xlkgsp1efZ-P?0wcwG>~ zOiu^wj0v-6?Zq1hf?Lo7)Qfu$7&OB9+xNX+k4UTXk1e!5ln4nbsi|>oZO8xWZk+l4 z%SvkUPO|9gx5F#;xta*url_bZ4+G4DdG>G^VIaw;e^(^Ygalh(hD*8P)4P!}@d%-# zW=zCZsMXp5L6fN1+r5VX)*LXAS)sOm-y#A7EtPi#Y$7OZPK_qemoW)BaEo+p zsp}_412j`i$DKVX%(awn7y<`Fx@>&0?G;}nvo@mzYhMRDdnH%bH_hoi6buJhkZ(j7kHWH*+cuL_`a&&8tXUt zDxZc76s+3o-zep+AoA5klT?J3iM{Tc0o!j#an6n?4|LCA;ZXg}zo0PMR_^gS5LmEB zop9Ueu@WZS)^#KE^HIOe0^8x|l*f1KA+M7sWA-NklcO;>ix@$MMvn{8l0A0&kzCjY zw)>*vcfw2#?{26Ct%p%wvT5#zLYyCF7O7PRA;mSGS{Bkwt1s$lR#~K$IA?J-Nk~WV z+?Kk(xf)HTzEc&CSpf1TAZ6)%k~hT=C;#d3IR&rt7Pp?q+H30WAelZJO`tPb2VkV) zRrhiDg!wjV_)8dJCSq)Jq~cVlhHB!yt%H`p^9v#ylTZiz+=alN;r_)*8~cP;i(N}v zDk=x73_@Z5g8rUHl@K#$;e2bKmz&GhFVyw7jVgASk986;+;~`Lh(O=7p`*d^X9V5X zZ8a(uK6vRf@S8s}uQHwnI51S(+Qa@AYdN(a(kO}!PM1o_^SOPLukd3GxyKez*4XS1OG>rhch=*wg$U5!Lmr~la6%{ks-Ac;^4b&Nrs zdCdkw|B-BBDG#B4%LDRqLOiU~9L8Y=r_Thd57I29jLJi@VFjdzitl*QUUO8dXT3Ms z&ivi1N?(8ZO)3tZ_%|e{@(WCZa~1g+V7OxLsfC?y%aiA4O>?ZRPoWJvctcdOR*1YD*0uo zzB|VS=P~YwWy{B3f90}(1}h4+4{R(1I>vV#w#a`gJ1dQ-m@*!%Bt^kfAhhek)LW=c zFSgE|IF2wp;6)3$J#fA!lkgo=4Buvf;fsT)8a{`(xw$zX-w)FEE9B5JBdwcmMK{YD zpO_J%KjE57`(6sNIxA+qC!te|By>$5_Z_xKSnZ=Jk!*Y*LiK0EVsoyhm)&(n)Cyyv ziV>fFH=#x1_F$y$Tuja^m!&lb#l|p*JnRaFVqI!&=Jsn`ii9z8)937R z-+Ekg0)bL*@Fs}*P}6ptcY7plBawXfO5aLB#NQ5fD@Ng@K;RK`e&<&GOEr?ztU1{& zZq?(zHxj)THrlq-dp;UcuGsg<#7fZh&895< zZZb@V29U;O;__p^q$*ru)@O2%Q@h13Z<2VV#41fj%l5n6GSmhI81i>NQQ*}>{OO_A zUGJfj6Wy8SpcZ0@M=c)*+nKk?%Eo_=Ki-|$@m!rtC!rOxjo-uqSV&b$`gF`k1S8?>Hd#fRN7hDMFclxYiYCDIZcV+$RsvN%u`fOEK8h z*)Xe292_$7Beqyb{WHrzSKUj;DO<x+Ui^;699lggQ?H=*4M;_ zfCg zbji=rm7bVatr{=!P|fD{c3zu=v`vLp(ouXAT3rL#7^6V#Tqn)J#Z1{^(QX0%%1kyE zl&1S^H%g1mp}%mR86RGFdCEC3JEV&0c|gP&Pk(X$kF7Qy3_=6%OQWSpuj7@IwSjV> z`y|t;GVu~g&ZVs0N|Q2n2{EDZ$&z!QuClO8SArsMJHMS%2HwR(eLWr?o_R|6ipT^C zR(~Uq|G}%?H*?myitbfw3?OA+U6=Pm_-K#v2iW4uwA zntLYKI{x?;$840ezo>;zRt|Dgmxl^`cD|nGL&)N`njv4q^OuAH;pQ`=#DZFb_q52s z{U39$1zpOPJN5K~J>Q*+`aMhp!jHFU%LPjV9KH3JI0|_dK%uRMqe58xHSf|^)0t1s z4afxx+`Xyo&XDk-1Q5ug>*qJeLARI(4MlDtou@$fFhdUQhuwbT>!XkMoHTcCewAw` zXH<<#(2BTmu}i>@z))LsHi{REq@$l`O)r6YQS6<%k~w}9q6yp-jKcnuGe{o+4r0{ zIQp0Tp*NOa4goWst!P9dq1&1Da{Yxp4D0%Qq zjdJ0Y=};imPNTN*cfW^xN(XzdeLH3bJ>nBI*ztS2+=R6SIIQmKX9B*EjAYSo)_|^1 zP~~9z|6Tx5QMkq;T2@cOfNBp2h6+YN5M0RAxh)Ud5$oel%I)(%y-LfDI<;qJ{aS;S z24t)uImJA*`}Ygp&pZB6xA}m}r$l+p4vKJFr>6zyEHxqx02wms%4g+7D}I!Uvfn|`*0=H|s`p`H&8C!8E~?mU zhm?hTRCsJr5>ad9=O!t925N&EzOO8rFaQ9JUorLy!J5@|!Gi&+h3dE-KmOjDw}7ge zaR2IwfGy%7YS(w|($)m(W?p$SQg*zb1_?4O89pwxckpqBt~LLq?2siru!lPh7BnN| z^tQjoC$epV1H2lR70teQ`BS#E@{X==&QeAf(&(R)_%sf~3;@iyeEYHb5VDjB8I7Ee zTIpk13NbD&E+(r7|NG5kp|!V|>D$oFO77TmzT?qB1~1dAJGoB)|cMf(?T6N;vu=CNygX&B#@i^eBZ zx@c7JT|{5-$%@`qJcF3H)PST0rU~@?B^vd9HlmK&O!2g0*Y>SY&9;G6C4Xr!f+e>x zwG~4)=hU?d&6ppr022|L^F3CFqV^fiwb%J?^uv&t@}IPM6WV-*(9v%O2k}RB+Q}}L z&UO3!fJ1;>E{&lM5qrGOWS3~0A5wU?Wa22PiT4-P`Eo+2p^5Zp5{J?U%+)26B6vgbxNouR0;M-f@W zj|HPFe28;G%5M)ZY7cH~+|16-exJITrL*0D{}KxoTKz!sYg(4$sYGmqKxP=izUlL( zvq$lF=ZW++2_708g9)%&d8d{H*q$a!xOC1cT5TITNPf9cPhR*Pk~0|ywzcCuXKici zFaf#idF;@)b)*JI0wk52VpbYjckS8H`kdu9YWiBKtZbR}eZnplwt&X2&qk;VN@WP4 z!#6Va>|ZPz=upN0&A*rqJ;GL=u-E(M7!0A}g~3 zEc=L?f(QXMA-PeXOa1Fg6do+Qf3^*-bTmqhB%$T?E5f`}(4)ix z4_t2cl*W<3oi2yG`D#|R#bhZw!mt5|qH6HT!LD}Wg zl6aG3(SWT*qfmfiwZ5#ZMO`t8*yz@xZR~BS`?M^m@UyxrW^v5~WEQR7H{6o@IskYQ zCcgulU9VtqFA7ym{MZb4KNlcFzY_G;?{QO-Y=JhDMrD_`cK7-KhG130$AruI4Y5^mE5| z#-+%(y;9wGvi1RiDAiM=yH>C(;S1=y0-(XtW90HjgwBP=e5e$|%To|LyLSK)1w{7H z&G~a273e3o%cbsqDU3lJZo9AXJw4kW_X|Fq7MF`#I^AAh%azX$uuV%UKu}<`0`2}B zUaCaKaT-OFhK7cE_t9$|)*w50jdTIPkCjHS(bIA3J4E@yAgI~dS#9?BKep`7S#7Xw&@vArG) z&}rI?z(>hidJYTwCJ^Ae@>Tu<#N#-TfwMDBzEID1AC+BJZZUz}7|BnixtUm{&iz5_ z4l8i|O*ggha@O=ayRH6^ty@hqU%zYTaRhtG}qe9j3r*nk)(oN9)mM zUu$ppsW$ji)$G!n{u2+xI1ttG;kf+UiO#p(NaJ|ashLxa>pG@70GY7(hPxfku#c(a zp0^mh*IdQUZOu%NC~`9dE| zoL4HC4U$3JTnJY0x=uJvKo#2Cpwqb8xgx{c+RcQbGfvm8?2E^A*~cb zr#KKT=HJ#86X)(Uu197#gxkm>Acaty`9G8Hy%6H@B4dM%wK8ygt(8htdl^vaT(~CVh-RTKl`Qi_|1oow6>0Se###rwulgX z;ntRars1_T)i-2Hu3qwdj862Oc@X~%cnzIu;?*5TB3$MoDAM95q<16O5Wt?<-M)ym zdi>*E^}scNR6e_kr;bhhveLyqrXIspi{l)Qu2Bn!TCVH!#Dmr&A4ux6j|_M3m~uj% z!AnyNB5%9g4f9+$B~^Cb-26-C!M7bgdAiZe_F+RGt8JyNQ(0fWOI@f8eO2KpZ81XO znl9dGu(b)e@fYL^Ww)TTXy%BNGJ@8AYkrYC11<`-&-=0L8m<+8+q`9yNQlMDBWjK2 ztUm5b$K{o|(w9rwA7r*%zasL7v$e^Co~PCKS5#@d#mKYIR#WKn!%RfZI`nN+FLi~b zXqgJ<#T9ksfx$byHZ%vBKcxqMKp<9|dQG8=P(8)FdfU~<!zk(uL}u%2rPwOI_$m5UPsms)0S%-CN0wmHBy8US#hz zd%ixOEhEZel?`H5pB0tjGs77n{kF0>u4S-h0~^wp=UF zB$GUD>t|JRML7}*I5;N1O2A}lVF?Z-BvIjg8q`Ko%2U7z+oiGNoNGm8fm^aIr0fO2uxFU0sr)QQ$ z#E@`>$cw(0TdMIMLv4_t8*+e2@p$P?j2dIc#O7n?!o&-&^F9IS#*$~6mky+C*l1E~ z07RA5wpjM4FrwVs5|%&b?(ysMauQ-N4I(|>`O>SN?-Jy^^-IKgf zkcGisH+%74EKgYCDy4uoBjZoi@$v`0RC{wxTMEu?-|zQej_W@Il;j(8v0xxE@$1wZ zsq>qC$73ISH+*~OfsW2Y?oqm5>{p_%koNbjcY8(=ZURe3N1uRoU6!QU4!?2fp+*g; z+w8>m*XFW4{Um>BT#FlNTRwLGgw{ta0t)vk@fXXqOjek8Vd~SBf!ZpRqLdvT&i95k z;f30bzWFTUM;m4|ml8!Xn9?pe0rxXr zL$612eYG6ylP{aJd3=heiOEs;Bu(b*kfl4cTTxC7&up#EEdw_9K6yCu)shQtYdg5w zF}{2&0eaVSC8o@}W&GR&`1EDg82x_?cYU$mOSjY*{&Of+UDn_ez-37XPyPnr=gV|p zga6sjUeVm4&R%p3(br4AY!TT}7wPfS8RzBUEtiBspz*BX{#kUI005{P|Hd;f$06DaN4zNvz5%DHU zmbNP@iC6o%vN65)CQe3jVLALgyyG#qoxufIAj|KUU|*qS-Dz;|>93SajwJLaz;YUc zyHQc+o{97_`CY{ioKkfe5JX-#47qI=zRpOI)@OM6&6b)1y&Uc7uu80vc7N^J{vz*i z!FngbD@6D5$xZqPZ{cN@ECC7p&6ovm^Vi?(tGOdEnG8WGt-C6J`ONE6stS~(2|&v` zw>H(Snm_chTLP${AtN7f^djMbXaDltH4ukt*m3`y9sAGEgybir%?++3E&}I(z6#sR zlI_R2fwZgV3gZbrgz#-M$GeRU_l7v%z3sth#r69VE0Dv3?)d-G4-E^Odf0g3J%3WS zej_VA9b_~=l1;Z|HEQfgY5C0M?&>(Un6(oL^7CcAWI!+ge7%;G+MFfCkRLyg$~@ZI z0I=N+<}~`#4A<UP z*^t|5_rMske?jB!GV~kti-1SjsJk6L?JucUn>+r*!}|F$0N2Ab0TD|Bm%{i4{z3IE z+wgRge@tqBwoIjRRlPnBw;4Cm3-RhdZ*1nRTwD))da}fE=gXbX*edRNY0ts|AU_01 z_dC}&dfWAHb<$Pj)e13#jY#{GRh<^Nq_<~JpFHX(QN8fTTUTq=k63o^r9)TMxnp?7 zuHJ@}e!Cv`dn->O0^-FxKBB)mvWIY&W&cS$S!h+wDgylUMH@*FP3yboG~Qku+WPPX zFMvwSbo##9R?O3nYu`Na=qp@hj6%!OCBs?l_E_<f;<$FuJYGwLGDXNO6V>cdlaJ zSY%d|qmQM_|2IOf_+kACq&KfW6*){w@8mMe7>@fj+SgGd&Gn;E z^2jFfapdL+c@=o?(re-_!lD0}m-`y~3)z;9|1wU-F7Ot)rn-1V*i|@MVXod;kX(!by3+_*G~;r7wJ+6RpotZgcC*N^YiZnCKHg{=RJuNSHJ>TH)1^uB{;TZY?k z`Jxy~*FEXVP8{8XkEWJ6BI*PjOy_vzasJQvW0FOIM_{L~djO1cI<(>`9BSHJUR)1{ zEba?OU3s)o|I3ft7`MGUi1lvAFfeKp&mTz>pkrJvBn$nR!i2Dert*K@UXdK;q8eiq!#FI~ZS z(~&|A+5p~j`Zp!Kf|2Q0&dD=ne!Dpa7qSrkzE>I^u9|&esC(R!+W^w}93~aHSHaP{ z?tsPS?~S)cY*l?Cp?eDpN*y6h$E@e?Y~EvzxtDAPtb5|VqlFZLnAUeHplO40VzEt| zIcj~rH(wdPBlT7jxXB%+fO{WOYb;~S6?wlTHWCWMZ`KB`*V_NeF8CqzvD0HnMWTOy z!uq9mXJB|}sN|e-k#eF$pFAK#9y-toF`MwmFclct3Ps#hrZSF^oKF#X0tSBx zBXj*^ozAuXEjx`4am|f$C&@8TwvuL^43x2uDRtJ;z_RPz`s6*+qK7@`_W`a5m~!E_ z>yNwz>i~P4ktwG{H}wi5KvX{n2nf*8W<0rbR{wRJKcI$e_exa`J}0*pBb5Y`R)E}i zj-IUiAI_cQ!p`T9cH0U4uaundRYW^Yg(>K7| zG`zARF^!GLomIA6SfOYZy6XeFJxML`p18R9_VUox^Bs?}U2Z!|koJUhIRHafbYfD{ z%HO|+hz5@E*T%-iz-BuH5Pm=n&KqF7?&mC(P{#X!cL>NYfDOFoX^olBly|N4RpB!% z^mJ)unRC|+Bmg=SYQdrX4%q2{E-{`yTrNl&-TLlVPSeu6z{^Yz9CcIXFMS4xi(Vyv z24xQQpu%T>IuKxR6~%SNWTV+rMb81CepB5?jHnnBSPcX3$PxEefS{Eo^Wf4=XZx+4 zCJk{tZ6v9v&o!*Eg+{lwR?L6wd*jm7Le=w^-|o~)`7;CTN8yCmeLwyYCb^b7Q?3V? zoqwwQo@#L-K*leH&`Bcp!*_v^4kLH4X^G;te(X^zzqt3VEoIsHJb3Wn*zrVgH%y#6 zdPixP$=(0WGSuy^c2a1P(i8ok^7L48Qyr(rc=talP2~V%0xSWbOvw^iaIDFj;3ofZ z&{uh0TBB581z}Q|0?u>cv<%<`E{jMKxdgHOOf$ENJ~J_iR;l@r|o z|4U^A)zczfr_9gbfCgmVrIkQWfRI!V_Vy{Vcm`ZLK(%!=C#K_1FVV!<7(f^QlfwW~ zsoEMKYydfHr7M9Cm=~5^B@dDWOHiHoKNMVz;SLty`vFQy0w{)<>By7E;czDnfkzT5 zp#awyRuIE&jfT~q^Je(fbH=f+1xQrP7=<&&@d3$TAkM+t1qo`DJ17mgE6WL z&(iS-f`>!&bXI3zg!G8*2N9!(IsJhbUJGZ0%mwB(oa?I@^_;lR+W`ftZzSo$UoYUg zpm_~S7)@f(2x+Ft|G{+eglz0XK_MX}%Gx*Z4C%k9AWn_l$b#}h0DXoSkSoL~kyPXDW9~6Sq25>k&2PNiv&mcjaPlhZ~ z=~3tv?sEh25b=I8`mkQwz$Oo{(x&?p_lWMHFq9zu-Kr-R*|?>&a!$VJ&!OHLUjuT0 zT<~)de!O;ZgAA(>3v=Li{Yc=)dxE#^mb~CHHNImnC{f-E^Gj~#16~V2=3HoMn5<*d zNU#G}7Qiisi`Lrt8Jgst<+}HJDT1rLS69RcbxjjqMU$5sJTVc-m#^b9W7J)icesbKON(CsMB(COk&uzGF?*iNyV5!(BNLU#A>u)#Xb=fO)hMGh0B>!?#<04C&?@w zMO0in1^c_O>Fo>`6Ort_;g&c8>tgX1nhI~Sn?$*;`%eWPpwpp4NfAeLl?`iip;V~N zeWy!E>*cI%EU*jeUC^>g+y`+>CxVbr#ZJSED@pCT=gkSvkON4 zh;V0k`9gZtQ-;S-3Rl_CtT=uF6}&?8>uOaJ@EIQ$051~8iS$fn&L@?F)(z$(y(T&5 zkLL8Y>b*mU7BnjATQJ+h2HB~%lHg%$ikLspEh7R(;}Y}Fn_qY8Cm4w3S~<8(`#nJ8 zSw!OWKVo+$Ju3n`zs`PS5BKRu1@|;KRD!p3#ncK&GvFN+#eV7$U=vnNEaioBMUOD7H3sG4W7vdf6`1o&TmoR3 zpBI0lxzemu7LTjRycFucb50{q`pCBsq1$8h*y7S8lWg_gqqjOZghYyHp3+Qkfknr| z7jgxK3K90%d>jAL7ORisPeb*rCM5_cfD< z6I$YE;#SSkceCBvGfFjGC z7y=JIJ2e>q8({EFc-b34j=Zy40L|smGM6ou_<`fK6X|fIfY~?8d(O2#eJI~=a2r=1 zf06^`t;!t+<6V9N)Gw_>CR%NyY5r!;Qo$9*AMk18F!Lt$gW?dyydLYPwth`4wPTG3 zGFBsbhst0)uJwB8TO>|&#qp@y7S_DGR31TN*ty5 zGBjB&kb5+6u?HyKPgLKV*;E>0YoqV5#9B`18og=%aD*YWP7W z`qFAXd3CQFQCtB&$7IlId~oFv-=7Xx5|1(f&;l!j=sm95?*tBxkKH8}jZI|&>0Zm` zpFx)KuCyK#pQ{jQ&7Vty-OGyj9Nd!Rksz^_{fU^geTtuP?yZ20ag+=R{@uSHsN0!u z`_dFUFYj?RPEJ;K9971>BTkaN5iDJD)gF%L@HcSCCF9R2O&cK}27TCbIsZdssCnSF zj&~f6cV3Lg778X=3bg>x^ak_6PWn=xqBQ3?E2yP^Bv07F<6J?>sC3N+Sz_G$?1O z)zgNXIxntu@VWiT{Z-8`i>!1^&~U&F7*5cn{l6C=9cpvZ8Duz_+`5-@h{W4JUmF0h z{~lgvJ0pwR6iJ$Kl`4i2f-=@-6V!1Q(gYx&9{v7CSFfzDsY(0krATp_(Ebeo8M1Zy zPJ~+GR-50am}8(G%Ep=-NPf&Jwd@r>rku&xl3!fJ15Qvq3F4S8dUs|-y3cr6f$EvV zJgbapM$!N!?FKVeg*RdOPe%+NPkUwS?xgDs@FYSjI}OI5+Ou+uQ5i3<{NAM=GYZe# zzV>Bg!Gz0XHv@YlrYC`g+R7ztEGGaW41k7l5wtC#mE+?clkm-f8X7HzeRdSJh6ViV zfc>N2rFO3`EXN^iL$^j+3UdF!0beUj_Uv3nVX99}@TjwlkB7f0=j}{9AkLA1G)@sn z3_AY&%Yrjs2D%dj6n)R+8W(4rIiHkwmYO8p7is{0s&yqlLM%V%#3>){ICCrh=1BW8 zS~fnh0dR~munC4ink&h&#GSrQ$>11p6_stqavGkj5EP0zcd#{BrIKdk63n}x5_7n!224%+635VuP9E&WiO=fp6YZ9D?UwMJ zlK~<^#5Qb$#)_GWOGW%fDE-pLF!~~+)6u$xm*@PmqKXHupuO|uz7j0=Pzmy~nPF(O z_y6_v%4_}~$fy^AEow*VX7^lkC^z*JdtQ~53VpSU(Jbar+$)j<#!-7Y=%V*BxI^~hB@ z4{q`b%CT>w+=Eo%VP1w#)9-#ejmq4lxm{>G7_zdjaYqtsO^aA3Mku3PD_)XS2Q!_f zuq+pZfMnx9%(v$X)e^!-Ft+~^gDBM)Et`Y-;W8b zIN}raNMZzn)D>}qkeGdnWMU(zU|!2%{@_c;dt4Y&p)&8pVG3^W2P#U`6n#^n{Gh_& zB%x$C!~7G=Nb?6bqOV&@^k&4&mLzO~=MX}2Bl>sHeNA;; zHN;il@0EOitOTtC+n{!ZVPQt*$s^Kv6wIspMV!sfGRvDw6Qx+A=4|`Is-#=YzWu23 zxQUsIFJGYlDSElGqcdweFL}M}Tx9X)sQ$i2Ov!A~vky7Da}Tar;+@~F=FLs(n{pQK z29e4?`&c6!POhG)-R<9G_we!khCWXEZu2cLuh{2pz31_;tVI9YWSnK_&se;2be?(l zy;?v?RfQJq)*_-KGM=2HwDl;jmVb53!0eVUFg3|<+kDem5=x)&_rKYiUEZ}(ckJ>I z;ub6Luzvf!`cNC&dX>|Za=~xran^#bg`5Dc*oxyBxk}w9C6CR@1L-i9d+VCN=}+U< z`Z_73sMg97!M^_WvE7up{LfnEB3E?3{kYZI`GLGGP07~}crPA5oORI5s6N-_a;|0Q zJvAJ@rP;ngIeolHp4=K#s*`Z1@TEy5!}8nyQgX&_d52W)+(fq6QuyxX1-xe>g;Q!c zH?m85%f?*gJhk4VdiL)0hp4c8`&IcXGW#Qm*ywUh?^v>`-m9r1F(gjuvm3YSm+gTc z5kr2KZ6)m38g^EGyy{&@cC20B#XBdB?=c~L9}&u@l9_iYbNR7mGE1b3 z&1`S)VkwLV962)OaYs^yYzFri#sb3ih5uZBUcCYv1Lcnj#caK^rSjDJEg75G$lib( z=Id`WrWFDW`b$aT>h*|d{t=rXB(Jd)N#DKNiJ0w?I@@iwS}?AhzMM7b{c1cjx(?Z| zFeLeAUyJK~zgP8W%U_deRg6(c!nIP2t4Sffe`QRGj>B7Z6p~04#osV>zkk}&3z^!s zkXs)(sDNQith$>OEnn1iK8y17>f0c>y?QZrf;8TxZ&|_Jo-(9ET-N0DHx01GbPNm{ zqx_XjRz$W~XE;N;3;e00wJN5cH1jcg(ok(IFocHQ;*oKNzhz3z8hDqF+5&o~51E-h zw@&n;$uu;)e`flnmNmcH#Vx%$NNzMIwvp`(i=q9chz>3>g1XKGkeM+#iDxb|FV z=plC9=aZ{iCixmUATi%hSxk@~WPbqfLaRkHU0Fh>Lw}cY)J(!ucjrI=r3b041 zlRXLUq}pSRw09kb>GJR4Hyv84VhKG(^mldqLAxK#e>5-mrjI(M*R`S$c+LB?CL~>s zmW)=Omb1T%HT45K?a+W9C}vJosF|Nx+>%y44V!wbYwjwX(5zXYBbDv#%cLDulI@<{ zPhn(s`)3Fcg&G^oCQ-0eGeprJJi5)`q+Jt~VX=C3V8-e|BSw%*;h500`ugQLVzsw9?edHD_h4sMydO{G$M zQC_VuchwQMGaM2&#WGt=X+3bJ2ENbB@1Xs}=4Py&!zXLKrwTey=1IHE4aWN?{PhH^ zK%^v0AE11Ko-To(H|4UMU#udu;g&~2Z%FL~7y3i439 zeV}ei?I^loejiOXRWEYG0wM8Z0#G@iW)69>bN+tQDJ9MIhNUQ4Qz8s~qapSR90h41 zMEg*><~T@w<(zD-T+_1mv)RJ!ZP)UH)~Jxr!aDo+RAydi*`g4WFvbP;s@(wD1MHvs zyNduM)Bb1;OQ6nhrO;5an(g|zd{Loe5qT8dLn*N!|!l%YC#k8FeFZ z$I5Nh(fd0?I#I?xlM$?uvfbAZWP~ZC>3b1r)!eLXpPH?-wLg5DaTjb!F=EGVw9oC& z)CF~*_20fw4v%iVi^!pTV}%C>jGj>JrZuExu#%}qwj`_tt>6KzOc%wU2%MWT2>c}) z-@)1Wa}pTYqt7NccK&uYBWPY&~Sh2@oK_o|UZA<~3CdNg+WG``&}{1^IB zF!jyk7WCp61^?<&X=~F8^@|f)e7eRch=O%yKIYbIC1XYYEp%Ltdb&dfF^fOueW^K;2v$ZNwa?*#;6v)A zY|dy&3`=TRfg^80{UPReaCWhj?UjOC#;A?o<0)E4e*f z0bB!WH&*HOz+Oo1x~CgiBqrBK)IF!qMt(NN#~eW(+n#t+V#E$DHW9$9Lnr1(6|Qru zb69|Q8b8Kr#G`Mr@Kpl*_|VIScQ4fB={5{9yNZDizRPAik{{z zJMPna03DrlkbB!h9XffDGnRN_=6bR(x6L-lyWAq%$W7~E!9k;8`tsS{w6; z7121O@PIIXRotyxT;V?ynPF)F1|bty3s{)-?ua4)B13n~A6ewS?MiEA)_t(4_^^F| zl@_Bk*nNm@xUe$s0W%EL#!B*2aCnZZ9B;8?}z}+9*3znHx*!83$NcOGW;aXH8^doYwqMv(CE(a zL9XfbwG(R6(v+UtS1bi)JLfJ)F*P^I75z)BAw{GVZ1q0NKmO}4n8#0vI#S_nKlzXC z$W}+*vL14MQ~y!2R0&10@DCrdVXLlwNu8qve=Op^3zqAL7O<+3KsG z@^QZZ(xOLDy%XB(xpPu|@tI+behE=7x73#SL|7+5gSsSKe>`8WevqYyyFoCDDABsP zxk>geV}+w^;~PFi?WTdZdKf=5DQkwl#*)<9lql8kw~ef=O}-)l9!1Ue6wg*?r4}48 z!wg}_)B8~w*Uepcr)6U?1sa%Xl=vNx^}W(me@~k1z3=qO|!GJ>wKy~H@DP@{vxNZGEb=>EO=MBrnQD z3-8=NXTSD=uHRU2^zDpk^)$&*#SV zmHo7Svv|D0B;xti4>CQQh4+GBbVA7JNKtZl^U@F$%)3kjGd&>Ke)YYI3vU!ExfrQO4dmD z2bNXC8bJ0luLHbn>R)5znFti)2J0VdRLJO!W7RJ#b>g&v^E#zcbK~W|Pf8Qw0Phq1 zytw$HZeIe;ha_@n)>xzFKGH-Yy;fh|62EfD6M5nj7dA2PWtqEP+4mv=hszHbCsHFf z8cg_^3mJuu!$8YA{*8#(+s{jJ90m6n8ylP8Dai(c5vT*$%FqVwfhk?vO6710?b&aC zCOll}J;IV>6!SuYEi; zN?zUucgvUOM)G*K#RBhhytx{FgKY`MHv1_X*UO+CL;THLf$-w(5k*k#R^bfQi_RH- z9SNqH72m>8p#H60z5h@3?($GH5z_<#?8y+ZQ#axM-JE?00pmdRp`kL^a+wT5hCrO8 zHPh=h2y>i#dIIqZq)Y4VU4=M!H23EIDcU1qiafn!3&pyH^7v6b?;Sy4@p*a;Y4GKYErahQg7~D4 zu1+15ICwQFf>lB_N{IVKJE%IDzixfo5^xE1G|lrVD}W&K3Rv@1IP+OpYFUdVw_hjt zv?3u}qP@?j5)2K%3k~sC$M0g%5mGJqbd^$N?;)gGf*C9Q(##B_5XXdn`NV1uv-51~ zb@ESd9)<~^yW-AoJ$NnLVRPpl3(LLZCGIIua`qev^<*g*FjHJMn1;9tCi># zGelTNZi$<(d&BDUQv0TD>=-S4)LQDRlV?ZKb8vftEh^e8oFP@mUOAqE01l>~6SLml z-HPLIaN!j1Zlh=i=H_T!Pv3qxK}Fj4FHc02q?|9m&fa~-fX{%mR=-c?*S2~^o|5V* z{+|}FvxPIL8JDzb0_v2JU^BQ3Um}#)B{QEQcP~ZdBsFu{IS+0&;)q_nS$@;PB#nM!`5ruV{7e&0C#%#5w#| zAO7J(>VcnQ9OP5%Rt|v}W6>lHm_Vlc#pW_hinnyRW3F~) z%mN`R&E{V9Tvr+B*2&0l?&}n2>!(QK2lhwL_jqg^X`!4n8*_7Qg~0(tso34dUIN@u@c}!^4i{{-iLn$ zPf9!h2)`gL#!`gZ+Z&OQyJfLnrS6uF&Lxr<&bQo?iq@4crUY|F`EHquUV8~~`Q5^s zyKQCe%`wy?`|+-QkBTMFJ-Hb>j;Ir)tyM^X#6TVhFgydw=6YktBAQRWA4+1MbaRI= zb-L_|A`+lm2Z8if=AHr!xg^&7uvV9}X{h{1c>(0Yy%0`P5iGf5q11c=c>4;Ma!cGT zQ&Yw$t5cd_Spj)PCO0x_2(}P`U@M7tQchhGRAw}dGzC<+L!pa>6$(Gi>T?@jjZ-+^ zA&?P0t~H#0#%lA4YB#?Y<4JNUOI^NBTu)bu0*k>0G)sJggSRdTRT*mERZqWCp;fcr zx94uCDf%E32F8NF97vlsVn+yP)|gKDUS_=x%D_tx2BPh&U7QWpWtb(S)6~(yFPo^1 zj~U2<86i%YkO4kEm@d74`}s7g*KF#Q$J413*|gU()AH%mITt>MxPyhZ1fHfxL8uwb z$#=gsL6hZcRBQi4hEixqDo_BjMo(reWla4OuL z5pMyYB!1MCR5k?}5}?XBL@v&}1G-aLJM>+>c>p*xp(uJTGm6}aJ0f{+QZd}=;Es*v z+PJ76-m%+=q*j325A!?xqS(?tfqNj}l{UTdd%U@mg9vXEz)ZHXH|+|`4oA;JVhka# zml24}Hs5s2fb&AfN<>G9R@kPS@FzEw+AGi}26EGg?KpWrcwDE0zod3#nE)pDC?}(p z;Ex1(*47`=W(tNn=bY8k;{omvWBc~}QK)HgPptY`au9K7r&V_@HD7qZFbskn0Xjg+ z@#pzoJc}G~u^61_%t+dCP}bS`HcDL(?|`=fbwGZP{d5zhr_Pc%Qjtz>v5og} zO)!4>Fxyf+FS_ zW3j1zW;cJ~N13M%@AIHpyVAqWAXanku;9S@YHDs1p-2+?a4^k|A01Hb{x245z}3#AGGKaL1`z|y z)Cut?FHvcjW^>7~r>vmJW1!tFRfT7@v`ja2C-t+uJN%3L5k?b?he4@{p_OuQ{Y)h zn3o5Q7Q2TyGRuMZU7g`yN#aMg?gx1#!v(BW!Vtoq_?ZJBUg~aNs4EAFoZ^kP$@5CF zSDcf@>$`>Q@XH8R`X4lYv^ib>;qNk!1%iBKxpMN%-M=Bc;)Erx0;Yrp2QGRJRDwdQ zWmS0ngkesE5%1!$hDNWR31b?56L__`ANcwCC|M@-e%kb(2dsHxoxVMLyM=_VH?XQH;XE zb26>=L9+VkE)+~lc@44wwB9wneA1Lw;AW7olp5J@_R&S!Q4WxbAi&2>jFSX&Z^F&=GgF(al+B5?O z4fcOgagbkT=KIowI^-#e3Lm6jX5wRV`yzex?B%hqj#V!gTBOVMj-N|2PuTq;82vr* zV@~h-0Y?9mh{dhG^oVH?m>iZ9@geoa$gB0N6@$3k1NEd?zoE{}D+davQ41?h+;pGm z#Pf>>^S%#Qg|M2P)pQ9-mm=j@9K#GXShKL}C!v$K-V>@XulK}&+2@h|xPj}) zvRADbM#44g9RfAV%YyiH{>LwrG;c$y-ea__6 z>R4RXY_H}W&Q3W^7m<96XZ{*SMD+1M%sc-?H3hlK)LRt45$CEiMREsgTuOU)>ON&) zmuF1yl%^lbiE;YkGK6#t-ZNgjwAADQx&C7P!j@&gQil2A9;{+)G=7Pjab(O)O&yhX zmW5yaL4d#is>29I2w)!Y83l%+z+CxDX49MaBOG|#*UIi?RiJ;LOFqqN@z3fn^ff4f zy+>~@IeHiLG?W_*s>Du?25itYjPCKH1Ohc<$i>&Cm=n@k8u6 zd=mVsK?3C6weqPD@^;#Ty=`(*;3#T(kOs;>tKX-rp-~R#i>KN~cU+2xRvJSHi^ah_ zUfuir+xe5I+gp3|CMBKAs-(6}LYLjvPDXTZt!FU<5|wI@9Vgt;HmU778E>e*nHl-V zC&~Ga#E0lHEJM+{TK9H?T2JN9w)3R|<*VgpeSOOiL*6n?0XH)Cry zf2J(0%-*KGL)C|W%-SXkt!!-Y)X=@{-sN;v)ZKg>F3Pv1t1AZ7qN|8n>mkQVAcrC_ zhU{z103$MrR`5erG2?nRHU~Sy&U25JSYV1lkvejQ+C&I#~`Vx=V1DJWD zER#r-kdlf@{9=$K_}X|1#TB3^yF#X>rb|mxdX;r`(&{TJray&sjz7!zJpVpRvCa9! zlR4W1n5N7!6t;T$a&_;8w$DMTyX7+Vf0m~6j8-<@Q%6m$S(Iz$_C5Notg5lm$TG_E zXpGF+CG<#6UvE6fo5AZ_VoaLquq@{6TmKMGv$DxcsSlE+mkIhQnnzcrS61#!C`vC3 zhpx^Uvt3PDo1arVs&6M3l`#?YLtTNXS?IZk&k3A*obW41$u}qY_dY8fenJf4v(^aN zT$-{ZJuziFcj%-*Lq-P;{)r!STMJT8uYWteSuM2moohMh!rPj+S+kZ9?t6H6=%&V; zw%0vi{QVMstcbs7@o=usBqkhzecg{_^NBtkeB$*2#*T|)euI)#`%HlG$12fgkBY%y z*3E7U)bN=Hp(kS$)I%00S}lWRKOK6aFR6|^ao3xw1}Yyu-p!x)B-h@yqtX~G8vErR z^v&K8jo10q?5oBI;zU(eRR(+Yml!&3krNiEruyyf8c5R}oOF^8A6(5a_$p-YUs#`Xw1TnbV|U8a&B5)a#pQN<)u<{@~WDt6FWNa|GrUDVbE=;B4_q?e!L5o_3 zA7cVdh{yP6!xQI@p-4}1vPQ*|A5lo2^*axfv-p3YteM__>hns8nW3&?OuBQCjg@;g zse58kx_##TJ61?B_qiqPR!F%8b@%JB?1ht=S&l!-+BwXv2lJ0EEr=|;n1&LZO_QFg z*bq*uB%!^`%T!Gc>M4v>qd$t*KCwZr=^uD^hg4I2kZrw^a9V#-@wKoH%sSNWpUO|8 zk`h9-!|Y79kAIa@PYq-)B@64!-lEJpmH%wP4pSGh<1#}s-yg?If24R;1>8;gfd{%i6OGv7%WO*&mOGF9)r&g`yPUk$F1BTuMa*~|B2>wEoMA(Pl zANY4>fT`WyZ?QQ-eRvj?w%1~@{oP{wjy9i6lf%D>cD42o)zk4{?IrQLmy2-6aqaij z+B~@5`ELOm>X51T3u_>99z zHrMBcZCn!N%`4bd*|q^$CU;hP{XJR`E;sHU&r>RCV_dJHp~0_>Q=XB}AIhm45{Xjz z>9^W@0sG$&erYSA3j!Xxh~u=~=$dFPssC{v0UC)h?DtUI3v*i6Suygr za(Xv>ae{3#WX}$j#)*!CqiofXE3LVGJi78924N>U=0pGYJ^VfG|Go#QPk}VZ*O?SZ%1A2sxCWizB-#tIhIFRSNLw2 zvQ>&*HANbd)*=gMv&Y@bSnO{s7W8xU&D^!bc-SnsmMjKukA?ugg(iMMG^$(LAJ0=aFT+X!kO@ej_={xzL8;vVi$( zHfxnN3AW8?gVEu;2j>i4W_<$9Js}~Goby4WYx|hVs~!Ht`03o#(9~HOm3<4rOZ~j= zNssTZZc^U;RyfSiKh#T+I~Z4qc)@O*!U(%&&>U-#m-}}JK3|P z@*@vP%wwdQX@6_th`irv_o1KiBiH82YOBJ2p{(ai$_GP91JWes`_=08F_V*`-GMLM z7Zx+Cc)#=VuX#V5-P-szz3HFgjP+fx>^C;%3P+?JZZ25SSXZlH7ODwOgKArq+dN_u%+dxs_$2V5$u%jp(11-Ds>0$|V68`1KEF2>#nen|c4=nX_ON zv~vN7v+N(1eEZCr?aGRZm)#nBf7bLFD7Egc?z7V_{3Xidt@^D% z`{!KtkgoJnP4sO-`|~kdHQ2TCez{sls@+IE!Mrr~0oi6NFmTiTqQ(N5G8*E)MVPI` z=X;pXyA1xpE?W~*v*+ZqY>Fie!O|XJH~x|^YzY3 zRrUEP{W#JO9Qt1VP^gK%2IHgN^ZNXRNypWS^7)WY>Y;=+(S$p5KJjq;sm}P;vz;(mS z->2udobWFM@;76uEpfnM3 z8|I;78MAFO(&2Buk#qFX0(oS|q8>L?w>`95KC-9UEm13T>=otfx-$Q6l6$EB^yjKa zH%6ArH-A@lZGC$9*(`8}8lw5pco~R0pIC42u%1uvj$Vh=W#%fP-`BPi{X1BbLnYl? z;TL=%U_HJ`oh8RTO)`S-;oN9Qy2=U;f1gkjz*`qlP`6P0o~nWTLdI>|_W3FtCbSo! z{YrU;lp{(?(OBQsMb;NG6!w7?wV5Kn{;nPMpiZ@VJBcVEn0|^J7NsIJd^uHk6PR`D z1nDlJ!}$ja=E4QxM^bQdlkN(0zGo4X6zIIf##hh(o$O$l)Bm%Hb=+7xs#C(9W&~wt ze(MI(uFoKNrl!-Kj8lH@nl^p+xwE^2q&SEUjlJQyV)XLif7{Fd81=vA{C_%!|1!+j z`&jIJd|r&Y#VI;CIT-x1_B{{2z|R|3z}}UlohLZepDn%4&@eX58PgY^CiXk=Z}gFP^n>@+iPs zloXl;9G!D1^e^5dmf+TLjRUz+c5pqbz`fbK3uX#BZcBpE;GCJGgYQj;cG zc2_L8kA927{!Y(_%cld6^G7mHSpwvVlY+8-r8g(6BjlV6IXUMmk_%;ODid~wSbV*1 z@CR!X_B5v97UIfEk5$6nd6%y;n{O$3zS-7kCLV%u_`LDl0giUxUTd+!t2+v@FxPmsDlM zKh;t3aDHe}U1m*CudFy7vs+(k0+KVs!^1p?Z2&D5?EO|wH8{QZ^XF-{bB{3hc)FyX z5D$P>y*~XW2R-6FwzEr|+hI~s`ss-MryAxA zjf1XO$N`VM^dR*ivoKwBx%-UkgVRj?B#h>##<;3dU}`}59CfaO+g|q+qMpd}q0u<~ zHfM0);ojt@Fa~U|7K6U%_C7x+B+qmOLk>v;;FQe6g}L#%tU3=?df0fnz3?Pkitynx zP-qIXzG%cs-@lG_eSU6=z3VJeW0>e&4_UHW=Ot)2MF1bU^^qdvrbZy}^#y5!RDUEO zR+oPiuWa~B4<6#h@8IBI7sSVer^C-DP}VZ1I?!E;vDg&SyLNBJNB^490S?K)DbM7} z_K`x5m;MUR`}+D=29qG3B3c7xkR>y#Ad%)VnW=)~5{ ztaF#+gq3CZ3nli^h4B#%nRG8lT_c(U@Gr^7X!X+RBQdq-)o_s+HW%1l{dGIEY;V@j z;!j<-$ET9TVtKEA)EtTyQhmR7Rv{%QjTo{HDg}|}v$*K&F1%&mnTZ}=drS3G3*H#~ zgsXCSehwX%^ExZ$e1IJHs)chRLgbA+4&tio`#@4FV`-46c6nl0PE>EGW$w@SAGHSl zgPaLiy#?j(Z+oLCL8`B1nW)cw2%Nmu`Z*Q*>B8(}`({gW%G$giWLtI{SbygN-JZ|( z-aMShH&>1BI4G5$zBS(_5oyq?1vA^~s`JP68bvPL@Iwx#eYK>Y|?Phiym+IY1H9V9yeKK9Zz|in8?S2d3<97?1 z^mWu|>NcYEBECqdLR6<{eUq?{8G5|oWcG^y+MBK9zhGYc;=-0UgvJbCg>T%K=g@M`77j3Wax)3tJ!Gc@|zASmWx1ql;sNl0mbf7z80%5&~BM(jH52&^H= z)mwDlOl)uQ`07y7cuJm@{Va2A3d0$~eNKntNVI%;StsoX|~~p(*BN z@xVCY5MB|??6|y5&KFLwOYf^L=JXZeuxp!U4lVs9w@@(|pIsPAr>Cb8_7j2tZhU^; z<85jb1UiZih}Yjve_Z=UaH6I6LgkMoC4ah_J-wp8<#A@>{T-Xsl%l_5u-#Ur8PL3=r7hd0>2ZQd#q}!@GXiv`9^WY$EvNX4)*iR?nqhgz2{i;75jIWe<-GZ&rW5)c2n+_g9^AZiY z@O7LgPVXmRSQ!iMK0kMf`m4BMM&8t`j$DbH#f=k0b%cbb*0RyD7|YvnqHrH{l0ywy z&f=F@KX-KKF!LOqi(e>*;Gh>!T)K*TI%-3pG+vLnf!tm2wLg{Y@A(^8nMSI5@7#fXyjQ_aapXr$G*Sn>JsaKD*UXIg^&#Ckq|SMWOiM3!hTeHu@po z{3~jZ6u-@sKNKAnZYrhLhk+9}xLjr(08avb&LBImDK~__?`1P4knX6(u;Gy^FF?D| zZZ!|IH_iwlII{`V?Oz81JUdK-b81}p9Z_kf7%XiF!=#o-gM)7)hneM#kA$n;vAOow z0l1}(m*HyEq4ue$(~qWyTgH=7mbJd(Eb>7*h)gZCU_Ht{u&6GmLzUt5TwvfZh^ zKBuAv)A^XXK=hJ-Y5XwaFfHKcol;hauRL&Sqs|i^#d^Whl{FVTUy8|-(?>)kU22P* zMqPl4LrT%}^B1^dxWeF&e=XZAB)}^OEv=`eLYWF&qJn|~nEp?$Sgg%wuF9I4U*)nW z6l&9`^sczdaKhB~L+2bKeC5UCD?IB=`bjoeEk+`0N=nW<;eQa0ffAO+){rSIhq`^} zy28^QH(e>Lb4&QoH>W$#vqVa0gFO?^R>>62$ETeXX>(6ZCr0HC1qV-^HRbnQuN8K&4Sjx3{T1o2t(Mad zO#hu0Ea{XvksDZqFmf<7H2g%H229ZaL8;K?YxlN%%s#-s`#XZVvL^k2?1`;@qPqzV zJh}r+g%*A*s@)4dlXas^0RU|@UL)mtoDP4F%yz5cG8+vNuVj5*}Z#SD(Ti$CGg|m5? z)d3(7P`bk1z7X>yfZ4o@#iAo4Ay3&Pk$21d5AB4qw%C0;S1?C`{poZN2HH3++eiNk D$Yjd) literal 0 HcmV?d00001 diff --git a/extensions/km-plot/kmplot.inx b/extensions/km-plot/kmplot.inx new file mode 100644 index 0000000..3b975b7 --- /dev/null +++ b/extensions/km-plot/kmplot.inx @@ -0,0 +1,16 @@ + + + Plot + org.knoxmakers.kmplot + + + all + + + + + + + diff --git a/extensions/km-plot/kmplot.py b/extensions/km-plot/kmplot.py new file mode 100644 index 0000000..86ee578 --- /dev/null +++ b/extensions/km-plot/kmplot.py @@ -0,0 +1,177 @@ +#!/usr/bin/env python3 +import glob +import os +import platform +import subprocess +import sys +from pathlib import Path +import ctypes + +# Make bundled deps (e.g., pyserial) importable before loading inkex. +BASE_DIR = Path(__file__).resolve().parent +DEPS_DIR = BASE_DIR / "deps" +if DEPS_DIR.exists(): + sys.path.insert(0, str(DEPS_DIR)) + +# Enable stderr logging when set True (or via KM_PLOT_DEBUG=1 environment variable). +DEBUG = os.environ.get("KM_PLOT_DEBUG", "").lower() in {"1", "true", "yes"} + +# Hide the transient console window that appears on Windows. +if os.name == "nt": # pragma: win32-only + try: + hwnd = ctypes.windll.kernel32.GetConsoleWindow() + if hwnd: + ctypes.windll.user32.ShowWindow(hwnd, 0) # SW_HIDE + except Exception: + pass + +import inkex +from gui import KMPlotGUI, Gtk, GLib +from plot import PlotEngine +from plotters import plotters + +try: + import serial.tools.list_ports # type: ignore +except Exception as exc: # pragma: no cover + serial_ports = None + serial_import_error = repr(exc) +else: + serial_ports = serial.tools.list_ports + serial_import_error = None + + +class KMPlot(KMPlotGUI, inkex.EffectExtension): + def __init__(self): + super().__init__() + self.window = None + self.status_label = None + self.device_label = None + self.port_info_label = None + self.port_combo = None + self.port_store = None + self.cut_button = None + self.status_bar = None + self.current_device = None + self.current_vidpid = None + self.poll_id = None + self.port_entries = [] + self.sending = False + self.device_image = None + self.icons_dir = BASE_DIR / "icons" + self.plot_engine = PlotEngine(self) + + def effect(self): + self.debug("KM Plot extension starting; setting up window.") + self.build_window() + interval = 2 + self.debug(f"Using poll interval: {interval} seconds") + self.update_status_bar("Searching for devices...") + self.poll_id = GLib.timeout_add_seconds(interval, self.poll_devices) + self.poll_devices() + Gtk.main() + + def find_matching_device(self): + devices = list(self.enumerate_with_serial()) + if not devices: + self.debug("pyserial enumeration returned no devices.") + for entry in devices: + vidpid = entry["vidpid"] + if vidpid in plotters: + return entry["device"], vidpid, plotters[vidpid] + return None + + def enumerate_with_serial(self): + if not serial_ports: + reason = ( + f" import error: {serial_import_error}" + if serial_import_error + else "" + ) + self.debug( + f"pyserial not available; skipping VID/PID enumeration.{reason}" + ) + return [] + devices = [] + try: + ports = list(serial_ports.comports()) + except Exception as exc: + self.debug(f"serial.tools.list_ports.comports() failed: {exc!r}") + return [] + + if not ports: + self.debug("serial.tools.list_ports reported no ports; retrying with links.") + try: + ports = list(serial_ports.comports(include_links=True)) + except Exception as exc: + self.debug( + f"serial.tools.list_ports(include_links=True) failed: {exc!r}" + ) + ports = [] + + if not ports: + self.debug("serial.tools.list_ports still returned no ports.") + return [] + + for port in ports: + device = ( + getattr(port, "device", None) + or getattr(port, "name", None) + or getattr(port, "path", None) + or getattr(port, "port", None) + or (port if isinstance(port, str) else None) + ) + vid = getattr(port, "vid", None) or getattr(port, "vendor_id", None) + pid = getattr(port, "pid", None) or getattr(port, "product_id", None) + vidpid = getattr(port, "vidpid", None) + manufacturer = getattr(port, "manufacturer", None) + product = getattr(port, "product", None) + + if vidpid: + vidpid = str(vidpid).lower() + elif vid is not None and pid is not None: + try: + vidpid = f"{int(vid):04x}:{int(pid):04x}".lower() + except Exception: + vidpid = f"{str(vid).lower()}:{str(pid).lower()}" + + self.debug( + f"Serial port candidate: device={device}, vid={vid}, pid={pid}, vidpid={vidpid}" + ) + if device and vid is not None and pid is not None and vidpid: + info_lines = [] + if manufacturer: + info_lines.append(str(manufacturer)) + if product: + info_lines.append(str(product)) + devices.append( + { + "device": device, + "vidpid": vidpid, + "info": "\n".join(info_lines), + } + ) + return devices + + def perform_cut(self, device_path): + return self.plot_engine.perform_cut(device_path) + + def update_option(self, key, value): + setattr(self.options, key, value) + + def update_option_from_combo(self, key, combo, default): + model = combo.get_model() + active_iter = combo.get_active_iter() + if active_iter: + value = model[active_iter][0] + else: + value = default + setattr(self.options, key, value) + + def debug(self, message): + text = f"[KMPlot] {message}" + if DEBUG: + print(text, file=sys.stderr, flush=True) + + +if __name__ == "__main__": + KMPlot().run() diff --git a/extensions/km-plot/plot.py b/extensions/km-plot/plot.py new file mode 100644 index 0000000..05acc0f --- /dev/null +++ b/extensions/km-plot/plot.py @@ -0,0 +1,150 @@ +import errno +import os +import platform + + +class PlotEngine: + + def __init__(self, extension): + self.ext = extension + + def perform_cut(self, device_path): + self.ext.debug(f"Generating HPGL and sending to {device_path}") + hpgl = self.generate_hpgl() + self.send_hpgl_serial(device_path, hpgl) + + def ensure_plotter_defaults(self): + defaults = { + "serialBaudRate": "9600", + "serialByteSize": "eight", + "serialStopBits": "one", + "serialParity": "none", + "serialFlowControl": "xonxoff", + "resolutionX": 1016.0, + "resolutionY": 1016.0, + "pen": 1, + "force": 0, + "speed": 0, + "orientation": "0", + "mirrorX": False, + "mirrorY": False, + "center": False, + "overcut": 1.0, + "precut": True, + "flat": 1.2, + "autoAlign": True, + "toolOffset": 0.25, + } + for key, value in defaults.items(): + if not hasattr(self.ext.options, key): + setattr(self.ext.options, key, value) + + def generate_hpgl(self): + self.ensure_plotter_defaults() + try: + import hpgl_encoder + except Exception as exc: + raise RuntimeError(f"hpgl_encoder not available: {exc}") from exc + + if self.ext.svg.xpath("//use|//flowRoot|//text") is not None: + self.preprocess(["flowRoot", "text"]) + encoder = hpgl_encoder.hpglEncoder(self.ext) + try: + hpgl = encoder.getHpgl() + except Exception as exc: + raise RuntimeError(f"HPGL generation failed: {exc}") from exc + return self.convert_hpgl(hpgl) + + def convert_hpgl(self, hpgl): + init = "IN" + return init + hpgl + ";PU0,0;SP0;IN; " + + def send_hpgl_serial(self, device_path, hpgl): + try: + import serial + except Exception as exc: + raise RuntimeError(f"pyserial not available: {exc}") from exc + + baud = int(getattr(self.ext.options, "serialBaudRate", 9600)) + byte_size = str(getattr(self.ext.options, "serialByteSize", "eight")).lower() + stop_bits = str(getattr(self.ext.options, "serialStopBits", "one")).lower() + parity = str(getattr(self.ext.options, "serialParity", "none")).lower() + flow = str(getattr(self.ext.options, "serialFlowControl", "xonxoff")).lower() + + size_map = { + "5": serial.FIVEBITS, + "five": serial.FIVEBITS, + "6": serial.SIXBITS, + "six": serial.SIXBITS, + "7": serial.SEVENBITS, + "seven": serial.SEVENBITS, + "8": serial.EIGHTBITS, + "eight": serial.EIGHTBITS, + } + stop_map = { + "1": serial.STOPBITS_ONE, + "one": serial.STOPBITS_ONE, + "1.5": serial.STOPBITS_ONE_POINT_FIVE, + "onepointfive": serial.STOPBITS_ONE_POINT_FIVE, + "2": serial.STOPBITS_TWO, + "two": serial.STOPBITS_TWO, + } + parity_map = { + "none": serial.PARITY_NONE, + "even": serial.PARITY_EVEN, + "odd": serial.PARITY_ODD, + "mark": serial.PARITY_MARK, + "space": serial.PARITY_SPACE, + } + + ser = serial.Serial() + ser.port = device_path + ser.baudrate = baud + ser.bytesize = size_map.get(byte_size, serial.EIGHTBITS) + ser.stopbits = stop_map.get(stop_bits, serial.STOPBITS_ONE) + ser.parity = parity_map.get(parity, serial.PARITY_NONE) + ser.timeout = 1 + ser.xonxoff = flow == "xonxoff" + ser.rtscts = flow in ("rtscts", "dsrdtrrtscts") + ser.dsrdtr = flow == "dsrdtrrtscts" + + self.ext.debug( + f"Opening serial port {device_path} baud={baud} size={ser.bytesize} " + f"stop={ser.stopbits} parity={ser.parity} flow={flow}" + ) + + try: + ser.open() + except Exception as exc: + hint = "" + if platform.system().lower() == "linux" and self._is_permission_denied(exc): + hint = ( + " Permission denied opening serial port. On Linux, add your user to the " + "'dialout' group (e.g. `sudo usermod -aG dialout $USER`) and log out/in, " + "or adjust udev permissions." + ) + raise RuntimeError(f"Failed to open serial port {device_path}: {exc}.{hint}") from exc + try: + ser.write(hpgl.encode("utf8")) + try: + ser.read(2) + except Exception: + pass + finally: + ser.close() + + def preprocess(self, convert): + try: + self.ext.svg.convert_to_paths(convert) + except Exception as exc: + self.ext.debug(f"Preprocess convert_to_paths failed: {exc}") + + def _is_permission_denied(self, exc): + errno_val = getattr(exc, "errno", None) + if errno_val is None: + inner = getattr(exc, "os_error", None) + errno_val = getattr(inner, "errno", None) + if errno_val == errno.EACCES: + return True + text = str(exc) + return "Permission denied" in text or "access is denied" in text.lower() diff --git a/extensions/km-plot/plotters.py b/extensions/km-plot/plotters.py new file mode 100644 index 0000000..d77f7db --- /dev/null +++ b/extensions/km-plot/plotters.py @@ -0,0 +1,10 @@ +plotters = { + # vid:pid -> {"name": "wat is this", "icon": "iconname"} + "0403:6001": {"name": "FTDI FT232RL", "icon": "vinyl"}, + "1A86:7523": {"name": "QinHeng CH340/CH341", "icon": "vinyl"}, + "067B:2303": {"name": "Prolific PL2303", "icon": "vinyl"}, + "04D8:000A": {"name": "Microchip CDC", "icon": "vinyl"}, + "7447:5419": {"name": "Generic", "icon": "vinyl"}, + "0483:5740": {"name": "STMicroelectronics", "icon": "vinyl2"}, + #"": {"name": "", "icon": "vinyl"}, +}